Spaces:
Sleeping
Sleeping
legend1234
commited on
Commit
•
8b94f20
1
Parent(s):
5bd9791
Update config.toml and sample input SMILES file
Browse files- .streamlit/config.toml +330 -3
- sample_input_smiles.csv +6 -7
.streamlit/config.toml
CHANGED
@@ -1,5 +1,332 @@
|
|
1 |
-
|
2 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
3 |
|
4 |
[server]
|
5 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
|
2 |
+
[global]
|
3 |
+
|
4 |
+
# By default, Streamlit checks if the Python watchdog module is available
|
5 |
+
# and, if not, prints a warning asking for you to install it. The watchdog
|
6 |
+
# module is not required, but highly recommended. It improves Streamlit's
|
7 |
+
# ability to detect changes to files in your filesystem.
|
8 |
+
|
9 |
+
# If you'd like to turn off this warning, set this to True.
|
10 |
+
|
11 |
+
# Default: false
|
12 |
+
# disableWatchdogWarning = false
|
13 |
+
|
14 |
+
# By default, Streamlit displays a warning when a user sets both a widget
|
15 |
+
# default value in the function defining the widget and a widget value via
|
16 |
+
# the widget's key in `st.session_state`.
|
17 |
+
|
18 |
+
# If you'd like to turn off this warning, set this to True.
|
19 |
+
|
20 |
+
# Default: false
|
21 |
+
# disableWidgetStateDuplicationWarning = false
|
22 |
+
|
23 |
+
# If True, will show a warning when you run a Streamlit-enabled script
|
24 |
+
# via "python my_script.py".
|
25 |
+
|
26 |
+
# Default: true
|
27 |
+
# showWarningOnDirectExecution = true
|
28 |
+
|
29 |
+
# DataFrame serialization.
|
30 |
+
|
31 |
+
# Acceptable values:
|
32 |
+
# - 'legacy': Serialize DataFrames using Streamlit's custom format. Slow
|
33 |
+
# but battle-tested.
|
34 |
+
# - 'arrow': Serialize DataFrames using Apache Arrow. Much faster and versatile.
|
35 |
+
|
36 |
+
# Default: "arrow"
|
37 |
+
dataFrameSerialization = "arrow"
|
38 |
+
|
39 |
+
|
40 |
+
[logger]
|
41 |
+
|
42 |
+
# Level of logging: 'error', 'warning', 'info', or 'debug'.
|
43 |
+
|
44 |
+
# Default: 'info'
|
45 |
+
# level = "info"
|
46 |
+
|
47 |
+
# String format for logging messages. If logger.datetimeFormat is set,
|
48 |
+
# logger messages will default to `%(asctime)s.%(msecs)03d %(message)s`. See
|
49 |
+
# [Python's documentation](https://docs.python.org/2.6/library/logging.html#formatter-objects)
|
50 |
+
# for available attributes.
|
51 |
+
|
52 |
+
# Default: "%(asctime)s %(message)s"
|
53 |
+
# messageFormat = "%(asctime)s %(message)s"
|
54 |
+
|
55 |
+
|
56 |
+
[client]
|
57 |
+
|
58 |
+
# Whether to enable st.cache. This does not affect st.cache_data or
|
59 |
+
# st.cache_resource.
|
60 |
+
|
61 |
+
# Default: true
|
62 |
+
caching = true
|
63 |
+
|
64 |
+
# If false, makes your Streamlit script not draw to a
|
65 |
+
# Streamlit app.
|
66 |
+
|
67 |
+
# Default: true
|
68 |
+
# displayEnabled = true
|
69 |
+
|
70 |
+
# Controls whether uncaught app exceptions and deprecation warnings
|
71 |
+
# are displayed in the browser. By default, this is set to True and
|
72 |
+
# Streamlit displays app exceptions and associated tracebacks, and
|
73 |
+
# deprecation warnings, in the browser.
|
74 |
+
|
75 |
+
# If set to False, deprecation warnings and full exception messages
|
76 |
+
# will print to the console only. Exceptions will still display in the
|
77 |
+
# browser with a generic error message. For now, the exception type and
|
78 |
+
# traceback show in the browser also, but they will be removed in the
|
79 |
+
# future.
|
80 |
+
|
81 |
+
# Default: true
|
82 |
+
# showErrorDetails = true
|
83 |
+
|
84 |
+
# Change the visibility of items in the toolbar, options menu,
|
85 |
+
# and settings dialog (top right of the app).
|
86 |
+
|
87 |
+
# Allowed values:
|
88 |
+
# * "auto" : Show the developer options if the app is accessed through
|
89 |
+
# localhost or through Streamlit Community Cloud as a developer.
|
90 |
+
# Hide them otherwise.
|
91 |
+
# * "developer" : Show the developer options.
|
92 |
+
# * "viewer" : Hide the developer options.
|
93 |
+
# * "minimal" : Show only options set externally (e.g. through
|
94 |
+
# Streamlit Community Cloud) or through st.set_page_config.
|
95 |
+
# If there are no options left, hide the menu.
|
96 |
+
|
97 |
+
# Default: "auto"
|
98 |
+
# toolbarMode = "auto"
|
99 |
+
|
100 |
+
|
101 |
+
[runner]
|
102 |
+
|
103 |
+
# Allows you to type a variable or string by itself in a single line of
|
104 |
+
# Python code to write it to the app.
|
105 |
+
|
106 |
+
# Default: true
|
107 |
+
# magicEnabled = true
|
108 |
+
|
109 |
+
# Install a Python tracer to allow you to stop or pause your script at
|
110 |
+
# any point and introspect it. As a side-effect, this slows down your
|
111 |
+
# script's execution.
|
112 |
+
|
113 |
+
# Default: false
|
114 |
+
# installTracer = false
|
115 |
+
|
116 |
+
# Sets the MPLBACKEND environment variable to Agg inside Streamlit to
|
117 |
+
# prevent Python crashing.
|
118 |
+
|
119 |
+
# Default: true
|
120 |
+
# fixMatplotlib = true
|
121 |
+
|
122 |
+
# Run the Python Garbage Collector after each script execution. This
|
123 |
+
# can help avoid excess memory use in Streamlit apps, but could
|
124 |
+
# introduce delay in rerunning the app script for high-memory-use
|
125 |
+
# applications.
|
126 |
+
|
127 |
+
# Default: true
|
128 |
+
# postScriptGC = true
|
129 |
+
|
130 |
+
# Handle script rerun requests immediately, rather than waiting for script
|
131 |
+
# execution to reach a yield point. This makes Streamlit much more
|
132 |
+
# responsive to user interaction, but it can lead to race conditions in
|
133 |
+
# apps that mutate session_state data outside of explicit session_state
|
134 |
+
# assignment statements.
|
135 |
+
|
136 |
+
# Default: true
|
137 |
+
# fastReruns = true
|
138 |
+
|
139 |
+
# Raise an exception after adding unserializable data to Session State.
|
140 |
+
# Some execution environments may require serializing all data in Session
|
141 |
+
# State, so it may be useful to detect incompatibility during development,
|
142 |
+
# or when the execution environment will stop supporting it in the future.
|
143 |
+
|
144 |
+
# Default: false
|
145 |
+
# enforceSerializableSessionState = false
|
146 |
+
|
147 |
|
148 |
[server]
|
149 |
+
|
150 |
+
# List of folders that should not be watched for changes. This
|
151 |
+
# impacts both "Run on Save" and @st.cache.
|
152 |
+
|
153 |
+
# Relative paths will be taken as relative to the current working directory.
|
154 |
+
|
155 |
+
# Example: ['/home/user1/env', 'relative/path/to/folder']
|
156 |
+
|
157 |
+
# Default: []
|
158 |
+
# folderWatchBlacklist = []
|
159 |
+
|
160 |
+
# Change the type of file watcher used by Streamlit, or turn it off
|
161 |
+
# completely.
|
162 |
+
|
163 |
+
# Allowed values:
|
164 |
+
# * "auto" : Streamlit will attempt to use the watchdog module, and
|
165 |
+
# falls back to polling if watchdog is not available.
|
166 |
+
# * "watchdog" : Force Streamlit to use the watchdog module.
|
167 |
+
# * "poll" : Force Streamlit to always use polling.
|
168 |
+
# * "none" : Streamlit will not watch files.
|
169 |
+
|
170 |
+
# Default: "auto"
|
171 |
+
# fileWatcherType = "auto"
|
172 |
+
|
173 |
+
# Symmetric key used to produce signed cookies. If deploying on multiple replicas, this should
|
174 |
+
# be set to the same value across all replicas to ensure they all share the same secret.
|
175 |
+
|
176 |
+
# Default: randomly generated secret key.
|
177 |
+
# cookieSecret = "59320264f737a53fb01de73458c8849b0b623a7ba8174de8612fd569c2c25035"
|
178 |
+
|
179 |
+
# If false, will attempt to open a browser window on start.
|
180 |
+
|
181 |
+
# Default: false unless (1) we are on a Linux box where DISPLAY is unset, or
|
182 |
+
# (2) we are running in the Streamlit Atom plugin.
|
183 |
+
# headless = false
|
184 |
+
|
185 |
+
# Automatically rerun script when the file is modified on disk.
|
186 |
+
|
187 |
+
# Default: false
|
188 |
+
# runOnSave = false
|
189 |
+
|
190 |
+
# The address where the server will listen for client and browser
|
191 |
+
# connections. Use this if you want to bind the server to a specific address.
|
192 |
+
# If set, the server will only be accessible from this address, and not from
|
193 |
+
# any aliases (like localhost).
|
194 |
+
|
195 |
+
# Default: (unset)
|
196 |
+
# address =
|
197 |
+
|
198 |
+
# The port where the server will listen for browser connections.
|
199 |
+
|
200 |
+
# Default: 8501
|
201 |
+
# port = 8501
|
202 |
+
|
203 |
+
# The base path for the URL where Streamlit should be served from.
|
204 |
+
|
205 |
+
# Default: ""
|
206 |
+
# baseUrlPath = ""
|
207 |
+
|
208 |
+
# Enables support for Cross-Origin Resource Sharing (CORS) protection, for added security.
|
209 |
+
|
210 |
+
# Due to conflicts between CORS and XSRF, if `server.enableXsrfProtection` is on and
|
211 |
+
# `server.enableCORS` is off at the same time, we will prioritize `server.enableXsrfProtection`.
|
212 |
+
|
213 |
+
# Default: true
|
214 |
+
# enableCORS = true
|
215 |
+
|
216 |
+
# Enables support for Cross-Site Request Forgery (XSRF) protection, for added security.
|
217 |
+
|
218 |
+
# Due to conflicts between CORS and XSRF, if `server.enableXsrfProtection` is on and
|
219 |
+
# `server.enableCORS` is off at the same time, we will prioritize `server.enableXsrfProtection`.
|
220 |
+
|
221 |
+
# Default: true
|
222 |
+
# enableXsrfProtection = true
|
223 |
+
|
224 |
+
# Max size, in megabytes, for files uploaded with the file_uploader.
|
225 |
+
|
226 |
+
# Default: 200
|
227 |
+
maxUploadSize = 2
|
228 |
+
|
229 |
+
# Max size, in megabytes, of messages that can be sent via the WebSocket connection.
|
230 |
+
|
231 |
+
# Default: 200
|
232 |
+
# maxMessageSize = 200
|
233 |
+
|
234 |
+
# Enables support for websocket compression.
|
235 |
+
|
236 |
+
# Default: false
|
237 |
+
# enableWebsocketCompression = false
|
238 |
+
|
239 |
+
# Enable serving files from a `static` directory in the running app's directory.
|
240 |
+
|
241 |
+
# Default: false
|
242 |
+
# enableStaticServing = false
|
243 |
+
|
244 |
+
# Server certificate file for connecting via HTTPS.
|
245 |
+
# Must be set at the same time as "server.sslKeyFile".
|
246 |
+
|
247 |
+
# ['DO NOT USE THIS OPTION IN A PRODUCTION ENVIRONMENT. It has not gone through security audits or performance tests. For the production environment, we recommend performing SSL termination by the load balancer or the reverse proxy.']
|
248 |
+
# sslCertFile =
|
249 |
+
|
250 |
+
# Cryptographic key file for connecting via HTTPS.
|
251 |
+
# Must be set at the same time as "server.sslCertFile".
|
252 |
+
|
253 |
+
# ['DO NOT USE THIS OPTION IN A PRODUCTION ENVIRONMENT. It has not gone through security audits or performance tests. For the production environment, we recommend performing SSL termination by the load balancer or the reverse proxy.']
|
254 |
+
# sslKeyFile =
|
255 |
+
|
256 |
+
|
257 |
+
[browser]
|
258 |
+
|
259 |
+
# Internet address where users should point their browsers in order to
|
260 |
+
# connect to the app. Can be IP address or DNS name and path.
|
261 |
+
|
262 |
+
# This is used to:
|
263 |
+
# - Set the correct URL for CORS and XSRF protection purposes.
|
264 |
+
# - Show the URL on the terminal
|
265 |
+
# - Open the browser
|
266 |
+
|
267 |
+
# Default: "localhost"
|
268 |
+
# serverAddress = "localhost"
|
269 |
+
|
270 |
+
# Whether to send usage statistics to Streamlit.
|
271 |
+
|
272 |
+
# Default: true
|
273 |
+
# gatherUsageStats = true
|
274 |
+
|
275 |
+
# Port where users should point their browsers in order to connect to the
|
276 |
+
# app.
|
277 |
+
|
278 |
+
# This is used to:
|
279 |
+
# - Set the correct URL for CORS and XSRF protection purposes.
|
280 |
+
# - Show the URL on the terminal
|
281 |
+
# - Open the browser
|
282 |
+
|
283 |
+
# Default: whatever value is set in server.port.
|
284 |
+
# serverPort = 8501
|
285 |
+
|
286 |
+
|
287 |
+
[mapbox]
|
288 |
+
|
289 |
+
# Configure Streamlit to use a custom Mapbox
|
290 |
+
# token for elements like st.pydeck_chart and st.map.
|
291 |
+
# To get a token for yourself, create an account at
|
292 |
+
# https://mapbox.com. It's free (for moderate usage levels)!
|
293 |
+
|
294 |
+
# Default: ""
|
295 |
+
# token = ""
|
296 |
+
|
297 |
+
|
298 |
+
[deprecation]
|
299 |
+
|
300 |
+
# Set to false to disable the deprecation warning for the file uploader encoding.
|
301 |
+
|
302 |
+
# Default: true
|
303 |
+
# showfileUploaderEncoding = true
|
304 |
+
|
305 |
+
# Set to false to disable the deprecation warning for using the global pyplot instance.
|
306 |
+
|
307 |
+
# Default: true
|
308 |
+
# showPyplotGlobalUse = true
|
309 |
+
|
310 |
+
|
311 |
+
[theme]
|
312 |
+
|
313 |
+
# The preset Streamlit theme that your custom theme inherits from.
|
314 |
+
# One of "light" or "dark".
|
315 |
+
# base =
|
316 |
+
|
317 |
+
# Primary accent color for interactive elements.
|
318 |
+
# primaryColor =
|
319 |
+
|
320 |
+
# Background color for the main content area.
|
321 |
+
# backgroundColor =
|
322 |
+
|
323 |
+
# Background color used for the sidebar and most interactive widgets.
|
324 |
+
# secondaryBackgroundColor =
|
325 |
+
|
326 |
+
# Color used for almost all text.
|
327 |
+
# textColor =
|
328 |
+
|
329 |
+
# Font family for all text in the app, except code blocks. One of "sans serif",
|
330 |
+
# "serif", or "monospace".
|
331 |
+
font = "sans serif"
|
332 |
+
|
sample_input_smiles.csv
CHANGED
@@ -1,7 +1,6 @@
|
|
1 |
-
|
2 |
-
|
3 |
-
|
4 |
-
|
5 |
-
|
6 |
-
CC(=O)
|
7 |
-
CC(=O)OC1=C(C=C(C=C1)Cl)C(=O)OC(=O)C2=C(C=CC(=C2)Cl)OC(=O)C
|
|
|
1 |
+
OC(=O)CCCN1CCC(OC(c2ncccc2)c2ccc(Cl)cc2)CC1
|
2 |
+
OC(c1ccccc1)(c1ccccc1)C1CN2CCC1CC2
|
3 |
+
c1nc2c(cc1)CCc1cc(Cl)ccc1C2=C1CCN(Cc2cncc(C)c2)CC1
|
4 |
+
C1=CC=C2C(=C1)C=CC3=CC=CC=C3N2C(=O)N
|
5 |
+
CC(=O)Oc1ccccc1C(=O)O
|
6 |
+
CC(=O)Oc1c(cc(cc1)Cl)C(=O)OC(=O)c1c(ccc(c1)Cl)OC(=O)C
|
|