convert dtype to float32
Browse files- bindingdb.ipynb +428 -12
- combine_dbs.ipynb +163 -21
- data/all.parquet +2 -2
- data/all_nokras.parquet +2 -2
- data/cov.parquet +2 -2
- moad.ipynb +264 -2
- pdbbind.ipynb +190 -10
bindingdb.ipynb
CHANGED
@@ -12,7 +12,7 @@
|
|
12 |
},
|
13 |
{
|
14 |
"cell_type": "code",
|
15 |
-
"execution_count":
|
16 |
"id": "89cbcd82-4ca2-4aba-95b7-e58c0ceed770",
|
17 |
"metadata": {},
|
18 |
"outputs": [],
|
@@ -619,17 +619,28 @@
|
|
619 |
},
|
620 |
{
|
621 |
"cell_type": "code",
|
622 |
-
"execution_count":
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
623 |
"id": "f602fdbe-7083-436c-9eac-9d97fbc8be67",
|
624 |
"metadata": {},
|
625 |
"outputs": [
|
626 |
{
|
627 |
"data": {
|
628 |
"text/plain": [
|
629 |
-
"
|
630 |
]
|
631 |
},
|
632 |
-
"execution_count":
|
633 |
"metadata": {},
|
634 |
"output_type": "execute_result"
|
635 |
}
|
@@ -640,7 +651,7 @@
|
|
640 |
},
|
641 |
{
|
642 |
"cell_type": "code",
|
643 |
-
"execution_count":
|
644 |
"id": "27194288-cf3e-4c30-ad55-3b0998fdf939",
|
645 |
"metadata": {},
|
646 |
"outputs": [
|
@@ -758,7 +769,7 @@
|
|
758 |
"4 PQITLWQRPLVTIKIGGQLKEALLDTGADDTVLEEMSLPGRWKPKM... 0.00099 "
|
759 |
]
|
760 |
},
|
761 |
-
"execution_count":
|
762 |
"metadata": {},
|
763 |
"output_type": "execute_result"
|
764 |
}
|
@@ -769,17 +780,17 @@
|
|
769 |
},
|
770 |
{
|
771 |
"cell_type": "code",
|
772 |
-
"execution_count":
|
773 |
"id": "603fd298-0aa6-4097-b298-c55db013548c",
|
774 |
"metadata": {},
|
775 |
"outputs": [
|
776 |
{
|
777 |
"data": {
|
778 |
"text/plain": [
|
779 |
-
"
|
780 |
]
|
781 |
},
|
782 |
-
"execution_count":
|
783 |
"metadata": {},
|
784 |
"output_type": "execute_result"
|
785 |
}
|
@@ -790,7 +801,7 @@
|
|
790 |
},
|
791 |
{
|
792 |
"cell_type": "code",
|
793 |
-
"execution_count":
|
794 |
"id": "d95ad9a9-d4ca-4679-8a33-235fe6e7047f",
|
795 |
"metadata": {},
|
796 |
"outputs": [
|
@@ -800,7 +811,7 @@
|
|
800 |
"2510716"
|
801 |
]
|
802 |
},
|
803 |
-
"execution_count":
|
804 |
"metadata": {},
|
805 |
"output_type": "execute_result"
|
806 |
}
|
@@ -809,10 +820,415 @@
|
|
809 |
"len(df_affinity[~df_affinity['affinity_uM'].isnull()])"
|
810 |
]
|
811 |
},
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
812 |
{
|
813 |
"cell_type": "code",
|
814 |
"execution_count": null,
|
815 |
-
"id": "
|
816 |
"metadata": {},
|
817 |
"outputs": [],
|
818 |
"source": []
|
|
|
12 |
},
|
13 |
{
|
14 |
"cell_type": "code",
|
15 |
+
"execution_count": 3,
|
16 |
"id": "89cbcd82-4ca2-4aba-95b7-e58c0ceed770",
|
17 |
"metadata": {},
|
18 |
"outputs": [],
|
|
|
619 |
},
|
620 |
{
|
621 |
"cell_type": "code",
|
622 |
+
"execution_count": 1,
|
623 |
+
"id": "f3a9173e-d574-4314-9cea-f8c0a66766c0",
|
624 |
+
"metadata": {},
|
625 |
+
"outputs": [],
|
626 |
+
"source": [
|
627 |
+
"import pandas as pd\n",
|
628 |
+
"df_affinity = pd.read_parquet('data/bindingdb.parquet')"
|
629 |
+
]
|
630 |
+
},
|
631 |
+
{
|
632 |
+
"cell_type": "code",
|
633 |
+
"execution_count": 2,
|
634 |
"id": "f602fdbe-7083-436c-9eac-9d97fbc8be67",
|
635 |
"metadata": {},
|
636 |
"outputs": [
|
637 |
{
|
638 |
"data": {
|
639 |
"text/plain": [
|
640 |
+
"2510716"
|
641 |
]
|
642 |
},
|
643 |
+
"execution_count": 2,
|
644 |
"metadata": {},
|
645 |
"output_type": "execute_result"
|
646 |
}
|
|
|
651 |
},
|
652 |
{
|
653 |
"cell_type": "code",
|
654 |
+
"execution_count": 3,
|
655 |
"id": "27194288-cf3e-4c30-ad55-3b0998fdf939",
|
656 |
"metadata": {},
|
657 |
"outputs": [
|
|
|
769 |
"4 PQITLWQRPLVTIKIGGQLKEALLDTGADDTVLEEMSLPGRWKPKM... 0.00099 "
|
770 |
]
|
771 |
},
|
772 |
+
"execution_count": 3,
|
773 |
"metadata": {},
|
774 |
"output_type": "execute_result"
|
775 |
}
|
|
|
780 |
},
|
781 |
{
|
782 |
"cell_type": "code",
|
783 |
+
"execution_count": 4,
|
784 |
"id": "603fd298-0aa6-4097-b298-c55db013548c",
|
785 |
"metadata": {},
|
786 |
"outputs": [
|
787 |
{
|
788 |
"data": {
|
789 |
"text/plain": [
|
790 |
+
"2510716"
|
791 |
]
|
792 |
},
|
793 |
+
"execution_count": 4,
|
794 |
"metadata": {},
|
795 |
"output_type": "execute_result"
|
796 |
}
|
|
|
801 |
},
|
802 |
{
|
803 |
"cell_type": "code",
|
804 |
+
"execution_count": 5,
|
805 |
"id": "d95ad9a9-d4ca-4679-8a33-235fe6e7047f",
|
806 |
"metadata": {},
|
807 |
"outputs": [
|
|
|
811 |
"2510716"
|
812 |
]
|
813 |
},
|
814 |
+
"execution_count": 5,
|
815 |
"metadata": {},
|
816 |
"output_type": "execute_result"
|
817 |
}
|
|
|
820 |
"len(df_affinity[~df_affinity['affinity_uM'].isnull()])"
|
821 |
]
|
822 |
},
|
823 |
+
{
|
824 |
+
"cell_type": "code",
|
825 |
+
"execution_count": 6,
|
826 |
+
"id": "b21c4683-0fe1-4a0a-a55c-c0dc80193f36",
|
827 |
+
"metadata": {},
|
828 |
+
"outputs": [
|
829 |
+
{
|
830 |
+
"data": {
|
831 |
+
"text/html": [
|
832 |
+
"<div>\n",
|
833 |
+
"<style scoped>\n",
|
834 |
+
" .dataframe tbody tr th:only-of-type {\n",
|
835 |
+
" vertical-align: middle;\n",
|
836 |
+
" }\n",
|
837 |
+
"\n",
|
838 |
+
" .dataframe tbody tr th {\n",
|
839 |
+
" vertical-align: top;\n",
|
840 |
+
" }\n",
|
841 |
+
"\n",
|
842 |
+
" .dataframe thead th {\n",
|
843 |
+
" text-align: right;\n",
|
844 |
+
" }\n",
|
845 |
+
"</style>\n",
|
846 |
+
"<table border=\"1\" class=\"dataframe\">\n",
|
847 |
+
" <thead>\n",
|
848 |
+
" <tr style=\"text-align: right;\">\n",
|
849 |
+
" <th></th>\n",
|
850 |
+
" <th>Ligand SMILES</th>\n",
|
851 |
+
" <th>IC50 (nM)</th>\n",
|
852 |
+
" <th>KEGG ID of Ligand</th>\n",
|
853 |
+
" <th>Ki (nM)</th>\n",
|
854 |
+
" <th>Kd (nM)</th>\n",
|
855 |
+
" <th>EC50 (nM)</th>\n",
|
856 |
+
" <th>seq</th>\n",
|
857 |
+
" <th>affinity_uM</th>\n",
|
858 |
+
" </tr>\n",
|
859 |
+
" </thead>\n",
|
860 |
+
" <tbody>\n",
|
861 |
+
" <tr>\n",
|
862 |
+
" <th>0</th>\n",
|
863 |
+
" <td>COc1cc2c(Nc3ccc(Br)cc3F)ncnc2cc1OCC1CCN(C)CC1</td>\n",
|
864 |
+
" <td>None</td>\n",
|
865 |
+
" <td>None</td>\n",
|
866 |
+
" <td>0.24</td>\n",
|
867 |
+
" <td>None</td>\n",
|
868 |
+
" <td>None</td>\n",
|
869 |
+
" <td>PQITLWQRPLVTIKIGGQLKEALLDTGADDTVLEEMSLPGRWKPKM...</td>\n",
|
870 |
+
" <td>0.00024</td>\n",
|
871 |
+
" </tr>\n",
|
872 |
+
" <tr>\n",
|
873 |
+
" <th>1</th>\n",
|
874 |
+
" <td>O[C@@H]1[C@@H](O)[C@@H](Cc2ccccc2)N(C\\C=C\\c2cn...</td>\n",
|
875 |
+
" <td>None</td>\n",
|
876 |
+
" <td>None</td>\n",
|
877 |
+
" <td>0.25</td>\n",
|
878 |
+
" <td>None</td>\n",
|
879 |
+
" <td>None</td>\n",
|
880 |
+
" <td>PQITLWQRPLVTIKIGGQLKEALLDTGADDTVLEEMSLPGRWKPKM...</td>\n",
|
881 |
+
" <td>0.00025</td>\n",
|
882 |
+
" </tr>\n",
|
883 |
+
" <tr>\n",
|
884 |
+
" <th>2</th>\n",
|
885 |
+
" <td>O[C@@H]1[C@@H](O)[C@@H](Cc2ccccc2)N(CC2CC2)C(=...</td>\n",
|
886 |
+
" <td>None</td>\n",
|
887 |
+
" <td>None</td>\n",
|
888 |
+
" <td>0.41</td>\n",
|
889 |
+
" <td>None</td>\n",
|
890 |
+
" <td>None</td>\n",
|
891 |
+
" <td>PQITLWQRPLVTIKIGGQLKEALLDTGADDTVLEEMSLPGRWKPKM...</td>\n",
|
892 |
+
" <td>0.00041</td>\n",
|
893 |
+
" </tr>\n",
|
894 |
+
" <tr>\n",
|
895 |
+
" <th>3</th>\n",
|
896 |
+
" <td>OCCCCCCN1[C@H](Cc2ccccc2)[C@H](O)[C@@H](O)[C@@...</td>\n",
|
897 |
+
" <td>None</td>\n",
|
898 |
+
" <td>None</td>\n",
|
899 |
+
" <td>0.8</td>\n",
|
900 |
+
" <td>None</td>\n",
|
901 |
+
" <td>None</td>\n",
|
902 |
+
" <td>PQITLWQRPLVTIKIGGQLKEALLDTGADDTVLEEMSLPGRWKPKM...</td>\n",
|
903 |
+
" <td>0.00080</td>\n",
|
904 |
+
" </tr>\n",
|
905 |
+
" <tr>\n",
|
906 |
+
" <th>4</th>\n",
|
907 |
+
" <td>OCCCCCN1[C@H](Cc2ccccc2)[C@H](O)[C@@H](O)[C@@H...</td>\n",
|
908 |
+
" <td>None</td>\n",
|
909 |
+
" <td>None</td>\n",
|
910 |
+
" <td>0.99</td>\n",
|
911 |
+
" <td>None</td>\n",
|
912 |
+
" <td>None</td>\n",
|
913 |
+
" <td>PQITLWQRPLVTIKIGGQLKEALLDTGADDTVLEEMSLPGRWKPKM...</td>\n",
|
914 |
+
" <td>0.00099</td>\n",
|
915 |
+
" </tr>\n",
|
916 |
+
" <tr>\n",
|
917 |
+
" <th>...</th>\n",
|
918 |
+
" <td>...</td>\n",
|
919 |
+
" <td>...</td>\n",
|
920 |
+
" <td>...</td>\n",
|
921 |
+
" <td>...</td>\n",
|
922 |
+
" <td>...</td>\n",
|
923 |
+
" <td>...</td>\n",
|
924 |
+
" <td>...</td>\n",
|
925 |
+
" <td>...</td>\n",
|
926 |
+
" </tr>\n",
|
927 |
+
" <tr>\n",
|
928 |
+
" <th>5112</th>\n",
|
929 |
+
" <td>COc1ccc(NC(=O)N2CCC(CC2)C(=O)N[C@@H](CC(C)C)C(...</td>\n",
|
930 |
+
" <td>17</td>\n",
|
931 |
+
" <td>None</td>\n",
|
932 |
+
" <td>None</td>\n",
|
933 |
+
" <td>None</td>\n",
|
934 |
+
" <td>None</td>\n",
|
935 |
+
" <td>MSYDRAITVFSPDGHLFQVEYAQEAVKKGSTAVGVRGRDIVVLGVE...</td>\n",
|
936 |
+
" <td>0.01700</td>\n",
|
937 |
+
" </tr>\n",
|
938 |
+
" <tr>\n",
|
939 |
+
" <th>5113</th>\n",
|
940 |
+
" <td>CC(C)C[C@H](NC(=O)C1CCN(CC1)C(=O)Nc1cnccn1)C(=...</td>\n",
|
941 |
+
" <td>76</td>\n",
|
942 |
+
" <td>None</td>\n",
|
943 |
+
" <td>None</td>\n",
|
944 |
+
" <td>None</td>\n",
|
945 |
+
" <td>None</td>\n",
|
946 |
+
" <td>MSYDRAITVFSPDGHLFQVEYAQEAVKKGSTAVGVRGRDIVVLGVE...</td>\n",
|
947 |
+
" <td>0.07600</td>\n",
|
948 |
+
" </tr>\n",
|
949 |
+
" <tr>\n",
|
950 |
+
" <th>5313</th>\n",
|
951 |
+
" <td>C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1)...</td>\n",
|
952 |
+
" <td>>100000</td>\n",
|
953 |
+
" <td>None</td>\n",
|
954 |
+
" <td>None</td>\n",
|
955 |
+
" <td>None</td>\n",
|
956 |
+
" <td>None</td>\n",
|
957 |
+
" <td>MSYDRAITVFSPDGHLFQVEYAQEAVKKGSTAVGVRGRDIVVLGVE...</td>\n",
|
958 |
+
" <td>100.00000</td>\n",
|
959 |
+
" </tr>\n",
|
960 |
+
" <tr>\n",
|
961 |
+
" <th>5314</th>\n",
|
962 |
+
" <td>FCC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)c1cccc2ccc...</td>\n",
|
963 |
+
" <td>>100000</td>\n",
|
964 |
+
" <td>None</td>\n",
|
965 |
+
" <td>None</td>\n",
|
966 |
+
" <td>None</td>\n",
|
967 |
+
" <td>None</td>\n",
|
968 |
+
" <td>MSYDRAITVFSPDGHLFQVEYAQEAVKKGSTAVGVRGRDIVVLGVE...</td>\n",
|
969 |
+
" <td>100.00000</td>\n",
|
970 |
+
" </tr>\n",
|
971 |
+
" <tr>\n",
|
972 |
+
" <th>5361</th>\n",
|
973 |
+
" <td>FCC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccccc1</td>\n",
|
974 |
+
" <td>>100000</td>\n",
|
975 |
+
" <td>None</td>\n",
|
976 |
+
" <td>None</td>\n",
|
977 |
+
" <td>None</td>\n",
|
978 |
+
" <td>None</td>\n",
|
979 |
+
" <td>MSYDRAITVFSPDGHLFQVEYAQEAVKKGSTAVGVRGRDIVVLGVE...</td>\n",
|
980 |
+
" <td>100.00000</td>\n",
|
981 |
+
" </tr>\n",
|
982 |
+
" </tbody>\n",
|
983 |
+
"</table>\n",
|
984 |
+
"<p>2510716 rows × 8 columns</p>\n",
|
985 |
+
"</div>"
|
986 |
+
],
|
987 |
+
"text/plain": [
|
988 |
+
" Ligand SMILES IC50 (nM) \\\n",
|
989 |
+
"0 COc1cc2c(Nc3ccc(Br)cc3F)ncnc2cc1OCC1CCN(C)CC1 None \n",
|
990 |
+
"1 O[C@@H]1[C@@H](O)[C@@H](Cc2ccccc2)N(C\\C=C\\c2cn... None \n",
|
991 |
+
"2 O[C@@H]1[C@@H](O)[C@@H](Cc2ccccc2)N(CC2CC2)C(=... None \n",
|
992 |
+
"3 OCCCCCCN1[C@H](Cc2ccccc2)[C@H](O)[C@@H](O)[C@@... None \n",
|
993 |
+
"4 OCCCCCN1[C@H](Cc2ccccc2)[C@H](O)[C@@H](O)[C@@H... None \n",
|
994 |
+
"... ... ... \n",
|
995 |
+
"5112 COc1ccc(NC(=O)N2CCC(CC2)C(=O)N[C@@H](CC(C)C)C(... 17 \n",
|
996 |
+
"5113 CC(C)C[C@H](NC(=O)C1CCN(CC1)C(=O)Nc1cnccn1)C(=... 76 \n",
|
997 |
+
"5313 C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1)... >100000 \n",
|
998 |
+
"5314 FCC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)c1cccc2ccc... >100000 \n",
|
999 |
+
"5361 FCC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccccc1 >100000 \n",
|
1000 |
+
"\n",
|
1001 |
+
" KEGG ID of Ligand Ki (nM) Kd (nM) EC50 (nM) \\\n",
|
1002 |
+
"0 None 0.24 None None \n",
|
1003 |
+
"1 None 0.25 None None \n",
|
1004 |
+
"2 None 0.41 None None \n",
|
1005 |
+
"3 None 0.8 None None \n",
|
1006 |
+
"4 None 0.99 None None \n",
|
1007 |
+
"... ... ... ... ... \n",
|
1008 |
+
"5112 None None None None \n",
|
1009 |
+
"5113 None None None None \n",
|
1010 |
+
"5313 None None None None \n",
|
1011 |
+
"5314 None None None None \n",
|
1012 |
+
"5361 None None None None \n",
|
1013 |
+
"\n",
|
1014 |
+
" seq affinity_uM \n",
|
1015 |
+
"0 PQITLWQRPLVTIKIGGQLKEALLDTGADDTVLEEMSLPGRWKPKM... 0.00024 \n",
|
1016 |
+
"1 PQITLWQRPLVTIKIGGQLKEALLDTGADDTVLEEMSLPGRWKPKM... 0.00025 \n",
|
1017 |
+
"2 PQITLWQRPLVTIKIGGQLKEALLDTGADDTVLEEMSLPGRWKPKM... 0.00041 \n",
|
1018 |
+
"3 PQITLWQRPLVTIKIGGQLKEALLDTGADDTVLEEMSLPGRWKPKM... 0.00080 \n",
|
1019 |
+
"4 PQITLWQRPLVTIKIGGQLKEALLDTGADDTVLEEMSLPGRWKPKM... 0.00099 \n",
|
1020 |
+
"... ... ... \n",
|
1021 |
+
"5112 MSYDRAITVFSPDGHLFQVEYAQEAVKKGSTAVGVRGRDIVVLGVE... 0.01700 \n",
|
1022 |
+
"5113 MSYDRAITVFSPDGHLFQVEYAQEAVKKGSTAVGVRGRDIVVLGVE... 0.07600 \n",
|
1023 |
+
"5313 MSYDRAITVFSPDGHLFQVEYAQEAVKKGSTAVGVRGRDIVVLGVE... 100.00000 \n",
|
1024 |
+
"5314 MSYDRAITVFSPDGHLFQVEYAQEAVKKGSTAVGVRGRDIVVLGVE... 100.00000 \n",
|
1025 |
+
"5361 MSYDRAITVFSPDGHLFQVEYAQEAVKKGSTAVGVRGRDIVVLGVE... 100.00000 \n",
|
1026 |
+
"\n",
|
1027 |
+
"[2510716 rows x 8 columns]"
|
1028 |
+
]
|
1029 |
+
},
|
1030 |
+
"execution_count": 6,
|
1031 |
+
"metadata": {},
|
1032 |
+
"output_type": "execute_result"
|
1033 |
+
}
|
1034 |
+
],
|
1035 |
+
"source": [
|
1036 |
+
"df_affinity"
|
1037 |
+
]
|
1038 |
+
},
|
1039 |
+
{
|
1040 |
+
"cell_type": "code",
|
1041 |
+
"execution_count": 25,
|
1042 |
+
"id": "20690729",
|
1043 |
+
"metadata": {},
|
1044 |
+
"outputs": [],
|
1045 |
+
"source": [
|
1046 |
+
"import rdkit.Chem as Chem"
|
1047 |
+
]
|
1048 |
+
},
|
1049 |
+
{
|
1050 |
+
"cell_type": "code",
|
1051 |
+
"execution_count": 27,
|
1052 |
+
"id": "48114dcc",
|
1053 |
+
"metadata": {},
|
1054 |
+
"outputs": [],
|
1055 |
+
"source": [
|
1056 |
+
"df_pdb = df[~df['PDB ID(s) for Ligand-Target Complex'].isnull()][['PDB ID(s) for Ligand-Target Complex','Ligand SMILES']]"
|
1057 |
+
]
|
1058 |
+
},
|
1059 |
+
{
|
1060 |
+
"cell_type": "code",
|
1061 |
+
"execution_count": 28,
|
1062 |
+
"id": "caa0497c",
|
1063 |
+
"metadata": {},
|
1064 |
+
"outputs": [],
|
1065 |
+
"source": [
|
1066 |
+
"def make_canonical(smi):\n",
|
1067 |
+
" return Chem.MolToSmiles(Chem.MolFromSmiles(smi))\n",
|
1068 |
+
"\n",
|
1069 |
+
"df_pdb['can_smiles'] = df_pdb['Ligand SMILES'].apply(make_canonical)"
|
1070 |
+
]
|
1071 |
+
},
|
1072 |
+
{
|
1073 |
+
"cell_type": "code",
|
1074 |
+
"execution_count": 29,
|
1075 |
+
"id": "e82d64f3",
|
1076 |
+
"metadata": {},
|
1077 |
+
"outputs": [
|
1078 |
+
{
|
1079 |
+
"data": {
|
1080 |
+
"text/html": [
|
1081 |
+
"<div>\n",
|
1082 |
+
"<style scoped>\n",
|
1083 |
+
" .dataframe tbody tr th:only-of-type {\n",
|
1084 |
+
" vertical-align: middle;\n",
|
1085 |
+
" }\n",
|
1086 |
+
"\n",
|
1087 |
+
" .dataframe tbody tr th {\n",
|
1088 |
+
" vertical-align: top;\n",
|
1089 |
+
" }\n",
|
1090 |
+
"\n",
|
1091 |
+
" .dataframe thead th {\n",
|
1092 |
+
" text-align: right;\n",
|
1093 |
+
" }\n",
|
1094 |
+
"</style>\n",
|
1095 |
+
"<table border=\"1\" class=\"dataframe\">\n",
|
1096 |
+
" <thead>\n",
|
1097 |
+
" <tr style=\"text-align: right;\">\n",
|
1098 |
+
" <th></th>\n",
|
1099 |
+
" <th>PDB ID(s) for Ligand-Target Complex</th>\n",
|
1100 |
+
" <th>Ligand SMILES</th>\n",
|
1101 |
+
" <th>can_smiles</th>\n",
|
1102 |
+
" </tr>\n",
|
1103 |
+
" </thead>\n",
|
1104 |
+
" <tbody>\n",
|
1105 |
+
" <tr>\n",
|
1106 |
+
" <th>0</th>\n",
|
1107 |
+
" <td>2IVU</td>\n",
|
1108 |
+
" <td>COc1cc2c(Nc3ccc(Br)cc3F)ncnc2cc1OCC1CCN(C)CC1</td>\n",
|
1109 |
+
" <td>COc1cc2c(Nc3ccc(Br)cc3F)ncnc2cc1OCC1CCN(C)CC1</td>\n",
|
1110 |
+
" </tr>\n",
|
1111 |
+
" <tr>\n",
|
1112 |
+
" <th>29</th>\n",
|
1113 |
+
" <td>1HWR</td>\n",
|
1114 |
+
" <td>O[C@@H]1[C@@H](O)[C@@H](Cc2ccccc2)N(CC=C)C(=O)...</td>\n",
|
1115 |
+
" <td>C=CCN1C(=O)N(CC=C)[C@H](Cc2ccccc2)[C@H](O)[C@@...</td>\n",
|
1116 |
+
" </tr>\n",
|
1117 |
+
" <tr>\n",
|
1118 |
+
" <th>34</th>\n",
|
1119 |
+
" <td>6DGY,6DH1,6DH4,6DH7,3O99</td>\n",
|
1120 |
+
" <td>CC[C@H](C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O...</td>\n",
|
1121 |
+
" <td>CC[C@H](C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O...</td>\n",
|
1122 |
+
" </tr>\n",
|
1123 |
+
" <tr>\n",
|
1124 |
+
" <th>129</th>\n",
|
1125 |
+
" <td>1MES,1MEU,1MET,1BVG,1BVE,3JVW,1QBS</td>\n",
|
1126 |
+
" <td>OCc1ccc(CN2[C@H](Cc3ccccc3)[C@H](O)[C@@H](O)[C...</td>\n",
|
1127 |
+
" <td>O=C1N(Cc2ccc(CO)cc2)[C@H](Cc2ccccc2)[C@H](O)[C...</td>\n",
|
1128 |
+
" </tr>\n",
|
1129 |
+
" <tr>\n",
|
1130 |
+
" <th>130</th>\n",
|
1131 |
+
" <td>1MER,1DMP,1RQ9</td>\n",
|
1132 |
+
" <td>Nc1cccc(CN2[C@H](Cc3ccccc3)[C@H](O)[C@@H](O)[C...</td>\n",
|
1133 |
+
" <td>Nc1cccc(CN2C(=O)N(Cc3cccc(N)c3)[C@H](Cc3ccccc3...</td>\n",
|
1134 |
+
" </tr>\n",
|
1135 |
+
" <tr>\n",
|
1136 |
+
" <th>...</th>\n",
|
1137 |
+
" <td>...</td>\n",
|
1138 |
+
" <td>...</td>\n",
|
1139 |
+
" <td>...</td>\n",
|
1140 |
+
" </tr>\n",
|
1141 |
+
" <tr>\n",
|
1142 |
+
" <th>2333375</th>\n",
|
1143 |
+
" <td>1MUI,2RKG,2RKF,1RV7,2Q5K,2O4S,6DJ1,6DJ2,3OGQ,2...</td>\n",
|
1144 |
+
" <td>CC(C)[C@H](N1CCCNC1=O)C(=O)N[C@H](C[C@H](O)[C@...</td>\n",
|
1145 |
+
" <td>Cc1cccc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)...</td>\n",
|
1146 |
+
" </tr>\n",
|
1147 |
+
" <tr>\n",
|
1148 |
+
" <th>2333376</th>\n",
|
1149 |
+
" <td>4NPT,4DQH,4DQE,5E5J,3JW2,6OPU,6OPX,2HS2,2HS1,2...</td>\n",
|
1150 |
+
" <td>CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@H]...</td>\n",
|
1151 |
+
" <td>CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@H]...</td>\n",
|
1152 |
+
" </tr>\n",
|
1153 |
+
" <tr>\n",
|
1154 |
+
" <th>2333380</th>\n",
|
1155 |
+
" <td>6EKZ,1DY4,5FUK,6PS5</td>\n",
|
1156 |
+
" <td>CC(C)NCC(O)COc1cccc2ccccc12</td>\n",
|
1157 |
+
" <td>CC(C)NCC(O)COc1cccc2ccccc12</td>\n",
|
1158 |
+
" </tr>\n",
|
1159 |
+
" <tr>\n",
|
1160 |
+
" <th>2333384</th>\n",
|
1161 |
+
" <td>6EKZ,1DY4,5FUK,6PS5</td>\n",
|
1162 |
+
" <td>CC(C)NCC(O)COc1cccc2ccccc12</td>\n",
|
1163 |
+
" <td>CC(C)NCC(O)COc1cccc2ccccc12</td>\n",
|
1164 |
+
" </tr>\n",
|
1165 |
+
" <tr>\n",
|
1166 |
+
" <th>2333385</th>\n",
|
1167 |
+
" <td>6A60,3DCT</td>\n",
|
1168 |
+
" <td>CC(C)c1onc(c1COc1ccc(\\C=C\\c2cccc(c2)C(O)=O)c(C...</td>\n",
|
1169 |
+
" <td>CC(C)c1onc(-c2c(Cl)cccc2Cl)c1COc1ccc(/C=C/c2cc...</td>\n",
|
1170 |
+
" </tr>\n",
|
1171 |
+
" </tbody>\n",
|
1172 |
+
"</table>\n",
|
1173 |
+
"<p>123385 rows × 3 columns</p>\n",
|
1174 |
+
"</div>"
|
1175 |
+
],
|
1176 |
+
"text/plain": [
|
1177 |
+
" PDB ID(s) for Ligand-Target Complex \\\n",
|
1178 |
+
"0 2IVU \n",
|
1179 |
+
"29 1HWR \n",
|
1180 |
+
"34 6DGY,6DH1,6DH4,6DH7,3O99 \n",
|
1181 |
+
"129 1MES,1MEU,1MET,1BVG,1BVE,3JVW,1QBS \n",
|
1182 |
+
"130 1MER,1DMP,1RQ9 \n",
|
1183 |
+
"... ... \n",
|
1184 |
+
"2333375 1MUI,2RKG,2RKF,1RV7,2Q5K,2O4S,6DJ1,6DJ2,3OGQ,2... \n",
|
1185 |
+
"2333376 4NPT,4DQH,4DQE,5E5J,3JW2,6OPU,6OPX,2HS2,2HS1,2... \n",
|
1186 |
+
"2333380 6EKZ,1DY4,5FUK,6PS5 \n",
|
1187 |
+
"2333384 6EKZ,1DY4,5FUK,6PS5 \n",
|
1188 |
+
"2333385 6A60,3DCT \n",
|
1189 |
+
"\n",
|
1190 |
+
" Ligand SMILES \\\n",
|
1191 |
+
"0 COc1cc2c(Nc3ccc(Br)cc3F)ncnc2cc1OCC1CCN(C)CC1 \n",
|
1192 |
+
"29 O[C@@H]1[C@@H](O)[C@@H](Cc2ccccc2)N(CC=C)C(=O)... \n",
|
1193 |
+
"34 CC[C@H](C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O... \n",
|
1194 |
+
"129 OCc1ccc(CN2[C@H](Cc3ccccc3)[C@H](O)[C@@H](O)[C... \n",
|
1195 |
+
"130 Nc1cccc(CN2[C@H](Cc3ccccc3)[C@H](O)[C@@H](O)[C... \n",
|
1196 |
+
"... ... \n",
|
1197 |
+
"2333375 CC(C)[C@H](N1CCCNC1=O)C(=O)N[C@H](C[C@H](O)[C@... \n",
|
1198 |
+
"2333376 CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@H]... \n",
|
1199 |
+
"2333380 CC(C)NCC(O)COc1cccc2ccccc12 \n",
|
1200 |
+
"2333384 CC(C)NCC(O)COc1cccc2ccccc12 \n",
|
1201 |
+
"2333385 CC(C)c1onc(c1COc1ccc(\\C=C\\c2cccc(c2)C(O)=O)c(C... \n",
|
1202 |
+
"\n",
|
1203 |
+
" can_smiles \n",
|
1204 |
+
"0 COc1cc2c(Nc3ccc(Br)cc3F)ncnc2cc1OCC1CCN(C)CC1 \n",
|
1205 |
+
"29 C=CCN1C(=O)N(CC=C)[C@H](Cc2ccccc2)[C@H](O)[C@@... \n",
|
1206 |
+
"34 CC[C@H](C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O... \n",
|
1207 |
+
"129 O=C1N(Cc2ccc(CO)cc2)[C@H](Cc2ccccc2)[C@H](O)[C... \n",
|
1208 |
+
"130 Nc1cccc(CN2C(=O)N(Cc3cccc(N)c3)[C@H](Cc3ccccc3... \n",
|
1209 |
+
"... ... \n",
|
1210 |
+
"2333375 Cc1cccc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)... \n",
|
1211 |
+
"2333376 CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@H]... \n",
|
1212 |
+
"2333380 CC(C)NCC(O)COc1cccc2ccccc12 \n",
|
1213 |
+
"2333384 CC(C)NCC(O)COc1cccc2ccccc12 \n",
|
1214 |
+
"2333385 CC(C)c1onc(-c2c(Cl)cccc2Cl)c1COc1ccc(/C=C/c2cc... \n",
|
1215 |
+
"\n",
|
1216 |
+
"[123385 rows x 3 columns]"
|
1217 |
+
]
|
1218 |
+
},
|
1219 |
+
"execution_count": 29,
|
1220 |
+
"metadata": {},
|
1221 |
+
"output_type": "execute_result"
|
1222 |
+
}
|
1223 |
+
],
|
1224 |
+
"source": [
|
1225 |
+
"df_pdb"
|
1226 |
+
]
|
1227 |
+
},
|
1228 |
{
|
1229 |
"cell_type": "code",
|
1230 |
"execution_count": null,
|
1231 |
+
"id": "593c9aec",
|
1232 |
"metadata": {},
|
1233 |
"outputs": [],
|
1234 |
"source": []
|
combine_dbs.ipynb
CHANGED
@@ -2,7 +2,7 @@
|
|
2 |
"cells": [
|
3 |
{
|
4 |
"cell_type": "code",
|
5 |
-
"execution_count":
|
6 |
"id": "95bd761a-fe51-4a8e-bc70-1365260ba5f8",
|
7 |
"metadata": {},
|
8 |
"outputs": [],
|
@@ -1332,12 +1332,14 @@
|
|
1332 |
},
|
1333 |
{
|
1334 |
"cell_type": "code",
|
1335 |
-
"execution_count":
|
1336 |
"id": "c6c64066-4032-4247-a8b9-00388176cc7b",
|
1337 |
"metadata": {},
|
1338 |
"outputs": [],
|
1339 |
"source": [
|
|
|
1340 |
"#df.to_parquet('data/all.parquet')\n",
|
|
|
1341 |
"#df = pd.read_parquet('data/all.parquet')"
|
1342 |
]
|
1343 |
},
|
@@ -1513,12 +1515,14 @@
|
|
1513 |
},
|
1514 |
{
|
1515 |
"cell_type": "code",
|
1516 |
-
"execution_count":
|
1517 |
"id": "47966268-c97c-4bd9-9c90-eb568249f2ef",
|
1518 |
"metadata": {},
|
1519 |
"outputs": [],
|
1520 |
"source": [
|
1521 |
-
"df_nokras.
|
|
|
|
|
1522 |
]
|
1523 |
},
|
1524 |
{
|
@@ -1531,7 +1535,7 @@
|
|
1531 |
},
|
1532 |
{
|
1533 |
"cell_type": "code",
|
1534 |
-
"execution_count":
|
1535 |
"id": "c0d250a3-5680-446c-9c98-7d6623643304",
|
1536 |
"metadata": {},
|
1537 |
"outputs": [],
|
@@ -1542,7 +1546,7 @@
|
|
1542 |
},
|
1543 |
{
|
1544 |
"cell_type": "code",
|
1545 |
-
"execution_count":
|
1546 |
"id": "0c7c0b26-1f2a-4b80-8117-f1e02719aac9",
|
1547 |
"metadata": {},
|
1548 |
"outputs": [
|
@@ -1550,14 +1554,14 @@
|
|
1550 |
"name": "stderr",
|
1551 |
"output_type": "stream",
|
1552 |
"text": [
|
1553 |
-
"RDKit WARNING: [13:
|
1554 |
-
"RDKit WARNING: [13:
|
1555 |
-
"RDKit WARNING: [13:
|
1556 |
-
"RDKit WARNING: [13:
|
1557 |
-
"RDKit WARNING: [13:
|
1558 |
-
"RDKit WARNING: [13:
|
1559 |
-
"RDKit WARNING: [13:
|
1560 |
-
"RDKit WARNING: [13:
|
1561 |
]
|
1562 |
}
|
1563 |
],
|
@@ -1578,28 +1582,166 @@
|
|
1578 |
},
|
1579 |
{
|
1580 |
"cell_type": "code",
|
1581 |
-
"execution_count":
|
1582 |
"id": "ee3fa0bc-9ad3-4ea7-9393-cbc7504f634c",
|
1583 |
"metadata": {},
|
1584 |
"outputs": [],
|
1585 |
"source": [
|
1586 |
-
"df_cov
|
|
|
|
|
1587 |
]
|
1588 |
},
|
1589 |
{
|
1590 |
"cell_type": "code",
|
1591 |
-
"execution_count":
|
1592 |
"id": "5c12fedc-4236-4587-a744-c0c9ec21ceaa",
|
1593 |
"metadata": {},
|
1594 |
-
"outputs": [
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1595 |
"source": [
|
1596 |
-
"
|
1597 |
]
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1598 |
}
|
1599 |
],
|
1600 |
"metadata": {
|
1601 |
"kernelspec": {
|
1602 |
-
"display_name": "Python 3",
|
1603 |
"language": "python",
|
1604 |
"name": "python3"
|
1605 |
},
|
@@ -1613,7 +1755,7 @@
|
|
1613 |
"name": "python",
|
1614 |
"nbconvert_exporter": "python",
|
1615 |
"pygments_lexer": "ipython3",
|
1616 |
-
"version": "3.9.
|
1617 |
}
|
1618 |
},
|
1619 |
"nbformat": 4,
|
|
|
2 |
"cells": [
|
3 |
{
|
4 |
"cell_type": "code",
|
5 |
+
"execution_count": 2,
|
6 |
"id": "95bd761a-fe51-4a8e-bc70-1365260ba5f8",
|
7 |
"metadata": {},
|
8 |
"outputs": [],
|
|
|
1332 |
},
|
1333 |
{
|
1334 |
"cell_type": "code",
|
1335 |
+
"execution_count": 7,
|
1336 |
"id": "c6c64066-4032-4247-a8b9-00388176cc7b",
|
1337 |
"metadata": {},
|
1338 |
"outputs": [],
|
1339 |
"source": [
|
1340 |
+
"df = df.astype({'affinity_uM': 'float32', 'neg_log10_affinity_M': 'float32', 'affinity': 'float32'})\n",
|
1341 |
"#df.to_parquet('data/all.parquet')\n",
|
1342 |
+
"\n",
|
1343 |
"#df = pd.read_parquet('data/all.parquet')"
|
1344 |
]
|
1345 |
},
|
|
|
1515 |
},
|
1516 |
{
|
1517 |
"cell_type": "code",
|
1518 |
+
"execution_count": 10,
|
1519 |
"id": "47966268-c97c-4bd9-9c90-eb568249f2ef",
|
1520 |
"metadata": {},
|
1521 |
"outputs": [],
|
1522 |
"source": [
|
1523 |
+
"#df_nokras = df_nokras.astype({'affinity_uM': 'float32', 'neg_log10_affinity_M': 'float32', 'affinity': 'float32'})\n",
|
1524 |
+
"#df_nokras.to_parquet('data/all_nokras.parquet')\n",
|
1525 |
+
"#df_nokras = pd.read_parquet('data/all_nokras.parquet')"
|
1526 |
]
|
1527 |
},
|
1528 |
{
|
|
|
1535 |
},
|
1536 |
{
|
1537 |
"cell_type": "code",
|
1538 |
+
"execution_count": 89,
|
1539 |
"id": "c0d250a3-5680-446c-9c98-7d6623643304",
|
1540 |
"metadata": {},
|
1541 |
"outputs": [],
|
|
|
1546 |
},
|
1547 |
{
|
1548 |
"cell_type": "code",
|
1549 |
+
"execution_count": 90,
|
1550 |
"id": "0c7c0b26-1f2a-4b80-8117-f1e02719aac9",
|
1551 |
"metadata": {},
|
1552 |
"outputs": [
|
|
|
1554 |
"name": "stderr",
|
1555 |
"output_type": "stream",
|
1556 |
"text": [
|
1557 |
+
"RDKit WARNING: [13:44:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
|
1558 |
+
"RDKit WARNING: [13:44:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
|
1559 |
+
"RDKit WARNING: [13:44:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
|
1560 |
+
"RDKit WARNING: [13:44:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
|
1561 |
+
"RDKit WARNING: [13:44:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
|
1562 |
+
"RDKit WARNING: [13:44:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
|
1563 |
+
"RDKit WARNING: [13:44:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n",
|
1564 |
+
"RDKit WARNING: [13:44:45] Warning: molecule is tagged as 3D, but all Z coords are zero\n"
|
1565 |
]
|
1566 |
}
|
1567 |
],
|
|
|
1582 |
},
|
1583 |
{
|
1584 |
"cell_type": "code",
|
1585 |
+
"execution_count": 12,
|
1586 |
"id": "ee3fa0bc-9ad3-4ea7-9393-cbc7504f634c",
|
1587 |
"metadata": {},
|
1588 |
"outputs": [],
|
1589 |
"source": [
|
1590 |
+
"df_cov = df_cov.astype({'affinity_uM': 'float32', 'neg_log10_affinity_M': 'float32', 'affinity': 'float32'})\n",
|
1591 |
+
"#df_cov.reset_index(drop=True).to_parquet('data/cov.parquet')\n",
|
1592 |
+
"#df_cov = pd.read_parquet('data/cov.parquet')"
|
1593 |
]
|
1594 |
},
|
1595 |
{
|
1596 |
"cell_type": "code",
|
1597 |
+
"execution_count": 77,
|
1598 |
"id": "5c12fedc-4236-4587-a744-c0c9ec21ceaa",
|
1599 |
"metadata": {},
|
1600 |
+
"outputs": [
|
1601 |
+
{
|
1602 |
+
"data": {
|
1603 |
+
"text/plain": [
|
1604 |
+
"346"
|
1605 |
+
]
|
1606 |
+
},
|
1607 |
+
"execution_count": 77,
|
1608 |
+
"metadata": {},
|
1609 |
+
"output_type": "execute_result"
|
1610 |
+
}
|
1611 |
+
],
|
1612 |
"source": [
|
1613 |
+
"len(df_cov)"
|
1614 |
]
|
1615 |
+
},
|
1616 |
+
{
|
1617 |
+
"cell_type": "code",
|
1618 |
+
"execution_count": 78,
|
1619 |
+
"id": "1b73cea5-e6d9-427f-a31e-7ab38b5e6e4e",
|
1620 |
+
"metadata": {},
|
1621 |
+
"outputs": [
|
1622 |
+
{
|
1623 |
+
"data": {
|
1624 |
+
"text/plain": [
|
1625 |
+
"2.703125"
|
1626 |
+
]
|
1627 |
+
},
|
1628 |
+
"execution_count": 78,
|
1629 |
+
"metadata": {},
|
1630 |
+
"output_type": "execute_result"
|
1631 |
+
}
|
1632 |
+
],
|
1633 |
+
"source": [
|
1634 |
+
"346/128"
|
1635 |
+
]
|
1636 |
+
},
|
1637 |
+
{
|
1638 |
+
"cell_type": "code",
|
1639 |
+
"execution_count": 80,
|
1640 |
+
"id": "2d1d2955-7839-45e0-9a11-07dda2d51b24",
|
1641 |
+
"metadata": {},
|
1642 |
+
"outputs": [
|
1643 |
+
{
|
1644 |
+
"data": {
|
1645 |
+
"text/plain": [
|
1646 |
+
"<AxesSubplot:>"
|
1647 |
+
]
|
1648 |
+
},
|
1649 |
+
"execution_count": 80,
|
1650 |
+
"metadata": {},
|
1651 |
+
"output_type": "execute_result"
|
1652 |
+
},
|
1653 |
+
{
|
1654 |
+
"data": {
|
1655 |
+
"image/png": "iVBORw0KGgoAAAANSUhEUgAAAXcAAAD4CAYAAAAXUaZHAAAAOXRFWHRTb2Z0d2FyZQBNYXRwbG90bGliIHZlcnNpb24zLjQuMiwgaHR0cHM6Ly9tYXRwbG90bGliLm9yZy8rg+JYAAAACXBIWXMAAAsTAAALEwEAmpwYAAAPIUlEQVR4nO3dX4xcd3nG8e/TGEqSLbGj0JVxom4qpUCKRSErGoiEdmtQaYNwLhopKCAHpfINf1LkqhhuchXVFw0qElUli1BcEWXlmkiJkpaSGraoF6S1EyQnGOQI3GATbChJYKMIcPv2Ygex49js7szOnM3P38/NzPkz57x+debZM7+Zc5yqQpLUlt/ougBJ0toz3CWpQYa7JDXIcJekBhnuktSgDV0XAHDFFVfU1NRU12Us64UXXuDSSy/tuox1wV70sx/97Ee/UfXj8OHDP6qq15xr2boI96mpKQ4dOtR1Gcuan59nZmam6zLWBXvRz370sx/9RtWPJP99vmUOy0hSgwx3SWqQ4S5JDTLcJalBhrskNchwl6QGGe6S1CDDXZIatGy4J/lcktNJnlgy7/IkjyQ51nvctGTZJ5I8leTbSf54VIVLks5vJVeofh74DPCPS+btBg5W1Z4ku3vTH09yLXAL8PvAa4F/S/J7VfW/a1u2LjRTux/ubN/H99zY2b6lQS175l5VXwN+fNbs7cC+3vN9wE1L5s9V1c+q6rvAU8Bb16ZUSdJKZSX/zV6SKeChqnpjb/q5qtq4ZPmzVbUpyWeAr1fVF3rz7wH+paoOnGObO4GdAJOTk9fNzc2twT9ntBYWFpiYmOi6jHVh3L04cvL5se3rbFu3XLbsOh4b/exHv1H1Y3Z29nBVTZ9r2VrfOCznmHfOvx5VtRfYCzA9PV0vh5sMeTOkXxl3L27rcljm1pll1/HY6Gc/+nXRj0F/LXMqyWaA3uPp3vwTwFVL1rsS+P7g5UmSBjFouD8I7Og93wE8sGT+LUl+M8nVwDXAfw5XoiRptZYdlklyHzADXJHkBHAnsAfYn+R24GngZoCqejLJfuCbwBngQ/5SRpLGb9lwr6r3nWfRtvOsfxdw1zBFSZKG4xWqktQgw12SGmS4S1KDDHdJapDhLkkNMtwlqUGGuyQ1yHCXpAYZ7pLUIMNdkhpkuEtSgwx3SWqQ4S5JDTLcJalBhrskNchwl6QGGe6S1CDDXZIaZLhLUoMMd0lqkOEuSQ0y3CWpQYa7JDXIcJekBhnuktQgw12SGmS4S1KDDHdJapDhLkkNMtwlqUGGuyQ1yHCXpAYNFe5JPpbkySRPJLkvyauSXJ7kkSTHeo+b1qpYSdLKbBj0hUm2AB8Frq2qF5PsB24BrgUOVtWeJLuB3cDH16RadW5q98MA7Np6htt6zyWtP8MOy2wALk6yAbgE+D6wHdjXW74PuGnIfUiSVilVNfiLkzuAu4AXgS9X1a1JnquqjUvWebaqXjI0k2QnsBNgcnLyurm5uYHrGJeFhQUmJia6LqNTR04+D8DkxXDqxY6LGZOtWy5bdh2PjX72o9+o+jE7O3u4qqbPtWyYYZlNLJ6lXw08B/xTkvev9PVVtRfYCzA9PV0zMzODljI28/PzvBzqHKXblgzL3H1k4MPnZeX4rTPLruOx0c9+9OuiH8MMy7wT+G5V/bCqfgHcD7wdOJVkM0Dv8fTwZUqSVmOYcH8auD7JJUkCbAOOAg8CO3rr7AAeGK5ESdJqDfy5uqoeTXIAeAw4AzzO4jDLBLA/ye0s/gG4eS0KlSSt3FCDplV1J3DnWbN/xuJZvCSpI16hKkkNMtwlqUGGuyQ1yHCXpAYZ7pLUIMNdkhpkuEtSgwx3SWqQ4S5JDTLcJalBhrskNchwl6QGGe6S1CDDXZIaZLhLUoMMd0lqkOEuSQ0y3CWpQYa7JDXIcJekBhnuktQgw12SGmS4S1KDDHdJapDhLkkNMtwlqUGGuyQ1yHCXpAYZ7pLUIMNdkhpkuEtSgwx3SWrQUOGeZGOSA0m+leRokrcluTzJI0mO9R43rVWxkqSVGfbM/dPAl6rq9cCbgKPAbuBgVV0DHOxNS5LGaOBwT/Jq4B3APQBV9fOqeg7YDuzrrbYPuGm4EiVJq5WqGuyFyR8Ae4FvsnjWfhi4AzhZVRuXrPdsVb1kaCbJTmAnwOTk5HVzc3MD1TFOCwsLTExMdF1Gp46cfB6AyYvh1IsdFzMmW7dctuw6Hhv97Ee/UfVjdnb2cFVNn2vZMOE+DXwduKGqHk3yaeAnwEdWEu5LTU9P16FDhwaqY5zm5+eZmZnpuoxOTe1+GIBdW89w95ENHVczHsf33LjsOh4b/exHv1H1I8l5w32YMfcTwImqerQ3fQB4C3AqyebejjcDp4fYhyRpAAOHe1X9APhektf1Zm1jcYjmQWBHb94O4IGhKpQkrdqwn6s/Atyb5JXAd4APsvgHY3+S24GngZuH3IckaZWGCveq+gZwrvGebcNsV5I0HK9QlaQGGe6S1CDDXZIaZLhLUoMMd0lqkOEuSQ26MK4fl4bwy1su/Dq7tp7hthWstxorue2BdD6euUtSgwx3SWqQ4S5JDTLcJalBhrskNchwl6QGGe6S1CDDXZIaZLhLUoMMd0lqkOEuSQ0y3CWpQYa7JDXIcJekBhnuktQgw12SGmS4S1KDDHdJapDhLkkNMtwlqUGGuyQ1yHCXpAYZ7pLUIMNdkhpkuEtSg4YO9yQXJXk8yUO96cuTPJLkWO9x0/BlSpJWYy3O3O8Aji6Z3g0crKprgIO9aUnSGA0V7kmuBG4EPrtk9nZgX+/5PuCmYfYhSVq9VNXgL04OAH8N/Bbwl1X1niTPVdXGJes8W1UvGZpJshPYCTA5OXnd3NzcwHWMy8LCAhMTE12X0akjJ58HYPJiOPVix8WsI6Pox9Ytl63tBsfI90q/UfVjdnb2cFVNn2vZhkE3muQ9wOmqOpxkZrWvr6q9wF6A6enpmplZ9SbGbn5+npdDnaN02+6HAdi19Qx3Hxn48GnOKPpx/NaZNd3eOPle6ddFP4Y5Gm8A3pvkT4FXAa9O8gXgVJLNVfVMks3A6bUoVJK0cgOPuVfVJ6rqyqqaAm4BvlJV7wceBHb0VtsBPDB0lZKkVRnF79z3AO9Kcgx4V29akjRGazJIWFXzwHzv+f8A29Ziu5KkwXiFqiQ1yHCXpAYZ7pLUIMNdkhpkuEtSgwx3SWqQ14+/DE31bgEgSefjmbskNcgzd2md6vIT2vE9N3a2b60Nz9wlqUGGuyQ1yHCXpAYZ7pLUIMNdkhpkuEtSgwx3SWqQ4S5JDTLcJalBhrskNchwl6QGGe6S1CDDXZIaZLhLUoMMd0lqkOEuSQ0y3CWpQYa7JDXIcJekBhnuktQgw12SGmS4S1KDDHdJatDA4Z7kqiRfTXI0yZNJ7ujNvzzJI0mO9R43rV25kqSVGObM/Qywq6reAFwPfCjJtcBu4GBVXQMc7E1LksZo4HCvqmeq6rHe858CR4EtwHZgX2+1fcBNQ9YoSVqlVNXwG0mmgK8BbwSerqqNS5Y9W1UvGZpJshPYCTA5OXnd3Nzc0HWM2sLCAhMTE12XwZGTz3ddApMXw6kXu65i/WitH1u3XDbU69fLe2W9GFU/ZmdnD1fV9LmWDR3uSSaAfwfuqqr7kzy3knBfanp6ug4dOjRUHeMwPz/PzMxM12Uwtfvhrktg19Yz3H1kQ9dlrBut9eP4nhuHev16ea+sF6PqR5LzhvtQv5ZJ8grgi8C9VXV/b/apJJt7yzcDp4fZhyRp9Yb5tUyAe4CjVfWpJYseBHb0nu8AHhi8PEnSIIb5HHkD8AHgSJJv9OZ9EtgD7E9yO/A0cPNQFUqSVm3gcK+q/wBynsXbBt2uJGl4XqEqSQ0y3CWpQYa7JDXIcJekBhnuktQgw12SGtTO9dIdWA+3AZBGYdhje9fWM9w2wDaGve2BfsUzd0lqkOEuSQ0y3CWpQYa7JDXIcJekBhnuktQgw12SGmS4S1KDDHdJapDhLkkNMtwlqUGGuyQ1yHCXpAZ5V0hJ60ZXd1pt8W6UnrlLUoMMd0lqkOEuSQ0y3CWpQU18oTquL2EG/a/DJGncPHOXpAYZ7pLUIMNdkhrUxJi7JA1j1N/b/brv60Z1AZVn7pLUIMNdkho0snBP8u4k307yVJLdo9qPJOmlRhLuSS4C/g74E+Ba4H1Jrh3FviRJLzWqM/e3Ak9V1Xeq6ufAHLB9RPuSJJ0lVbX2G03+DHh3Vf15b/oDwB9W1YeXrLMT2NmbfB3w7TUvZO1dAfyo6yLWCXvRz370sx/9RtWP36mq15xrwah+CplzzOv7K1JVe4G9I9r/SCQ5VFXTXdexHtiLfvajn/3o10U/RjUscwK4asn0lcD3R7QvSdJZRhXu/wVck+TqJK8EbgEeHNG+JElnGcmwTFWdSfJh4F+Bi4DPVdWTo9jXmL2shpFGzF70sx/97Ee/sfdjJF+oSpK65RWqktQgw12SGmS4LyPJVUm+muRokieT3NF1TetBkouSPJ7koa5r6VqSjUkOJPlW7zh5W9c1dSXJx3rvkyeS3JfkVV3XNE5JPpfkdJInlsy7PMkjSY71HjeNoxbDfXlngF1V9QbgeuBD3koBgDuAo10XsU58GvhSVb0eeBMXaF+SbAE+CkxX1RtZ/DHFLd1WNXafB9591rzdwMGqugY42JseOcN9GVX1TFU91nv+UxbfuFu6rapbSa4EbgQ+23UtXUvyauAdwD0AVfXzqnqu06K6tQG4OMkG4BIusOtbquprwI/Pmr0d2Nd7vg+4aRy1GO6rkGQKeDPwaMeldO1vgb8C/q/jOtaD3wV+CPxDb5jqs0ku7bqoLlTVSeBvgKeBZ4Dnq+rL3Va1LkxW1TOweLII/PY4dmq4r1CSCeCLwF9U1U+6rqcrSd4DnK6qw13Xsk5sAN4C/H1VvRl4gTF97F5vemPJ24GrgdcClyZ5f7dVXbgM9xVI8goWg/3eqrq/63o6dgPw3iTHWbzb5x8l+UK3JXXqBHCiqn75ae4Ai2F/IXon8N2q+mFV/QK4H3h7xzWtB6eSbAboPZ4ex04N92UkCYvjqUer6lNd19O1qvpEVV1ZVVMsfln2laq6YM/OquoHwPeSvK43axvwzQ5L6tLTwPVJLum9b7ZxgX65fJYHgR295zuAB8axU/+D7OXdAHwAOJLkG715n6yqf+6uJK0zHwHu7d1H6TvABzuupxNV9WiSA8BjLP7K7HEusNsQJLkPmAGuSHICuBPYA+xPcjuLfwBvHkst3n5AktrjsIwkNchwl6QGGe6S1CDDXZIaZLhLUoMMd0lqkOEuSQ36fwQ+77qgfKxkAAAAAElFTkSuQmCC\n",
|
1656 |
+
"text/plain": [
|
1657 |
+
"<Figure size 432x288 with 1 Axes>"
|
1658 |
+
]
|
1659 |
+
},
|
1660 |
+
"metadata": {
|
1661 |
+
"needs_background": "light"
|
1662 |
+
},
|
1663 |
+
"output_type": "display_data"
|
1664 |
+
}
|
1665 |
+
],
|
1666 |
+
"source": [
|
1667 |
+
"df_cov['neg_log10_affinity_M'].hist()"
|
1668 |
+
]
|
1669 |
+
},
|
1670 |
+
{
|
1671 |
+
"cell_type": "code",
|
1672 |
+
"execution_count": 92,
|
1673 |
+
"id": "ab2e429b-d84c-42b7-b0dc-55e6728b9f81",
|
1674 |
+
"metadata": {},
|
1675 |
+
"outputs": [
|
1676 |
+
{
|
1677 |
+
"data": {
|
1678 |
+
"text/plain": [
|
1679 |
+
"167"
|
1680 |
+
]
|
1681 |
+
},
|
1682 |
+
"execution_count": 92,
|
1683 |
+
"metadata": {},
|
1684 |
+
"output_type": "execute_result"
|
1685 |
+
}
|
1686 |
+
],
|
1687 |
+
"source": [
|
1688 |
+
"len(df_cov['seq'].unique())"
|
1689 |
+
]
|
1690 |
+
},
|
1691 |
+
{
|
1692 |
+
"cell_type": "code",
|
1693 |
+
"execution_count": 94,
|
1694 |
+
"id": "4d535b74-1a32-45ee-a61f-f0cca805ad9b",
|
1695 |
+
"metadata": {},
|
1696 |
+
"outputs": [
|
1697 |
+
{
|
1698 |
+
"data": {
|
1699 |
+
"text/plain": [
|
1700 |
+
"49"
|
1701 |
+
]
|
1702 |
+
},
|
1703 |
+
"execution_count": 94,
|
1704 |
+
"metadata": {},
|
1705 |
+
"output_type": "execute_result"
|
1706 |
+
}
|
1707 |
+
],
|
1708 |
+
"source": [
|
1709 |
+
"len(df_cov['smiles'].unique())"
|
1710 |
+
]
|
1711 |
+
},
|
1712 |
+
{
|
1713 |
+
"cell_type": "code",
|
1714 |
+
"execution_count": 96,
|
1715 |
+
"id": "f59aa644-f848-447f-b82a-cff5b0507738",
|
1716 |
+
"metadata": {},
|
1717 |
+
"outputs": [
|
1718 |
+
{
|
1719 |
+
"data": {
|
1720 |
+
"text/plain": [
|
1721 |
+
"346"
|
1722 |
+
]
|
1723 |
+
},
|
1724 |
+
"execution_count": 96,
|
1725 |
+
"metadata": {},
|
1726 |
+
"output_type": "execute_result"
|
1727 |
+
}
|
1728 |
+
],
|
1729 |
+
"source": [
|
1730 |
+
"len(df_cov)"
|
1731 |
+
]
|
1732 |
+
},
|
1733 |
+
{
|
1734 |
+
"cell_type": "code",
|
1735 |
+
"execution_count": null,
|
1736 |
+
"id": "b8af53a6-5203-4889-9c4b-31140da5fc5b",
|
1737 |
+
"metadata": {},
|
1738 |
+
"outputs": [],
|
1739 |
+
"source": []
|
1740 |
}
|
1741 |
],
|
1742 |
"metadata": {
|
1743 |
"kernelspec": {
|
1744 |
+
"display_name": "Python 3 (ipykernel)",
|
1745 |
"language": "python",
|
1746 |
"name": "python3"
|
1747 |
},
|
|
|
1755 |
"name": "python",
|
1756 |
"nbconvert_exporter": "python",
|
1757 |
"pygments_lexer": "ipython3",
|
1758 |
+
"version": "3.9.6"
|
1759 |
}
|
1760 |
},
|
1761 |
"nbformat": 4,
|
data/all.parquet
CHANGED
@@ -1,3 +1,3 @@
|
|
1 |
version https://git-lfs.github.com/spec/v1
|
2 |
-
oid sha256:
|
3 |
-
size
|
|
|
1 |
version https://git-lfs.github.com/spec/v1
|
2 |
+
oid sha256:7f5a4cf9181e53127ff08a5e4041855090b9545d9292b2a2151f1143e4225504
|
3 |
+
size 227594093
|
data/all_nokras.parquet
CHANGED
@@ -1,3 +1,3 @@
|
|
1 |
version https://git-lfs.github.com/spec/v1
|
2 |
-
oid sha256:
|
3 |
-
size
|
|
|
1 |
version https://git-lfs.github.com/spec/v1
|
2 |
+
oid sha256:2e5ad3371e2f8aa4e2126cc0bd0a62be698b344fa5270bf6dfc1b02d2e53ffbd
|
3 |
+
size 236076396
|
data/cov.parquet
CHANGED
@@ -1,3 +1,3 @@
|
|
1 |
version https://git-lfs.github.com/spec/v1
|
2 |
-
oid sha256:
|
3 |
-
size
|
|
|
1 |
version https://git-lfs.github.com/spec/v1
|
2 |
+
oid sha256:d081ff36f1ea2fca675719b09b78954b5e10d75e38761c42445a7a49afdf48b6
|
3 |
+
size 94330
|
moad.ipynb
CHANGED
@@ -2,7 +2,7 @@
|
|
2 |
"cells": [
|
3 |
{
|
4 |
"cell_type": "code",
|
5 |
-
"execution_count":
|
6 |
"id": "c47a32d8-c857-41de-a70a-cec48046df12",
|
7 |
"metadata": {},
|
8 |
"outputs": [],
|
@@ -23,6 +23,258 @@
|
|
23 |
"#df = df[df['ligand_valid']!='invalid'].copy()"
|
24 |
]
|
25 |
},
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
26 |
{
|
27 |
"cell_type": "code",
|
28 |
"execution_count": 3,
|
@@ -587,10 +839,20 @@
|
|
587 |
},
|
588 |
{
|
589 |
"cell_type": "code",
|
590 |
-
"execution_count":
|
591 |
"id": "49a160d6-4599-488a-ba02-a65a79535f38",
|
592 |
"metadata": {},
|
593 |
"outputs": [],
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
594 |
"source": []
|
595 |
}
|
596 |
],
|
|
|
2 |
"cells": [
|
3 |
{
|
4 |
"cell_type": "code",
|
5 |
+
"execution_count": 4,
|
6 |
"id": "c47a32d8-c857-41de-a70a-cec48046df12",
|
7 |
"metadata": {},
|
8 |
"outputs": [],
|
|
|
23 |
"#df = df[df['ligand_valid']!='invalid'].copy()"
|
24 |
]
|
25 |
},
|
26 |
+
{
|
27 |
+
"cell_type": "code",
|
28 |
+
"execution_count": 3,
|
29 |
+
"id": "a4a7384f-8068-43e8-add7-c498aafe61c9",
|
30 |
+
"metadata": {},
|
31 |
+
"outputs": [
|
32 |
+
{
|
33 |
+
"data": {
|
34 |
+
"text/html": [
|
35 |
+
"<div>\n",
|
36 |
+
"<style scoped>\n",
|
37 |
+
" .dataframe tbody tr th:only-of-type {\n",
|
38 |
+
" vertical-align: middle;\n",
|
39 |
+
" }\n",
|
40 |
+
"\n",
|
41 |
+
" .dataframe tbody tr th {\n",
|
42 |
+
" vertical-align: top;\n",
|
43 |
+
" }\n",
|
44 |
+
"\n",
|
45 |
+
" .dataframe thead th {\n",
|
46 |
+
" text-align: right;\n",
|
47 |
+
" }\n",
|
48 |
+
"</style>\n",
|
49 |
+
"<table border=\"1\" class=\"dataframe\">\n",
|
50 |
+
" <thead>\n",
|
51 |
+
" <tr style=\"text-align: right;\">\n",
|
52 |
+
" <th></th>\n",
|
53 |
+
" <th>0</th>\n",
|
54 |
+
" <th>1</th>\n",
|
55 |
+
" <th>pdb</th>\n",
|
56 |
+
" <th>ligand_name</th>\n",
|
57 |
+
" <th>ligand_valid</th>\n",
|
58 |
+
" <th>affinity_quantity</th>\n",
|
59 |
+
" <th>6</th>\n",
|
60 |
+
" <th>affinity_val</th>\n",
|
61 |
+
" <th>affinity_unit</th>\n",
|
62 |
+
" <th>smiles</th>\n",
|
63 |
+
" <th>10</th>\n",
|
64 |
+
" </tr>\n",
|
65 |
+
" </thead>\n",
|
66 |
+
" <tbody>\n",
|
67 |
+
" <tr>\n",
|
68 |
+
" <th>0</th>\n",
|
69 |
+
" <td>NaN</td>\n",
|
70 |
+
" <td>NaN</td>\n",
|
71 |
+
" <td>NaN</td>\n",
|
72 |
+
" <td>HAE:C:989</td>\n",
|
73 |
+
" <td>valid</td>\n",
|
74 |
+
" <td>NaN</td>\n",
|
75 |
+
" <td>NaN</td>\n",
|
76 |
+
" <td>NaN</td>\n",
|
77 |
+
" <td>NaN</td>\n",
|
78 |
+
" <td>CC(=O)NO</td>\n",
|
79 |
+
" <td>NaN</td>\n",
|
80 |
+
" </tr>\n",
|
81 |
+
" <tr>\n",
|
82 |
+
" <th>1</th>\n",
|
83 |
+
" <td>NaN</td>\n",
|
84 |
+
" <td>NaN</td>\n",
|
85 |
+
" <td>NaN</td>\n",
|
86 |
+
" <td>NI:C:574</td>\n",
|
87 |
+
" <td>Part of Protein</td>\n",
|
88 |
+
" <td>NaN</td>\n",
|
89 |
+
" <td>NaN</td>\n",
|
90 |
+
" <td>NaN</td>\n",
|
91 |
+
" <td>NaN</td>\n",
|
92 |
+
" <td>[Ni+2]</td>\n",
|
93 |
+
" <td>NaN</td>\n",
|
94 |
+
" </tr>\n",
|
95 |
+
" <tr>\n",
|
96 |
+
" <th>2</th>\n",
|
97 |
+
" <td>NaN</td>\n",
|
98 |
+
" <td>NaN</td>\n",
|
99 |
+
" <td>NaN</td>\n",
|
100 |
+
" <td>NI:C:575</td>\n",
|
101 |
+
" <td>Part of Protein</td>\n",
|
102 |
+
" <td>NaN</td>\n",
|
103 |
+
" <td>NaN</td>\n",
|
104 |
+
" <td>NaN</td>\n",
|
105 |
+
" <td>NaN</td>\n",
|
106 |
+
" <td>[Ni+2]</td>\n",
|
107 |
+
" <td>NaN</td>\n",
|
108 |
+
" </tr>\n",
|
109 |
+
" <tr>\n",
|
110 |
+
" <th>3</th>\n",
|
111 |
+
" <td>NaN</td>\n",
|
112 |
+
" <td>Family. Representative Entry is</td>\n",
|
113 |
+
" <td>6H8J</td>\n",
|
114 |
+
" <td>NaN</td>\n",
|
115 |
+
" <td>NaN</td>\n",
|
116 |
+
" <td>NaN</td>\n",
|
117 |
+
" <td>NaN</td>\n",
|
118 |
+
" <td>NaN</td>\n",
|
119 |
+
" <td>NaN</td>\n",
|
120 |
+
" <td>NaN</td>\n",
|
121 |
+
" <td>NaN</td>\n",
|
122 |
+
" </tr>\n",
|
123 |
+
" <tr>\n",
|
124 |
+
" <th>4</th>\n",
|
125 |
+
" <td>NaN</td>\n",
|
126 |
+
" <td>NaN</td>\n",
|
127 |
+
" <td>NaN</td>\n",
|
128 |
+
" <td>SO4:C:611</td>\n",
|
129 |
+
" <td>invalid</td>\n",
|
130 |
+
" <td>NaN</td>\n",
|
131 |
+
" <td>NaN</td>\n",
|
132 |
+
" <td>NaN</td>\n",
|
133 |
+
" <td>NaN</td>\n",
|
134 |
+
" <td>[O-]S(=O)(=O)[O-]</td>\n",
|
135 |
+
" <td>NaN</td>\n",
|
136 |
+
" </tr>\n",
|
137 |
+
" <tr>\n",
|
138 |
+
" <th>...</th>\n",
|
139 |
+
" <td>...</td>\n",
|
140 |
+
" <td>...</td>\n",
|
141 |
+
" <td>...</td>\n",
|
142 |
+
" <td>...</td>\n",
|
143 |
+
" <td>...</td>\n",
|
144 |
+
" <td>...</td>\n",
|
145 |
+
" <td>...</td>\n",
|
146 |
+
" <td>...</td>\n",
|
147 |
+
" <td>...</td>\n",
|
148 |
+
" <td>...</td>\n",
|
149 |
+
" <td>...</td>\n",
|
150 |
+
" </tr>\n",
|
151 |
+
" <tr>\n",
|
152 |
+
" <th>306520</th>\n",
|
153 |
+
" <td>NaN</td>\n",
|
154 |
+
" <td>NaN</td>\n",
|
155 |
+
" <td>NaN</td>\n",
|
156 |
+
" <td>CA:D:1950</td>\n",
|
157 |
+
" <td>Part of Protein</td>\n",
|
158 |
+
" <td>NaN</td>\n",
|
159 |
+
" <td>NaN</td>\n",
|
160 |
+
" <td>NaN</td>\n",
|
161 |
+
" <td>NaN</td>\n",
|
162 |
+
" <td>[Ca+2]</td>\n",
|
163 |
+
" <td>NaN</td>\n",
|
164 |
+
" </tr>\n",
|
165 |
+
" <tr>\n",
|
166 |
+
" <th>306521</th>\n",
|
167 |
+
" <td>NaN</td>\n",
|
168 |
+
" <td>NaN</td>\n",
|
169 |
+
" <td>NaN</td>\n",
|
170 |
+
" <td>NGA NAG:F:1</td>\n",
|
171 |
+
" <td>valid</td>\n",
|
172 |
+
" <td>Ka</td>\n",
|
173 |
+
" <td>=</td>\n",
|
174 |
+
" <td>5910.0</td>\n",
|
175 |
+
" <td>M^-1</td>\n",
|
176 |
+
" <td>NaN</td>\n",
|
177 |
+
" <td>NaN</td>\n",
|
178 |
+
" </tr>\n",
|
179 |
+
" <tr>\n",
|
180 |
+
" <th>306522</th>\n",
|
181 |
+
" <td>NaN</td>\n",
|
182 |
+
" <td>NaN</td>\n",
|
183 |
+
" <td>NaN</td>\n",
|
184 |
+
" <td>NGA NAG:E:1</td>\n",
|
185 |
+
" <td>valid</td>\n",
|
186 |
+
" <td>Ka</td>\n",
|
187 |
+
" <td>=</td>\n",
|
188 |
+
" <td>5910.0</td>\n",
|
189 |
+
" <td>M^-1</td>\n",
|
190 |
+
" <td>NaN</td>\n",
|
191 |
+
" <td>NaN</td>\n",
|
192 |
+
" </tr>\n",
|
193 |
+
" <tr>\n",
|
194 |
+
" <th>306523</th>\n",
|
195 |
+
" <td>NaN</td>\n",
|
196 |
+
" <td>NaN</td>\n",
|
197 |
+
" <td>NaN</td>\n",
|
198 |
+
" <td>NGA NAG:H:1</td>\n",
|
199 |
+
" <td>valid</td>\n",
|
200 |
+
" <td>Ka</td>\n",
|
201 |
+
" <td>=</td>\n",
|
202 |
+
" <td>5910.0</td>\n",
|
203 |
+
" <td>M^-1</td>\n",
|
204 |
+
" <td>NaN</td>\n",
|
205 |
+
" <td>NaN</td>\n",
|
206 |
+
" </tr>\n",
|
207 |
+
" <tr>\n",
|
208 |
+
" <th>306524</th>\n",
|
209 |
+
" <td>NaN</td>\n",
|
210 |
+
" <td>NaN</td>\n",
|
211 |
+
" <td>NaN</td>\n",
|
212 |
+
" <td>A2G NAG:G:1</td>\n",
|
213 |
+
" <td>invalid</td>\n",
|
214 |
+
" <td>NaN</td>\n",
|
215 |
+
" <td>NaN</td>\n",
|
216 |
+
" <td>NaN</td>\n",
|
217 |
+
" <td>NaN</td>\n",
|
218 |
+
" <td>NaN</td>\n",
|
219 |
+
" <td>NaN</td>\n",
|
220 |
+
" </tr>\n",
|
221 |
+
" </tbody>\n",
|
222 |
+
"</table>\n",
|
223 |
+
"<p>306525 rows × 11 columns</p>\n",
|
224 |
+
"</div>"
|
225 |
+
],
|
226 |
+
"text/plain": [
|
227 |
+
" 0 1 pdb ligand_name \\\n",
|
228 |
+
"0 NaN NaN NaN HAE:C:989 \n",
|
229 |
+
"1 NaN NaN NaN NI:C:574 \n",
|
230 |
+
"2 NaN NaN NaN NI:C:575 \n",
|
231 |
+
"3 NaN Family. Representative Entry is 6H8J NaN \n",
|
232 |
+
"4 NaN NaN NaN SO4:C:611 \n",
|
233 |
+
"... ... ... ... ... \n",
|
234 |
+
"306520 NaN NaN NaN CA:D:1950 \n",
|
235 |
+
"306521 NaN NaN NaN NGA NAG:F:1 \n",
|
236 |
+
"306522 NaN NaN NaN NGA NAG:E:1 \n",
|
237 |
+
"306523 NaN NaN NaN NGA NAG:H:1 \n",
|
238 |
+
"306524 NaN NaN NaN A2G NAG:G:1 \n",
|
239 |
+
"\n",
|
240 |
+
" ligand_valid affinity_quantity 6 affinity_val affinity_unit \\\n",
|
241 |
+
"0 valid NaN NaN NaN NaN \n",
|
242 |
+
"1 Part of Protein NaN NaN NaN NaN \n",
|
243 |
+
"2 Part of Protein NaN NaN NaN NaN \n",
|
244 |
+
"3 NaN NaN NaN NaN NaN \n",
|
245 |
+
"4 invalid NaN NaN NaN NaN \n",
|
246 |
+
"... ... ... ... ... ... \n",
|
247 |
+
"306520 Part of Protein NaN NaN NaN NaN \n",
|
248 |
+
"306521 valid Ka = 5910.0 M^-1 \n",
|
249 |
+
"306522 valid Ka = 5910.0 M^-1 \n",
|
250 |
+
"306523 valid Ka = 5910.0 M^-1 \n",
|
251 |
+
"306524 invalid NaN NaN NaN NaN \n",
|
252 |
+
"\n",
|
253 |
+
" smiles 10 \n",
|
254 |
+
"0 CC(=O)NO NaN \n",
|
255 |
+
"1 [Ni+2] NaN \n",
|
256 |
+
"2 [Ni+2] NaN \n",
|
257 |
+
"3 NaN NaN \n",
|
258 |
+
"4 [O-]S(=O)(=O)[O-] NaN \n",
|
259 |
+
"... ... .. \n",
|
260 |
+
"306520 [Ca+2] NaN \n",
|
261 |
+
"306521 NaN NaN \n",
|
262 |
+
"306522 NaN NaN \n",
|
263 |
+
"306523 NaN NaN \n",
|
264 |
+
"306524 NaN NaN \n",
|
265 |
+
"\n",
|
266 |
+
"[306525 rows x 11 columns]"
|
267 |
+
]
|
268 |
+
},
|
269 |
+
"execution_count": 3,
|
270 |
+
"metadata": {},
|
271 |
+
"output_type": "execute_result"
|
272 |
+
}
|
273 |
+
],
|
274 |
+
"source": [
|
275 |
+
"df"
|
276 |
+
]
|
277 |
+
},
|
278 |
{
|
279 |
"cell_type": "code",
|
280 |
"execution_count": 3,
|
|
|
839 |
},
|
840 |
{
|
841 |
"cell_type": "code",
|
842 |
+
"execution_count": 5,
|
843 |
"id": "49a160d6-4599-488a-ba02-a65a79535f38",
|
844 |
"metadata": {},
|
845 |
"outputs": [],
|
846 |
+
"source": [
|
847 |
+
"df_all = pd.read_parquet('data/moad.parquet')"
|
848 |
+
]
|
849 |
+
},
|
850 |
+
{
|
851 |
+
"cell_type": "code",
|
852 |
+
"execution_count": null,
|
853 |
+
"id": "bebcbe84-fa6d-4e39-bd26-40ed173e0e67",
|
854 |
+
"metadata": {},
|
855 |
+
"outputs": [],
|
856 |
"source": []
|
857 |
}
|
858 |
],
|
pdbbind.ipynb
CHANGED
@@ -10,7 +10,7 @@
|
|
10 |
},
|
11 |
{
|
12 |
"cell_type": "code",
|
13 |
-
"execution_count":
|
14 |
"id": "86476f6e-802a-463b-a1b0-2ae228bb92af",
|
15 |
"metadata": {},
|
16 |
"outputs": [],
|
@@ -20,7 +20,7 @@
|
|
20 |
},
|
21 |
{
|
22 |
"cell_type": "code",
|
23 |
-
"execution_count":
|
24 |
"id": "9b2be11c-f4bb-4107-af49-abd78052afcf",
|
25 |
"metadata": {},
|
26 |
"outputs": [],
|
@@ -34,7 +34,7 @@
|
|
34 |
},
|
35 |
{
|
36 |
"cell_type": "code",
|
37 |
-
"execution_count":
|
38 |
"id": "68983ab8-bf11-4ed6-ba06-f962dbdc077e",
|
39 |
"metadata": {},
|
40 |
"outputs": [],
|
@@ -44,7 +44,7 @@
|
|
44 |
},
|
45 |
{
|
46 |
"cell_type": "code",
|
47 |
-
"execution_count":
|
48 |
"id": "3acbca3c-9c0b-43a1-a45e-331bf153bcfa",
|
49 |
"metadata": {},
|
50 |
"outputs": [],
|
@@ -67,7 +67,7 @@
|
|
67 |
},
|
68 |
{
|
69 |
"cell_type": "code",
|
70 |
-
"execution_count":
|
71 |
"id": "58e5748b-2cea-43ff-ab51-85a5021bd50b",
|
72 |
"metadata": {},
|
73 |
"outputs": [],
|
@@ -78,7 +78,7 @@
|
|
78 |
},
|
79 |
{
|
80 |
"cell_type": "code",
|
81 |
-
"execution_count":
|
82 |
"id": "d92f0004-68c1-4487-94b9-56b4fd598de4",
|
83 |
"metadata": {},
|
84 |
"outputs": [
|
@@ -88,7 +88,7 @@
|
|
88 |
"<AxesSubplot:>"
|
89 |
]
|
90 |
},
|
91 |
-
"execution_count":
|
92 |
"metadata": {},
|
93 |
"output_type": "execute_result"
|
94 |
},
|
@@ -111,7 +111,7 @@
|
|
111 |
},
|
112 |
{
|
113 |
"cell_type": "code",
|
114 |
-
"execution_count":
|
115 |
"id": "aa358835-55f3-4551-9217-e76a15de4fe8",
|
116 |
"metadata": {},
|
117 |
"outputs": [],
|
@@ -121,7 +121,7 @@
|
|
121 |
},
|
122 |
{
|
123 |
"cell_type": "code",
|
124 |
-
"execution_count":
|
125 |
"id": "d6dda488-f709-4fe7-b372-080042cf7c66",
|
126 |
"metadata": {},
|
127 |
"outputs": [],
|
@@ -131,7 +131,7 @@
|
|
131 |
},
|
132 |
{
|
133 |
"cell_type": "code",
|
134 |
-
"execution_count":
|
135 |
"id": "df7929e3-c7fd-4e1b-a165-92f8d53b9011",
|
136 |
"metadata": {},
|
137 |
"outputs": [],
|
@@ -139,6 +139,186 @@
|
|
139 |
"df_all = df_complex.merge(df_filter,on='name').drop('affinity',axis=1)"
|
140 |
]
|
141 |
},
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
142 |
{
|
143 |
"cell_type": "code",
|
144 |
"execution_count": 53,
|
|
|
10 |
},
|
11 |
{
|
12 |
"cell_type": "code",
|
13 |
+
"execution_count": 1,
|
14 |
"id": "86476f6e-802a-463b-a1b0-2ae228bb92af",
|
15 |
"metadata": {},
|
16 |
"outputs": [],
|
|
|
20 |
},
|
21 |
{
|
22 |
"cell_type": "code",
|
23 |
+
"execution_count": 12,
|
24 |
"id": "9b2be11c-f4bb-4107-af49-abd78052afcf",
|
25 |
"metadata": {},
|
26 |
"outputs": [],
|
|
|
34 |
},
|
35 |
{
|
36 |
"cell_type": "code",
|
37 |
+
"execution_count": 13,
|
38 |
"id": "68983ab8-bf11-4ed6-ba06-f962dbdc077e",
|
39 |
"metadata": {},
|
40 |
"outputs": [],
|
|
|
44 |
},
|
45 |
{
|
46 |
"cell_type": "code",
|
47 |
+
"execution_count": 14,
|
48 |
"id": "3acbca3c-9c0b-43a1-a45e-331bf153bcfa",
|
49 |
"metadata": {},
|
50 |
"outputs": [],
|
|
|
67 |
},
|
68 |
{
|
69 |
"cell_type": "code",
|
70 |
+
"execution_count": 15,
|
71 |
"id": "58e5748b-2cea-43ff-ab51-85a5021bd50b",
|
72 |
"metadata": {},
|
73 |
"outputs": [],
|
|
|
78 |
},
|
79 |
{
|
80 |
"cell_type": "code",
|
81 |
+
"execution_count": 16,
|
82 |
"id": "d92f0004-68c1-4487-94b9-56b4fd598de4",
|
83 |
"metadata": {},
|
84 |
"outputs": [
|
|
|
88 |
"<AxesSubplot:>"
|
89 |
]
|
90 |
},
|
91 |
+
"execution_count": 16,
|
92 |
"metadata": {},
|
93 |
"output_type": "execute_result"
|
94 |
},
|
|
|
111 |
},
|
112 |
{
|
113 |
"cell_type": "code",
|
114 |
+
"execution_count": 17,
|
115 |
"id": "aa358835-55f3-4551-9217-e76a15de4fe8",
|
116 |
"metadata": {},
|
117 |
"outputs": [],
|
|
|
121 |
},
|
122 |
{
|
123 |
"cell_type": "code",
|
124 |
+
"execution_count": 18,
|
125 |
"id": "d6dda488-f709-4fe7-b372-080042cf7c66",
|
126 |
"metadata": {},
|
127 |
"outputs": [],
|
|
|
131 |
},
|
132 |
{
|
133 |
"cell_type": "code",
|
134 |
+
"execution_count": 20,
|
135 |
"id": "df7929e3-c7fd-4e1b-a165-92f8d53b9011",
|
136 |
"metadata": {},
|
137 |
"outputs": [],
|
|
|
139 |
"df_all = df_complex.merge(df_filter,on='name').drop('affinity',axis=1)"
|
140 |
]
|
141 |
},
|
142 |
+
{
|
143 |
+
"cell_type": "code",
|
144 |
+
"execution_count": 21,
|
145 |
+
"id": "41711825-b110-472b-a9f3-2eccc5afbfd9",
|
146 |
+
"metadata": {},
|
147 |
+
"outputs": [
|
148 |
+
{
|
149 |
+
"data": {
|
150 |
+
"text/html": [
|
151 |
+
"<div>\n",
|
152 |
+
"<style scoped>\n",
|
153 |
+
" .dataframe tbody tr th:only-of-type {\n",
|
154 |
+
" vertical-align: middle;\n",
|
155 |
+
" }\n",
|
156 |
+
"\n",
|
157 |
+
" .dataframe tbody tr th {\n",
|
158 |
+
" vertical-align: top;\n",
|
159 |
+
" }\n",
|
160 |
+
"\n",
|
161 |
+
" .dataframe thead th {\n",
|
162 |
+
" text-align: right;\n",
|
163 |
+
" }\n",
|
164 |
+
"</style>\n",
|
165 |
+
"<table border=\"1\" class=\"dataframe\">\n",
|
166 |
+
" <thead>\n",
|
167 |
+
" <tr style=\"text-align: right;\">\n",
|
168 |
+
" <th></th>\n",
|
169 |
+
" <th>name</th>\n",
|
170 |
+
" <th>seq</th>\n",
|
171 |
+
" <th>smiles</th>\n",
|
172 |
+
" <th>affinity_uM</th>\n",
|
173 |
+
" <th>affinity_quantity</th>\n",
|
174 |
+
" </tr>\n",
|
175 |
+
" </thead>\n",
|
176 |
+
" <tbody>\n",
|
177 |
+
" <tr>\n",
|
178 |
+
" <th>0</th>\n",
|
179 |
+
" <td>2lbv</td>\n",
|
180 |
+
" <td>MTVPDRSEIAGKWYVVALASNTEFFLREKDKMKMAMARISFLGEDE...</td>\n",
|
181 |
+
" <td>CCCCCCCCCCCCCCCCCCCC(=O)O</td>\n",
|
182 |
+
" <td>0.02600</td>\n",
|
183 |
+
" <td>Kd</td>\n",
|
184 |
+
" </tr>\n",
|
185 |
+
" <tr>\n",
|
186 |
+
" <th>1</th>\n",
|
187 |
+
" <td>1lt6</td>\n",
|
188 |
+
" <td>APQTITELCSEYRNTQIYTINDKILSYTESMAGKREMVIITFKSGE...</td>\n",
|
189 |
+
" <td>OC[C@H]1O[C@H](Oc2cccc(c2)N(=O)=O)[C@@H]([C@H]...</td>\n",
|
190 |
+
" <td>500.00000</td>\n",
|
191 |
+
" <td>IC50</td>\n",
|
192 |
+
" </tr>\n",
|
193 |
+
" <tr>\n",
|
194 |
+
" <th>2</th>\n",
|
195 |
+
" <td>4lwi</td>\n",
|
196 |
+
" <td>VETFAFQAEIAQLMSLIINTFYSNKEIFLRELISNSSDALDKIRYE...</td>\n",
|
197 |
+
" <td>COc1ccc(cc1)c1c(onc1c1cc(C(C)C)c(cc1O)O)NC(=O)...</td>\n",
|
198 |
+
" <td>0.02300</td>\n",
|
199 |
+
" <td>IC50</td>\n",
|
200 |
+
" </tr>\n",
|
201 |
+
" <tr>\n",
|
202 |
+
" <th>3</th>\n",
|
203 |
+
" <td>3t4p</td>\n",
|
204 |
+
" <td>AAPFDKSKNVAQSIDQLIGQTPALYLNKLNNTKAKVVLKMECENPM...</td>\n",
|
205 |
+
" <td>OC[C@@H](C(=O)N[C@@H]([C@H](CC)C)C(=O)O)NC(=O)...</td>\n",
|
206 |
+
" <td>6.43000</td>\n",
|
207 |
+
" <td>Kd</td>\n",
|
208 |
+
" </tr>\n",
|
209 |
+
" <tr>\n",
|
210 |
+
" <th>4</th>\n",
|
211 |
+
" <td>6oyz</td>\n",
|
212 |
+
" <td>YITFRSFTAVLIAFFLTLVLSPSFINRLRKIQRKKYTPTMGGIVIL...</td>\n",
|
213 |
+
" <td>CO[C@@H]1[C@H](O[C@H]([C@@H]1O)n1ccc(=O)[nH]c1...</td>\n",
|
214 |
+
" <td>0.18500</td>\n",
|
215 |
+
" <td>IC50</td>\n",
|
216 |
+
" </tr>\n",
|
217 |
+
" <tr>\n",
|
218 |
+
" <th>...</th>\n",
|
219 |
+
" <td>...</td>\n",
|
220 |
+
" <td>...</td>\n",
|
221 |
+
" <td>...</td>\n",
|
222 |
+
" <td>...</td>\n",
|
223 |
+
" <td>...</td>\n",
|
224 |
+
" </tr>\n",
|
225 |
+
" <tr>\n",
|
226 |
+
" <th>24754</th>\n",
|
227 |
+
" <td>4j46</td>\n",
|
228 |
+
" <td>GTIYPRNPAMYSEEARLKSFQNWPDYAHLTPRELASAGLYYTGIGD...</td>\n",
|
229 |
+
" <td>CC[C@@H]([C@@H](C(=O)O)NC(=O)[C@@H]1CCCN1C(=O)...</td>\n",
|
230 |
+
" <td>5.24000</td>\n",
|
231 |
+
" <td>Ki</td>\n",
|
232 |
+
" </tr>\n",
|
233 |
+
" <tr>\n",
|
234 |
+
" <th>24755</th>\n",
|
235 |
+
" <td>2c80</td>\n",
|
236 |
+
" <td>DHIKVIYFNGRGRAESIRMTLVAAGVNYEDERISFQDWPKIKPTIP...</td>\n",
|
237 |
+
" <td>CCCCCCSC[C@@H](C(=O)NCC(=O)O)NC(=O)CC[C@@H](C(...</td>\n",
|
238 |
+
" <td>4.70000</td>\n",
|
239 |
+
" <td>Kd</td>\n",
|
240 |
+
" </tr>\n",
|
241 |
+
" <tr>\n",
|
242 |
+
" <th>24756</th>\n",
|
243 |
+
" <td>2c80</td>\n",
|
244 |
+
" <td>DHIKVIYFNGRGRAESIRMTLVAAGVNYEDERISFQDWPKIKPTIP...</td>\n",
|
245 |
+
" <td>CCCCCCSC[C@@H](C(=O)NCC(=O)O)NC(=O)CC[C@@H](C(...</td>\n",
|
246 |
+
" <td>4.70000</td>\n",
|
247 |
+
" <td>Kd</td>\n",
|
248 |
+
" </tr>\n",
|
249 |
+
" <tr>\n",
|
250 |
+
" <th>24757</th>\n",
|
251 |
+
" <td>5wl0</td>\n",
|
252 |
+
" <td>NDDIDQSLIIAARNIVRRASVSADPLASLLEMCHSTQIGGTRMVDI...</td>\n",
|
253 |
+
" <td>OC(=O)[C@H]1[C@@H]2CC[C@H]([C@@H]1Nc1nc(ncc1F)...</td>\n",
|
254 |
+
" <td>0.00067</td>\n",
|
255 |
+
" <td>Kd</td>\n",
|
256 |
+
" </tr>\n",
|
257 |
+
" <tr>\n",
|
258 |
+
" <th>24758</th>\n",
|
259 |
+
" <td>5wl0</td>\n",
|
260 |
+
" <td>NDDIDQSLIIAARNIVRRASVSADPLASLLEMCHSTQIGGTRMVDI...</td>\n",
|
261 |
+
" <td>OC(=O)[C@H]1[C@@H]2CC[C@H]([C@@H]1Nc1nc(ncc1F)...</td>\n",
|
262 |
+
" <td>0.00067</td>\n",
|
263 |
+
" <td>Kd</td>\n",
|
264 |
+
" </tr>\n",
|
265 |
+
" </tbody>\n",
|
266 |
+
"</table>\n",
|
267 |
+
"<p>24759 rows × 5 columns</p>\n",
|
268 |
+
"</div>"
|
269 |
+
],
|
270 |
+
"text/plain": [
|
271 |
+
" name seq \\\n",
|
272 |
+
"0 2lbv MTVPDRSEIAGKWYVVALASNTEFFLREKDKMKMAMARISFLGEDE... \n",
|
273 |
+
"1 1lt6 APQTITELCSEYRNTQIYTINDKILSYTESMAGKREMVIITFKSGE... \n",
|
274 |
+
"2 4lwi VETFAFQAEIAQLMSLIINTFYSNKEIFLRELISNSSDALDKIRYE... \n",
|
275 |
+
"3 3t4p AAPFDKSKNVAQSIDQLIGQTPALYLNKLNNTKAKVVLKMECENPM... \n",
|
276 |
+
"4 6oyz YITFRSFTAVLIAFFLTLVLSPSFINRLRKIQRKKYTPTMGGIVIL... \n",
|
277 |
+
"... ... ... \n",
|
278 |
+
"24754 4j46 GTIYPRNPAMYSEEARLKSFQNWPDYAHLTPRELASAGLYYTGIGD... \n",
|
279 |
+
"24755 2c80 DHIKVIYFNGRGRAESIRMTLVAAGVNYEDERISFQDWPKIKPTIP... \n",
|
280 |
+
"24756 2c80 DHIKVIYFNGRGRAESIRMTLVAAGVNYEDERISFQDWPKIKPTIP... \n",
|
281 |
+
"24757 5wl0 NDDIDQSLIIAARNIVRRASVSADPLASLLEMCHSTQIGGTRMVDI... \n",
|
282 |
+
"24758 5wl0 NDDIDQSLIIAARNIVRRASVSADPLASLLEMCHSTQIGGTRMVDI... \n",
|
283 |
+
"\n",
|
284 |
+
" smiles affinity_uM \\\n",
|
285 |
+
"0 CCCCCCCCCCCCCCCCCCCC(=O)O 0.02600 \n",
|
286 |
+
"1 OC[C@H]1O[C@H](Oc2cccc(c2)N(=O)=O)[C@@H]([C@H]... 500.00000 \n",
|
287 |
+
"2 COc1ccc(cc1)c1c(onc1c1cc(C(C)C)c(cc1O)O)NC(=O)... 0.02300 \n",
|
288 |
+
"3 OC[C@@H](C(=O)N[C@@H]([C@H](CC)C)C(=O)O)NC(=O)... 6.43000 \n",
|
289 |
+
"4 CO[C@@H]1[C@H](O[C@H]([C@@H]1O)n1ccc(=O)[nH]c1... 0.18500 \n",
|
290 |
+
"... ... ... \n",
|
291 |
+
"24754 CC[C@@H]([C@@H](C(=O)O)NC(=O)[C@@H]1CCCN1C(=O)... 5.24000 \n",
|
292 |
+
"24755 CCCCCCSC[C@@H](C(=O)NCC(=O)O)NC(=O)CC[C@@H](C(... 4.70000 \n",
|
293 |
+
"24756 CCCCCCSC[C@@H](C(=O)NCC(=O)O)NC(=O)CC[C@@H](C(... 4.70000 \n",
|
294 |
+
"24757 OC(=O)[C@H]1[C@@H]2CC[C@H]([C@@H]1Nc1nc(ncc1F)... 0.00067 \n",
|
295 |
+
"24758 OC(=O)[C@H]1[C@@H]2CC[C@H]([C@@H]1Nc1nc(ncc1F)... 0.00067 \n",
|
296 |
+
"\n",
|
297 |
+
" affinity_quantity \n",
|
298 |
+
"0 Kd \n",
|
299 |
+
"1 IC50 \n",
|
300 |
+
"2 IC50 \n",
|
301 |
+
"3 Kd \n",
|
302 |
+
"4 IC50 \n",
|
303 |
+
"... ... \n",
|
304 |
+
"24754 Ki \n",
|
305 |
+
"24755 Kd \n",
|
306 |
+
"24756 Kd \n",
|
307 |
+
"24757 Kd \n",
|
308 |
+
"24758 Kd \n",
|
309 |
+
"\n",
|
310 |
+
"[24759 rows x 5 columns]"
|
311 |
+
]
|
312 |
+
},
|
313 |
+
"execution_count": 21,
|
314 |
+
"metadata": {},
|
315 |
+
"output_type": "execute_result"
|
316 |
+
}
|
317 |
+
],
|
318 |
+
"source": [
|
319 |
+
"df_all"
|
320 |
+
]
|
321 |
+
},
|
322 |
{
|
323 |
"cell_type": "code",
|
324 |
"execution_count": 53,
|