id
int64 0
71k
| molecules
dict | messages
listlengths 3
3
| ground_truth
stringclasses 1
value |
---|---|---|---|
200 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][N][C][C][=Branch1][C][=O][O]",
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][C][=C][Ring1][=Branch1][F]",
"[C][C][Branch1][C][C][Branch1][#Branch1][C][C][=Branch1][C][=O][O][N][C][=C][C][=C][C][=C][Ring1][=Branch1][N+1][=Branch1][C][=O][O-1]"
],
"smiles": [
"CC(C)(N)CC(=O)O",
"O=[N+]([O-])c1ccccc1F",
"CC(C)(CC(=O)O)Nc1ccccc1[N+](=O)[O-]"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
201 | {
"selfies": [
"[C][O][C][=C][C][=C][Branch1][Branch1][C][C][C][O][C][=C][Ring1][#Branch2]",
"[O][=C][C][C][C][=Branch1][C][=O][N][Ring1][=Branch1][Br]",
"[C][O][C][=C][C][=C][Branch1][Branch1][C][C][C][Br][C][=C][Ring1][#Branch2]"
],
"smiles": [
"COc1ccc(CCCO)cc1",
"O=C1CCC(=O)N1Br",
"COc1ccc(CCCBr)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
202 | {
"selfies": [
"[O][=C][C][=C][C][=N][C][=C][Ring1][=Branch1][S][N][Ring1][=Branch2][C][C][C][C][O][C][C][C][C][C][O][Ring1][=Branch1]",
"[O][=C][C][=C][C][=N][C][=C][Ring1][=Branch1][S][N][Ring1][=Branch2][C][C][C][C][O]"
],
"smiles": [
"O=c1c2ccncc2sn1CCCCOC1CCCCO1",
"O=c1c2ccncc2sn1CCCCO"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CO .",
"role": "assistant"
}
] | |
203 | {
"selfies": [
"[C][N][C][C][C][C][Ring1][Branch1][C][=C][N][=C][C][Branch1][Branch1][C][C][C][#N][=C][Ring1][#Branch2]",
"[C][N][C][C][C][C][Ring1][Branch1][C][=C][N][=C][C][Branch1][Branch1][C][C][C][N][=C][Ring1][#Branch2]"
],
"smiles": [
"CN1CCCC1c1cncc(CCC#N)c1",
"CN1CCCC1c1cncc(CCCN)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CO.N .",
"role": "assistant"
}
] | |
204 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][C][Branch1][C][Cl][=C][Branch1][=N][C][=C][C][=C][C][Branch1][Ring1][C][#N][=C][Ring1][Branch2][C][Branch1][=Branch1][C][Branch1][C][N][=O][=C][Ring1][P][C][Ring2][Ring1][Branch1]",
"[N][#C][C][=C][C][=C][C][Branch2][Ring1][Branch2][C][C][Branch1][=Branch1][C][Branch1][C][N][=O][=C][N][Branch1][Branch1][C][=Ring1][Branch2][Cl][C][C][N][C][Ring1][Branch2][=C][Ring2][Ring1][Ring1]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCn2c(Cl)c(-c3cccc(C#N)c3)c(C(N)=O)c2C1",
"N#Cc1cccc(-c2c(C(N)=O)c3n(c2Cl)CCNC3)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be ClCCl .",
"role": "assistant"
}
] | |
205 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][C][=C][N][=C][Branch2][=Branch1][Ring1][C][=C][C][=C][Branch2][Branch1][=Branch1][C][Branch1][Ring1][C][C][Branch1][Ring1][C][C][C][=C][C][=C][Branch2][Ring1][=C][C][C][C][Branch1][P][O][Si][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][C][C][Branch1][C][C][Branch1][C][C][C][C][Branch1][C][C][=C][Ring2][Ring1][=Branch1][C][=C][Ring2][Ring1][P][C][N][=C][Ring2][Ring2][Branch2]",
"[C][C][O][C][=Branch1][C][=O][C][C][=C][N][=C][Branch2][Branch1][C][C][=C][C][=C][Branch2][Ring2][Branch1][C][Branch1][Ring1][C][C][Branch1][Ring1][C][C][C][=C][C][=C][Branch1][#C][C][C][C][Branch1][C][O][C][Branch1][C][C][Branch1][C][C][C][C][Branch1][C][C][=C][Ring1][#C][C][=C][Ring2][Ring1][#Branch2][C][N][=C][Ring2][Ring1][P]"
],
"smiles": [
"CCOC(=O)Cc1cnc(-c2ccc(C(CC)(CC)c3ccc(CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C)c(C)c3)cc2C)nc1",
"CCOC(=O)Cc1cnc(-c2ccc(C(CC)(CC)c3ccc(CCC(O)C(C)(C)C)c(C)c3)cc2C)nc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
206 | {
"selfies": [
"[O][=N+1][Branch1][C][O-1][O]",
"[O][C][=C][C][=C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][=C]",
"[O][=N+1][Branch1][C][O-1][C][=C][C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][C][=C][Ring1][=C][O]"
],
"smiles": [
"O=[N+]([O-])O",
"Oc1ccc(OCc2ccccc2)cc1",
"O=[N+]([O-])c1cc(OCc2ccccc2)ccc1O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CC(=O)O .",
"role": "assistant"
}
] | |
207 | {
"selfies": [
"[C][N][Branch1][C][C][C][C][Cl]",
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][C][Branch1][C][O][=C][Ring1][#Branch1]",
"[C][N][Branch1][C][C][C][C][O][C][=C][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Ring1][=Branch2]"
],
"smiles": [
"CN(C)CCCl",
"O=[N+]([O-])c1cccc(O)c1",
"CN(C)CCOc1cccc([N+](=O)[O-])c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CS(C)=O .",
"role": "assistant"
}
] | |
208 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][Branch1][=C][O][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][#Branch1][O][C][Ring1][=N]",
"[O][C][C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][#Branch2]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][Branch2][Ring1][=C][O][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][#Branch1][O][C][C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][#Branch2][C][Ring2][Ring1][#Branch1]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CC(Oc2cc(Cl)ccc2O)C1",
"OC1CC(c2ccccc2)C1",
"CC(C)(C)OC(=O)N1CC(Oc2cc(Cl)ccc2OC2CC(c3ccccc3)C2)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be Cc1ccccc1 .",
"role": "assistant"
}
] | |
209 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][=C][C][C][O][C][Branch1][C][C][Branch1][C][C][O][Ring1][#Branch1][=C][Ring1][=N][F]",
"[C][C][Branch1][C][C][O][C][C][Branch1][P][C][=C][C][=C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][Ring1][=Branch2][F][O][Ring1][S]"
],
"smiles": [
"CCOC(=O)c1cccc(C2COC(C)(C)O2)c1F",
"CC1(C)OCC(c2cccc(C(=O)O)c2F)O1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
210 | {
"selfies": [
"[N][#C][C][C][=C][Branch1][C][F][C][=C][C][=C][Ring1][#Branch1][F]",
"[N][C][C][C][=C][Branch1][C][F][C][=C][C][=C][Ring1][#Branch1][F]"
],
"smiles": [
"N#CCc1c(F)cccc1F",
"NCCc1c(F)cccc1F"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
211 | {
"selfies": [
"[Br][C][=C][C][=C][C][=C][N][=C][C][=C][Ring1][#Branch2][Ring1][=Branch1]",
"[O][=C][Branch1][Ring1][O][O][C][=C][C][=C][C][Branch1][C][Cl][=C][Ring1][#Branch1]",
"[O-1][N+1][=C][C][=C][C][Branch1][C][Br][=C][C][=C][C][Ring1][#Branch1][=C][Ring1][O]"
],
"smiles": [
"Brc1cccc2cnccc12",
"O=C(OO)c1cccc(Cl)c1",
"[O-][n+]1ccc2c(Br)cccc2c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
212 | {
"selfies": [
"[C][C][C][C][C][C][C][C][Br]",
"[C][=C][C][=C][NH1][C][=C][C][Ring1][Branch1][=C][Ring1][=Branch2]",
"[C][C][C][C][C][C][C][C][N][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][=Branch2]"
],
"smiles": [
"CCCCCCCCBr",
"c1ccc2[nH]ccc2c1",
"CCCCCCCCn1ccc2ccccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "c1ccccc1 .",
"role": "assistant"
}
] | |
213 | {
"selfies": [
"[C][C][O][C][=C][C][=N][C][Branch1][Branch2][C][O][C][Branch1][C][C][=O][=C][Ring1][O][C]",
"[C][C][O][C][=C][C][=N][C][Branch1][Ring1][C][O][=C][Ring1][Branch2][C]"
],
"smiles": [
"CCOc1ccnc(COC(C)=O)c1C",
"CCOc1ccnc(CO)c1C"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "Cc1ccccc1 .",
"role": "assistant"
}
] | |
214 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][O][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]",
"[C][C][Branch1][C][C][Branch1][C][N][C][O]",
"[C][C][Branch1][C][C][Branch1][Ring1][C][O][N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]"
],
"smiles": [
"CC(C)(C)OC(=O)OC(=O)OC(C)(C)C",
"CC(C)(N)CO",
"CC(C)(CO)NC(=O)OC(C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be C1CCOC1.O .",
"role": "assistant"
}
] | |
215 | {
"selfies": [
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][Branch1][#C][O][C][=C][C][=N][C][C][=C][S][C][Ring1][=Branch2][=Ring1][Branch1][C][Branch1][C][F][=C][Ring1][P]",
"[N][C][=C][C][=C][Branch1][#C][O][C][=C][C][=N][C][C][=C][S][C][Ring1][=Branch2][=Ring1][Branch1][C][Branch1][C][F][=C][Ring1][P]"
],
"smiles": [
"O=[N+]([O-])c1ccc(Oc2ccnc3ccsc23)c(F)c1",
"Nc1ccc(Oc2ccnc3ccsc23)c(F)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
216 | {
"selfies": [
"[C][I]",
"[C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch2][N+1][=Branch1][C][=O][O-1]",
"[C][O][C][=Branch1][C][=O][C][=C][C][Branch1][C][Cl][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Ring1][#Branch2][C]"
],
"smiles": [
"CI",
"Cc1c(C(=O)O)cc(Cl)cc1[N+](=O)[O-]",
"COC(=O)c1cc(Cl)cc([N+](=O)[O-])c1C"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "CN(C)C=O.O .",
"role": "assistant"
}
] | |
217 | {
"selfies": [
"[C][O][C][O][C][=C][Branch2][Ring1][Branch1][C][=C][C][=C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][C][=C][C][=C][C][=C][Ring2][Ring1][N][Ring1][=Branch1]",
"[O][C][=C][Branch2][Ring1][Branch1][C][=C][C][=C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][C][=C][C][=C][C][=C][Ring2][Ring1][N][Ring1][=Branch1]"
],
"smiles": [
"COCOc1c(-c2ccc(OCc3ccccc3)cc2)c(C(F)(F)F)cc2ccccc12",
"Oc1c(-c2ccc(OCc3ccccc3)cc2)c(C(F)(F)F)cc2ccccc12"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "C1COCCO1 .",
"role": "assistant"
}
] | |
218 | {
"selfies": [
"[C][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][C][=C][Ring1][=Branch2][O][C][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][=N]",
"[C][C][=C][C][Branch1][C][N][=C][C][=C][Ring1][#Branch1][O][C][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][=N]"
],
"smiles": [
"Cc1cc([N+](=O)[O-])ccc1OC1CCN(C(=O)OC(C)(C)C)CC1",
"Cc1cc(N)ccc1OC1CCN(C(=O)OC(C)(C)C)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
219 | {
"selfies": [
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][C][C][C][C][C][Ring1][=Branch1]",
"[N][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][C][C][C][C][C][Ring1][=Branch1]"
],
"smiles": [
"O=[N+]([O-])c1ccccc1NC1CCCCC1",
"Nc1ccccc1NC1CCCCC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
220 | {
"selfies": [
"[O][=N+1][Branch1][C][O-1][C][=C][Branch1][C][Cl][C][=C][Branch1][C][Cl][C][=C][Ring1][Branch2][C][=N][NH1][C][=C][Ring1][Branch1][Cl]",
"[N][C][=C][Branch1][C][Cl][C][=C][Branch1][C][Cl][C][=C][Ring1][Branch2][C][=N][NH1][C][=C][Ring1][Branch1][Cl]"
],
"smiles": [
"O=[N+]([O-])c1c(Cl)cc(Cl)cc1-c1n[nH]cc1Cl",
"Nc1c(Cl)cc(Cl)cc1-c1n[nH]cc1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CC(=O)O .",
"role": "assistant"
}
] | |
221 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][C][N][=C][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][O][C][=Ring1][N][C][C][Branch1][C][C][C]",
"[C][C][Branch1][C][C][C][C][O][C][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][=N][C][=Ring1][N][C][C][=Branch1][C][=O][O]"
],
"smiles": [
"CCOC(=O)Cc1nc(-c2ccc(F)cc2)oc1CC(C)C",
"CC(C)Cc1oc(-c2ccc(F)cc2)nc1CC(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "O .",
"role": "assistant"
}
] | |
222 | {
"selfies": [
"[C][N][C]",
"[O][=C][Branch1][C][O][C][=C][C][Branch1][C][Br][=C][C][Branch1][C][I][=C][Ring1][Branch2]",
"[C][N][Branch1][C][C][C][=Branch1][C][=O][C][=C][C][Branch1][C][Br][=C][C][Branch1][C][I][=C][Ring1][Branch2]"
],
"smiles": [
"CNC",
"O=C(O)c1cc(Br)cc(I)c1",
"CN(C)C(=O)c1cc(Br)cc(I)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "O=S(Cl)Cl .",
"role": "assistant"
}
] | |
223 | {
"selfies": [
"[C][N][Branch1][C][C][C][=Branch1][C][=O][C][C][C][C][#C][C][=C][C][=C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][Ring1][=Branch2]",
"[N][C][C][C][Ring1][Ring1]",
"[C][N][Branch1][C][C][C][=Branch1][C][=O][C][C][C][C][#C][C][=C][C][=C][C][Branch1][O][C][=Branch1][C][=O][N][C][C][C][Ring1][Ring1][=C][Ring1][N]"
],
"smiles": [
"CN(C)C(=O)CCCC#Cc1cccc(C(=O)O)c1",
"NC1CC1",
"CN(C)C(=O)CCCC#Cc1cccc(C(=O)NC2CC2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
224 | {
"selfies": [
"[C][C][=Branch1][C][=O][O]",
"[C][C][Branch1][C][N][C][C][C][C][N][C][=Branch1][C][=O][C][=C][Branch1][#Branch1][N][=C][N][Ring1][Branch1][C][N][Branch1][C][C][C][Ring1][N][=O]",
"[C][C][=Branch1][C][=O][N][C][Branch1][C][C][C][C][C][C][N][C][=Branch1][C][=O][C][=C][Branch1][#Branch1][N][=C][N][Ring1][Branch1][C][N][Branch1][C][C][C][Ring1][N][=O]"
],
"smiles": [
"CC(=O)O",
"CC(N)CCCCn1c(=O)c2c(ncn2C)n(C)c1=O",
"CC(=O)NC(C)CCCCn1c(=O)c2c(ncn2C)n(C)c1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
225 | {
"selfies": [
"[C][C][=C][C][=C][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][Cl][C][=C][Ring1][#Branch2]",
"[Cl][C][=N][C][Branch1][C][Cl][=C][C][=C][NH1][C][Ring1][Branch1][=N][Ring1][#Branch2]",
"[C][C][=C][C][=C][Branch2][Ring1][O][S][=Branch1][C][=O][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][Cl][N][=C][Branch1][C][Cl][N][=C][Ring1][Branch2][Ring1][O][C][=C][Ring2][Ring1][Ring2]"
],
"smiles": [
"Cc1ccc(S(=O)(=O)Cl)cc1",
"Clc1nc(Cl)c2cc[nH]c2n1",
"Cc1ccc(S(=O)(=O)n2ccc3c(Cl)nc(Cl)nc32)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be ClCCl .",
"role": "assistant"
}
] | |
226 | {
"selfies": [
"[C][O][C][=C][C][=C][Branch1][=C][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][=C][Ring1][#C]",
"[C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1]"
],
"smiles": [
"COc1ccc(C(=O)c2ccccc2C)cc1",
"Cc1ccccc1C(=O)c1ccc(O)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "ClC(Cl)Cl.ClCCl .",
"role": "assistant"
}
] | |
227 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][#C][C][=C][C][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Ring1][Branch2][C][Ring2][Ring1][C]",
"[O][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][#C][C][=C][C][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Ring1][Branch2][C][Ring2][Ring1][C]"
],
"smiles": [
"CCOC(=O)C1Cc2ccccc2C(c2ccc(Cl)c(Cl)c2)C1",
"OCC1Cc2ccccc2C(c2ccc(Cl)c(Cl)c2)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
228 | {
"selfies": [
"[C][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][Branch1][C][Cl][=C][Ring1][O]",
"[O][=C][C][C][C][=Branch1][C][=O][N][Ring1][=Branch1][Br]",
"[F][C][Branch1][C][F][Branch1][C][F][C][=C][C][=C][Branch1][Ring1][C][Br][C][=C][Ring1][Branch2][Cl]"
],
"smiles": [
"Cc1ccc(C(F)(F)F)c(Cl)c1",
"O=C1CCC(=O)N1Br",
"FC(F)(F)c1ccc(CBr)cc1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be ClC(Cl)(Cl)Cl .",
"role": "assistant"
}
] | |
229 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][O][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]",
"[N][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CC(C)(C)OC(=O)OC(=O)OC(C)(C)C",
"NCC(C(=O)O)c1ccccc1",
"CC(C)(C)OC(=O)NCC(C(=O)O)c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "C1COCCO1.O .",
"role": "assistant"
}
] | |
230 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][Branch1][=Branch1][C][C][C][C][N][N][C][=C][C][Branch1][C][C][=C][Branch1][C][F][C][Branch1][C][C][=C][Ring1][=Branch2]",
"[C][C][=C][C][Branch1][Ring1][C][=O][=C][C][=C][Ring1][Branch2][F]",
"[C][O][C][=Branch1][C][=O][C][Branch2][Ring1][Branch1][C][C][C][C][N][C][C][=C][C][=C][Branch1][C][F][C][Branch1][C][C][=C][Ring1][Branch2][N][C][=C][C][Branch1][C][C][=C][Branch1][C][F][C][Branch1][C][C][=C][Ring1][=Branch2]"
],
"smiles": [
"COC(=O)C(CCCCN)Nc1cc(C)c(F)c(C)c1",
"Cc1cc(C=O)ccc1F",
"COC(=O)C(CCCCNCc1ccc(F)c(C)c1)Nc1cc(C)c(F)c(C)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CC(Cl)Cl .",
"role": "assistant"
}
] | |
231 | {
"selfies": [
"[C][O][C][=C][Branch1][P][N][C][C][N][Branch1][#Branch1][C][C][O][C][C][O][C][C][Ring1][N][C][Branch1][C][F][=C][C][C][=Branch1][C][=O][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][N][Branch1][#Branch1][C][C][C][Ring1][Ring1][F][C][Ring2][Ring1][#C][=Ring1][=C]",
"[N][C][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][Cl]",
"[C][O][C][=C][Branch1][P][N][C][C][N][Branch1][#Branch1][C][C][O][C][C][O][C][C][Ring1][N][C][Branch1][C][F][=C][C][C][=Branch1][C][=O][C][Branch2][Ring1][Ring1][C][=Branch1][C][=O][N][C][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][Cl][=C][N][Branch1][#Branch1][C][C][C][Ring1][Ring1][F][C][Ring2][Ring2][Branch2][=Ring2][Ring1][#Branch1]"
],
"smiles": [
"COc1c(N2CCN(CCOCCO)CC2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3F)c12",
"NCc1ccc(Cl)cc1Cl",
"COc1c(N2CCN(CCOCCO)CC2)c(F)cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3Cl)cn(C3CC3F)c12"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CN(C)C=O.O .",
"role": "assistant"
}
] | |
232 | {
"selfies": [
"[C][C][C][O][C][=C][C][=C][C][Branch2][Ring2][#Branch1][C][=C][C][=Branch1][C][=O][N][Branch1][C][C][C][=C][C][=C][Branch1][S][C][=Branch1][C][=O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=C][Ring2][Ring1][Branch1][Ring1][#C][=C][Ring2][Ring1][O]",
"[C][C][C][O][C][=C][C][=C][C][Branch2][Ring2][#Branch1][C][=C][C][=Branch1][C][=O][N][Branch1][C][C][C][=C][C][=C][Branch1][S][C][Branch1][C][O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=C][Ring2][Ring1][Branch1][Ring1][#C][=C][Ring2][Ring1][O]"
],
"smiles": [
"CCCOc1cccc(-c2cc(=O)n(C)c3ccc(C(=O)c4ccc(Cl)cc4)cc23)c1",
"CCCOc1cccc(-c2cc(=O)n(C)c3ccc(C(O)c4ccc(Cl)cc4)cc23)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "C1CCOC1.CO .",
"role": "assistant"
}
] | |
233 | {
"selfies": [
"[Br][Br]",
"[O][=C][Branch1][C][O][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][#Branch2][O]",
"[O][=C][Branch1][C][O][C][=C][C][Branch1][C][Br][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][O][O]"
],
"smiles": [
"BrBr",
"O=C(O)c1ccc2ccccc2c1O",
"O=C(O)c1cc(Br)c2ccccc2c1O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CC(=O)O .",
"role": "assistant"
}
] | |
234 | {
"selfies": [
"[C][O][C][=C][C][=C][C][=Branch1][C][=O][N][Branch1][P][C][C][N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][Branch1][#Branch1][C][N][Branch1][C][C][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring2][Ring1][O][=C][Ring2][Ring1][#C]",
"[C][O][C][=C][C][=C][C][=Branch1][C][=O][N][Branch1][Ring2][C][C][N][C][Branch1][#Branch1][C][N][Branch1][C][C][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring2][Ring1][Ring2][=C][Ring2][Ring1][Branch2]"
],
"smiles": [
"COc1ccc2c(=O)n(CCNC(=O)OC(C)(C)C)c(CN(C)C)c(-c3ccccc3)c2c1",
"COc1ccc2c(=O)n(CCN)c(CN(C)C)c(-c3ccccc3)c2c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CCOC(C)=O .",
"role": "assistant"
}
] | |
235 | {
"selfies": [
"[C][C][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2][C][#N]",
"[C][C][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1][C][#N]"
],
"smiles": [
"CCS(=O)(=O)c1ccc([N+](=O)[O-])cc1C#N",
"CCS(=O)(=O)c1ccc(N)cc1C#N"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be CC(=O)O .",
"role": "assistant"
}
] | |
236 | {
"selfies": [
"[O][=C][Branch1][C][O][C][=C][Branch1][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=C][N][=C][Ring1][=N][Cl]",
"[O][C][C][=C][Branch1][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=C][N][=C][Ring1][=N][Cl]"
],
"smiles": [
"O=C(O)c1c(-c2ccc(Cl)cc2)ccnc1Cl",
"OCc1c(-c2ccc(Cl)cc2)ccnc1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
237 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][=C][N][=C][C][=C][Branch1][C][Br][C][=C][N][Ring1][#Branch2][Ring1][#Branch1]",
"[O][=C][Branch1][C][O][C][=C][N][=C][C][=C][Branch1][C][Br][C][=C][N][Ring1][#Branch2][Ring1][#Branch1]"
],
"smiles": [
"CCOC(=O)c1cnc2cc(Br)ccn12",
"O=C(O)c1cnc2cc(Br)ccn12"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CO .",
"role": "assistant"
}
] | |
238 | {
"selfies": [
"[N][#C][C][=C][C][=C][O][C][Branch1][O][C][O][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][C][Ring1][=N][=C][Ring1][P]",
"[N][C][C][=C][C][=C][O][C][Branch1][O][C][O][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][C][Ring1][=N][=C][Ring1][P]"
],
"smiles": [
"N#Cc1ccc2oc(COc3ccccc3)cc2c1",
"NCc1ccc2oc(COc3ccccc3)cc2c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
239 | {
"selfies": [
"[C][O][C][C][=N][C][=C][Branch1][C][N][N][=C][C][=C][Branch1][N][C][C][C][=Branch1][C][=O][N][Branch1][C][C][C][C][=C][C][Ring1][=N][=C][Ring2][Ring1][C][N][Ring2][Ring1][Branch1][C][C][Branch1][C][C][Branch1][C][C][O]",
"[C][N][Branch1][C][C][C][=Branch1][C][=O][C][C][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][N][=C][Branch1][C][N][C][N][=C][Branch1][Ring1][C][O][N][Branch1][#Branch2][C][C][Branch1][C][C][Branch1][C][C][O][C][=Ring1][N][Ring2][Ring1][C]"
],
"smiles": [
"COCc1nc2c(N)nc3cc(CCC(=O)N(C)C)ccc3c2n1CC(C)(C)O",
"CN(C)C(=O)CCc1ccc2c(c1)nc(N)c1nc(CO)n(CC(C)(C)O)c12"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be ClCCl .",
"role": "assistant"
}
] | |
240 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][Si][Branch1][C][C][Branch1][C][C][Cl]",
"[O][C][C][=C][C][=C][N][=C][Ring1][=Branch1][Cl]",
"[C][C][Branch1][C][C][Branch1][C][C][Si][Branch1][C][C][Branch1][C][C][O][C][C][=C][C][=C][N][=C][Ring1][=Branch1][Cl]"
],
"smiles": [
"CC(C)(C)[Si](C)(C)Cl",
"OCc1cccnc1Cl",
"CC(C)(C)[Si](C)(C)OCc1cccnc1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CCOCC.CN(C)C=O .",
"role": "assistant"
}
] | |
241 | {
"selfies": [
"[O][=N+1][Branch1][C][O-1][C][=C][C][Branch1][C][Br][=C][C][=C][Ring1][#Branch1][O][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[N][C][=C][C][Branch1][C][Br][=C][C][=C][Ring1][#Branch1][O][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"O=[N+]([O-])c1cc(Br)ccc1Oc1ccccc1",
"Nc1cc(Br)ccc1Oc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: O .",
"role": "assistant"
}
] | |
242 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][C][C][C][C][=C][C][Branch1][C][Br][=C][C][NH1][C][=Branch1][C][=O][C][=Branch1][C][=O][N][Ring1][#C][C][Ring1][=N][=Ring1][Branch2]",
"[O][=C][Branch1][C][O][C][C][C][C][C][=C][C][Branch1][C][Br][=C][C][NH1][C][=Branch1][C][=O][C][=Branch1][C][=O][N][Ring1][#C][C][Ring1][=N][=Ring1][Branch2]"
],
"smiles": [
"COC(=O)CC1CCc2cc(Br)cc3[nH]c(=O)c(=O)n1c23",
"O=C(O)CC1CCc2cc(Br)cc3[nH]c(=O)c(=O)n1c23"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: C1CCOC1.CO .",
"role": "assistant"
}
] | |
243 | {
"selfies": [
"[C][C][C][C][Branch1][=Branch2][N][C][C][N][C][C][Ring1][=Branch1][C][Ring1][O]",
"[C][C][C][C][C][N][Ring1][Branch1][C][C][C][O][C][=C][C][=C][Branch1][=N][N][C][C][Branch1][Ring1][C][Cl][C][C][Ring1][#Branch1][=O][C][=C][Ring1][=C]",
"[C][C][C][C][C][N][Ring1][Branch1][C][C][C][O][C][=C][C][=C][Branch2][Ring1][=C][N][C][C][Branch2][Ring1][Ring1][C][N][C][C][N][Branch1][Branch2][C][C][C][C][C][Ring1][Branch1][C][C][Ring1][O][C][C][Ring1][P][=O][C][=C][Ring2][Ring1][Branch2]"
],
"smiles": [
"C1CCC(N2CCNCC2)C1",
"CC1CCCN1CCCOc1ccc(N2CC(CCl)CC2=O)cc1",
"CC1CCCN1CCCOc1ccc(N2CC(CN3CCN(C4CCCC4)CC3)CC2=O)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CC#N .",
"role": "assistant"
}
] | |
244 | {
"selfies": [
"[Br][C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][S][C][=N][C][=C][Branch1][=Branch1][C][Branch1][C][C][O][C][=C][Ring1][=Branch2][Cl]",
"[C][S][C][=N][C][=C][Branch1][#C][C][Branch1][C][C][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][S][Cl]"
],
"smiles": [
"BrCc1ccccc1",
"CSc1ncc(C(C)O)cc1Cl",
"CSc1ncc(C(C)OCc2ccccc2)cc1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be CN(C)C=O.O .",
"role": "assistant"
}
] | |
245 | {
"selfies": [
"[N][C][=C][C][Branch1][P][C][=N][C][Branch1][Branch2][C][=C][C][=C][O][Ring1][Branch1][=N][O][Ring1][#Branch2][=C][C][=C][Ring1][S][Cl]",
"[O][=C][Branch1][C][Cl][O][C][C][Branch1][C][Cl][Branch1][C][Cl][Cl]",
"[O][=C][Branch2][Ring1][=N][N][C][=C][C][Branch1][P][C][=N][C][Branch1][Branch2][C][=C][C][=C][O][Ring1][Branch1][=N][O][Ring1][#Branch2][=C][C][=C][Ring1][S][Cl][O][C][C][Branch1][C][Cl][Branch1][C][Cl][Cl]"
],
"smiles": [
"Nc1cc(-c2nc(-c3ccco3)no2)ccc1Cl",
"O=C(Cl)OCC(Cl)(Cl)Cl",
"O=C(Nc1cc(-c2nc(-c3ccco3)no2)ccc1Cl)OCC(Cl)(Cl)Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be C1COCCO1 .",
"role": "assistant"
}
] | |
246 | {
"selfies": [
"[N][O]",
"[O][=C][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1]",
"[O][N][=C][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1]"
],
"smiles": [
"NO",
"O=Cc1ccc(F)cc1",
"ON=Cc1ccc(F)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
247 | {
"selfies": [
"[N][#C][C][=C][C][=C][C][=C][Ring1][=Branch1][O]",
"[O][=S][=Branch1][C][=O][Branch1][P][O][S][=Branch1][C][=O][=Branch1][C][=O][C][Branch1][C][F][Branch1][C][F][F][C][Branch1][C][F][Branch1][C][F][F]",
"[N][#C][C][=C][C][=C][C][=C][Ring1][=Branch1][O][S][=Branch1][C][=O][=Branch1][C][=O][C][Branch1][C][F][Branch1][C][F][F]"
],
"smiles": [
"N#Cc1ccccc1O",
"O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F",
"N#Cc1ccccc1OS(=O)(=O)C(F)(F)F"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
248 | {
"selfies": [
"[O][C][C][=C][C][=C][C][=C][Branch1][#C][O][C][=N][C][=N][C][=C][C][=C][Ring1][=Branch1][S][Ring1][=Branch2][C][=C][Ring1][S][NH1][Ring2][Ring1][Ring1]",
"[O][=C][C][=C][C][=C][C][=C][Branch1][#C][O][C][=N][C][=N][C][=C][C][=C][Ring1][=Branch1][S][Ring1][=Branch2][C][=C][Ring1][S][NH1][Ring2][Ring1][Ring1]"
],
"smiles": [
"OCc1cc2ccc(Oc3nc4ncccc4s3)cc2[nH]1",
"O=Cc1cc2ccc(Oc3nc4ncccc4s3)cc2[nH]1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "ClC(Cl)Cl .",
"role": "assistant"
}
] | |
249 | {
"selfies": [
"[C][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][C][C][=C][C][=C][Branch1][Ring1][C][O][N][=C][Ring1][Branch2][N][Ring2][Ring1][=Branch1][Ring1][O]",
"[O][=C][C][C][C][=Branch1][C][=O][N][Ring1][=Branch1][Br]",
"[C][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][C][C][=C][C][Branch1][C][Br][=C][Branch1][Ring1][C][O][N][=C][Ring1][=Branch2][N][Ring2][Ring1][#Branch1][Ring1][N]"
],
"smiles": [
"CC1CN(C(=O)OC(C)(C)C)CC2Cc3ccc(CO)nc3N12",
"O=C1CCC(=O)N1Br",
"CC1CN(C(=O)OC(C)(C)C)CC2Cc3cc(Br)c(CO)nc3N12"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
250 | {
"selfies": [
"[C][C][=N][C][Branch1][C][N][=N][C][Branch1][C][N][=C][Ring1][Branch2][N][C][C][N][C][C][Ring1][=Branch1]",
"[N][#C][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1]",
"[C][C][=N][C][Branch1][C][N][=N][C][Branch1][C][N][=C][Ring1][Branch2][N][C][C][N][Branch1][=N][C][=C][C][=C][Branch1][Ring1][C][#N][C][=C][Ring1][Branch2][C][C][Ring1][=C]"
],
"smiles": [
"Cc1nc(N)nc(N)c1N1CCNCC1",
"N#Cc1ccc(F)cc1",
"Cc1nc(N)nc(N)c1N1CCN(c2ccc(C#N)cc2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CS(C)=O .",
"role": "assistant"
}
] | |
251 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][C][C][C][C][N][Ring1][=Branch1][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][=C][Branch1][C][O][C][C][C][C][C][N][Ring1][=Branch1][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"COC(=O)C1CCCCN1C(=O)OCc1ccccc1",
"O=C(O)C1CCCCN1C(=O)OCc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
252 | {
"selfies": [
"[C][C][C][S][=Branch1][C][=O][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][F][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][Ring1][#Branch2][F]",
"[N][C][=C][N][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][Branch1][C][I][=C][N][Ring1][#Branch1][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][C][C][S][=Branch1][C][=O][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][F][C][Branch2][Ring2][#Branch1][C][=Branch1][C][=O][N][C][=C][N][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][Branch1][C][I][=C][N][Ring1][#Branch1][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring2][Ring1][=N][F]"
],
"smiles": [
"CCCS(=O)(=O)Nc1ccc(F)c(C(=O)O)c1F",
"Nc1cnc2c(c1)c(I)cn2S(=O)(=O)c1ccccc1",
"CCCS(=O)(=O)Nc1ccc(F)c(C(=O)Nc2cnc3c(c2)c(I)cn3S(=O)(=O)c2ccccc2)c1F"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
253 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][P][O][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2][C][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][S][Ring1][=Branch2]",
"[C][C][Branch1][C][C][Branch1][=N][O][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1][C][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][S][Ring1][=Branch2]"
],
"smiles": [
"CC(C)(Oc1ccc([N+](=O)[O-])cc1)c1nc2ccccc2s1",
"CC(C)(Oc1ccc(N)cc1)c1nc2ccccc2s1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
254 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][Branch1][C][F][C][C][C][C][Ring1][=Branch1][O]",
"[C][S][=Branch1][C][=O][=Branch1][C][=O][Cl]",
"[C][O][C][=Branch1][C][=O][C][Branch1][C][F][C][C][C][C][Ring1][=Branch1][O][S][Branch1][C][C][=Branch1][C][=O][=O]"
],
"smiles": [
"COC(=O)C1(F)CCCC1O",
"CS(=O)(=O)Cl",
"COC(=O)C1(F)CCCC1OS(C)(=O)=O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be c1ccncc1 .",
"role": "assistant"
}
] | |
255 | {
"selfies": [
"[O][=N+1][Branch1][C][O-1][C][C][C][C][C][C][Ring1][=Branch1][N][C][C][C][N][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring1][=N]",
"[N][C][C][C][C][C][C][Ring1][=Branch1][N][C][C][C][N][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring1][=N]"
],
"smiles": [
"O=[N+]([O-])C1CCCCC1NC1CCN(Cc2ccccc2)CC1",
"NC1CCCCC1NC1CCN(Cc2ccccc2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
256 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][=Branch1][P][=N][O][C][C][=Branch1][C][=O][N][C][C][C][C][C][C][Ring1][#Branch1][C][=C][S][C][Branch1][C][N][=N][Ring1][=Branch1]",
"[N][C][=N][C][Branch2][Ring1][=Branch2][C][=Branch1][P][=N][O][C][C][=Branch1][C][=O][N][C][C][C][C][C][C][Ring1][#Branch1][C][=Branch1][C][=O][O][=C][S][Ring2][Ring1][Branch1]"
],
"smiles": [
"CCOC(=O)C(=NOCC(=O)N1CCCCCC1)c1csc(N)n1",
"Nc1nc(C(=NOCC(=O)N2CCCCCC2)C(=O)O)cs1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
257 | {
"selfies": [
"[C][=C][C][Br]",
"[C][C][O][C][=Branch1][C][=O][C][Branch1][C][O][Branch2][Ring1][Branch1][C][C][Branch1][C][C][Branch1][C][C][C][=C][C][Branch1][C][F][=C][C][=C][Ring1][#Branch1][O][C][Branch1][C][F][Branch1][C][F][F]",
"[C][=C][C][O][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][Branch1][C][C][Branch1][C][C][C][C][Branch1][C][O][Branch1][Branch2][C][=Branch1][C][=O][O][C][C][C][Branch1][C][F][Branch1][C][F][F]"
],
"smiles": [
"C=CCBr",
"CCOC(=O)C(O)(CC(C)(C)c1cc(F)ccc1O)C(F)(F)F",
"C=CCOc1ccc(F)cc1C(C)(C)CC(O)(C(=O)OCC)C(F)(F)F"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
258 | {
"selfies": [
"[C][C][C][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][O]",
"[O][=S][=Branch1][C][=O][Branch1][C][O][Cl]",
"[C][C][C][O][C][=C][C][=C][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][Cl][C][=C][Ring1][#Branch2][C][=Branch1][C][=O][O]"
],
"smiles": [
"CCCOc1ccccc1C(=O)O",
"O=S(=O)(O)Cl",
"CCCOc1ccc(S(=O)(=O)Cl)cc1C(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be ClCCl .",
"role": "assistant"
}
] | |
259 | {
"selfies": [
"[Br][Br]",
"[C][C][C][C][C][C][=C][Branch2][Ring1][C][C][=C][C][=C][C][=C][Branch1][C][O][C][=C][C][Ring1][#Branch1][=C][Ring1][O][O][C][=C][C][=C][C][=C][Ring2][Ring1][Ring2][Ring1][=Branch1]",
"[C][C][C][C][C][C][=C][Branch2][Ring1][Branch1][C][=C][C][=C][C][Branch1][C][Br][=C][Branch1][C][O][C][=C][C][Ring1][Branch2][=C][Ring1][N][O][C][=C][C][=C][C][=C][Ring2][Ring1][Branch1][Ring1][=Branch1]"
],
"smiles": [
"BrBr",
"CCCCCc1c(-c2ccc3cc(O)ccc3c2)oc2ccccc12",
"CCCCCc1c(-c2ccc3c(Br)c(O)ccc3c2)oc2ccccc12"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "CC(=O)O .",
"role": "assistant"
}
] | |
260 | {
"selfies": [
"[Br][C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][C][=C][C][Branch1][C][I][=C][C][=C][Ring1][#Branch1][O]",
"[C][C][=C][C][Branch1][C][I][=C][C][=C][Ring1][#Branch1][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"BrCc1ccccc1",
"Cc1cc(I)ccc1O",
"Cc1cc(I)ccc1OCc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CC(C)=O .",
"role": "assistant"
}
] | |
261 | {
"selfies": [
"[C][=C][C][C][=C][C][Branch1][C][Cl][=C][Branch1][C][O][C][C][Branch1][C][C][=C][Branch1][P][C][=Branch1][C][=O][C][=C][C][=C][Branch1][Ring1][O][C][C][=C][Ring1][Branch2][O][C][Ring2][Ring1][=Branch1][=Ring1][S]",
"[C][C][C][C][=C][C][Branch1][C][Cl][=C][Branch1][C][O][C][C][Branch1][C][C][=C][Branch1][P][C][=Branch1][C][=O][C][=C][C][=C][Branch1][Ring1][O][C][C][=C][Ring1][Branch2][O][C][Ring2][Ring1][=Branch1][=Ring1][S]"
],
"smiles": [
"C=CCc1cc(Cl)c(O)c2c(C)c(C(=O)c3ccc(OC)cc3)oc12",
"CCCc1cc(Cl)c(O)c2c(C)c(C(=O)c3ccc(OC)cc3)oc12"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
262 | {
"selfies": [
"[C][C][C][C][N][C][C][Ring1][#Branch1]",
"[C][C][C][C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O]",
"[C][C][C][C][C][C][C][C][C][C][C][C][=Branch1][C][=O][N][C][C][C][C][C][C][Ring1][#Branch1]"
],
"smiles": [
"C1CCCNCC1",
"CCCCCCCCCCCC(=O)O",
"CCCCCCCCCCCC(=O)N1CCCCCC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CC(=O)O .",
"role": "assistant"
}
] | |
263 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][C][Branch1][C][F][Branch2][Ring2][=Branch1][C][N][C][=N][C][Branch2][Ring1][C][C][C][=N][N][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=Ring1][=Branch2][=C][C][=N][C][=C][C][=C][Ring2][Ring1][Ring1][Ring1][=Branch1][C][Ring2][Ring1][N]",
"[C][C][Branch1][C][C][Branch1][C][C][N][C][=C][Branch2][Ring1][#C][C][=C][C][=N][C][=C][C][=C][Ring1][=Branch1][C][Branch1][=C][N][C][C][Branch1][C][F][C][C][C][N][C][Ring1][#Branch1][=N][Ring2][Ring1][Ring1][C][=N][Ring2][Ring1][Branch2]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCCC(F)(CNc2nc(-c3cnn(C(C)(C)C)c3)cc3ncccc23)C1",
"CC(C)(C)n1cc(-c2cc3ncccc3c(NCC3(F)CCCNC3)n2)cn1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
264 | {
"selfies": [
"[O][=C][C][C][=C][Branch1][C][Cl][N][=C][N][=C][Ring1][#Branch1][Cl]",
"[O][C][C][C][=C][Branch1][C][Cl][N][=C][N][=C][Ring1][#Branch1][Cl]"
],
"smiles": [
"O=CCc1c(Cl)ncnc1Cl",
"OCCc1c(Cl)ncnc1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CO .",
"role": "assistant"
}
] | |
265 | {
"selfies": [
"[N][C][Branch2][Ring1][Ring2][C][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2][C][Branch1][C][O][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1]",
"[O][=C][Branch1][C][Cl][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][=C]",
"[O][=C][Branch2][Ring2][Branch2][N][C][Branch2][Ring1][Ring2][C][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2][C][Branch1][C][O][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][=C]"
],
"smiles": [
"NC(Cc1ccc(C(F)(F)F)cc1)C(O)c1ccc(F)cc1",
"O=C(Cl)c1cc(C(F)(F)F)cc(C(F)(F)F)c1",
"O=C(NC(Cc1ccc(C(F)(F)F)cc1)C(O)c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CCOC(C)=O.O .",
"role": "assistant"
}
] | |
266 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch2][Branch1][Ring1][C][=Branch1][C][=O][N][C][C][C][N][Branch2][Ring2][Ring1][C][=N][C][Branch2][Ring1][C][N][C][=C][C][=C][Branch1][Ring1][O][C][C][Branch1][Ring1][O][C][=C][Ring1][#Branch2][=C][N][=C][S][C][Ring1][Branch1][=N][Ring2][Ring1][Ring2][C][Ring2][Ring1][=Branch2][C][=C][Ring2][Ring2][C][O]",
"[C][O][C][=C][C][=C][Branch2][Branch1][Branch1][N][C][=N][C][Branch2][Ring2][Ring1][N][C][C][C][Branch2][Ring1][Branch2][N][C][=Branch1][C][=O][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][Branch1][C][O][=C][Ring1][#Branch2][C][Ring2][Ring1][C][=N][C][S][C][=N][C][Ring2][Ring1][O][=Ring1][Branch1][C][=C][Ring2][Ring2][C][O][C]"
],
"smiles": [
"COC(=O)c1ccc(C(=O)NC2CCN(c3nc(Nc4ccc(OC)c(OC)c4)c4ncsc4n3)C2)cc1O",
"COc1ccc(Nc2nc(N3CCC(NC(=O)c4ccc(C(=O)O)c(O)c4)C3)nc3scnc23)cc1OC"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be C1CCOC1.CO .",
"role": "assistant"
}
] | |
267 | {
"selfies": [
"[C][=C][C][N][C][=N][C][Branch1][C][Cl][=N][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=C][Ring1][=Branch2]",
"[N][C][C][N]",
"[C][=C][C][N][C][=N][C][Branch1][Branch1][N][C][C][N][=N][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][P][Ring1][=Branch2]"
],
"smiles": [
"C=CCNc1nc(Cl)nc2ccc([N+](=O)[O-])cc12",
"NCCN",
"C=CCNc1nc(NCCN)nc2ccc([N+](=O)[O-])cc12"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "O .",
"role": "assistant"
}
] | |
268 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][Branch1][=Branch2][C][C][C][C][C][C][Ring1][Branch1][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2]",
"[C][C][O][C][=Branch1][C][=O][C][Branch1][=Branch2][C][C][C][C][C][C][Ring1][Branch1][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1]"
],
"smiles": [
"CCOC(=O)C(CC1CCCC1)c1ccc([N+](=O)[O-])cc1",
"CCOC(=O)C(CC1CCCC1)c1ccc(N)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CCOC(C)=O .",
"role": "assistant"
}
] | |
269 | {
"selfies": [
"[Br][C][C][C][C][C][Ring1][Ring2]",
"[O][C][=C][C][=C][Branch1][C][Br][C][=C][Ring1][#Branch1]",
"[Br][C][=C][C][=C][Branch1][=Branch2][O][C][C][C][C][C][Ring1][Ring2][C][=C][Ring1][N]"
],
"smiles": [
"BrCC1CCC1",
"Oc1ccc(Br)cc1",
"Brc1ccc(OCC2CCC2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: CN(C)C=O .",
"role": "assistant"
}
] | |
270 | {
"selfies": [
"[N][C][=N][C][Branch1][=Branch2][N][C][C][N][C][C][Ring1][=Branch1][=C][N][=C][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][S][C][Ring1][N][=N][Ring2][Ring1][=Branch1]",
"[O][=S][=Branch1][C][=O][Branch1][C][Cl][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[N][C][=N][C][Branch2][Ring1][#Branch2][N][C][C][N][Branch1][S][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring1][#C][=C][N][=C][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][S][C][Ring1][N][=N][Ring2][Ring1][#C]"
],
"smiles": [
"Nc1nc(N2CCNCC2)c2nc(-c3ccc(F)cc3)sc2n1",
"O=S(=O)(Cl)c1ccccc1",
"Nc1nc(N2CCN(S(=O)(=O)c3ccccc3)CC2)c2nc(-c3ccc(F)cc3)sc2n1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CN(C)C=O .",
"role": "assistant"
}
] | |
271 | {
"selfies": [
"[C][C][C][Branch1][Ring1][C][C][C][=C][C][Branch1][=Branch1][C][Branch1][C][N][=O][=C][C][=C][Ring1][=Branch2][C][C][Branch1][Ring1][O][C][C][Ring1][P][N][C][C][C][Branch1][#Branch2][C][C][C][C][C][C][C][Ring1][=Branch1][C][=Branch1][C][=O][O][C]",
"[C][C][C][Branch1][Ring1][C][C][C][=C][C][Branch1][=Branch1][C][Branch1][C][N][=O][=C][C][=C][Ring1][=Branch2][C][C][Branch1][Ring1][O][C][C][Ring1][P][N][C][C][C][Branch1][#Branch2][C][C][C][C][C][C][C][Ring1][=Branch1][C][=Branch1][C][=O][O]"
],
"smiles": [
"CCC1(CC)c2cc(C(N)=O)ccc2CC(OC)C1NCCC(CC1CCCCC1)C(=O)OC",
"CCC1(CC)c2cc(C(N)=O)ccc2CC(OC)C1NCCC(CC1CCCCC1)C(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
272 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][N][=C][Branch1][Branch2][C][C][=N][NH1][C][=Ring1][Branch1][C][Branch1][#Branch2][N][Branch1][C][C][C][Branch1][C][C][C][=N][C][Ring1][S][=C][Ring2][Ring1][Ring2]",
"[C][C][Branch1][C][C][N][Branch1][C][C][C][=N][C][=C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][C][=C][Ring1][=Branch2][N][=C][Ring1][=N][C][C][=N][NH1][C][=Ring1][Branch1]"
],
"smiles": [
"COC(=O)c1ccc2nc(-c3cn[nH]c3)c(N(C)C(C)C)nc2c1",
"CC(C)N(C)c1nc2cc(C(=O)O)ccc2nc1-c1cn[nH]c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CO.O .",
"role": "assistant"
}
] | |
273 | {
"selfies": [
"[C][C][=C][C][=C][C][Branch2][Ring1][#Branch1][C][=C][Branch1][C][Br][S][C][=N][C][Branch1][C][C][=C][C][Branch1][C][N][=C][Ring1][N][Ring1][Branch2][=C][Ring2][Ring1][C]",
"[O][=S][=Branch1][C][=O][Branch1][C][Cl][C][=C][C][=C][C][Branch1][C][Cl][=C][Ring1][#Branch1]",
"[C][C][=C][C][=C][C][Branch2][Ring2][N][C][=C][Branch1][C][Br][S][C][=N][C][Branch1][C][C][=C][C][Branch2][Ring1][Ring2][N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][C][Branch1][C][Cl][=C][Ring1][#Branch1][=C][Ring2][Ring1][=Branch1][Ring2][Ring1][C][=C][Ring2][Ring1][N]"
],
"smiles": [
"Cc1cccc(-c2c(Br)sc3nc(C)cc(N)c23)c1",
"O=S(=O)(Cl)c1cccc(Cl)c1",
"Cc1cccc(-c2c(Br)sc3nc(C)cc(NS(=O)(=O)c4cccc(Cl)c4)c23)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be C1CCOC1 .",
"role": "assistant"
}
] | |
274 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][Branch1][C][C][Branch1][C][C][S][C][=C][C][=C][N][=C][Ring1][=Branch1][C][=C][C][=C][Branch1][Ring1][C][#N][C][=C][Ring1][Branch2]",
"[C][C][Branch1][C][C][Branch2][Ring1][=Branch1][S][C][=C][C][=C][N][=C][Ring1][=Branch1][C][=C][C][=C][Branch1][Ring1][C][#N][C][=C][Ring1][Branch2][C][=Branch1][C][=O][O]"
],
"smiles": [
"CCOC(=O)C(C)(C)Sc1cccnc1-c1ccc(C#N)cc1",
"CC(C)(Sc1cccnc1-c1ccc(C#N)cc1)C(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CO .",
"role": "assistant"
}
] | |
275 | {
"selfies": [
"[C][O][C][=C][C][=C][Branch1][=N][C][=C][C][=C][Branch1][Ring1][C][=O][C][=C][Ring1][Branch2][C][=C][Ring1][=C]",
"[N][C][C][C][N][C][=N][S][C][=N][C][=C][N][=C][Ring1][=Branch2][Ring1][=Branch1]",
"[C][O][C][=C][C][=C][Branch2][Ring1][S][C][=C][C][=C][Branch2][Ring1][Ring2][C][N][C][C][C][N][C][=N][S][C][=N][C][=C][N][=C][Ring1][=Branch2][Ring1][=Branch1][C][=C][Ring2][Ring1][Branch1][C][=C][Ring2][Ring1][O]"
],
"smiles": [
"COc1ccc(-c2ccc(C=O)cc2)cc1",
"NCCCNc1nsc2nccnc12",
"COc1ccc(-c2ccc(CNCCCNc3nsc4nccnc34)cc2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: ClCCCl.ClCCl .",
"role": "assistant"
}
] | |
276 | {
"selfies": [
"[C][C][C][C][C][C][C][C][C][C][C][C][C][NH1][C][=C][C][Branch1][Branch2][C][=Branch1][C][=O][O][C][C][=C][C][=C][Ring1][O][C][=Ring1][=C][Ring2][Ring1][C]",
"[C][C][C][C][C][C][C][C][C][C][C][C][C][NH1][C][=C][C][Branch1][Ring1][C][O][=C][C][=C][Ring1][Branch2][C][=Ring1][O][Ring1][#C]"
],
"smiles": [
"CCCCCCCCC1CCCc2[nH]c3cc(C(=O)OCC)ccc3c21",
"CCCCCCCCC1CCCc2[nH]c3cc(CO)ccc3c21"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: Cc1ccccc1.ClCCl .",
"role": "assistant"
}
] | |
277 | {
"selfies": [
"[C][O][C][=C][C][=C][Branch1][=Branch1][C][Branch1][C][C][=O][C][S][C][=Branch1][C][=O][NH1][C][Ring1][=N][=Ring1][=Branch1]",
"[C][C][=Branch1][C][=O][C][=C][C][=C][Branch1][C][O][C][NH1][C][=Branch1][C][=O][S][C][Ring1][O][=Ring1][=Branch1]"
],
"smiles": [
"COc1ccc(C(C)=O)c2sc(=O)[nH]c12",
"CC(=O)c1ccc(O)c2[nH]c(=O)sc12"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CN1CCCC1=O.O .",
"role": "assistant"
}
] | |
278 | {
"selfies": [
"[F][C][=C][C][=C][Branch1][=Branch2][C][C][N][C][C][N][Ring1][=Branch1][C][=C][Ring1][N]",
"[O][=C][Branch1][C][O][C][=C][N][Branch1][=Branch1][C][C][C][Ring1][Ring1][C][=N][C][=C][C][Branch1][C][Cl][=C][Branch1][C][F][C][=C][Ring1][Branch2][C][=C][Ring1][N][C][Ring2][Ring1][Ring1][=O]",
"[O][=C][Branch1][C][O][C][=C][N][Branch1][=Branch1][C][C][C][Ring1][Ring1][C][=N][C][=C][C][Branch2][Ring1][=Branch1][N][C][C][N][C][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][Ring1][=N][=C][Branch1][C][F][C][=C][Ring2][Ring1][Ring2][C][=C][Ring2][Ring1][Branch2][C][Ring2][Ring1][#C][=O]"
],
"smiles": [
"Fc1ccc(C2CNCCN2)cc1",
"O=C(O)c1cn(C2CC2)c2nc3cc(Cl)c(F)cc3cc2c1=O",
"O=C(O)c1cn(C2CC2)c2nc3cc(N4CCNC(c5ccc(F)cc5)C4)c(F)cc3cc2c1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "CCN(CC)CC .",
"role": "assistant"
}
] | |
279 | {
"selfies": [
"[N][C][C][C][Br]",
"[O][=C][N][C][N][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][O][C][C][N][C][C][Ring1][=Branch1]",
"[N][C][C][C][N][C][C][C][Branch1][Branch1][C][C][Ring1][=Branch1][C][=Branch1][C][=O][N][C][N][Ring1][Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"NCCCBr",
"O=C1NCN(c2ccccc2)C12CCNCC2",
"NCCCN1CCC2(CC1)C(=O)NCN2c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "C1COCCO1 .",
"role": "assistant"
}
] | |
280 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch2][Ring1][#C][N][C][C][C][C][C][=C][C][Branch1][=N][N][C][=Branch1][C][=N][C][=C][C][=C][S][Ring1][Branch1][=C][C][=C][Ring1][=C][Ring2][Ring1][Ring1][C][Ring2][Ring1][Branch2]",
"[N][=C][Branch2][Ring1][#Branch2][N][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][C][C][C][N][Ring1][Branch2][C][C][C][N][C][Ring1][Branch1][C][=C][C][=C][S][Ring1][Branch1]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCC(N2CCCCc3cc(NC(=N)c4cccs4)ccc32)C1",
"N=C(Nc1ccc2c(c1)CCCCN2C1CCNC1)c1cccs1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CO .",
"role": "assistant"
}
] | |
281 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][C][C][Ring1][=Branch1][C][=N][C][Branch1][=N][C][=C][C][=C][C][Branch1][Ring1][C][#N][=C][Ring1][Branch2][=N][O][Ring1][=N]",
"[N][#C][C][=C][C][=C][C][Branch2][Ring1][C][C][=N][O][C][Branch1][=Branch2][C][C][C][C][C][N][Ring1][=Branch1][=N][Ring1][O][=C][Ring1][P]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCCCC1c1nc(-c2cccc(C#N)c2)no1",
"N#Cc1cccc(-c2noc(C3CCCCN3)n2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "O=CO .",
"role": "assistant"
}
] | |
282 | {
"selfies": [
"[C][N][Branch1][Branch1][C][C][C][Br][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][=C][C][=C][Branch1][=Branch2][N][C][C][N][C][C][Ring1][=Branch1][C][Branch1][=Branch1][C][C][C][Ring1][Ring1][=C][Ring1][#C]",
"[C][N][Branch2][Ring1][O][C][C][C][N][C][C][N][Branch1][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][C][Ring1][Ring1][C][C][Ring1][#C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CN(CCCBr)C(c1ccccc1)(c1ccccc1)c1ccccc1",
"c1ccc(N2CCNCC2)c(C2CC2)c1",
"CN(CCCN1CCN(c2ccccc2C2CC2)CC1)C(c1ccccc1)(c1ccccc1)c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
283 | {
"selfies": [
"[C][C][O][C][=C][C][=C][Branch1][C][F][C][Branch2][Ring2][=C][C][=C][C][=N][C][Branch2][Ring1][P][C][C][C][C][Branch1][O][C][C][N][Branch1][C][C][C][Ring1][=Branch1][=O][N][Ring1][O][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][=C][Ring2][Ring1][Branch2][C][=C][Ring2][Ring1][S]",
"[C][C][O][C][=C][C][=C][Branch1][C][F][C][Branch2][Ring1][S][C][=C][C][=N][C][Branch2][Ring1][Ring2][C][C][C][C][Branch1][O][C][C][N][Branch1][C][C][C][Ring1][=Branch1][=O][N][Ring1][O][=C][Ring1][P][C][=C][Ring2][Ring1][=Branch2]"
],
"smiles": [
"CCOc1ccc(F)c(-c2ccnc(C3CCC4(CCN(C)C4=O)N3C(=O)OC(C)(C)C)c2C)c1",
"CCOc1ccc(F)c(-c2ccnc(C3CCC4(CCN(C)C4=O)N3)c2C)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: Cl .",
"role": "assistant"
}
] | |
284 | {
"selfies": [
"[C][C][=Branch1][C][=O][C][C][C][C][C][C][C][C][C][C][=C][C][C][Ring1][=Branch1][Branch1][C][C][C][Ring1][O][C][C][C][Ring2][Ring1][C][Ring1][#C][C]",
"[C][C][Branch1][C][O][C][C][C][C][C][C][C][C][C][C][=C][C][C][Ring1][=Branch1][Branch1][C][C][C][Ring1][O][C][C][C][Ring2][Ring1][C][Ring1][#C][C]"
],
"smiles": [
"CC(=O)C1CCC2C3CCC4CC=CCC4(C)C3CCC12C",
"CC(O)C1CCC2C3CCC4CC=CCC4(C)C3CCC12C"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: ClCCl .",
"role": "assistant"
}
] | |
285 | {
"selfies": [
"[C][O][C][C][Branch1][C][O][C][N][C][=Branch1][C][=O][C][=C][Branch2][Ring2][=Branch2][N][=C][Branch2][Ring1][Branch1][O][C][=C][C][=C][C][Branch1][#Branch2][O][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][O][N][Ring1][P][C][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][N][Branch1][C][C][C][Ring2][Ring1][#C][=O]",
"[C][O][C][C][=Branch1][C][=O][C][N][C][=Branch1][C][=O][C][=C][Branch2][Ring2][=Branch2][N][=C][Branch2][Ring1][Branch1][O][C][=C][C][=C][C][Branch1][#Branch2][O][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][O][N][Ring1][P][C][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][N][Branch1][C][C][C][Ring2][Ring1][#C][=O]"
],
"smiles": [
"COCC(O)Cn1c(=O)c2c(nc(Oc3cccc(OC(F)(F)F)c3)n2Cc2ccc(Cl)cc2)n(C)c1=O",
"COCC(=O)Cn1c(=O)c2c(nc(Oc3cccc(OC(F)(F)F)c3)n2Cc2ccc(Cl)cc2)n(C)c1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CS(C)=O .",
"role": "assistant"
}
] | |
286 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][Si][Branch1][C][C][Branch1][C][C][Cl]",
"[O][C][C][=C][C][=N][C][=C][Ring1][=Branch1]",
"[C][C][Branch1][C][C][Branch1][C][C][Si][Branch1][C][C][Branch1][C][C][O][C][C][=C][C][=N][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CC(C)(C)[Si](C)(C)Cl",
"OCc1ccncc1",
"CC(C)(C)[Si](C)(C)OCc1ccncc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be CN(C)C=O .",
"role": "assistant"
}
] | |
287 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][Si][Branch1][C][C][Branch1][C][C][Cl]",
"[C][N][C][C][O]",
"[C][N][C][C][O][Si][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][C]"
],
"smiles": [
"CC(C)(C)[Si](C)(C)Cl",
"CNCCO",
"CNCCO[Si](C)(C)C(C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
288 | {
"selfies": [
"[Br][C][C][C][C][C][Br]",
"[C][C][C][C][=C][Branch1][N][O][C][C][C][C][=Branch1][C][=O][O][C][C][C][=C][C][Branch1][=Branch1][C][Branch1][C][C][=O][=C][Ring2][Ring1][C][O]",
"[C][C][C][C][=C][Branch1][N][O][C][C][C][C][=Branch1][C][=O][O][C][C][C][=C][C][Branch1][=Branch1][C][Branch1][C][C][=O][=C][Ring2][Ring1][C][O][C][C][C][C][C][Br]"
],
"smiles": [
"BrCCCCCBr",
"CCCc1c(OCCCC(=O)OCC)ccc(C(C)=O)c1O",
"CCCc1c(OCCCC(=O)OCC)ccc(C(C)=O)c1OCCCCCBr"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CC(C)=O .",
"role": "assistant"
}
] | |
289 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][C][N][C][C][C][N][C][C][N][Branch1][#C][C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][C][N][Branch1][=Branch1][C][C][Ring2][Ring1][=Branch1][C][C][Branch1][P][C][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2][C][Ring2][Ring1][#C]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][C][N][C][C][C][N][C][C][N][Branch1][#C][C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][C][N][Branch1][=Branch1][C][C][Ring2][Ring1][=Branch1][C][C][Branch1][=N][C][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1][C][Ring2][Ring1][=N]"
],
"smiles": [
"CC(C)(C)OC(=O)CN1CCCN2CCN(CC(=O)OC(C)(C)C)CCCN(CC1)CC(Cc1ccc([N+](=O)[O-])cc1)C2",
"CC(C)(C)OC(=O)CN1CCCN2CCN(CC(=O)OC(C)(C)C)CCCN(CC1)CC(Cc1ccc(N)cc1)C2"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
290 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][Branch2][Ring2][Branch1][C][=Branch1][C][=O][C][N][N][=C][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][N][=C][Ring1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][C][Ring2][Ring1][N]",
"[O][=C][Branch2][Ring1][P][C][N][N][=C][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][N][=C][Ring1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][N][C][C][N][C][C][Ring1][=Branch1]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCN(C(=O)Cn2nc(-c3ccc(F)cc3)nc2-c2ccc(F)cc2)CC1",
"O=C(Cn1nc(-c2ccc(F)cc2)nc1-c1ccc(F)cc1)N1CCNCC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be ClCCl .",
"role": "assistant"
}
] | |
291 | {
"selfies": [
"[C][O][C][=C][C][=C][C][=Branch2][Ring1][N][=C][Ring1][=Branch1][C][N][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][=N][O][C][=Branch2][Ring2][Branch1][=C][C][=C][N][Branch2][Ring1][Ring1][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][C][=C][C][=C][C][=C][Ring2][Ring1][Ring1][Ring1][=Branch1][C][Ring2][Ring2][Branch2][=O]",
"[C][O][C][=C][C][=C][C][=Branch1][=N][=C][Ring1][=Branch1][C][N][C][C][N][C][C][Ring1][=Branch1][O][C][=Branch2][Ring2][Branch1][=C][C][=C][N][Branch2][Ring1][Ring1][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][C][=C][C][=C][C][=C][Ring2][Ring1][Ring1][Ring1][=Branch1][C][Ring2][Ring1][P][=O]"
],
"smiles": [
"COc1ccc2c(c1CN1CCN(C(=O)OC(C)(C)C)CC1)OC(=Cc1cn(S(=O)(=O)c3ccc(C)cc3)c3ccccc13)C2=O",
"COc1ccc2c(c1CN1CCNCC1)OC(=Cc1cn(S(=O)(=O)c3ccc(C)cc3)c3ccccc13)C2=O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "C1COCCO1.ClCCl .",
"role": "assistant"
}
] | |
292 | {
"selfies": [
"[C][O][C][N][C][=Branch1][C][=O][C][=C][Branch1][S][C][=C][C][=C][Branch1][Ring2][C][C][#N][C][=C][Ring1][=Branch2][Ring1][=C][N][C][C][C][Ring1][#C]",
"[N-1][=N+1][=N-1]",
"[C][O][C][N][C][=Branch1][C][=O][C][=C][Branch2][Ring1][Branch1][C][=C][C][=C][Branch1][=Branch2][C][C][=N][N][=N][NH1][Ring1][Branch1][C][=C][Ring1][N][Ring1][P][N][C][C][C][Ring2][Ring1][C]"
],
"smiles": [
"COCn1c(=O)c2c(c3ccc(CC#N)cc31)NCCC2",
"[N-]=[N+]=[N-]",
"COCn1c(=O)c2c(c3ccc(Cc4nnn[nH]4)cc31)NCCC2"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
293 | {
"selfies": [
"[C][C][C][C][O][C][Branch2][Ring1][Branch1][C][=C][C][=C][Branch1][O][C][#C][Si][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][N][Branch1][=Branch1][O][C][Ring2][Ring1][C][O][C][Ring2][Ring1][Ring2]",
"[C][#C][C][=C][C][=C][Branch2][Ring1][Ring1][C][O][C][C][Branch1][Ring1][C][C][Branch1][Branch1][C][O][Ring1][Branch2][C][O][Ring1][#Branch2][C][=C][Ring1][S]"
],
"smiles": [
"CCC12COC(c3ccc(C#C[Si](C)(C)C)cc3)(OC1)OC2",
"C#Cc1ccc(C23OCC(CC)(CO2)CO3)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
294 | {
"selfies": [
"[C][N]",
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][C][=C][Ring1][=Branch1][S][=Branch1][C][=O][=Branch1][C][=O][Cl]",
"[C][N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][N+1][=Branch1][C][=O][O-1]"
],
"smiles": [
"CN",
"O=[N+]([O-])c1ccccc1S(=O)(=O)Cl",
"CNS(=O)(=O)c1ccccc1[N+](=O)[O-]"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
295 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][C][=N][N][Branch2][Ring1][=Branch1][C][C][=N][C][Branch1][N][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1][=C][S][Ring1][N][C][=Ring2][Ring1][C]",
"[C][O][C][C][=Branch1][C][=O][Cl]",
"[C][C][O][C][=Branch1][C][=O][C][C][=N][N][Branch2][Ring1][=C][C][C][=N][C][Branch2][Ring1][Ring1][C][=C][C][=C][Branch1][=Branch2][N][C][=Branch1][C][=O][C][O][C][C][=C][Ring1][N][=C][S][Ring1][P][C][=Ring2][Ring1][#Branch1]"
],
"smiles": [
"CCOC(=O)c1cnn(Cc2nc(-c3ccc(N)cc3)cs2)c1",
"COCC(=O)Cl",
"CCOC(=O)c1cnn(Cc2nc(-c3ccc(NC(=O)COC)cc3)cs2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
296 | {
"selfies": [
"[C][C][C][Branch1][C][O][Branch2][Branch1][#Branch2][C][=C][C][=C][C][=C][Branch2][Ring2][O][C][Branch1][Ring1][C][C][Branch1][Ring1][C][C][C][=C][C][=C][Branch2][Ring1][Ring2][B][O][C][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][O][Ring1][=Branch2][C][Branch1][C][C][=C][Ring1][S][C][=C][Ring2][Ring1][O][C][C][C]",
"[C][O][C][=Branch1][C][=O][C][C][=C][N][=C][C][Branch1][C][Br][=C][Ring1][#Branch1]",
"[C][C][C][Branch1][C][O][Branch2][Branch1][=Branch2][C][=C][C][=C][C][=C][Branch2][Ring2][#Branch2][C][Branch1][Ring1][C][C][Branch1][Ring1][C][C][C][=C][C][=C][Branch2][Ring1][C][C][=C][N][=C][C][Branch1][Branch2][C][C][=Branch1][C][=O][O][C][=C][Ring1][O][C][Branch1][C][C][=C][Ring2][Ring1][C][C][=C][Ring2][Ring1][=N][C][C][C]"
],
"smiles": [
"CCC(O)(C=Cc1ccc(C(CC)(CC)c2ccc(B3OC(C)(C)C(C)(C)O3)c(C)c2)cc1C)CC",
"COC(=O)Cc1cncc(Br)c1",
"CCC(O)(C=Cc1ccc(C(CC)(CC)c2ccc(-c3cncc(CC(=O)OC)c3)c(C)c2)cc1C)CC"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
297 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][O][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]",
"[C][O][C][=C][C][=C][Branch1][Ring2][C][C][N][C][=C][Ring1][=Branch2][O][C]",
"[C][O][C][=C][C][=C][Branch1][P][C][C][N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][S][O][C]"
],
"smiles": [
"CC(C)(C)OC(=O)OC(=O)OC(C)(C)C",
"COc1ccc(CCN)cc1OC",
"COc1ccc(CCNC(=O)OC(C)(C)C)cc1OC"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
298 | {
"selfies": [
"[C][C][=Branch1][C][=O][O][C][=C][C][=C][C][=C][C][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][Cl][=C][C][=C][Ring1][=C][Ring1][#Branch2]",
"[N][C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][C][=Branch1][C][=O][O][C][=C][C][=C][C][=C][C][Branch2][Ring1][C][S][=Branch1][C][=O][=Branch1][C][=O][N][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][C][=C][Ring2][Ring1][Branch1][Ring1][P]"
],
"smiles": [
"CC(=O)Oc1cccc2cc(S(=O)(=O)Cl)ccc12",
"NCc1ccccc1",
"CC(=O)Oc1cccc2cc(S(=O)(=O)NCc3ccccc3)ccc12"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be C1CCOC1 .",
"role": "assistant"
}
] | |
299 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][N][C][=Branch1][C][=O][C][=C][Branch1][C][O][N][Branch1][=Branch2][C][C][C][C][C][C][Ring1][=Branch1][C][=Branch1][C][=O][N][Branch1][=C][C][C][=C][C][=C][Branch1][Ring1][C][C][C][=C][Ring1][Branch2][C][Ring2][Ring1][#Branch1][=O]",
"[C][C][C][=C][C][=C][Branch2][Ring2][=Branch2][C][N][C][=Branch1][C][=O][C][Branch1][N][C][=Branch1][C][=O][N][C][C][=Branch1][C][=O][O][=C][Branch1][C][O][N][Branch1][=Branch2][C][C][C][C][C][C][Ring1][=Branch1][C][Ring2][Ring1][Branch1][=O][C][=C][Ring2][Ring1][=N]"
],
"smiles": [
"CCOC(=O)CNC(=O)c1c(O)n(C2CCCCC2)c(=O)n(Cc2ccc(CC)cc2)c1=O",
"CCc1ccc(Cn2c(=O)c(C(=O)NCC(=O)O)c(O)n(C3CCCCC3)c2=O)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] |