[
 {
  "question": "What is the SMILES expression of C10H22N2S?\nAnswer:",
  "answer": [
   "CC(C)CNC(CN)C1CCSC1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (2R,5S)-5-ethyl-2-methylnonanal?\nAnswer:",
  "answer": [
   "C12H24O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (3E,6E)-5,5-dimethylocta-1,3,6-triene?\nAnswer (numerical number):",
  "answer": [
   "136.23"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-amino-3-pentan-2-yloxypropanenitrile?\nAnswer:",
  "answer": [
   "CCCC(C)OCC(C#N)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H18O3?\nAnswer (numerical number):",
  "answer": [
   "162.23"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-[(E)-3-piperidin-4-ylprop-2-enylidene]methanimidamide?\nAnswer:",
  "answer": [
   "C9H15N3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 4-[(2,2-difluoro-3-hydroxypropyl)amino]butan-1-ol?\nAnswer (numerical number):",
  "answer": [
   "183.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C(#N)SNC(=NN)N?\nAnswer (numerical number):",
  "answer": [
   "131.16"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H14O?\nAnswer:",
  "answer": [
   "CCCC(CC=C)C=O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (E)-1-hydroperoxy-2-methylbut-1-ene?\nAnswer:",
  "answer": [
   "C5H10O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (3R)-1-(2H-tetrazol-5-yl)pyrrolidin-3-ol?\nAnswer:",
  "answer": [
   "C1CN(CC1O)C2=NNN=N2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 5-hydroxy-N-(3-hydroxy-4-methoxybutyl)pentanamide?\nAnswer (numerical number):",
  "answer": [
   36
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in N,N,N'-trimethyl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C6H6N2O?\nAnswer (numerical number):",
  "answer": [
   15
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CN1CCCC(C1)C(=O)ON?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C7H14ClN5?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 4-iodo-4-methylhex-5-enoic acid?\nAnswer (numerical number):",
  "answer": [
   21
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H17NO2S?\nAnswer:",
  "answer": [
   "3-ethylsulfanyl-1-morpholin-4-ylpropan-1-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C13H27NO?\nAnswer:",
  "answer": [
   "CCCNC(CC)CCC1CCCOC1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C7H16OS2?\nAnswer:",
  "answer": [
   "4-methyl-5,6-bis(sulfanyl)hexan-1-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 4-aminocyclohexa-2,4-diene-1-thione?\nAnswer:",
  "answer": [
   "C6H7NS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C11H24O?\nAnswer:",
  "answer": [
   "CCC(C)(C)OC(C)(CC)CC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1CC(CC1CNCC(CO)O)O?\nAnswer:",
  "answer": [
   "C9H19NO3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C(CCl)C(CCCl)O?\nAnswer (numerical number):",
  "answer": [
   18
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1CC(C(NC1)C)C\nAnswer:",
  "answer": [
   "(2R,3S,5R)-2,3,5-trimethylpiperidine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (5R)-5-(1,3-thiazol-4-yl)-1,4-oxazepane?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C7H12O3?\nAnswer (numerical number):",
  "answer": [
   "144.17"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1-(3-oxobutyl)diazinan-3-one?\nAnswer (numerical number):",
  "answer": [
   "170.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H18N2O?\nAnswer:",
  "answer": [
   "6-amino-2-propan-2-ylidenehexanamide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-(5-bromo-2-methyl-1,2,4-triazol-3-yl)propan-1-amine?\nAnswer (numerical number):",
  "answer": [
   22
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H25NO2?\nAnswer (numerical number):",
  "answer": [
   "203.32"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 5-ethyl-3,5-dimethylhept-3-ene?\nAnswer (numerical number):",
  "answer": [
   33
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H13NS?\nAnswer (numerical number):",
  "answer": [
   "155.26"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCCCCN(C)C(C)CCC\nAnswer:",
  "answer": [
   "N-methyl-N-pentan-2-ylhexan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 8-[(2-methylpropan-2-yl)oxy]oct-1-yne?\nAnswer (numerical number):",
  "answer": [
   "182.30"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C=CCC(=O)NC1CCCCC1CO\nAnswer:",
  "answer": [
   "N-[2-(hydroxymethyl)cyclohexyl]but-3-enamide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C12H26O4?\nAnswer (numerical number):",
  "answer": [
   "234.33"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(CCC(C=C)C(C)O)O?\nAnswer (numerical number):",
  "answer": [
   "158.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-methoxy-3-(4-methylpiperidin-3-yl)oxypropan-2-ol?\nAnswer:",
  "answer": [
   "C10H21NO3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 3-(2-fluoropropan-2-yl)-5-methylhexan-1-amine?\nAnswer (numerical number):",
  "answer": [
   "175.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCCC(C#N)N?\nAnswer:",
  "answer": [
   "C6H12N2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(=COC)C(=O)O.Cl?\nAnswer:",
  "answer": [
   "C5H9ClO3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(CCN)(C1CCN(C1)C)F\nAnswer:",
  "answer": [
   "3-fluoro-3-(1-methylpyrrolidin-3-yl)butan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H22O2?\nAnswer:",
  "answer": [
   "(3S,6R)-3,7-dimethyloctane-1,6-diol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C1CC(C1)C2=NOC(C2)N\nAnswer:",
  "answer": [
   "3-cyclobutyl-4,5-dihydro-1,2-oxazol-5-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C15H32O2?\nAnswer:",
  "answer": [
   "CCCCCCCCCCCCC(C)OOC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H20N2?\nAnswer (numerical number):",
  "answer": [
   "180.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCC(=O)C(C)C(C)O?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1CC(SC1)C(CN)(F)F?\nAnswer (numerical number):",
  "answer": [
   "167.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-(ethoxymethyl)-N-(2-methoxyethyl)-2-methylbut-3-en-1-amine?\nAnswer (numerical number):",
  "answer": [
   37
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CN1N=C(N=N1)CC(CO)CO?\nAnswer:",
  "answer": [
   "C6H12N4O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C14H27Br?\nAnswer (numerical number):",
  "answer": [
   "275.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C12H21NO?\nAnswer:",
  "answer": [
   "[1-[(pent-3-ynylamino)methyl]cyclopentyl]methanol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-but-2-en-2-yl-9-phosphabicyclo[3.3.1]nonane?\nAnswer (numerical number):",
  "answer": [
   34
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of COC1COC2C1OCC2OC\nAnswer:",
  "answer": [
   "3,6-dimethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H14N2O2?\nAnswer:",
  "answer": [
   "C1COCCC1C2CNC(=O)N2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of O-(pyrrolidin-1-ylmethyl) methylsulfanylmethanethioate?\nAnswer:",
  "answer": [
   "CSC(=S)OCN1CCCC1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C7H13ClOS?\nAnswer:",
  "answer": [
   "2-(3-chloro-2-methylprop-2-enyl)sulfanylpropan-1-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCN(CCC#CC)C1CCNC1?\nAnswer (numerical number):",
  "answer": [
   "180.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of pyrrolidin-2-ylboronic acid?\nAnswer (numerical number):",
  "answer": [
   "114.94"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C6H13BrO2S?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CNC1CCCCCC1N2CCOCC2?\nAnswer:",
  "answer": [
   "C12H24N2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C6H12N2O?\nAnswer:",
  "answer": [
   "C1CCC(C(C1)N)N=O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H11ClN2S?\nAnswer (numerical number):",
  "answer": [
   "178.68"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 6-propyl-6-azabicyclo[3.1.0]hexan-2-one?\nAnswer:",
  "answer": [
   "C8H13NO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H21NO?\nAnswer (numerical number):",
  "answer": [
   "159.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C11H23NOS?\nAnswer (numerical number):",
  "answer": [
   37
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(CO)OCC(COC(C)CO)O\nAnswer:",
  "answer": [
   "1,3-bis(1-hydroxypropan-2-yloxy)propan-2-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (2R)-3-[[(2R)-butan-2-yl]amino]-1,1,1-trifluoropropan-2-ol?\nAnswer:",
  "answer": [
   "CCC(C)NCC(C(F)(F)F)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H13FO2?\nAnswer (numerical number):",
  "answer": [
   "172.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of methyl 4-amino-3-(propan-2-ylamino)butanoate?\nAnswer:",
  "answer": [
   "CC(C)NC(CC(=O)OC)CN"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1,1,2,3-tetraethylguanidine?\nAnswer (numerical number):",
  "answer": [
   "171.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (5-ethyl-1-propan-2-ylpyrazol-3-yl)methanamine?\nAnswer (numerical number):",
  "answer": [
   "167.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H22O?\nAnswer (numerical number):",
  "answer": [
   33
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(OS(=O)C(C)S)S?\nAnswer:",
  "answer": [
   "C4H10O2S3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(C)(C)C1CC=NN1C?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 4,4-dimethyl-1-methylsulfanylhexane?\nAnswer:",
  "answer": [
   "CCC(C)(C)CCCSC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of methyl (3S)-3-amino-4-methylhexanoate?\nAnswer:",
  "answer": [
   "C8H17NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCC1C(=O)NC(=S)S1?\nAnswer (numerical number):",
  "answer": [
   "161.3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H10FNO?\nAnswer (numerical number):",
  "answer": [
   "167.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H21NOS?\nAnswer:",
  "answer": [
   "(1S,2S)-N-(2-methoxyethyl)-N-methyl-2-methylsulfanylcyclopentan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H17N3O?\nAnswer:",
  "answer": [
   "CC(CNCC(=C)C)C(=NO)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H17N?\nAnswer:",
  "answer": [
   "C1CCCC2C(CC1)CN2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (1S,2R)-N-ethyl-2-pyrrolidin-1-ylcycloheptan-1-amine?\nAnswer:",
  "answer": [
   "CCNC1CCCCCC1N2CCCC2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in ethyl 1-(methylaminomethyl)cyclopropane-1-carboxylate?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C1CCC(C1)(CN)C(O)O\nAnswer:",
  "answer": [
   "[1-(aminomethyl)cyclopentyl]methanediol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (2S)-N-[(2S)-butan-2-yl]morpholine-2-carboxamide?\nAnswer (numerical number):",
  "answer": [
   "186.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 3-ethenyl-7-thiabicyclo[4.1.0]hept-1(6)-ene?\nAnswer (numerical number):",
  "answer": [
   "138.23"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C12H27NO2?\nAnswer:",
  "answer": [
   "1-(hexylamino)-4-methoxy-2-methylbutan-2-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in methyl 2-[3-(methylaminomethyl)cyclobutyl]oxyacetate?\nAnswer (numerical number):",
  "answer": [
   30
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC1(CC1)CNCC(=C)Br?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H17NO3?\nAnswer (numerical number):",
  "answer": [
   "175.23"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H14O?\nAnswer:",
  "answer": [
   "CC12CCCC(C1C2)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C12H25NO?\nAnswer:",
  "answer": [
   "N-ethyl-4-(oxan-3-yl)pentan-2-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 1-methoxy-3-(morpholin-2-ylmethoxy)propan-2-ol?\nAnswer (numerical number):",
  "answer": [
   33
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H10BrNS?\nAnswer (numerical number):",
  "answer": [
   "244.15"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-(difluoromethyl)-5-methyl-1,2-oxazole?\nAnswer (numerical number):",
  "answer": [
   14
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H11FO2?\nAnswer (numerical number):",
  "answer": [
   "134.15"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H17NOS?\nAnswer (numerical number):",
  "answer": [
   28
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of nitroxyl;1,3-thiazole?\nAnswer:",
  "answer": [
   "C1=CSC=N1.N=O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-amine?\nAnswer:",
  "answer": [
   "C10H17N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H18ClNO?\nAnswer (numerical number):",
  "answer": [
   30
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC#CCCC(C1CCCCS1)O?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 4-(4-methylpiperidin-3-yl)oxybutan-2-ol?\nAnswer:",
  "answer": [
   "CC1CCNCC1OCCC(C)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C5H11ClN2O?\nAnswer (numerical number):",
  "answer": [
   20
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (3S)-3-methyloxane-2-thiol?\nAnswer:",
  "answer": [
   "C6H12OS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-[(E)-ethylideneamino]-2-methylguanidine?\nAnswer:",
  "answer": [
   "C4H10N4"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1(CN(C1)C(CO)COC)C\nAnswer:",
  "answer": [
   "2-(3,3-dimethylazetidin-1-yl)-3-methoxypropan-1-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C11H11I?\nAnswer:",
  "answer": [
   "CCC#CC1=CC=CC(=C1)CI"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H9BrS?\nAnswer:",
  "answer": [
   "(1S)-1-(4-bromophenyl)ethanethiol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(=O)C=CC=COO?\nAnswer:",
  "answer": [
   "C6H8O3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C4H12O4?\nAnswer (numerical number):",
  "answer": [
   20
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H20N2S?\nAnswer:",
  "answer": [
   "7-isothiocyanato-N,N-dimethylheptan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (E)-N-[(Z)-ethylideneamino]but-1-en-1-amine?\nAnswer:",
  "answer": [
   "CCC=CNN=CC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 5-methyl-N-propan-2-ylpyrazin-2-amine?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (8R,8aS)-2,7-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol?\nAnswer:",
  "answer": [
   "C9H16O4"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C5H11NO3S?\nAnswer:",
  "answer": [
   "C1CS(=O)(=O)CC1CNO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H18N2O?\nAnswer (numerical number):",
  "answer": [
   "170.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C7H13F3N2?\nAnswer:",
  "answer": [
   "CN1CCNCCC1C(F)(F)F"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-formyl-N-methylcyclopropanecarboxamide?\nAnswer:",
  "answer": [
   "CN(C=O)C(=O)C1CC1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-(3-chloro-2-methylprop-2-enyl)pentan-1-amine?\nAnswer:",
  "answer": [
   "CCCCCNCC(=CCl)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCC(C)CCC(C)(O)O?\nAnswer:",
  "answer": [
   "C8H18O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H21NO2?\nAnswer (numerical number):",
  "answer": [
   "187.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCC1=CSC(=N1)CC(C)O?\nAnswer:",
  "answer": [
   "C8H13NOS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1(C(=O)N(N=N1)C)C?\nAnswer:",
  "answer": [
   "C5H9N3O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C12H22O?\nAnswer (numerical number):",
  "answer": [
   35
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H20O?\nAnswer (numerical number):",
  "answer": [
   "168.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H17NO2S?\nAnswer:",
  "answer": [
   "C1CSCC1CNCC(CO)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H15N?\nAnswer:",
  "answer": [
   "N-(2-methylbut-3-yn-2-yl)pent-3-yn-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCCCCCCCCC(C)OOOC?\nAnswer:",
  "answer": [
   "C13H28O3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC#CC(C)(C)C=NC#CC?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 5-methylthiolan-2-ol?\nAnswer (numerical number):",
  "answer": [
   17
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C7H13N3?\nAnswer (numerical number):",
  "answer": [
   "139.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H16O4?\nAnswer:",
  "answer": [
   "COCC1C=CC(C(O1)OC)OC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (2R,4R)-2-methyl-4-thiophen-2-ylpiperidine?\nAnswer (numerical number):",
  "answer": [
   "181.30"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CN(CC(=C)O)CC(=O)O\nAnswer:",
  "answer": [
   "2-[2-hydroxyprop-2-enyl(methyl)amino]acetic acid"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCNC(=O)NCCCC(C)N?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCOC(=O)C1CCCCC=CC1?\nAnswer:",
  "answer": [
   "C11H18O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(C)(C)C#CCBr.P\nAnswer:",
  "answer": [
   "1-bromo-4,4-dimethylpent-2-yne;phosphane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCC(CCC1CCCOC1)N\nAnswer:",
  "answer": [
   "1-(oxan-3-yl)hexan-3-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in COCC(CCN1CC(C1=O)N)O?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of but-2-yne;ethane;propane;sulfanylidene-(sulfanylidene-\u00ce\u00bb4-sulfanylidene)-\u00ce\u00bb4-sulfane?\nAnswer:",
  "answer": [
   "C9H20S4"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 1-[[(2S)-1,4-dithian-2-yl]methyl]-3-prop-2-ynylurea?\nAnswer (numerical number):",
  "answer": [
   28
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-bromo-4-propyl-4,5-dihydro-1,3-thiazole?\nAnswer:",
  "answer": [
   "C6H10BrNS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H19N?\nAnswer:",
  "answer": [
   "1,4-dimethyl-6-propyl-3,6-dihydro-2H-pyridine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 5-[(1-methylimidazol-2-yl)amino]pentan-2-ol?\nAnswer (numerical number):",
  "answer": [
   30
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCC(C(=O)OCCOC)O?\nAnswer (numerical number):",
  "answer": [
   "176.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H18O3?\nAnswer:",
  "answer": [
   "CCCC(C(CC)(CO)O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (2S)-2-piperazin-1-yl-1-azabicyclo[2.2.2]octane?\nAnswer:",
  "answer": [
   "C1CN2CCC1CC2N3CCNCC3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H18N2O2?\nAnswer (numerical number):",
  "answer": [
   30
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2,2-difluoro-2-(oxan-2-yl)ethanamine?\nAnswer (numerical number):",
  "answer": [
   "165.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H8O2?\nAnswer (numerical number):",
  "answer": [
   "136.15"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (1S,2S)-2-aminocycloheptane-1-carboxamide?\nAnswer (numerical number):",
  "answer": [
   "156.23"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(CNC1CCNCC1)N(C)C\nAnswer:",
  "answer": [
   "(2S)-2-N,2-N-dimethyl-1-N-piperidin-4-ylpropane-1,2-diamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (2Z,4Z,6Z)-2,3-dimethoxyocta-2,4,6-triene?\nAnswer (numerical number):",
  "answer": [
   28
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C11H15NO?\nAnswer (numerical number):",
  "answer": [
   28
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H10F3NO2?\nAnswer (numerical number):",
  "answer": [
   "185.14"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(C)C(CCN)C1=NSC=N1?\nAnswer (numerical number):",
  "answer": [
   "185.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-[(3-chlorocyclohexyl)methyl]-2-fluoroethanamine?\nAnswer (numerical number):",
  "answer": [
   "193.69"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H16F2N2?\nAnswer:",
  "answer": [
   "3,3-difluoro-3-piperidin-3-ylpropan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-methyl-2-(3-methylbutyl)aniline?\nAnswer (numerical number):",
  "answer": [
   "177.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1C(C1(F)F)C(=O)O?\nAnswer:",
  "answer": [
   "C4H4F2O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 4-ethenoxybutyl formate?\nAnswer:",
  "answer": [
   "C7H12O3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 5-(methylsulfanylmethyl)piperidin-3-ol?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-(4-bromobutoxy)pentane?\nAnswer (numerical number):",
  "answer": [
   "223.15"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1-(3-aminocyclobutyl)oxy-3-ethoxypropan-2-ol?\nAnswer (numerical number):",
  "answer": [
   "189.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-chloro-1,2,2,2-tetrafluoro-1-methylsulfanylethane?\nAnswer:",
  "answer": [
   "C3H3ClF4S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 5,6-dihydropyrrolo[3,2-c]pyrazole?\nAnswer:",
  "answer": [
   "C5H5N3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-methyl-1,3,9,12-tetrathiacycloheptadecane?\nAnswer:",
  "answer": [
   "CC1SCCCCCSCCSCCCCCS1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (4Z)-6-methyl-3-methylidenehepta-4,6-dienal?\nAnswer:",
  "answer": [
   "CC(=C)C=CC(=C)CC=O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(=CCNC1CC(C1)N)C?\nAnswer (numerical number):",
  "answer": [
   "154.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (2R)-N-ethyl-N,3,3-trimethylpentan-2-amine?\nAnswer:",
  "answer": [
   "C10H23N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H11NO2?\nAnswer:",
  "answer": [
   "C1C2CC(=O)NCC2CC1=O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C10H20N2?\nAnswer:",
  "answer": [
   "CC(=CCNC1CCCNC1)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H18N2?\nAnswer:",
  "answer": [
   "CC1C(NC(C(N1)C)C)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-iodononan-4-ol?\nAnswer (numerical number):",
  "answer": [
   30
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-[[(2S)-1-methylpiperidin-2-yl]methyl]cyclohexanamine?\nAnswer (numerical number):",
  "answer": [
   "210.36"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H17ClN2?\nAnswer:",
  "answer": [
   "1-(3-chloro-2-methylprop-2-enyl)-N-methylpyrrolidin-3-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC1CN1CC(C=C)O?\nAnswer (numerical number):",
  "answer": [
   "127.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-(3-amino-2-methylpropyl)oxazinan-3-one?\nAnswer (numerical number):",
  "answer": [
   28
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C3H6ClN3S?\nAnswer (numerical number):",
  "answer": [
   14
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H15NOS2?\nAnswer:",
  "answer": [
   "2-(2-methylsulfanylethylamino)-1-thiophen-3-ylethanol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H17NOS?\nAnswer:",
  "answer": [
   "3-(cyclohexen-1-ylsulfinyl)propan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H12O2?\nAnswer (numerical number):",
  "answer": [
   22
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C6H13N3O?\nAnswer:",
  "answer": [
   "CC1(CCNC(=O)NC1)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-[(2S,3S)-2-methyloxetan-3-yl]acetic acid?\nAnswer (numerical number):",
  "answer": [
   19
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(COC(=O)C=C)OOCC=C?\nAnswer (numerical number):",
  "answer": [
   "186.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H4Cl2O?\nAnswer (numerical number):",
  "answer": [
   "163.00"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H8ClI?\nAnswer (numerical number):",
  "answer": [
   18
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-(1-fluoropropyl)-8-azabicyclo[3.2.1]octane?\nAnswer:",
  "answer": [
   "CCC(C1CC2CCC(C1)N2)F"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1CC(CNC1)OCOCC2CC2?\nAnswer:",
  "answer": [
   "C10H19NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of [2-(4-methoxybutylamino)cyclopentyl]methanol?\nAnswer:",
  "answer": [
   "COCCCCNC1CCCC1CO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of methyl 4-fluoro-2-(hydroxymethyl)cyclopentane-1-carboxylate?\nAnswer (numerical number):",
  "answer": [
   "176.19"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (1S,2S,4R)-1-bromo-2-heptyl-4-methylcyclohexane?\nAnswer:",
  "answer": [
   "CCCCCCCC1CC(CCC1Br)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CN1C(CCC1CN)CCN(C)C?\nAnswer (numerical number):",
  "answer": [
   36
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H17NOS?\nAnswer:",
  "answer": [
   "CCOC1(CCSC1C)CN"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-(methylamino)-1-thiophen-2-ylpropan-1-ol?\nAnswer:",
  "answer": [
   "C8H13NOS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (Z)-1-N-(3-aminopropyl)-2-N-methylprop-1-ene-1,2-diamine?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C1C(NCS1)C2=CON=N2\nAnswer:",
  "answer": [
   "4-(1,3-thiazolidin-4-yl)oxadiazole"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1=NN(CN1C)C?\nAnswer:",
  "answer": [
   "C5H11N3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C7H11N3S?\nAnswer:",
  "answer": [
   "CCC1=NN=C(S1)C2CNC2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-methyl-3,4,4a,5,6,7,8,8a-octahydroquinoline?\nAnswer (numerical number):",
  "answer": [
   28
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CH5ClN2O2?\nAnswer (numerical number):",
  "answer": [
   "112.51"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H17NO2?\nAnswer (numerical number):",
  "answer": [
   28
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-(chloromethyl)-N-(3-ethylsulfanylpropyl)cyclopentan-1-amine?\nAnswer (numerical number):",
  "answer": [
   36
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2,2,2-trifluoro-1-(2-hydroxyethylamino)ethanol?\nAnswer (numerical number):",
  "answer": [
   18
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C4H13NOP2?\nAnswer:",
  "answer": [
   "4-amino-1,1-bis(phosphanyl)butan-1-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(CN)NCC(C)(CCOC)O?\nAnswer:",
  "answer": [
   "C9H22N2O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-[(3S)-1-propylpyrrolidin-3-yl]acetonitrile?\nAnswer (numerical number):",
  "answer": [
   "152.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCCCCCC(CC(CC=C)O)OC?\nAnswer (numerical number):",
  "answer": [
   41
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H12BrF3?\nAnswer:",
  "answer": [
   "CCC(=C(F)F)F.C=CCCBr"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (2R)-2-N,2-N-dimethyl-1-N-piperidin-4-ylpropane-1,2-diamine?\nAnswer:",
  "answer": [
   "C10H23N3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCC(CC)NC1CCCC1C#N?\nAnswer:",
  "answer": [
   "C11H20N2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C12H25NOS?\nAnswer:",
  "answer": [
   "4-propan-2-yloxy-N-(thiolan-3-ylmethyl)butan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C4H10N2OS?\nAnswer:",
  "answer": [
   "C(CNC(=O)N)CS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C6H14N2O2?\nAnswer:",
  "answer": [
   "CCCCC(C(=O)O)NN"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC1=CN=C(S1)C2COCCN2?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CN(C)CCC1CCN(C1)CCO\nAnswer:",
  "answer": [
   "2-[(3R)-3-[2-(dimethylamino)ethyl]pyrrolidin-1-yl]ethanol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-methoxy-N-propylhept-5-yn-2-amine?\nAnswer:",
  "answer": [
   "C11H21NO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 4-methyl-1,3-dioxolan-2-one;prop-1-ene?\nAnswer:",
  "answer": [
   "C7H12O3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1CCCCC(C1)I\nAnswer:",
  "answer": [
   "1-iodo-3-methylcycloheptane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1CN=C(N1)SI?\nAnswer (numerical number):",
  "answer": [
   12
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H16N2S?\nAnswer:",
  "answer": [
   "CN(C1CCSC1)C2CNC2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C7H10O?\nAnswer (numerical number):",
  "answer": [
   18
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(CCCNCC=C(C)C)Cl\nAnswer:",
  "answer": [
   "4-chloro-N-(3-methylbut-2-enyl)pentan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-[2-(propylamino)ethoxy]propane-1,2-diol?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C6H14N2O2?\nAnswer:",
  "answer": [
   "CCC(C)(C)ONC(=O)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CN1C(=CN=C1COCCN)Cl?\nAnswer (numerical number):",
  "answer": [
   "189.64"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of COC1CC2=CC=CC=C2OC1?\nAnswer (numerical number):",
  "answer": [
   "164.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 5-(2-hydroxyethylidene)-1-methylpyrrolidin-2-one?\nAnswer (numerical number):",
  "answer": [
   21
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-methyl-3,7,9-triazabicyclo[3.3.2]decan-10-one?\nAnswer:",
  "answer": [
   "C8H15N3O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C12H24N2?\nAnswer:",
  "answer": [
   "CCCCC(C)CCC=CN(C)C=N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C6H12N4OS?\nAnswer:",
  "answer": [
   "COCC(CN)NC1=NC=NS1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H13NO2?\nAnswer:",
  "answer": [
   "3-butyl-3-azabicyclo[3.1.0]hexane-2,4-dione"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in sulfanide;triethylazanium?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(C)COP(=O)(C)CCO?\nAnswer:",
  "answer": [
   "C7H17O3P"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H15N3O?\nAnswer:",
  "answer": [
   "2-(azetidin-3-yloxymethyl)-1-ethylimidazole"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCOC(=O)NC(CCN)C(C)C?\nAnswer:",
  "answer": [
   "C9H20N2O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C11H22O?\nAnswer:",
  "answer": [
   "CC(=C)CCCCCCCCO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of pent-2-yne-1-sulfinic acid?\nAnswer (numerical number):",
  "answer": [
   "132.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H22N2?\nAnswer:",
  "answer": [
   "(1R,2R)-N-ethyl-2-pyrrolidin-1-ylcyclopentan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in ethyl 2-(1-formylpyrrolidin-2-yl)acetate?\nAnswer (numerical number):",
  "answer": [
   28
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C(N)(N)SSC(=N)N?\nAnswer (numerical number):",
  "answer": [
   16
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H21NO2?\nAnswer (numerical number):",
  "answer": [
   "187.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCC(C)COC(=O)OC(C)I\nAnswer:",
  "answer": [
   "1-iodoethyl 2-methylbutyl carbonate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-azabicyclo[2.1.1]hexane-2-carbaldehyde?\nAnswer:",
  "answer": [
   "C1C2CC1N(C2)C=O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C12H21NO?\nAnswer (numerical number):",
  "answer": [
   35
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in propyl pyrrole-1-carboxylate?\nAnswer (numerical number):",
  "answer": [
   22
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C7H12N2?\nAnswer (numerical number):",
  "answer": [
   "124.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCC(CO)NCCCNC(CC)CO?\nAnswer (numerical number):",
  "answer": [
   "218.34"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCCC(CC)NC(CCC)C#C?\nAnswer (numerical number):",
  "answer": [
   "195.34"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(CCCC(=O)O)N\nAnswer:",
  "answer": [
   "(5S)-5-aminohexanoic acid"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCCC1(CCC(=O)O1)CC?\nAnswer (numerical number):",
  "answer": [
   "170.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C10H18N2OS?\nAnswer:",
  "answer": [
   "COCCNC1=NC2CCCC2CS1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1CCC(=O)C(C1)C=O?\nAnswer:",
  "answer": [
   "C7H10O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H20N2OS?\nAnswer:",
  "answer": [
   "(2R)-2-(1,4-thiazepan-4-ylmethyl)morpholine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C7H10O2?\nAnswer:",
  "answer": [
   "ethane;pyran-4-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C=CCOC1CCOC1\nAnswer:",
  "answer": [
   "3-prop-2-enoxyoxolane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCOC(=O)CC(C)CCC(C)C\nAnswer:",
  "answer": [
   "ethyl (3S)-3,6-dimethylheptanoate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1CCCN1C2=CC(=NS2)N?\nAnswer:",
  "answer": [
   "C8H13N3S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCCOC(=O)C(C)CCNC?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (Z)-3-cyclopropylbut-2-en-1-ol?\nAnswer:",
  "answer": [
   "C7H12O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C7H12N4S?\nAnswer (numerical number):",
  "answer": [
   "184.26"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-(chloromethyl)-N-(2-propan-2-yloxyethyl)cyclohexan-1-amine?\nAnswer:",
  "answer": [
   "CC(C)OCCNC1CCCCC1CCl"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C11H23NO2?\nAnswer (numerical number):",
  "answer": [
   37
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in methyl (2S)-2-(ethylideneamino)-3-hydroxypropanoate?\nAnswer (numerical number):",
  "answer": [
   21
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of sulfonyllead?\nAnswer (numerical number):",
  "answer": [
   "271"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H12F3N?\nAnswer:",
  "answer": [
   "1,1,1-trifluorooct-6-yn-3-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H12N4?\nAnswer:",
  "answer": [
   "1-(3-methyltriazol-4-yl)pent-1-yn-3-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC#CCCN1CCNCC1C(=O)N\nAnswer:",
  "answer": [
   "1-pent-3-ynylpiperazine-2-carboxamide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-(1-pyridin-3-ylpropylidene)hydroxylamine?\nAnswer (numerical number):",
  "answer": [
   "150.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H19NO3?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H18ClNO?\nAnswer:",
  "answer": [
   "1-(3-chloro-2-methylprop-2-enoxy)-2-methylbutan-2-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C5H11NO2S?\nAnswer (numerical number):",
  "answer": [
   20
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1=NN(C=C1N)CC(C)OC?\nAnswer:",
  "answer": [
   "C8H15N3O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(C(C)S)C(C(=O)O)N?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C10H19NO2?\nAnswer:",
  "answer": [
   "CCCC1(CNCC1C(=O)O)CC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H5BrN4?\nAnswer (numerical number):",
  "answer": [
   "213.03"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H16N2?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CSCCCCNC1CC(=O)NC1\nAnswer:",
  "answer": [
   "4-(4-methylsulfanylbutylamino)pyrrolidin-2-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC=CCCNC(C)(C)C\nAnswer:",
  "answer": [
   "(E)-N-tert-butylpent-3-en-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(=O)ONC?\nAnswer (numerical number):",
  "answer": [
   13
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-[(2,2-difluoro-3-hydroxypropyl)amino]butan-2-ol?\nAnswer:",
  "answer": [
   "C7H15F2NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(C#N)OOCC=C?\nAnswer (numerical number):",
  "answer": [
   "127.14"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C11H19NO2?\nAnswer:",
  "answer": [
   "CCCCC(C(=O)O)NCCCC#C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H21NO2?\nAnswer (numerical number):",
  "answer": [
   34
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 4-dimethylarsanylbutanoic acid;hydrochloride?\nAnswer (numerical number):",
  "answer": [
   "228.55"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C11H23NO3?\nAnswer (numerical number):",
  "answer": [
   38
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-(2,2-difluorocyclopropyl)prop-2-enenitrile?\nAnswer:",
  "answer": [
   "C1C(C1(F)F)C=CC#N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCOCOCC1CCCC1CN\nAnswer:",
  "answer": [
   "[2-(ethoxymethoxymethyl)cyclopentyl]methanamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H25N3?\nAnswer (numerical number):",
  "answer": [
   38
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H21NO3?\nAnswer:",
  "answer": [
   "1-[[(2R)-2-hydroxypropyl]amino]-4-methoxy-2-methylbutan-2-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H19NO?\nAnswer:",
  "answer": [
   "4-(2-cyclopropylethylamino)-3-methylbutan-2-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (4,5,5-trimethyl-2,6-dihydro-1H-pyridin-3-yl)methanimine?\nAnswer:",
  "answer": [
   "C9H16N2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2,2-difluoro-3-(2-methylprop-2-enylamino)propan-1-ol?\nAnswer (numerical number):",
  "answer": [
   "165.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C11H24N2S?\nAnswer (numerical number):",
  "answer": [
   38
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of COC=C(C#N)Cl\nAnswer:",
  "answer": [
   "2-chloro-3-methoxyprop-2-enenitrile"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCOC1(CCCSC1)C=O\nAnswer:",
  "answer": [
   "3-ethoxythiane-3-carbaldehyde"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-(1-hydroxy-3-methoxypropan-2-yl)formamide?\nAnswer (numerical number):",
  "answer": [
   "133.15"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCCOCCC(=O)NCCCC(C)N?\nAnswer (numerical number):",
  "answer": [
   39
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in [1-(3-chloro-2-methylprop-2-enyl)pyrrolidin-2-yl]methanamine?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of COC1CC(=C)CCC1F\nAnswer:",
  "answer": [
   "1-fluoro-2-methoxy-4-methylidenecyclohexane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-(1,1,1-trifluoropent-2-en-2-yl)methanimine?\nAnswer (numerical number):",
  "answer": [
   "151.13"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1=C(C=NC(=N1)NN)C#N?\nAnswer (numerical number):",
  "answer": [
   15
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H16O?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C(COCO)NC(=O)CBr\nAnswer:",
  "answer": [
   "2-bromo-N-[2-(hydroxymethoxy)ethyl]acetamide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C2H3ClOS?\nAnswer:",
  "answer": [
   "ethenoxy thiohypochlorite"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(=CCl)CN(CCOC)CCCl?\nAnswer (numerical number):",
  "answer": [
   "226.14"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H12O?\nAnswer:",
  "answer": [
   "(2E,4Z)-2,4-dimethylhexa-2,4-dienal"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C10H23NO3?\nAnswer:",
  "answer": [
   "CC(CCOC)(CNCCCCO)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 1-cyclopentylpentane-1,4-diol?\nAnswer:",
  "answer": [
   "CC(CCC(C1CCCC1)O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CN(C)C(=S)SCC=COC\nAnswer:",
  "answer": [
   "[(E)-3-methoxyprop-2-enyl] N,N-dimethylcarbamodithioate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCCCCC(CCC)OOCCC?\nAnswer:",
  "answer": [
   "C13H28O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H17NO2S?\nAnswer:",
  "answer": [
   "CN(CCC(=O)O)CC1CCSC1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N'-hydroxy-2-(2-methylprop-2-enylamino)ethanimidamide?\nAnswer:",
  "answer": [
   "CC(=C)CNCC(=NO)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 3-(azetidin-3-yloxy)butan-2-ol?\nAnswer (numerical number):",
  "answer": [
   "145.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCN1CCC(CC1)NCCC#CC?\nAnswer:",
  "answer": [
   "C13H24N2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCSCCCNCC1CCC(CC1)Cl?\nAnswer:",
  "answer": [
   "C12H24ClNS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H6O?\nAnswer (numerical number):",
  "answer": [
   16
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-methyl-2-(2-pentan-2-yloxyethyl)cyclopentan-1-amine?\nAnswer:",
  "answer": [
   "C13H27NO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1=CC=CC=C1CCONC?\nAnswer:",
  "answer": [
   "C10H15NO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C7H9N3?\nAnswer (numerical number):",
  "answer": [
   19
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2,2-difluoro-3-(1-methylpyrrolidin-2-yl)propan-1-amine?\nAnswer (numerical number):",
  "answer": [
   "178.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (NE)-N-[[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]methylidene]hydroxylamine?\nAnswer:",
  "answer": [
   "CC1(OCC(O1)(C)C=NO)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CN(C)C(=O)CC1CNCC1F?\nAnswer (numerical number):",
  "answer": [
   "174.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCCCCCCC(CC)OOOOCC?\nAnswer (numerical number):",
  "answer": [
   42
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in ethyl 2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]acetate?\nAnswer (numerical number):",
  "answer": [
   37
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1CCC(=C(Cl)Cl)C1?\nAnswer (numerical number):",
  "answer": [
   "151.03"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(CCCSC)(CBr)C=C?\nAnswer:",
  "answer": [
   "C9H17BrS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 3-fluoro-3-[(propan-2-ylamino)methyl]cyclopentan-1-amine?\nAnswer (numerical number):",
  "answer": [
   "174.26"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-(chloromethyl)-2-ethyl-N-methylbutan-1-amine?\nAnswer:",
  "answer": [
   "CCC(CC)(CNC)CCl"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCC1=NN(C=C1C)CC=O\nAnswer:",
  "answer": [
   "2-(3-ethyl-4-methylpyrazol-1-yl)acetaldehyde"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (NZ)-N-[(3aR)-3,3a,4,5-tetrahydro-2H-pentalen-1-ylidene]hydroxylamine?\nAnswer (numerical number):",
  "answer": [
   21
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(=CCNCC(COCCOC)O)C?\nAnswer (numerical number):",
  "answer": [
   "217.31"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 6-methyl-3,4-dihydro-1H-isothiochromene?\nAnswer (numerical number):",
  "answer": [
   "164.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-[2-(pyrrolidin-3-ylmethoxy)ethoxy]ethanol?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (3-cyclobutyl-3-azabicyclo[3.1.0]hexan-2-yl)methanamine?\nAnswer:",
  "answer": [
   "C10H18N2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1C(CCS1)(C(=O)O)OC?\nAnswer:",
  "answer": [
   "C7H12O3S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-[(1S,2R)-2,6,6-trimethylcyclohex-3-en-1-yl]acetonitrile?\nAnswer:",
  "answer": [
   "CC1C=CCC(C1CC#N)(C)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 4,4,4-trifluorobutanamide?\nAnswer (numerical number):",
  "answer": [
   15
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (4,5-dichloroimidazol-1-yl)methanamine?\nAnswer (numerical number):",
  "answer": [
   "166.01"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C4H5ClN2?\nAnswer:",
  "answer": [
   "3-chloro-3,6-dihydropyridazine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H18S2?\nAnswer (numerical number):",
  "answer": [
   "190.4"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C6H13N3?\nAnswer:",
  "answer": [
   "N'-methyl-N-[(Z)-3-(methylamino)prop-1-enyl]methanimidamide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in [(4S)-octan-4-yl] acetate?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C7H15NO3?\nAnswer (numerical number):",
  "answer": [
   "161.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1-N'-methyl-1-(methylideneamino)ethane-1,1-diamine?\nAnswer (numerical number):",
  "answer": [
   "101.15"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-[2-(cyclopenten-1-yl)ethyl]-2-methylprop-2-en-1-amine?\nAnswer (numerical number):",
  "answer": [
   "165.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCC(COC)(C1=CCCCO1)O?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCC(=C=CC(=O)O)C\nAnswer:",
  "answer": [
   "4-methylhexa-2,3-dienoic acid"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H14N2O?\nAnswer:",
  "answer": [
   "(1R)-1-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl)ethanamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H19NO3?\nAnswer (numerical number):",
  "answer": [
   "189.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1C(OC(C1O)CO)CI?\nAnswer:",
  "answer": [
   "C6H11IO3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C5H10N2O2S?\nAnswer:",
  "answer": [
   "2-amino-4-methylsulfanyl-N-oxobutanamide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCC(C)OCC(C)O?\nAnswer (numerical number):",
  "answer": [
   "146.23"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCC1CC1S?\nAnswer (numerical number):",
  "answer": [
   16
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 4,4-dihydroxyhexan-2-one?\nAnswer (numerical number):",
  "answer": [
   21
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H21NO?\nAnswer:",
  "answer": [
   "(2S)-N,2-diethylhexanamide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H7FO?\nAnswer (numerical number):",
  "answer": [
   17
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C7H11BrN2O?\nAnswer:",
  "answer": [
   "C1=C(NC=C1C(CCN)O)Br"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H18O?\nAnswer:",
  "answer": [
   "(5R)-2-methyl-5-propan-2-ylcyclohex-2-en-1-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H8N4S?\nAnswer (numerical number):",
  "answer": [
   "168.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-chlorocyclohexa-1,4-diene-1-carbonitrile?\nAnswer:",
  "answer": [
   "C7H6ClN"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C6H10NP?\nAnswer:",
  "answer": [
   "CCN1C=CC(=C1)P"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-ethyl-2-(oxiran-2-yl)piperidine?\nAnswer:",
  "answer": [
   "C9H17NO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C7H15NO?\nAnswer:",
  "answer": [
   "(2R,4S)-2-ethyl-4-methoxypyrrolidine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(C)CCOCCNC(COC)CCl?\nAnswer:",
  "answer": [
   "C11H24ClNO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(=O)CC(=O)NC(=O)C?\nAnswer (numerical number):",
  "answer": [
   "143.14"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(C)NC(C)SC\nAnswer:",
  "answer": [
   "N-(1-methylsulfanylethyl)propan-2-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H17NO2?\nAnswer:",
  "answer": [
   "1-[3-(methoxymethoxy)cyclobutyl]-N-methylmethanamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H17ClO?\nAnswer:",
  "answer": [
   "7-chloro-2,6-dimethylhept-6-en-3-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCOCC(C)(C)NCC(C)CC?\nAnswer:",
  "answer": [
   "C12H27NO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CNCC(C(=O)NC)(F)F?\nAnswer:",
  "answer": [
   "C5H10F2N2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H19Cl?\nAnswer:",
  "answer": [
   "1-chlorobutane;cyclopentane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in COC1CC(OC=CCO1)OC?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H16O?\nAnswer:",
  "answer": [
   "CC(C)C1CCC(C1)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C4H7NO4S?\nAnswer (numerical number):",
  "answer": [
   "165.17"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H17NO2S?\nAnswer:",
  "answer": [
   "C1CSCC1CNCCCC(=O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CNCC1=CSC=C1\nAnswer:",
  "answer": [
   "N-methyl-1-thiophen-3-ylmethanamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H18N2O?\nAnswer:",
  "answer": [
   "CCC(CC)(CNCC#N)CO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(C)(CN)C(=O)NCCO\nAnswer:",
  "answer": [
   "3-amino-N-(2-hydroxyethyl)-2,2-dimethylpropanamide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCC(C)NCC1=NC=NC=C1?\nAnswer:",
  "answer": [
   "C9H15N3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (2S,4S)-2-butyl-1-ethylpiperidin-4-amine?\nAnswer (numerical number):",
  "answer": [
   37
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H19NO2?\nAnswer:",
  "answer": [
   "CC(CCOC(C)CNC)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C5H13NO2?\nAnswer:",
  "answer": [
   "[ethyl(methyl)amino]-methoxymethanol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-N-cyclopropyl-2-N-methyl-1-N-(2-methylsulfanylethyl)propane-1,2-diamine?\nAnswer (numerical number):",
  "answer": [
   35
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCCCC=CC1=CCCCC1=O?\nAnswer (numerical number):",
  "answer": [
   "192.30"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C6H15NO2?\nAnswer:",
  "answer": [
   "CCC(CO)OCCN"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of ethane;6-ethyl-2-methyl-2H-pyran?\nAnswer (numerical number):",
  "answer": [
   "154.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCNC1=NOC(=N1)C?\nAnswer (numerical number):",
  "answer": [
   "127.14"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(=O)OC1CC1?\nAnswer (numerical number):",
  "answer": [
   "100.12"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H19NO?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H22N2?\nAnswer:",
  "answer": [
   "(5R)-5,6-dimethylheptane-1,6-diamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-N,4-N,4-N-trimethylcyclohex-2-ene-1,4-diamine?\nAnswer:",
  "answer": [
   "C9H18N2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C13H28N2?\nAnswer (numerical number):",
  "answer": [
   43
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1CNCC(OC1)C2=CN=CS2?\nAnswer:",
  "answer": [
   "C8H12N2OS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCNCCOCC1(CCCCC1)O?\nAnswer (numerical number):",
  "answer": [
   "201.31"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C16H31N?\nAnswer (numerical number):",
  "answer": [
   "237.42"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H11ClS?\nAnswer (numerical number):",
  "answer": [
   "174.69"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-(cyclopenten-1-yl)-N-[2-(2-methylpropoxy)ethyl]ethanamine?\nAnswer:",
  "answer": [
   "C13H25NO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1CC(C1)C(CC=O)C(F)F?\nAnswer (numerical number):",
  "answer": [
   "162.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-(1-hydroxyethyl)cyclobutane-1-carboxylic acid?\nAnswer:",
  "answer": [
   "C7H12O3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C7H9N3O?\nAnswer:",
  "answer": [
   "N-methyl-N-(pyridin-4-ylmethyl)nitrous amide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCCCNC1CC(=O)NC1\nAnswer:",
  "answer": [
   "4-(pentylamino)pyrrolidin-2-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-(1-ethenylimidazol-2-yl)-N,N-dimethylethanamine?\nAnswer:",
  "answer": [
   "CN(C)CCC1=NC=CN1C=C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCCC1CNC(CN1)C?\nAnswer:",
  "answer": [
   "C9H20N2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1CCC2C(CO2)C(=O)CC1?\nAnswer (numerical number):",
  "answer": [
   "154.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-[3-(oxolan-2-yl)propyl]hex-1-yn-3-amine?\nAnswer (numerical number):",
  "answer": [
   "209.33"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H13NO2?\nAnswer:",
  "answer": [
   "(2S)-2-(pent-3-ynylamino)propanoic acid"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C11H22N2?\nAnswer:",
  "answer": [
   "CCNCC1CCN(C1)C2CCC2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CN1CCCC1CC(C=O)(F)F?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(=CCl)CN(C)CCCCCCl?\nAnswer (numerical number):",
  "answer": [
   "224.17"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of ethyl (2R)-2-(3-methylbutylamino)propanoate?\nAnswer:",
  "answer": [
   "CCOC(=O)C(C)NCCC(C)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCN(C)CC1CNCCO1?\nAnswer (numerical number):",
  "answer": [
   "158.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H13NO2S?\nAnswer:",
  "answer": [
   "CNCC(C1=C(C=CO1)SC)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C6H13F2NO?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCC(C)NC(=O)C1CCNCC1?\nAnswer:",
  "answer": [
   "C10H20N2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of COC(=CC(=O)OCC=C)CCl?\nAnswer (numerical number):",
  "answer": [
   "190.62"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1CCC2CC2=CC1?\nAnswer:",
  "answer": [
   "C8H12"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H18ClNS?\nAnswer:",
  "answer": [
   "CC(=CCl)CNCC(C)(C)SC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C5H8N2O?\nAnswer:",
  "answer": [
   "CC(=N)N(C=C)C=O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCC=CC(=CCC)C(=N)C?\nAnswer:",
  "answer": [
   "C11H19N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in N-(1,1-difluoropropan-2-yl)pent-1-yn-3-amine?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H22O2?\nAnswer (numerical number):",
  "answer": [
   "174.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H15N3?\nAnswer:",
  "answer": [
   "N-(1H-pyrazol-5-ylmethyl)hex-1-yn-3-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC1COC2C1OCC2C#C?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C5H13NO2S?\nAnswer (numerical number):",
  "answer": [
   "151.23"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C(CP(Cl)Cl)CP(Cl)Cl?\nAnswer (numerical number):",
  "answer": [
   15
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H21NOS?\nAnswer (numerical number):",
  "answer": [
   34
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 5-bromo-1-(oxolan-3-yl)pyrazole?\nAnswer:",
  "answer": [
   "C1COCC1N2C(=CC=N2)Br"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 1-butoxyperoxyhexane?\nAnswer:",
  "answer": [
   "CCCCCCOOOCCCC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in butane;cyclohexane;prop-1-ene?\nAnswer (numerical number):",
  "answer": [
   41
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 1-methoxy-N-propylnon-7-yn-4-amine?\nAnswer (numerical number):",
  "answer": [
   40
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-(chloromethyl)-N-pentan-3-ylcyclohexan-1-amine?\nAnswer:",
  "answer": [
   "C12H24ClN"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H16O?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCN1C(=O)C=CC=C1CNC?\nAnswer (numerical number):",
  "answer": [
   "166.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of [ethyl-bis(phosphanyl)-\u00ce\u00bb4-sulfanyl]phosphane?\nAnswer (numerical number):",
  "answer": [
   "160.10"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H14N2?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (3R,4R)-4-iodo-3-propan-2-yloxycyclohexene?\nAnswer:",
  "answer": [
   "CC(C)OC1C=CCCC1I"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1-(5-ethyl-2-methyloctyl)-2-methylhydrazine?\nAnswer (numerical number):",
  "answer": [
   "200.36"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CNC1CCOCC1N2CCCC2\nAnswer:",
  "answer": [
   "(3S,4S)-N-methyl-3-pyrrolidin-1-yloxan-4-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H23NO?\nAnswer (numerical number):",
  "answer": [
   "185.31"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of COCCCNC1CCCC1CO?\nAnswer (numerical number):",
  "answer": [
   "187.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-(3-chloro-2-methylprop-2-enyl)oxan-3-amine?\nAnswer:",
  "answer": [
   "CC(=CCl)CNC1CCCOC1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC=CC=CC(C)CC=C?\nAnswer:",
  "answer": [
   "C10H16"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CNCCC(C1=CC=CC=C1)F\nAnswer:",
  "answer": [
   "3-fluoro-N-methyl-3-phenylpropan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C5H9N3?\nAnswer (numerical number):",
  "answer": [
   "111.15"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C(=COC(=O)N)O\nAnswer:",
  "answer": [
   "[(E)-2-hydroxyethenyl] carbamate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(C)(C(C1CCCCC1)F)N?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H19NO?\nAnswer:",
  "answer": [
   "1-(oxolan-3-yl)hept-5-yn-2-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCC(C(=O)OCC)OCCNC?\nAnswer:",
  "answer": [
   "C9H19NO3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H19Cl2N?\nAnswer:",
  "answer": [
   "4-chloro-N-(3-chloro-2-methylprop-2-enyl)-2-ethylbutan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H18FN?\nAnswer (numerical number):",
  "answer": [
   "171.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(C)OC1=NC(=NCC1)F?\nAnswer:",
  "answer": [
   "C7H11FN2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-methyl-5-(thiolan-3-yl)-4,5-dihydroimidazol-2-amine?\nAnswer:",
  "answer": [
   "C8H15N3S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC1=C(N(N=N1)C)I?\nAnswer (numerical number):",
  "answer": [
   "223.02"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in N-[(1R,2R)-2-(sulfanylamino)cyclohexyl]thiohydroxylamine?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-butan-2-yl-1-(thiolan-3-yl)ethane-1,2-diamine?\nAnswer:",
  "answer": [
   "CCC(C)NC(CN)C1CCSC1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (2S)-N-(2-aminoethyl)morpholine-2-carboxamide?\nAnswer:",
  "answer": [
   "C1COC(CN1)C(=O)NCCN"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1CC(NC1)(C(=O)O)O?\nAnswer (numerical number):",
  "answer": [
   "131.13"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CN1CC(=C(C1)C=O)C=O?\nAnswer (numerical number):",
  "answer": [
   19
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H10S?\nAnswer (numerical number):",
  "answer": [
   "138.23"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (1R,4R,5S)-5-methoxybicyclo[2.2.2]oct-2-ene?\nAnswer:",
  "answer": [
   "C9H14O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (1S)-1-[3-(2-methylpropoxy)propoxy]propan-1-ol?\nAnswer:",
  "answer": [
   "C10H22O3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H21NO?\nAnswer (numerical number):",
  "answer": [
   33
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of COC(CCCN=O)C=C?\nAnswer (numerical number):",
  "answer": [
   "143.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 6H-1,4-diazepine-2-carboxamide?\nAnswer (numerical number):",
  "answer": [
   "137.14"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCC(C)NC=O?\nAnswer (numerical number):",
  "answer": [
   "101.15"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of COCCCOCCNCCC1=CCCC1?\nAnswer:",
  "answer": [
   "C13H25NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H25NO?\nAnswer (numerical number):",
  "answer": [
   "187.32"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C1CNC(CN1)CC2=CSN=N2\nAnswer:",
  "answer": [
   "4-(piperazin-2-ylmethyl)thiadiazole"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCC1CC(=O)CCC1=O?\nAnswer (numerical number):",
  "answer": [
   "154.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H14N2S?\nAnswer (numerical number):",
  "answer": [
   "182.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-methyl-5-(methylamino)-2H-pyridin-4-ol?\nAnswer:",
  "answer": [
   "C7H12N2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-methyl-2,5-dihydro-1H-imidazole?\nAnswer (numerical number):",
  "answer": [
   "84.12"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H19NOS?\nAnswer:",
  "answer": [
   "CCC(CN)C(C1CCSC1)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(C)NCC1CCC1?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 1-(oxolan-3-yl)hex-4-yn-1-ol?\nAnswer:",
  "answer": [
   "CC#CCCC(C1CCOC1)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (Z)-2-(prop-1-en-2-ylamino)but-2-enoic acid?\nAnswer:",
  "answer": [
   "C7H11NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(C)(COC1CCCC1O)N?\nAnswer (numerical number):",
  "answer": [
   "173.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC1=NC(=CN1C)Br?\nAnswer (numerical number):",
  "answer": [
   "175.03"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H15NS?\nAnswer:",
  "answer": [
   "CSCCC(C(=C)C=C)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-butylhept-6-enal?\nAnswer:",
  "answer": [
   "C11H20O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H13NO2?\nAnswer (numerical number):",
  "answer": [
   "131.17"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]propanal?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of tert-butyl [(E)-prop-1-enyl] carbonate?\nAnswer (numerical number):",
  "answer": [
   "158.19"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in methyl 2-[3-(propan-2-ylamino)propoxy]acetate?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in COCCOCCCNCC(CO)(F)F?\nAnswer (numerical number):",
  "answer": [
   34
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(C(C)(C)C1CO1)O?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H18O2?\nAnswer:",
  "answer": [
   "1,2-dioxacycloundecane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H16N2O?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of [2-[(1-amino-2-methylbutan-2-yl)amino]cyclopentyl]methanol?\nAnswer:",
  "answer": [
   "C11H24N2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-[(3S)-1-butylpyrrolidin-3-yl]acetonitrile?\nAnswer:",
  "answer": [
   "C10H18N2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C14H29N?\nAnswer (numerical number):",
  "answer": [
   "211.39"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC.CC1OCCCO1?\nAnswer (numerical number):",
  "answer": [
   "132.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H23N?\nAnswer:",
  "answer": [
   "2-ethenyl-N,2-dimethylheptan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C10H20O2?\nAnswer:",
  "answer": [
   "CCCCCCC1CCOCO1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (1S,2S,5S)-bicyclo[3.2.0]hept-3-en-2-ol?\nAnswer (numerical number):",
  "answer": [
   18
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H16O?\nAnswer (numerical number):",
  "answer": [
   "140.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H19NO?\nAnswer (numerical number):",
  "answer": [
   "145.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(CC(=CCO)C)OC?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (2S)-2-bromo-2-cyano-N,N-dimethylacetamide?\nAnswer (numerical number):",
  "answer": [
   16
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H16S?\nAnswer:",
  "answer": [
   "CCCCCC=CSC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H10N2?\nAnswer:",
  "answer": [
   "(1R,3R)-3-(cyanomethyl)-2,2-dimethylcyclopropane-1-carbonitrile"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H15NO2S?\nAnswer (numerical number):",
  "answer": [
   "189.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-[(1S,2S)-2-methoxycyclopentyl]thian-4-amine?\nAnswer:",
  "answer": [
   "COC1CCCC1NC2CCSCC2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of [(5S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-5-yl]methanol?\nAnswer (numerical number):",
  "answer": [
   "138.17"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 5-methyl-4-[[(2S)-pyrrolidin-2-yl]methyl]-1,2-thiazole?\nAnswer:",
  "answer": [
   "CC1=C(C=NS1)CC2CCCN2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C6H13ClFN?\nAnswer:",
  "answer": [
   "(2S)-2-(fluoromethyl)piperidine;hydrochloride"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H17NO2?\nAnswer:",
  "answer": [
   "N-methyl-2-(4-methyl-1,3-dioxetan-2-yl)butan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-[2-(1,3-thiazol-5-yl)ethyl]cyclopropan-1-amine?\nAnswer:",
  "answer": [
   "C8H12N2S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in [1-(ethylamino)cyclopentyl]methyl formate?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H25N?\nAnswer:",
  "answer": [
   "(2S)-N-methyldecan-2-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (6aS)-6a-methyl-1,4,5,6-tetrahydropentalen-2-one?\nAnswer:",
  "answer": [
   "CC12CCCC1=CC(=O)C2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-(3-methylbut-2-enyl)hept-6-en-1-amine?\nAnswer:",
  "answer": [
   "C12H23N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H14F2O?\nAnswer:",
  "answer": [
   "3-(difluoromethyl)-5-methylhexanal"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C(CC=CC=CCCCC=O)CC=O?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CNC(C=CC=CONC)N?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-methyl-4-(oxan-3-yl)pentan-2-amine?\nAnswer:",
  "answer": [
   "CC(CC(C)NC)C1CCCOC1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-(hydroxymethyl)pyrazolidin-4-ol?\nAnswer (numerical number):",
  "answer": [
   18
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCN(CC)CC1C(O1)(C)C\nAnswer:",
  "answer": [
   "N-[[(2S)-3,3-dimethyloxiran-2-yl]methyl]-N-ethylethanamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C11H18?\nAnswer:",
  "answer": [
   "CC=C(C)CC(=CC(=C)C)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H24N2?\nAnswer:",
  "answer": [
   "3-butyl-3-ethyl-1-methylpiperazine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(CN)NC(CO)COC\nAnswer:",
  "answer": [
   "2-(1-aminopropan-2-ylamino)-3-methoxypropan-1-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-cyclopentyloxyhexan-3-amine?\nAnswer (numerical number):",
  "answer": [
   "185.31"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCN1CCCC(C1)C(CO)F?\nAnswer:",
  "answer": [
   "C9H18FNO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C7H18N2?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H14N2?\nAnswer:",
  "answer": [
   "CCNC1CCCC1C#N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCC(CC)(CN)NCC#CC?\nAnswer (numerical number):",
  "answer": [
   "182.31"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CN1CCCCC1CN2CCCNCC2?\nAnswer (numerical number):",
  "answer": [
   "211.35"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(C1CC1)NC(C)C(=O)O?\nAnswer (numerical number):",
  "answer": [
   "157.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C(C(O)(O)Cl)(O)O.P?\nAnswer:",
  "answer": [
   "C2H8ClO4P"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H11NO3?\nAnswer:",
  "answer": [
   "2-formamidohept-5-ynoic acid"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-ethyl-5-methyl-1H-1,2,4-triazol-3-one?\nAnswer (numerical number):",
  "answer": [
   18
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1-(2-methoxyethoxymethyl)-4-methylcyclohexane?\nAnswer (numerical number):",
  "answer": [
   "186.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(C)N(C(=O)O)NC1CC1?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1CC=C(C1)CCNCC(CO)O?\nAnswer:",
  "answer": [
   "C10H19NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-(4,4-difluoro-1-methylpyrrolidin-3-yl)propan-1-amine?\nAnswer:",
  "answer": [
   "CN1CC(C(C1)(F)F)CCCN"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H13N?\nAnswer:",
  "answer": [
   "(2E,5Z)-N-methylocta-2,5,7-trien-4-imine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1CC(C2=CC=CC=C2C1)I?\nAnswer:",
  "answer": [
   "C10H11I"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H18ClNO?\nAnswer:",
  "answer": [
   "N-(1-chloro-3-methoxypropan-2-yl)butan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC=CS(=S)O?\nAnswer:",
  "answer": [
   "C3H6OS2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(C#N)NCC=C(C)C?\nAnswer:",
  "answer": [
   "C8H14N2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1=C(C=C(S1)CCCl)Br\nAnswer:",
  "answer": [
   "3-bromo-5-(2-chloroethyl)-2-methylthiophene"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-methylphosphanylcarbonylazepan-2-one?\nAnswer:",
  "answer": [
   "C8H14NO2P"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-[methyl-[(1S,2R)-2-methylsulfanylcyclopentyl]amino]propan-1-ol?\nAnswer:",
  "answer": [
   "C10H21NOS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C4H12N2O2S?\nAnswer (numerical number):",
  "answer": [
   21
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C5H11NO3?\nAnswer (numerical number):",
  "answer": [
   20
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C[Se]CCS?\nAnswer (numerical number):",
  "answer": [
   "155.13"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-(1,1-dimethoxypropan-2-yl)pent-1-yn-3-amine?\nAnswer:",
  "answer": [
   "CCC(C#C)NC(C)C(OC)OC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC1=CC=CC1Br?\nAnswer (numerical number):",
  "answer": [
   14
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC1CCC1C(=C)C?\nAnswer (numerical number):",
  "answer": [
   22
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C(CO)C(CC(Cl)Cl)O\nAnswer:",
  "answer": [
   "5,5-dichloropentane-1,3-diol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H16O2?\nAnswer (numerical number):",
  "answer": [
   "156.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1-amino-2-hex-1-yn-3-ylguanidine?\nAnswer (numerical number):",
  "answer": [
   "154.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H14O?\nAnswer (numerical number):",
  "answer": [
   "162.23"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1(CCN(C1)CCCCS)O?\nAnswer:",
  "answer": [
   "C9H19NOS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 1-(5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)-N-methoxymethanamine?\nAnswer (numerical number):",
  "answer": [
   22
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C7H13NS?\nAnswer:",
  "answer": [
   "CC(C)C(=C)NC(=S)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-(methylamino)-N-propylprop-2-enamide?\nAnswer:",
  "answer": [
   "CCCNC(=O)C(=C)NC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H16S2?\nAnswer:",
  "answer": [
   "(3E)-4,7-bis(methylsulfanyl)hepta-1,3-diene"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H20N2O2?\nAnswer (numerical number):",
  "answer": [
   "188.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2,2-dimethyloct-6-yn-3-amine?\nAnswer:",
  "answer": [
   "C10H19N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of COC=CC(=N)N?\nAnswer (numerical number):",
  "answer": [
   "100.12"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C7H17N3O?\nAnswer (numerical number):",
  "answer": [
   28
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCCC(CC)COC(C)(C)C?\nAnswer (numerical number):",
  "answer": [
   "186.33"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H19NS?\nAnswer:",
  "answer": [
   "(E)-N-propyl-3-(thiolan-3-yl)prop-2-en-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H12O2?\nAnswer:",
  "answer": [
   "(1R,3S,5R)-6-methylidene-8-oxabicyclo[3.2.1]octan-3-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(C(C1CCCC1)(F)F)N\nAnswer:",
  "answer": [
   "1-cyclopentyl-1,1-difluoropropan-2-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-ethyl-3a,7a-dihydro-1H-indole?\nAnswer:",
  "answer": [
   "C10H13N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N'-hydroxy-3-(pent-1-yn-3-ylamino)propanimidamide?\nAnswer (numerical number):",
  "answer": [
   "169.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H11NO?\nAnswer (numerical number):",
  "answer": [
   "113.16"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H20FN?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(CSC1=NN=CN1N)N?\nAnswer:",
  "answer": [
   "C5H11N5S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1C(C(CS1)F)CN.Cl?\nAnswer (numerical number):",
  "answer": [
   20
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H22N2O?\nAnswer:",
  "answer": [
   "N-methyl-N-[[(2R)-morpholin-2-yl]methyl]cyclopentanamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 1-butylsulfanyl-5-methylsulfanylpentane?\nAnswer (numerical number):",
  "answer": [
   34
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCC(C)CC(C=CCC=O)O?\nAnswer (numerical number):",
  "answer": [
   "170.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCC(=NNCCC)C1CCCC1?\nAnswer (numerical number):",
  "answer": [
   "196.33"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-methoxy-3-(2-methylphenyl)propan-1-ol?\nAnswer:",
  "answer": [
   "CC1=CC=CC=C1CC(CO)OC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H17NOS?\nAnswer:",
  "answer": [
   "[1-(thiolan-3-ylmethylamino)cyclopropyl]methanol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-(heptylamino)-1-methylpyrrolidin-2-one?\nAnswer:",
  "answer": [
   "CCCCCCCNC1CCN(C1=O)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (E)-5-hydroxy-3,4-dimethylpent-3-en-2-one?\nAnswer:",
  "answer": [
   "C7H12O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H15N3O2S?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C7H16O3?\nAnswer:",
  "answer": [
   "CC(OC)OCCCCO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-(2,2,2-trifluoroethoxymethoxymethyl)pyrrolidine?\nAnswer:",
  "answer": [
   "C8H14F3NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC=CC1=C(C=CC=C1Cl)F?\nAnswer (numerical number):",
  "answer": [
   19
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C7H7NO2?\nAnswer:",
  "answer": [
   "CC(=O)C1=C(NC=C1)C=O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C1COCCN1CNC2=NN=CS2\nAnswer:",
  "answer": [
   "N-(morpholin-4-ylmethyl)-1,3,4-thiadiazol-2-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(=O)CCCCC1CCSS1\nAnswer:",
  "answer": [
   "6-[(3S)-dithiolan-3-yl]hexan-2-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C14H28ClN?\nAnswer (numerical number):",
  "answer": [
   "245.83"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C6H14N2O2?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H20N2O?\nAnswer:",
  "answer": [
   "CCCC(CC)(CC(=O)N)NC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(=CC=CCF)S?\nAnswer (numerical number):",
  "answer": [
   "132.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C1COCC(C1CCO)(F)F\nAnswer:",
  "answer": [
   "2-(3,3-difluorooxan-4-yl)ethanol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1=CNSSC=C1?\nAnswer:",
  "answer": [
   "C4H5NS2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H14F2O?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H19NO3?\nAnswer:",
  "answer": [
   "CCCNCCOC(C)C(=O)OC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-methyl-3-(oxolan-2-ylmethylamino)pentan-1-ol?\nAnswer (numerical number):",
  "answer": [
   37
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-(3-chloro-2-methylprop-2-enoxy)-N-propan-2-ylpropan-1-amine?\nAnswer:",
  "answer": [
   "C10H20ClNO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H16O3?\nAnswer (numerical number):",
  "answer": [
   "172.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCCCCCNCC1CCCOC1?\nAnswer (numerical number):",
  "answer": [
   "213.36"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in N-[[(2R)-1-methylpiperidin-2-yl]methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine?\nAnswer (numerical number):",
  "answer": [
   36
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (3R)-N-[2-[(2S)-oxolan-2-yl]ethyl]thiolan-3-amine?\nAnswer:",
  "answer": [
   "C1CC(OC1)CCNC2CCSC2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCC(CCC=C)NCC1CCCC1O\nAnswer:",
  "answer": [
   "(1S,2S)-2-[[[(3R)-hept-6-en-3-yl]amino]methyl]cyclopentan-1-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CN1CCC(CC1)CCN(C)O?\nAnswer:",
  "answer": [
   "C9H20N2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2,3-dimethyloxirane;ethane?\nAnswer (numerical number):",
  "answer": [
   "102.17"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H17NO?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H22?\nAnswer (numerical number):",
  "answer": [
   "154.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H10F2?\nAnswer:",
  "answer": [
   "2-ethyl-1,5-difluoro-3-methylbenzene"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC=C(CI)C(=O)O\nAnswer:",
  "answer": [
   "(E)-2-(iodomethyl)but-2-enoic acid"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H10O?\nAnswer:",
  "answer": [
   "(1S,4S)-bicyclo[2.2.1]hept-2-ene-2-carbaldehyde"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C4H5F2N3?\nAnswer:",
  "answer": [
   "C1=C(C=NN1C(F)F)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (1R,5S,6S)-tricyclo[4.2.1.03,8]nonan-5-ol?\nAnswer:",
  "answer": [
   "C1C2CC3C2CC1C(C3)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (2R)-2-butanoyloxypropanoic acid?\nAnswer:",
  "answer": [
   "C7H12O4"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2,5-dimethyl-1-pent-3-ynylpiperazine?\nAnswer (numerical number):",
  "answer": [
   33
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCCCC(CCCC)CO?\nAnswer (numerical number):",
  "answer": [
   "172.31"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H12N2O?\nAnswer:",
  "answer": [
   "(3-ethoxyphenyl)methyldiazene"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H18N2S2?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1=C(SC=C1C=O)C(F)F?\nAnswer:",
  "answer": [
   "C6H4F2OS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (2R)-2-(ethylamino)butanenitrile?\nAnswer:",
  "answer": [
   "CCC(C#N)NCC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-(2-methylthiolan-3-yl)morpholin-4-amine?\nAnswer (numerical number):",
  "answer": [
   "202.32"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C5H11NO3?\nAnswer:",
  "answer": [
   "C1COCC[N+]1(CO)[O-]"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1-cyclopentyl-2-pentan-2-yloxyethanamine?\nAnswer (numerical number):",
  "answer": [
   "199.33"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-(5-bromopyridin-3-yl)propanenitrile?\nAnswer (numerical number):",
  "answer": [
   18
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (7S,8S)-7,8-dimethyl-1-azaspiro[4.4]nonane?\nAnswer (numerical number):",
  "answer": [
   "153.26"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C6H13NO2?\nAnswer:",
  "answer": [
   "(3S,4R)-3,4-dimethoxypyrrolidine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H14O3S?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCC1C(=NN(C1=O)C)C?\nAnswer:",
  "answer": [
   "C7H12N2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H20ClNO2?\nAnswer (numerical number):",
  "answer": [
   33
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C7H9NO2?\nAnswer:",
  "answer": [
   "methyl (2E)-2-[(methylideneamino)methylidene]but-3-enoate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CN1C(=C(NC1=O)CS)O?\nAnswer (numerical number):",
  "answer": [
   "160.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 1-[3-(1-hydroxycyclopropyl)propyl]cyclopropan-1-ol?\nAnswer:",
  "answer": [
   "C1CC1(CCCC2(CC2)O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H13BrS?\nAnswer:",
  "answer": [
   "CC1C2(CCS1)CC2CBr"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC1=NC2=C(S1)CN(C2)N?\nAnswer (numerical number):",
  "answer": [
   19
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC#CCCC(CC1CCCCO1)N\nAnswer:",
  "answer": [
   "1-(oxan-2-yl)hept-5-yn-2-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H15P?\nAnswer (numerical number):",
  "answer": [
   "166.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (2-bromo-1-fluoroethyl)cyclopropane?\nAnswer:",
  "answer": [
   "C5H8BrF"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H19NO4?\nAnswer (numerical number):",
  "answer": [
   33
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1=NN=C(C1=NN)N?\nAnswer (numerical number):",
  "answer": [
   13
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-[(thiolan-3-ylmethylamino)methyl]pentan-1-ol?\nAnswer (numerical number):",
  "answer": [
   37
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-propylcyclohex-2-en-1-one?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCSC#N.C1CCSC1?\nAnswer:",
  "answer": [
   "C8H15NS2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(C)SCP(=O)(O)O?\nAnswer:",
  "answer": [
   "C4H11O3PS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-ethenyl-4-ethyl-2-methylhexan-1-amine?\nAnswer:",
  "answer": [
   "CCC(CC)CC(C)(CN)C=C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC=C(C)C(C)C(=CC=C)C?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H11NO?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C7H15NO2?\nAnswer:",
  "answer": [
   "1-(azetidin-3-yloxy)-2-methylpropan-2-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-pent-1-yn-3-ylpent-1-yn-3-amine?\nAnswer (numerical number):",
  "answer": [
   "149.23"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C#CCCCC#CO\nAnswer:",
  "answer": [
   "hepta-1,6-diyn-1-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CN1C=NC(=C1N)C2CCSC2\nAnswer:",
  "answer": [
   "3-methyl-5-(thiolan-3-yl)imidazol-4-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (2S)-N,2-dimethyl-3-(1-methylpyrazol-4-yl)propan-1-amine?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 4-chloro-N-(2-methoxypropyl)butanamide?\nAnswer (numerical number):",
  "answer": [
   "193.67"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 1-[ethyl(methylamino)amino]-3-(methylamino)pentan-2-ol?\nAnswer:",
  "answer": [
   "CCC(C(CN(CC)NC)O)NC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of COC1C=COO1\nAnswer:",
  "answer": [
   "3-methoxy-3H-dioxole"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC.C1=CC=NC(=C1)CO\nAnswer:",
  "answer": [
   "ethane;pyridin-2-ylmethanol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCNCCOCC1=NC=CN1CC?\nAnswer (numerical number):",
  "answer": [
   "197.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (2S,4R)-4-(cyclohexylmethyl)-2-methylpyrrolidine?\nAnswer (numerical number):",
  "answer": [
   "181.32"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in [(1S,3R)-3-methylcyclohexyl]oxyphosphane?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 1-ethyl-3-(2-methylprop-2-enyl)urea?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of methyl N-prop-1-enylpropanimidate?\nAnswer (numerical number):",
  "answer": [
   "127.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC1CC(N(C(C=N1)C)C)C?\nAnswer (numerical number):",
  "answer": [
   "154.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H14O2?\nAnswer:",
  "answer": [
   "2-(3-ethynylcyclohex-3-en-1-yl)ethane-1,1-diol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (buta-1,2-dienylamino) cyanate?\nAnswer (numerical number):",
  "answer": [
   "110.11"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1COCCNC1C2=CSC=C2?\nAnswer (numerical number):",
  "answer": [
   "183.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2,2-difluoro-3-[[(2R)-2-hydroxypropyl]amino]propan-1-ol?\nAnswer:",
  "answer": [
   "CC(CNCC(CO)(F)F)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCC=CCCOC1CCCCO1?\nAnswer (numerical number):",
  "answer": [
   33
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C10H18O2?\nAnswer:",
  "answer": [
   "CC(C)C1CCCC1C(=O)OC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1(CC1)CNCCC(C)(C)O?\nAnswer:",
  "answer": [
   "C10H21NO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCC1=CNC(CC1)CO?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H13ClO2?\nAnswer:",
  "answer": [
   "CCCCC1CC(C(=O)O1)Cl"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C7H14ClNS?\nAnswer:",
  "answer": [
   "CC(CN)SCC(=CCl)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H9N?\nAnswer (numerical number):",
  "answer": [
   18
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C1C=NC2=NC=NC=C21\nAnswer:",
  "answer": [
   "5H-pyrrolo[2,3-d]pyrimidine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C6H8N2S2?\nAnswer:",
  "answer": [
   "CC1=CC(=S)N=C(N1)SC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(=C(C)N)C(N)NC?\nAnswer (numerical number):",
  "answer": [
   "129.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1CC(CCNC1)O\nAnswer:",
  "answer": [
   "6-methylazepan-4-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-chloroethyl 4-oxopentanoate?\nAnswer (numerical number):",
  "answer": [
   22
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCN1CCCN(C1=O)C2CC2\nAnswer:",
  "answer": [
   "1-cyclopropyl-3-ethyl-1,3-diazinan-2-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H16O3?\nAnswer:",
  "answer": [
   "pentan-3-yl 2-ethenoxyacetate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H19N3?\nAnswer (numerical number):",
  "answer": [
   "169.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-(3-bromopropyl)-N-methylcyclopropanecarboxamide?\nAnswer:",
  "answer": [
   "CN(CCCBr)C(=O)C1CC1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (2S,4S)-2,5-diamino-4-fluoropentanoic acid?\nAnswer:",
  "answer": [
   "C(C(CN)F)C(C(=O)O)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1CCCCS1\nAnswer:",
  "answer": [
   "(2R)-2-methylthiane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C7H14O2S?\nAnswer (numerical number):",
  "answer": [
   "162.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC=COOOO\nAnswer:",
  "answer": [
   "(Z)-1-hydroperoxyperoxyprop-1-ene"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1CN(CS1)C(=O)C?\nAnswer:",
  "answer": [
   "C6H11NOS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3,3-diaminopropanoic acid;hydrochloride?\nAnswer:",
  "answer": [
   "C(C(N)N)C(=O)O.Cl"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1=NN=NN1CCC(=O)O?\nAnswer (numerical number):",
  "answer": [
   16
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(C)CCCCCCCCOC=O\nAnswer:",
  "answer": [
   "9-methyldecyl formate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (2R)-bicyclo[2.2.1]heptane-2-carbaldehyde?\nAnswer:",
  "answer": [
   "C8H12O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 3-(3-hydroxypropyl)octan-2-one?\nAnswer (numerical number):",
  "answer": [
   "186.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-(thiolan-3-ylmethyl)cyclohex-2-en-1-amine?\nAnswer:",
  "answer": [
   "C11H19NS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C6H10OS2?\nAnswer:",
  "answer": [
   "1,1,1,3-tetradeuterio-4,4-bis(methylsulfanyl)but-3-en-2-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (E)-3-(cyclohexen-1-yl)prop-2-ene-1,1-diol?\nAnswer:",
  "answer": [
   "C9H14O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(=CCl)CN1CCOCC1CBr\nAnswer:",
  "answer": [
   "3-(bromomethyl)-4-(3-chloro-2-methylprop-2-enyl)morpholine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H14O3?\nAnswer:",
  "answer": [
   "1-(furan-2-yl)pentane-1,4-diol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C11H23Cl?\nAnswer (numerical number):",
  "answer": [
   35
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(CO)COCCC1CCNC1?\nAnswer (numerical number):",
  "answer": [
   34
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 1-methoxy-2-methylpentane-1,3-diol?\nAnswer:",
  "answer": [
   "CCC(C(C)C(O)OC)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H16N4O?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H17NO2S?\nAnswer (numerical number):",
  "answer": [
   30
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C5H11IN2S?\nAnswer:",
  "answer": [
   "CSC1=[NH+]CCCN1.[I-]"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1=CSC=C1C(CNCCF)O?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in N-[[(2S)-oxan-2-yl]methyl]-1-[(3S)-oxolan-3-yl]methanamine?\nAnswer (numerical number):",
  "answer": [
   35
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-(4-methoxybutan-2-yl)-N'-methylmethanimidamide?\nAnswer:",
  "answer": [
   "C7H16N2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C=CC=CCCCCC=CC#N?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-methyl-N-[(2-methylcyclopentyl)methyl]thiolan-3-amine?\nAnswer (numerical number):",
  "answer": [
   "213.38"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H13NO?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCC(C#C)NC1CCCC1CN\nAnswer:",
  "answer": [
   "2-(aminomethyl)-N-hex-1-yn-3-ylcyclopentan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C#CCCCCNCC1CCSC1\nAnswer:",
  "answer": [
   "N-(thiolan-3-ylmethyl)hex-5-yn-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H20ClNO2?\nAnswer (numerical number):",
  "answer": [
   "209.71"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-ethoxy-N-(2-propylsulfonylethyl)ethanamine?\nAnswer:",
  "answer": [
   "CCCS(=O)(=O)CCNCCOCC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H12O2?\nAnswer:",
  "answer": [
   "2-methoxy-6-methylcyclohex-2-en-1-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H13I?\nAnswer (numerical number):",
  "answer": [
   "212.07"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-[[(3-chloro-2-methylprop-2-enyl)amino]methyl]cyclopentan-1-ol?\nAnswer:",
  "answer": [
   "C10H18ClNO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-(3-methylfuran-2-yl)prop-2-yn-1-amine?\nAnswer:",
  "answer": [
   "C8H9NO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCCCCCOC(=O)C1CN1CCO?\nAnswer (numerical number):",
  "answer": [
   36
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(C)(C)C(=O)CN(C)F?\nAnswer:",
  "answer": [
   "C7H14FNO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C6H9ClO2?\nAnswer (numerical number):",
  "answer": [
   18
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1-piperidin-4-ylpentan-2-ol?\nAnswer (numerical number):",
  "answer": [
   "171.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(C(=O)O)NC1CCSCC1?\nAnswer:",
  "answer": [
   "C8H15NO2S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (3S)-N,N,3-trihydroxypyrrolidine-1-carboxamide?\nAnswer (numerical number):",
  "answer": [
   "162.14"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1(C2CCC1C=C2)C.S?\nAnswer:",
  "answer": [
   "C9H16S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCCNC1=NC(=O)C=NN1\nAnswer:",
  "answer": [
   "3-(butylamino)-2H-1,2,4-triazin-5-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1CC1C2=C(C2)C?\nAnswer:",
  "answer": [
   "C8H12"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H19ClN2?\nAnswer:",
  "answer": [
   "CCN(C)CCNCC(=CCl)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC1=NC(=NC=C1)CC(C)N?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H18N2?\nAnswer:",
  "answer": [
   "C=CCCN1CCCC(C1)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H14O2?\nAnswer:",
  "answer": [
   "CC=CCC(C)(C=C)C(=O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H20N2O?\nAnswer:",
  "answer": [
   "N-[2-(1-methylpiperidin-4-yl)ethoxy]methanamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C=CC(=O)OC1CCOC1=C?\nAnswer (numerical number):",
  "answer": [
   21
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H17F2N?\nAnswer:",
  "answer": [
   "CCCC(CC1CCCN1)(F)F"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(CCCOCC(F)(F)F)Cl?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(C)C(=O)N(C)C?\nAnswer (numerical number):",
  "answer": [
   "115.17"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H10INO?\nAnswer (numerical number):",
  "answer": [
   "239.05"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC1=NC=NC=C1C2CNCCO2?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 1-propan-2-ylsulfanylhept-5-yn-2-one?\nAnswer:",
  "answer": [
   "CC#CCCC(=O)CSC(C)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C6H12ClNO?\nAnswer (numerical number):",
  "answer": [
   21
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C11H15NS?\nAnswer (numerical number):",
  "answer": [
   28
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H9N3O?\nAnswer (numerical number):",
  "answer": [
   "139.16"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (2R)-3-(1H-imidazol-5-yl)-2-(methylamino)propane-1-thiol?\nAnswer:",
  "answer": [
   "C7H13N3S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H19NO?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(C(=O)OC)(NC=O)OC?\nAnswer (numerical number):",
  "answer": [
   "161.16"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCC(C)CCCCCC1=CC=CO1?\nAnswer (numerical number):",
  "answer": [
   "194.31"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of pentan-2-yl (2R)-2-aminopropanoate?\nAnswer (numerical number):",
  "answer": [
   "159.23"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (3R)-3-methylnonanal?\nAnswer (numerical number):",
  "answer": [
   "156.26"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 6-methyl-2,3,4,5-tetrahydropyridine-3-carboxamide?\nAnswer:",
  "answer": [
   "CC1=NCC(CC1)C(=O)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C12H15NO?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C6H8Br2O2?\nAnswer:",
  "answer": [
   "(7R)-8,8-dibromo-3,5-dioxabicyclo[5.1.0]octane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1CCCCC=CCC=CCCC1?\nAnswer (numerical number):",
  "answer": [
   "178.31"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCC(C(C(=O)N)O)NCl?\nAnswer:",
  "answer": [
   "C5H11ClN2O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C5H8ClN?\nAnswer:",
  "answer": [
   "CC(C#N)C(C)Cl"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H22ClNO?\nAnswer:",
  "answer": [
   "N-(3-butoxypropyl)-3-chloro-2-methylprop-2-en-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H9ClINO2?\nAnswer (numerical number):",
  "answer": [
   "289.50"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1CC1NCC2=CN=C(N2)C?\nAnswer:",
  "answer": [
   "C9H15N3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCC(CC)C1CCCCN1\nAnswer:",
  "answer": [
   "2-hexan-3-ylpiperidine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-(1,2-dihydroxy-3-sulfanylpropyl)sulfanylpropanal?\nAnswer:",
  "answer": [
   "CC(C=O)SC(C(CS)O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H16O4?\nAnswer (numerical number):",
  "answer": [
   "176.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-(1-chloro-3-methoxypropan-2-yl)octan-1-amine?\nAnswer:",
  "answer": [
   "C12H26ClNO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(CO)N1CC2CC2C1?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H21NO2S?\nAnswer:",
  "answer": [
   "4-butylsulfonyl-N-methylbutan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H18ClNO?\nAnswer:",
  "answer": [
   "3-[[(E)-3-chloroprop-2-enyl]amino]-3-methylpentan-1-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(=O)C(C)(C)OCCOCCO?\nAnswer (numerical number):",
  "answer": [
   "190.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(=O)C1=CC=CCC=CC1\nAnswer:",
  "answer": [
   "1-cycloocta-1,3,6-trien-1-ylethanone"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C6H7ClOS?\nAnswer:",
  "answer": [
   "CC=C(C=O)SC(=C)Cl"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1CSCC(N1)C2=NC=CO2?\nAnswer:",
  "answer": [
   "C7H10N2OS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of methyl 2-(hydroxymethyl)-1-methylpyrrolidine-2-carboxylate?\nAnswer:",
  "answer": [
   "CN1CCCC1(CO)C(=O)OC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in fluoroethane;fluoromethane;fluoromethoxymethoxyethane?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1C(C(COCO1)O)NS?\nAnswer:",
  "answer": [
   "C5H11NO3S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-cyclopropyl-2-ethoxy-N,2-dimethylpropan-1-amine?\nAnswer:",
  "answer": [
   "CCOC(C)(CC1CC1)CNC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1=C(C(=S)N=CN1)N?\nAnswer:",
  "answer": [
   "C5H7N3S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H18N2O?\nAnswer:",
  "answer": [
   "CCCN1CCCCC1C(=O)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C4H8N2O?\nAnswer (numerical number):",
  "answer": [
   15
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H20N2O2?\nAnswer (numerical number):",
  "answer": [
   "188.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 1-(1,3-dioxetan-2-yl)pyrrolidine?\nAnswer:",
  "answer": [
   "C1CCN(C1)C2OCO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of [ethoxy(methoxy)methyl] carbamate?\nAnswer:",
  "answer": [
   "CCOC(OC)OC(=O)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H16O2?\nAnswer:",
  "answer": [
   "CC(C)C(C)C(C)C(=O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCC(C(=O)O)OCCNCC?\nAnswer (numerical number):",
  "answer": [
   "189.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 9-methyl-2,4-dioxaspiro[5.5]undec-9-ene?\nAnswer:",
  "answer": [
   "CC1=CCC2(CC1)COCOC2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (2S)-1-[(3S)-oxolan-3-yl]oxypropan-2-ol?\nAnswer:",
  "answer": [
   "CC(COC1CCOC1)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-ethyl-N-hexan-3-ylpentan-2-amine?\nAnswer:",
  "answer": [
   "C13H29N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H15NO2S?\nAnswer:",
  "answer": [
   "methyl 2-[(2-methylthiolan-3-yl)amino]acetate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N,N-dimethyl-2-[(5S)-1-methyl-1,4-diazepan-5-yl]ethanamine?\nAnswer:",
  "answer": [
   "CN1CCC(NCC1)CCN(C)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCC(C=CC=CCCO)O\nAnswer:",
  "answer": [
   "nona-3,5-diene-1,7-diol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C4H9NO?\nAnswer (numerical number):",
  "answer": [
   "87.12"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-[1-(2-aminoethyl)piperidin-2-yl]-N,N-dimethylpropan-1-amine?\nAnswer:",
  "answer": [
   "C12H27N3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-[(trifluoromethylamino)methyl]cyclopentan-1-amine?\nAnswer:",
  "answer": [
   "C1CC(CC1CNC(F)(F)F)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H17ClN2?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC1CNC(CO1)CC(C)C?\nAnswer (numerical number):",
  "answer": [
   "157.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1CCCC(CC1)CN2CCCC2?\nAnswer:",
  "answer": [
   "C12H23N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(C(C)(C#N)Br)Br?\nAnswer (numerical number):",
  "answer": [
   "240.92"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H12N2?\nAnswer:",
  "answer": [
   "CC(C)N1C=C(C=N1)C=C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1CC2CC1CC2C(=O)Cl?\nAnswer (numerical number):",
  "answer": [
   21
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of COC1=C(C=CN=C1F)C#N\nAnswer:",
  "answer": [
   "2-fluoro-3-methoxypyridine-4-carbonitrile"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-methyl-3-prop-1-en-2-ylhexa-1,3-diene?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-hydroxyhexyl thiocyanate?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCC(CC)(CN)N(CC)CC?\nAnswer (numerical number):",
  "answer": [
   "186.34"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C10H20N2O?\nAnswer:",
  "answer": [
   "C1CC(CCC1CNC2CNC2)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpropan-1-one?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(C)CC(CC1=CSC=N1)N?\nAnswer (numerical number):",
  "answer": [
   28
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1CCCCN1CC(C)C?\nAnswer:",
  "answer": [
   "C10H21N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of COC1=NC=C(C=C1)CN=O?\nAnswer:",
  "answer": [
   "C7H8N2O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (3R)-3-butoxy-2-oxobutanal?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(CCO)NCCNC(C)CCO\nAnswer:",
  "answer": [
   "3-[2-(4-hydroxybutan-2-ylamino)ethylamino]butan-1-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(=C)C=CC1CCC(CC1)N?\nAnswer (numerical number):",
  "answer": [
   "165.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1=CC=CC=C1C(CO)OC\nAnswer:",
  "answer": [
   "2-methoxy-2-(2-methylphenyl)ethanol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of ethyl (4R)-4-methyl-4H-imidazole-5-carboxylate?\nAnswer:",
  "answer": [
   "C7H10N2O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1CC1C2=NC=CNC2=S?\nAnswer (numerical number):",
  "answer": [
   "152.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H14O?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C(=CS(=O)(=O)C=CF)F\nAnswer:",
  "answer": [
   "1-fluoro-2-(2-fluoroethenylsulfonyl)ethene"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C6H7FN2O2?\nAnswer:",
  "answer": [
   "C1=C(C=NN1CCC(=O)O)F"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-methylidene-N-propylpent-3-enamide?\nAnswer:",
  "answer": [
   "C9H15NO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-(pent-3-ynoxymethyl)pentan-3-amine?\nAnswer:",
  "answer": [
   "CCC(CC)(COCCC#CC)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-methyl-2-(5,6,7,8-tetrahydroindolizin-2-yl)ethanamine?\nAnswer (numerical number):",
  "answer": [
   "178.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C12H26N2?\nAnswer (numerical number):",
  "answer": [
   "198.35"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C14H22?\nAnswer:",
  "answer": [
   "4-propylideneundeca-1,5,8-triene"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H17NS2?\nAnswer:",
  "answer": [
   "N-[(4-methylthiophen-3-yl)methyl]-1-(thiolan-3-yl)methanamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-fluoro-N-methyl-3-(oxan-4-yl)propan-1-amine?\nAnswer (numerical number):",
  "answer": [
   "175.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CNOCC1CCCCS1?\nAnswer (numerical number):",
  "answer": [
   "161.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C2H6NPS?\nAnswer:",
  "answer": [
   "CCP(#N)S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H17NO?\nAnswer:",
  "answer": [
   "CCN(CC)CC#CC(C)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C4H6ClN5?\nAnswer (numerical number):",
  "answer": [
   "159.58"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-amino-2-methyl-3-(3-methylcyclopentyl)guanidine?\nAnswer:",
  "answer": [
   "C8H18N4"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1CSCC1CNC2CC(C2)O?\nAnswer (numerical number):",
  "answer": [
   "187.30"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 3-N-methyldodecane-1,3,12-triamine?\nAnswer (numerical number):",
  "answer": [
   "229.41"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-(7-oxoheptyl)formamide?\nAnswer:",
  "answer": [
   "C(CCCNC=O)CCC=O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C5H7N3S?\nAnswer (numerical number):",
  "answer": [
   16
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1C=CCCC1(C)C=O?\nAnswer:",
  "answer": [
   "C9H14O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1-cyclopentylhex-4-yn-1-one?\nAnswer (numerical number):",
  "answer": [
   "164.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H13N?\nAnswer:",
  "answer": [
   "CC1=CC2CCCC2N1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H19NO2?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H13N3?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H12N2S?\nAnswer:",
  "answer": [
   "1-(pyridin-4-ylmethylamino)ethanethiol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C5H9BrN4?\nAnswer (numerical number):",
  "answer": [
   "205.06"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 1-[(2R)-1-methoxypropan-2-yl]-2,5-dimethylpyrrole?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCC(C)NC(=O)CCC?\nAnswer:",
  "answer": [
   "C9H19NO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 4-(difluoromethylsulfanyl)piperidine?\nAnswer:",
  "answer": [
   "C1CNCCC1SC(F)F"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C6H6F2N2S?\nAnswer:",
  "answer": [
   "CSC1=NC=NC(=C1)C(F)F"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 1-bromopiperidine-2,6-dione?\nAnswer (numerical number):",
  "answer": [
   15
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H18O2?\nAnswer (numerical number):",
  "answer": [
   "170.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC1CCC(C(C1)(O)F)C?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCCCCCSCC(C)(C)C?\nAnswer (numerical number):",
  "answer": [
   36
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1,1-difluoro-1-(oxan-2-yl)propan-2-ol?\nAnswer (numerical number):",
  "answer": [
   "180.19"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1COCCNC1C2=CSC=N2?\nAnswer:",
  "answer": [
   "C8H12N2OS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCC(C)(CCO)NCCCCO?\nAnswer (numerical number):",
  "answer": [
   36
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H16OS?\nAnswer (numerical number):",
  "answer": [
   28
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C7H10O2?\nAnswer:",
  "answer": [
   "5-ethenyloxan-2-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C7H12N2O3?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 4-(hex-1-yn-3-ylamino)-2-methylbutan-2-ol?\nAnswer (numerical number):",
  "answer": [
   34
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(C)(C)OCCCN1CCOCC1\nAnswer:",
  "answer": [
   "4-[3-[(2-methylpropan-2-yl)oxy]propyl]morpholine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H14N4O?\nAnswer (numerical number):",
  "answer": [
   "182.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CON1C(=C)CC(C1=C)O?\nAnswer (numerical number):",
  "answer": [
   "141.17"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCCCCCCCCCC=CCS\nAnswer:",
  "answer": [
   "tetradec-2-ene-1-thiol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C7H14N2?\nAnswer:",
  "answer": [
   "CCCC(C)C(C#N)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCC(CC)C(CC(=O)C=C)O?\nAnswer (numerical number):",
  "answer": [
   30
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (Z)-1-N-methyl-1-N-prop-1-en-2-ylprop-1-ene-1,2-diamine?\nAnswer:",
  "answer": [
   "CC(=C)N(C)C=C(C)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1CC1C2C3CCC(C3CN2)N?\nAnswer (numerical number):",
  "answer": [
   "166.26"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 7-ethyl-3-methyl-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole?\nAnswer (numerical number):",
  "answer": [
   "167.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (3S)-4-methyl-3-(nitrosomethyl)morpholine?\nAnswer:",
  "answer": [
   "CN1CCOCC1CN=O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in [(Z)-3-methylpent-3-en-2-yl] acetate?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C7H13F3O?\nAnswer:",
  "answer": [
   "CCC(C(F)(F)F)OC(C)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 5-methoxy-4,5-dimethylhept-2-enal?\nAnswer (numerical number):",
  "answer": [
   "170.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H16ClNO?\nAnswer:",
  "answer": [
   "CC(=CCl)CN1CCC(C1)CO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCC(COC(=O)CBr)O?\nAnswer:",
  "answer": [
   "C6H11BrO3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-[(2R)-2-bromopropyl]-4-methyl-1,3-thiazole?\nAnswer (numerical number):",
  "answer": [
   20
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H19NO2?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(C#C)C1(CC1)C(=O)C?\nAnswer:",
  "answer": [
   "C9H12O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-methylidenethiolane?\nAnswer (numerical number):",
  "answer": [
   14
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC.CC.C1=CC(C=C1)I?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H14N2O?\nAnswer:",
  "answer": [
   "C1CC(C(C1)NCCO)C#N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H18N2?\nAnswer (numerical number):",
  "answer": [
   "142.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1C=NC2=C(S1)C=NC=C2?\nAnswer (numerical number):",
  "answer": [
   "150.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of S-methyl dodecanethioate?\nAnswer:",
  "answer": [
   "CCCCCCCCCCCC(=O)SC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 3-(1-methyl-5-propylpyrazol-3-yl)propan-1-amine?\nAnswer (numerical number):",
  "answer": [
   "181.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-methoxy-2-(methylsulfamoylamino)propan-1-ol?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H13NO?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-ethenyl-2-methyl-N-propan-2-ylpentan-1-amine?\nAnswer:",
  "answer": [
   "C11H23N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-ethyl-2-methylpentan-3-imine?\nAnswer:",
  "answer": [
   "CCC(=NCC)C(C)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H16O?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC=C(CCCN)C(=O)OC?\nAnswer:",
  "answer": [
   "C8H15NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C13H28N2?\nAnswer (numerical number):",
  "answer": [
   43
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (3R)-3-(5-methylthiophen-2-yl)piperidine?\nAnswer (numerical number):",
  "answer": [
   "181.30"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (2S)-1-amino-2-(1-methylpiperidin-4-yl)propan-2-ol?\nAnswer (numerical number):",
  "answer": [
   "172.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-hydroxy-3-(oxan-3-yl)butanal?\nAnswer:",
  "answer": [
   "C9H16O3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-cycloheptyl-2-fluoropropan-1-ol?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of ethyl N-(propan-2-ylamino)carbamate?\nAnswer:",
  "answer": [
   "C6H14N2O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCC(CN1C=C(NC1=O)O)O?\nAnswer (numerical number):",
  "answer": [
   "172.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C7H14N2O3?\nAnswer:",
  "answer": [
   "CC(C1CNCCN1C(=O)O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(C)CNC(C#N)C1CCSC1?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-ethynyl-5-fluorocyclohexa-1,3-diene?\nAnswer (numerical number):",
  "answer": [
   16
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(CO)(COC)C=O?\nAnswer:",
  "answer": [
   "C6H12O3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC1=S(CCN1C)C?\nAnswer (numerical number):",
  "answer": [
   21
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H22N2O?\nAnswer:",
  "answer": [
   "(3R,4R)-N-ethyl-3-pyrrolidin-1-yloxan-4-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H22N2?\nAnswer (numerical number):",
  "answer": [
   "182.31"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in N-[[(2S)-butan-2-yl]oxymethyl]prop-2-enamide?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-(1H-imidazol-2-yl)hex-4-yn-1-one?\nAnswer:",
  "answer": [
   "C9H10N2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H19ClO?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCC(CC)(COCCNCC)O?\nAnswer (numerical number):",
  "answer": [
   36
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H17NO2?\nAnswer:",
  "answer": [
   "ethyl 2-[(2S)-1-methylpyrrolidin-2-yl]acetate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in [2-(oxetan-3-ylamino)cyclopentyl]methanol?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1CC2(CCNC2)CC1C(F)F?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C=CCCCOCl?\nAnswer (numerical number):",
  "answer": [
   16
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (Z)-4-methylidene-6-(methylideneamino)hex-5-en-3-one?\nAnswer:",
  "answer": [
   "CCC(=O)C(=C)C=CN=C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(CCCNCCCCOC)Cl?\nAnswer (numerical number):",
  "answer": [
   35
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H20ClN?\nAnswer:",
  "answer": [
   "2-(cyclobutylmethyl)piperidine;hydrochloride"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-[(3-chloro-2-methylprop-2-enyl)amino]-2-methylpropan-1-ol?\nAnswer:",
  "answer": [
   "CC(=CCl)CNC(C)(C)CO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (2S)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carbaldehyde?\nAnswer (numerical number):",
  "answer": [
   "139.19"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H20O2?\nAnswer:",
  "answer": [
   "(1R,3R)-1-cyclohexylpent-4-ene-1,3-diol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1CC(=O)N(C1=O)CC#N\nAnswer:",
  "answer": [
   "2-[(3R)-3-methyl-2,5-dioxopyrrolidin-1-yl]acetonitrile"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-(diethylamino)ethyl methanesulfonate?\nAnswer (numerical number):",
  "answer": [
   "195.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H23NO?\nAnswer (numerical number):",
  "answer": [
   "185.31"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H20N2O?\nAnswer:",
  "answer": [
   "N-[(1-ethylpyrrol-2-yl)methyl]-2-methoxypropan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C10H17N?\nAnswer:",
  "answer": [
   "CC=CC=C(C=CC)N(C)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H19FN2?\nAnswer (numerical number):",
  "answer": [
   "174.26"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 3,3,3-trifluoro-N-(thiolan-3-ylmethyl)propan-1-amine?\nAnswer (numerical number):",
  "answer": [
   "213.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCNC(=O)OCCP(=O)(O)O?\nAnswer:",
  "answer": [
   "C5H12NO5P"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCC(C)OC(=O)C(CN)O?\nAnswer:",
  "answer": [
   "C8H17NO3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(C)(C(=O)OCCON)Br?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H15N?\nAnswer:",
  "answer": [
   "N-tert-butylbut-2-en-1-imine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 1-oxaspiro[4.5]decan-4-ylmethanamine?\nAnswer:",
  "answer": [
   "C1CCC2(CC1)C(CCO2)CN"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H12O?\nAnswer:",
  "answer": [
   "(5S)-2,5-dimethylcyclohex-2-en-1-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of methylsulfanylsulfinyloxysulfanylmethane?\nAnswer (numerical number):",
  "answer": [
   "158.3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H16N2?\nAnswer:",
  "answer": [
   "N-(3-methylbut-2-enyl)azetidin-3-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H19N?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C1CNCCC1C=C(C(=O)O)F\nAnswer:",
  "answer": [
   "(Z)-2-fluoro-3-piperidin-4-ylprop-2-enoic acid"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C(OS(=O)O)(I)(I)I?\nAnswer (numerical number):",
  "answer": [
   "473.80"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-[(3E)-3-methylhexa-1,3-dien-2-yl]ethanimine?\nAnswer:",
  "answer": [
   "CCC=C(C)C(=C)N=CC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-(3-hydroxy-3-methylpyrrolidin-1-yl)acetaldehyde?\nAnswer:",
  "answer": [
   "CC1(CCN(C1)CC=O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-(ethylamino)-N-methylsulfonylacetamide?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (Z)-3-amino-N'-ethyl-N-methylidenebut-2-enimidamide?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-piperazin-1-yl-1,3-thiazole?\nAnswer:",
  "answer": [
   "C1CN(CCN1)C2=NC=CS2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H16N2S?\nAnswer (numerical number):",
  "answer": [
   "184.30"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-butan-2-yl-2-(chloromethyl)cyclohexan-1-amine?\nAnswer (numerical number):",
  "answer": [
   "203.75"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(=O)CN(C)CN(C)C?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-[(propan-2-ylamino)methylidene]cyclohexan-1-one?\nAnswer (numerical number):",
  "answer": [
   "167.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (2R)-2-[(3-methylthiophen-2-yl)methyl]pyrrolidine?\nAnswer:",
  "answer": [
   "CC1=C(SC=C1)CC2CCCN2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C12H23N?\nAnswer (numerical number):",
  "answer": [
   36
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2,3,5,6,7,8,9,9a-octahydro-1H-pyrrolo[1,2-a]azepin-9-ylmethanol?\nAnswer (numerical number):",
  "answer": [
   "169.26"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C7H12N2O2?\nAnswer (numerical number):",
  "answer": [
   "156.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (E)-N-propan-2-ylpent-3-enamide?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (6R,10S)-10-methyl-4-oxa-1-azaspiro[5.5]undecane?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C5H11P?\nAnswer:",
  "answer": [
   "dimethyl(propylidyne)-\u00ce\u00bb5-phosphane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H13NS?\nAnswer (numerical number):",
  "answer": [
   "155.26"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H19NS?\nAnswer (numerical number):",
  "answer": [
   "185.33"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (3aR,6aS)-5-methyl-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-2-one?\nAnswer (numerical number):",
  "answer": [
   20
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCCOC(=O)COC(C)CNC\nAnswer:",
  "answer": [
   "butyl 2-[1-(methylamino)propan-2-yloxy]acetate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (5-oxopyrrolidin-3-yl)cyanamide?\nAnswer (numerical number):",
  "answer": [
   "125.13"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1CCCN2C1CC(C2)C?\nAnswer:",
  "answer": [
   "C10H19N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C4H7N5S?\nAnswer (numerical number):",
  "answer": [
   17
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-[(Z)-but-2-en-2-yl]propan-1-imine?\nAnswer:",
  "answer": [
   "CCC=NC(=CC)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(C)N1CCC(=O)N1CCN?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-ethyl-2-propylhexane-1-thiol?\nAnswer:",
  "answer": [
   "C11H24S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCCN(CC)CCNCC=CC?\nAnswer (numerical number):",
  "answer": [
   37
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CN1CCCN(CC1=O)CCCC#N?\nAnswer (numerical number):",
  "answer": [
   "195.26"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 4-oxononyl acetate?\nAnswer:",
  "answer": [
   "CCCCCC(=O)CCCOC(=O)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in COC(=O)C1CC=CCO1?\nAnswer (numerical number):",
  "answer": [
   20
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H19Br?\nAnswer:",
  "answer": [
   "1-bromopentylcyclopentane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 4-(2,2-difluoroethyl)-4-fluoropiperidine?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C(CCN)CC(C(=O)O)N?\nAnswer (numerical number):",
  "answer": [
   "151.19"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H17BrO?\nAnswer:",
  "answer": [
   "CCC(CCCCBr)C(=O)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCNC(CC=NCCC)C(=O)C\nAnswer:",
  "answer": [
   "3-(propylamino)-5-propyliminopentan-2-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-bromo-7-methyl-4,5,6,7-tetrahydrofuro[3,2-c]pyridine?\nAnswer (numerical number):",
  "answer": [
   "216.07"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of [(2R)-2,3-dimethylbutyl] acetate?\nAnswer:",
  "answer": [
   "C8H16O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of methyl N-(1-amino-4-methylpentan-3-yl)carbamate?\nAnswer:",
  "answer": [
   "CC(C)C(CCN)NC(=O)OC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C1COCC(N1)C2COCCO2\nAnswer:",
  "answer": [
   "3-(1,4-dioxan-2-yl)morpholine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1CN(C2=C1C=CN=C2)C\nAnswer:",
  "answer": [
   "1,3-dimethyl-2,3-dihydropyrrolo[2,3-c]pyridine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCC=CC#CCCBr\nAnswer:",
  "answer": [
   "(E)-1-bromonon-5-en-3-yne"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 1-amino-2-formylcyclopropane-1-carboxamide?\nAnswer:",
  "answer": [
   "C1C(C1(C(=O)N)N)C=O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H16S?\nAnswer (numerical number):",
  "answer": [
   "156.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-cycloheptylpropane-1,2-diol?\nAnswer (numerical number):",
  "answer": [
   "172.26"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 9-ethyl-3-oxatricyclo[5.2.0.02,4]nonane?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (Z)-1-iodo-4-[(2-methylpropan-2-yl)oxy]but-1-ene?\nAnswer (numerical number):",
  "answer": [
   "254.11"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCNCCOCCCCCC(=O)OCC?\nAnswer (numerical number):",
  "answer": [
   "231.33"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 3-amino-N-(3-hydroxypropyl)propanamide?\nAnswer (numerical number):",
  "answer": [
   "146.19"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H16O2?\nAnswer:",
  "answer": [
   "[(2S,3S)-3-hex-5-enyloxiran-2-yl]methanol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C6H13NS?\nAnswer:",
  "answer": [
   "[CH2-][NH+]1CCCCS1=C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC=CCC(=CC)C(C)(C)O?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C3H8N2OS?\nAnswer:",
  "answer": [
   "2-hydroxyethylthiourea"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CN(C)NC1=CCCC=C1?\nAnswer (numerical number):",
  "answer": [
   "138.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 3-(ethylamino)-N-[2-(hydroxymethyl)cyclopentyl]propanamide?\nAnswer (numerical number):",
  "answer": [
   "214.30"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H15N?\nAnswer (numerical number):",
  "answer": [
   "137.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-(4-methylsulfanylbutyl)hex-1-yn-3-amine?\nAnswer (numerical number):",
  "answer": [
   "199.36"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1-butylperoxydecane?\nAnswer (numerical number):",
  "answer": [
   "230.39"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCOCOC(CCl)CCl\nAnswer:",
  "answer": [
   "1,3-dichloro-2-(ethoxymethoxy)propane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (3S)-N-(4-methoxybutyl)thiolan-3-amine?\nAnswer:",
  "answer": [
   "C9H19NOS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 1-[2-(aminomethyl)cyclopentyl]oxypropan-2-ol?\nAnswer:",
  "answer": [
   "CC(COC1CCCC1CN)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (3R)-3-methyl-3-(methylamino)oct-7-en-2-one?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-(3-hydroxy-4-methoxybutyl)-2-sulfanylacetamide?\nAnswer:",
  "answer": [
   "C7H15NO3S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C11H21NO?\nAnswer:",
  "answer": [
   "CCCC1(CCCC(=NOC1)C)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-ethylpenta-2,4-dien-1-imine?\nAnswer:",
  "answer": [
   "C7H11N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H18N2S?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N'-ethyl-N'-propyl-N-(thiolan-3-ylmethyl)ethane-1,2-diamine?\nAnswer (numerical number):",
  "answer": [
   "230.42"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1C=CN(N=C1I)I?\nAnswer (numerical number):",
  "answer": [
   12
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CNCCOCC1(CCCCC1)O?\nAnswer (numerical number):",
  "answer": [
   34
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in N-(thiolan-3-ylmethyl)but-3-yn-1-amine?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCC(CC1=CN(N=N1)C)N?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC1CN=C(S1)C?\nAnswer (numerical number):",
  "answer": [
   "115.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H9NO2?\nAnswer:",
  "answer": [
   "3-ethyl-1,2-benzoxazol-7-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H21NOS?\nAnswer (numerical number):",
  "answer": [
   "215.36"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCC1=C(C=NN1CC)CCNC\nAnswer:",
  "answer": [
   "2-(1,5-diethylpyrazol-4-yl)-N-methylethanamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-ethyl-4-hydroxy-3-methylpyrrolidin-2-one?\nAnswer:",
  "answer": [
   "C7H13NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1C(C2=CC=CC=C12)C\nAnswer:",
  "answer": [
   "(7S,8S)-7,8-dimethylbicyclo[4.2.0]octa-1,3,5-triene"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-[3-[hydroxy(methoxy)phosphinothioyl]oxypropyldisulfanyl]propan-1-ol?\nAnswer:",
  "answer": [
   "C7H17O4PS3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H21NO2?\nAnswer (numerical number):",
  "answer": [
   "199.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C1CC2COC(C1)O2\nAnswer:",
  "answer": [
   "6,8-dioxabicyclo[3.2.1]octane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(=O)OC1CC(NC1)CO?\nAnswer (numerical number):",
  "answer": [
   "159.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H18O3?\nAnswer (numerical number):",
  "answer": [
   "174.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(C)(C)CCCCNC\nAnswer:",
  "answer": [
   "N,5,5-trimethylhexan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H19NO2S?\nAnswer:",
  "answer": [
   "N-(1-hydroxy-3-methylpentan-3-yl)-3-sulfanylpropanamide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C12H23N?\nAnswer (numerical number):",
  "answer": [
   36
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1C(=O)CO1\nAnswer:",
  "answer": [
   "(2R)-2-methyloxetan-3-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H18N2?\nAnswer:",
  "answer": [
   "2-(dimethylamino)-2-ethylpentanenitrile"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C4H12O2S2?\nAnswer:",
  "answer": [
   "2-sulfanylethanol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H17N5?\nAnswer:",
  "answer": [
   "N-(2H-tetrazol-5-ylmethyl)hexan-3-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCC1CC(C(CO1)O)O?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C4H6N2OS?\nAnswer (numerical number):",
  "answer": [
   14
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C7H17NO2S?\nAnswer (numerical number):",
  "answer": [
   "179.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C4H5N3OS?\nAnswer:",
  "answer": [
   "CN1C=C(N=N1)C(=O)S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 4-methyl-2,3,3a,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol;hydrochloride?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 1-cyclopentylsulfanyl-N-methylhept-5-yn-2-amine?\nAnswer (numerical number):",
  "answer": [
   38
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C(CC(CCCN)CCC(N)N)CN?\nAnswer:",
  "answer": [
   "C10H26N4"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 4-methyl-3-(oxan-3-yl)piperidine?\nAnswer (numerical number):",
  "answer": [
   "183.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCCCS(=O)C=CC(=O)O?\nAnswer:",
  "answer": [
   "C8H14O3S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (2R)-4-(azetidin-3-yl)-2-ethylmorpholine?\nAnswer:",
  "answer": [
   "CCC1CN(CCO1)C2CNC2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-[(2S,3R)-2-methyloxetan-3-yl]acetic acid?\nAnswer (numerical number):",
  "answer": [
   19
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1CC2=CC=CC=C2C1N?\nAnswer:",
  "answer": [
   "C9H11N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C7H14F2N2?\nAnswer (numerical number):",
  "answer": [
   "164.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C6H10N4OS?\nAnswer:",
  "answer": [
   "CN(CC1=NN2CCSC2=N1)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of [2-[[(3-chloro-2-methylprop-2-enyl)amino]methyl]cyclopentyl]methanol?\nAnswer (numerical number):",
  "answer": [
   "217.73"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(C)N(C(=N)N)C(=O)S?\nAnswer (numerical number):",
  "answer": [
   "161.23"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(C)CNCCCCC1CCSC1\nAnswer:",
  "answer": [
   "N-(2-methylpropyl)-4-(thiolan-3-yl)butan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of dideuteriomethyl 5-sulfanylidene-4H-1,3-thiazole-4-carboxylate?\nAnswer (numerical number):",
  "answer": [
   "177.2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H18N2O?\nAnswer (numerical number):",
  "answer": [
   30
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCCCC(=O)NCCCC(C)Cl?\nAnswer (numerical number):",
  "answer": [
   "219.75"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H18O3?\nAnswer:",
  "answer": [
   "butyl (4R)-4-hydroxypentanoate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H8N2O3?\nAnswer (numerical number):",
  "answer": [
   "156.14"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CN1CCCN(CC1=O)CCCC#C\nAnswer:",
  "answer": [
   "1-methyl-4-pent-4-ynyl-1,4-diazepan-2-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCC=C(CCC)CCC?\nAnswer:",
  "answer": [
   "C11H22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC1(OCC(O1)C(=O)CI)C?\nAnswer (numerical number):",
  "answer": [
   "270.06"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C10H17F?\nAnswer:",
  "answer": [
   "CC(CCCCCCC#C)F"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1CC2=CC=CCCC2=NC1?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CSCC(=O)NCC1CCCNCC1?\nAnswer (numerical number):",
  "answer": [
   34
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H16N2O?\nAnswer:",
  "answer": [
   "CC(CNCC1=CNC=C1)OC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 4-(2-bromoethyl)-5-methyl-1H-pyrazole?\nAnswer (numerical number):",
  "answer": [
   "189.05"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-[1-(2-methylhydrazinyl)ethylidene]acetamide?\nAnswer:",
  "answer": [
   "C5H11N3O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1=NNC2=C1C=NN2?\nAnswer (numerical number):",
  "answer": [
   "108.10"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCC(CCBr)NCC(=CCl)C?\nAnswer (numerical number):",
  "answer": [
   "254.59"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C1CN(CCN1)C=S\nAnswer:",
  "answer": [
   "piperazine-1-carbothialdehyde"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-(fluoromethyl)cyclooctyne?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-(3,3-difluoropyrrolidin-1-yl)acetic acid?\nAnswer:",
  "answer": [
   "C6H9F2NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H15NOS?\nAnswer (numerical number):",
  "answer": [
   "173.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in N-[(2-methoxyphenyl)methoxy]methanamine?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(CSC1CCCCC1N)N\nAnswer:",
  "answer": [
   "2-(2-aminopropylsulfanyl)cyclohexan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C5H13N5?\nAnswer:",
  "answer": [
   "5-ethyl-2,4-dihydro-1,3,5-triazine-2,3-diamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-[2-(3-methylbutoxy)ethyl]pent-3-yn-1-amine?\nAnswer:",
  "answer": [
   "C12H23NO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C7H11N3?\nAnswer:",
  "answer": [
   "(2R)-1-pyrimidin-2-ylpropan-2-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (3R)-1-(cyclobutylmethyl)piperidin-3-amine?\nAnswer:",
  "answer": [
   "C1CC(C1)CN2CCCC(C2)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C4H6N4O?\nAnswer (numerical number):",
  "answer": [
   15
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of COCCOCCNC1CCCCCC1C#N\nAnswer:",
  "answer": [
   "(1S,2R)-2-[2-(2-methoxyethoxy)ethylamino]cycloheptane-1-carbonitrile"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(C)SCSCSCSSC(C)C?\nAnswer (numerical number):",
  "answer": [
   34
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-[(6S)-6-methylcyclohex-2-en-1-yl]-2,3-dihydropyridine?\nAnswer:",
  "answer": [
   "CC1CCC=CC1C2CN=CC=C2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(=CCNC1CCC(C1)N)C?\nAnswer:",
  "answer": [
   "C10H20N2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC.CC1=NN(C(=N1)C)C?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCC(C#C)NC(CCCN)COC?\nAnswer (numerical number):",
  "answer": [
   36
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H15NO2S?\nAnswer (numerical number):",
  "answer": [
   "189.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 4-ethylhexane-1,3,5-triol?\nAnswer (numerical number):",
  "answer": [
   "162.23"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCC(C)(C(N)N)N(C)C?\nAnswer (numerical number):",
  "answer": [
   "145.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N'-but-1-en-2-ylethane-1,2-diamine?\nAnswer:",
  "answer": [
   "C6H14N2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C13H25NO?\nAnswer:",
  "answer": [
   "(1S,2S)-2-[[[(3S)-hept-6-en-3-yl]amino]methyl]cyclopentan-1-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C7H17NO2?\nAnswer:",
  "answer": [
   "CC(C)(COCCNC)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC1=CC=C(N1)C(C)(C)O?\nAnswer (numerical number):",
  "answer": [
   "139.19"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H17NOS?\nAnswer (numerical number):",
  "answer": [
   28
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C1CC(CC2(C1)OCCO2)CN\nAnswer:",
  "answer": [
   "1,4-dioxaspiro[4.5]decan-7-ylmethanamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCC(C)CCC(=C)C#N?\nAnswer:",
  "answer": [
   "C9H15N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H12OS?\nAnswer:",
  "answer": [
   "2-ethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C12H25NO2?\nAnswer:",
  "answer": [
   "1-[2-(propylamino)ethoxymethyl]cyclohexan-1-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H23NO?\nAnswer:",
  "answer": [
   "3-(oxan-3-yl)-N-propylpropan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (1R,2S)-1-bromo-2-(2-ethoxyethyl)cyclohexane?\nAnswer (numerical number):",
  "answer": [
   "235.16"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC#CCCC(C1CCOCC1)NC\nAnswer:",
  "answer": [
   "N-methyl-1-(oxan-4-yl)hex-4-yn-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (5S)-5-methyl-2-sulfanylidene-1,3-thiazinan-4-one?\nAnswer:",
  "answer": [
   "C5H7NOS2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in butyl 2-(pyrrolidin-3-ylmethoxy)acetate?\nAnswer (numerical number):",
  "answer": [
   36
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H14N2O2?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCCNCC1=CC=C(O1)C?\nAnswer (numerical number):",
  "answer": [
   "167.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(CNCCCCN)NC(=O)C?\nAnswer (numerical number):",
  "answer": [
   34
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCC(C)CC(C)(CBr)C=C?\nAnswer:",
  "answer": [
   "C10H19Br"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1CCN(C1)CC=C2CCNCC2?\nAnswer (numerical number):",
  "answer": [
   "180.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C(CCCCCS)CCCCC(N)O?\nAnswer:",
  "answer": [
   "C11H25NOS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C7H14F2N2O?\nAnswer (numerical number):",
  "answer": [
   "180.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of methyl 3-[(3-chloro-2-methylprop-2-enyl)amino]propanoate?\nAnswer:",
  "answer": [
   "C8H14ClNO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1-methyl-1-azacyclodeca-3,9-diyn-2-one?\nAnswer (numerical number):",
  "answer": [
   "161.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(C1=CCSCC1)C(=O)O?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-(thiolan-3-ylmethyl)pyridin-2-amine?\nAnswer:",
  "answer": [
   "C10H14N2S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (3aS,7aR)-1,3-dihydroxy-7a-methyl-2,3a,4,5,6,7-hexahydrobenzimidazole?\nAnswer (numerical number):",
  "answer": [
   "172.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1-N,1-N-diethylheptane-1,6-diamine?\nAnswer (numerical number):",
  "answer": [
   "186.34"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C7H11NOS?\nAnswer (numerical number):",
  "answer": [
   21
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 4-(pent-3-ynylamino)cyclohexan-1-ol?\nAnswer (numerical number):",
  "answer": [
   "181.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 1-methyl-4-pent-2-en-2-ylpiperidine?\nAnswer (numerical number):",
  "answer": [
   33
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C7H9IN2?\nAnswer (numerical number):",
  "answer": [
   "248.06"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (1S,2S)-2-(propan-2-ylamino)cycloheptane-1-carbonitrile?\nAnswer (numerical number):",
  "answer": [
   33
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1CC(C(C1)F)CCN.Cl?\nAnswer:",
  "answer": [
   "C7H15ClFN"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C3H5KO2S?\nAnswer (numerical number):",
  "answer": [
   "144.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C11H19NS?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H24O3?\nAnswer (numerical number):",
  "answer": [
   "204.31"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1CC(NC(=S)N1)O\nAnswer:",
  "answer": [
   "4-hydroxy-6-methyl-1,3-diazinane-2-thione"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC1=NC(=N)C=CC1=C?\nAnswer (numerical number):",
  "answer": [
   "120.15"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCCCC(CC)C1C(CCN1)C?\nAnswer (numerical number):",
  "answer": [
   38
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H19NO?\nAnswer:",
  "answer": [
   "CC(CNCC1(CC1)C)OC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1CCC(C(C1)CC(C)C)O?\nAnswer:",
  "answer": [
   "C11H22O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (2S)-2-[[(2S)-pyrrolidin-2-yl]methoxymethyl]pyrrolidine?\nAnswer (numerical number):",
  "answer": [
   "184.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCC(CC)(CO)N1CCNCC1\nAnswer:",
  "answer": [
   "2-ethyl-2-piperazin-1-ylpentan-1-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCC(CCNC1CCC(CC1)O)O?\nAnswer:",
  "answer": [
   "C11H23NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H23NO2?\nAnswer (numerical number):",
  "answer": [
   "201.31"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCCCCCC=CC(F)(F)Cl?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C4H9O6P?\nAnswer:",
  "answer": [
   "ethoxycarbonyl(methylperoxy)phosphinic acid"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(=C)CC(CC=C)O?\nAnswer (numerical number):",
  "answer": [
   "126.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H12O3?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C2H9NO3Si?\nAnswer (numerical number):",
  "answer": [
   "123.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H21ClO?\nAnswer:",
  "answer": [
   "1-chloro-5-pentan-2-yloxypentane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-chloro-2-methyl-N-[(1-methylpiperidin-2-yl)methyl]prop-2-en-1-amine?\nAnswer (numerical number):",
  "answer": [
   35
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 1-[(1R)-1-cyclopropylethyl]-1,4-diazepane?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H11NO2S?\nAnswer (numerical number):",
  "answer": [
   "161.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (2Z,4Z)-5,6-dimethylhepta-2,4,6-trien-2-amine?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCSSCC1(CSSCN1)N?\nAnswer (numerical number):",
  "answer": [
   "242.5"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of COC(=O)C1(CCC1)OC=C?\nAnswer (numerical number):",
  "answer": [
   "156.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC=CC1OCC(O1)CCl?\nAnswer (numerical number):",
  "answer": [
   "162.61"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1-pentan-2-yloxyhex-1-ene?\nAnswer (numerical number):",
  "answer": [
   "170.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC=CCCNCC(=CCl)C?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C7H13ClO?\nAnswer:",
  "answer": [
   "CC(CCC(=CCl)C)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C12H25NO3?\nAnswer (numerical number):",
  "answer": [
   41
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C11H23NOS?\nAnswer (numerical number):",
  "answer": [
   37
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(CO)SC(=NC)N\nAnswer:",
  "answer": [
   "1-hydroxypropan-2-yl N'-methylcarbamimidothioate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of [(1R)-2-(2-methoxyphenyl)cyclopropyl]methanamine?\nAnswer (numerical number):",
  "answer": [
   "177.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 5-[(1-aminocyclopentyl)methoxy]pentan-1-ol?\nAnswer (numerical number):",
  "answer": [
   37
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C11H21NO?\nAnswer (numerical number):",
  "answer": [
   34
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 1,2,3,5,6,7,4,8-hexathiadiazocane?\nAnswer:",
  "answer": [
   "N1SSSNSSS1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 6-butoxy-5-hydroxyhexan-3-one?\nAnswer (numerical number):",
  "answer": [
   33
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC1=NN(C2=C1CCN=C2)C?\nAnswer (numerical number):",
  "answer": [
   "149.19"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCC(C)OC=S?\nAnswer:",
  "answer": [
   "C6H12OS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of [1-(thiolan-3-ylmethyl)pyrrolidin-3-yl]methanol?\nAnswer:",
  "answer": [
   "C10H19NOS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H8F2O2S?\nAnswer (numerical number):",
  "answer": [
   "182.19"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C6H15NO2S?\nAnswer:",
  "answer": [
   "3-[ethyl(methyl)amino]propane-1-sulfinic acid"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H20N2O?\nAnswer (numerical number):",
  "answer": [
   "184.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (3S)-5-methyl-3-(trifluoromethyl)hexan-1-amine?\nAnswer (numerical number):",
  "answer": [
   "183.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 4-bromo-1-(chloromethyl)-3,5-dimethylpyrazole?\nAnswer:",
  "answer": [
   "C6H8BrClN2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C13H25NO2?\nAnswer:",
  "answer": [
   "2-(4-methylpiperidin-3-yl)oxycycloheptan-1-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 6-hydroxy-1-methyl-2-methylsulfanylpyrimidin-4-one?\nAnswer:",
  "answer": [
   "C6H8N2O2S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 6-chloro-3-ethyl-5-methylhex-5-en-2-ol?\nAnswer (numerical number):",
  "answer": [
   "176.68"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 1-[2-(oxetan-3-yl)pyrazol-3-yl]ethanamine?\nAnswer:",
  "answer": [
   "CC(C1=CC=NN1C2COC2)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C7H11NO3?\nAnswer (numerical number):",
  "answer": [
   "157.17"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C5H8Br4?\nAnswer (numerical number):",
  "answer": [
   "387.73"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of [(2R)-4-methyl-1-oxopentan-2-yl]carbamic acid?\nAnswer:",
  "answer": [
   "CC(C)CC(C=O)NC(=O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N,N,3-triethylpentan-2-amine?\nAnswer:",
  "answer": [
   "CCC(CC)C(C)N(CC)CC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in N-methyl-1-[5-(2-methylpropyl)-1H-pyrazol-4-yl]methanamine?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (1R,2S)-2-(2-methylpropylamino)cyclopentane-1-carbonitrile?\nAnswer:",
  "answer": [
   "CC(C)CNC1CCCC1C#N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-imino-1-N'-(methylideneamino)propane-1,1-diamine?\nAnswer:",
  "answer": [
   "C=NNC(CC=N)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (Z)-3-hydroxyundec-2-enenitrile?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (4R)-4-methyl-3-pentyl-1,3-oxazolidin-2-one?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CNCCC(=O)NCCC1=CCCC1?\nAnswer:",
  "answer": [
   "C11H20N2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-(4-methylpent-3-enyl)-2-propylcyclopropane?\nAnswer:",
  "answer": [
   "C12H22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCOCOCCC1CCCNC1?\nAnswer (numerical number):",
  "answer": [
   "187.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of [4-(oxan-3-yl)morpholin-3-yl]methanamine?\nAnswer:",
  "answer": [
   "C1CC(COC1)N2CCOCC2CN"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H17F2N?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(CC(CCCCCCO)O)O?\nAnswer (numerical number):",
  "answer": [
   35
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(=O)C1=CC=CC=C1I?\nAnswer:",
  "answer": [
   "C8H7IO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in N-piperidin-3-ylpentan-3-imine?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-chloro-5-methyl-1,3-oxazole?\nAnswer:",
  "answer": [
   "C4H4ClNO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H12N2S?\nAnswer (numerical number):",
  "answer": [
   "180.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H13N?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H18O2?\nAnswer (numerical number):",
  "answer": [
   "170.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCOCCOCCOCCOCCC(=O)F?\nAnswer:",
  "answer": [
   "C11H21FO5"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (2S)-2-(5-methoxy-1H-pyrazol-4-yl)propan-1-amine?\nAnswer:",
  "answer": [
   "C7H13N3O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H16O?\nAnswer:",
  "answer": [
   "(4S)-tricyclo[4.3.1.03,8]decan-4-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 4-cyclopentyl-3-methoxybutan-1-amine?\nAnswer (numerical number):",
  "answer": [
   "171.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (1-bromo-4-methoxybutyl)cyclopentane?\nAnswer:",
  "answer": [
   "COCCCC(C1CCCC1)Br"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (1S)-2-amino-1-[(4R)-1-methylazepan-4-yl]ethanol?\nAnswer (numerical number):",
  "answer": [
   "172.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H18O2?\nAnswer (numerical number):",
  "answer": [
   "170.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H10O?\nAnswer:",
  "answer": [
   "(2Z,7Z)-5-methylcycloocta-2,4,7-trien-1-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H18N2O2?\nAnswer (numerical number):",
  "answer": [
   "174.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1=C(C=C(OSOC1=O)O)O?\nAnswer (numerical number):",
  "answer": [
   15
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCCCCCCOC(=O)C(CO)O?\nAnswer:",
  "answer": [
   "C11H22O4"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H17ClN2O?\nAnswer (numerical number):",
  "answer": [
   30
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H18O2S?\nAnswer (numerical number):",
  "answer": [
   30
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H13NO?\nAnswer (numerical number):",
  "answer": [
   "151.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H17ClO2?\nAnswer:",
  "answer": [
   "4-(chloromethyl)-2-ethyl-2-propyl-1,3-dioxolane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-[5-(1-aminopropan-2-yl)pyrazol-1-yl]ethanol?\nAnswer (numerical number):",
  "answer": [
   "169.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 4-methoxy-3-methyloxane?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of ethyl (2E)-2-chloro-2-hydrazinylideneacetate?\nAnswer:",
  "answer": [
   "CCOC(=O)C(=NN)Cl"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1CCC(C1)(CI)O?\nAnswer (numerical number):",
  "answer": [
   "226.06"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H17N3?\nAnswer:",
  "answer": [
   "N'-[(E)-4-(propan-2-ylamino)but-3-en-2-yl]methanimidamide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCC(CC)(C1CCCOC1)O?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-ethyl-N-hex-1-yn-3-ylhexan-1-amine?\nAnswer (numerical number):",
  "answer": [
   "209.37"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C11H24O3?\nAnswer (numerical number):",
  "answer": [
   38
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of diazaphosphiridine?\nAnswer (numerical number):",
  "answer": [
   "62.011"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (3R)-3-methoxypentanal?\nAnswer (numerical number):",
  "answer": [
   "116.16"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C=CNC(CS)C=O?\nAnswer (numerical number):",
  "answer": [
   "131.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of morpholin-3-yl hydrogen carbonate?\nAnswer:",
  "answer": [
   "C5H9NO4"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in COC1=CC=CC2=C1CC2CO?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H13FO3?\nAnswer (numerical number):",
  "answer": [
   "176.19"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 4-methyl-1,2,3,4,5,6-hexahydroisoquinoline?\nAnswer (numerical number):",
  "answer": [
   "149.23"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in N-[2-[[(1S,2R)-2-cyanocyclopentyl]amino]ethyl]acetamide?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-(2-amino-2-ethylbutoxy)cyclopentan-1-ol?\nAnswer:",
  "answer": [
   "CCC(CC)(COC1CCCC1O)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC#CCCC(CC1CCCCO1)O?\nAnswer (numerical number):",
  "answer": [
   "196.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H13OPS2?\nAnswer (numerical number):",
  "answer": [
   "196.3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-(2-aminopyridin-3-yl)ethenol?\nAnswer:",
  "answer": [
   "C7H8N2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1COCCN1SCP(=O)(O)O?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1=CC=CC=C1OCCN=N\nAnswer:",
  "answer": [
   "2-(2-methylphenoxy)ethyldiazene"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 5-(chloromethyl)-1-methyl-4,5-dihydroimidazole;hydrochloride?\nAnswer (numerical number):",
  "answer": [
   "169.05"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (3R,4R)-3-ethoxy-4-iodocycloheptene?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 4-(2-oxoethoxy)but-2-ynoic acid?\nAnswer:",
  "answer": [
   "C(C=O)OCC#CC(=O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCCCCCCCCC1CCN(C1)C\nAnswer:",
  "answer": [
   "3-decyl-1-methylpyrrolidine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1CCC(C(CC1)OCCN)O?\nAnswer (numerical number):",
  "answer": [
   "173.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1(CC1)CNCCCC(=O)NC\nAnswer:",
  "answer": [
   "N-methyl-4-[(1-methylcyclopropyl)methylamino]butanamide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C3H5NO2S?\nAnswer:",
  "answer": [
   "(3Z)-3-sulfinoiminoprop-1-ene"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C(CN)C(CC(C(=O)O)N)O?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 4-[(3-ethylsulfanylpropylamino)methyl]cyclohexan-1-ol?\nAnswer (numerical number):",
  "answer": [
   "231.40"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in N-methyl-N-pent-3-ynylpiperidin-4-amine?\nAnswer (numerical number):",
  "answer": [
   33
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C11H16OS?\nAnswer:",
  "answer": [
   "CCSC1C=CCCC1C(=O)C=C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1C(CC(=O)O1)I\nAnswer:",
  "answer": [
   "(4S,5S)-4-iodo-5-methyloxolan-2-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CN(C)CCC1CNC(=O)CC1N\nAnswer:",
  "answer": [
   "(4R,5R)-4-amino-5-[2-(dimethylamino)ethyl]piperidin-2-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-pyridin-4-yl-1,2,4-thiadiazole?\nAnswer (numerical number):",
  "answer": [
   16
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C4H14N4?\nAnswer (numerical number):",
  "answer": [
   "118.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCCCCCCCCCCOOOCC?\nAnswer (numerical number):",
  "answer": [
   44
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1=C(OCC(=C)N1)C\nAnswer:",
  "answer": [
   "5,6-dimethyl-3-methylidene-4H-1,4-oxazine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H19NO2?\nAnswer (numerical number):",
  "answer": [
   "173.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of COCC(CCl)NCC1=CC=CS1?\nAnswer:",
  "answer": [
   "C9H14ClNOS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 5-[(1R)-1-[(3S)-pyrrolidin-3-yl]ethyl]-1,3-thiazole?\nAnswer (numerical number):",
  "answer": [
   "182.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(C)C(=CNC(=O)C)C=C\nAnswer:",
  "answer": [
   "N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]acetamide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H21NO2?\nAnswer (numerical number):",
  "answer": [
   "187.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(C)CCN=CC(C)C?\nAnswer:",
  "answer": [
   "C9H19N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2,8-dimethyl-5,6,7,8-tetrahydro-4H-[1,3]thiazolo[4,5-d]azepine?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in N,N-dimethylmethanamine;undecane?\nAnswer (numerical number):",
  "answer": [
   48
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in COCCCCNCC1CCCC(C1)Cl?\nAnswer (numerical number):",
  "answer": [
   39
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C7H16O2?\nAnswer:",
  "answer": [
   "CCCCC(C(C)O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1CC(CCN1)C2=CC=CS2?\nAnswer:",
  "answer": [
   "C10H15NS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-(bromomethyl)-5-butoxy-3-methylpent-1-ene?\nAnswer (numerical number):",
  "answer": [
   34
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(C)C1(CCC(C1)Cl)C?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 8,8-bis(sulfanyl)nonanoic acid?\nAnswer (numerical number):",
  "answer": [
   "222.4"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC=CC=CC1=CC=CC=N1\nAnswer:",
  "answer": [
   "2-[(1Z,3Z)-penta-1,3-dienyl]pyridine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2,3-dihydropyrrolo[2,1-b][1,3]oxazol-7-ylmethanamine?\nAnswer:",
  "answer": [
   "C1COC2=C(C=CN21)CN"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C7H11NO2?\nAnswer (numerical number):",
  "answer": [
   "141.17"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCNS(=O)(=O)C?\nAnswer:",
  "answer": [
   "C4H11NO2S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H16N4O?\nAnswer (numerical number):",
  "answer": [
   "196.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H12O3?\nAnswer (numerical number):",
  "answer": [
   "168.19"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H18ClNO?\nAnswer:",
  "answer": [
   "CC(=CCl)CNCCCCOC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N,N-dimethylmethanamine;N,N-dimethylpentan-1-amine?\nAnswer:",
  "answer": [
   "C10H26N2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (4R)-4-ethyl-2,2-dimethylcyclopentan-1-one?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCC(C#C)NC(C)(C)CN\nAnswer:",
  "answer": [
   "2-N-hex-1-yn-3-yl-2-methylpropane-1,2-diamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C7H13N3?\nAnswer (numerical number):",
  "answer": [
   "139.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H21N?\nAnswer:",
  "answer": [
   "(2R,3R)-3-cyclopropyl-2-(2-methylpropyl)pyrrolidine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(C)C(CCN)C1CCOCC1?\nAnswer (numerical number):",
  "answer": [
   36
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C1CCNC(C1)C2CCCSC2\nAnswer:",
  "answer": [
   "(2S)-2-[(3S)-thian-3-yl]piperidine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCCCC=CC(CC=C)O?\nAnswer (numerical number):",
  "answer": [
   "168.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCC(C#C)NC1CCC(CC1)O\nAnswer:",
  "answer": [
   "4-(pent-1-yn-3-ylamino)cyclohexan-1-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-iodo-4-methylcyclohex-2-en-1-one?\nAnswer (numerical number):",
  "answer": [
   "236.05"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C7H11N3OS?\nAnswer:",
  "answer": [
   "CC1=NSN=C1C2CNCCO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-(chloromethyl)-N-propylcyclopentan-1-amine?\nAnswer:",
  "answer": [
   "CCCNC1CCCC1CCl"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(=N)COOOC\nAnswer:",
  "answer": [
   "1-methoxyperoxypropan-2-imine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 1,2,4-oxadiazol-3-yl(thiolan-3-yl)methanamine?\nAnswer:",
  "answer": [
   "C1CSCC1C(C2=NOC=N2)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-ethyl-3-ethylperoxydecane?\nAnswer (numerical number):",
  "answer": [
   46
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H23N3?\nAnswer (numerical number):",
  "answer": [
   36
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(COC)CON?\nAnswer (numerical number):",
  "answer": [
   21
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H20O3?\nAnswer (numerical number):",
  "answer": [
   "176.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 7-methyl-5-methylidene-3,3a,4,6,7,7a-hexahydro-2H-1-benzofuran?\nAnswer:",
  "answer": [
   "C10H16O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C12H23NO?\nAnswer (numerical number):",
  "answer": [
   37
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H18O3?\nAnswer:",
  "answer": [
   "3-(hydroxymethyl)heptane-1,4-diol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in methyl 2-(methylamino)-4,5-dihydro-1,3-thiazole-5-carboxylate?\nAnswer (numerical number):",
  "answer": [
   21
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-[2-(methylamino)ethyl]-4,5-dihydro-1,3-oxazole-4-carboxylic acid?\nAnswer (numerical number):",
  "answer": [
   "172.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-(2-aminoethoxy)-1-(oxan-3-yl)ethanone?\nAnswer:",
  "answer": [
   "C9H17NO3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(C)COCCNC1CCCC1CCl?\nAnswer (numerical number):",
  "answer": [
   39
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H22O4?\nAnswer:",
  "answer": [
   "2,2-diethoxyethyl pentanoate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCOC(C)CNC1CCC(CC1)O?\nAnswer (numerical number):",
  "answer": [
   37
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of imidazo[1,2-d][1,2,4]oxadiazole-5-carbaldehyde?\nAnswer (numerical number):",
  "answer": [
   "137.10"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCCC(C)(C)CS(=O)O?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(C1(CCCC1)CN)(F)F?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-methyl-1,4-dihydropyrimidin-4-amine?\nAnswer:",
  "answer": [
   "C5H9N3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCCC(CC)NC1CC(=O)NC1?\nAnswer (numerical number):",
  "answer": [
   33
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H18N2O2?\nAnswer:",
  "answer": [
   "2-N-(1,3-dioxan-2-ylmethyl)propane-1,2-diamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C12H25NO?\nAnswer:",
  "answer": [
   "CCCC(C)OCCC1CCCCN1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of pentan-2-yl 2-(methylamino)butanoate?\nAnswer:",
  "answer": [
   "CCCC(C)OC(=O)C(CC)NC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H24O?\nAnswer (numerical number):",
  "answer": [
   "172.31"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H18N2?\nAnswer:",
  "answer": [
   "(1S,2S)-2-(propylamino)cyclohexane-1-carbonitrile"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCC(C#C)NC1=NCCC1?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H17NO2?\nAnswer:",
  "answer": [
   "5-(azetidin-3-yloxy)pentan-1-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H15Cl?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C=C(C=O)N(CC=O)NN\nAnswer:",
  "answer": [
   "2-[hydrazinyl(2-oxoethyl)amino]prop-2-enal"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H24N2O2?\nAnswer (numerical number):",
  "answer": [
   37
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(=O)COCC(=O)N(C)C?\nAnswer:",
  "answer": [
   "C7H13NO3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N,N-dimethylpenta-1,4-dien-3-amine?\nAnswer:",
  "answer": [
   "C7H13N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H14N4?\nAnswer:",
  "answer": [
   "3-(5-ethyl-1,2,4-triazin-3-yl)propan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C4H6BrNO3?\nAnswer (numerical number):",
  "answer": [
   "196.00"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C6H7F3O3?\nAnswer:",
  "answer": [
   "2,2,2-trifluoroethyl 2-ethenoxyacetate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 4-cyclopropyl-1H-pyridazin-6-one?\nAnswer:",
  "answer": [
   "C7H8N2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H14N2?\nAnswer (numerical number):",
  "answer": [
   "150.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(C(C)O)C(C(=O)OC)O?\nAnswer (numerical number):",
  "answer": [
   "162.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C11H25N?\nAnswer (numerical number):",
  "answer": [
   37
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 4-N-pent-1-yn-3-ylcyclohexane-1,4-diamine?\nAnswer (numerical number):",
  "answer": [
   "180.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (2S)-2-[[(2R)-1-methylpiperidin-2-yl]methylamino]propanenitrile?\nAnswer (numerical number):",
  "answer": [
   "181.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (3R)-1,3-dichlorobutan-2-one?\nAnswer:",
  "answer": [
   "C4H6Cl2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1C(=O)N(CO1)CC(=O)O?\nAnswer (numerical number):",
  "answer": [
   17
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2,2-dimethylpropoxymethylcyclohexane?\nAnswer:",
  "answer": [
   "CC(C)(C)COCC1CCCCC1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (3-bromopyrazin-2-yl) hypochlorite?\nAnswer (numerical number):",
  "answer": [
   11
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of chloro 2-(chloromethylidene)pentanoate?\nAnswer:",
  "answer": [
   "C6H8Cl2O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N,N,3-trimethylpent-4-en-1-amine?\nAnswer:",
  "answer": [
   "C8H17N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(=NO)C(=O)C1CCCCC1?\nAnswer:",
  "answer": [
   "C9H15NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-(aminomethyl)-N-(2-methoxypropyl)cyclohexan-1-amine?\nAnswer:",
  "answer": [
   "C11H24N2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C4H6Si2?\nAnswer (numerical number):",
  "answer": [
   "110.26"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H21NO?\nAnswer (numerical number):",
  "answer": [
   "183.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(C#C)NC(CN)C1CCSC1?\nAnswer:",
  "answer": [
   "C10H18N2S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC#CCCC(C1=CSC=N1)O?\nAnswer:",
  "answer": [
   "C9H11NOS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H19NO4?\nAnswer (numerical number):",
  "answer": [
   33
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of methyl 5-ethyl-1,2,3,6-tetrahydropyridine-4-carboxylate?\nAnswer:",
  "answer": [
   "C9H15NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 5-fluoro-1-methyl-3-methylidene-2H-pyridin-6-one?\nAnswer (numerical number):",
  "answer": [
   18
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCC(C)OCCNC1CC1\nAnswer:",
  "answer": [
   "N-(2-pentan-2-yloxyethyl)cyclopropanamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-ethyl-3-methylcyclohexane-1,2-dione?\nAnswer:",
  "answer": [
   "C9H14O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C7H17NO4?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC1CN(C(=C)C1C)C?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1=CC=C(NC=C1)OC=O?\nAnswer (numerical number):",
  "answer": [
   "137.14"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCC(C)(CC)OC=S?\nAnswer:",
  "answer": [
   "C7H14OS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in benzene;2,3-dihydrothiophene?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCC(CC(=O)CCCl)Cl?\nAnswer (numerical number):",
  "answer": [
   "183.07"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC1=CCC1.S?\nAnswer (numerical number):",
  "answer": [
   "102.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCN(CC)CC1CCCN1CCN\nAnswer:",
  "answer": [
   "2-[2-(diethylaminomethyl)pyrrolidin-1-yl]ethanamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H13NO3?\nAnswer (numerical number):",
  "answer": [
   "171.19"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C7H14N2O2?\nAnswer (numerical number):",
  "answer": [
   "158.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-methyl-2,6-diazaspiro[4.5]decan-1-one?\nAnswer (numerical number):",
  "answer": [
   "168.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-[(dimethylamino)methyl]-4-methyl-1,2-oxazol-5-amine?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-ethyl-3-imino-N-(methylideneamino)propan-1-amine?\nAnswer:",
  "answer": [
   "CCN(CCC=N)N=C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of COCC1CCCC(C1)CCO?\nAnswer (numerical number):",
  "answer": [
   "172.26"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H19N3O?\nAnswer:",
  "answer": [
   "2-butylpiperazine-2-carboxamide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C12H27N3?\nAnswer:",
  "answer": [
   "2-[1-(2-aminoethyl)pyrrolidin-2-yl]-N,N-diethylethanamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 4-methyl-1,5-dihydroimidazole-2-thione?\nAnswer:",
  "answer": [
   "C4H6N2S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (E)-1-iodo-4,4-dimethoxy-2-methylbut-1-ene?\nAnswer:",
  "answer": [
   "C7H13IO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCC1CN2CCC1CC2CN?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C6H8N2O?\nAnswer:",
  "answer": [
   "C1CC(C(=NO)C1)C#N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C7H14N4?\nAnswer (numerical number):",
  "answer": [
   "154.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-[(1E,4E)-1-amino-5-aminooxyhexa-1,4-dien-3-ylidene]methanimidamide?\nAnswer:",
  "answer": [
   "CC(=CC(=NC=N)C=CN)ON"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C10H19NO2?\nAnswer:",
  "answer": [
   "C1CNCC(OC1)C2CCOCC2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC1(CCNCCC1F)C(=O)O?\nAnswer (numerical number):",
  "answer": [
   "175.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C(CCOP(=O)(O)O)CCS?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H23NOS?\nAnswer (numerical number):",
  "answer": [
   "217.37"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-(2,2-dimethylhydrazinyl)-2-methylpropanenitrile?\nAnswer:",
  "answer": [
   "C6H13N3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-methyl-4-[(3R)-piperidin-3-yl]-1,2,5-thiadiazole?\nAnswer:",
  "answer": [
   "CC1=NSN=C1C2CCCNC2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-amino-2-(1-fluoroethyl)pentanoic acid?\nAnswer (numerical number):",
  "answer": [
   "163.19"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H16O3?\nAnswer:",
  "answer": [
   "CCC(=O)C.CC(=O)C.C=O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-(1,4-dithian-2-yl)hex-4-yn-1-ol?\nAnswer:",
  "answer": [
   "C10H16OS2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC#CCCNC(C)C1CCCCC1?\nAnswer (numerical number):",
  "answer": [
   "193.33"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H14?\nAnswer (numerical number):",
  "answer": [
   22
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C11H18O?\nAnswer:",
  "answer": [
   "CCC=CC1C2(O1)CCCCC2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(C)CC(=O)N1CCCCC1O?\nAnswer:",
  "answer": [
   "C10H19NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in N-ethyl-2-[(3-methylimidazol-4-yl)methoxy]ethanamine?\nAnswer (numerical number):",
  "answer": [
   30
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-fluoro-2-methylbutanal?\nAnswer:",
  "answer": [
   "CCC(C)(C=O)F"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (2R)-N-(2-methylpropyl)morpholine-2-carboxamide?\nAnswer:",
  "answer": [
   "CC(C)CNC(=O)C1CNCCO1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C7H8INO?\nAnswer:",
  "answer": [
   "N-cyclopenta-2,4-dien-1-yl-2-iodoacetamide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCCCCC1=NC(=NC=C1)SC?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(C)CCCC(C)C(C)C=O\nAnswer:",
  "answer": [
   "(2S,3S)-2,3,7-trimethyloctanal"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-methyl-N-(pyrrolidin-2-ylmethyl)-1-(thiolan-3-yl)methanamine?\nAnswer (numerical number):",
  "answer": [
   "214.37"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-ethoxy-4-propan-2-yloxybutane-1,3-diol?\nAnswer (numerical number):",
  "answer": [
   "192.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCCCC#CCC#CC=CCBr?\nAnswer:",
  "answer": [
   "C13H17Br"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(CC1CCCSC1)C(=O)O?\nAnswer (numerical number):",
  "answer": [
   "188.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-aminobutanamide?\nAnswer (numerical number):",
  "answer": [
   17
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of COC1=C2C=CC=C2C=CO1\nAnswer:",
  "answer": [
   "1-methoxycyclopenta[c]pyran"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C5H11FN2O?\nAnswer (numerical number):",
  "answer": [
   20
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H8ClNS?\nAnswer (numerical number):",
  "answer": [
   "161.65"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C(CO)C(CO)C(CCO)CO\nAnswer:",
  "answer": [
   "(4R)-3,4-bis(hydroxymethyl)hexane-1,6-diol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (3S,4S)-4-butyl-3-ethyloxetan-2-one?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C4H7NO3S?\nAnswer (numerical number):",
  "answer": [
   16
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CNC1CCCCC1OCCO?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-(hydroxyamino)-4,5-dihydro-1H-pyrimidin-6-one?\nAnswer (numerical number):",
  "answer": [
   16
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C7H17NO2?\nAnswer:",
  "answer": [
   "N-[2-(methoxymethoxy)ethyl]propan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (E,3R)-3,7-dimethylnon-6-en-1-yn-3-ol?\nAnswer:",
  "answer": [
   "C11H18O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C7H14OS?\nAnswer:",
  "answer": [
   "CCC(C(C)C)OC=S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC=CC(CC(=O)O)(S)S?\nAnswer:",
  "answer": [
   "C6H10O2S2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C12H24?\nAnswer:",
  "answer": [
   "CC1CCC(CCC1(C)C)(C)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCC.C1CCC2(C1)CCCNC2?\nAnswer (numerical number):",
  "answer": [
   "183.33"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H21NO3?\nAnswer:",
  "answer": [
   "butyl 2-[2-(ethylamino)ethoxy]acetate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-methyl-1-(3-methylfuran-2-yl)prop-2-yn-1-amine?\nAnswer (numerical number):",
  "answer": [
   "149.19"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H16N2?\nAnswer:",
  "answer": [
   "CNC1CCCCCC1C#N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCOC(=O)C(=NC)N?\nAnswer (numerical number):",
  "answer": [
   "130.15"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 1-(2-methylbut-1-enoxy)nonane?\nAnswer (numerical number):",
  "answer": [
   43
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 4-hex-1-yn-3-yl-1H-1,2,4-triazol-5-one?\nAnswer:",
  "answer": [
   "C8H11N3O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H18N2O?\nAnswer:",
  "answer": [
   "CCCC(CCC#CN)C(N)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-(cyclopropylamino)-N-(2-methoxypropyl)acetamide?\nAnswer:",
  "answer": [
   "C9H18N2O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H16O2?\nAnswer (numerical number):",
  "answer": [
   "168.23"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C7H14N2O?\nAnswer:",
  "answer": [
   "(5aR,8aR)-2,3,4,5,5a,6,8,8a-octahydro-1H-furo[3,4-b][1,4]diazepine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (4R)-4-amino-4-methyl-1,2-oxazolidin-3-one?\nAnswer (numerical number):",
  "answer": [
   "116.12"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2,10-diazaspiro[4.6]undecan-1-one?\nAnswer:",
  "answer": [
   "C9H16N2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (2R,6S)-4-chloro-2,6-dipropyloxane?\nAnswer:",
  "answer": [
   "C11H21ClO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCN(CC)CCC(CCC#CC)NC\nAnswer:",
  "answer": [
   "1-N,1-N-diethyl-3-N-methyloct-6-yne-1,3-diamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1CCCCC1(C)N\nAnswer:",
  "answer": [
   "(1S,2R)-1,2-dimethylcyclohexan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-(1-fluoroethyl)thietane-3-carboxylic acid?\nAnswer:",
  "answer": [
   "CC(C1(CSC1)C(=O)O)F"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(=O)N(C)P(C)OC?\nAnswer (numerical number):",
  "answer": [
   "149.13"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC1=NN(C=C1Cl)CC(C)N?\nAnswer (numerical number):",
  "answer": [
   "173.64"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in [2-(pent-4-ynylamino)cyclopentyl]methanol?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (3R,5R)-3-methyl-5-thiophen-2-ylpiperidine?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C5H10N2O2S?\nAnswer (numerical number):",
  "answer": [
   "162.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-(ethylaminomethyl)benzaldehyde?\nAnswer:",
  "answer": [
   "C10H13NO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-N,2-N,1-trimethylpyrrolidine-2,3-diamine?\nAnswer:",
  "answer": [
   "C7H17N3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-sulfanylidene-2H-1,2,4-triazin-5-one?\nAnswer (numerical number):",
  "answer": [
   11
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C12H24ClNO?\nAnswer:",
  "answer": [
   "2-(chloromethyl)-N-(2-propoxyethyl)cyclohexan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H18N2O2?\nAnswer (numerical number):",
  "answer": [
   "186.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCC1CC(OC1OC)OC?\nAnswer (numerical number):",
  "answer": [
   "160.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC1=CC(=CC=C1)CC(C)I?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (E)-N-ethyl-2-phenylethenamine?\nAnswer:",
  "answer": [
   "C10H13N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-[2-(2-formamidoethylamino)ethyl]acetamide?\nAnswer:",
  "answer": [
   "CC(=O)NCCNCCNC=O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-methyl-N-[(2S)-pentan-2-yl]azetidin-3-amine?\nAnswer (numerical number):",
  "answer": [
   "156.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1=CNC(=O)C(=C1N)O?\nAnswer:",
  "answer": [
   "C5H6N2O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCC1(CN=C(SC1)NCC)CC?\nAnswer (numerical number):",
  "answer": [
   33
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1COC(C(C1F)O)CO?\nAnswer:",
  "answer": [
   "C7H13FO3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H19ClO?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C7H15NO?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C11H23NO2?\nAnswer:",
  "answer": [
   "C1CC(C1)N(CCCCO)CCCO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-[(2Z,4E)-hexa-2,4-dien-2-yl]ethanimine?\nAnswer:",
  "answer": [
   "C8H13N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(C=CC=CC#CC#CC#C)O?\nAnswer (numerical number):",
  "answer": [
   "170.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(C)C(CCN)C1=NC=NS1?\nAnswer:",
  "answer": [
   "C8H15N3S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 4-ethylfuran-3-one?\nAnswer (numerical number):",
  "answer": [
   "112.13"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C7H15NO2?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-(4-methoxypyrrolidin-3-yl)propanoic acid?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H21NO?\nAnswer:",
  "answer": [
   "3-methyl-3-(pent-1-yn-3-ylamino)pentan-1-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C11H21NO?\nAnswer (numerical number):",
  "answer": [
   34
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-[2-[(dimethylamino)methyl]piperidin-1-yl]-N-methylethanamine?\nAnswer:",
  "answer": [
   "C11H25N3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C7H15NO2?\nAnswer:",
  "answer": [
   "CCCCC(=O)NOCC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N'-[1-[methyl(methylamino)amino]propyl]methanimidamide?\nAnswer (numerical number):",
  "answer": [
   "144.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C7H15F2NO?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCN1C(=C2CNCC2=N1)CO?\nAnswer:",
  "answer": [
   "C8H13N3O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H14O4?\nAnswer:",
  "answer": [
   "(3-methoxy-3-oxopropyl) butanoate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C12H22O2?\nAnswer (numerical number):",
  "answer": [
   36
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H18ClNO2?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C6H12N4O2?\nAnswer:",
  "answer": [
   "CNC1=C(NOCN(C1=O)C)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCNCC(C)(CC(C)C)C=C?\nAnswer (numerical number):",
  "answer": [
   "169.31"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C7H9ClN2?\nAnswer:",
  "answer": [
   "(1S)-1-(2-chloropyridin-3-yl)ethanamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-methyl-1-(oxan-3-yl)azetidin-3-ol?\nAnswer:",
  "answer": [
   "CC1(CN(C1)C2CCCOC2)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C6H11NO2?\nAnswer (numerical number):",
  "answer": [
   20
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCOC(CO)C(CC=O)O?\nAnswer:",
  "answer": [
   "C8H16O4"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H14N2O?\nAnswer:",
  "answer": [
   "CC(=CCN1CCNC1=O)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (5R)-5-hydroxy-6-methylhept-1-en-3-one?\nAnswer:",
  "answer": [
   "CC(C)C(CC(=O)C=C)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CN=C(NC=O)SC?\nAnswer:",
  "answer": [
   "C4H8N2OS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C6H15N3O?\nAnswer:",
  "answer": [
   "C(CC(CC(=O)N)N)CN"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCN(C)C(N(C)C)O\nAnswer:",
  "answer": [
   "dimethylamino-[methyl(propyl)amino]methanol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCCCCCCCC(CC)OOOOCC?\nAnswer:",
  "answer": [
   "C14H30O4"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 4-[(3-methylimidazol-4-yl)methoxy]piperidine?\nAnswer:",
  "answer": [
   "CN1C=NC=C1COC2CCNCC2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C5H11NO4?\nAnswer:",
  "answer": [
   "(2S,3R,4S,5S)-4-aminooxane-2,3,5-triol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-ethyl-2-methylsulfanylcyclohexane?\nAnswer:",
  "answer": [
   "C9H18S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C5H11NO2?\nAnswer:",
  "answer": [
   "O-(cyclopropylmethoxymethyl)hydroxylamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-chloro-N-(5-oxopyrrolidin-3-yl)acetamide?\nAnswer:",
  "answer": [
   "C1C(CNC1=O)NC(=O)CCl"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (1R)-1-hydroperoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene?\nAnswer (numerical number):",
  "answer": [
   30
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H11NO?\nAnswer (numerical number):",
  "answer": [
   "137.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C10H12O?\nAnswer:",
  "answer": [
   "CC1CCC2=C1C=CC=C2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (E)-1-chloro-1,1-difluoronon-2-en-4-yne?\nAnswer:",
  "answer": [
   "CCCCC#CC=CC(F)(F)Cl"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H12O?\nAnswer (numerical number):",
  "answer": [
   "148.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H10N2O?\nAnswer (numerical number):",
  "answer": [
   "150.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1CC(CS1)NCC(C)OC?\nAnswer:",
  "answer": [
   "C9H19NOS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCCCCCC(C)NCC=C(C)C?\nAnswer:",
  "answer": [
   "C14H29N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-methyl-4-propan-2-ylcyclohexan-1-one?\nAnswer:",
  "answer": [
   "CC1CC(=O)CCC1C(C)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 1-cyclopentyl-5-fluoropentan-1-ol?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 5-N-pent-4-ynyl-1,2,4-thiadiazole-3,5-diamine?\nAnswer:",
  "answer": [
   "C#CCCCNC1=NC(=NS1)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1-[2-(1,2-thiazol-5-yl)ethyl]cyclopropan-1-amine?\nAnswer (numerical number):",
  "answer": [
   "168.26"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC#CCCOCC1CCCNC1?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of [1-(hydrazinylmethyl)cycloheptyl]methanol?\nAnswer (numerical number):",
  "answer": [
   "172.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-[azocan-4-yl(methyl)amino]propane-1-thiol?\nAnswer:",
  "answer": [
   "CN(CCCS)C1CCCCNCC1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H3ClN2?\nAnswer (numerical number):",
  "answer": [
   "138.55"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1C(C1C(C)C2CC2)C\nAnswer:",
  "answer": [
   "1-(1-cyclopropylethyl)-2,3-dimethylcyclopropane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H19NOS?\nAnswer:",
  "answer": [
   "CCC(CO)NCC1CCSC1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-[4-(1-aminopropyl)triazol-1-yl]ethanol?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-ethyl-3-methoxypiperidine-3-carbaldehyde?\nAnswer:",
  "answer": [
   "C9H17NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C7H13ClO2?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3H-dioxepine-4-carboxylic acid?\nAnswer:",
  "answer": [
   "C1C(=CC=COO1)C(=O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H21NO?\nAnswer (numerical number):",
  "answer": [
   "171.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 1-(2-aminocyclopentyl)oxypropan-2-ol?\nAnswer (numerical number):",
  "answer": [
   28
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2,4-diethyl-3-fluoro-1H-pyrazol-5-one?\nAnswer:",
  "answer": [
   "CCC1=C(N(NC1=O)CC)F"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-(4-fluorooxan-4-yl)-2-methylpropan-1-amine?\nAnswer:",
  "answer": [
   "C9H18FNO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCC(CNCC=C)C(=O)N?\nAnswer:",
  "answer": [
   "C8H16N2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1(CNCC1C(=O)O)C?\nAnswer:",
  "answer": [
   "C7H13NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H14N2S?\nAnswer:",
  "answer": [
   "3-methyl-4-[(3R)-piperidin-3-yl]-1,2-thiazole"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (1S,2S)-N-methyl-2-(4-methylpiperidin-1-yl)cyclopentan-1-amine?\nAnswer (numerical number):",
  "answer": [
   "196.33"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 1-(1,3-thiazol-5-yl)ethanol?\nAnswer:",
  "answer": [
   "CC(C1=CN=CS1)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C=CC1CCC(C(C1)O)N?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCOC(C(CCC#CC)NC)OCC?\nAnswer (numerical number):",
  "answer": [
   "213.32"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1CC(C(C1)NCCCF)CO?\nAnswer:",
  "answer": [
   "C9H18FNO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H19NO?\nAnswer:",
  "answer": [
   "CC(C)CC(C(C1CC1)O)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CN(C)C(C=O)N1C=CN=C1?\nAnswer (numerical number):",
  "answer": [
   "153.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCC(C#C)NCCOCCC(C)C?\nAnswer (numerical number):",
  "answer": [
   "211.34"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H20O?\nAnswer (numerical number):",
  "answer": [
   "168.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C3H3ClN2S?\nAnswer:",
  "answer": [
   "CC1=C(SN=N1)Cl"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-[(3-chloro-2-methylprop-2-enyl)-ethylamino]ethanol?\nAnswer (numerical number):",
  "answer": [
   "177.67"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1C(CNC1=O)NC2COC2?\nAnswer:",
  "answer": [
   "C7H12N2O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H12?\nAnswer:",
  "answer": [
   "(2E,4E)-3-methylocta-2,4-dien-6-yne"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-[2-[(3-chloro-2-methylprop-2-enyl)amino]ethoxy]ethanol?\nAnswer (numerical number):",
  "answer": [
   28
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C2H6AsClO2?\nAnswer:",
  "answer": [
   "C=C[AsH](O)(O)Cl"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-[3-(2-methoxyethoxy)propylamino]-3-methylpentan-1-ol?\nAnswer:",
  "answer": [
   "CCC(C)(CCO)NCCCOCCOC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H10O2?\nAnswer (numerical number):",
  "answer": [
   "114.14"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCC(C)(CCO)N1CCCC1C?\nAnswer:",
  "answer": [
   "C11H23NO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C6H8O3S?\nAnswer (numerical number):",
  "answer": [
   18
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-ethyl-3-hydroxy-2-propylhexanenitrile?\nAnswer:",
  "answer": [
   "CCCC(C#N)C(CC)(CCC)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-(2-butoxyethyl)hex-1-yn-3-amine?\nAnswer:",
  "answer": [
   "C12H23NO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H13N3S?\nAnswer:",
  "answer": [
   "CC1=C(SN=C1N)NC2CCC2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C7H10N2O?\nAnswer (numerical number):",
  "answer": [
   "138.17"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (2S,4S)-4-cyclohexyl-2-methylpiperidine?\nAnswer:",
  "answer": [
   "CC1CC(CCN1)C2CCCCC2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H12O2?\nAnswer:",
  "answer": [
   "CC1(CC1C(=O)O)C2CC2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CN1CCCC1CC2CCCNC2?\nAnswer (numerical number):",
  "answer": [
   35
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1C(CCO1)S(=O)CCCOC\nAnswer:",
  "answer": [
   "(2R,3S)-3-[(S)-3-methoxypropylsulfinyl]-2-methyloxolane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1CCSC(C1)CNCC2CCSC2?\nAnswer (numerical number):",
  "answer": [
   "231.4"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-methyl-1,2-dihydro-1,3,2-diazaborole?\nAnswer:",
  "answer": [
   "C3H7BN2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-[[(2R)-morpholin-2-yl]methyl]cyclopropanamine?\nAnswer:",
  "answer": [
   "C8H16N2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CNCCOC1CCCCNC1=O?\nAnswer:",
  "answer": [
   "C9H18N2O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-ethyl-1-(3-methylfuran-2-yl)propan-1-amine?\nAnswer:",
  "answer": [
   "CCC(C1=C(C=CO1)C)NCC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(CC1=CN(N=N1)C)N?\nAnswer (numerical number):",
  "answer": [
   "140.19"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC#CCCNC1CCCC(C1C)C?\nAnswer (numerical number):",
  "answer": [
   "193.33"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1(CCN2C1O2)C\nAnswer:",
  "answer": [
   "4,4-dimethyl-6-oxa-1-azabicyclo[3.1.0]hexane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCC(C)CC(=NCCO)CC\nAnswer:",
  "answer": [
   "2-[[(5S)-5-methylheptan-3-ylidene]amino]ethanol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H16N2O?\nAnswer (numerical number):",
  "answer": [
   "168.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-(3-methyloxiran-2-yl)acetamide?\nAnswer:",
  "answer": [
   "CC1C(O1)NC(=O)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1CC2CCCN(C1)C2?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H16O?\nAnswer:",
  "answer": [
   "CCCCC1COC1C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (5S)-5-methyloct-6-en-3-ol?\nAnswer:",
  "answer": [
   "CCC(CC(C)C=CC)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1C(CN1)OCCN2C=CN=C2?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C12H23NO?\nAnswer (numerical number):",
  "answer": [
   37
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H13NO2?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(C)NCCOCOCC1CC1?\nAnswer (numerical number):",
  "answer": [
   "187.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C6H13NS2?\nAnswer (numerical number):",
  "answer": [
   22
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H14O2?\nAnswer:",
  "answer": [
   "CCC=CC(C=CC)OO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-(2,2-difluoro-3-hydroxypropyl)-2-(methylamino)acetamide?\nAnswer:",
  "answer": [
   "C6H12F2N2O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1C2=C(C=NC=C2)N=C1N?\nAnswer (numerical number):",
  "answer": [
   17
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (3-chloro-2-hydroxypropyl) hexanoate?\nAnswer:",
  "answer": [
   "CCCCCC(=O)OCC(CCl)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCC1CC2CCC2N1CC\nAnswer:",
  "answer": [
   "2,3-diethyl-2-azabicyclo[3.2.0]heptane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC#CCCN1CCCC1CNC?\nAnswer:",
  "answer": [
   "C11H20N2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-[(1-methylimidazol-2-yl)methoxy]piperidine?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1(C(CC1OC)N)C?\nAnswer:",
  "answer": [
   "C7H15NO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCSC=NNC?\nAnswer:",
  "answer": [
   "C4H10N2S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H14O5?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of methyl 3-fluoro-4-hydroxycyclopentane-1-carboxylate?\nAnswer:",
  "answer": [
   "C7H11FO3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H18O3?\nAnswer:",
  "answer": [
   "(3S)-3-[(3S)-oxan-3-yl]pentanoic acid"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (3S,6S,11S)-11-methyl-1,4-dioxaspiro[5.5]undecan-3-ol?\nAnswer:",
  "answer": [
   "C10H18O3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 1,2,4,5-tetrahydropyrrolo[2,3-c]pyrazole-3-carbaldehyde?\nAnswer:",
  "answer": [
   "C1CN=C2C1=C(NN2)C=O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC1CC(C(C(=C1)O)O)O?\nAnswer (numerical number):",
  "answer": [
   22
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(C)(C(CCN)C1CCC1)F?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCC(C)OCC(=C)C(=O)O\nAnswer:",
  "answer": [
   "2-(pentan-2-yloxymethyl)prop-2-enoic acid"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C5H10BrNOS?\nAnswer (numerical number):",
  "answer": [
   "212.11"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1CC2CCC=NC2=NC1?\nAnswer (numerical number):",
  "answer": [
   22
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C7H13N3O?\nAnswer:",
  "answer": [
   "(1R)-N,N-dimethyl-1-(1,2-oxazol-4-yl)ethane-1,2-diamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H7IS?\nAnswer (numerical number):",
  "answer": [
   "262.11"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC1CN(CC(O1)C)CS?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H18FNO?\nAnswer:",
  "answer": [
   "2-fluoro-2-(1-propan-2-ylpyrrolidin-3-yl)ethanol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCC1=C(CC(=O)C=N1)C\nAnswer:",
  "answer": [
   "6-ethyl-5-methyl-4H-pyridin-3-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in N-(2,4-dimethylpentan-3-yl)-1,3-dioxetan-2-amine?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of methyl 4-(thiolan-3-ylmethylamino)butanoate?\nAnswer:",
  "answer": [
   "C10H19NO2S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of COCC1=NOC(=C1)N.Cl?\nAnswer (numerical number):",
  "answer": [
   "164.59"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-(2-methoxyethyl)-N,2-dimethylbut-3-en-1-amine?\nAnswer (numerical number):",
  "answer": [
   30
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C7H14INO2?\nAnswer:",
  "answer": [
   "CC(C)(C(=O)NCCCO)I"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in [(2R)-1,4-difluorobutan-2-yl] hydrogen carbonate?\nAnswer (numerical number):",
  "answer": [
   18
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-(5-bromopyridin-3-yl)-N-methylethanamine?\nAnswer:",
  "answer": [
   "CNCCC1=CC(=CN=C1)Br"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C1C2CC3C2CC1C(C3)O\nAnswer:",
  "answer": [
   "(1S,5S,6R)-tricyclo[4.2.1.03,8]nonan-5-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1CC=CC=CC=CCCC=C1?\nAnswer (numerical number):",
  "answer": [
   "160.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 4-methyl-5-[[(2R)-pyrrolidin-2-yl]methyl]-1,3-thiazole?\nAnswer (numerical number):",
  "answer": [
   "182.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCCCCCC(CC=C)C=CC\nAnswer:",
  "answer": [
   "4-prop-1-enylundec-1-ene"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 6-oxa-2,4,7,8-tetrazabicyclo[3.2.1]octa-1(8),2,4-triene?\nAnswer:",
  "answer": [
   "C1=NC2=NC(=N1)ON2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1COC(CN1C=O)C(=O)O?\nAnswer (numerical number):",
  "answer": [
   20
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-(4-methylcyclohexyl)propane-1,3-diol?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H18ClN?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCN(CC)CC(CC(=O)O)N?\nAnswer:",
  "answer": [
   "C8H18N2O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H14FNS?\nAnswer (numerical number):",
  "answer": [
   "175.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC1=CC(=S)NN=C1?\nAnswer (numerical number):",
  "answer": [
   "126.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H15N?\nAnswer:",
  "answer": [
   "N-benzyl-N-methylprop-2-en-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-(oxan-2-yl)morpholine?\nAnswer:",
  "answer": [
   "C9H17NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(=O)C(CCC(=O)ON)N?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C[Se]CCCC(=O)O\nAnswer:",
  "answer": [
   "4-methylselanylbutanoic acid"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of ethane;isothiocyanatoethane?\nAnswer:",
  "answer": [
   "CC.CCN=C=S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC1=NOC=C1C2CNCCCO2?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H15NO2?\nAnswer:",
  "answer": [
   "5-(1,3-dioxolan-2-yl)-1-methyl-3,6-dihydro-2H-pyridine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H13NO2S?\nAnswer:",
  "answer": [
   "CSCC(=O)N1CCCC1C=O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (4S)-4-bromohexanamide?\nAnswer (numerical number):",
  "answer": [
   "194.07"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C11H23NO2?\nAnswer:",
  "answer": [
   "CC(C)NCCCCCCCC(=O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-fluoro-2-methyl-3-piperidin-4-ylpropan-1-amine?\nAnswer (numerical number):",
  "answer": [
   "174.26"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H14O4?\nAnswer:",
  "answer": [
   "ethyl 4-(ethoxymethoxy)but-2-ynoate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (E)-5-amino-2-propan-2-ylidenepent-4-enoic acid?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-bis(methylideneamino)phosphinimylmethanimine?\nAnswer:",
  "answer": [
   "C3H7N4P"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H19NO3?\nAnswer (numerical number):",
  "answer": [
   "177.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H24N2O2?\nAnswer (numerical number):",
  "answer": [
   38
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of S-ethyl N-(2-methylprop-2-enoyl)carbamothioate?\nAnswer:",
  "answer": [
   "C7H11NO2S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(=CC1CCSC1)CNC2CC2?\nAnswer:",
  "answer": [
   "C11H19NS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C6H9F3O?\nAnswer:",
  "answer": [
   "CC=CCC(C(F)(F)F)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-[(2R)-butan-2-yl]-N'-tert-butylethane-1,2-diamine?\nAnswer:",
  "answer": [
   "CCC(C)NCCNC(C)(C)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-(2-aminophenyl)sulfanylprop-1-ene-2-thiol?\nAnswer:",
  "answer": [
   "C9H11NS2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H7N?\nAnswer (numerical number):",
  "answer": [
   "117.15"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C5H9BrZn?\nAnswer (numerical number):",
  "answer": [
   "214.4"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (2R)-2-amino-2-cyanoacetamide?\nAnswer (numerical number):",
  "answer": [
   "99.09"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C12H21N?\nAnswer (numerical number):",
  "answer": [
   "179.30"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-ethenoxy-N-(thiolan-3-ylmethyl)propan-1-amine?\nAnswer:",
  "answer": [
   "C=COCCCNCC1CCSC1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1CCC(CC1)C(CNN)CO?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-methyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-amine?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (2S)-2-[[(3S)-thiolan-3-yl]amino]propanoic acid?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H15Br?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 5-ethyl-2-propan-2-yl-2,5-dihydro-1,3-thiazole?\nAnswer:",
  "answer": [
   "CCC1C=NC(S1)C(C)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H17NS?\nAnswer:",
  "answer": [
   "5-butyl-2-propan-2-yl-1,3-thiazole"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCCOC(C=CC)OCCCC\nAnswer:",
  "answer": [
   "1,1-dibutoxybut-2-ene"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H18N2O2?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H17NO2S?\nAnswer:",
  "answer": [
   "(1R,2S)-N-ethyl-2-methylsulfonylcyclopentan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of [(1E)-2,3-dimethylbuta-1,3-dienyl]cyclohexane?\nAnswer (numerical number):",
  "answer": [
   "164.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H23NO3?\nAnswer (numerical number):",
  "answer": [
   "217.31"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H15NO2?\nAnswer (numerical number):",
  "answer": [
   "157.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H19N3S?\nAnswer (numerical number):",
  "answer": [
   "213.35"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CN(CC1CCCCO1)C2CNC2?\nAnswer (numerical number):",
  "answer": [
   33
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C10H19Cl?\nAnswer:",
  "answer": [
   "CCCCC(C1CCCC1)Cl"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C7H13O3P?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 3-ethyl-2-methylhex-1-en-3-ol?\nAnswer (numerical number):",
  "answer": [
   "142.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCC(CC)C(CC)NCCC\nAnswer:",
  "answer": [
   "4-ethyl-N-propylheptan-3-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1CNCCOC1C2=NC=NS2?\nAnswer (numerical number):",
  "answer": [
   "185.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (Z)-2-ethylhept-2-en-1-ol?\nAnswer:",
  "answer": [
   "C9H18O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C5H8N4?\nAnswer (numerical number):",
  "answer": [
   17
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-methyl-3-(thiolan-3-ylmethylamino)butan-1-ol?\nAnswer (numerical number):",
  "answer": [
   "203.35"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H21N?\nAnswer:",
  "answer": [
   "3-ethyl-5-methylhexan-2-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 1-(3-ethoxyoxan-3-yl)-N-methylmethanamine?\nAnswer:",
  "answer": [
   "CCOC1(CCCOC1)CNC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 3-[(1-hydroxy-3-methylpentan-3-yl)amino]propane-1,2-diol?\nAnswer (numerical number):",
  "answer": [
   "191.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCOC(=O)C(C)NCCC(C)C?\nAnswer:",
  "answer": [
   "C10H21NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-methyl-1-propan-2-ylsulfonylpropane?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H17Cl2N?\nAnswer (numerical number):",
  "answer": [
   "210.14"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (5S)-5-(5-methyl-2H-triazol-4-yl)-1,4-oxazepane?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (3R,4S)-3,4-dimethylheptan-1-ol?\nAnswer:",
  "answer": [
   "CCCC(C)C(C)CCO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H20ClNO?\nAnswer (numerical number):",
  "answer": [
   "193.71"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (2R)-2-[(3-chloro-2-methylprop-2-enyl)amino]propanoic acid?\nAnswer:",
  "answer": [
   "CC(C(=O)O)NCC(=CCl)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-methyl-3-(oxan-3-yl)cyclopentan-1-amine?\nAnswer (numerical number):",
  "answer": [
   "183.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1CCCC(CC1)OCC(CN)O?\nAnswer:",
  "answer": [
   "C10H21NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CON1CCCN1\nAnswer:",
  "answer": [
   "1-methoxypyrazolidine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-methylpiperazin-2-one?\nAnswer:",
  "answer": [
   "C5H10N2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1COCC1(CC(F)F)CN?\nAnswer (numerical number):",
  "answer": [
   "165.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C5H6N2O2S2?\nAnswer:",
  "answer": [
   "2-(4-methylthiadiazol-5-yl)sulfanylacetic acid"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-(prop-2-ynylamino)butanoic acid?\nAnswer:",
  "answer": [
   "C7H11NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCOC(C)C(=O)C1CCCOC1?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-[(3-chloro-2-methylprop-2-enoxy)methyl]piperidine?\nAnswer:",
  "answer": [
   "CC(=CCl)COCC1CCCCN1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H17NO2?\nAnswer:",
  "answer": [
   "3-ethyl-1-hydroxyazocan-2-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (2Z)-2-(4-oxobutylidene)octanenitrile?\nAnswer:",
  "answer": [
   "CCCCCCC(=CCCC=O)C#N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 3-chloro-N-(3-iodopropyl)-2-methylprop-2-en-1-amine?\nAnswer (numerical number):",
  "answer": [
   "273.54"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 3-pentan-2-yloxypropanal?\nAnswer (numerical number):",
  "answer": [
   "144.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CNC1=C(C=CC(=C1)CN)N?\nAnswer (numerical number):",
  "answer": [
   "151.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C5H3IO2?\nAnswer (numerical number):",
  "answer": [
   11
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(CC(=O)O)C1CCCOCC1?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H14N4?\nAnswer (numerical number):",
  "answer": [
   "166.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H12O?\nAnswer:",
  "answer": [
   "tricyclo[3.2.1.02,4]octan-6-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-iodo-5-phosphanylphenol?\nAnswer (numerical number):",
  "answer": [
   "251.99"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N'-(3-chloro-2-methylprop-2-enyl)propane-1,3-diamine?\nAnswer (numerical number):",
  "answer": [
   "162.66"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (6-amino-6-oxohexyl) prop-2-enoate?\nAnswer:",
  "answer": [
   "C9H15NO3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C1=COOC2=NC2=C1\nAnswer:",
  "answer": [
   "2,3-dioxa-8-azabicyclo[5.1.0]octa-1(8),4,6-triene"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in [3-[2-aminoethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]methanol?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC1(CCNC1C2=CC=CS2)C?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2,5-dihydro-1,2-oxazole-5-carboxylic acid?\nAnswer:",
  "answer": [
   "C1=CNOC1C(=O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC=CC(=N)C?\nAnswer (numerical number):",
  "answer": [
   15
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (4R)-4-ethyl-4,5-dihydro-1,3-oxazole?\nAnswer:",
  "answer": [
   "C5H9NO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H22N4?\nAnswer (numerical number):",
  "answer": [
   36
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1CNCC(OC1)C2CCOCC2?\nAnswer (numerical number):",
  "answer": [
   "185.26"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H19BrN2O?\nAnswer:",
  "answer": [
   "2-bromo-N-[2-[ethyl(propyl)amino]ethyl]acetamide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCOCCOCCOCCOC(F)(F)F\nAnswer:",
  "answer": [
   "1-ethoxy-2-[2-[2-(trifluoromethoxy)ethoxy]ethoxy]ethane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H22ClNO?\nAnswer:",
  "answer": [
   "1-chloro-N-(cyclohexylmethyl)-3-methoxypropan-2-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C11H23NO3?\nAnswer:",
  "answer": [
   "CCOCC(COC1CCCCC1N)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C12H19N?\nAnswer:",
  "answer": [
   "C#CCCCNCCC1=CCCC1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C12H25NO3?\nAnswer:",
  "answer": [
   "CNC(CCOCCOC)C1CCCOC1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (E)-3,4-diaminohex-3-ene-2,5-diol?\nAnswer:",
  "answer": [
   "C6H14N2O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCSCC(CCC#CC)O?\nAnswer:",
  "answer": [
   "C10H18OS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1COCCC1C(C(=O)Cl)F?\nAnswer (numerical number):",
  "answer": [
   21
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H13NO3?\nAnswer (numerical number):",
  "answer": [
   "171.19"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C6H7N3S?\nAnswer:",
  "answer": [
   "(2-methylsulfanylpyridin-3-yl)diazene"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-ethoxyperoxyoctane?\nAnswer:",
  "answer": [
   "C10H22O3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H20BrNO?\nAnswer (numerical number):",
  "answer": [
   "250.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1=CC=C(C=C1)C=CCCF?\nAnswer:",
  "answer": [
   "C10H11F"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C5H10O4?\nAnswer:",
  "answer": [
   "C1C(CC(OC1O)O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CN1CCC(C1)CC(CN)(F)F\nAnswer:",
  "answer": [
   "2,2-difluoro-3-(1-methylpyrrolidin-3-yl)propan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C2H5ClO2?\nAnswer (numerical number):",
  "answer": [
   "96.51"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C3H3NO3?\nAnswer:",
  "answer": [
   "C(=O)C(=N)C(=O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-aminooxy-1-cycloheptylethanone?\nAnswer (numerical number):",
  "answer": [
   "171.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-methyl-1-pyridin-2-ylpropan-2-ol?\nAnswer (numerical number):",
  "answer": [
   "151.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of COC1=C(C=CC=C1Br)CF?\nAnswer:",
  "answer": [
   "C8H8BrFO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CN1CC(CC1C2CCCC2)CN\nAnswer:",
  "answer": [
   "[(3S,5R)-5-cyclopentyl-1-methylpyrrolidin-3-yl]methanamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-methylsulfonyl-N-prop-2-enylpropan-1-amine?\nAnswer (numerical number):",
  "answer": [
   "177.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H23NS?\nAnswer:",
  "answer": [
   "3-methyl-N-(thiolan-3-ylmethyl)pentan-2-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(=O)OCC=CCOCC=O?\nAnswer:",
  "answer": [
   "C8H12O4"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H21N3O?\nAnswer:",
  "answer": [
   "N-[2-[(1-ethylimidazol-2-yl)methoxy]ethyl]propan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCOC1(CCN(C1)C)CC=O\nAnswer:",
  "answer": [
   "2-(3-ethoxy-1-methylpyrrolidin-3-yl)acetaldehyde"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCNCC(=O)N1CCC(C1)C?\nAnswer:",
  "answer": [
   "C9H18N2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (3S)-2-(methylaminooxy)-5-methylsulfanylpent-1-en-3-amine?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 5-(methoxymethyl)-2-methylpyrazol-3-amine?\nAnswer (numerical number):",
  "answer": [
   "141.17"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (5-fluoro-2-methyl-1,2-dihydropyridin-3-yl)methanol?\nAnswer (numerical number):",
  "answer": [
   "143.16"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 4,5-dimethyl-5-prop-2-enylcyclopent-2-en-1-one?\nAnswer:",
  "answer": [
   "C10H14O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (4R)-4-ethylcyclohexa-1,5-dien-1-ol?\nAnswer:",
  "answer": [
   "C8H12O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in [(2R)-heptan-2-yl] N-prop-2-ynylcarbamate?\nAnswer (numerical number):",
  "answer": [
   33
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (Z)-N-(2-but-3-enoxyethyl)-3-chloro-2-methylprop-2-en-1-amine?\nAnswer:",
  "answer": [
   "CC(=CCl)CNCCOCCC=C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCNC(=O)OCC1=NC=CS1?\nAnswer:",
  "answer": [
   "C7H10N2O2S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CNCC(C1=CN=C(S1)OC)O\nAnswer:",
  "answer": [
   "(1R)-1-(2-methoxy-1,3-thiazol-5-yl)-2-(methylamino)ethanol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(CN)N1C(=O)COC1=O\nAnswer:",
  "answer": [
   "3-(1-aminopropan-2-yl)-1,3-oxazolidine-2,4-dione"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H11NO?\nAnswer:",
  "answer": [
   "CC(=O)C1=CC=CN1C2CC2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(=O)N1C=CC=CC1=NC\nAnswer:",
  "answer": [
   "1-(2-methyliminopyridin-1-yl)ethanone"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H17FN2?\nAnswer:",
  "answer": [
   "C1CC2CC(CCN2C1)(CN)F"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1,4,7-trioxacyclonona-2,5,8-triyne?\nAnswer (numerical number):",
  "answer": [
   "120.06"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC.C1CCNS(=O)(=O)CC1\nAnswer:",
  "answer": [
   "ethane;thiazepane 1,1-dioxide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2,5-dimethyl-1-prop-2-enylpiperazine?\nAnswer (numerical number):",
  "answer": [
   "154.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CN(C)CCNC1CCCC1C#N\nAnswer:",
  "answer": [
   "(1S,2R)-2-[2-(dimethylamino)ethylamino]cyclopentane-1-carbonitrile"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H21N?\nAnswer (numerical number):",
  "answer": [
   "167.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H11NOS?\nAnswer:",
  "answer": [
   "CC(=O)NC1=CC=CC=C1SC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCC1CC1NC(=O)C(F)F?\nAnswer (numerical number):",
  "answer": [
   "177.19"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-[2-[cyclopropyl(ethyl)amino]ethylamino]propanenitrile?\nAnswer:",
  "answer": [
   "C10H19N3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-but-2-ynyl-3-chloro-2-methylprop-2-en-1-amine?\nAnswer (numerical number):",
  "answer": [
   "157.64"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H18FN?\nAnswer:",
  "answer": [
   "2-(2-cyclopropyl-2-fluoroethyl)piperidine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H10O2S?\nAnswer (numerical number):",
  "answer": [
   21
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCC(C)CCC(C)C(=O)NC?\nAnswer (numerical number):",
  "answer": [
   "171.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C12H18O2?\nAnswer (numerical number):",
  "answer": [
   "194.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-(4-methylidenecyclohexyl)acetaldehyde?\nAnswer (numerical number):",
  "answer": [
   "138.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 4-(aminomethyl)-3-chloro-1H-pyridin-2-one?\nAnswer:",
  "answer": [
   "C1=CNC(=O)C(=C1CN)Cl"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(=S)C1=CC=CC=N1\nAnswer:",
  "answer": [
   "1-pyridin-2-ylethanethione"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C6H14N2O2?\nAnswer:",
  "answer": [
   "CC(C(=O)OCCCN)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of [2-(1-aminohexan-2-ylamino)cyclohexyl]methanol?\nAnswer (numerical number):",
  "answer": [
   "228.37"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC1CN(CCC1N)C2CCSC2C?\nAnswer (numerical number):",
  "answer": [
   "214.37"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1CCCC=CC=CCC1?\nAnswer (numerical number):",
  "answer": [
   "136.23"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCCCC1C(CO1)C?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-fluoro-N-methyl-2-(oxan-3-yl)propan-1-amine?\nAnswer (numerical number):",
  "answer": [
   "175.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H22O?\nAnswer (numerical number):",
  "answer": [
   "158.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C11H25NO?\nAnswer (numerical number):",
  "answer": [
   "187.32"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-[(5-amino-3-hydroxy-1-methyl-2,3-dihydropyrrol-4-yl)amino]acetaldehyde?\nAnswer:",
  "answer": [
   "C7H13N3O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCC=COC=C\nAnswer:",
  "answer": [
   "1-ethenoxypent-1-ene"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCN1C=CN=C1NCCCC(C)N?\nAnswer:",
  "answer": [
   "C10H20N4"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in N,2-bis(2-methoxyethyl)-2-methylbut-3-en-1-amine?\nAnswer (numerical number):",
  "answer": [
   37
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (7R)-7-thiophen-2-yl-1,4-oxazepane?\nAnswer:",
  "answer": [
   "C9H13NOS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (3R)-4-methyl-3-(oxan-4-yl)pentan-1-amine?\nAnswer (numerical number):",
  "answer": [
   "185.31"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CON=C1CCC2=C1N=CC=C2\nAnswer:",
  "answer": [
   "(Z)-N-methoxy-5,6-dihydrocyclopenta[b]pyridin-7-imine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C12H23NO?\nAnswer:",
  "answer": [
   "CCCNC(=O)CCC1CCCCC1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-ethyl-2-N-(2-methoxyethyl)pentane-1,2-diamine?\nAnswer (numerical number):",
  "answer": [
   "188.31"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 5-methoxy-4,4-dimethylhex-2-en-1-ol?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCC(COCC1CNCC(O1)C)O?\nAnswer:",
  "answer": [
   "C10H21NO3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H14N2?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N'-hydroxy-5-(2-methylprop-2-enylamino)pentanimidamide?\nAnswer (numerical number):",
  "answer": [
   "185.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCCCOC(=C)CCCC(=C)S?\nAnswer (numerical number):",
  "answer": [
   "214.37"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H17Cl?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (2E,4E)-6-hydroxy-N'-propan-2-ylhexa-2,4-dienehydrazide?\nAnswer:",
  "answer": [
   "C9H16N2O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C4H4NPS2?\nAnswer (numerical number):",
  "answer": [
   "161.2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-(thiolan-3-ylmethylamino)ethyl carbamate?\nAnswer (numerical number):",
  "answer": [
   "204.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (1S,2R)-N-methyl-2-morpholin-4-ylcyclohexan-1-amine?\nAnswer:",
  "answer": [
   "CNC1CCCCC1N2CCOCC2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(C=O)(C1CCCOC1)OC?\nAnswer (numerical number):",
  "answer": [
   "172.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCCC(CC(=O)N(C)OC)N?\nAnswer (numerical number):",
  "answer": [
   30
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H19NO?\nAnswer:",
  "answer": [
   "(NZ)-N-(2,2-dimethylheptan-4-ylidene)hydroxylamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H16O?\nAnswer:",
  "answer": [
   "(2S,5S)-2-ethyl-5-methylcyclohexan-1-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C11H18O?\nAnswer (numerical number):",
  "answer": [
   30
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-methyl-2,3,3a,4,7,7a-hexahydroisoindol-1-one?\nAnswer:",
  "answer": [
   "CC1C2CC=CCC2C(=O)N1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C=C1CCN(C1N)P?\nAnswer:",
  "answer": [
   "C5H11N2P"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of isocyanooxyboronic acid?\nAnswer (numerical number):",
  "answer": [
   "86.85"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1CCCN(CC1)C2CCCC2CO?\nAnswer (numerical number):",
  "answer": [
   "197.32"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCC(CCN1CCOCC1)N?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C5H6O4S?\nAnswer (numerical number):",
  "answer": [
   "162.17"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2H-pyrimidin-1-ylboronic acid?\nAnswer (numerical number):",
  "answer": [
   16
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C5H11ClO2S?\nAnswer:",
  "answer": [
   "CCCCCS(=O)(=O)Cl"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H7NO2S?\nAnswer (numerical number):",
  "answer": [
   "157.19"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CSC(=S)CCN.Cl\nAnswer:",
  "answer": [
   "methyl 3-aminopropanedithioate;hydrochloride"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1-(1-hydroxy-3-methoxypropan-2-yl)piperidin-2-one?\nAnswer (numerical number):",
  "answer": [
   "187.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C1CCCC(CC1)(CI)O\nAnswer:",
  "answer": [
   "1-(iodomethyl)cycloheptan-1-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(=CCl)CNCCSC?\nAnswer:",
  "answer": [
   "C7H14ClNS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H19FN2?\nAnswer:",
  "answer": [
   "2-N-(2-fluoroethyl)-2-N-methylcyclohexane-1,2-diamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(C)C1=C(ON=C1N)N?\nAnswer (numerical number):",
  "answer": [
   "141.17"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C5H10ClN3?\nAnswer (numerical number):",
  "answer": [
   "147.60"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H24ClN?\nAnswer:",
  "answer": [
   "4-(4-methylpentyl)piperidine;hydrochloride"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC1CC(C(C1C)C)O?\nAnswer (numerical number):",
  "answer": [
   "128.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of [2-(2,2-dimethylpropyl)oxiran-2-yl]methanol?\nAnswer:",
  "answer": [
   "C8H16O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C11H19NS?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC#CCCC(=O)C1CSCCO1?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H15NO?\nAnswer (numerical number):",
  "answer": [
   "165.23"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C=COC(=O)C(=O)OCCC#C?\nAnswer (numerical number):",
  "answer": [
   20
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C3H6O4S2?\nAnswer:",
  "answer": [
   "2-methylsulfonylsulfanylacetic acid"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C11H19Cl?\nAnswer:",
  "answer": [
   "CC(CC1CCCC1)(CCl)C=C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(C(=O)NC)NCC1CCOC1\nAnswer:",
  "answer": [
   "(2S)-N-methyl-2-[[(3R)-oxolan-3-yl]methylamino]propanamide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-(ethylamino)-2-(thiolan-3-yl)acetic acid?\nAnswer:",
  "answer": [
   "C8H15NO2S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-ethyl-1-(thian-2-yl)hex-4-yn-1-amine?\nAnswer (numerical number):",
  "answer": [
   "225.40"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H16ClNS?\nAnswer (numerical number):",
  "answer": [
   "193.74"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H11N3OS?\nAnswer:",
  "answer": [
   "4-(ethylaminomethylsulfanyl)pyrimidine-5-carbaldehyde"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H18N2O2?\nAnswer:",
  "answer": [
   "(2R)-2-amino-N-(2-methoxypropyl)butanamide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-pyrimidin-5-ylmorpholin-4-amine?\nAnswer:",
  "answer": [
   "C1COCCN1NC2=CN=CN=C2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C10H19NO?\nAnswer:",
  "answer": [
   "CC1(CCC2N1CCCC2)CO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC1C2(CCS1)OCC(O2)CN?\nAnswer (numerical number):",
  "answer": [
   "189.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 5,6-dimethyl-3-propyl-5,6-dihydro-2H-azepine?\nAnswer:",
  "answer": [
   "C11H19N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H15NO2S?\nAnswer:",
  "answer": [
   "1-(2-methylsulfanylacetyl)piperidine-2-carbaldehyde"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-hexan-3-yl-N-methylazetidin-3-amine?\nAnswer:",
  "answer": [
   "CCCC(CC)N(C)C1CNC1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (2S)-1-(6-methylpyrimidin-4-yl)propan-2-amine?\nAnswer:",
  "answer": [
   "C8H13N3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C3H4N2O3?\nAnswer (numerical number):",
  "answer": [
   12
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCC(=CCOCC)N(C)C?\nAnswer (numerical number):",
  "answer": [
   "171.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H17NS?\nAnswer (numerical number):",
  "answer": [
   28
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C10H14N2?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-(trimethylsilylmethyl)butan-2-amine?\nAnswer:",
  "answer": [
   "C8H21NSi"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCCCCCCCC(CC#C)CO?\nAnswer:",
  "answer": [
   "C14H26O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (1-hydroxy-3-methylpentan-3-yl)cyanamide?\nAnswer:",
  "answer": [
   "C7H14N2O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC(C)(CSCCS)S?\nAnswer:",
  "answer": [
   "C6H14S3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H17NO3?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1(CCC1N)C\nAnswer:",
  "answer": [
   "(1R)-2,2-dimethylcyclobutan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1,1,2-trichloro-2,2-dideuterioethanol?\nAnswer:",
  "answer": [
   "C2H3Cl3O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of hexa-1,3-dienyl formate?\nAnswer (numerical number):",
  "answer": [
   "126.15"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC1C(OCCN1)C2CCCCC2?\nAnswer (numerical number):",
  "answer": [
   34
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 3-amino-1-[amino(ethyl)amino]pentan-2-ol?\nAnswer (numerical number):",
  "answer": [
   30
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 4-(2-methylsulfanylpropylamino)cyclohexan-1-ol?\nAnswer:",
  "answer": [
   "C10H21NOS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (6S)-3-ethyl-3-methyl-6-(oxiran-2-yl)dioxane?\nAnswer:",
  "answer": [
   "C9H16O3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCNCCN1C=C(N=N1)CO?\nAnswer:",
  "answer": [
   "C7H14N4O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCOC1(CCSC1)CC=O?\nAnswer:",
  "answer": [
   "C8H14O2S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C11H20N2?\nAnswer:",
  "answer": [
   "CC(C)(C)CNC1CCCC1C#N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1CNC2C1C2C(F)(F)F?\nAnswer (numerical number):",
  "answer": [
   18
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H15N3S?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H15F?\nAnswer (numerical number):",
  "answer": [
   "142.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCNCCOCC1=NN=C(N1C)C\nAnswer:",
  "answer": [
   "2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methoxy]-N-ethylethanamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 5-methoxypent-2-ynylcyclohexane?\nAnswer:",
  "answer": [
   "C12H20O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-(3-methylpentylsulfanyl)propane-1,1-diol?\nAnswer:",
  "answer": [
   "C9H20O2S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCNCC1=CN=C(S1)CO?\nAnswer:",
  "answer": [
   "C7H12N2OS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (E)-3-(2,3-dihydrofuran-5-yl)prop-2-enoic acid?\nAnswer:",
  "answer": [
   "C1COC(=C1)C=CC(=O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCCCNC=C(CC=C)C(=O)C?\nAnswer (numerical number):",
  "answer": [
   "181.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1C2C=CC(C1C#N)S2?\nAnswer (numerical number):",
  "answer": [
   16
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 6-(3-ethylpyrrolidin-1-yl)hexane-1-thiol?\nAnswer (numerical number):",
  "answer": [
   39
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2\u00ce\u00bb3-ioda-7-azabicyclo[4.4.0]deca-1,3,5,7,9-pentaene?\nAnswer:",
  "answer": [
   "C8H6IN"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in O-(11-sulfanylundecyl)hydroxylamine?\nAnswer (numerical number):",
  "answer": [
   39
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C12H26O2?\nAnswer:",
  "answer": [
   "CCCCCCCCC(C(C)(C)O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1COC(CC1(F)F)CO?\nAnswer (numerical number):",
  "answer": [
   "152.14"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCC1CCC2C1CNC2\nAnswer:",
  "answer": [
   "4-propyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-ethyloct-1-yn-3-amine?\nAnswer:",
  "answer": [
   "CCCCCC(C#C)NCC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C8H13NO?\nAnswer (numerical number):",
  "answer": [
   "139.19"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCCOC(C)C(=O)C=O\nAnswer:",
  "answer": [
   "(3S)-3-butoxy-2-oxobutanal"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C1CC(CCC1CNCCCF)Cl\nAnswer:",
  "answer": [
   "N-[(4-chlorocyclohexyl)methyl]-3-fluoropropan-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H18O3?\nAnswer (numerical number):",
  "answer": [
   "186.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 1-ethyl-5-methyl-4,5,6,7-tetrahydrobenzimidazole?\nAnswer:",
  "answer": [
   "CCN1C=NC2=C1CCC(C2)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1-methoxy-2,5-dimethylidenepyrrol-3-ol?\nAnswer (numerical number):",
  "answer": [
   "139.15"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC=CC(C)C?\nAnswer:",
  "answer": [
   "C6H12"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCCCC(CC)(CCCC)S\nAnswer:",
  "answer": [
   "(5R)-5-ethyldecane-5-thiol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C7H12O4?\nAnswer (numerical number):",
  "answer": [
   "160.17"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1=CC(=NC=C1O)CCO?\nAnswer (numerical number):",
  "answer": [
   19
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCC(C)(CN)CNCC(C)CN?\nAnswer (numerical number):",
  "answer": [
   "187.33"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C11H22O2?\nAnswer:",
  "answer": [
   "CC1CCC(CC1)OCCCOC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C3H11NO5P2?\nAnswer (numerical number):",
  "answer": [
   "203.07"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C10H23NO3?\nAnswer:",
  "answer": [
   "CC(CCOC)(CNCCCOC)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N'-methyl-N-propylideneethanimidamide?\nAnswer:",
  "answer": [
   "CCC=NC(=NC)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (2S)-3-[(1R)-1-butoxy-2-hydroxyethoxy]propane-1,2-diol?\nAnswer:",
  "answer": [
   "CCCCOC(CO)OCC(CO)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC#CCCC(C)(C)C(=O)O?\nAnswer (numerical number):",
  "answer": [
   "154.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(CCC(C1CCCC1)O)OC?\nAnswer (numerical number):",
  "answer": [
   "186.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (2S)-1-cyclohexyloxy-3-(methylamino)propan-2-ol?\nAnswer (numerical number):",
  "answer": [
   34
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCC(C)C(CC)C(C)CS?\nAnswer (numerical number):",
  "answer": [
   33
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (2S)-2-(1,2,4-thiadiazol-5-yl)-1,4-oxazepane?\nAnswer:",
  "answer": [
   "C1CNCC(OC1)C2=NC=NS2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-(3-aminocyclopentyl)oxypropan-1-ol?\nAnswer:",
  "answer": [
   "C1CC(CC1N)OCCCO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-methyl-1-(oxolan-2-yl)but-3-en-2-ol?\nAnswer:",
  "answer": [
   "C9H16O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of B(C1CCC(=NC1)OC)(O)O?\nAnswer (numerical number):",
  "answer": [
   "156.98"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C7H13NS2?\nAnswer:",
  "answer": [
   "CC1CC(NC(=S)S1)(C)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-ethyl-3-(methylamino)hexanoic acid?\nAnswer:",
  "answer": [
   "C9H19NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCC(C(CC)CC(CC)CO)O?\nAnswer:",
  "answer": [
   "C12H26O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 3,3-diethylhexa-1,5-diene?\nAnswer (numerical number):",
  "answer": [
   "138.25"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1C2C1(C(CCC2)OC)C?\nAnswer:",
  "answer": [
   "C10H18O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C1C(CC(C1CO)OC#P)N?\nAnswer (numerical number):",
  "answer": [
   "173.15"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of ethyl N-acetyl-N-ethylcarbamate?\nAnswer (numerical number):",
  "answer": [
   "159.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1CCCCC1N(C)C2CNC2?\nAnswer:",
  "answer": [
   "C11H22N2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-amino-N-[2-(2-aminoethyldisulfanyl)ethyl]acetamide?\nAnswer (numerical number):",
  "answer": [
   "209.3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C12H21N?\nAnswer (numerical number):",
  "answer": [
   "179.30"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1(CC(CCO1)N)C?\nAnswer:",
  "answer": [
   "C7H15NO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C4H9N2O2P?\nAnswer:",
  "answer": [
   "CNP(O)OCCC#N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H21NO3?\nAnswer:",
  "answer": [
   "1-methoxy-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]propan-2-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of C1CCC(CC1)C23COCC2O3?\nAnswer:",
  "answer": [
   "C10H16O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CC(C)(C)CNC1CCCC1C#N?\nAnswer (numerical number):",
  "answer": [
   "180.29"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H19O6P?\nAnswer:",
  "answer": [
   "2-methoxyethyl 2-propoxyethyl hydrogen phosphate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H11N?\nAnswer:",
  "answer": [
   "CC=CC(=C)C(=N)C=C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of octyl(prop-1-enyl)phosphane?\nAnswer (numerical number):",
  "answer": [
   "186.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC#CCCNC1CC2CCC1O2\nAnswer:",
  "answer": [
   "N-pent-3-ynyl-7-oxabicyclo[2.2.1]heptan-2-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H13N3O?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H11NS?\nAnswer:",
  "answer": [
   "CC#CCCNC1=CSC=C1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C10H21NO2?\nAnswer:",
  "answer": [
   "C1CC(C1)N(CCCO)CCCO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (2S,4R)-2-ethyl-4-thiophen-2-ylpyrrolidine?\nAnswer:",
  "answer": [
   "C10H15NS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 4-methoxy-2-methyl-1-(prop-2-enylamino)butan-2-ol?\nAnswer:",
  "answer": [
   "C9H19NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H15NO3?\nAnswer:",
  "answer": [
   "2-(3-hydroxy-2-methylpropyl)oxazinan-3-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-ethyl-5-propan-2-yl-1,2,4-oxadiazol-3-amine?\nAnswer:",
  "answer": [
   "C7H13N3O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C(=NS(=O)OCl)=O?\nAnswer (numerical number):",
  "answer": [
   "141.53"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCC(C#N)N1CCCCC1CN\nAnswer:",
  "answer": [
   "(2S)-2-[(2R)-2-(aminomethyl)piperidin-1-yl]butanenitrile"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C5H13N2OP?\nAnswer:",
  "answer": [
   "(5-methyl-1,2,5-oxadiazepan-2-yl)phosphane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H13N3?\nAnswer:",
  "answer": [
   "CN1CC=CN2C1=NCCC2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 4-(2,2-difluoropropyl)azepane?\nAnswer:",
  "answer": [
   "C9H17F2N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 2-hexan-3-yl-1,1-dimethylhydrazine?\nAnswer:",
  "answer": [
   "C8H20N2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCCCC=CN1CCOCC1\nAnswer:",
  "answer": [
   "4-hept-1-enylmorpholine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H11BrN2?\nAnswer (numerical number):",
  "answer": [
   22
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CNC1CC2(CCCO2)CCC1O\nAnswer:",
  "answer": [
   "7-(methylamino)-1-oxaspiro[4.5]decan-8-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C7H11N5?\nAnswer:",
  "answer": [
   "1-[(5E)-5-(aminomethylidene)imidazol-4-yl]iminopropan-2-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 5-amino-N-(2-methoxypropyl)pentanamide?\nAnswer (numerical number):",
  "answer": [
   33
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H19NO?\nAnswer (numerical number):",
  "answer": [
   30
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C6H15N3?\nAnswer:",
  "answer": [
   "4-(2-methylpropyl)triazolidine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-[(3S)-4,4-dimethylpiperidin-3-yl]-N,N-dimethylethanamine?\nAnswer:",
  "answer": [
   "CC1(CCNCC1CCN(C)C)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C6H11NO?\nAnswer:",
  "answer": [
   "3-aminohex-4-enal"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (1R,2R)-2-(3-methylbutylamino)cyclopentane-1-carbonitrile?\nAnswer:",
  "answer": [
   "C11H20N2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-(pyrrolidin-3-yloxymethyl)pentan-3-ol?\nAnswer:",
  "answer": [
   "C10H21NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C11H24N2S?\nAnswer (numerical number):",
  "answer": [
   38
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C6H12N2O4?\nAnswer (numerical number):",
  "answer": [
   "176.17"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCOCCC(C)(CN)C=C\nAnswer:",
  "answer": [
   "2-(2-ethoxyethyl)-2-methylbut-3-en-1-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(CNCC1CCOC1)C#N\nAnswer:",
  "answer": [
   "(2S)-2-methyl-3-[[(3R)-oxolan-3-yl]methylamino]propanenitrile"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of CCC(C)(CO)C(=O)OC?\nAnswer (numerical number):",
  "answer": [
   "146.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in N-[[1-(oxan-3-yl)piperidin-2-yl]methyl]ethanamine?\nAnswer (numerical number):",
  "answer": [
   42
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(C)N(CCN)CC(=CCl)C\nAnswer:",
  "answer": [
   "N'-(3-chloro-2-methylprop-2-enyl)-N'-propan-2-ylethane-1,2-diamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of [1,3]thiazolo[3,2-b][1,2,4]triazole?\nAnswer:",
  "answer": [
   "C4H3N3S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H23P?\nAnswer:",
  "answer": [
   "butyl(2-ethylbutyl)phosphane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-[(1R,2S)-2,4-dimethylcyclohex-3-en-1-yl]-1,3-dioxolane?\nAnswer:",
  "answer": [
   "CC1C=C(CCC1C2OCCO2)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(=O)OCCCCP?\nAnswer (numerical number):",
  "answer": [
   22
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-dimethylphosphorylbut-2-yne?\nAnswer:",
  "answer": [
   "C6H11OP"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (2S)-2,3-dimethylpentan-1-ol?\nAnswer:",
  "answer": [
   "CCC(C)C(C)CO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of cyclohepta-2,6-dien-1-imine?\nAnswer:",
  "answer": [
   "C1CC=CC(=N)C=C1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C5H10O3?\nAnswer:",
  "answer": [
   "(2S)-2-methoxy-1,4-dioxane"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-methyl-1-(2-methylsulfinylphenyl)methanamine?\nAnswer (numerical number):",
  "answer": [
   "183.27"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of COC(=O)C(=C)C1CCCO1?\nAnswer (numerical number):",
  "answer": [
   "156.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C5H7ClN2O?\nAnswer:",
  "answer": [
   "3-chloro-N-(cyanomethyl)propanamide"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C=CCSCCNC(=O)OCCO?\nAnswer (numerical number):",
  "answer": [
   "205.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC1(CCN(C1)CCS)O?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 5-hydroxy-3-methyl-4-sulfanyl-1H-imidazol-2-one?\nAnswer (numerical number):",
  "answer": [
   "146.17"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in ethane;3-methylcyclopentene?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of ethoxymethyl 2-hydroxypentanoate?\nAnswer:",
  "answer": [
   "C8H16O4"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H17NS?\nAnswer (numerical number):",
  "answer": [
   "183.32"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCCCCC(=O)CCC=CC=C\nAnswer:",
  "answer": [
   "trideca-1,3-dien-7-one"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 4-methyl-N-pent-3-ynylpiperazin-1-amine?\nAnswer:",
  "answer": [
   "CC#CCCNN1CCN(CC1)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H17N3?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-(3-methylbutan-2-yl)pent-3-yn-1-amine?\nAnswer (numerical number):",
  "answer": [
   "153.26"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of methyl 2-chloro-2-(thiolan-3-yl)acetate?\nAnswer:",
  "answer": [
   "C7H11ClO2S"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CC1=C(SN=C1C(CCN)O)C?\nAnswer:",
  "answer": [
   "C8H14N2OS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of (5-cyclobutyl-3-methyl-1,2-oxazol-4-yl)methanamine?\nAnswer (numerical number):",
  "answer": [
   "166.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C8H17NO2?\nAnswer:",
  "answer": [
   "CNCCOCOCC1CC1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C7H15N5?\nAnswer:",
  "answer": [
   "CC(CCN)CC1=NN(N=N1)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCC1=NN2C=CN=C2C=C1F?\nAnswer:",
  "answer": [
   "C8H8FN3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C3H8N2S?\nAnswer:",
  "answer": [
   "2-aminoethyl methanimidothioate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 1-(3-methyl-1,2-oxazol-5-yl)butan-1-amine?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H19NOS?\nAnswer:",
  "answer": [
   "N-cyclopentyloxy-2-methylthiolan-3-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C9H14N2O?\nAnswer (numerical number):",
  "answer": [
   "166.22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H18N4O?\nAnswer:",
  "answer": [
   "N-[2-[(4-methyl-1,2,4-triazol-3-yl)methoxy]ethyl]propan-2-amine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 5-hydroxy-N-(2-prop-2-enylsulfanylethyl)pentanamide?\nAnswer:",
  "answer": [
   "C=CCSCCNC(=O)CCCCO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1CC(COC1)C(C=O)(F)F?\nAnswer (numerical number):",
  "answer": [
   21
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H17N3O?\nAnswer (numerical number):",
  "answer": [
   "195.26"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1-propan-2-ylpyrrolidine-2,5-dione?\nAnswer:",
  "answer": [
   "C7H11NO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-ethyl-2-methyl-2-(2-methylsulfanylethyl)but-3-en-1-amine?\nAnswer:",
  "answer": [
   "C10H21NS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C6H11N3?\nAnswer:",
  "answer": [
   "2,3,7-triazaspiro[4.4]non-2-ene"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H14N2?\nAnswer:",
  "answer": [
   "dec-2-enedinitrile"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (2R)-2-[(Z)-hex-3-enoxy]oxane?\nAnswer:",
  "answer": [
   "CCC=CCCOC1CCCCO1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C12H14?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H21O2P?\nAnswer:",
  "answer": [
   "CCCCOCP(=O)(CC)CC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2-methyldeca-4,6-diene?\nAnswer (numerical number):",
  "answer": [
   31
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2,5-dimethyl-1-(2-methylpropyl)imidazole?\nAnswer (numerical number):",
  "answer": [
   "152.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in [2-(3-methylbut-3-enylamino)cyclopentyl]methanol?\nAnswer (numerical number):",
  "answer": [
   34
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of methyl 2-[2-(aminomethyl)cyclohexyl]oxyacetate?\nAnswer:",
  "answer": [
   "C10H19NO3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C4H8O2?\nAnswer (numerical number):",
  "answer": [
   "88.11"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H17NO2?\nAnswer (numerical number):",
  "answer": [
   28
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C7H12N2O?\nAnswer (numerical number):",
  "answer": [
   "140.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of N-(2-methoxypropyl)-1-(thiolan-3-yl)ethane-1,2-diamine?\nAnswer:",
  "answer": [
   "CC(CNC(CN)C1CCSC1)OC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethoxy]ethanamine;hydrochloride?\nAnswer (numerical number):",
  "answer": [
   "238.74"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-fluoroprop-2-ynal?\nAnswer:",
  "answer": [
   "C3HFO"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-methyl-4-(pent-1-yn-3-ylamino)butan-2-ol?\nAnswer (numerical number):",
  "answer": [
   "169.26"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C=CCSSC1=NNSC1=S?\nAnswer (numerical number):",
  "answer": [
   17
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C12H21N?\nAnswer:",
  "answer": [
   "CCCC(C#C)NC(CC)C1CC1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCOCCCC(=O)N1CCCCC1C?\nAnswer (numerical number):",
  "answer": [
   38
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCC(C(=O)NCC)NC(=O)C?\nAnswer:",
  "answer": [
   "C8H16N2O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C3H10N2S?\nAnswer:",
  "answer": [
   "ethane;thiourea"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C9H14O?\nAnswer:",
  "answer": [
   "CC1CC(=CC=C1C)OC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 1,3-diaminobutyl acetate?\nAnswer:",
  "answer": [
   "C6H14N2O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C10H21NO2?\nAnswer:",
  "answer": [
   "CCCC(CC)N(C)CCC(=O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-(3-aminopropoxy)cyclopentan-1-ol?\nAnswer:",
  "answer": [
   "C1CC(C(C1)OCCCN)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 1-[2-(1-methylpyrrol-2-yl)ethyl]cyclopropan-1-amine?\nAnswer (numerical number):",
  "answer": [
   28
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C12H24N2?\nAnswer:",
  "answer": [
   "CNC1CCCCCC1N2CCCC2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CNC1C2N(C1=O)CCCS2?\nAnswer:",
  "answer": [
   "C7H12N2OS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C7H16O2?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (2S)-1-[(1-methyltriazol-4-yl)methylamino]propan-2-ol?\nAnswer (numerical number):",
  "answer": [
   26
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1-(furan-2-yl)cyclopropan-1-ol?\nAnswer (numerical number):",
  "answer": [
   "124.14"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(=O)C(C(CCS)N)(N)S?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C12H25NO?\nAnswer (numerical number):",
  "answer": [
   39
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1-[[(2S)-1-methylpiperidin-2-yl]methyl]-1,5-diazocane?\nAnswer (numerical number):",
  "answer": [
   "225.37"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of methyl (2R)-2-(aminomethyl)piperidine-1-carboxylate?\nAnswer:",
  "answer": [
   "COC(=O)N1CCCCC1CN"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 2-N-hex-1-yn-3-ylhexane-1,2-diamine?\nAnswer (numerical number):",
  "answer": [
   "196.33"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of N-prop-2-ynylbutan-1-amine?\nAnswer (numerical number):",
  "answer": [
   "111.18"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C5H9NS2?\nAnswer (numerical number):",
  "answer": [
   "147.3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H16FN?\nAnswer (numerical number):",
  "answer": [
   "169.24"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C6H6O2S?\nAnswer:",
  "answer": [
   "2,2,3,3,5,7-hexadeuteriothieno[3,4-b][1,4]dioxine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 1-amino-3-ethyl-2-methylhexan-3-ol?\nAnswer:",
  "answer": [
   "CCCC(CC)(C(C)CN)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCC1=CC2=C(N1)CCC2?\nAnswer:",
  "answer": [
   "C9H13N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(CCC1=CC=CS1)N(C)O\nAnswer:",
  "answer": [
   "N-methyl-N-[(2S)-4-thiophen-2-ylbutan-2-yl]hydroxylamine"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 1-(5-methyl-1,3,4-oxadiazol-2-yl)ethanethiol?\nAnswer (numerical number):",
  "answer": [
   "144.20"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of C4H10OS4?\nAnswer:",
  "answer": [
   "CSCSS(=O)CSC"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of ethyl (2R)-2-chlorohexanoate?\nAnswer:",
  "answer": [
   "C8H15ClO2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene?\nAnswer (numerical number):",
  "answer": [
   24
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in (2R)-2-[[[(2R)-butan-2-yl]amino]methyl]butanamide?\nAnswer (numerical number):",
  "answer": [
   32
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in 4-methylidenepiperidine;hydroiodide?\nAnswer (numerical number):",
  "answer": [
   20
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCCCCCCCl.C1CCCCC1?\nAnswer:",
  "answer": [
   "C14H29Cl"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C11H23NO2?\nAnswer:",
  "answer": [
   "4-[[2-(hydroxymethyl)cyclohexyl]amino]butan-2-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC(CCCCCN)C(C)O\nAnswer:",
  "answer": [
   "8-amino-3-methyloctan-2-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of (2E,4E,6Z)-octa-2,4,6-triene-3,5-diol?\nAnswer:",
  "answer": [
   "C8H12O2"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CCC1=CN2CCSC2=N1?\nAnswer (numerical number):",
  "answer": [
   20
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of (2S)-2-amino-4-(difluoromethoxy)butanoic acid?\nAnswer:",
  "answer": [
   "C(COC(F)F)C(C(=O)O)N"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of CCCC(C)CC(C)C=CC?\nAnswer:",
  "answer": [
   "C11H22"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C7H17NO2?\nAnswer (numerical number):",
  "answer": [
   27
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of N-(1,2-oxazol-3-ylmethyl)-1-(thiolan-3-yl)methanamine?\nAnswer:",
  "answer": [
   "C9H14N2OS"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular formula of 3-ethoxyperoxynonane?\nAnswer:",
  "answer": [
   "C11H24O3"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of 3-methoxy-2-(pyrimidin-4-ylamino)propan-1-ol?\nAnswer (numerical number):",
  "answer": [
   "183.21"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-[2-(2,2-dimethylhydrazinyl)ethyl]-1,1-dimethylhydrazine?\nAnswer:",
  "answer": [
   "CN(C)NCCNN(C)C"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C10H18O3?\nAnswer:",
  "answer": [
   "furan-2-ol;hexan-1-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C8H12F2?\nAnswer (numerical number):",
  "answer": [
   22
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 2-decan-2-yl-1,3,5-trithiane?\nAnswer:",
  "answer": [
   "CCCCCCCCC(C)C1SCSCS1"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C9H16?\nAnswer (numerical number):",
  "answer": [
   25
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCC(=O)OCC1CC1\nAnswer:",
  "answer": [
   "cyclopropylmethyl butanoate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CC(C)(C)CN(C)CC=C?\nAnswer (numerical number):",
  "answer": [
   29
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 3-[(2,2-difluoro-3-hydroxypropyl)amino]pentanenitrile?\nAnswer:",
  "answer": [
   "CCC(CC#N)NCC(CO)(F)F"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the SMILES expression of 5-(hydroxymethyl)-1-propylpyrrolidine-3,3-diol?\nAnswer:",
  "answer": [
   "CCCN1CC(CC1CO)(O)O"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CCCC(C)OCC(CNC)O\nAnswer:",
  "answer": [
   "1-(methylamino)-3-pentan-2-yloxypropan-2-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the molecular weight of C10H20N2O?\nAnswer (numerical number):",
  "answer": [
   "184.28"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C8H10O2S?\nAnswer:",
  "answer": [
   "methyl (1S,2R,4S)-7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C1CC(NC1)COCCCCCO?\nAnswer (numerical number):",
  "answer": [
   34
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of C9H17NO3?\nAnswer:",
  "answer": [
   "methyl 2-(4-methylpiperidin-3-yl)oxyacetate"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in CN(CC1=CN=C2N1CCS2)O?\nAnswer (numerical number):",
  "answer": [
   23
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "How many atoms are there in C7H10N4?\nAnswer (numerical number):",
  "answer": [
   21
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 },
 {
  "question": "What is the name of CC1=NC(=CS1)O\nAnswer:",
  "answer": [
   "2-methyl-1,3-thiazol-4-ol"
  ],
  "category": "chemistry",
  "topic": null,
  "ability": "Knowledge Application",
  "type": "filling",
  "task_name": "Molecular",
  "prompt": "Please answer the following question without any explaination, and directly give the answer.",
  "cot_prompt": ""
 }
]