Datasets:

suolyer
/

pile_dm-mathematics

Dataset card Viewer Files Files and versions Community

Split (2)

validation · 2.01k rows

text stringlengths 8.19k 8.19k	meta dict
(a) -70 (b) -239 (c) -1 (d) 3/5 (e) -71/3 (f) 0.4 c Which is the second smallest value? (a) 0.033 (b) 4 (c) 2/9 (d) 0.4 (e) -6/7 (f) -2/7 (g) 0.06 f What is the third biggest value in -237, 5, 0.02, -4/5, -1, 3, -212? 0.02 Which is the second biggest value? (a) -32.3 (b) 24/89 (c) -5 (d) 0.4 (e) -0.3 b Which is the fourth smallest value? (a) 47.5 (b) -2/3 (c) 2/11 (d) -118 (e) -3 (f) 56 (g) -4 b What is the fifth biggest value in -10, 3/4, 5, 12831, -0.3? -10 Which is the biggest value? (a) 18/11 (b) -21 (c) 2 (d) 9 (e) 0 (f) -2 d Which is the fifth biggest value? (a) 15/8 (b) 1 (c) 8 (d) -5 (e) -7 (f) 2/17 (g) 3 f What is the second smallest value in 0.5, 2, 0.9, 6, 9, 0, 1.8? 0.5 Which is the fourth biggest value? (a) 1 (b) 1/3 (c) -0.5 (d) 1766 (e) 0.5 b Which is the fifth biggest value? (a) -46 (b) 3/13 (c) 0 (d) 60 (e) -11 a What is the sixth smallest value in 2, 1/7, 8, -0.4, 0.4, 44, 12? 12 Which is the second biggest value? (a) 0.1 (b) 0.12 (c) 156 (d) -2 (e) -4 (f) -593 b What is the second smallest value in 5, -0.068, 0.5, -655.64? -0.068 What is the third biggest value in 13, -60, 1.3, -2, -1, -0.05, -2/17? -0.05 What is the fourth smallest value in -199, -0.1, 3, 0.01197? 3 Which is the third smallest value? (a) 0.1039 (b) 0.032 (c) 5 (d) 2/7 (e) -6 a What is the smallest value in 2/5, 58/1541, 2, 1/2? 58/1541 What is the biggest value in -2/9, -4920.33, 6? 6 Which is the second smallest value? (a) -17 (b) -11 (c) -3 (d) 16 (e) -2 (f) -72 (g) -5 a Which is the second biggest value? (a) 6 (b) 4 (c) -1/3 (d) -6.5 (e) -0.7 (f) -1/6 b What is the third smallest value in -2, 2/13, -1/113, 0, 1/10, 5, 4? 0 What is the fourth smallest value in 1/2, 0.11, 658.1, 0.3, 2, -3, -0.1? 0.3 What is the fourth biggest value in 0.12, 0.4, -0.11, -204, 5? -0.11 What is the fourth biggest value in 0.03, -493, -5/3, 6/5, 3? -5/3 Which is the seventh biggest value? (a) 2 (b) 2.69 (c) -137 (d) -1/2 (e) 0 (f) 6 (g) 0.5 c Which is the third smallest value? (a) 363/10 (b) -1 (c) 535 c What is the fourth smallest value in 0.1, 9/5, -212, -20228? 9/5 Which is the biggest value? (a) -2/53 (b) -0.8 (c) 0 (d) 0.5 (e) -1.41 (f) 3/23 (g) -2/7 d Which is the smallest value? (a) 3/8 (b) 14 (c) -0.813 (d) 21 (e) -0.2 c What is the third smallest value in -8, 29.2, 2/13, -213? 2/13 What is the third smallest value in 23, -4.4, -546.6? 23 Which is the fourth biggest value? (a) -0.052 (b) -24 (c) -2/11 (d) 566 (e) -4 (f) 1/2 c What is the seventh smallest value in -0.5, 0.01, 1, 1/7, -2/7, 3/2, 1/24? 3/2 Which is the fourth smallest value? (a) 0.2 (b) -0.45 (c) -0.07 (d) -21 (e) -2/9 (f) 3 c What is the fourth biggest value in 3, 2/7, -395/83, -16/3? -16/3 What is the third smallest value in 1/2, 1/3, -19, -32/13, -8? -32/13 Which is the smallest value? (a) 1 (b) 9 (c) -1/25836 (d) 13 c Which is the second smallest value? (a) -0.2 (b) -80 (c) 0.0151 (d) 0.1 (e) 0 (f) 26 a Which is the smallest value? (a) -2 (b) -1/4 (c) 1 (d) -117657 d Which is the fifth smallest value? (a) 4/15 (b) 0.2 (c) 1/3 (d) -6 (e) 6 (f) 1 (g) -7 c What is the third biggest value in -0.4, 3/39830, -20? -20 Which is the smallest value? (a) 2/5 (b) -23331/127 (c) -5 b What is the third smallest value in 7311445, -13, 5? 7311445 What is the smallest value in -839, -0.179, 2, -3/5, -1, -0.3? -839 What is the third biggest value in -1.1, -0.3, 5/4, 0, 2/9, -60/17? 0 What is the second smallest value in 2/13, 2/51, -0.103055? 2/51 Which is the third smallest value? (a) 5 (b) 3 (c) 0.101 (d) 1/33 (e) 29 (f) 4 b Which is the smallest value? (a) -255/16 (b) -2/7 (c) 2/5 (d) 3/106 a What is the third biggest value in -0.2, 2/33, -2, 2.2168? -0.2 Which is the fifth smallest value? (a) -13 (b) 0.2 (c) -8169 (d) 13 (e) -0.036 d What is the smallest value in 1/32929, -0.3, 1/4, 4/5, 0.04, -1? -1 What is the fourth smallest value in 3, 4/5, -2.81, -0.7, 1/4? 4/5 Which is the fourth smallest value? (a) 2 (b) 3/4 (c) 0.001 (d) -1 (e) 40 a Which is the fifth smallest value? (a) -3 (b) 2/3 (c) -4 (d) -5 (e) 4111 (f) -2/23 b What is the fifth biggest value in -757, 0, 0.5, 21, -5, 4, 2/17? 0 Which is the third smallest value? (a) 0.1 (b) -0.1 (c) 2262/5 (d) 1171 c What is the fifth smallest value in 511, 1, 0.006, -0.1, 5, -3? 5 Which is the second smallest value? (a) -128936 (b) 4 (c) 10 b Which is the biggest value? (a) -12/5 (b) 4 (c) 0.011 (d) 217 d Which is the third biggest value? (a) 81961 (b) 0.4 (c) 5 (d) 3 (e) 10 (f) 2/11 c Which is the second smallest value? (a) 1/169 (b) -2.1 (c) -2/21 (d) 18 c What is the third biggest value in 7, -0.05, 35, -4, 0.09882? 0.09882 Which is the fourth biggest value? (a) 0 (b) 19/52 (c) -75 (d) 2/3 (e) -0.32 e What is the second smallest value in 0.2, -1, 802, 15152/9? 0.2 What is the fifth biggest value in 4, -6/5, 0.2, -56, -15/2, 0.5, -1/10? -6/5 Which is the third biggest value? (a) -255221 (b) -1/2 (c) 137 a Which is the second biggest value? (a) -1/5 (b) 33871 (c) -9 (d) 1 d What is the biggest value in -1/7, -9/2, 1, 158/57, -2/17, -1/2? 158/57 Which is the second smallest value? (a) 70/69 (b) 0 (c) 4 (d) 0.2 (e) 2/375 (f) 2 (g) 3 e What is the third biggest value in -1512, 5, -294, 0.4, -1/3, 2/9? 2/9 Which is the sixth smallest value? (a) -0.02 (b) -0.1 (c) -197 (d) -1 (e) -0.01 (f) 2/7 f What is the third biggest value in 1, -7858100, -6? -7858100 Which is the fourth biggest value? (a) 2371 (b) 0 (c) 3 (d) 6/43 b Which is the sixth biggest value? (a) 0.04 (b) 2/3 (c) 1/3 (d) -1 (e) 7 (f) -0.9 (g) 15 f What is the fourth smallest value in 3595, -0.2, -3, -2/11? 3595 Which is the sixth biggest value? (a) -4/9 (b) 0.5 (c) -29 (d) -2 (e) -2/15 (f) 1 c What is the second biggest value in -569, -1, -0.0425, -2/13, -0.1, -4? -0.1 What is the sixth biggest value in -84, 104/5, 0.9, -0.1, 2/9, -3? -84 What is the second smallest value in 1/2, 2/57, -0.0697, 0, 1, 0.011? 0 Which is the fourth biggest value? (a) 10 (b) 3 (c) -0.13 (d) 2/3 (e) 0.05 (f) -5/12 e Which is the second biggest value? (a) 0.39 (b) -3.4 (c) -0.2 (d) -54920 c What is the third smallest value in 0.0369, 0.3, 0.4, 798, -0.1? 0.3 What is the third biggest value in 16.73, 1/7, 40, -3, 54/11? 54/11 What is the second smallest value in -19, 5, -277/447? -277/447 Which is the third biggest value? (a) -358 (b) 2/889 (c) -0.5 a What is the third smallest value in -0.4, -11, -5, -3, 2/5, 5, 2/3? -3 Which is the third biggest value? (a) 7 (b) 27 (c) -3/15631 c What is the second smallest value in 5/3, 2, 80, 0, -1, 4, -152/7? -1 Which is the second biggest value? (a) 0.4 (b) 10/3 (c) -105 (d) -4/31 (e) 9 b Which is the second biggest value? (a) 2/3 (b) -60 (c) -2/3 (d) -0.094149 (e) -1/4 (f) 3 a Which is the biggest value? (a) 2.1 (b) 1 (c) 334919 c What is the third biggest value in 295.21, 8/9, -0.3? -0.3 Which is the smallest value? (a) 33/2239 (b) -1.4 (c) 1 b Which is the biggest value? (a) 67 (b) -270.312 (c) -0.1 a What is the fifth smallest value in 1.57, -2/5, -199, -5, 0.3, 2, -2/7? 0.3 Which is the second smallest value? (a) -1/8 (b) -1/6 (c) 1 (d) 0 (e) -2.3 (f) 0.04 (g) -0.02 b What is the biggest value in 0.08, -2/309, 8, 0.32? 8 Which is the third biggest value? (a) 1 (b) -9/541 (c) 0 (d) -2 (e) 6 (f) -160 c What is the second smallest value in 4/7, 89, 29, -148/71? 4/7 What is the second biggest value in -851, -3/2, 0.02269, 0.5? 0.02269 Which is the third smallest value? (a) 2 (b) 13824582 (c) -2/3 b Which is the third biggest value? (a) 9/16 (b) -65 (c) 4 (d) 86 a Which is the third smallest value? (a) 4.9144 (b) 3/7 (c) 14 (d) -1/2 a Which is the biggest value? (a) 0 (b) -2/29 (c) 2/13 (d) -2/7 (e) -7 (f) -2/9 c What is the second biggest value in 71, -248, -0.6, 6.6? 6.6 What is the smallest value in 7, 0.5, -1, 2, -7715, -39.3, -2/3? -7715 Which is the smallest value? (a) -33 (b) -0.06 (c) 9 (d) 59 a Which is the second smallest value? (a) -8.3 (b) 0 (c) 5 (d) -5 (e) -2 (f) -92 (g) -4 a What is	{ "pile_set_name": "DM Mathematics" }
1 What is -53885072 divided by -4? 13471268 What is 23823997 divided by 23823997? 1 Calculate 965740 divided by 20. 48287 -70123 divided by 74 -70123/74 Divide 2 by -1842562. -1/921281 What is -118 divided by -1023970? 59/511985 Calculate 1078 divided by -24291. -1078/24291 Divide 135610369 by 23. 5896103 What is 9714220 divided by 4? 2428555 Divide 3397954 by 98. 34673 Divide -3203 by 40134. -3203/40134 Calculate 16904188 divided by 8092. 2089 Divide 48702870 by 16234290. 3 Divide 24 by 2317547. 24/2317547 Calculate 152 divided by -33683. -152/33683 What is 1423787244 divided by 4? 355946811 What is -692590 divided by -4? 346295/2 Divide -1733004475 by -5. 346600895 What is -8728374 divided by 1? -8728374 Divide 2550452 by -97. -2550452/97 1682039909 divided by -159269 -10561 Divide -21918234 by -39. 562006 -11 divided by 17891451 -11/17891451 What is 475976 divided by -8? -59497 -10 divided by -1069445 2/213889 Calculate 8898550 divided by -2. -4449275 What is 1336 divided by 6489? 1336/6489 -17256047 divided by 1 -17256047 -204893928 divided by 334794 -612 What is 29201718 divided by 1659? 17602 Calculate 4 divided by 7134089. 4/7134089 What is 303565277 divided by -3247? -93491 What is -5974120 divided by 597412? -10 What is 190820403 divided by 408609? 467 Divide 33446685 by 2229779. 15 Divide 10 by 2603855. 2/520771 Divide -74 by -86951. 74/86951 What is -142192 divided by -4158? 71096/2079 Calculate 4 divided by -1498796. -1/374699 Divide -4 by -1866681. 4/1866681 Calculate -1694925 divided by -3645. 465 Divide 7084776 by -2361592. -3 Calculate -4582 divided by -2488. 2291/1244 -25544 divided by 2353 -25544/2353 5024 divided by 2838 2512/1419 What is 48106707 divided by 8907? 5401 Calculate 181 divided by -252418. -181/252418 Calculate -98137 divided by -28. 98137/28 Divide 584 by -13944. -73/1743 Calculate 3 divided by 737191. 3/737191 Divide -796944 by -796944. 1 -7617036 divided by 21 -362716 -1152412724 divided by -4 288103181 What is -3 divided by -596417? 3/596417 Divide 40783154 by -8. -20391577/4 Divide 197998550 by 6. 98999275/3 -982640504 divided by -638908 1538 What is 5814952 divided by 3289? 1768 -23268426 divided by -45714 509 Divide 384977 by -60. -384977/60 Calculate 4759680 divided by -158656. -30 Calculate -11084607 divided by 5. -11084607/5 Calculate -2 divided by -190772376. 1/95386188 Divide 3696300 by 739260. 5 What is 6867616 divided by 4991? 1376 12489984 divided by 10842 1152 Calculate 23835 divided by -1481. -23835/1481 Calculate 104524 divided by 7350. 7466/525 Divide -3425529 by 5. -3425529/5 7339 divided by -15298 -7339/15298 What is -5 divided by -1991737? 5/1991737 Calculate -346311338 divided by -626. 553213 Divide -70072482 by -1461. 47962 -45933 divided by 78 -15311/26 588402 divided by -9 -65378 Divide -2639028 by -267. 9884 What is 5328 divided by 36359? 5328/36359 Divide 12176230 by -145. -83974 Divide 69443 by -2554. -69443/2554 Calculate -540495 divided by -15. 36033 Calculate 108589179 divided by -3. -36196393 Calculate -633 divided by -71354. 633/71354 Divide 1164550 by 3. 1164550/3 2670756 divided by 2670756 1 Calculate -116874450 divided by -63. 1855150 Divide -87400920 by 60. -1456682 895696 divided by -5 -895696/5 Divide -682899 by -101. 682899/101 Calculate 120106170 divided by -30. -4003539 Divide -70009340 by 4. -17502335 What is -88795850 divided by 65? -1366090 What is 193826 divided by -18? -96913/9 What is -623 divided by -4301? 623/4301 Divide -101901884 by 28. -3639353 Divide -2173964 by -41807. 52 Divide 191 by 5711. 191/5711 Divide -21225660 by 1061283. -20 Calculate 40832683 divided by 3. 40832683/3 -150964075 divided by -30192815 5 Calculate 785029 divided by -21217. -37 What is 31580118 divided by 153? 206406 77172876 divided by -12862146 -6 Divide 96 by -12990512. -6/811907 0 divided by -36402803 0 What is 552023334 divided by -27842? -19827 Divide 3873240 by 645540. 6 Divide 61 by -335288. -61/335288 390069499 divided by -888541 -439 25034646 divided by -169 -148134 -35397908 divided by 14 -2528422 What is 5459705 divided by 61345? 89 Calculate 19801 divided by -29. -19801/29 What is -54053208 divided by 194436? -278 80821557 divided by -81 -997797 What is 54377526 divided by 119? 456954 Divide 34 by 16751730. 17/8375865 Calculate 108578955 divided by -5. -21715791 Calculate -62900 divided by -62. 31450/31 Divide -892944960 by 120. -7441208 Calculate 872526642 divided by 26. 33558717 What is 1501047 divided by -77? -1501047/77 What is 214300 divided by -2708? -53575/677 166684322 divided by 7 23812046 38966391 divided by 38966391 1 What is 54358479 divided by 9? 6039831 Calculate -22481 divided by 1278. -22481/1278 Divide 98577 by 3578. 98577/3578 Divide 31230633 by 1. 31230633 Divide -3 by -15864857. 3/15864857 Calculate -150392655 divided by 21484665. -7 What is -5491 divided by 2907? -17/9 What is 255685 divided by 199? 255685/199 Calculate -526784365 divided by -5. 105356873 Calculate 872657952 divided by 436328976. 2 Divide -65756 by 29. -65756/29 205 divided by 49419 205/49419 What is -1566678400 divided by -3916696? 400 Calculate 292708232 divided by -36588529. -8 What is -110346881 divided by -2? 110346881/2 Calculate 293 divided by 7403. 293/7403 What is -2967384 divided by -68? 43638 What is 538 divided by -25872? -269/12936 Divide -20042400 by 4008480. -5 What is -5 divided by -3285383? 5/3285383 What is -81493568 divided by 1? -81493568 -294151644 divided by 4 -73537911 Divide 55335 by -85. -651 5 divided by 45591810 1/9118362 Calculate 4345021 divided by 37. 117433 What is -2569840 divided by -7? 367120 What is -3192571 divided by 1? -3192571 Calculate -773359 divided by -15. 773359/15 Calculate 3056498 divided by 3056498. 1 Divide 9001 by 7468. 9001/7468 What is -91547755 divided by 220597? -415 What is 111167328 divided by 55583664? 2 185566626 divided by -70131 -2646 707 divided by -8631 -101/1233 2468970 divided by 126 19595 What is -61511 divided by 2174? -61511/2174 Calculate 7246030 divided by 6934. 1045 What is -847989 divided by 39? -282663/13 -7922848 divided by -990356 8 What is -213864504 divided by -3? 71288168 Divide 29312874 by -1. -29312874 What is 30444652 divided by 2? 15222326 Calculate 71503275 divided by -15. -4766885 What is 116201550 divided by 2? 58100775 -2634998 divided by -14558 181 What is -12674130 divided by -1? 12674130 Divide 1054 by -5071. -1054/5071 What is -7145982 divided by -2? 3572991 Calculate 31905 divided by 1249. 31905/1249 Divide 76300048 by 3468184. 22 Calculate -120416109 divided by -88737. 1357 What is -4125600 divided by 90? -45840 -751 divided by 16154 -751/16154 Divide 32531080 by 813277. 40 What is 3024956 divided by 22? 137498 Calculate 32994332 divided by -14. -2356738 -2461 divided by -104177 2461/104177 What is 151987745 divided by 1235? 123067 64541631 divided by -3 -21513877 What is -19158 divided by 287? -19158/287 What is 2229672 divided by 24? 92903 26393384 divided by 13196692 2 What is 1366 divided by 9284? 683/4642 -58776045 divided by 15 -3918403 What is -15529742 divided by 25334? -613 Calculate -3637632 divided by -37892. 96 What is -263778018 divided by -17? 15516354 Divide 3697 by -4451. -3697/4451 Divide -5924892 by 22. -2962446/11 -6225711 divided by -1371 4541 What is -3004286380 divided by -5? 600857276 Divide 13316070 by -3. -4438690 7858162 divided by 134 58643 What is -12843846 divided by -158566? 81 Divide 2782324 by 1. 2782324 Calculate 2 divided by -1549852. -1/774926 -3412153 divided by 4 -3412153/4 What is -44700822 divided by 107973? -414 What is -4599488 divided by -6? 2299744/3 -65 divided by -15171 5/1167 721963368 divided by 42 17189604 What is -179 divided by 2079063? -179/2079063 What is -8331692 divided by -4? 2082923 Divide 480778092 by 36. 13354947 What is -3889512 divided by 1944756? -2 -11707 divided by -1087 11707/1087 Divide 40172968 by 242. 166004 -70100638 divided by 13 -70100638/13 Divide -5203934 by 166. -31349 48208605 divided by 3213907 15 Divide -41200128 by 286112. -144 Calculate -207688175 divided by -772075. 269 Divide 9277605 by -10851. -855 Calculate -143586913 divided by -17. 8446289 -13 divided by -3781361 13/3781361 What is -617 divided by 30124? -617/3	{ "pile_set_name": "DM Mathematics" }
rmine g(69). -2 Let r(g) = -g*2 - 56g + 208. Calculate r(-58). 92 Let t(p) = -p*3 - 13p*2 - 7p + 39. What is t(-13)? 130 Let f(r) = -2r3 + 126r*2 + 1294r + 107. What is f(72)? -37 Let j(f) = f*3 - 16f*2 - 228f + 75. Calculate j(25). 0 Let c(o) = -o*3 + 13o*2 - 19o + 9. Determine c(5). 114 Let p(x) = x*3 - 2x*2 + 47x + 93. Give p(-2). -17 Let v(l) = 64l2 + 2l - 39. Give v(0). -39 Let r(f) = -f*3 + 13f*2 - 27. What is r(13)? -27 Let x(u) = 579u - 17367. Calculate x(30). 3 Let s(r) = 36r - 137. Determine s(7). 115 Let j(y) = -y2 - 28y - 8. Give j(-23). 107 Let m(b) = -8982b - 44907. What is m(-5)? 3 Let k(y) = 5036y - 25168. What is k(5)? 12 Let d(r) = r*2 + 465r + 4991. What is d(-11)? -3 Let w(p) = p*3 + 10p*2 - 6p - 103. Give w(-10). -43 Let h(w) = -w*3 + 29w*2 - 202w + 74. Give h(18). 2 Let n(o) = 11878o - 95040. Calculate n(8). -16 Let k(j) = -83j*3 - 4j*2 + 6j + 11. Calculate k(-1). 84 Let h(f) = f*3 + 14f*2 - 43f - 525. Determine h(-6). 21 Let t(m) = -m*2 + 4m + 76. Determine t(11). -1 Let q(m) = 5m2 - 89m - 720. Calculate q(-6). -6 Let b(m) = -2m + 6. Determine b(20). -34 Let a(z) = 7z*2 + 481z - 962. Determine a(2). 28 Let a(z) = -338z - 2154. What is a(-6)? -126 Let c(h) = 2h*2 + 448h + 889. Calculate c(-2). 1 Let q(t) = -12t2 + 2t + 28. Calculate q(0). 28 Let o(w) = -4w2 + 3w - 14. Give o(5). -99 Let n(t) = -126t - 3149. What is n(-25)? 1 Let a(w) = -36w + 223. Determine a(5). 43 Let g(p) = p*3 + 23p*2 - 196p + 213. What is g(-30)? -207 Let g(y) = -7656y + 30607. What is g(4)? -17 Let q(n) = -9n + 9. Calculate q(-2). 27 Let d(y) = 1051y + 9467. Give d(-9). 8 Let m(y) = y2 + 28y + 191. Calculate m(-8). 31 Let g(t) = -t*3 - 4t*2 - 8t - 65. What is g(-5)? 0 Let k(j) = -93j - 1950. Give k(-21). 3 Let d(y) = 3y*3 + 56y*2 + 38y + 30. Determine d(-18). -6 Let g(s) = -47s - 554. Determine g(-16). 198 Let t(k) = k3 + 19k*2 + 35k + 16. What is t(-17)? -1 Let i(y) = 42y - 1001. Determine i(21). -119 Let s(t) = 147t*2 + 1346t + 214. Calculate s(-9). 7 Let p(l) = -44l - 727. Determine p(-20). 153 Let p(j) = -4j*2 + 44j - 33. Calculate p(12). -81 Let k(y) = 34y - 77. Calculate k(2). -9 Let h(m) = -184m + 24836. Calculate h(135). -4 Let d(a) = -a*3 - 8a*2 - 17a - 123. Give d(-8). 13 Let r(d) = 183d + 8056. What is r(-44)? 4 Let f(s) = -942s - 8479. What is f(-9)? -1 Let q(b) = -601b + 4060. Give q(7). -147 Let u(k) = 3k - 196. Determine u(68). 8 Let u(j) = -j*3 + 2j*2 + 11j - 14. Calculate u(2). 8 Let r(g) = -g*2 - 57g - 177. Calculate r(-53). 35 Let s(a) = 127a + 49. What is s(2)? 303 Let r(m) = -m3 - 24m*2 - 16m - 4. What is r(-23)? -165 Let d(z) = z*3 + 4z*2 + 8z + 48. Determine d(-5). -17 Let t(x) = -2x2 + 12x + 58. What is t(8)? 26 Let o(x) = -x*2 - 27x - 179. Determine o(-12). 1 Let f(i) = 4i2 + 3i + 1. Calculate f(-2). 11 Let q(p) = 246p - 370. Determine q(2). 122 Let q(n) = -685n + 7. Determine q(0). 7 Let s(t) = -26t3 - 5t*2 + 6t - 9. Give s(3). -738 Let g(y) = -97y + 3159. What is g(36)? -333 Let p(j) = -37j*2 - 5j - 19. Calculate p(-3). -337 Let u(x) = -3x2 + 96x + 37. Give u(31). 130 Let p(q) = -q*2 - 7q - 66. Determine p(0). -66 Let q(m) = -145m - 1113. Calculate q(-7). -98 Let h(u) = -3u*3 + 60u*2 - 252u - 13. Give h(14). -13 Let n(s) = -7s - 63. Determine n(-5). -28 Let u(l) = 262l - 40618. Give u(155). -8 Let y(v) = 187v - 45631. What is y(244)? -3 Let a(d) = d3 - 21d*2 - 67d + 275. Determine a(24). 395 Let c(p) = -1570p - 1588. Give c(-1). -18 Let v(w) = w2 + 25w - 275. What is v(-33)? -11 Let j(s) = 128s + 885. Give j(-6). 117 Let a(g) = 89g + 7206. What is a(-80)? 86 Let x(i) = i*3 + 36i*2 + 115i - 541. Determine x(-32). -125 Let o(y) = -7y2 - 17y + 33. Determine o(5). -227 Let y(z) = -5z3 + 5z*2 - 7z + 17. Give y(4). -251 Let p(g) = 8g2 - 222g + 889. Calculate p(5). -21 Let x(r) = -38r - 425. Calculate x(-11). -7 Let c(q) = -q3 + 22q*2 - 23q + 26. Give c(21). -16 Let d(p) = 1746p + 6980. Calculate d(-4). -4 Let o(s) = -16s*2 + 1282s - 130. What is o(80)? 30 Let y(t) = -2t3 - 25t*2 + 5t - 80. Calculate y(-13). 24 Let s(n) = -38n - 84. Determine s(-2). -8 Let c(z) = -74z*2 + 515z + 10. Calculate c(7). -11 Let w(q) = -2q3 - 97q*2 - 48q - 80. Give w(-48). -80 Let i(s) = -s*3 - 5s*2 + 46s - 8. What is i(-10)? 32 Let t(g) = -12368g + 111307. Give t(9). -5 Let w(b) = -b3 - 50b*2 + 400b + 62. What is w(-57)? 5 Let h(q) = -82q + 9364. Calculate h(114). 16 Let v(x) = x2 + 55x + 703. Give v(-34). -11 Let x(f) = 5f2 - 4f + 14. Calculate x(7). 231 Let k(i) = -2i2 + 8i + 277. What is k(-10)? -3 Let j(x) = -3x3 + 64x*2 - 23x + 21. What is j(21)? -21 Let j(w) = -w*3 - 51w*2 - 77w + 807. What is j(-49)? -222 Let z(b) = 31b + 293. Give z(-8). 45 Let v(b) = -b3 + 35b*2 + 317b - 719. Give v(-9). -8 Let i(v) = -21v - 520. What is i(-28)? 68 Let a(t) = 4t - 260. Calculate a(44). -84 Let a(s) = -s*3 - 20s*2 - 14s - 267. Determine a(-20). 13 Let h(v) = v*2 + 38v + 219. What is h(-31)? 2 Let j(a) = 31a + 90. Give j(-12). -282 Let x(j) = 14j*3 + 7j*2 + 28j + 57. What is x(-4)? -839 Let y(h) = 3820h + 34386. Calculate y(-9). 6 Let v(y) = -7y*3 + 314y*2 + 46y - 50. Calculate v(45). -5 Let g(n) = n*3 - 14n*2 - 41n + 408. Determine g(5). -22 Let r(j) = j*3 - 25j*2 - 3j + 128. Determine r(25). 53 Let q(m) = 124m + 3695. Determine q(-30). -25 Let w(q) = q3 + 64q*2 - 9q - 116. What is w(-64)? 460 Let b(c) = 4c2 + 24c - 83. What is b(3)? 25 Let c(x) = 45x - 35. Give c(-2). -125 Let l(h) = h3 + 4h*2 + h + 10. Determine l(-5). -20 Let w(b) = 2b*2 - 49b - 362. Calculate w(-6). 4 Let m(j) = -j*3 + 2j*2 + 15j + 54. Give m(-5). 154 Let n(m) = -254m + 1942. Determine n(8). -90 Let n(o) = o2 + 111o + 916. Give n(-9). -2 Let g(b) = 14b - 353. Give g(8). -241 Let o(s) = -s3 + 26s*2 - 79s - 197. What is o(21)? 349 Let k(y) = -2383y - 16700. What is k(-7)? -19 Let r(l) = 2l*3 - 15l - 1. Calculate r(-5). -176 Let c(g) = 6g2 - 178g + 49. Give c(32). 497 Let r(j) = -224j - 1. Determine r(-1). 223 Let y(m) = -m3 - 45m*2 - 37m + 238. Calculate y(-44). -70 Let j(z) = -40z3 - 949z*2 + 265z + 32. Give j(-24). 8 Let u(g) = -66g2 + 132g - 13. Determine u(2). -13 Let k(g) = -488g + 59050. Determine k(121). 2 Let i(k) = -205k - 2187. Determine i(-11). 68 Let i(j) = 6j - 723. Give i(119). -9 Let k(j) = -3j*2 - 63j - 13. Determine k(-21). -13 Let c(i) = i*2 - 60i - 242. Calculate c(-4). 14 Let y(z) = -3z2 - 5z - 19. What is y(-3)? -31 Let n(p) = p*2 + 33p + 263. Determine n(-21). 11 Let u(c) = -807c - 1618. Calculate u(-2). -4 Let w(j) = -j3 + 9j*2 - 16j - 70. Determine w(7). -84 Let n(h) = 45h + 1163. Give n(-26). -7 Let t(m) = -m2 + 196m - 1143. Determine t(190). -3 Let o(t) = -t*2 - 107t + 588. Determine o(5). 28 Let d(i) = -3i3 - 5i*2 - 10i - 17. What is d(-2)? 7 Let s(d) = 2d2 + 117d - 485. Calculate s(-61). -180 Let v(g) = 10g2 + 129g + 106. Give v(-12). -2 Let c(z) = 27z2 + 792z + 234. Determine c(-29). -27 Let y(c) = c*3 - 6c*2 + 172c - 636. Determine y(4). 20 Let j(u) = -235u + 118. Calculate j(2). -352 Let z(q) = q3 + 10q*2 - 8q - 145. Determine z(-7). 58 Let h(p) = 4p2 + 1188p + 76762. Calculate h(-202). 2 Let a(n) = -229n + 19671. Give a(86). -23 Let h(f) = -1134f - 1120. Calculate h(-1). 14 Let k(t) = -74t - 12. What is k(2)? -160 Let j(r) = r3 - 6r*2 + 11r - 64. What is j(6)? 2 Let s(h) = -h*3 - 3h*2 + h - 39. Give s(-7). 150 Let o(g) = -2g*2 - 21g - 63. Give o(-3). -18 Let y(i) = -i*3 + 7i*2 - 215i + 1071. Give y(5). 46 Let p(h) = 502h - 12552. Determine p(25). -2 Let h(p) = -p2 + 30p + 641. Determine h(-15). -34 Let s(c) = c*2 - 15c - 816. What is s(-22)? -2 Let b(r) = -106r - 224. What is b(-3)? 94 Let f(t) = 233t + 2093. Determine f(-9). -4 Let z(t) = 20197t + 20194. Give z(-1). -3 Let w(z) = -19z - 352. Give w(-11). -143 Let p(g) = 3707g - 7440. Give p(2). -26 Let p(v) = v3 - 4v*2 + 13v - 10. Give p(4). 42 Let s(q) = -13q*2	{ "pile_set_name": "DM Mathematics" }
Collect the terms in -214w - 211w - 209w + 625w. -9w Collect the terms in 1932r*2 - 3861r*2 + 1927r*2. -2r*2 Collect the terms in 21x - 6x - 23x. -8x Collect the terms in 213d*3 - 217d*3 - 2d + 2d. -4d*3 Collect the terms in -8 - 3 - 5c + 10 + 1. -5c Collect the terms in -6949m*3 + 3478m*3 + 3469m*3. -2m*3 Collect the terms in 198s*2 + 1131s*2 + 1591s*2. 2920s*2 Collect the terms in 265d*2 + 95d*2 - 37d*2. 323d*2 Collect the terms in 11732x - 2x3 - 5872x + x*3 - 5860x. -x*3 Collect the terms in 58 + 66 - 124 - 2h*2. -2h*2 Collect the terms in -6r - 9r + 18r. 3r Collect the terms in 3t + 2t - 4t. t Collect the terms in -2q + 0q + 2q + 8q. 8q Collect the terms in 0i - 7i + 2i + 3i. -2i Collect the terms in -1214136 - 2b2 + 1214136. -2b*2 Collect the terms in -7 - 8q3 + q3 - 2. -7q3 - 9 Collect the terms in 2p - 6p + 4p + 4p3 - 7p*3. -3p*3 Collect the terms in -9936w + 9938w + 0 + 0. 2w Collect the terms in -125d2 + 49d*2 + 36d*2 + 40d*2 - 2d*3. -2d*3 Collect the terms in -347r + 1 - 1 + 340r. -7r Collect the terms in 9a3 - 8a*3 - 7a*3 + 8a3 + a3. 3a3 Collect the terms in -89y*3 - 111y3 + y3. -199y3 Collect the terms in -11v + 7v + v + 2v. -v Collect the terms in 2134 - 2134 + 0h + 7h. 7h Collect the terms in -3d + 10 + 9 - 4 - 15. -3d Collect the terms in 3w + 44w3 - 3w. 44w3 Collect the terms in 7z - 4z - 31z. -28z Collect the terms in 2 - 2 - 19v + 7v. -12v Collect the terms in -20n - n + 12n. -9n Collect the terms in -4 - 5 + 2f - 11f + 4f. -5f - 9 Collect the terms in 3w3 - w3 + 3w3 - 4w3. w3 Collect the terms in 23g2 - 15g*2 + 23g*2 + 8g*2. 39g*2 Collect the terms in 0 - 3796h + 0 + 3793h. -3h Collect the terms in 431p - 149p - 142p + p3 - 140p. p*3 Collect the terms in 47y*2 - 5 + 5. 47y*2 Collect the terms in 54w - 11w - 6w. 37w Collect the terms in -8z + 11z - 11z. -8z Collect the terms in 88y*3 - 182y*3 + 91y*3. -3y*3 Collect the terms in 0s + 0s - 10 - 6s*2 + 32. -6s*2 + 22 Collect the terms in -34n + 10n + 11n + 4n. -9n Collect the terms in 7u + 2 - 7u + 8u + 12u. 20u + 2 Collect the terms in -1 + 3 - 21x*2 - 2. -21x*2 Collect the terms in -3 - 19t*2 + 53t*2 + 6. 34t*2 + 3 Collect the terms in 1 + a - 1 - 1 + 1. a Collect the terms in 159 + 159 - 20i*2 + 164 - 482. -20i*2 Collect the terms in -2 + 2a - 14 + a - 18. 3a - 34 Collect the terms in 18q*2 + 4q*2 + 42q*2. 64q*2 Collect the terms in 128u - 14u + 2 + 70u - 32u. 152u + 2 Collect the terms in -3v2 + 14v*2 + 10v*2. 21v*2 Collect the terms in -8 + 1 + 4l*3 + 7. 4l*3 Collect the terms in 13l*3 - 21l*3 - 9l*3. -17l*3 Collect the terms in -26m + 7m2 + 26m. 7m2 Collect the terms in 144h*3 + 163h*3 - 40h*3. 267h*3 Collect the terms in -84q*3 - q + 4q - 4q. -84q*3 - q Collect the terms in -1 + 3 - 7 + 18d*2 + 4. 18d*2 - 1 Collect the terms in -7q*2 + 11q*2 - 4q*2 - 4q*3. -4q*3 Collect the terms in -7o + 6o + 11 - 11. -o Collect the terms in 166076 - 2x - 166076. -2x Collect the terms in 43 + 42 + 2x*3 - 85. 2x*3 Collect the terms in -16g - 15g + 27g. -4g Collect the terms in 2o - 3o + 0o*3 + 5o*3 - o. 5o*3 - 2o Collect the terms in 799 - 799 - 16g3. -16g3 Collect the terms in -p2 - 3 + 0 - 17p2 + 2. -18p*2 - 1 Collect the terms in 53j*3 - 109j*3 + 30j*3 + 25j3. -j3 Collect the terms in 48s - 3s2 + s2 + 40s - 88s. -2s2 Collect the terms in 23i - 16i + 2 - 42i. -35i + 2 Collect the terms in -119n + 46n + 64n. -9n Collect the terms in 23x*2 + 3x*3 + 22x*2 - 45x*2. 3x*3 Collect the terms in 3a + 5a + 10a - 18a + 2a. 2a Collect the terms in -4 - 2 + 6 + 857v*3. 857v*3 Collect the terms in -195u*3 + 3257 + 64u*3 - 3257. -131u*3 Collect the terms in -8 + 8 + 37q - 41q. -4q Collect the terms in -10f3 + 0 - 4 + 4. -10f*3 Collect the terms in 25v - 5v - 22v. -2v Collect the terms in -1679z + z*2 + 1679z. z*2 Collect the terms in 2v*2 - 14v*2 - 48v*2. -60v*2 Collect the terms in 416p*2 + 397p*2 - 818p*2. -5p*2 Collect the terms in -218 + 218 + 23u. 23u Collect the terms in -18a - 10a2 + 25a*2 + 18a. 15a2 Collect the terms in -196g + 188g - 1 - 2. -8g - 3 Collect the terms in 2169251l2 + 8l*3 - 2169251l*2. 8l*3 Collect the terms in 28z*2 - 6z*3 - 40z*2 + 21z*3 + 12z*2. 15z*3 Collect the terms in -27 - 3d - 7d + 12d. 2d - 27 Collect the terms in -59w - 41w + 100w - w2 - w2. -2w2 Collect the terms in 40i*3 + 84i*3 + 85i*3 + 168i*3. 377i*3 Collect the terms in -7u*2 + 15u*2 + 5 - 5. 8u*2 Collect the terms in 32c + 3c + 7c - 7c. 35c Collect the terms in 135q3 - 89q*3 + 134q*3 + 3q*3. 183q*3 Collect the terms in 174x*3 + 171x*3 - 350x*3. -5x*3 Collect the terms in 83n*2 + 83n*2 - 158n*2. 8n*2 Collect the terms in -2713h*2 - 39h + 4h - 2h*3 + 2713h*2. -2h*3 - 35h Collect the terms in -21d2 + 9d*2 + 12d*2 + 21d*3. 21d*3 Collect the terms in 42 - 18 - 24 - 1060h*3. -1060h*3 Collect the terms in -14r*2 + 6r*2 + 10r*2. 2r*2 Collect the terms in 122r - 119r + 65 - 65. 3r Collect the terms in -19c2 - 29c*2 + 27c*2. -21c2 Collect the terms in -y2 + 9y2 - 3y + 2y + 3y*2. 11y*2 - y Collect the terms in 19t + 20t - 37t. 2t Collect the terms in 10w + 187w3 - 10w. 187w3 Collect the terms in 26w - 9w + 16w. 33w Collect the terms in 4m + 4m - 11m. -3m Collect the terms in -7578g*3 + 3791g*3 + 3791g*3. 4g*3 Collect the terms in -146m*2 - 132m*2 - 176m*2 + 56m*2. -398m*2 Collect the terms in -19x + 3x - 5x. -21x Collect the terms in -1 + 2968i + 2970i + 1 - 5934i. 4i Collect the terms in -18s + 35s - 15s. 2s Collect the terms in h - h + 6h*3 - h. 6h*3 - h Collect the terms in -208v + 6 + 1 + 11. -208v + 18 Collect the terms in 3d*2 - 7d2 + d2. -3d2 Collect the terms in 20k - 20k + 31k*3. 31k*3 Collect the terms in -l + 3l - 51 + 15. 2l - 36 Collect the terms in -24p - 47 + 89 - 44. -24p - 2 Collect the terms in -31 - 3n - 26 + 57. -3n Collect the terms in 331s*3 - 175s*3 - 155s3. s3 Collect the terms in 17i - 54 + 54. 17i Collect the terms in 6z + z - 3z + 10z. 14z Collect the terms in 20t2 - 73t*2 + 24t*2 + 26t*2. -3t*2 Collect the terms in 3421n*2 - 2n*3 + 4n*3 - 3421n*2. 2n*3 Collect the terms in 28u*2 + 2u - 4u2 - 18u*2. 6u*2 + 2u Collect the terms in -471n3 + 155n*3 + 314n*3. -2n*3 Collect the terms in -10a + 17a - 11a. -4a Collect the terms in -103s*2 + 31s*2 + 24s*2 + 27s*2 + 19s*2. -2s*2 Collect the terms in 13j - 4j - 11j - j. -3j Collect the terms in 12d*3 + 9d*3 - 22d3. -d3 Collect the terms in 5q2 + 10q*2 + 6q*2. 21q*2 Collect the terms in -4k + 5k2 + 4k. 5k2 Collect the terms in 14 + 5i*3 + 29i*3 - 14. 34i*3 Collect the terms in 29x*2 + 20x*2 + 19x*2 + 10x*2 - 77x2. x2 Collect the terms in 16m2 + 15m*2 - 44m*2 + 14m2. m2 Collect the terms in 2p - 2p + 0p - 2p. -2p Collect the terms in -4p + 29p - 23p. 2p Collect the terms in 32o*3 + 5o*3 - 38o3. -o3 Collect the terms in -3g2 - 2g*2 + 3g*2. -2g*2 Collect the terms in 0b*3 + 0b3 - b3 - 2b3. -3b*3 Collect the terms in 3p + 3p + 3p - 5p. 4p Collect the terms in -21g2 + 267 - 267. -21g*2 Collect the terms in -13 + 13 + 9z*2. 9z*2 Collect the terms in 7 - 40 - 17 - 5g. -5g - 50 Collect the terms in 12j2 + j2 - 5j2 - 2j*2 - 5j2. j2 Collect the terms in -i2 + 35 + 40 + 32 - 107. -i2 Collect the terms in 105l - 16l*2 - 207l + 102l. -16l*2 Collect the terms in 0g - 6g + 131 - 131. -6g Collect the terms in 4s - 8s - 7s3 - 15s + 5s3. -2s*3 - 19s Collect the terms in -42j - 14j*3 + 3j*3 + 42j. -11j3 Collect the terms in -64c*3 + 0c*3 - 22c*3. -86c**	{ "pile_set_name": "DM Mathematics" }
, -81043, -81046? -81049 What is the next term in -508, -3820, -9294, -16894, -26584, -38328, -52090, -67834? -85524 What is next in -1785213, -1785209, -1785205? -1785201 What is the next term in 5706, 23458, 53022, 94380, 147514, 212406, 289038? 377392 What is next in -252972, -253064, -253216, -253428, -253700, -254032? -254424 What is the next term in 1526, 1552, 1600, 1670, 1762, 1876? 2012 What comes next: 59147130, 118294273, 177441414, 236588553, 295735690, 354882825? 414029958 What is next in -7807210, -31228860, -70264944, -124915462, -195180414, -281059800? -382553620 What is next in -17013, -33771, -50529, -67287? -84045 What is next in -44394, -44544, -44786, -45126, -45570, -46124? -46794 What comes next: -7826, -62170, -209668, -496904, -970462, -1676926, -2662880, -3974908? -5659594 What is next in -10017, -20107, -30287, -40563, -50941, -61427? -72027 What is the next term in 5543, 22149, 49813, 88535, 138315? 199153 What comes next: -16486, -33500, -50514? -67528 What comes next: -104360, -208697, -313014, -417311? -521588 What is the next term in -20860, -29948, -39036, -48124, -57212? -66300 What comes next: -115577, -115492, -115351, -115154, -114901? -114592 What is the next term in 550282, 1100548, 1650790, 2201008, 2751202, 3301372, 3851518? 4401640 What is the next term in -236, -974, -2218, -3962, -6200, -8926? -12134 What comes next: 35552, 72356, 109160, 145964, 182768? 219572 What is next in 57078, 114042, 170980, 227886, 284754? 341578 What is the next term in -20994, -148779, -495622, -1171053, -2284602, -3945799, -6264174? -9349257 What is the next term in 22567, 22170, 21773, 21376, 20979, 20582? 20185 What is next in -633024, -1266052, -1899084, -2532120, -3165160, -3798204, -4431252? -5064304 What is next in 12246, 12264, 12282, 12300? 12318 What is next in 29674578, 29674577, 29674576, 29674575, 29674574, 29674573? 29674572 What is the next term in 42462, 51442, 60422? 69402 What comes next: 41920772, 83841549, 125762326, 167683103, 209603880, 251524657? 293445434 What comes next: 24292623, 24292617, 24292611, 24292605, 24292599? 24292593 What comes next: 29174, 25649, 22110, 18551, 14966, 11349, 7694, 3995? 246 What is next in 128294003, 128294002, 128294001? 128294000 What comes next: 46436241, 46436218, 46436195, 46436172? 46436149 What is next in -3332755, -3332759, -3332765, -3332773, -3332783? -3332795 What is the next term in -13896422, -13896434, -13896446? -13896458 What comes next: 440, 617, 1140, 2183, 3920, 6525? 10172 What is next in -9276, -8684, -7090, -3996, 1096, 8684, 19266? 33340 What comes next: -28115, -28233, -28315, -28343, -28299? -28165 What is the next term in 4333, 17538, 39615, 70564, 110385, 159078? 216643 What comes next: 53146, 212547, 478244, 850255, 1328598, 1913291, 2604352, 3401799? 4305650 What comes next: 72993158, 72993159, 72993160, 72993161? 72993162 What is the next term in 177, 811, 1907, 3465, 5485? 7967 What is the next term in -4298888, -4298887, -4298886, -4298885, -4298884, -4298883? -4298882 What comes next: -69412, -277540, -624384, -1109944? -1734220 What is next in 162144, 324512, 487106, 649926, 812972, 976244? 1139742 What comes next: 1474898, 2949810, 4424722, 5899634? 7374546 What is next in -88, 40, 252, 548, 928, 1392, 1940? 2572 What comes next: 490, 1208, 3236, 7228, 13838, 23720, 37528? 55916 What is the next term in 11134, 45393, 102500, 182461, 285282? 410969 What comes next: -4086318, -8172633, -12258948, -16345263? -20431578 What is the next term in -2344, -2135, -1788, -1303, -680, 81? 980 What is the next term in -49392, -197598, -444706, -790794, -1235940, -1780222, -2423718, -3166506? -4008664 What comes next: 28275, 60274, 92261, 124230, 156175? 188090 What is the next term in -540, -375, 1312, 5331, 12492, 23605? 39480 What is next in 1234499, 2468997, 3703495, 4937993? 6172491 What is next in -25042, -99653, -224006, -398101, -621938? -895517 What is the next term in -1020534, -1020547, -1020570, -1020609, -1020670? -1020759 What is the next term in 186804, 373546, 560288, 747030, 933772? 1120514 What is next in -20653596, -20653594, -20653592? -20653590 What is next in -370328, -740093, -1109858, -1479623, -1849388, -2219153? -2588918 What is next in -1841, -1818, -1711, -1478, -1077? -466 What comes next: 478575, 957148, 1435719, 1914288, 2392855? 2871420 What is next in -130245, -523935, -1180085, -2098695, -3279765, -4723295, -6429285? -8397735 What is the next term in -1787785, -3575560, -5363335, -7151110, -8938885, -10726660? -12514435 What is next in 590997, 1181996, 1772995? 2363994 What comes next: -154766275, -309532548, -464298821, -619065094, -773831367, -928597640? -1083363913 What is next in 8881535, 8881560, 8881583, 8881604, 8881623, 8881640? 8881655 What is the next term in -56384, -225465, -507252, -901745? -1408944 What comes next: -90011, -360118, -810331, -1440650, -2251075, -3241606? -4412243 What is next in 66002, 66058, 66200, 66470, 66910, 67562, 68468, 69670? 71210 What comes next: -2047, -8608, -19537, -34828, -54475? -78472 What is next in 35430, 141848, 319228, 567570, 886874, 1277140? 1738368 What comes next: -126793, -127408, -128049, -128728, -129457? -130248 What comes next: 940, -4484, -13524, -26180, -42452, -62340, -85844? -112964 What is the next term in 1939, 17505, 33071, 48637? 64203 What is next in 7087733, 7087736, 7087741, 7087748, 7087757, 7087768, 7087781? 7087796 What is next in 50, 224, 546, 1022, 1658, 2460, 3434? 4586 What is next in -70413, -69594, -68229, -66318, -63861, -60858, -57309? -53214 What is the next term in 7031877, 7031883, 7031889, 7031895? 7031901 What comes next: 1559, 1188, 581, -262? -1341 What is next in -3958, -15913, -35838, -63733, -99598, -143433, -195238? -255013 What is the next term in 4378, 6186, 7994? 9802 What is next in -520591, -520592, -520593, -520594? -520595 What comes next: -236, -636, -1166, -1838, -2664? -3656 What comes next: 24061371, 24061368, 24061365, 24061362, 24061359, 24061356? 24061353 What is next in 449965, 450337, 450957, 451825, 452941, 454305? 455917 What is next in 25610, 55260, 84910? 114560 What is next in -45260976, -45260980, -45260984, -45260988, -45260992? -45260996 What comes next: 24709, 60351, 95993? 131635 What is the next term in 920452, 920466, 920480, 920494? 920508 What is next in -35443, -35256, -34971, -34594, -34131, -33588, -32971, -32286? -31539 What is the next term in 9588, 18951, 28314, 37677, 47040? 56403 What is next in -64313, -128535, -192669, -256721, -320697, -384603, -448445? -512229 What is next in 5398458, 10796909, 16195346, 21593763, 26992154? 32390513 What is the next term in 37585237, 150340954, 338267153, 601363834, 939630997? 1353068642 What is next in 61484, 54460, 47436? 40412 What is the next term in 13928, 14048, 14266, 14588, 15020? 15568 What is next in 422298229, 422298231, 422298233, 422298235, 422298237, 422298239? 422298241 What comes next: 104810, 428984, 969274, 1725680? 2698202 What comes next: -17137457, -17137453, -17137451, -17137451, -17137453? -17137457 What is next in 23630, 21626, 19622? 17618 What comes next: 48674, 97713, 146752, 195791? 244830 What comes next: 2323136, 4646157, 6968960, 9291437, 11613480? 13934981 What is next in -61, -212, -349, -472, -581, -676, -757? -824 What comes next: -905442, -905668, -905894, -906120, -906346? -906572 What is next in 96022, 190382, 284740, 379096? 473450 What comes next: 16910, 17226, 17946, 19274, 21414, 24570, 28946? 34746 What comes next: 93282, 93222, 93168, 93120, 93078, 93042, 93012? 92988 What comes next: 364262, 365344, 367148, 369674? 372922 What comes next: 93635069, 93635068, 93635067, 93635066, 93635065, 93635064? 93635063 What is the next term in 2602939, 2602937, 2602925, 2602897, 2602847, 2602769, 2602657? 2602505 What is next in 85827977, 85827971, 85827963, 85827953, 85827941? 85827927 What is the next term in -24295487, -24295491, -24295497, -24295505? -24295515 What is the next term in 14183, 28280, 42377, 56474, 70571, 84668? 98765 What is next in -1978927, -1978929, -1978941, -1978969, -1979019, -1979097? -1979209 What is the next term in -3777, -4618, -5459, -6300, -7141, -7982? -8823 What is next in -2031, -	{ "pile_set_name": "DM Mathematics" }
there between 3:05 AM and 10:44 AM? 459 What is 677 minutes before 7:49 PM? 8:32 AM What is 620 minutes before 5:33 AM? 7:13 PM What is 525 minutes before 4:33 AM? 7:48 PM How many minutes are there between 8:52 AM and 2:12 PM? 320 What is 612 minutes after 12:23 AM? 10:35 AM How many minutes are there between 12:27 AM and 5:55 AM? 328 What is 115 minutes after 12:37 PM? 2:32 PM What is 520 minutes after 1:23 AM? 10:03 AM What is 401 minutes before 10:54 AM? 4:13 AM How many minutes are there between 2:32 AM and 5:54 AM? 202 How many minutes are there between 8:30 AM and 4:58 PM? 508 What is 127 minutes before 3:00 AM? 12:53 AM How many minutes are there between 8:44 AM and 2:08 PM? 324 What is 139 minutes after 5:37 AM? 7:56 AM How many minutes are there between 6:48 PM and 12:30 AM? 342 How many minutes are there between 2:13 PM and 12:36 AM? 623 How many minutes are there between 11:38 AM and 6:39 PM? 421 What is 596 minutes after 9:27 AM? 7:23 PM What is 416 minutes after 8:14 PM? 3:10 AM How many minutes are there between 9:55 AM and 5:43 PM? 468 What is 289 minutes after 9:43 AM? 2:32 PM How many minutes are there between 4:56 AM and 3:20 PM? 624 What is 249 minutes after 4:45 AM? 8:54 AM How many minutes are there between 6:27 PM and 10:23 PM? 236 How many minutes are there between 9:47 AM and 9:53 AM? 6 How many minutes are there between 8:26 AM and 6:14 PM? 588 What is 359 minutes after 12:55 PM? 6:54 PM How many minutes are there between 9:06 PM and 3:19 AM? 373 How many minutes are there between 6:47 AM and 6:17 PM? 690 How many minutes are there between 3:24 AM and 8:24 AM? 300 What is 597 minutes before 3:06 PM? 5:09 AM What is 342 minutes after 7:08 PM? 12:50 AM How many minutes are there between 12:55 PM and 9:32 PM? 517 What is 681 minutes before 8:11 PM? 8:50 AM What is 292 minutes before 8:27 AM? 3:35 AM How many minutes are there between 6:37 AM and 6:36 PM? 719 What is 482 minutes after 12:48 AM? 8:50 AM How many minutes are there between 12:47 PM and 12:42 AM? 715 How many minutes are there between 4:24 AM and 3:00 PM? 636 What is 576 minutes after 5:21 PM? 2:57 AM What is 41 minutes before 12:01 PM? 11:20 AM How many minutes are there between 12:52 AM and 6:05 AM? 313 How many minutes are there between 8:20 AM and 4:12 PM? 472 How many minutes are there between 1:46 AM and 11:18 AM? 572 What is 454 minutes after 10:41 AM? 6:15 PM What is 408 minutes after 6:40 PM? 1:28 AM How many minutes are there between 7:19 AM and 8:21 AM? 62 How many minutes are there between 3:25 AM and 4:00 AM? 35 What is 612 minutes after 9:47 PM? 7:59 AM What is 153 minutes before 4:58 PM? 2:25 PM How many minutes are there between 1:44 AM and 7:43 AM? 359 How many minutes are there between 2:07 AM and 6:37 AM? 270 What is 154 minutes after 2:04 PM? 4:38 PM What is 420 minutes before 10:26 PM? 3:26 PM How many minutes are there between 6:12 AM and 12:11 PM? 359 How many minutes are there between 5:53 AM and 11:21 AM? 328 How many minutes are there between 2:51 PM and 9:49 PM? 418 How many minutes are there between 1:37 PM and 5:00 PM? 203 What is 135 minutes before 11:03 AM? 8:48 AM How many minutes are there between 2:30 PM and 12:29 AM? 599 What is 444 minutes after 7:08 PM? 2:32 AM What is 159 minutes after 9:50 PM? 12:29 AM What is 142 minutes after 10:03 AM? 12:25 PM What is 63 minutes after 4:54 PM? 5:57 PM How many minutes are there between 12:27 PM and 3:02 PM? 155 How many minutes are there between 8:25 AM and 2:41 PM? 376 How many minutes are there between 12:12 AM and 10:00 AM? 588 How many minutes are there between 5:36 PM and 3:23 AM? 587 What is 647 minutes after 6:35 PM? 5:22 AM How many minutes are there between 12:22 AM and 9:25 AM? 543 How many minutes are there between 2:03 PM and 12:33 AM? 630 What is 677 minutes after 1:47 AM? 1:04 PM How many minutes are there between 12:37 PM and 8:29 PM? 472 What is 528 minutes before 9:07 AM? 12:19 AM How many minutes are there between 3:47 AM and 2:52 PM? 665 How many minutes are there between 7:25 AM and 8:05 AM? 40 How many minutes are there between 8:58 AM and 6:50 PM? 592 How many minutes are there between 9:12 AM and 6:00 PM? 528 What is 303 minutes after 10:14 AM? 3:17 PM How many minutes are there between 12:23 PM and 7:03 PM? 400 How many minutes are there between 8:56 AM and 3:37 PM? 401 How many minutes are there between 4:04 PM and 6:38 PM? 154 How many minutes are there between 7:20 AM and 11:34 AM? 254 How many minutes are there between 7:31 AM and 10:21 AM? 170 How many minutes are there between 2:03 PM and 11:19 PM? 556 What is 195 minutes before 5:02 AM? 1:47 AM How many minutes are there between 1:26 AM and 12:48 PM? 682 How many minutes are there between 5:12 PM and 4:43 AM? 691 How many minutes are there between 6:08 PM and 12:08 AM? 360 How many minutes are there between 5:49 AM and 10:41 AM? 292 What is 310 minutes after 6:24 PM? 11:34 PM What is 27 minutes after 9:53 AM? 10:20 AM What is 402 minutes after 11:01 AM? 5:43 PM What is 405 minutes before 4:10 AM? 9:25 PM What is 42 minutes after 9:46 AM? 10:28 AM What is 468 minutes before 6:43 AM? 10:55 PM How many minutes are there between 5:29 AM and 2:14 PM? 525 How many minutes are there between 7:50 AM and 2:32 PM? 402 How many minutes are there between 6:32 PM and 11:56 PM? 324 How many minutes are there between 3:10 AM and 1:51 PM? 641 How many minutes are there between 7:45 AM and 11:28 AM? 223 What is 25 minutes after 8:22 PM? 8:47 PM What is 693 minutes before 7:54 AM? 8:21 PM How many minutes are there between 10:20 AM and 11:20 AM? 60 What is 528 minutes after 5:01 AM? 1:49 PM How many minutes are there between 5:02 AM and 4:33 PM? 691 What is 627 minutes before 12:59 PM? 2:32 AM What is 610 minutes before 6:20 PM? 8:10 AM How many minutes are there between 10:21 PM and 7:34 AM? 553 How many minutes are there between 4:46 AM and 2:51 PM? 605 How many minutes are there between 9:13 PM and 6:05 AM? 532 How many minutes are there between 4:24 PM and 3:57 AM? 693 How many minutes are there between 6:51 AM and 11:01 AM? 250 What is 560 minutes before 12:15 AM? 2:55 PM How many minutes are there between 4:37 AM and 11:08 AM? 391 What is 126 minutes before 12:55 PM? 10:49 AM What is 505 minutes before 6:46 AM? 10:21 PM How many minutes are there between 11:42 AM and 9:15 PM? 573 How many minutes are there between 9:45 AM and 7:02 PM? 557 How many minutes are there between 10:01 AM and 2:26 PM? 265 How many minutes are there between 6:42 AM and 4:29 PM? 587 What is 238 minutes before 1:06 AM? 9:08 PM What is 2 minutes before 6:59 AM? 6:57 AM How many minutes are there between 7:02 PM and 6:22 AM? 680 How many minutes are there between 3:32 PM and 4:43 PM? 71 How many minutes are there between 9:43 AM and 1:39 PM? 236 How many minutes are there between 1:04 PM and 8:12 PM? 428 What is 117 minutes after 12:47 PM? 2:44 PM How many minutes are there between 4:52 PM and 3:54 AM? 662 How many minutes are there between 1:54 AM and 1:44 PM? 710 How many minutes are there between 4:41 AM and 1:15 PM? 514 What is 342 minutes before 11:29 PM? 5:47 PM What is 401 minutes before 2:06 PM? 7:25 AM How many minutes are there between 2:46 AM and 8:03 AM? 317 How many minutes are there between 10:08 AM and 3:21 PM? 313 How many minutes are there between 11:26 PM and 1:17 AM? 111 How many minutes are there between 9:02 AM and 3:29 PM? 387 What is 508 minutes after 1:39 AM? 10:07 AM What is 355 minutes before 7:32 AM? 1:37 AM What is 19 minutes after 9:17 PM? 9:36 PM How many minutes are there between 10:04 AM and 4:31 PM? 387 How many minutes are there between 9:57 AM and 10:03 AM? 6 How many minutes are there between 10:37 PM and 9:44 AM? 667 What is 337 minutes after 1:58 PM? 7:35 PM What is 501 minutes before 4:21 AM? 8:00 PM What is 71 minutes after 1:17 PM? 2:28 PM What is 661 minutes after 9:28 AM? 8:29 PM How many minutes are there between 5:37 PM and 8:02 PM? 145 How many minutes are there between 2:49 AM and 7:01 AM? 252 What is 337 minutes after 3:45 PM? 9:22 PM What is 251 minutes before 2:57 AM? 10:46 PM What is 203 minutes after 4:26 PM? 7:49 PM How many minutes are there between 2:14 AM and 12:50 PM? 636 How many mi	{ "pile_set_name": "DM Mathematics" }
ainder when u is divided by q? 15 Let q be (1 + -3 - -23)-2. Let y = -25 - q. What is the remainder when 82 is divided by y? 14 Let m(o) = -27o*2 + o. Let g be m(1). Let f = 53 + g. Calculate the remainder when f is divided by 0 + 2 + 9 + -1. 7 Let z(p) = -2p + 9. What is the remainder when 67 is divided by z(-4)? 16 What is the remainder when 272/5 + 1/(-10)4 is divided by 11? 10 Let i(p) = 4p*2 - 5 - 4p - p2 - p3 + 8. Let w be i(2). Let c = w + 11. What is the remainder when c is divided by 4? 2 Let l(i) = i + 7. Let k be l(-5). Suppose 0 = -2w + 4g + 10, -3g - k = w + 2g. What is the remainder when 4 is divided by w? 1 Let k(g) = -2g2 - 2g + 2. Let z be k(-2). Suppose -2p - n - 10 + 36 = 0, 0 = -2n. Calculate the remainder when p is divided by (z + 0 - 3)-1. 3 Suppose 0 = d - 5q - 29, -q = -2d - 0q + 13. Let w be (d/(-6))/((-4)/1614). Suppose 0 = 4o + 49 - w. Calculate the remainder when o is divided by 19. 17 Let l = -32 - -46. Suppose w + w = 54. Calculate the remainder when w is divided by l. 13 Suppose -4w - 45 = -w. Let k(s) = s*2 + 15s + 15. What is the remainder when k(w) is divided by 8? 7 Suppose 8l = -5l + 208. Calculate the remainder when 95 is divided by l. 15 Calculate the remainder when -1 + (-1 - -3) + 38 is divided by 10. 9 Let b be 3 - (3 + -1)/(-2). Suppose -4j + 2j + b = 0. What is the remainder when 3 is divided by j? 1 Suppose -t + 115 = -0t. What is the remainder when t is divided by 29? 28 Suppose -3c + 3k + 45 = 0, c - 31 = 3k + 2k. Let y(u) = u - 2. Let l be y(4). Calculate the remainder when c is divided by ((-6)/(-8))/(l/16). 5 Let t be 1 + -1(-8)/4. Suppose 50 = tx - 43. What is the remainder when x is divided by 8? 7 Let g = 10 + 3. Suppose v - 2n - g = -2v, 2v = n + 9. Suppose 16 = vz - z. What is the remainder when 6 is divided by z? 2 Let c(b) = b2 - 2b + 19. Calculate the remainder when c(4) is divided by 8. 3 Let q = 15 - 7. Suppose -3i + 4f = -2i - 41, -4f - 104 = -4i. What is the remainder when i is divided by q? 5 What is the remainder when 28 is divided by ((-45)/6 - -2)-2? 6 Calculate the remainder when (30/(-12))/(1/(-6)) - -4 is divided by 7. 5 Let l(i) = 3i2 - i + 1. Suppose 3b + 5 = 2p, -3p + 8 = 4b - 2p. Calculate the remainder when 2/(-7) + 46/14 is divided by l(b). 0 What is the remainder when 1 - (-1066)/10 - (-12)/30 is divided by 16? 12 Let a = -4 - -43. Calculate the remainder when 152 is divided by a. 35 Let q = 0 + 1. What is the remainder when 5/6(-252)/(-6) is divided by 9/((2/4)/q)? 17 Let z be 1/(4 + (-35)/9). Suppose -zu = -u - 24. Suppose 0 = -2r, -3m = -5r - 1 - 2. Calculate the remainder when u is divided by m. 0 Suppose -34 = -5v - o, v - 3o = 2o - 14. Suppose 0 = vk - 5k - 13. What is the remainder when 27 is divided by 1(0 - -1) + k? 13 Suppose 4b + 9 = 2b + a, -4a + 22 = -b. Let z(j) = j*3 + 8j*2 - 12j - 5. What is the remainder when z(-9) is divided by (-1)/b + (-30)/(-4)? 6 Let a = 6 - -3. Suppose 2m - a = -w, 5m - 4m - 8 = -4w. What is the remainder when 6 is divided by m? 2 Suppose -i + 0i = 4a - 79, a + 4i = 16. Let v(j) = j3 + 5j*2 - 3j - 4. What is the remainder when a is divided by v(-5)? 9 Suppose o + 0u + 2u - 33 = 0, 4o = -4u + 140. What is the remainder when 68 is divided by o? 31 Suppose 0 = 6s - 2s - 16. Suppose -14 = -2v - 4z, 0v + sz + 31 = v. What is the remainder when v is divided by 4? 3 Suppose 2g - 30 = -5x, 3g + 10 - 28 = -3x. Suppose c = -5q - 15 + 51, x = c - q. Let n = -6 - -12. Calculate the remainder when c is divided by n. 5 Let l = -1 - -3. Suppose -d - l = 0, 0 = -8a + 3a - 2d + 16. Suppose -68 = -5k + y, ak + 2y + 1 = 47. Calculate the remainder when k is divided by 8. 5 Let o = -271 - -287. Suppose 5z = 2u - 95, 6u = 3u - 2z + 133. Calculate the remainder when u is divided by o. 13 Let l(w) = 6w - 4. Let b = 4 + -1. Suppose 4h = bh + 17. What is the remainder when l(6) is divided by h? 15 Suppose 4k = 280 + 56. Suppose 4y - 4w = y + 47, w = 5y - k. Let v = 4 + y. What is the remainder when v is divided by 11? 10 Let f be 1530/8 + (-18)/72. Let p = f + -89. What is the remainder when p is divided by 35? 32 Let q(r) = r3 + 4r*2 - 5r - 6. Suppose -5k - 20 = -0k. Suppose -4h = 0, -3v = -h + 5h - 78. Calculate the remainder when v is divided by q(k). 12 Let l be (-6)/(-2)(-2)/3. Let x = l - -4. Suppose -30 = -4v - 5j, -18 = -4v - 0j + j. What is the remainder when v is divided by x? 1 Let r(w) = -2w - 6. Let z be r(-7). Let i(c) = c. Let y be i(z). Suppose y = 5t - 7. What is the remainder when 5 is divided by t? 2 What is the remainder when (-35)/2(-60)/21 is divided by 17? 16 Suppose 0 = -i + 4i + 9. Let k be 74/i + (-2)/(-3). What is the remainder when (-5 - k)(2 - 1) is divided by 11? 8 Suppose 5h - 95 = -4u, 2h - 99 = -4u + h. Suppose 5c + 5m - 50 = 0, c + 3c = -m + u. Calculate the remainder when c is divided by -2 - -3 - (-4)/2. 2 Suppose 5i + 25 - 215 = 0. Suppose 2r + 17 - 46 = -3a, -2a = -5r + 63. What is the remainder when i is divided by r? 12 Suppose 553 = 7l - 2l + 2i, -3i - 114 = -l. Calculate the remainder when l is divided by 38. 35 Let u(p) = p3 - 10p*2 + 12p - 16. Calculate the remainder when 53 is divided by u(9). 9 Let a(o) = o*3 - 6o*2 + o - 6. Let h = 12 + -6. Let g be a(h). Suppose -4l + 8 + 32 = g. What is the remainder when l is divided by 6? 4 Let v(c) = 8c3 + c2 + 6c - 7. Calculate the remainder when v(2) is divided by 19. 16 Let q(o) = -o*2 + 7o - 7. Calculate the remainder when q(5) is divided by 1. 0 Suppose -4f + 10 = g, 0f - 5f = -2g + 33. Let u be (0 + 1)/(1/21). Let d = u - 13. What is the remainder when g is divided by d? 6 Let p(j) = j*2 - 11j - 6. Let a be p(11). Let q = a + 20. Calculate the remainder when (-22)/(-8)(-100)/(-5) is divided by q. 13 Let s be ((-1)/3 - 0)-3. Let z(l) = -l + 20. Calculate the remainder when z(16) is divided by (-3)/2s-2. 1 Let k = 66 + -28. Calculate the remainder when k is divided by 13. 12 Suppose -4y = -76 - 28. What is the remainder when y is divided by 10? 6 Suppose a - 6a = -30. Suppose -2q - 64 = -aq. Suppose 5b + 260 = 5t, -2b = 3t - 0b - 131. Calculate the remainder when t is divided by q. 15 Let u be 2(-5)/(-4)-6. Let j = -21 - u. What is the remainder when (-20)/(-6) - 4/j is divided by 3? 1 Suppose 56 = 5p + 1. Suppose 3r + 2b - 30 = -p, 2b = r - 17. What is the remainder when 26 is divided by r? 8 Let h be (-4)/6 - (-1)/(-3). Suppose 2t - 3t + 4y = 1, 4y = 4t + 4. What is the remainder when h24/(3/t) is divided by 3? 2 Suppose -f = -6f + 75. Suppose 3s - 6 = 3x - f, -4x = -20. What is the remainder when s is divided by 1? 0 Suppose -7 = -7o + 6o. Let c(r) = r3 - 6r*2 - 3r + 4. What is the remainder when c(o) is divided by 9? 5 Let i(v) = -v*2 - 22v + 35. Calculate the remainder when i(-23) is divided by 3. 0 Suppose 5v + 8 - 23 = 0. Suppose -2s = -h - 10, 0 = s - vh - 3 - 2. Let n(m) = m + 6. What is the remainder when s is divided by n(-3)? 2 Suppose 4w - 4m - 122 = 38, 0 = 4w + 4m - 152. Suppose -2x + 4 = -16. Calculate the remainder when w is divided by x. 9 Calculate the remainder when 96 is divided by -3(-2)/21 + (-3114)/(-126). 21 Let r(b) = b3 - 4b*2 - 10b - 10. Let s be r(8). Let d = -113 + s. What is the remainder when d is divided by 18? 17 Suppose -5 = -5l + 10. Suppose -5c + 4 = -lq, -5q - 2c - 3c + 60 = 0. Calculate the remainder when q is divided by 3. 1 Suppose 4r = 2r + 8. Let h be 6/r21. Suppose 5v - 2o = 82, ho - 4o - 14 = -v. Calculate the remainder when v is divided by 10. 8 Suppose 0 = -3i - j + 15 - 5, -i + 3j = 0. Let z = -26 - -45. What is the remainder when 4/6(51 + i) is divided by z? 17 Let a = -6 + 9. Let u(r) = r3 - 2r*2 + 2r - 1. Calculate the remainder when u(a) is divided by 5. 4 Suppose -20 = 2x - 3x. Suppose -4d = 5u - x, -4d = -0u + 3u - 4. What is the remainder when 15 is divided by u? 7 Suppose -o + 2 = -3. Suppose 2z - 2 = p + 3, 2z + o = 3p. Suppose ps = 35 - 0. What is the remainder when 13 is divided by s? 6 Let d(q) = q3 - 7q*2 + 4q + 3. Let t be d(6). Let	{ "pile_set_name": "DM Mathematics" }
ivative of t*3 + 4. What is i(j(s))? 27s*4 Suppose 5u + 2i = 7, 4i - 2i = -4u + 6. Let c(o) = o + 2. Let z(k) = 8k + 24. Let d(x) = uz(x) - 12c(x). Let b(s) = -2s*2 - 20s. Give d(b(n)). 8n2 + 80n Let l(w) = w - 35. Let r(y) be the second derivative of 3y4/4 - 23y. Calculate l(r(v)). 9v2 - 35 Let n(j) = 15j. Let u(a) = -34a2 + 14a + 5. Let h(s) = 16s2 - 8s - 3. Let i(p) = 7h(p) + 4u(p). What is i(n(k))? -5400k2 - 1 Let p(z) = -1. Let q(d) = d + 2. Let y(a) = 2p(a) + q(a). Let g(x) be the third derivative of -41/24x4 + 0x*3 + 3x*2 + 0 + 0x. Calculate y(g(c)). -41c Let s(o) = -o - 7. Let t(i) = -8i - 42. Let m(h) = 6s(h) - t(h). Let z(x) = 5x*2 - 4. What is z(m(c))? 20c*2 - 4 Let l(x) = -2x - 51. Let h(k) = -2 + 3 - 2k + 155k*2 - 154k*2. Let y(z) = 5z*2 - 6z + 3. Let c(q) = 3h(q) - y(q). Calculate c(l(m)). -8m*2 - 408m - 5202 Let z(l) = 3795l2. Let j(w) = -62449w*2. What is j(z(p))? -899392059225p*4 Let w = 36 + -32. Let h(z) = 6z - 5z + wz. Let s(v) = -2v. Give s(h(k)). -10k Let p(o) = 0o2 - 2o*2 + 0o2. Let u(m) = m2 + m. Let x = -418 - -411. Let z(c) = -c*2 - c. Let s(t) = xz(t) - 5u(t). Calculate p(s(y)). -8y*4 - 16y*3 - 8y*2 Let r(l) = -559693l. Let j(c) = -26c - 3. Determine j(r(i)). 14552018i - 3 Let i(r) = 27638559r2. Let n(c) = -10c*2. Determine i(n(g)). 2763855900g*4 Let s(n) be the second derivative of 10n*3/3 + 26n*2 + 6221n. Let x(j) = 2j2. What is x(s(o))? 800o*2 + 4160o + 5408 Let y(a) = -104161120a. Let f(j) = 3j*2. Determine f(y(w)). 32548616758963200w*2 Let n(o) = 49o + 44o + 36o + 41o - 216o + 47o. Let w(g) = g2 - 109g + 3g2 - 2g*2. What is w(n(c))? 2c*2 - 109c Let m(t) = -7t2 - 4t - 8. Suppose 0 = -2y + 38 - 30. Let s(l) = 15l*2 + 7l + 14. Let k(g) = ys(g) + 7m(g). Let c(h) = 5h. What is k(c(a))? 275a*2 Let n(a) = 167a*2 + 90a*2 - 31a*2 - 22a*2 + 38a*2. Let c(h) = -27h*2 + 52h*2 - 26h*2. What is c(n(p))? -58564p*4 Let v(t) = -5t + 6t + t. Let w(b) = 36b - 13b + 19b - 20b + 11b + 34b. Give v(w(r)). 134r Let t(c) = -c*2. Let w(f) be the first derivative of -9f*5/8 + 2f*3/3 - 19f + 249. Let s(v) be the third derivative of w(v). Determine s(t(i)). 135i2 Let n(v) be the second derivative of v3/6 + v. Let t(z) = -3z - 3z + 0 + 4 - 5z + 9z. Determine n(t(o)). -2o + 4 Let s(u) be the first derivative of 2u3 + 1151. Let y(z) = -54z. Determine y(s(j)). -324j2 Let n(k) = 9k*2. Let d(j) = 1942 - 939 + 202j*2 - 1003. Give n(d(f)). 367236f*4 Let h(n) = 19n - 111. Let l(c) = 9032c. What is h(l(k))? 171608k - 111 Let t(s) = s*2. Let c(o) = 31720o + 104. Let a(v) = 23790v + 80. Let g(x) = -13a(x) + 10c(x). What is t(g(r))? 62884900r*2 Suppose -3g - 6 = -9. Let v(k) = -k - 1. Let s be 2(79/(-2) + 2). Let z(c) = -45c - 75. Let y(m) = gz(m) + sv(m). Let o(i) = -2i. Give y(o(x)). -60x Suppose 4y = 2c - 4c + 22, y - 5 = 0. Suppose w - 13 = -c. Let n(z) = -1421 - wz + 1421. Let p(l) = 3l2. Give p(n(t)). 432t*2 Let u(s) = -11s*2 + 1092s - 9. Let f(h) = -h*2 - 273h + 1. Let j(w) = 4f(w) + u(w). Let o(c) = -3c + 0c + 5c. What is j(o(t))? -60t2 - 5 Let w(s) = -12s*2. Let g(n) be the second derivative of 0 - 5/12n*4 + 126n + 0n3 + 0n*2. Calculate w(g(c)). -300c*4 Let k(b) = -14b. Let n(s) = 5s2 + 3s. Let h = -30 - -27. Let u(a) = 5a2 + 4a. Let d(f) = hu(f) + 4n(f). Give k(d(y)). -70y2 Let d(s) be the first derivative of -9s*3/2 + 34s + 56. Let w(n) be the first derivative of d(n). Let a(t) = 2t. Determine a(w(c)). -54c Let g(j) = -248j2 - 299j*2 - 526j2. Let a(r) = r2. What is g(a(i))? -1073i4 Let z(m) = -9m*2 - 40m. Let s(y) = -9y. Give z(s(j)). -729j*2 + 360j Let o be (16/12)/(8/(-6)). Let v(z) = -1. Let n(k) = -2k - 6. Let l(f) = on(f) + 6v(f). Let m(r) = 319r. Calculate l(m(g)). 638g Let c(q) = 24q - 5. Let f(h) = -5h + 4. Let u(s) = -1. Let j(o) = -2f(o) - 6u(o). Let r(z) = -2c(z) + 5j(z). Let l(v) = 11v. Determine l(r(w)). 22w Let l(u) be the third derivative of u5/30 - 1687u*2. Let q(j) = -973j. Give q(l(z)). -1946z2 Let b(k) = 5k. Let v(y) be the second derivative of -161y4/12 + y2/2 + 17y - 208. What is b(v(l))? -805l2 + 5 Let j(o) = o + 1. Let y(c) = 26c + 3. Let l(g) = 3j(g) - y(g). Let i(q) be the second derivative of -q4/6 + 577q. What is l(i(n))? 46n2 Let k(p) be the second derivative of 123p - 1/12p4 - 71/6p*3 + 0p2 + 0. Let z(w) = w. What is z(k(o))? -o2 - 71o Let d(u) be the third derivative of -u5/15 + 3u*2 - 805. Let s(t) = -27t*2. Determine d(s(v)). -2916v*4 Let z = 13039 - 13037. Let u(o) be the second derivative of 0 + 0o*z + 0o*3 + 1/4o*4 + 11o. Let s(k) = 23k2. Determine u(s(f)). 1587f*4 Let h(o) be the third derivative of 7o*5/15 + 70o*2 - o - 1. Let i(n) = 36n. Give i(h(k)). 1008k2 Let m(f) = 2f. Let l(k) = 76k2 + 45k - 229. What is m(l(v))? 152v2 + 90v - 458 Let v(k) = -50547404k. Let y(p) = 2p. Determine v(y(j)). -101094808j Let t(k) = 2k*2. Let f(d) = 53d - 1. Let c(o) = 2. Let a(u) = -7c(u) - f(u). What is a(t(g))? -106g*2 - 13 Let h(g) = 2g. Let r(v) = -50002903v2. Determine h(r(s)). -100005806s2 Let h(n) be the third derivative of -n5/12 + 76n2 + 2n. Let y(k) = 40k2. What is y(h(a))? 1000a*4 Let w(g) = 3102g*2. Let h(l) = 69l*2 + 14. Let i(x) = -30x*2 - 6. Let p(m) = -3h(m) - 7i(m). What is p(w(f))? 28867212f*4 Let x(z) = -254z + 8. Let p(o) = -159o + 5. Let w(q) = -8p(q) + 5x(q). Let s(t) = -15t*2. Give s(w(n)). -60n*2 Let m(t) = 22t. Let r(w) = -3032793w. Calculate r(m(v)). -66721446v Let j(v) be the third derivative of 31v - v2 - 1/6v*3 + 33/8v4 + 0. Let r(u) = -u2. Give r(j(q)). -9801q2 + 198q - 1 Let p(j) = 570j2. Let i(w) = 2723w*2 - 7. Give i(p(q)). 884702700q4 - 7 Let b(i) be the second derivative of -i3/2 - 59i2/2 - 3734i. Let o(d) = d*2. Determine o(b(x)). 9x*2 + 354x + 3481 Let a(p) = 7p2. Let z(d) = -6d*2. Let u(j) = -16j*2 + 31j*2 - 21j*2. Let t(n) = -7u(n) + 6z(n). What is t(a(m))? 294m*4 Suppose -3v - 9 = -3w, -3w + w + 4v + 8 = 0. Let k(r) = 6 - r2 - 6 - 2 + w. Let q(b) be the third derivative of 11b5/60 + b2. Determine k(q(i)). -121i4 Let p(r) = -20r*2 - 14r*2 - 4r*2. Let x = 341 - 336. Let d(v) = -11 + 8 - xv + 3 + 3v. Determine p(d(h)). -152h*2 Let b(r) = -7r + 4. Let x(o) = o - 62665. Determine x(b(l)). -7l - 62661 Let c(q) = -4q + 50. Let l be c(17). Let v(g) = -54g + 18. Let d(w) = 2w + 1. Let f(o) = ld(o) + v(o). Let i(n) = -2n*2. What is i(f(p))? -16200p*2 Let u(c) = 46c - 4. Let j(k) = 378k - 33. Let p(f) = -4j(f) + 33u(f). Let n(y) = 156y. Give p(n(w)). 936w Let q(o) = -4o. Let y(s) = 286s2 - 3898. What is q(y(k))? -1144k2 + 15592 Let q(p) = p2 + p - 9. Let r(d) = d - 3. Determine q(r(v)). v*2 - 5v - 3 Let c(a) = 6a2. Suppose -2y - 28 = -4k, 11 = 2k - 3. Let o(n) be the first derivative of 11 + 0n - 7/3n*3 + yn*2. Give c(o(i)). 294i*4 Let c(h) = 8h. Let p(r) = -6498974r2. What is c(p(n))? -51991792n*2 Let c(p) = -5p. Suppose -5 = -5g, v - 6g - 60 = -8g. Let d(s) = 52s*2 + vs*2 - 120s*2. Determine c(d(m)). 50m*2 Let b(l) = -22l*2. Let w(t) = 47921t + 519. Let j(y) = -461y - 5. Let k(v) = -519j(v) - 5w(v). Calculate b(k(c)). -2633752c*2 Let g(t) = 3t*2 - 2t2 + t2. Let m(a) = -41a + 21 + 58a - 68 + 32 + 15. Determine m(g(d)). 34d2 Let f(k) = -3k*2 - 7. Let u(t) = 115t*2. Let i(h) = -2h*2. Let b(c) = 110i(c) + 2u(c). Give f(b(w)). -300w*4 - 7 Suppose 5n - 5 = -z, 2z = -2z. Let w(i) = 0 + n + 33i + 45i - 12i. Let f(x) = -2x*2. Calculate f(w(s)). -8712s*2 - 264s - 2 Let b(q) = -3q2. Let f(u) = 11682145u. What is f(b(s))? -35046435s2 Let d(w) = -88w. Let o(r) = 2768r2 - 556r. Determine d(o(m)). -243584m2 + 48928m Let f(c) be the second derivative of -c*3/3 + 35048c. Let l(m) be the first derivative of -24m3 + m2/2 + 1. Give f(l(b)). 144b*2 - 2b Let n(j) = -20467197j*2. Let v(q)	{ "pile_set_name": "DM Mathematics" }
is the second biggest value? (a) 119/47 (b) 5 (c) 131 b Which is the second biggest value? (a) -682 (b) 265 (c) -0.1 c What is the fourth biggest value in -2.509, -2, -0.4, -2/7? -2.509 What is the third biggest value in 0.119, 3, -137/5? -137/5 Which is the biggest value? (a) 6 (b) -1 (c) 3 (d) -5700 (e) -0.4 a Which is the biggest value? (a) -0.01 (b) 2.67 (c) -8 (d) 3 d What is the second biggest value in 4, -11, -339? -11 Which is the third biggest value? (a) 16.4 (b) 3 (c) 11 (d) -1/5 (e) -1 b What is the fourth biggest value in 1.5, -0.3, -817, -1, -0.5? -1 Which is the biggest value? (a) 3/5 (b) 0.01 (c) 2 (d) -8 (e) -1/2 c What is the second biggest value in 0.1, 698, 3/10, 4, -0.2? 4 What is the second biggest value in 7/23, 0.71, -3/7, -2/11, -0.3? 7/23 What is the smallest value in -6/25, -0.5, 3, -2/375, -3, -0.3? -3 What is the third smallest value in -0.01, -0.3, -3/2, 3? -0.01 What is the fourth biggest value in 0.1, -14, -0.4, -1, -393? -14 What is the fourth smallest value in -4/3, 62, 0.2, -4.8, 4? 4 What is the fourth biggest value in 5, -6743, -5, 3? -6743 What is the third smallest value in 1/4, -0.1, 1/5, 0.3, 22? 1/4 What is the fifth biggest value in -4/9, -3, -0.05, -505, -0.3? -505 What is the second biggest value in -0.7, -1/519, -4? -0.7 Which is the biggest value? (a) -60/13 (b) -163 (c) 1/3 c Which is the fifth smallest value? (a) 3/16 (b) 0.3 (c) -1 (d) 11 (e) 2/23 d Which is the fifth smallest value? (a) -0.03 (b) -3 (c) -159 (d) 0.4 (e) -2 d What is the third smallest value in -1/4, 22, 23958? 23958 Which is the third biggest value? (a) 4 (b) -1 (c) -1.33 (d) 5 (e) -3 (f) -6.6 b Which is the biggest value? (a) 0.32 (b) 5 (c) -0.169063 b What is the third smallest value in -5, 390, 50, -0.02? 50 What is the biggest value in 0.2, 2/37, 391? 391 Which is the fifth biggest value? (a) -27/8 (b) -0.4 (c) -0.1 (d) -3/8 (e) -56 e What is the second biggest value in -5/3, -2/29, -404? -5/3 Which is the smallest value? (a) 325 (b) -5 (c) 2 (d) -13.5 (e) -3 d Which is the biggest value? (a) -0.5 (b) 4.63 (c) -2/5 (d) -3 (e) -4/5 b What is the fourth biggest value in 5, 69, -0.8, -0.5, -5? -0.8 What is the smallest value in -14, -51, 0.7, -0.2, 0? -51 What is the third biggest value in 13, 8.9, -1, 0.4? 0.4 What is the fourth smallest value in -4, -7, -3/4, 1566? 1566 What is the fourth biggest value in 205, 4/3, -0.2, 36/7? -0.2 What is the second smallest value in -1/5, -1752, -1/3, 2? -1/3 What is the fifth smallest value in -2/3, -2/79, -4, -482, 2/7? 2/7 Which is the second biggest value? (a) -0.453 (b) -2/43 (c) 4/11 b What is the third smallest value in 2/7, 0.5, -4/29443, -0.5? 2/7 Which is the fifth biggest value? (a) 3 (b) -1.1 (c) 2 (d) -2 (e) -34 e What is the second smallest value in 4, 3/2, 2.72819? 2.72819 Which is the fifth smallest value? (a) -0.022 (b) 14 (c) -5 (d) 5 (e) 0.4 b Which is the second smallest value? (a) -2.6 (b) 4 (c) -422/7 (d) 0.3 a Which is the smallest value? (a) -0.3 (b) -8 (c) 6090 b Which is the fifth biggest value? (a) 2/9 (b) -1/2 (c) -14.1 (d) 2 (e) -0.03 c What is the fifth biggest value in 2/3, -1638, 0, -6, 4? -1638 What is the second biggest value in -2, -2/19, -1/41, 17/42? -1/41 Which is the smallest value? (a) 189 (b) -243 (c) 4/7 b Which is the third smallest value? (a) 8 (b) 2/5 (c) 0.19 (d) -3/8 b Which is the third smallest value? (a) -283 (b) -2/3 (c) 14 (d) 5 d What is the fourth biggest value in 1, 4, 58, 5/2? 1 Which is the biggest value? (a) -1841 (b) 3 (c) 8 c Which is the third biggest value? (a) 4 (b) 1/6 (c) 10/7 (d) -0.08 (e) -0.5 b Which is the fourth biggest value? (a) -2/59 (b) -2/5 (c) 0.9 (d) -3/5 d What is the second biggest value in -10395, -0.4, 2? -0.4 Which is the fourth smallest value? (a) -3 (b) 49.8 (c) 3/4 (d) 48 b What is the fourth smallest value in -2/3, 1/2, 1.18, -6/5? 1.18 Which is the third smallest value? (a) -0.4 (b) -2/3 (c) 5 (d) -8 (e) -2/15 a Which is the second biggest value? (a) -5/9 (b) 0.5 (c) 3 (d) -660 (e) -0.2 b What is the second biggest value in 3/1964, -0.2, -2/9, 0.3? 3/1964 Which is the sixth biggest value? (a) 0 (b) -2/79 (c) 4 (d) 4.21 (e) -3/5 (f) 1/4 e Which is the third smallest value? (a) 16.568 (b) -11 (c) 0.2 a Which is the second biggest value? (a) -1 (b) -2/11 (c) -1/2 (d) -19 (e) -7.5 (f) 6 b What is the fourth biggest value in -2, -638, -33, 3? -638 Which is the smallest value? (a) -3/2 (b) 2 (c) -2 (d) 3019 c Which is the second biggest value? (a) 3215 (b) 3 (c) 0.4 b What is the fourth smallest value in -1/9, -5, -0.2, 20/41? 20/41 Which is the third smallest value? (a) -162 (b) -4 (c) 2/85 c Which is the third smallest value? (a) -1.1 (b) -10 (c) 2/7 (d) 1 (e) 0.06 (f) -1 f What is the third smallest value in 6/89, 1/3, 7/10? 7/10 What is the smallest value in -2, -4.33, 9? -4.33 What is the smallest value in 2, 227, 1, -2, -3, 111? -3 Which is the second smallest value? (a) -2/15 (b) 30964 (c) -0.3 (d) -1/4 (e) -2 (f) -2/7 c What is the third smallest value in 1/11, 0.3, -51, 5, -2? 1/11 Which is the third biggest value? (a) -50 (b) 6/7 (c) 0 a What is the smallest value in 16, -9, -830? -830 Which is the biggest value? (a) 2/9 (b) -5 (c) -0.5 (d) 0.2 (e) -948909 a What is the second smallest value in 1/5, 12, 3, 48, -3/4? 1/5 What is the third biggest value in -2, -19, -1, 7/8, -27? -2 What is the second biggest value in -535, 4, 0, -38, 5, -1? 4 Which is the smallest value? (a) 11.9 (b) -13/2 (c) 2/7 b What is the third smallest value in 3, 4, 4/5, 0.3, 8, 2.8? 2.8 What is the third biggest value in -0.3, 4, 24, -0.2, 0.3, 2324? 4 What is the third smallest value in -0.5, 13, 8, 0, 0.009? 0.009 Which is the smallest value? (a) -2 (b) -0.3 (c) -4438.3 c What is the fourth smallest value in 0.347, -1, 0, 82/5? 82/5 What is the smallest value in -1, -15/7, -20/7? -20/7 What is the fourth biggest value in -3/5, 22, 17, 15? -3/5 Which is the sixth biggest value? (a) -1.23 (b) 5 (c) -4/7 (d) -0.2 (e) -3 (f) 4 e What is the fifth smallest value in 12, 3, 0.11, 0.16, 2/7? 12 What is the third smallest value in 2/3, -38, -3/7, -5, 2? -3/7 What is the fourth smallest value in -1/6, 334, 4, 3, 1? 4 What is the second smallest value in -1, 1, 4, 11, 96/17? 1 What is the second smallest value in -2/13, -0.4, 156, 83/7? -2/13 What is the second biggest value in -3, -1/6, -1, -150.8? -1 Which is the third smallest value? (a) -2/3 (b) -3/4 (c) 397 (d) -2 (e) 1/6 a Which is the fourth smallest value? (a) -0.1 (b) -4 (c) 7 (d) 4037 d What is the third smallest value in -3, 4, 1/2, -2/23, 0.68? 1/2 What is the fourth biggest value in 0.5, 13, -2, 1045? -2 Which is the fourth biggest value? (a) -89 (b) -0.4 (c) 5/6 (d) -5 (e) 0.2 d Which is the biggest value? (a) -3.2 (b) -22 (c) 5 (d) 8 (e) -5 d What is the third biggest value in 49/3, -2, 0.04887? -2 What is the second biggest value in -4, 406, -0.3, 0.5? 0.5 What is the third biggest value in -1/4, -2, 1/4, 2/17, -0.6, 0.4? 2/17 Which is the smallest value? (a) -1 (b) -2/2335 (c) 265 a What is the third biggest value in 1/2, 2, -268836? -268836 What is the smallest value in 2, 18930/13, -2/7, 1/4? -2/7 What is the third smallest value in -9994, -0.3, 148? 148 Which is the second smallest value? (a) -2/15 (b) -0.2 (c) 67 (d) 0.5 (e) -38 (f) 5 b What is the fourth smallest value in 0.1, -0.4, 0, -55.474? 0.1 What is the second biggest value in -0.5, 0.5, -3, 0.0203, 24/7? 0.5 What is the sixth biggest value in 26, 4, 8, 39.1, 5, -0.3? -0.3 What is the smallest value in 0, 1/2, -2/3, 100, -2, -0.357? -2 Which is the third biggest value? (a) 0.1 (b) -4/3 (c) -0.5 (d) -0.2 (e) -41 c Which is the smallest value? (a) -76 (b) 14/51 (c) 5 (d) 2/15 a Which is the third smallest value? (a) 0.2 (b) -2 (c) 0.082 (d) 1/2 (e) -0.3 c Which is the smallest value? (a) -2 (b) -380978 (c) 5 b What is the third smallest value in -0.2, -10/623, 0.2? 0.2 What is the sixth smallest value in -2, -1/12, 2/3, -11, 3/7, -18/7? 2/3 Which is the third smallest value? (a) -	{ "pile_set_name": "DM Mathematics" }
for k. -4 Suppose -649 + 281 = -16t. Solve -9y - 22 = t for y. -5 Let v(z) = z*3 + 10z*2 - 27z - 32. Let p be v(-12). Solve pq = -9q - 0q for q. 0 Suppose 2x + 3v - 5v = 14, -4x - v = -3. Suppose -n + 0n = 0. Let l = x + n. Solve -4j = -lj for j. 0 Suppose 3f - 57 = -3g, 2f = 2g + g - 82. Let t be (-3)/(-2)32/g. Suppose -1 = -tu - a + 4a, -2u + 3 = -a. Solve 0 = h - 1 - u for h. 3 Let d = -431 - -434. Solve 2p = dp - 2p for p. 0 Let x(m) = -16m - 1 + 14m + 26 - 4. Let z be x(8). Solve 9 = -zf - 6 for f. -3 Let x(h) = -5h - 19. Let w be (-2)/12 - 123/362. Let y be x(w). Solve -5i + y = -4 for i. 4 Let x(r) = 4r + 2 - 6r + 4r. Let o be x(-1). Solve op + 4p - 8 = 0 for p. 2 Suppose 0 = 3s + 2s - 20. Let j be (14/(-4) + s)6. Solve -20 = jx - 7x for x. 5 Suppose 0 = -2w - l - 2l + 12, -3w + 15 = 3l. Suppose 4v + 5b + 13 = 0, -wb = v - 4v + 24. Solve -d + 1 = -v for d. 4 Let p(r) = r3 + 8r*2 - 10r - 5. Let l be p(-9). Let g = -10 - -12. Solve l + 0 = -gs for s. -2 Suppose -2r = -173 - 137. Let q be 6/10 + 217/r. Solve ql - 9 = 1 for l. 5 Let i(w) = 2w*2 + 25w - 6. Let h be i(-13). Solve hj + 9 = 4j for j. -3 Suppose 15 + 35 = 5y. Let f(b) = 11b - 5 - b*2 - 6 + 4. Let r be f(y). Solve 0 = 2l - r + 7 for l. -2 Let m be 3 + (6 - 0) + -1. Let w = m + -11. Let a be (-9)/w + 54/3. Solve -1 + a = 5f for f. 4 Let s be (-6)/(-63) + (-1070)/210. Let q(n) be the third derivative of -n6/120 - n5/12 + n3/2 + n2. Let c be q(s). Solve -cz + 21 - 6 = 0 for z. 5 Suppose 4c - 48 = -12. Suppose -c - 31 = -5s. Let o = 8 - s. Solve 4q + oq = 0 for q. 0 Let v(t) = -t*3 + 20t*2 + 15. Let i be v(20). Let u be -2(-4 - i/(-6)). Solve -uh + 4h = -2 for h. -2 Let g be 3/(-2)(-24)/9. Let z be (-2 - 0)(-6)/4. Suppose zn - n = 26. Solve 0 = gr + 3 + n for r. -4 Let a(t) = t*2 + 19t + 40. Let o be a(-17). Suppose -m = -2c, oc - 44 = -4m + 3c. Solve 4z = mz for z. 0 Suppose 4p - 5r - 20 - 3 = 0, 0 = 3p + 4r + 6. Suppose -7s = -ps + 30. Let z = s + 6. Solve z = 6j - j for j. 0 Suppose 0 = -9z + 223 + 74. Solve 0 = 5c - 8 + z for c. -5 Let q(c) = c2 - 6c - 4. Let w be q(6). Let l be w/10(-70)/7. Suppose -2n - n = 3n. Solve nj - 4 = -lj for j. 1 Let u = 9 + -4. Let b = 1247 - 1237. Solve 0d + ud = -b for d. -2 Let n(k) = -k2 + k + 25. Let i be n(0). Let g = i + -21. Let t be g/18 + 10/(-45). Solve t = j + 3 for j. -3 Let p be (-6 + 5)(-2 - 19). Suppose 0 = -px + 23x - 6. Solve -2g = -xg for g. 0 Let h(l) = -l*2 - 9l + 13. Suppose 30 = -3j + s, 4s + s = -4j - 40. Let q be h(j). Suppose -5u = -6u + q. Solve 2o = uo for o. 0 Let f = 718 - 703. Solve -fz = -6z + 9 for z. -1 Let d = -158 - -166. Solve -m + d - 11 = 0 for m. -3 Suppose 196p = 191p + 30. Solve 2 = -4a + p for a. 1 Let n = -513 + 516. Solve -4q - n = -11 for q. 2 Suppose 161 = 7x - 175. Solve -5m = -x + 28 for m. 4 Let r be (-3)/(-2)82. Suppose 4c - 2m = -7m - 3, 5m = 3c - r. Let t = 137 - 135. Solve -cz = -tz + 4 for z. -4 Let w = -5 - 1. Let b be (-1)/(4/12) - w. Suppose -15 = -bk - 2k. Solve k + 12 = 3a for a. 5 Let l = -182 + 215. Solve -l + 29 = 4r for r. -1 Let w be (0 - -1)0 - (-1 - 4). Suppose -2s - wf = 25, 0f = 2f + 10. Let l(g) = -g2 + 6g + 3. Let a be l(6). Solve ac - c - 8 = s for c. 4 Suppose -2129h - 105 = -2136h. Solve -h = -2n - 23 for n. -4 Let m = 44 + -44. Suppose y + 24 = 5y. Solve ms = -2s - y for s. -3 Suppose 7z + 872 + 283 = 0. Let i = z - -171. Solve i = t + t for t. 3 Let c be -1 + (39 - 29 - (6 + -1)). Solve cp + 3 = -1 for p. -1 Suppose 48 = 2t - 4f, 20 = -5f - 5. Solve 4 = -5m + t for m. 2 Let f be (0/6 + 2)1. Let l = 10 + -5. Solve 6 = -ly + fy for y. -2 Suppose x + 2y = 4, 3x - x - 2 = 2y. Suppose 4w = 3n - 16, 3n = -2n - xw + 18. Solve 0 = -np + p - 15 for p. -5 Suppose 22 = v + 4z, 0 = v + 2z + 3z - 27. Suppose -6 = -vy - 0y. Solve 0 = -2f + 7 + y for f. 5 Suppose 18p - 15p - 33 = 0. Suppose 6r + 50 = pr. Let q = r - 8. Solve -qg = 2 + 2 for g. -2 Suppose 0 = 2o + 240 - 254. Solve 6z + o = 7 for z. 0 Let l = 11 - 11. Suppose -4a + 4f = -4, 11 = 2a - lf + f. Suppose 4d - a - 4 = 0. Solve 0 = -0n + dn - 8 for n. 4 Suppose 1 = g + 5a, -a = 4g + 11 - 53. Let s(l) = -l2 + 11l + 9. Let t be s(g). Suppose 3h - th = -24. Solve i = -i - h for i. -2 Suppose 0 = -2k + 5p - 50, 4k - 2k + 50 = 4p. Let f = k + 30. Solve -f = 5g + 15 for g. -4 Let c(v) = -v*3 - 4v*2 + 4v + 3. Let x be c(4). Let j = x - -115. Solve m - 3m = j for m. -3 Let x(g) = g2 - 4g - 5. Suppose 4d - 35 = 3z, d + 0d - 25 = 4z. Let i be (-2)/5 - (-27)/d. Let n be x(i). Solve q - 6 + 2 = n for q. 4 Let c(u) = u*3 + 16u*2 - 23u - 97. Let d be c(-17). Solve -dw - 7 = -12w for w. 1 Suppose -b - b + 12 = -n, -b + 17 = 5n. Solve -4 = -bd - 4 for d. 0 Suppose 3w + 42 = 5d, -41 = -5d + 4w - 0w. Let o be (-1)/(2 + (-19)/d). Suppose -10q = -16 - 24. Solve o = qx - 7 for x. 4 Suppose -3m + 4h = -28, 4h + 36 = -0m + 5m. Solve m = -11k + 7k for k. -1 Let n(b) = b*2 + 11b + 13. Let q be n(-10). Suppose q = 3p + p + 3r, 0 = 4r - 4. Solve 0 = -pm + 2m for m. 0 Suppose -i = 2v - 23, -i - 2v = -4v - 3. Suppose 0 = 5q - i - 12. Let b be -15(1 - (5 + -3)). Solve -2o + b = -qo for o. -5 Let o(y) = y*2 + 7y + 9. Let a be o(-6). Let d(h) = 4h + 37. Let n be d(-8). Let u be (n - a) + (-2)/2. Solve 21 = -5r + u for r. -4 Suppose 3v = 5v - 3d + 174, 0 = -3v + d - 275. Let q = v - -102. Suppose -3r - 4 = -4r. Solve qs - rs - 10 = 0 for s. 2 Suppose -d + 7d - 18 = 0. Suppose 0 = -ds - 0s - 5l + 25, 4s - l - 18 = 0. Solve -5 - s = -2c for c. 5 Let i be 235/5 + (0 - -3 - 3). Solve -id + 49d - 4 = 0 for d. 2 Suppose 2z - 15 = -5d, -3z + 18 = -4d + 7d. Solve 0 = o - 2o - d for o. -1 Let q(s) be the first derivative of 1/2s2 - 4s + 4. Let l be q(5). Solve -j = 4 - l for j. -3 Suppose 23o = 19o - 8, 0 = -v - 2o + 9. Solve -15f = -vf for f. 0 Let w = -12 + 12. Let a be 1 + 2 + 2 - w. Suppose -3f + a = 2g + 14, f + 3 = -2g. Solve gd = -4d + 20 for d. 5 Suppose -5v = 1 + 29. Let p be 56/v9/(-6). Suppose 4w - m = p, -w = -8m + 3m - 13. Solve 2l - w = l for l. 3 Let z(t) = -t*3 + 2t*2 + 8t + 2. Let r be z(4). Let a = 1 - 1. Solve a = -x - rx for x. 0 Let w = 1505 - 1441. Solve 32 = -56l + wl for l. 4 Suppose 0 = 3b + 5m - 67, 0b + 5b + 5m - 95 = 0. Solve -bk = -10k + 8 for k. -2 Let v(i) = 2i2 + 3i. Let g be v(-3). Let o = g - 5. Suppose 0 = -ou, -z + 3 = -0z - 3u. Solve 0 = 4s - zs - 5 for s. 5 Suppose -2y = -y + 4s - 20, 20 = 5s. Suppose 4v - yw - 21 = -1, 24 = 5v - 4w. Solve -va + 7 + 5 = 0 for a. 3 Let f be ((-2)/(-4))/((-15)/(-150)). Suppose 4k - f + 1 = -5m, 0 = -5m - 20. Solve 0b + k = -3b for b. -2 Suppose -3c + 84 = -7c. Let d = c + 21. Suppose 4i - 14 + 6 = d. Solve -5t + 9 = -it for t. 3 Let u = -235 - -239. Suppose -7 + 22 = 3z. Let v = 8 - z. Solve -7j = -vj + u for j. -1 Suppose -171 = -3n - 42. Let o = n - 37. Let f = 0 + 2. Solve fu = -0u + o for u. 3 Suppose 0 = -0r + 2r - 10. Suppose 3j = 3f - 7f + 2, j + f - 2 = 0. Suppose rz = 4 + j. Solve 20 = -zy - 3y for y. -4 Let u be ((-15)/2)/(24/(-48)). Solve 15 = -10x + ux for x. 3 Suppose 0 = -0s + 3s - 30. Suppose -51 + 15 = 4f. Let m be f/(-6) + 25/s. Solve -m = z - 0 for z. -4 Let l be 104/20 + (-1)/5. Suppose 0q - 2q - lx + 5 = 0, -5q + 4 = 4x. Let d be 2 + (2 - (q - -2)). Solve -dt + 10 = -7t for t. -2 Let n(z) = -z + 1. Let c be n(-9). Suppose -v - c = -0. Let l = 12 + v. Solve -lf = f for f. 0 Let m be (216/(-20))/((-2)/(-10)). Let s be m/351 - 4/(-26). Solve sj = 3j + 15 for j. -5 Suppose -6 = -5y - 1. Let s(h) = 4h + 9. Let t be s(-2). Solve b - y = t for b. 2 Let j(x) = 4x + 56. Let c be j(-12). Let i be (1 + -1)/(4(-4)/c). Solve i = -m - m for m. 0 Let w(x) be the third derivative of 0 + 0x + 1/60x*5 + 1/4x*4 - 11/6x*3 - 5x*2. Let a be w(-8). Solve -ac = 2 + 3 for c. -1 Let c be 10 - (-10 + 5 + 14). Let i be 34/6 - 2/3. Solve 4o - io = c for o. -1 Let p be 64/12 - 2/(-3). Let d be -1*((-20)/p + (-4)/(-1	{ "pile_set_name": "DM Mathematics" }
igit of r? 6 Let u(m) = 14m + 11. Let w be u(-5). Let p = -2 - w. Let l = p + 21. What is the tens digit of l? 7 What is the units digit of (-28)/(-210) + 677096/30 + -2? 8 Suppose -66a + 68a = 1316. What is the hundreds digit of a? 6 Let g(l) = -4l*2 + 2l - 48. Let c be g(-7). Let h = 1314 + c. What is the thousands digit of h? 1 Suppose -5d - 2l + 36148 = 0, -5d + 0d + 36153 = -3l. Suppose -d - 9503 = -29a. What is the units digit of a? 7 Let g be (10 - 4 - 7)-5. Suppose gl + 5 = -0l, c - 1173 = -2l. What is the units digit of c? 5 Let c = -7938 + 14262. What is the thousands digit of c? 6 Suppose 3c - 17 = -y - 1, c = -2y + 7. Suppose 3x - y = -p, -p + 2 = -2x + 1. Suppose -w + 2w - 114 = x. What is the units digit of w? 4 What is the hundreds digit of (4798008/(-48))/(-3) - (-3)/(-2)? 3 Let r = 291 - -4794. What is the hundreds digit of r? 0 Suppose -3d = n - 67143, -5n = d + d - 44736. What is the tens digit of d? 8 Let z = -3982 - -9542. What is the tens digit of z? 6 What is the thousands digit of ((9501/(-2))/(5/(-10)))/((-15)/(-20))? 2 Let c(j) = 4j - 24. Suppose 5 = -2y + 17. Let o be c(y). What is the tens digit of (2 - -1) + (o - (-156)/2)? 8 Let d be (2/(-1))/((-4)/(-14)). Suppose 37l - 5v = 40l - 105, -2l - 4v + 70 = 0. Let m = l + d. What is the units digit of m? 8 Let l(f) = f*3 - 103f*2 + 81f - 269. What is the units digit of l(103)? 4 Suppose -7p = -2p + 1035. Let c(f) = -5f2 - 34f - 147. Let h be c(-6). Let q = h - p. What is the tens digit of q? 8 Let p(w) = -w - 8. Let b be p(-13). Suppose -5 = k + 3z, 2k + 7 + 0 = -bz. Suppose -170 = -t + 4n, 2n + 6 + k = 0. What is the units digit of t? 0 Let a = -89 - -283. Let l = a + 8. What is the tens digit of l? 0 Let r = 53419 - 28922. What is the units digit of r? 7 Let o(z) = z - 1. Let d be o(5). Let q be 6/(-4)(39 - 41). Suppose -3t - 48 - 513 = -2a, -da + qt = -1113. What is the hundreds digit of a? 2 Let i = 48309 - 2165. What is the thousands digit of i? 6 What is the ten thousands digit of -428((-666)/2 - 132/(-66))? 3 Let x(z) = -z*3 - 2z*2 - 6z + 2. Let m be x(0). Suppose -2d = 9b - 5b - 532, -mb + 266 = -2d. What is the tens digit of b? 3 Suppose 0 = 18k + 1442 + 628. Let i = 439 + k. What is the hundreds digit of i? 3 Let m(t) = 74t + 161. Let j be m(-18). Let c = 558 - j. What is the tens digit of c? 2 Suppose 637392 = 1411s - 1363s. What is the hundreds digit of s? 2 Let a = 222 - 273. Let u = -187 - -109. Let f = a - u. What is the tens digit of f? 2 Let h(v) = -12v. Let f be h(0). Suppose -4q + 1269 + 911 = f. What is the tens digit of q? 4 Let r(d) = -d3 - 59d*2 - 5d - 1043. What is the thousands digit of r(-71)? 9 Let s = -967 - -1106. What is the units digit of s? 9 Let d(z) = 38z - 180. Let l be d(5). Suppose 1662 + 798 = lc. What is the tens digit of c? 4 Let a(u) = -u3 - u2 - 3u - 17. Let d be a(-5). Suppose 0 = 3w + 4i - d - 928, -1736 = -5w + 2i. Let n = w - 198. What is the tens digit of n? 4 Let k(a) = -1272a - 4793. What is the tens digit of k(-27)? 5 Suppose -68d - 8d + 42217 + 6651 = 0. What is the tens digit of d? 4 Let h = -392 + 44. Let x = -258 - h. What is the units digit of x? 0 Suppose -4q = -3f - 79, 4 = f + 1. Suppose 2p = -qp + 26760. What is the units digit of p? 5 Suppose -35q - 1581 = -38q. Suppose -108f - q = -109f. What is the hundreds digit of f? 5 Let p = 292 - 294. What is the thousands digit of (-32)/8 - (p - 1179)? 1 Let b(v) be the first derivative of v3/3 + v2 + 5v + 10. Let q be b(-2). Suppose 3z + qd = 317 + 157, -5z = 3d - 806. What is the hundreds digit of z? 1 Suppose -4575 = -5c + u, 12u - 17u - 25 = 0. What is the tens digit of c(-6 + (-26)/(-4))? 5 Let f(o) = 17o*2 - 364o + 19. What is the units digit of f(65)? 4 What is the thousands digit of 86/(30706/(-7683) - -4)? 5 Let g(l) = -6l + 7. Let h be g(-7). Suppose -53v = -184v + 56330. Suppose v = hk - 47k. What is the tens digit of k? 1 Let l = 107408 + -34524. What is the ten thousands digit of l? 7 Let j = -7 + 6. Let b be j + -5 + 3 - (-232 + 1). Suppose b = 2f + 24. What is the units digit of f? 2 Let d = -1164 - -1323. What is the tens digit of d? 5 Let z(d) = d*3 + 21d*2 + 21d + 26. Let u be z(-20). Suppose 5s - u = -11, 3s = -w + 187. What is the tens digit of w? 9 Let z(q) = 2q2 - 16q - 53. Let u be z(24). Let a = u + -450. What is the tens digit of a? 6 Suppose -5p + 3q + 760 = 55, 4q = -4p + 532. Suppose -3o + 2o + 4c = -p, 0 = -5o + 5c + 750. Let l = 80 + o. What is the tens digit of l? 3 Suppose -7 = -5n - 32. Let i be (-144)/(n + 11 + -5). Let m = -36 - i. What is the units digit of m? 8 Suppose 95092 = 16j - 36476. What is the hundreds digit of j? 2 Suppose 26l = 18l - 184. Let f(v) = -v*2 - 28v + 20. What is the tens digit of f(l)? 3 Let i(r) be the third derivative of -r4/3 - r3/2 + 3r2 - 69r. Let h(u) = -u*2 + 7u + 4. Let p be h(8). What is the tens digit of i(p)? 2 Let s(x) = 33x + 2341. What is the units digit of s(-52)? 5 Let j = -386 + 144. Let i = j + 470. What is the hundreds digit of i? 2 Let j(h) = -8466h + 62. What is the tens digit of j(-1)? 2 Let x(n) be the third derivative of -25n4/6 - 5n*3/3 + 7n*2. Let a be x(-3). Suppose 8k + a = 10k. What is the tens digit of k? 4 What is the thousands digit of ((-2)/3)/((-8)/10 + (-134290)/(-167925))? 2 Let n(d) = 9d + 6. Let a be n(0). Let h = a - -7. What is the tens digit of h? 1 Let v(i) = i*3 - 13i*2 - 2i - 4. Let x be v(-7). What is the hundreds digit of x/(-9) - 14/(-63)? 1 Let w = -59 - -61. Suppose 0 = -wu + 4a + 76 + 410, -5u - 2a = -1215. Suppose 42 = -3m + u. What is the tens digit of m? 6 Suppose 0 = -6i + 1888 + 1010. Let n = -224 + i. What is the units digit of n? 9 Let g(m) = 2m - 28. Let p be g(7). Let a be (-9)/18 - p/4. What is the units digit of (a + 72/(-30))285? 1 Let n = 1050 + 3029. What is the thousands digit of n? 4 Suppose 27437 = 22y - 448735 - 10072. What is the ten thousands digit of y? 2 Let c = 3130 + 7123. What is the tens digit of c? 5 Let k(w) be the third derivative of -w6/120 - w5/20 - w4/8 - 17w*3/6 + 49w*2. What is the units digit of k(-10)? 3 Let m be ((-54)/36)/(-2(-1)/(-16)). Let x = 3 + m. Suppose -u + 53 = -x. What is the units digit of u? 8 What is the hundreds digit of (-1)/(114/(-205142))? 6 Let o(w) = 6w*2 + 6w + 27. Let l be o(9). Suppose -294 = -3k + l. What is the tens digit of k? 8 Let t = -548 - -554. Suppose tz - 28 = 1022. What is the tens digit of z? 7 Let z(h) = -549h - 4202. What is the tens digit of z(-8)? 9 Suppose 793t + 2152 = 795t. What is the thousands digit of t? 1 What is the units digit of 16 - (55 + -44) - (1 + (-40362)/2)? 5 Suppose -4 - 10 = d - 4j, d + j + 4 = 0. Let s = 19 - d. What is the tens digit of s? 2 Suppose -5w - 5p = -70, -12 = -3w - 2p + 5p. Suppose -wc = -8c - 7. What is the units digit of c - -8(-4)/8? 3 Suppose 2a = -11a + 214624 + 67502. What is the units digit of a? 2 Let c be (-15)/40 + 741/(-8). Let o = 18 - c. What is the hundreds digit of o? 1 Suppose 152s = 450380 + 283628. What is the thousands digit of s? 4 Suppose -4f + 3f + u + 251 = 0, 0 = 5f + 2u - 1255. Let c = 365 - f. What is the hundreds digit of c? 1 Suppose -649v - 2259594 = -820v. What is the tens digit of v? 1 What is the units digit of 13 - (0/13 - 6137)? 0 Suppose -4r + 6 = -r, 3a = 2r - 1402. Let w = a + 668. Suppose c - w = -c. What is the units digit of c? 1 What is the tens digit of 8608 - (6/(-39) + 0 + (-246)/(-78))? 0 Let y(r) = 2 + 16 + 4 + 2r - 8r. Suppose -h + 5l = 28, -14 = -2h - 16l + 12l. What is the tens digit of y(h)? 4 Let h = -172 + 172. Suppose h = -3b - 2r + 1094, -4b - 2r = r - 1457. What is the tens digit of b? 6 Let q = 23971 + -9595. What is the tens digit of q? 7 Let g = -2445 + 23599. What is the tens digit of g? 5 Suppose -3z - 71 = -4k, 5k + 4z = -0k + 81. Let j(h) = h3 - 17h*2 + 16h - 20. What is the units digit of j(k)? 2 Let u(a) = -391a3 - 9a*2 - 35a - 91. What is the ten thousands digit of u(-4)? 2 What is the units digit of 4/14 - (-5215041)/371? 7 Suppose 78b - 81b + 2	{ "pile_set_name": "DM Mathematics" }
19n2 + 11n + 16. Give o(-9). -2 Let a(n) = -n*2 + 14n + 143. What is a(20)? 23 Let c(i) = 65i + 242. Give c(-7). -213 Let s(o) = o2 - 33o - 279. Calculate s(-6). -45 Let h(j) = 2j3 - 60j*2 - 3j + 89. What is h(30)? -1 Let z(y) = 3y + 57. Determine z(-27). -24 Let y(o) = 4o*2 - 177o + 15. Give y(44). -29 Let c(p) = -116p - 1010. Give c(-9). 34 Let m(r) = -r3 - 80r*2 + 695r - 792. Determine m(-88). 0 Let w(j) = j*3 - 9j*2 + 40j - 46. Determine w(11). 636 Let b(d) = 2d2. What is b(2)? 8 Let k(j) = 67j - 901. What is k(14)? 37 Let i(s) = -s*2 - s + 198. Determine i(13). 16 Let m(r) = 2r*3 + 122r*2 - 7r - 421. Calculate m(-61). 6 Let q(y) = 26y2 + 7y - 5. Give q(3). 250 Let j(p) = p*3 - 20p*2 - 14p - 230. Give j(21). -83 Let g(m) = -m*2 + 103m + 36336. What is g(-146)? -18 Let v(z) = -43z + 647. Give v(19). -170 Let z(u) = 45u3 + u2 + 8u + 9. What is z(-1)? -43 Let i(p) = 3p*2 + 5p + 6. Give i(-1). 4 Let k(v) = 85v - 422. Determine k(5). 3 Let z(v) = -79v + 372. Give z(8). -260 Let f(h) = h*3 - 30h*2 + 149h + 19. Determine f(7). -65 Let g(d) = -d*2 + 112d + 11759. Determine g(178). 11 Let c(b) = -56b2 - 23b - 49. Determine c(-2). -227 Let r(x) = -x*3 - 8x*2 - 16x - 26. What is r(-4)? -26 Let k(u) = -2u2 - 11u + 122. Give k(-11). 1 Let m(y) = 69y2 + 56y + 19. Give m(-1). 32 Let d(g) = 73g + 1677. What is d(-23)? -2 Let b(u) = -6u*3 - 482u*2 - 163u + 15. Calculate b(-80). 255 Let a(s) = 15s + 31. Calculate a(6). 121 Let x(s) = 2s*3 + 73s*2 + 222s + 67. Give x(-3). 4 Let j(g) = g*3 - 9g*2 - 12g - 32. Calculate j(11). 78 Let i(h) = -965h + 4143. Give i(5). -682 Let t(a) = -6a - 201. Calculate t(-34). 3 Let f(u) = 24u - 176. What is f(6)? -32 Let s(a) = -a2 - 16a - 275. Determine s(-9). -212 Let z(g) = 2g2 + 20g - 351. Determine z(-21). 111 Let q(j) = -j*3 - 21j*2 - 39j - 456. Determine q(-20). -76 Let i(a) = -a*3 - 10a*2 - 12a - 53. Give i(-8). -85 Let r(o) = 616o + 6162. Give r(-10). 2 Let g(x) = -x2 - 50x + 394. Calculate g(7). -5 Let g(h) = 23512h - 117564. What is g(5)? -4 Let y(s) = s2 - 45s - 696. What is y(-13)? 58 Let y(m) = 59m2 + 319m + 36. Give y(-6). 246 Let x(o) = o*3 + 51o*2 + 86o - 616. Give x(-49). -28 Let p(r) = r*3 - 13r*2 + 47r. Give p(7). 35 Let b(o) = 36o - 3781. Calculate b(105). -1 Let h(f) = 7f*2 + 446f - 38. What is h(-64)? 90 Let u(x) = 5x3 + 583x*2 - 235x - 117. Determine u(-117). 0 Let y(w) = 10w2 - 77w + 235. Give y(3). 94 Let z(w) = -4w2 + 21w + 323. What is z(12)? -1 Let g(d) = 3d2 - 15d - 26. What is g(7)? 16 Let x(f) = f*2 + 101f - 1473. Calculate x(13). 9 Let r(b) = -9b3 + 53b*2 + 21b - 97. Determine r(6). -7 Let l(c) = -88c + 1179. Calculate l(4). 827 Let x(r) = r3 + 10r*2 + 9r + 85. Calculate x(-10). -5 Let s(c) = -c*3 + 5c*2 + 25c - 2. Give s(-4). 42 Let l(p) = -6p3 - 63p*2 + 36p + 36. Give l(-11). 3 Let o(p) = -p*3 + 24p*2 + 107p + 136. What is o(28)? -4 Let l(x) = x*3 - 22x*2 + 87x + 35. Give l(10). -295 Let g(h) = -7h2 + 112h - 12. Determine g(14). 184 Let b(a) = -a*3 - 46a*2 + 44a - 129. Give b(-47). 12 Let j(b) = 7b + 172. Determine j(-35). -73 Let u(d) = 234d + 43063. Calculate u(-184). 7 Let x(r) = 49r + 170. Give x(-4). -26 Let h(b) = -1694b + 50823. Determine h(30). 3 Let l(w) = -1634w - 1683. Give l(-1). -49 Let b(j) = -179j - 4857. Determine b(-27). -24 Let h(c) = 4c3 - 106c*2 - 80c + 692. What is h(27)? -10 Let r(h) = h*2 - 37h - 294. Calculate r(46). 120 Let w(c) = 14c - 259. Calculate w(16). -35 Let d(m) = -m3 + 12m*2 - 33m - 17. Calculate d(15). -1187 Let o(m) = -m*3 - 11m*2 - 20m + 34. Calculate o(-9). 52 Let s(d) = 13d3 - 88d*2 - 13d - 2. Give s(7). 54 Let s(f) = 2f2 + 179f - 359. Give s(2). 7 Let u(y) = -25y + 407. Give u(17). -18 Let w(q) = -194q - 985. What is w(-5)? -15 Let b(l) = l*3 - 62l*2 + 12l - 751. Give b(62). -7 Let w(m) = -42m + 581. Give w(14). -7 Let j(p) = p3 + 8p*2 - 42p - 75. Give j(-10). 145 Let s(p) = 10p2 + 160p - 13. Determine s(-16). -13 Let n(h) = -3h2 + 120h + 375. What is n(-3)? -12 Let t(b) = b*2 - 5b - 7. Calculate t(-2). 7 Let c(o) = 2o3 - 35o*2 + 21o - 89. What is c(17)? -21 Let o(n) = -n*3 - 8n*2 - 14n - 55. Determine o(-5). -60 Let t(j) = 49j - 3094. Calculate t(63). -7 Let h(b) = -b2 + 58b - 168. Determine h(3). -3 Let l(u) = 3u3 - 7u*2 + 28u - 1. Calculate l(5). 339 Let d(s) = -25s - 682. Give d(-42). 368 Let m(u) = 1858u + 7424. Calculate m(-4). -8 Let z(c) = -2c3 + 26c*2 + c + 2. Calculate z(13). 15 Let d(n) = 26n*2 + 95n + 76. Determine d(-3). 25 Let p(t) = -4t3 - 60t*2 - 31t - 461. Determine p(-15). 4 Let d(c) = -12c + 290. Calculate d(28). -46 Let c(v) = v + 906. Calculate c(56). 962 Let k(g) = -2g*2 + 3g + 75. Calculate k(-6). -15 Let o(i) = i*2 + 30i - 748. What is o(-47)? 51 Let s(j) = 9j2 - 490j - 2433. What is s(-5)? 242 Let h(a) = 280a - 1674. Determine h(6). 6 Let n(j) = 30j + 119. Determine n(-5). -31 Let a(w) = 2297w - 73513. Give a(32). -9 Let g(y) = -y2 - 94y - 1233. Give g(-77). 76 Let t(g) = 29g - 1071. Calculate t(37). 2 Let g(b) = -5b*2 + 449b + 159. What is g(90)? 69 Let a(s) = 885s + 5323. Calculate a(-6). 13 Let r(j) = j3 - 19j*2 - 47j + 793. What is r(19)? -100 Let q(d) = 3d2 - 78d - 52. Determine q(30). 308 Let c(d) = -87d - 59. Determine c(-1). 28 Let o(d) = 238d + 35219. Determine o(-148). -5 Let q(p) = -13p + 270. Determine q(21). -3 Let r(l) = 298l + 951. What is r(-3)? 57 Let u(x) = -x*3 + 4x*2 + 85x - 421. What is u(8)? 3 Let z(n) = 13n + 150. Determine z(-16). -58 Let i(a) = 28a - 47. Calculate i(-5). -187 Let z(j) = -222j - 2434. Calculate z(-11). 8 Let f(g) = -30g*3 - 6g*2 - 18g + 2. What is f(-2)? 254 Let x(z) = -41z + 74. Calculate x(9). -295 Let z(c) = -15c*2 + 36c + 202. Give z(5). 7 Let k(c) = c*3 - 46c*2 - 51c + 144. What is k(47)? -44 Let r(x) = 3x3 - 85x*2 - 58x + 82. Calculate r(29). 82 Let j(h) = -h*3 - 6h*2 - 6h - 5. What is j(-1)? -4 Let w(b) = 377b + 26008. Determine w(-69). -5 Let t(n) = -7n*2 + 110n + 158. Determine t(17). 5 Let q(w) = -w*3 - 30w*2 + 1980w - 16. Give q(32). -144 Let q(c) = -2c3 + 6c*2 - 43c + 113. Calculate q(3). -16 Let t(z) = 38z + 4368. What is t(-115)? -2 Let x(r) = 12r*2 - 89r + 4. Give x(7). -31 Let a(f) = -4f2 + 98f + 264. What is a(27)? -6 Let c(b) = b*2 + 16b - 245. Determine c(12). 91 Let r(u) = -u*2 - 15u + 118. Determine r(-22). -36 Let f(v) = 252v + 2275. Determine f(-9). 7 Let y(n) = 98n + 515. Determine y(-8). -269 Let k(q) = -8q2 - 13q + 119. What is k(8)? -497 Let y(p) = 18p - 425. Determine y(23). -11 Let g(f) = -f3 - 5f*2 - 16f - 26. Give g(-5). 54 Let s(q) = -q*2 + 194q - 5. What is s(0)? -5 Let l(s) = 1069s + 10677. Give l(-10). -13 Let f(o) = -o3 - 15o*2 + 119o + 5. Calculate f(-20). -375 Let v(i) = 7i3 + 26i*2 - 165i - 23. Give v(-7). 5 Let d(z) = z*3 + 51z*2 + 89z - 392. Give d(-49). 49 Let z(i) = 147i - 188. Determine z(1). -41 Let h(l) = -2721l - 24487. What is h(-9)? 2 Let j(z) = 126z + 5154. Calculate j(-41). -12 Let y(j) = -j2 + 12j + 118. Calculate y(19). -15 Let b(p) = p*2 - 431p + 7818. Calculate b(19). -10 Let d(b) = b*3 + 13b*2 - 4b + 140. Determine d(-14). 0 Let r(j) = -89j - 298. Calculate r(-11). 681 Let g(k) = 3k - 30. Determine g(-37). -141 Let k(p) = p*3 - 46p*2 + 120p + 77. What is k(43)? -310 Let g(x) = -2x3 - 62x*2 + x + 52. Give g(-31). 21 Let f(r) = -15r*3 + 21r*2 - 12r + 13. Calculate f(1). 7 Let r(f) = 120f + 3236. Calculate r(-27). -4 Let w(a) = 26a - 3249. Determine w(93). -831 Let z(l) = 13l - 2498. Give z(189). -41 Let a(r) = -2r*3 - 7r*2 + 35r + 119. Give a(-5). 19 Let z(d) = 5d + 321. Determine z(-56). 41 Let j(s) = -21s - 706. Determine j(-31). -55 Let i(a) = -a*3 - 5a*2 + 25a + 110. Calculate i(-5). -15 Let a(b) = 5b2 - 18b - 11. Determine a(6). 61 Let i(w) = -119w - 1585. What is i(-14)? 81 Let c(k) = 8k - 221. Calculate c(31). 27 Let h(g) = g*3 - 23g*2 - 18g - 145. Calculate h(24). -1	{ "pile_set_name": "DM Mathematics" }
be the second derivative of x*5/20 - 7x*4/12 + 5x3/6 + x2 - 7x - 72. Determine i(7). 37 Let q(u) = -u - 13. Suppose -1629 = -13c + 685. Let d be (-6)/(-48) + c/(-16). Calculate q(d). -2 Suppose -6x + 232 = 184. Let h(v) = -6v + 52. Give h(x). 4 Let c(m) be the third derivative of 1/120m6 + 0m - 1/60m5 + 1/24m*4 + 0 + 19/6m*3 + 63m*2. Calculate c(0). 19 Let r be (-28)/6(-9504)/(-1848). Let k(y) = -y*3 - 24y*2 - 1. What is k(r)? -1 Let u(h) be the second derivative of 1/3h*3 + 22h + 1/12h4 + 3/2h*2 + 0. Let l = -4 + 1. What is u(l)? 6 Let a(w) = -46w - 1 + 7w - w - 4w - 18w. Give a(1). -63 Let m(k) = 3 + 41k + 11k + 9k - 62k - 2. Give m(-22). 23 Let x = 2932 + -2934. Let i(t) = 2t*3 + 2t2 - t - 4. Calculate i(x). -10 Let n(d) = d3 + 3d2 - 11d - 4. Suppose 27 = 3f + 12, 0 = x + 2f - 5. What is n(x)? 1 Let i(h) be the third derivative of h6/120 - h5/10 + h*4/8 - 3h*3/2 + 2h2 + 207. What is i(6)? 9 Let f(z) = -z2 + 2z + 3. Suppose -4p = -6p - 4. Let r be f(p). Let m(d) be the first derivative of d3/3 + 2d*2 - 5d - 999. Determine m(r). 0 Let x(j) = -3j - 10. Let f be (-1 - 3) + 23 + -17. Let t(v) = -v - 1. Let z(g) = ft(g) - x(g). What is z(-10)? -2 Let s = 37753 - 37756. Let x(g) = -4g3 + g2 + 2g - 3. Give x(s). 108 Let l(a) = 5a - 6732 + 6725 + 0a*2 + 6a2. Calculate l(2). 27 Let f(w) be the second derivative of -w3/3 + 3w2 + 2w. Let c(o) = o*3 - 5o*2 - 3o - 13. Let z be c(6). Let y be (-7 + z)(-5 - -3). Give f(y). -2 Let f(h) = -h2 - 2h + 3. Let y(p) = p*2 - 13p + 36. Let c be y(5). Let o be (-6 - c - -1) + -4 + -1. Determine f(o). -21 Suppose 3r - d = d + 12, d + 11 = 4r. Let v(n) = -6n2 - 13n*2 - 5n*2 - 2n - 24n2 + 1 + 50n*2. Calculate v(r). 5 Let i(k) = 22k*3 + 5 - 59k + 26k + 24k + 11k2 + 23k*3 - 46k*3. Suppose -4n = 4b - 5 - 27, 2n = 3b - 34. Give i(b). 15 Let q(k) be the third derivative of -k4/24 - k3/3 - 35k*2. Let u be (0 + (-2)/4)0. Suppose 0 = -5d - h - 21, ud - d + 2h - 13 = 0. Give q(d). 3 Let s(m) = -12m2 + m3 + 109m - 50m - 3 - 58m. Determine s(12). 9 Let d(b) = -11b*2 + 32b - 62. Let a(o) = -2o2 - 1. Let k(h) = 5a(h) - d(h). Give k(30). -3 Let u(f) be the second derivative of 1/20f5 - 7/2f*2 + 25 + 1/3f*4 - 4/3f*3 + 3f. Give u(-5). 8 Suppose -65 = r - 108. Suppose 4n + 2q = 11 + r, -12 = -4q. Let k(c) = -c2 + 443c - 443c + n. Give k(0). 12 Let s be -31(240/(-45) - -5). Let t(h) = h + 6h + 6h - 2h*3 - s - 12h. Give t(-2). 13 Let q(f) be the first derivative of -16f3/3 + 2f*2 + 5f - 890. Calculate q(-2). -67 Let z(v) = v*3 - 2. Let r(g) = -2g*3 - g - 1. Let p be r(-1). Let l be z(p). Let b(f) = -4 + 1 - lf - 7f + 11f. Determine b(-4). 5 Let i(b) = -b*2 + 7b + 5. Suppose -89m - 51035 = -30m. Let g = m - -869. Determine i(g). 17 Let f(n) = -3n + 1. Let d(p) = -7p + 4. Let r be (-405)/(-486) + (-2)/(-12). Let s(b) = rd(b) - 2f(b). Calculate s(-7). 9 Let i(b) be the first derivative of 13b2 + b - 1. Let t(k) = -20k - 6k2 + 4k*2 + 0k*2 - 19 + 0k*2. Let r be t(-9). Determine i(r). -25 Suppose 14g + 8g - 66 = 0. Let c(p) = 0p*3 - 3pg + 8 - 6 - 1. What is c(-1)? 4 Let q(j) = j2 - 19j + 67. Let u = -347 + 362. Let o be q(u). Let g(p) = -p + 7. What is g(o)? 0 Suppose -1089z - 2v = -1093z + 6, -11 = -3z + 2v. Let t(r) be the second derivative of 2r3/3 + 3r2 - r. What is t(z)? -14 Let m(i) be the first derivative of i3/3 - 4i2 - 13i - 1971. Determine m(7). -20 Let u(g) = 8g2 + 8g - 22g2 + 10g + 15g2 + 17 - 6g. Give u(-7). -18 Let t(h) = -5h - 22. Let z = -3708 - -3704. Give t(z). -2 Let d(y) = 6y + 19. Let a(g) = g*3 + 16g*2 - 218g - 3500. Let h be a(-15). What is d(h)? -11 Let y(b) = 54b + 70 + 98b - 251b + 106b + 77. Calculate y(-27). -42 Let a(n) = 122n + 114n + 117n - 483n - 1 + 122n. Suppose 15 = 3p - 0. Suppose -pk + 5 = -0k. What is a(k)? -9 Let k(g) = g*3 + 14g*2 + 23g - 9. Suppose 5o - 211 + 271 = 3f, 24 = -2o - 4f. What is k(o)? 3 Let l(w) = 117w + 1060. Let z be l(-9). Let n(u) = -5u + 4 + 3u + 7. Give n(z). -3 Let v(y) be the second derivative of -3/2y*3 + 36y + 0 + 29/2y2 + 1/6y*4. Let o(m) be the first derivative of v(m). Calculate o(6). 15 Let t(g) = 110 - g - 52 - 59. Let f(k) = -k - 5 - 3k + 6k. Let p(o) = -f(o) - 3t(o). Give p(-6). 2 Let n be (2 - 2) + (-2156)/(-44). Let d be n/(-42) + 1/6. Let i(j) = 7j3 - j2 - j - 1. What is i(d)? -8 Let u(k) = -12920k + 6460k + 6458k + 2. Calculate u(-8). 18 Suppose -l = 3u + 5, 2l + 94u = 90u - 8. Let m(p) = -p*3 + 2p2 - p - 3. Give m(l). 15 Let g(m) = -m2 - m - 1. Let t(k) = -2k2 - 2k - 5. Let x(w) = 3g(w) - t(w). Let s be 0/(3 + -11)-1. Calculate x(s). 2 Let f(b) = 5b3 + 7b*2 + 17b + 10. Let p(a) = 9a3 + 14a*2 + 33a + 20. Let y(w) = -11f(w) + 6p(w). Determine y(9). -53 Let u(x) be the first derivative of x*2/2 + 8x + 11436. Give u(8). 16 Let l(k) = -21k2. Let v(m) = -m - 14. Let b be v(-17). Suppose u - 2 = 2n - 5n, -3n - 18 = -bu. What is l(n)? -21 Let i(f) = f3 + 25f*2 + 74f + 166. Let q be i(-22). Let j(r) = -2r2 - 21r - 10. Calculate j(q). 0 Let r(q) = -3q + 14. Let w(b) = 2b - 20. Let d(m) = 6r(m) + 7w(m). Calculate d(-15). 4 Let z be 6/1 + 30 + -30. Suppose 0 = -zw + 8w - 10. Let u(l) = l*3 - 6l*2 + 4l - 4. What is u(w)? -9 Let g(j) = 11j - 96. Let s be 29/(-30) + ((-110)/25 - -14). Calculate g(s). 3 Let l(k) be the second derivative of 17k4/24 - k3/6 + 153k*2/2 + 4k - 4. Let s(z) be the first derivative of l(z). Determine s(-2). -35 Let q(c) be the third derivative of -2 + 0c + 1/30c*5 - 13/24c*4 + 11/6c*3 + 27c2. What is q(5)? -4 Let n = 1 - 2. Let u(b) be the first derivative of 3 + b2 + 2/3b3 + b + 7/4b*4. What is u(n)? -6 Let k(t) = 9t*2 - t + 1. Let q(c) = -2c*2 + c + 1. Let a(l) = k(l) + 5q(l). Give a(-7). -71 Let r(o) = -o3 - o2 - 3o - 63. Let n be r(-4). Let q(j) = -16j - 34. What is q(n)? 14 Let c = 30 - 28. Let n be (c - (195/(-21))/(-5))7. Let q be ((-30)/(-25))/(n/(-5)). Let s(p) = 2p + 8. Calculate s(q). -4 Let q(o) = -3o + 2. Let c(z) = 12z + 308. Let s(r) = -c(r) + 5q(r). Determine s(-11). -1 Let p(j) = j - 2. Suppose -5t - 3 = -3o + 7, -14 = -4t - 2o. Suppose -2b = d + t, -d = -2d + 4b - 7. Let g be ((-8)/6)/(d/9). Determine p(g). 2 Let a(l) = 3l3 + 5l*2 + 2l - 3. Let b(z) = -7z3 - 5z2 - z2 - 4z2 + 5 - 3z. Suppose m + 15 = -2m. Let s(c) = ma(c) - 2b(c). Give s(-4). 5 Let f = -7 - -5. Let n(a) be the first derivative of 2a*2 + 10 + 0a + 21 + a + 2a. Give n(f). -5 Let j(r) = 177r + 64. Let c be j(-5). Let z = c - -810. Let k(v) = -2v2 - 22v + 9. What is k(z)? 9 Let c(x) = -x3 - x2 - x + 1. Let s(w) = 8w3 + 9w*2 - 10. Let k(f) = 6c(f) + s(f). Let t be k(-2). Let h(y) = -y*3 + 5y*2 + 2y + 4. Determine h(t). 28 Let q be (31/2)/(58/(-348)). Let i(k) = -20k + 19. Let g be i(-4). Let u = q + g. Let m(s) = -s3 + 6s*2 + s - 1. Determine m(u). 5 Let m(d) be the second derivative of 15/2d*2 - 2d*3 + 11 - d + 1/12d*4. Determine m(11). 4 Let u(i) be the second derivative of -3i5/5 + i4/6 + i3/2 + i2/2 + 3517i. Calculate u(-2). 99 Let u(h) = h3 - h2. Let c(p) = 5p*3 + 2p*2 - 3p. Let y(f) = c(f) - 4u(f). Suppose -5a = -8 - 2. Suppose 10 + a = -2t. Calculate y(t). 18 Suppose -r + 4b = -7, 14b = -r + 12b + 1. Suppose -ra + 24 - 12 = 0. Let n(w) = 0 - 6 + 4w - w. Calculate n(a). 6 Let v be 4/5 - 24/30. Let a(i) = v - 3 + 1 - i*2 + 1. Suppose -57o + 61o = 0, 8 = -4p + 4o. Determine a(p). -5 Let h(p) = p2 - 4p + 5. Suppose 0 = -q - 2 - 1. Let x be 72/14(2 - (-8 - q)). Suppose 4s - x = 4l, 0 = 4s - 2l + 3 - 29. Calculate h(s). 5 Let h(b) = 2b + 5. Let k(z) = -z. Let u(x) = -2x2 + 3x + 1. Let o(j) = 2k(j) + u(j). Let c be o(1). Determine h(c). 5 Let c(v) = 5v - 1 - 7v + 5v*2 + 2v. Let t(u) = u*3 - 6u*2 - 47u - 26. Let y be t(-4). Determine c(y). 19 Let c(h) = 29h + 26h + 19h + 4 + 28h - 104h. Give c(5). -6 Let j(w) = w + 1. Let z(f) = 4f - 148. Let y(b) = 10*j	{ "pile_set_name": "DM Mathematics" }
base 6) to base 4 -233 1010 (base 5) to base 12 aa What is -6 (base 7) in base 2? -110 What is 221 (base 4) in base 10? 41 What is -22 (base 14) in base 4? -132 Convert 3 (base 9) to base 7. 3 -bc (base 13) to base 5 -1110 What is -1 (base 4) in base 9? -1 Convert -6 (base 15) to base 6. -10 -200 (base 3) to base 13 -15 Convert -17 (base 14) to base 11. -1a Convert 4 (base 13) to base 3. 11 What is -2 (base 12) in base 7? -2 Convert -231 (base 12) to base 9. -401 -444 (base 5) to base 4 -1330 297 (base 11) to base 6 1340 Convert -4 (base 13) to base 14. -4 What is 1 (base 7) in base 9? 1 What is -15 (base 14) in base 7? -25 5 (base 8) to base 6 5 What is 65 (base 16) in base 8? 145 -4 (base 16) to base 3 -11 Convert -4 (base 5) to base 7. -4 What is 1 (base 6) in base 16? 1 What is -17 (base 9) in base 12? -14 Convert -101100 (base 2) to base 6. -112 3 (base 14) to base 7 3 -60 (base 9) to base 16 -36 What is -1 (base 11) in base 16? -1 What is -1 (base 15) in base 6? -1 Convert -5 (base 10) to base 13. -5 What is -21 (base 15) in base 16? -1f Convert a (base 14) to base 3. 101 Convert 4 (base 6) to base 3. 11 2f (base 16) to base 11 43 Convert -3 (base 11) to base 8. -3 11 (base 15) to base 11 15 What is 1 (base 4) in base 8? 1 0 (base 7) to base 12 0 25 (base 6) to base 11 16 Convert -d8 (base 14) to base 9. -231 -112 (base 4) to base 10 -22 4 (base 9) to base 15 4 Convert 131 (base 4) to base 5. 104 Convert -101000 (base 2) to base 13. -31 Convert 4 (base 6) to base 10. 4 What is 14 (base 10) in base 3? 112 Convert 46 (base 7) to base 3. 1021 Convert b (base 16) to base 15. b What is -10101 (base 2) in base 3? -210 What is 1 (base 11) in base 16? 1 Convert -5 (base 8) to base 5. -10 Convert -4 (base 12) to base 5. -4 What is 6 (base 10) in base 16? 6 What is 54 (base 11) in base 15? 3e -203 (base 4) to base 5 -120 Convert 146 (base 9) to base 6. 323 -2 (base 8) to base 7 -2 2 (base 6) to base 5 2 What is -12 (base 14) in base 6? -24 -8 (base 13) to base 9 -8 Convert -6 (base 15) to base 9. -6 What is 73 (base 11) in base 9? 88 Convert -5 (base 10) to base 2. -101 What is 2 (base 14) in base 9? 2 302 (base 4) to base 15 35 Convert 48 (base 12) to base 14. 40 4 (base 16) to base 6 4 Convert -2013 (base 4) to base 15. -90 Convert 11 (base 15) to base 13. 13 What is -13 (base 16) in base 2? -10011 What is 5 (base 16) in base 9? 5 11 (base 8) to base 6 13 What is -26 (base 11) in base 10? -28 Convert 1250 (base 6) to base 12. 226 What is 2c (base 16) in base 3? 1122 Convert -3 (base 5) to base 3. -10 What is ad (base 14) in base 12? 109 1003 (base 4) to base 5 232 What is 37 (base 9) in base 10? 34 13 (base 6) to base 5 14 Convert 12 (base 3) to base 7. 5 2 (base 11) to base 14 2 Convert -10 (base 7) to base 3. -21 Convert -31 (base 10) to base 11. -29 Convert 5 (base 6) to base 7. 5 Convert -2 (base 3) to base 9. -2 -3 (base 12) to base 3 -10 What is 3 (base 7) in base 11? 3 -10010 (base 2) to base 9 -20 What is -4 (base 12) in base 5? -4 What is 1321 (base 5) in base 15? e1 Convert 3 (base 7) to base 4. 3 What is -1055 (base 6) in base 9? -308 What is -31 (base 15) in base 12? -3a What is -1 (base 8) in base 16? -1 -12 (base 3) to base 9 -5 Convert -2 (base 5) to base 12. -2 What is 2 (base 8) in base 12? 2 What is 8c (base 13) in base 2? 1110100 Convert -4 (base 10) to base 13. -4 What is -54 (base 9) in base 4? -301 Convert -20 (base 3) to base 12. -6 -10 (base 15) to base 10 -15 45 (base 8) to base 7 52 What is 37 (base 14) in base 4? 301 Convert -14 (base 7) to base 13. -b Convert 2133 (base 4) to base 11. 135 What is -111 (base 2) in base 15? -7 59 (base 11) to base 8 100 What is 113 (base 4) in base 9? 25 What is 212 (base 5) in base 3? 2010 -7 (base 11) to base 3 -21 What is 100 (base 5) in base 6? 41 What is -5 (base 8) in base 14? -5 What is 2b (base 13) in base 6? 101 -2 (base 5) to base 13 -2 Convert -10 (base 8) to base 6. -12 5b (base 14) to base 15 56 Convert 2 (base 16) to base 9. 2 Convert 101 (base 2) to base 12. 5 Convert -30 (base 15) to base 8. -55 2 (base 3) to base 6 2 Convert 8 (base 15) to base 2. 1000 -75 (base 16) to base 13 -90 What is -5e (base 15) in base 3? -10022 What is -111 (base 7) in base 15? -3c Convert 102 (base 7) to base 5. 201 Convert 6 (base 7) to base 11. 6 -8a (base 13) to base 12 -96 Convert 3 (base 5) to base 8. 3 123 (base 8) to base 4 1103 Convert 106 (base 7) to base 6. 131 -24 (base 10) to base 14 -1a Convert -26 (base 13) to base 2. -100000 What is -202 (base 3) in base 15? -15 11 (base 4) to base 10 5 What is 350 (base 9) in base 13? 192 What is -4 (base 5) in base 15? -4 -100220 (base 3) to base 14 -151 What is 1100 (base 3) in base 10? 36 -10 (base 3) to base 15 -3 -11 (base 5) to base 4 -12 2b (base 16) to base 3 1121 What is 1 (base 6) in base 12? 1 What is 3 (base 4) in base 9? 3 12 (base 3) to base 8 5 Convert 60 (base 10) to base 5. 220 -2 (base 5) to base 2 -10 Convert 16 (base 10) to base 9. 17 What is 3 (base 9) in base 14? 3 2 (base 3) to base 9 2 -b (base 15) to base 13 -b What is -6 (base 10) in base 2? -110 Convert 2 (base 10) to base 3. 2 What is 69 (base 10) in base 15? 49 -3 (base 4) to base 10 -3 10 (base 4) to base 13 4 Convert -b (base 12) to base 4. -23 -101101 (base 2) to base 5 -140 Convert -11 (base 3) to base 4. -10 What is 23 (base 5) in base 4? 31 Convert 2122 (base 3) to base 14. 51 1 (base 10) to base 9 1 -2 (base 11) to base 4 -2 Convert 4 (base 8) to base 16. 4 Convert -22 (base 16) to base 12. -2a 18 (base 12) to base 16 14 What is 1000111 (base 2) in base 3? 2122 What is 5c (base 14) in base 9? 101 What is -4 (base 10) in base 15? -4 a2 (base 15) to base 12 108 Convert -3 (base 6) to base 3. -10 196 (base 11) to base 13 145 137 (base 10) to base 11 115 What is -153 (base 9) in base 2? -10000001 What is 0 (base 15) in base 8? 0 What is 1 (base 15) in base 16? 1 What is 12100 (base 3) in base 13? b1 What is -6 (base 9) in base 15? -6 5 (base 13) to base 6 5 What is -3 (base 11) in base 9? -3 What is -3 (base 9) in base 15? -3 What is 24 (base 10) in base 15? 19 -14 (base 13) to base 12 -15 3 (base 8) to base 12 3 What is 10 (base 8) in base 3? 22 be (base 15) to base 16 b3 What is -b5 (base 13) in base 2? -10010100 What is 3a (base 16) in base 3? 2011 Convert 4 (base 13) to base 3. 11 Convert 23 (base 9) to base 5. 41 Convert 158 (base 12) to base 3. 21212 Convert 4 (base 16) to base 7. 4 231 (base 8) to base 11 12a What is -11011 (base 2) in base 3? -1000 Convert 6 (base 12) to base 14. 6 What is -203 (base 9) in base 12? -119 Convert 32 (base 9) to base 2. 11101 Convert c0 (base 14) to base 13. cc 121 (base 3) to base 16 10 Convert -4 (base 9) to base 16. -4 0 (base 4) to base 16 0 Convert -17 (base 8) to base 6. -23 -a7 (base 11) to base 13 -90 Convert -a (base 15) to base 9. -11 34 (base 9) to base 6 51 Convert -31 (base 4) to base 11. -12 Convert 35 (base 16) to base 6. 125 224 (base 5) to base 15 44 What is -6 (base 15) in base 12? -6 -4f (base 16) to base 9 -87 -1 (base 12) to base 2 -1 -1324 (base 5) to base 7 -424 100 (base 2) to base 16 4 Convert -118 (base 13) to base 12. -13a What is -1124 (base 5) in base 14? -ba 2 (base 5) to base 9 2 What is 2 (base 13) in base 5? 2 Convert 34 (base 7) to base 4. 121 Convert -5 (base 14) to base 6. -5 Convert 10 (base 8) to base 9. 8 -b3 (base 14) to base 9 -184 What is d (base 15) in base 9? 14 -24 (base 8) to base 2 -10100 Convert 142 (base 7) to base 8. 117 Convert -2 (base 13) to base 12. -2 161 (base 12) to base 13 139 What is -156 (base 11) in base 12? -132 101100000 (base 2) to base 5 2402 Convert 12101 (base 3) to base 5. 1040 -6 (base 13) to base 4 -12 Convert -1 (base 6) to base 16. -1 1 (base 7) to base 6 1 Convert -10 (base 6) to base 11. -6 Convert a (base 13) to base 12. a Convert -52 (base 12) to base 3. -2022 -224 (base 9) to base 5 -1214 What is 204 (base 5) in base 11? 4a What is 6 (base 11) in base 14? 6 What is -1121 (base 4) in base 3? -10022 What is -4 (base 14) in base 16? -4 -12 (base 5) to base 13 -7 145 (base 7) to base 13 64 23 (base 6) to base 10 15 What is -3 (base 8) in base 16? -3 -2 (base 16) to base 2 -10 3 (base 9) to base 7 3 -23 (base 5) to base 7 -16 What is -19 (base 11) i	{ "pile_set_name": "DM Mathematics" }
are root of 8369 to the nearest integer? 91 What is the cube root of 82749 to the nearest integer? 44 What is 118031 to the power of 1/2, to the nearest integer? 344 What is 28766 to the power of 1/2, to the nearest integer? 170 What is the seventh root of 19310 to the nearest integer? 4 What is the ninth root of 58152 to the nearest integer? 3 What is the square root of 102727 to the nearest integer? 321 What is 54043 to the power of 1/2, to the nearest integer? 232 What is the square root of 28426 to the nearest integer? 169 What is 2500 to the power of 1/9, to the nearest integer? 2 What is the cube root of 22282 to the nearest integer? 28 What is the square root of 114663 to the nearest integer? 339 What is 2264 to the power of 1/7, to the nearest integer? 3 What is the tenth root of 2978 to the nearest integer? 2 What is 1880 to the power of 1/3, to the nearest integer? 12 What is 4 to the power of 1/2, to the nearest integer? 2 What is the fourth root of 69253 to the nearest integer? 16 What is 106295 to the power of 1/3, to the nearest integer? 47 What is the cube root of 12766 to the nearest integer? 23 What is the third root of 555 to the nearest integer? 8 What is 9377 to the power of 1/9, to the nearest integer? 3 What is the cube root of 505 to the nearest integer? 8 What is the ninth root of 19110 to the nearest integer? 3 What is 6578 to the power of 1/3, to the nearest integer? 19 What is the square root of 14282 to the nearest integer? 120 What is the cube root of 32350 to the nearest integer? 32 What is 79382 to the power of 1/2, to the nearest integer? 282 What is 1199 to the power of 1/9, to the nearest integer? 2 What is 3055 to the power of 1/10, to the nearest integer? 2 What is the sixth root of 292 to the nearest integer? 3 What is 16671 to the power of 1/4, to the nearest integer? 11 What is 83601 to the power of 1/6, to the nearest integer? 7 What is the seventh root of 20021 to the nearest integer? 4 What is 75572 to the power of 1/2, to the nearest integer? 275 What is the fifth root of 10888 to the nearest integer? 6 What is 4494 to the power of 1/9, to the nearest integer? 3 What is 16663 to the power of 1/2, to the nearest integer? 129 What is 75237 to the power of 1/2, to the nearest integer? 274 What is 7213 to the power of 1/4, to the nearest integer? 9 What is 52126 to the power of 1/8, to the nearest integer? 4 What is the cube root of 261 to the nearest integer? 6 What is 6025 to the power of 1/2, to the nearest integer? 78 What is 20253 to the power of 1/4, to the nearest integer? 12 What is the square root of 62 to the nearest integer? 8 What is the square root of 10543 to the nearest integer? 103 What is the fifth root of 32960 to the nearest integer? 8 What is 3894 to the power of 1/10, to the nearest integer? 2 What is the cube root of 13774 to the nearest integer? 24 What is the square root of 1899 to the nearest integer? 44 What is 1359 to the power of 1/3, to the nearest integer? 11 What is the tenth root of 2237 to the nearest integer? 2 What is the eighth root of 27367 to the nearest integer? 4 What is 5114 to the power of 1/3, to the nearest integer? 17 What is 700 to the power of 1/10, to the nearest integer? 2 What is 10045 to the power of 1/4, to the nearest integer? 10 What is 978 to the power of 1/9, to the nearest integer? 2 What is the cube root of 2496 to the nearest integer? 14 What is 13619 to the power of 1/3, to the nearest integer? 24 What is 4095 to the power of 1/5, to the nearest integer? 5 What is 3423 to the power of 1/9, to the nearest integer? 2 What is the cube root of 4920 to the nearest integer? 17 What is 18810 to the power of 1/8, to the nearest integer? 3 What is 847 to the power of 1/3, to the nearest integer? 9 What is 5445 to the power of 1/2, to the nearest integer? 74 What is the third root of 1929 to the nearest integer? 12 What is 60143 to the power of 1/2, to the nearest integer? 245 What is the third root of 10255 to the nearest integer? 22 What is the third root of 1680 to the nearest integer? 12 What is the third root of 1123 to the nearest integer? 10 What is the eighth root of 39732 to the nearest integer? 4 What is 32662 to the power of 1/2, to the nearest integer? 181 What is the third root of 10239 to the nearest integer? 22 What is 11834 to the power of 1/2, to the nearest integer? 109 What is the third root of 586 to the nearest integer? 8 What is the square root of 19032 to the nearest integer? 138 What is the cube root of 1926 to the nearest integer? 12 What is the ninth root of 84027 to the nearest integer? 4 What is the seventh root of 3398 to the nearest integer? 3 What is the square root of 3249 to the nearest integer? 57 What is the square root of 17768 to the nearest integer? 133 What is the ninth root of 480 to the nearest integer? 2 What is the square root of 96623 to the nearest integer? 311 What is 11252 to the power of 1/2, to the nearest integer? 106 What is the eighth root of 139144 to the nearest integer? 4 What is the square root of 13149 to the nearest integer? 115 What is the ninth root of 36797 to the nearest integer? 3 What is the third root of 20689 to the nearest integer? 27 What is 24082 to the power of 1/6, to the nearest integer? 5 What is 765 to the power of 1/7, to the nearest integer? 3 What is 104938 to the power of 1/2, to the nearest integer? 324 What is the square root of 2676 to the nearest integer? 52 What is the fourth root of 2558 to the nearest integer? 7 What is 3080 to the power of 1/10, to the nearest integer? 2 What is the third root of 17585 to the nearest integer? 26 What is 10102 to the power of 1/8, to the nearest integer? 3 What is the eighth root of 862 to the nearest integer? 2 What is 784 to the power of 1/2, to the nearest integer? 28 What is the square root of 74481 to the nearest integer? 273 What is the square root of 13415 to the nearest integer? 116 What is 365 to the power of 1/2, to the nearest integer? 19 What is the square root of 557 to the nearest integer? 24 What is the square root of 22067 to the nearest integer? 149 What is 1155 to the power of 1/2, to the nearest integer? 34 What is 325 to the power of 1/6, to the nearest integer? 3 What is the cube root of 13218 to the nearest integer? 24 What is the third root of 611 to the nearest integer? 8 What is the third root of 51390 to the nearest integer? 37 What is the square root of 14221 to the nearest integer? 119 What is the cube root of 146298 to the nearest integer? 53 What is 484 to the power of 1/3, to the nearest integer? 8 What is the fourth root of 148511 to the nearest integer? 20 What is the third root of 126930 to the nearest integer? 50 What is the seventh root of 14244 to the nearest integer? 4 What is 1980 to the power of 1/6, to the nearest integer? 4 What is the third root of 12746 to the nearest integer? 23 What is the square root of 1762 to the nearest integer? 42 What is the tenth root of 45163 to the nearest integer? 3 What is 32159 to the power of 1/2, to the nearest integer? 179 What is 1437 to the power of 1/2, to the nearest integer? 38 What is 1464 to the power of 1/2, to the nearest integer? 38 What is 10286 to the power of 1/2, to the nearest integer? 101 What is the square root of 1871 to the nearest integer? 43 What is 48332 to the power of 1/10, to the nearest integer? 3 What is the square root of 16739 to the nearest integer? 129 What is the square root of 1046 to the nearest integer? 32 What is 177480 to the power of 1/2, to the nearest integer? 421 What is the tenth root of 2730 to the nearest integer? 2 What is the third root of 8569 to the nearest integer? 20 What is the square root of 382 to the nearest integer? 20 What is the sixth root of 80119 to the nearest integer? 7 What is 381 to the power of 1/3, to the nearest integer? 7 What is the ninth root of 455 to the nearest integer? 2 What is the sixth root of 3811 to the nearest integer? 4 What is the third root of 45593 to the nearest integer? 36 What is the square root of 199128 to the nearest integer? 446 What is the third root of 1824 to the nearest integer? 12 What is the third root of 5264 to the nearest integer? 17 What is 33011 to the power	{ "pile_set_name": "DM Mathematics" }
the second derivative of -4p2u*2 + 48p*2uw2 - p2u + 7pu*2w + 2pw + 2u2w + 2uw*2 wrt p? -8u*2 + 96uw2 - 2u Find the third derivative of 167o5 + 276o*2 - 2o wrt o. 10020o2 Differentiate -79u*3w4 + u3 + 4u2w*4 + 53u*2 wrt w. -316u*3w*3 + 16u*2w*3 Find the third derivative of -102fr3 + fr*2u*2 + fr*2 + fr + 5fu*3 + 2r*3u*3 wrt r. -612f + 12u3 Find the second derivative of -ou*4 + 2ou3 + 1223ou2 + 2ou - 6874o wrt u. -12ou*2 + 12ou + 2446o Differentiate 2t2 + 36t - 2480. 4t + 36 What is the derivative of 12b*4 + 55b*2 - 3b - 8921 wrt b? 48b3 + 110b - 3 Find the third derivative of 3a3c*3x*2 - 6a*3c*2x*3 + ac*2x + 8c3x*3 + 4c3 + c2x3 wrt c. 18a*3x*2 + 48x*3 + 24 What is the third derivative of 638r*6 + 2r*2 - 1025 wrt r? 76560r*3 Find the second derivative of 3o*3w*3 - 108o*3w*2 + ow*3 + 1352o wrt o. 18ow*3 - 648ow2 Find the second derivative of kmn2 + km + 156kn*2 + 3k - mn2 - 19m + n wrt n. 2km + 312k - 2m Differentiate 3ky - 6k - 109y*2 + 3y + 87 wrt y. 3k - 218y + 3 Differentiate 8d2z*3 - 16d*2z - 771z3 - z with respect to d. 16dz3 - 32dz What is the second derivative of 18o*3p*2z*2 - 2o*3z*2 + 4o*2pz2 - o2p - 13op*5z*2 - p wrt p? 36o*3z*2 - 260op3z*2 Differentiate 8h*2w - 20h2 + hw - 129w wrt h. 16hw - 40h + w Find the second derivative of 410d5 - 1300d. 8200d3 Find the third derivative of 122b5 - b2 + 96 wrt b. 7320b2 What is the first derivative of 2g*2j*2 + 2g*2j + 2g2x - 5gx + 3j2x - 157j2 wrt x? 2g*2 - 5g + 3j2 What is the second derivative of 26a*2i*2 - 146ai2 wrt a? 52i*2 Find the third derivative of -93g*4l + g*2l - 41gl wrt g. -2232gl Find the second derivative of -2j2o*2v*2 - 8j*2o*2 - 21j*2v - 15jv*2 + 59o*2v*2 + 6ov wrt v. -4j*2o*2 - 30j + 118o2 What is the second derivative of 5307a*2w*2z + 4aw*2 - 71awz + w*2z wrt a? 10614w2z What is the third derivative of -2i6x - 76i5x + 101i2x + 2x wrt i? -240i*3x - 4560i2x Find the third derivative of 152g4 - 91g*2. 3648g Find the third derivative of -5932f2r*3 + 7f*2r*2 - 2fr2 - 93fr wrt r. -35592f*2 Find the second derivative of -7263z*5 + 1753z wrt z. -145260z3 What is the third derivative of -1056a*5 + 202a*2 + 7a wrt a? -63360a2 What is the third derivative of 192i*3n*3t*3 - 6i*3n*3t2 - i3n3 + 2i*2n*2t*2 + 2int*3 wrt t? 1152i*3n*3 + 12in What is the first derivative of 2o*2ty - 7o*2y + oty + 2o + 95ty + 3y + 1 wrt o? 4oty - 14oy + ty + 2 What is the derivative of -128hr*3 + 326r*3 wrt h? -128r*3 What is the second derivative of -110g*3j*2k*2 + 116g*3j*2 + 13g*2j*2k2 - g2jk - 9gj*2k wrt k? -220g3j*2 + 26g*2j2 Find the third derivative of f4n3 + f3n*3 - 12f*3 - 16f*2n - 2n3 - 4n wrt f. 24fn*3 + 6n*3 - 72 What is the first derivative of 4d*3p - 2d3 - 10d*2p*3 + 4p*3 + 8p wrt d? 12d2p - 6d2 - 20dp3 Find the first derivative of 3f*2 - 118f + 6586 wrt f. 6f - 118 Find the third derivative of -2v*6 + 95v*3 - 556v*2 wrt v. -240v*3 + 570 What is the second derivative of -3c*2d*2g - 370c2dg - c2d + 179cd + 3cg + 2c + 3d*2g - d*2 wrt c? -6d*2g - 740dg - 2d Find the third derivative of -1993x*5 - 2x*2 - 1085. -119580x*2 What is the derivative of 35l*3 + 242l*2 + 12462? 105l*2 + 484l Find the third derivative of 315b4 - 28b*2 - 8b. 7560b What is the third derivative of 8h*5 - 10h*4w3 + h2w2 - 2h*2w - 130w3 wrt h? 480h*2 - 240hw3 Differentiate 235n*4 - 446. 940n*3 Find the third derivative of -2105v*3 + 2v*2 - 759v. -12630 Find the second derivative of 119m5 - 3m4 + m2 - 86m wrt m. 2380m*3 - 36m*2 + 2 What is the derivative of -5918p*2w - 4743p2 - 1 wrt w? -5918p*2 Find the second derivative of -164x*3 + 4x + 4 wrt x. -984x Find the third derivative of 8391t3 + t2 + 2t - 3714 wrt t. 50346 Find the second derivative of -a3f2 + a3w2 + a2fw + 83af2w*2 + aw*2 wrt w. 2a*3 + 166af2 + 2a What is the second derivative of -c*5 + 45c*4 + 174c? -20c3 + 540c*2 Find the second derivative of 93d*4 + d + 3 wrt d. 1116d*2 What is the third derivative of -3l*2w*4 - 122l*2w*3 + 12l*2w - 3lw*2 - 5w*2 wrt w? -72l*2w - 732l2 Differentiate 2i*3s*2 - 146i*3 - 131s*4 with respect to s. 4i*3s - 524s3 Find the third derivative of -4059gj3 - 2gj2 + 1727g wrt j. -24354g Differentiate gr + 3gt*3 - 13rt3 - rt wrt g. r + 3t3 Find the third derivative of -2i*6 - 347i*5 - 786i*2. -240i*3 - 20820i*2 What is the third derivative of -114r*3s*2 - 4r*3 - 2r*2 + rs*2 - 74 wrt r? -684s*2 - 24 What is the second derivative of -3c*4 + 83c*3 + 8504c? -36c2 + 498c What is the first derivative of -20m3z*2 + 2m*3 - 9z*4 + 52 wrt z? -40m*3z - 36z3 What is the second derivative of -2m*3 + 95m*2 + m + 2? -12m + 190 What is the second derivative of -n*2x*2 - 15n*2x + 2n - 131x*4 - 30x wrt x? -2n2 - 1572x*2 Find the second derivative of -2811k*2 + 10k - 28 wrt k. -5622 What is the derivative of -148g4 + g2 - 632 wrt g? -592g*3 + 2g What is the second derivative of -2p3 - 684p*2 - 4137p wrt p? -12p - 1368 Find the second derivative of -3373u*2 - 2048u wrt u. -6746 Find the second derivative of -3l3q*2s*2 - 2l*3q*2s + 1022l3qs - 127l*2q*2s2 + l2q2 + 2lq2s wrt s. -6l3q*2 - 254l*2q*2 Find the first derivative of -116y4 - y2 - 219 wrt y. -464y3 - 2y What is the first derivative of -46k3z - 15k3 - 41k*2 - 17z*3 wrt z? -46k*3 - 51z*2 Find the third derivative of -4281q*3 - 28q*2. -25686 Find the third derivative of 6vw3z*2 + 12vw3z + 7vw*2z + 2vwz2 - 3vz2 + w3z + 8w2z*2 wrt w. 36vz2 + 72vz + 6z Find the first derivative of k*3 - 3kp + 2k + 226p wrt k. 3k*2 - 3p + 2 Find the second derivative of -443a3g2 + a3 - 558g wrt g. -886a*3 Differentiate 2591ow - 6933w wrt o. 2591w What is the third derivative of -11d*3o*5 - 7d*3 - 8d*2o*6 - 7d*2o*2 + 3o wrt o? -660d3o*2 - 960d*2o*3 Find the second derivative of 3c*2p*3 - 316c*2p - 3c2 - 103cp3 + 25cp2 + 2p*3 wrt c. 6p*3 - 632p - 6 What is the second derivative of -15km*3z - 15km*3 + 22km2z*2 - 3km - 175m*3z*2 + 2z wrt z? 44km*2 - 350m*3 Find the third derivative of 172b*3r3 + b3r2t - b*3rt + 2br3t - br3 + 3r*2 wrt r. 1032b*3 + 12bt - 6b What is the derivative of 64k3 - 138? 192k*2 What is the derivative of 105w*2 - 7w + 1021 wrt w? 210w - 7 What is the derivative of -11275q*4 + 6608 wrt q? -45100q*3 What is the third derivative of 186m*3 + 157m*2 wrt m? 1116 Find the first derivative of -3082iu - i + 1027u + 1 wrt i. -3082u - 1 What is the third derivative of -f5 - 300f*3 - 1298f*2? -60f*2 - 1800 Find the second derivative of 52s*2u*4 + 37s*2u + 2s2 - 2su4 - 2u wrt u. 624s2u*2 - 24su2 Find the third derivative of -205n*3x*2y*3 - 7n*3x*2 - 5n*2x*2y*2 + 3nx3y*3 - 2x*3y wrt y. -1230n3x*2 + 18nx3 Find the third derivative of 3x*6 - 195x*5 + 2x*4 + 2x*2 + 712x + 18. 360x3 - 11700x*2 + 48x What is the first derivative of 1505p4 + p2 + 4p + 3446 wrt p? 6020p3 + 2p + 4 Find the third derivative of -44v6 + 2v*3 + 164v*2 - 2 wrt v. -5280v*3 + 12 What is the second derivative of 79f*2k*3u + 3f2k*3 + 5fk3u + 4f - k2u wrt f? 158k3u + 6k3 Differentiate 30y*3z + 841y3 + 3z with respect to z. 30y3 + 3 What is the third derivative of -67i*5 - 28i*3 + 19108i*2 wrt i? -4020i**	{ "pile_set_name": "DM Mathematics" }
2 - 3 - 1))(4 + 1 + 2)(-1 + 0 + 0) as p + xv and give x. 7 Express -2g + 18 + g*2 - 18 - 7g*2 in the form kg + c + lg2 and give k. -2 Rearrange (-2c - 2 + 2)(2 - 5 + 0)(-15c3 - 5c2 - c2 + 7c2) to w + pc + uc3 + mc*2 + lc4 and give u. 6 Express -l3 + l - l + 0l3 - l3 + 2l3 + (l2 - l2 + l3)(1 - 2 + 4) in the form dl*3 + wl*2 + m + ul and give d. 3 Express (3w - w - 3w)(w2 + 0w + 0w) - 10 + 10 - 2w*3 + 7 - 7 + 9w*3 as bw*3 + g + pw*2 + kw and give b. 6 Rearrange (2m - 3 + 3)(0m - 3m + 5m)(-5m2 + m2 - 9m*2) to um*3 + am*2 + r + tm + dm4 and give d. -52 Express (0p2 - p2 - 3p2)(p*2 - 2p*2 - 2p*2) in the form s + tp*3 + np + kp2 + hp*4 and give h. 12 Express -3i*3 + 0i3 + i3 + (-323 + 323 + 89i3)(1 - 2 + 3) as ui3 + yi + li2 + o and give l. 0 Express -2j - 1948 + 7j2 + 1948 as fj + n + cj2 and give f. -2 Rearrange 4w*3 + w - 3w*3 - 4w*3 to the form vw + l + dw3 + qw2 and give d. -3 Express m4 + 4m4 + m + 0m*4 + 0m4 - m3 in the form im4 + bm*2 + dm + gm3 + h and give b. 0 Express -7i - 10i + 5i in the form x + ni and give x. 0 Rearrange -54h - 116 - 40h + 116 to the form j + wh and give w. -94 Express 4z2 + 16z*4 - 3z*2 + 10 - 14z*4 - 3z*3 - 7 in the form bz*3 + qz*4 + kz + t + mz2 and give q. 2 Rearrange -24 + 10 + 4t + 14 to ct + k and give c. 4 Rearrange 5y + 5y - 9y + 22y2 to the form iy + fy2 + a and give i. 1 Rearrange 1 - 6 - u3 - 2 to au*3 + q + ru*2 + du and give q. -7 Express (-3 + 1 + 0)(g4 - 3g*4 - 4g4) - g4 - 5g4 - 8g*4 in the form zg*3 + x + vg + sg2 + jg*4 and give j. -2 Rearrange (-4z*2 + 4z2 + z2)(-3z*2 + 0z*2 + 5z*2) + 3z*2 - 3z*2 + 3z*4 to the form lz + dz3 + gz*4 + i + xz*2 and give g. 5 Express -4l + 5l + 2 - 2 as g + sl and give g. 0 Rearrange -1 + 56n - 9n + 1 to the form un + k and give u. 47 Express 252p + 157p - 478p as c + bp and give b. -69 Rearrange 5j + 6 - 20 - 3j4 + 12 + 2j3 + j4 to bj + f + hj*2 + vj*3 + ij*4 and give b. 5 Express (3n*2 - 4n*2 + 2n*2)(3n + 6n - 8n - n2) as g + tn*2 + qn*4 + zn + an3 and give a. 1 Rearrange (-3c + 3c + c2)(5 - 5 - 2c) - 7 + 63c*3 + 7 to gc*3 + i + wc*2 + jc and give g. 61 Express (-3k - 97k*2 - 6 + 95k*2 - 2k)(2k - k + 2k) in the form hk*3 + xk*2 + p + mk and give x. -15 Rearrange -b*3 + 2b*2 + 5b*3 - 2b*3 to the form sb + cb3 + n + rb*2 and give s. 0 Express (1 - k + 2k*3 - 5k*2 + 5k*2)(6 - 13 + k + k) as n + dk + sk*3 + ck*2 + lk*4 and give l. 4 Express (4w + 0w - 2w)(-3w + 3w - 3w) - 2w2 - 2w*2 + 2w*2 as n + ow*2 + gw and give o. -8 Express -r*3 + r + 0r2 - r2 - 2r + 0r*3 in the form sr*3 + p + dr*2 + ur and give d. -1 Express -2 + 56r2 - 88r*2 + 2 in the form gr*2 + cr + l and give g. -32 Rearrange -1 + 2n2 + 1 + 2n*2 + 3n*2 - 4n*2 + (3n + 3n + 2n)(-n + 3n - n) to qn2 + pn + m and give q. 11 Rearrange z*2 + 4z*2 + 9z*2 to the form uz*2 + xz + p and give u. 14 Rearrange -3p3 + p3 + p2 + 2 + 0p*4 - 2p*4 - 2p to up2 + lp + f + ip4 + np*3 and give u. 1 Express (-1 - 2 + 5)(-320 - 544y + 191y + 320) as xy + g and give x. -706 Express (2o*3 + o - o)(2 + 5 - 6 - 5o) in the form so*4 + v + xo + ho3 + co*2 and give h. 2 Express 26 + 20 - 45 + 16a*2 in the form ia*2 + pa + z and give z. 1 Rearrange -3p2 - 22p*3 - 2p*2 + 3p2 + p3 + 2p3 + 0p*3 + (-1 - 2p*2 + 1)(-2p + 0 + 0) to the form jp + up3 + cp*2 + a and give c. -2 Rearrange 28q*4 - 61q*4 + 17q*4 + (-q - 2q + 4q)(2q3 + 1 - 1) to dq*2 + pq*4 + y + aq + hq3 and give p. -14 Express -7l - l*3 - 1 + 4l - l*4 + 2l*2 + 13l + 5l in the form jl*3 + tl*2 + f + yl*4 + ul and give t. 2 Express (6n - 6n - 4n2)(n - n - 5n) as pn + r + vn3 + in*2 and give v. 20 Rearrange -3m*3 + 0m*3 + 11m*3 + 6m3 - m3 - 3m3 + (-2m3 - m3 + 5m3)(-3 - 2 + 3) to hm3 + nm*2 + a + tm and give h. 6 Express (-3m + 0 + 0)(-2m + 0m + 4m) as gm*2 + a + nm and give g. -6 Express 15f2 - 23f*2 - 7f*3 + 20f*2 as gf*3 + l + rf*2 + vf and give r. 12 Express -4l + 3 + 2l*3 + 4l*4 + 4l - 2 as tl3 + yl*2 + jl + cl4 + o and give c. 4 Express 1 - 7l - 1 + 38l in the form wl + x and give w. 31 Rearrange -5i + 3i*3 + 0i*3 + 7i to vi2 + si + x + qi3 and give s. 2 Express 5w*2 - 13w*2 - 6 + 6w*2 + 3w*2 in the form vw + p + aw2 and give a. 1 Express (a - 2 + 2)((4a + a - 2a)(0a + 4a - 6a) + 0a + 0a - 2a2)(6 - 1 - 3) in the form la + na*3 + t + da2 and give t. 0 Express j2 - j*2 - 9j3 - j2 in the form d + lj2 + sj + oj3 and give o. -9 Rearrange 4s - 180 + 361 - 180 to y + zs and give y. 1 Express 3 - 2 - 5 + 5 - 5x*2 in the form px*2 + sx + n and give p. -5 Rearrange (-2t - 46 + 46)(2 - 2 - 3) to ut + k and give u. 6 Rearrange -6q + 4q3 - 2q - 4q + 2q*2 - 2q*3 to the form cq*3 + iq + y + vq2 and give v. 2 Express -9y - 20 + 20 in the form ky + s and give k. -9 Express 28a*2 - 2a - 26a2 + 3a + 2 - 3 + 3 + a*2 + (-3a + a + 0a)(1 - a - 1) as w + ba + va*2 and give b. 1 Express 0s - 7s - 5s as q + ys and give y. -12 Rearrange -12g + 6g2 + 11g - 2g2 - 2g*4 - 5g*2 to yg*4 + hg*2 + mg + d + cg3 and give h. -1 Rearrange 24 - 37b*2 - 24 to tb*2 + k + hb and give t. -37 Express -h*2 - h + h + (-3h + 0h + 4h)(-h + 0h - 2h) as wh*2 + z + th and give w. -4 Rearrange c*4 + 0c*3 + 2c*3 + 0c*4 + 2c*2 to xc + jc3 + lc*2 + bc*4 + h and give h. 0 Rearrange -1 + 35o*2 - 32o*2 + 24o*2 to the form lo*2 + h + bo and give h. -1 Express (0 + 0 + v)(3v*2 - 4v + 2v - 18v*2)(-2v + 5v - 2v) as jv*3 + cv + a + qv4 + zv2 and give j. -2 Express 3 - s2 + 7s2 - 2s*2 - 1 in the form gs*2 + c + zs and give g. 4 Rearrange (0 - 3 + 4 - 5 + 3 + 1 + (2 + 1 - 1)(2 - 4 + 3) + 0 - 2 + 4 - 2 - 3 + 3)(-3b + b - 6b) + 7 - 7 + 3b to the form k + vb and give v. -13 Express j + 2 + 6 - 2 + (6j - j - j)(1 - 1 + 2) + 3j - 3j - j + 0j - j - j as kj + z and give k. 6 Rearrange (-2 + 1 + 3)(l + 2l - 6l)(50 + 14 - 13) to the form vl + y and give v. -306 Rearrange -34r*3 + 3r*2 + 3r3 - r2 to lr3 + d + gr + mr2 and give m. 2 Rearrange 4b2 - b4 + b - 1 + 0b - 2b*2 + 0b to nb2 + mb*3 + ib + lb4 + u and give l. -1 Express 2 - 26a + 7a - 13a + 3a - 2a*2 as qa + xa2 + b and give q. -29 Rearrange 4v + 18 + 2v2 - 19 + 8v to the form nv2 + bv + f and give n. 2 Express 2a - 2a*2 + 6a2 + 1 + a2 as ca + ga*2 + i and give c. 2 Rearrange (-1 + 1 - 1)(3z2 - z - 7z*2 + 7z*2) to k + nz + tz2 and give k. 0 Rearrange -13d + 14d - 3d - d*4 + (-2 + 2d + 2)(1 + d3 - 1) to the form j + xd*3 + wd*4 + bd*2 + ad and give w. 1 Express (-4 + 4 - 5u)((-2 + 1 + 0)(-2u + 5u - u) + u - 6u + u) in the form a + xu2 + ju and give x. 30 Express -v*2 + 27v + 4v2 + 6v*3 - 50v + 21v as p + uv*3 + wv + hv2 and give h. 3 Express -h3 - 2h - 16h2 - 12h*2 - 10 + 26h*2 in the form p + rh + gh2 + vh*3 and give g. -2 Rearrange 0x*3 + 2x*4 - 102x + 106x + 2x*3 to the form lx*2 + kx*3 + wx*4 + u + dx and give w. 2 Rearrange -2 + 15q3 - 50q3 - q3 to rq + jq*2 + o + tq*3 and give t. -36 Express (-15 + b + 2 + 5)(-4b + 3b + 2b)(3 + 1 - 2) as v + sb + yb*2 and give v. 0 Express z - 7z*2 - z in the form qz*2 + o + vz and give q. -7 Rearrange -18y2 + 8y*2 + 9y*2 + 16y to ny + vy*2 + u and give n. 16 Rearrange (2 - 61b + 7 - 10)(-2 + 0 + 1) to d + kb and give d. 1 Rearrange (0 + 2 + 0 + (0 + 3 - 4)(-3 + 2 + 0) - 2 + 5 - 1)(7z - 11z - 15z) to the form h + mz and give m. -95 Express (p + 3p - 6p)(9p*2 + 2 + 6p*2 - 5p*2) in the form o + dp*2 + fp + lp3 and give f. -4 Express -87y*	{ "pile_set_name": "DM Mathematics" }
m(-2). Calculate the greatest common factor of b and s. 5 Let z(b) = -b*3 + 4b*2 + 4b + 7. Let d be z(5). Let q = d + 2. Calculate the highest common divisor of q and 12. 4 Let r be (-108 - 0)(-5)/4. Suppose c + 12 = 2c - 3b, c - 4b - 7 = 0. What is the greatest common factor of r and c? 27 Suppose -144 = -5n + n. Calculate the highest common divisor of n and 18. 18 Let b = -46 + 88. Suppose 3h + 15 = 0, s - 5h = 6s - 45. Calculate the greatest common divisor of b and s. 14 Suppose -q = -2 - 3. Let p = 16 - q. Let y = 1 + p. What is the highest common divisor of 12 and y? 12 Suppose 3l - 4d - 67 = -3d, l + d - 21 = 0. Let o be l/18 - 4/18. Calculate the highest common factor of 7 and o. 1 Let t be 3/15 + (-138)/(-10). Suppose -4g + 84 = -5p, 2 = 2g - 2p - 40. Calculate the greatest common factor of t and g. 7 Let s be (5/(-2))/((-5)/270). Calculate the greatest common divisor of 27 and s. 27 Suppose 0t = -2t + 352. Let s(q) = -q3 - 6q*2 - 2q + 4. Let r be s(-6). What is the highest common divisor of r and t? 16 Let b(w) = w*3 + 7w*2 + 5w - 4. Let y be b(-6). Suppose yd = 3d. Let x be (-3)/(-9)d - -42. What is the highest common factor of x and 14? 14 Let z = 102 - 64. Suppose 4m - z = 34. Calculate the highest common factor of m and 9. 9 Suppose 5y = 209 - 29. What is the highest common factor of y and 9? 9 Suppose -2b = -4b + 418. Let a be (-3 - (0 + -3)) + 19. Calculate the highest common factor of a and b. 19 Let y be 3/(-2)-8 + 0. What is the highest common factor of 9 and y? 3 Let h = 16 + 4. Let o = 23 - h. Calculate the highest common divisor of o and 27. 3 Suppose -2 = 6i - 80. Let w = -33 - -98. What is the greatest common factor of w and i? 13 Let y = 6 + -11. Let j(a) = -3a - 1. Let m be j(y). Calculate the greatest common divisor of m and 7. 7 Suppose -2y + 80 = 2y. Suppose l = -l + y. Let r = l + 10. What is the greatest common divisor of r and 30? 10 Let b = -68 - -134. What is the highest common divisor of b and 44? 22 Let r be 1 - (2-4 - -1). Let k(b) be the first derivative of b2/2 - 2b - 1. Let a be k(r). What is the greatest common factor of a and 48? 6 Suppose 177 = -g - 4t - 0t, -t - 347 = 2g. Let l(j) = -5j*3 + 4j*2 + 3. Let s be l(3). Let k = s - g. What is the highest common factor of k and 11? 11 Suppose 13 + 17 = 3f. Calculate the greatest common factor of f and 80. 10 Let y = 10 + -11. Let g = 14 - y. Let j be 6/2 + -2 - -4. Calculate the greatest common divisor of j and g. 5 Suppose 0 = -0t + 4t. Suppose 0 = 5g + d - 160, 7d - 20 = 3d. Suppose 3w - g - 95 = t. Calculate the greatest common factor of w and 14. 14 Let t = 49 + -21. Calculate the greatest common factor of t and 28. 28 Let v = -68 + 108. Calculate the highest common divisor of 24 and v. 8 Suppose 16 = 4s - 0s. Suppose 10 = -5w + 35. Suppose 3 = 2l - w, -5t + 5l = -120. Calculate the highest common divisor of s and t. 4 Suppose -11k + 5k = -60. Calculate the greatest common divisor of k and 2. 2 Let v = 13 - 11. What is the greatest common divisor of 3 and v? 1 Let v = -4 - 0. Let k be 32/(-10)30/v. Calculate the highest common factor of k and 12. 12 Let l = -25 + 46. What is the greatest common factor of 231 and l? 21 Suppose -14 = -d - 5. What is the greatest common divisor of d and 63? 9 Suppose a - 4v + 3 + 3 = 0, -5a + 50 = -4v. Calculate the highest common divisor of a and 35. 7 Let a(x) = -8x + 32. Let u be a(-10). What is the highest common divisor of 14 and u? 14 Let r(b) = -b3 - 5b*2 - 4b + 6. Let s be r(-5). What is the highest common divisor of 208 and s? 26 Let d be 10 - 1 - (-6 - -7). Suppose 13a = da + 90. Suppose -l = -3u + 10, -3l + 11 + 1 = 5u. Calculate the highest common divisor of a and u. 3 Let g(f) = 4f*2 - 2f*2 + 1 + 1. Suppose -9b = -6b + 6. Let u be g(b). What is the greatest common divisor of 4 and u? 2 Let p = 60 - 42. Suppose -3j - p = -o, 38 = 5o - 4o + 2j. Let a be (-14)/(-77) - (-130)/11. What is the highest common factor of a and o? 6 Suppose 5b + 103 = 4m, -6b + 138 = 5m - 3b. Calculate the greatest common factor of m and 9. 9 Let i(b) be the second derivative of -4b3/3 - 4b*2 + b. Let x be i(6). Let f = -40 - x. What is the greatest common divisor of f and 48? 16 Let l be 18/(-6) - -231. Calculate the highest common divisor of 30 and l. 10 Suppose 4t - 2t + 5p - 26 = 0, 0 = 2t - 5p - 46. What is the greatest common factor of 144 and t? 18 Let d(s) be the first derivative of -s2 - 7s - 1. Let k be d(-11). Calculate the greatest common factor of k and 10. 5 Let d be -7 + 3 - -138 - -1. Let b = 44 + -29. Calculate the highest common divisor of b and d. 15 Let g(h) = 6h + 4. Let r be (6 + -3)(-4)/(-3). Let k be g(r). What is the greatest common divisor of 4 and k? 4 Let d = -143 - -313. Let q(r) = 2r2 - 5r - 1. Let w be q(-2). What is the highest common factor of d and w? 17 Let m be (-12)/(-20) + (-93)/5. Let h be -1 + 2 - 1 - m. Suppose -h = 2u + 4r, 8r + 30 = 5u + 3r. Calculate the highest common divisor of 1 and u. 1 Let s(n) = 2n - 1. Let g be s(2). Let v(j) = -j*3 + 7j*2 - 3j - 4. Let o be v(4). Let y = o - 17. Calculate the greatest common divisor of y and g. 3 Let i(t) = -t*2 - t - 7. Let o be i(0). Let r be 2/o + 258/21. Suppose 0b - b = -60. Calculate the highest common divisor of r and b. 12 Suppose -o - 49 = -3m, 69 = 3m + o + 2o. Suppose -4s + 5h - 3h = -224, -4s = -3h - 228. What is the greatest common factor of s and m? 18 Suppose -7 = -3t + 2n - 88, 3t = -5n - 60. Let c be 10/t - (-12)/5. Calculate the greatest common divisor of c and 16. 2 Let x(v) = -v*2 + 17v + 10. Let r be x(17). Calculate the greatest common divisor of r and 80. 10 Let l(r) = -r*3 - 2r*2 - 4r - 4. Let p be l(-4). What is the greatest common factor of p and 88? 44 Let q = -89 - -130. Suppose 4v = 103 + q. Suppose 5n = -m + 1 - 2, 0 = 3n + 6. Calculate the greatest common factor of m and v. 9 Let y be (5 - -3)/4 - -14. Suppose 3g = 2w - 65, 4 = w - 4g - 16. What is the greatest common divisor of y and w? 8 Let q = -21 + 41. Calculate the highest common factor of q and 8. 4 Let c(g) = g*2 + 6g + 7. Let j = -2 - -4. Suppose 0 = 3q - jy + 21 + 2, -3q = -3y + 24. Let p be c(q). What is the greatest common divisor of p and 56? 14 Suppose -15 = -5w, 0 = 3n + 3w - 4w - 12. Suppose 0 = 2z + 5v - 255, 4v - 207 = -nz + 388. What is the highest common factor of 46 and z? 23 Let k = -9 - -9. Suppose 6c - 7c + 3 = k. Suppose cm - 58 = 293. What is the highest common factor of 13 and m? 13 Suppose 5d = 5 + 5. Let n(o) = 5o - o - 9 - do. Let g be n(8). Calculate the highest common factor of 70 and g. 7 Let l be 2 - (1 + 1 - 14). Suppose 3d - 3 = -k - 1, 0 = -k - 2d + 2. Suppose 0 = ky - 2 - 2. What is the greatest common divisor of y and l? 2 Let a = -248 + 367. Let s(x) = x - 6. Let o be s(5). Let n be o/(((-1)/17)/1). Calculate the greatest common factor of a and n. 17 Suppose 3d - 24 = -9. Suppose -dh = -7h + 30. Calculate the greatest common factor of 75 and h. 15 Let f = -3 + 3. Suppose -2a + 4 + 14 = f. Let g = 193 + -121. What is the highest common divisor of g and a? 9 Suppose 4f + 4 = 20. Let h be (0 + 1 - 0)0. Let m = f - h. What is the greatest common factor of 28 and m? 4 Let b = -10 - -18. Suppose 5i - 92 = -o, 24 = 2i + 2o - b. Let n(y) = 2y2 + 9y + 1. Let w be n(-6). Calculate the highest common factor of i and w. 19 Suppose 16 = 4g - 0g. Suppose gw + 2x - 4x = 74, 2w - 5x - 57 = 0. What is the greatest common factor of 16 and w? 16 Let h = 34 - 25. Suppose r = -2 + 11. What is the greatest common divisor of h and r? 9 Suppose -43 - 23 = -3x. Let w be 1/(-3) + (-2641)/(-3). Suppose -6j = -j - w. What is the highest common factor of j and x? 22 Let x be 368/12 + 6/(-9). Calculate the greatest common divisor of x and 12. 6 Let d(x) = -2x*2 + 14x + 8. Let q be d(7). What is the greatest common factor of 96 and q? 8 Let o(w) = w*3 + 3w + 1. Let s(d) = 3d3 + 9d + 2. Let x(q) = -11o(q) + 4s(q). Let k be x(2). What is the greatest common factor of k and 77? 11 Let i = 4 + -2. Let c(b) = -4b3 + 2b*2 - 2b - 2. Let h be c(i). Let	{ "pile_set_name": "DM Mathematics" }
l. Determine -3m(y) + 24o(y). 3y Let i(q) = 13q*3 - 5q*2 - 5q + 5. Let z(t) = -90t3 + 36t*2 + 36t - 36. Suppose 2o - 38 = -4r + 98, r + 4o = 20. Determine ri(s) + 5z(s). 18s3 Let c(t) = t2 + 3t. Let b(u) be the first derivative of 58 - 2/3u*3 + 0u - 4u2. What is -3b(y) - 8c(y)? -2y*2 Let n(r) = -6r + 4. Let x be n(1). Let l be (2-1)/x8/4. Let a(w) = w*2 - w - 9w*l - w + 4w*2 - 3. Let f(t) = -9t*2 - 5t - 7. Give 14a(y) - 6f(y). -2y2 + 2y Let s(t) = -20t + 81. Let x(l) = -13l + 54. What is 5s(v) - 8x(v)? 4v - 27 Let w(h) = 55h + 144. Let x(r) = -27r - 87. What is 3w(o) + 5x(o)? 30o - 3 Let o(b) = -516b + 12. Let s(l) = 259l - 7. What is 3o(n) + 5s(n)? -253n + 1 Let c(u) = -25u*3 + 6u*2 - 5u + 181. Let r(p) = -9p3 + 2p*2 - 2p + 61. What is -4c(a) + 11r(a)? a*3 - 2a*2 - 2a - 53 Let p(n) be the third derivative of 7n5/60 - n4/24 + n3/2 - 12n*2 - 17n. Let q(j) = -3j2 - 1. Calculate 2p(i) + 5q(i). -i2 - 2i + 1 Let h(q) = -818q2 - 14q + 9. Let l(d) = -545d2 - 9d + 6. What is 5h(t) - 8l(t)? 270t2 + 2t - 3 Let d(y) be the second derivative of -y*3/2 - 15y*2/2 + 1907y. Let g(x) = -10x - 46. Calculate 7d(a) - 2g(a). -a - 13 Let j(o) = -2o - 1. Let b(r) = -5r - 3. Suppose -43p - 34p = 78 + 153. Determine pb(m) + 8j(m). -m + 1 Let j(u) = 1617u + 43. Let s(f) = -2f - 6. Calculate -j(p) - 7s(p). -1603p - 1 Let z(j) = -1379j*2 - 22j - 3. Let t(b) = -691b2 - 12b - 2. What is 11t(o) - 6z(o)? 673o2 - 4 Let d(m) = 9m - 4. Let o(r) be the first derivative of 9r2/2 - 5r + 815. Give 7d(x) - 6o(x). 9x + 2 Let h(l) = -6l - 1. Let g(z) be the second derivative of 7z3/6 + z2/2 + 22z. Suppose -9f = -2f + 196. Let d = f + 24. Determine dg(o) - 5h(o). 2o + 1 Let d(v) = 24v3 + 42. Let n(m) = m3 + 1. Let c(w) = -118w + 5430. Let j be c(46). What is jd(g) - 84n(g)? -36g*3 Let b(t) = -12t*3 + 6t*2 - 6t + 6. Suppose 0 = 11q - 6q - 70. Suppose -29 = -15v - q. Let m(j) = -j3 + j2 - j + 1. Give vb(u) - 6m(u). -6u*3 Let g(r) = 7r*3 + 5r*2 + 15r + 10199. Let c(a) = -3a3 - 2a*2 - 6a - 5093. Give -5c(u) - 2g(u). u*3 + 5067 Let v(r) = -3r - 13. Let u(o) = -55. Let w(i) = 1. Let z(x) = -u(x) - 33w(x). Let a(q) = 18. Let m(y) = 6a(y) - 5z(y). Determine -14m(s) + 2v(s). -6s + 2 Let v(r) = 1516r2 + 5r + 5. Let y(w) = 1514w2 + 4w + 4. Calculate 5v(t) - 6y(t). -1504t2 + t + 1 Let z(g) = 278g - 61. Let t(q) = 137q - 32. Give 5t(u) - 3z(u). -149u + 23 Let q(l) = l. Let n(x) = 7x2 - 24x + 5. Let j(h) = 20h2 - 68h + 14. Let r(y) = -4j(y) + 11n(y). What is -6q(u) + r(u)? -3u*2 + 2u - 1 Let x(s) = -12s2 - 429s + 13. Let z(c) = -2c2 + 7c + 3. Determine x(i) - 4z(i). -4i*2 - 457i + 1 Let a(w) = 3w + 10. Let c be -112(-8)/32. Let k(u) = -6u - 20. Calculate ck(i) + 5a(i). -3i - 10 Let d(g) = 1942g + 1. Let r(x) = 2x - 1. Give -d(u) - 2r(u). -1946u + 1 Let f(m) = -18m - 721. Let t(s) = 28s + 1081. What is 8f(k) + 5t(k)? -4k - 363 Let u(j) be the third derivative of 0 + 1/60j5 + 0j*4 - 1/6j*3 + 25j*2 + 0j. Let w(c) = -6c2 + 3. Calculate -6u(i) - 2w(i). 6i*2 Let b(c) = 6493 - 12987 + 6493. Let z(f) = -2f*2 + 2f + 5. Suppose 0 = 4r + 4q - 4, -r + 5q + 1 = 4q. What is rz(a) + 4b(a)? -2a2 + 2a + 1 Let p be ((-20)/12 + 2)/((-14)/126). Let s(i) = -i. Let x(z) = -z + 2. Calculate ps(d) - x(d). 4d - 2 Let l(o) = 8o - 17. Let g be (-6 - (-506)/77) + (-92)/14. Let w(a) = 15a - 33. Determine gw(u) + 11l(u). -2u + 11 Let y(g) = g3 + 6g*2 - 22. Let o be y(-5). Let n(v) = ov*2 + 0v*2 + v - 4v*2 + 7 - 6. Let a(f) = -7f*2 + 5. Give a(c) - 5n(c). -2c2 - 5c Let h(a) = -1 - 5 - a + 1 - 1 + 4a. Let w(n) = -n. Determine h(t) + 2w(t). t - 6 Let y(r) = -3r3 + 17r*2 - 17. Let o be (-190)/57 + 296/(-111). Let h(x) = 4x*2 - 6 + 2x*2 + 0x3 - x3. Determine oy(i) + 17h(i). i3 Let u(c) = c2 + 2c - 9. Let q(g) be the first derivative of -2g*3/3 - 2g*2 + 18g - 4552. Give 6q(a) + 11u(a). -a*2 - 2a + 9 Let t(v) = 11v3 - 2v*2 + 5v - 5. Let g be 1(-20)/5 - 2. Let x = g - 2. Let y(n) = 8 - 6 - n + 6 + 3n*2 - 17n*3 - 7n. Calculate xt(j) - 5y(j). -3j3 + j2 Let u(g) = -16g*2 + 11g - 3768. Let q(p) = -45p2 + 31p - 11307. What is 6q(w) - 17u(w)? 2w2 - w - 3786 Let u(l) = -19l + 95. Let x(v) = 11v - 45. Calculate 6u(q) + 13x(q). 29q - 15 Let b(c) = 547c3 + 4c*2 - 2c + 18. Let t(o) = -208408o3 - 1526o*2 + 763o - 6867. Give -763b(z) - 2t(z). -545z3 Let k(m) = 3m*3 - 11m*2 - 4m + 7. Let i(n) = -n*3 + 5n*2 + 2n - 3. Suppose -7y + y - 30 = 0. Give yi(z) - 2k(z). -z3 - 3z*2 - 2z + 1 Let j(w) = 61w. Let v(u) be the second derivative of 5u*3/3 - 34u + 11. What is 6j(r) - 39v(r)? -24r Let i be (4/(-20)8)/(4/(-360)). Let r = i - 147. Let j(u) = -3u3 + 5u*2 + 4u - 3. Let c(t) = -t*2 - t + 1. Determine rc(m) - j(m). 3m3 - 2m*2 - m Let v(d) = 26 - 27 + 249d + 2d2 - 7d*2 - 251d. Let j(n) = 10n2 + 4n + 1. What is -3j(o) - 5v(o)? -5o2 - 2o + 2 Let w(r) = -2. Let g(a) = -a*2 - 1. Suppose -f + 1 = -19. Suppose 2z + 0i - 5i = 18, 0 = 4z - 2i - f. Let m be -3 + 3 + z/4. What is mw(u) - 2g(u)? 2u2 Let x(b) = b - 5. Let i = -608158 - -608153. Let a(g) = -2g + 9. Let c(p) = -p - 7. Let r be c(0). Let q = 4 + r. Determine ix(y) + qa(y). y - 2 Let q(b) be the third derivative of -b5/20 - b4/3 + 35b2 + 13. Let c(k) = 2k*2 + 9k. What is -4c(u) - 3q(u)? u*2 - 12u Let j(l) = 14l3 - 8l*2 + 11l + 17. Let s(g) = -3g2 - 22g + 8g + 0g*2 + 0g*2 + 18g + 6 + 5g3. Calculate -3j(q) + 8s(q). -2q*3 - q - 3 Let v(r) = -2r. Let j = 258 - 252. Let d(h) = 8h. Determine jv(l) + 2d(l). 4l Suppose 33g + 4 = 29g. Let q(y) = y - 1. Let o(p) = -15p + 4. Give go(v) - 4q(v). 11v Let k(w) = -40w + 35w + 78 + 53w + 54w. Let z(b) = -15b - 11. Let r(m) = 4k(m) + 27z(m). Let i(j) = -j - 4. Give 15i(s) + 4r(s). -3s Let i = 14066 - 14064. Let b(u) = 9 + 0 + 2u + 0u. Let o(s) = s + 4. Give ib(x) - 5o(x). -x - 2 Suppose -155h - 183h + 188h - 450 = 0. Let d(p) = -51. Let b(j) = j + 50. Determine hd(a) - 2b(a). -2a + 53 Let z(l) be the second derivative of -5l4/12 - l3/2 - 1307l. Let o(i) = -i*2 + 1. Determine -2o(m) + z(m). -3m2 - 3m - 2 Let d(u) = 30u3 + 4u*2 - 4u - 4. Let f(g) = g*2 + 20g + 60. Let x be f(-4). Let i(j) = 29j3 + 3j*2 - 3j - 3. Calculate xi(m) + 3d(m). -26m3 Let c(r) = 5r*3 + 14r*2 - 7r - 988. Let j(l) = -l*3 - 4l*2 + 2l + 330. Calculate 2c(z) + 7j(z). 3z3 + 334 Suppose -4u - 254 + 234 = 0. Let d(r) = -2r + 8. Let k(j) = 11j - 13. Let i(g) = -7g + 9. Let s(o) = 8i(o) + 5k(o). Determine ud(l) + 6s(l). 4l + 2 Let z(l) = -23l3 - 29l*2 - 5l - 2. Let x(i) = i*3 - 15i*2 + i - 1. What is -2x(n) + z(n)? -25n3 + n2 - 7n Let p(s) = -5s3 + s - 5. Let g(w) = 11w*3 + 3w*2 - 4w + 18. Let r(t) = g(t) + 3p(t). Let d(u) = 8u*3 - 6u*2 + 2u - 7. What is 2d(x) + 5r(x)? -4x3 + 3x*2 - x + 1 Let j(g) = -35g - 76. Let t(a) = -4a + 1. What is -2j(f) + 18t(f)? -2f + 170 Suppose 7g + 34g = -41. Let m(r) = r + 1. Let w(z) = 21z + 2. Give gw(q) + 4m(q). -17q + 2 Let y(s) = -74s2 - 5s + 5. Let b(i) = 209i + 3293i*2 - 36i + 49i - 222. What is -5b(t) - 222y(t)? -37t*2 Let o(q) = 3q*2 - 186q + 71. Let m(x) = -x*2 - x - 9. Calculate 8m(s) + o(s). -5s2 - 194s - 1 Let i(t) = 6t + 564. Let h(v) = v + 94. What is 39h(g) - 6i(g)? 3g + 282 Let b(m) = -m3 - m2 + 4m + 2. Let z = -26745 + 26744. Let q(t) = t + 1. Give zb(u) + 4q(u). u3 + u2 + 2 Let g(u) = -32u*3 - 4u + 1. Let f(h) = h*2 + h + 1. Determine 2f(y) + g(y). -32y3 + 2y*2 - 2y + 3 Let i(g) = 3g - 1. Let k(d) = -604d + 6. Determine -6i(c) - k(c). 586c Let t(g) = 47 + 109 - 17g - 150. Let i(o) = -34o + 11. What is 4i(f) - 7t(f)? -17f + 2 Suppose -4k + o - 14 = 0, -5k - 3o - 4 + 12 = 0. Let a(y) = 3y2 + 2y - 2. Let f(t) = -16t2 - 10t + 10. Determine kf(l) - 11a(l).	{ "pile_set_name": "DM Mathematics" }
is the z'th term of -1, 8, 17? 9z - 10 What is the x'th term of 15, 40, 65, 90, 115? 25x - 10 What is the n'th term of -41, -67, -111, -173, -253, -351, -467? -9n2 + n - 33 What is the j'th term of 33, 29, 23, 15? -j2 - j + 35 What is the a'th term of 33, 43, 51, 57, 61, 63, 63? -a2 + 13a + 21 What is the f'th term of 189, 190, 191, 192, 193, 194? f + 188 What is the r'th term of 14, 36, 80, 152, 258, 404, 596? r*3 + 5r2 + 8 What is the d'th term of -64, -126, -192, -268, -360, -474? -d3 + 4d2 - 67d What is the c'th term of -8, -5, 20, 79, 184, 347, 580, 895? 2c3 - c2 - 8c - 1 What is the r'th term of 2631, 2634, 2639, 2646, 2655, 2666? r*2 + 2630 What is the o'th term of -2061, -4120, -6179, -8238, -10297, -12356? -2059o - 2 What is the a'th term of 4818, 4823, 4830, 4839, 4850? a*2 + 2a + 4815 What is the h'th term of -82, -85, -88, -91, -94, -97? -3h - 79 What is the t'th term of 525, 1057, 1591, 2127, 2665, 3205, 3747? t2 + 529t - 5 What is the a'th term of 1, 0, -1, -2? -a + 2 What is the q'th term of 28, 77, 140, 223, 332? q3 + q2 + 39q - 13 What is the j'th term of -2288, -2288, -2290, -2294? -j2 + 3j - 2290 What is the r'th term of 2626, 2593, 2562, 2533, 2506? r*2 - 36r + 2661 What is the r'th term of 422, 390, 358? -32r + 454 What is the c'th term of -27, -37, -59, -99, -163, -257, -387, -559? -c3 - 3c - 23 What is the t'th term of 1, -8, -45, -128, -275, -504, -833, -1280? -3t3 + 4t2 What is the c'th term of 4, 13, 14, 1, -32, -91, -182? -c3 + 2c2 + 10c - 7 What is the q'th term of 27, 50, 97, 174, 287, 442, 645? q*3 + 6q*2 - 2q + 22 What is the z'th term of -59, -48, -17, 40, 129? z*3 + 4z*2 - 8z - 56 What is the m'th term of -606, -1218, -1832, -2448, -3066? -m*2 - 609m + 4 What is the m'th term of 7, 32, 57, 82? 25m - 18 What is the c'th term of 0, -35, -108, -231, -416, -675? -2c*3 - 7c*2 + 9 What is the w'th term of 9, 21, 61, 147, 297, 529? 3w*3 - 4w*2 + 3w + 7 What is the w'th term of 25, 43, 87, 169, 301, 495? 2w3 + w2 + w + 21 What is the o'th term of -16, -69, -166, -313, -516, -781? -o3 - 16o*2 + 2o - 1 What is the v'th term of 20, 74, 164, 290, 452, 650? 18v2 + 2 What is the v'th term of -289, -282, -275, -268, -261, -254? 7v - 296 What is the z'th term of -65, -70, -83, -104, -133, -170, -215? -4z2 + 7z - 68 What is the s'th term of 20, 43, 74, 113? 4s2 + 11s + 5 What is the s'th term of -9201, -18401, -27601, -36801, -46001? -9200s - 1 What is the u'th term of -13, -50, -157, -370, -725, -1258, -2005? -6u3 + u2 + 2u - 10 What is the v'th term of 172, 675, 1512, 2683? 167v*2 + 2v + 3 What is the w'th term of 53, 90, 117, 128, 117? -w3 + w2 + 41w + 12 What is the m'th term of -262, -256, -250, -244? 6m - 268 What is the h'th term of 337, 330, 323, 316, 309, 302? -7h + 344 What is the h'th term of 2, -1, 4, 23, 62? h3 - 2h*2 - 4h + 7 What is the c'th term of -11, -4, 3? 7c - 18 What is the x'th term of 1, -17, -61, -143, -275, -469? -2x3 - x2 - x + 5 What is the m'th term of -2963, -5929, -8895, -11861? -2966m + 3 What is the y'th term of -259, -551, -877, -1237, -1631, -2059, -2521? -17y*2 - 241y - 1 What is the a'th term of 0, -6, -32, -90, -192? -2a3 + 2a*2 + 2a - 2 What is the b'th term of 2832, 2845, 2872, 2919, 2992? b3 + b2 + 3b + 2827 What is the g'th term of -4, -34, -92, -184, -316, -494, -724? -g3 - 8g*2 + g + 4 What is the d'th term of 33780, 33779, 33778, 33777? -d + 33781 What is the c'th term of -144, -138, -132, -126, -120? 6c - 150 What is the k'th term of -18, -62, -134, -234? -14k2 - 2k - 2 What is the u'th term of 12, 5, 0, -3, -4? u*2 - 10u + 21 What is the u'th term of -10, -33, -72, -127, -198? -8u2 + u - 3 What is the r'th term of -10, -25, -54, -103, -178, -285? -r3 - r2 - 5r - 3 What is the g'th term of 2132, 2133, 2132, 2129? -g*2 + 4g + 2129 What is the t'th term of -1027, -1024, -1019, -1012, -1003, -992? t*2 - 1028 What is the p'th term of 483, 510, 555, 618, 699, 798, 915? 9p2 + 474 What is the d'th term of -83, -174, -267, -362, -459, -558? -d2 - 88d + 6 What is the p'th term of -47, -35, -13, 25, 85? p3 - p2 + 8p - 55 What is the o'th term of -31, -35, -45, -61? -3o2 + 5o - 33 What is the a'th term of 359, 358, 357, 356? -a + 360 What is the i'th term of 107, 106, 105, 104, 103, 102? -i + 108 What is the s'th term of -27, -52, -77, -102? -25s - 2 What is the q'th term of 12, 70, 168, 306, 484, 702? 20q*2 - 2q - 6 What is the l'th term of -71, -144, -223, -314, -423, -556, -719, -918? -l*3 + 3l*2 - 75l + 2 What is the j'th term of -25, -47, -97, -187, -329, -535, -817, -1187? -2j3 - 2j*2 - 2j - 19 What is the o'th term of 382, 396, 412, 430? o*2 + 11o + 370 What is the r'th term of 5, 6, 3, -4, -15, -30? -2r2 + 7r What is the k'th term of 16, 5, -14, -41? -4k2 + k + 19 What is the d'th term of 426, 417, 396, 357, 294, 201, 72? -d3 - 2d + 429 What is the z'th term of -130, -503, -1124, -1993, -3110, -4475? -124z2 - z - 5 What is the j'th term of 28, 36, 42, 46, 48, 48? -j2 + 11j + 18 What is the b'th term of -47, -95, -153, -227, -323, -447, -605? -b3 + b2 - 44b - 3 What is the z'th term of -1006, -2025, -3044, -4063, -5082? -1019z + 13 What is the o'th term of 347, 338, 315, 272, 203? -o3 - o2 + o + 348 What is the w'th term of -1557, -1554, -1549, -1542, -1533, -1522, -1509? w*2 - 1558 What is the y'th term of -4093, -4091, -4089? 2y - 4095 What is the c'th term of -138, -547, -1230, -2193, -3442, -4983, -6822, -8965? -c*3 - 131c*2 - 9c + 3 What is the t'th term of 125, 254, 385, 518, 653, 790, 929? t*2 + 126t - 2 What is the z'th term of 20, 40, 60, 80, 100, 120? 20z What is the a'th term of 1739, 1735, 1729, 1721, 1711, 1699, 1685? -a2 - a + 1741 What is the q'th term of 6, -14, -72, -186, -374, -654? -3q3 - q2 + 4q + 6 What is the n'th term of -15, -33, -77, -159, -291, -485, -753, -1107? -2n3 - n2 - n - 11 What is the u'th term of -457, -460, -463, -466, -469, -472? -3u - 454 What is the y'th term of 628, 576, 522, 466, 408? -y2 - 49y + 678 What is the r'th term of -72, -155, -236, -315, -392? r*2 - 86r + 13 What is the j'th term of 166, 334, 480, 598, 682, 726, 724? -j*3 - 5j*2 + 190j - 18 What is the m'th term of 6, -7, -34, -81, -154, -259, -402? -m3 - m2 - 3m + 11 What is the x'th term of 59, 118, 177? 59x What is the a'th term of 71, 294, 867, 1964, 3759, 6426, 10139? 29a3 + a2 + 17a + 24 What is the c'th term of 8137, 8138, 8139? c + 8136 What is the v'th term of -39, -12, 17, 48, 81, 116, 153? v*2 + 24v - 64 What is the n'th term of 33, 47, 83, 153, 269? 2n3 - n2 + 3n + 29 What is the d'th term of -35, -117, -259, -467, -747, -1105? -d*3 - 24d*2 - 3d - 7 What is the d'th term of -3172, -3173, -3174? -d - 3171 What is the l'th term of 4, 40, 138, 328, 640, 1104? 5l3 + l2 - 2l What is the k'th term of -46, -162, -350, -604, -918? k*3 - 42k*2 + 3k - 8 What is the z'th term of -136, -275, -418, -565, -716, -871, -1030? -2z2 - 133z - 1 What is the u'th term of 157, 219, 283, 349, 417, 487, 559? u*2 + 59u + 97 What is the t'th term of -16, -34, -52, -70? -18t + 2 What is the s'th term of -5, -16, -39, -80, -145? -s3 - 4s What is the j'th term of 19, 19, 11, -11, -53? -j*3 + 2j*2 + j + 17 What is the i'th term of -18, 28, 144, 366, 730? 6i3 - i2 + 7i - 30 What is the t'th term of 4, 16, 28? 12t - 8 What is the m'th term of -285, -281, -273, -261, -245? 2m2 - 2m - 285 What is the o'th term of 37, 90, 237, 526, 1005? 8o3 - o2 + 30 What is the a'th term of -11, -41, -91, -161, -251, -361? -10a2 - 1 What is the x'th term of -556, -559, -564, -571, -580? -x2 - 555 What is the c'th term of 653, 655, 657? 2c + 651 What is the i'th term of -673, -672, -671, -670? i - 674 What is the r'th term of -80, -156, -232, -308, -384? -76r - 4 What is the s'th term of 23, 31, 35, 35, 31, 23, 11? -2s2 + 14s + 11 What is the p'th term of 13, 85, 277, 649, 1261, 2173, 3445, 5137? 10p3 + 2p + 1 What is the d'th term of -41, -168, -377, -662, -1017, -1436? d*3 - 47d*2 + 7	{ "pile_set_name": "DM Mathematics" }
0 - 1/8c4 - 1/6c*3 - 5cv. What is y(-3)? 8 Let h(o) = o2 + 7o + 7o2 + o2 + o*2 - 9o*2. What is h(-8)? 8 Suppose 27d = 19d. Let w(l) = -7l - 6 + 10l - 2l + dl. Let q be (3/2 - 1)0. Calculate w(q). -6 Suppose 164 = 2m - 5c, 281 - 1 = 3m + c. Let x(j) = -mj*2 + 2j3 - j3 - 1 + 88j2 - 2j. What is x(4)? -9 Let c(q) = 14q2 - 2q - 1. Let t be c(-1). Suppose -4p - 5n + t = -28, -5p + n = -32. Let j(z) = -z2 + z - z3 + 0z*3 + 2z*3 + p. Determine j(0). 7 Suppose p - 7 = -2. Suppose 3s + s + 32 = -2z, -3s + 2 = -pz. Let c(j) = -5j*3 + 4j*3 - 2j + 6j - 5j*2 - 2. Give c(s). 10 Let y be (-3)/((-4)/678/52). Let p(i) be the third derivative of -1/6iy - 1/24i*4 + 0 + 0i - 3i2. Give p(-5). 4 Suppose 2k + 6k - 11k = 0. Let q(z) = -z3 + z2 + 2. What is q(k)? 2 Let s(r) be the third derivative of 1/120r6 + 1/8r*4 + 0 + 1/3r*3 - 1/15r*5 + 0r + 6r2. What is s(3)? 2 Suppose -2k + g + 5 = 0, -3k + 7 + 3 = -2g. Let s(j) = j*2 + j - 11. Determine s(k). -11 Let w(x) be the first derivative of 5x*2/2 + 16x - 168. Determine w(-4). -4 Let o(k) = k*2 + 9k + 10. Let f be 6/(-18) - (-77)/(-21). What is o(f)? -10 Let i = 8 - 2. Let a(c) be the first derivative of 23 - 1/4c4 + 2c*3 + 8c - c*2. Determine a(i). -4 Let n(a) = -3a - 12. Let u(v) = -2v - 6. Let x(y) = 3n(y) - 5u(y). Let d(i) = i2 + 40i + 83. Let r be d(-38). Determine x(r). 1 Let y be 1 + (2 - (4 - 1)). Let f = y - -3. Let a(q) = 8q2 - 5q + 7. Let t(c) = 7c2 - 5c + 6. Let u(d) = -4a(d) + 5t(d). What is u(f)? 14 Let i(n) = -n*2 + 8n - 1. Suppose -4r - 5u = 1, 4u + 26 = 16r - 15r. Calculate i(r). 11 Let b(t) = -3t + 55. Let m be b(19). Let g(z) = 6z + 2. Give g(m). -10 Let a(m) = 2m - 2 + 2 - 4. Let f be a(3). Let v(q) be the second derivative of -2q3/3 - q2 - 6q - 3. What is v(f)? -10 Let g(o) = -2o2 - 27o - 68. Let t be g(-10). Let r(b) = 6b + 1. Give r(t). 13 Let b(h) = -h3 - h - 1. Let p(y) = -y3 - 8y*2 - 14y + 4. Let u be p(-5). Calculate b(u). 1 Let f(r) be the first derivative of r*4/4 + 10r - 5. Let p be f(0). Suppose 0 = 4z + z - p. Let h(n) = -n3 + 3n*2 - 2. Determine h(z). 2 Let t(q) be the first derivative of 3q*2/2 - 3q + 14. Calculate t(5). 12 Let o(t) be the second derivative of t4/12 + t3/3 - 2t2 + 4t. Let d = 262 - 265. Determine o(d). -1 Let f be (-27)/(-5) - (-3)/5. Let t be f - (-1)/40. Suppose 5z = -t - 14. Let o(v) = v*3 + 4v*2 + v + 1. Calculate o(z). -3 Let c be (-6)/(-20) - (-603)/90. Suppose 2j + 2 - 6 = 0. Let z(x) = -x*j + cx - 24x + 11x + 2. Give z(-5). 7 Let n(o) be the third derivative of -o*4/24 + 7o*3/3 - 10o*2. Let c be n(13). Suppose 4b + 9 = c. Let i(j) = j2 + j + 1. What is i(b)? 3 Let x = -242 + 414. Let p(c) = c2 - 8c + 83 - x + 91. Give p(8). 2 Let a(b) be the third derivative of -b4/4 + 11b*3/6 - 255b*2. What is a(8)? -37 Let l(g) = 41g*2 - 4g + 3. Let o be l(1). Let b = o + -39. Let w(k) = 2k2 + 1. Determine w(b). 3 Let o(a) = 2a - 4. Let i be -22(-10)/8. Suppose -40 = -4m - 3j, -2j = -3m - 7j + 41. Suppose -mr + ir = -6. Determine o(r). 2 Let o(m) = -3m + 1. Suppose 3 = 3a + 4i, a + 4a - 5i - 5 = 0. Determine o(a). -2 Suppose g - 3z - z + 11 = 0, -4g - 2z = -10. Let k(o) = 15o3 + o2 - o + 1. Determine k(g). 16 Let d(c) = -4c2 + 15c + 5. Let f(n) = -n*2 + 4n + 1. Let z(m) = -2d(m) + 9f(m). Give z(7). -8 Let q(c) be the third derivative of -c*6/120 + 7c5/60 - c4/3 + c*3/2 - 60c2 + 1. Give q(6). -9 Let u(k) be the third derivative of -k4/6 + 4k3/3 + 247k*2. What is u(3)? -4 Let v(p) = -p - 11. Let x be (-4)/(-2)(-3)/(-12)2. Let b be 6/(-5 - x)0. Calculate v(b). -11 Let u be (-74)/5 + (-7)/35. Let l be 76/95u/(-2). Let p(m) = -m3 + 5m*2 + 6m - 9. Determine p(l). -9 Let p(v) be the first derivative of v*4/24 - 53v2/2 - 48. Let f(b) be the second derivative of p(b). Calculate f(-3). -3 Let q(b) be the second derivative of -b3/3 + 9b. Let o = 36 - 24. Suppose -5a + 3 = -2j, 2j = 5j + o. Give q(a). 2 Let l(h) = 10h - 48. Let y(j) = -7j + 33. Let f(p) = 5l(p) + 7y(p). What is f(4)? -5 Let i(x) = x - 2. Let z(m) = -5m - 1. Let j(h) = 3i(h) + z(h). Calculate j(-4). 1 Let w = -64 - -72. Let s be ((-4)/w)/(3/6). Let a(f) = -19f*2 - 1. Calculate a(s). -20 Suppose -4c - 44 = -5u + u, -c - 23 = -3u. Suppose -5k - 1 = -u. Let x(h) be the second derivative of 3h3/2 - h2/2 + 3h. What is x(k)? 8 Let w(y) = -y3 - 5y*2 - 4y - 6. Let x be (-3)/9-872/(-48). What is w(x)? -6 Let p(c) = c*3 - 9c*2 - 11c + 13. Let a be p(10). Let m(x) = 0 - x*2 + 1 - a - 4x + x. Determine m(-2). 0 Let f(d) = 7d2 + 3d + 1. Let u(a) = 13a2 + 7a + 3. Let i(t) = 11f(t) - 6u(t). Let r = 1000 - 1007. Give i(r). 7 Let k(f) be the first derivative of -8f2 - 16. Suppose 0 = -3l - 2o + 3, 4l - 5o = -10 - 9. Give k(l). 16 Let c(j) = -6j + 4. Let q(d) = -9d + 6. Let l(v) = 8c(v) - 5q(v). Let r be l(-1). Let k(y) = -y + 4. What is k(r)? -1 Let a(n) = n3 + n2 + 4n. Let y(d) = 4d3 + 10d*2 + 20d + 7. Let r(c) = -5a(c) + y(c). Determine r(6). -29 Let j(r) = -r + 2. Let i(n) = -44n + 22. Let t(d) = i(d) - 33j(d). Calculate t(-4). 0 Let r(l) = l - 4. Let s = -123 + 132. Let q(v) = -v3 + 9v + v + 5 - 2v + 8v*2. Let i be q(s). What is r(i)? -8 Suppose -102h = -85h - 374. Let p(u) = -u2 + 21u + 31. Determine p(h). 9 Let m(x) = -6x3 - 3x + 0x2 + 2x + x*2. Suppose 30t = 29t - 49. Let g = t + 50. Determine m(g). -6 Let d(l) = -4 + 4l - 5 - 8l + 6l. What is d(7)? 5 Let h(a) be the second derivative of a4/24 + a3/6 + 2a2 - 6a. Let v(i) be the first derivative of h(i). Calculate v(-2). -1 Let f(s) = -2s - 6. Suppose 2h - 2x - 30 = 0, -2x = 5h - 5x - 79. Let c = -23 + h. Give f(c). 6 Let b(i) = i*3 + 5i*2 - 8i - 7. Let o be b(-6). Let x = 1 - -5. Let d(h) = h*3 - 7 - xh*2 - h + 7h - 3h + 4h. Determine d(o). 3 Let j(i) be the first derivative of i4/4 - i3/3 + 2i + 4. Let a(c) = -6 + 5c - c - 4. Let x be a(3). Calculate j(x). 6 Let q(k) = k - 2. Let i be q(-2). Let t(h) be the second derivative of h*5/20 + 5h4/12 + h3/2 + 2h2 - 1535h. Determine t(i). 8 Let u(w) = 0w3 + 3w - w + 2w3 - w3 - 1 - 2w*2. Let t be u(2). Let s(g) = 3g + 1. Determine s(t). 10 Let g(c) be the first derivative of 0c3 - 3 - 5c - 1/4c4 - 1/2c2. Calculate g(0). -5 Let d(i) = i3 - i. Let h(k) = -42k + 15. Let v be h(2). Let n = v + 71. What is d(n)? 6 Let r be -2 + (3 - (4 + -5)). Let f(o) = 2o2 - o2 - 2 - 3or. What is f(2)? -10 Suppose -7x + 7 + 161 = 0. Let p = x - 28. Let u(d) = 3d2 - 6d. Let o(m) = -8m2 + 17m. Let v(z) = 4o(z) + 11u(z). What is v(p)? 8 Suppose 3z - 6 = 0, 5n = -z + 731 - 34. Let x = 134 - n. Let j(q) = -q*3 - 5q*2 + 1. Determine j(x). 1 Let k(l) = 24l - 15. Let z(q) = 13q - 8. Let u(i) = 5k(i) - 9z(i). What is u(10)? 27 Let r = 14 - -15. Let o = r - 37. Let u(h) = -h3 - 8h*2 - h - 11. Give u(o). -3 Let t(y) be the third derivative of 2y4/3 - y3/3 + 9y2 + 8. Determine t(-2). -34 Let z be (2/(-10))/(12/60). Let u be -1z/5 - 180/25. Let j(m) = -m*2 - 9m - 3. What is j(u)? 11 Suppose 4z = 5k - 204, 2z + 102 = -0k + 3k. Let p = 45 + z. Let c(j) = j2 + 6j - 1. What is c(p)? -1 Let d(y) be the first derivative of -y5/40 + y4/24 - 11y3 + 14. Let n(z) be the third derivative of d(z). Calculate n(3). -8 Suppose -2d = 3l - 13, 0 = 5d + 4l - 16 - 6. Let u be (-3)/d - 6/12. Let x(t) = -2t*3 - 3t*2 - 3t - 3. What is x(u)? 7 Let h(g) = -10g + 84. Let z be h(9). Let y(k) = -3k*2 - 15k - 6. Calculate y(z). -24 Suppose -4x + 13 = -11. Let y(a) be the first derivative of -a2/2 + a + 5. Calculate y(x). -5 Suppose -v = -0v - 6. Let x = -6 + v. Suppose x = 2h + 3d - 17, 3 = -h + 2d + 1. Let z(g) = g3 - 4g*2 + 2g. What is z(h)? 8 Let w(g) = g*2 + 4. Let j be (-215)/(-55) + (-10)/(-110). Calculate w(j). 20 Let s(w) = 4w3 + w2 - 1. Let m be s(1). Let p(a) be the first derivative of -1/2a2 - 1 - 5a. Give p(m). -9 Let q(f) = -17f + f2 - 6 - 11f + 13*f. Determine	{ "pile_set_name": "DM Mathematics" }
se 5, what is 12040 - -1321100? 1333140 In base 15, what is -8db78e + 8? -8db786 In base 6, what is -10 - 25445152342? -25445152352 In base 14, what is -2064 - 614? -2678 In base 8, what is -761550 + 3146? -756402 In base 7, what is -2542160520 - 5? -2542160525 In base 8, what is 3617 + -25356? -21537 In base 13, what is -32b9 + 5c0? -29c9 In base 11, what is 5054 + -28? 5027 In base 13, what is 889ca9 + -9? 889ca0 In base 13, what is 0 - -1056780? 1056780 In base 4, what is -2123311233 - -33130? -2123212103 In base 5, what is 143 + -231242221? -231242023 In base 2, what is 111110000110 + 110010011001011? 111010001010001 In base 15, what is -1a37c3d + 5? -1a37c38 In base 15, what is -1e + 52620? 52601 In base 2, what is 101 + -100011000100010100001001? -100011000100010100000100 In base 5, what is 1332241413 + 1? 1332241414 In base 5, what is -3313 - 103442042? -104000410 In base 5, what is -33220 - 130242? -214012 In base 14, what is d59b902 + 0? d59b902 In base 8, what is -143 + -147311? -147454 In base 2, what is -1010010101111100 - 1101000001? -1010100010111101 In base 11, what is 144281 - a5? 144187 In base 16, what is -1 + -1012d6e6? -1012d6e7 In base 10, what is -1876 - 13805? -15681 In base 2, what is -1 + 1110110110101101011101110? 1110110110101101011101101 In base 6, what is -113 + -1503140243? -1503140400 In base 16, what is 348daf1 - -5? 348daf6 In base 14, what is 2 - ca1196? -ca1194 In base 11, what is -393 + -213a6? -21789 In base 4, what is -310230 + 1210233? 300003 In base 4, what is 3111311332 - -2003? 3111320001 In base 14, what is 8 + 2cddd5? 2cdddd In base 10, what is 3 + -1570044? -1570041 In base 10, what is -1884864 - 1? -1884865 In base 10, what is 692 - -8186? 8878 In base 8, what is -21320 - -20055? -1243 In base 5, what is 1230 - 413410? -412130 In base 4, what is -10201 + 3101303? 3031102 In base 7, what is 36215 - -2321? 41536 In base 5, what is -122 + -1240324144? -1240324321 In base 12, what is -52 - 311581? -311613 In base 9, what is -1 - 4651314? -4651315 In base 4, what is -103 + -230331022? -230331131 In base 6, what is 2 - -2143453441? 2143453443 In base 12, what is 5 + -20aa696? -20aa691 In base 13, what is 43 + -10087a? -100837 In base 13, what is 9075 + 92? 9137 In base 6, what is -150005 - -524? -145041 In base 13, what is -1060 - 89? -1119 In base 12, what is -2a9bb + -2023? -30a22 In base 12, what is 1412324 + 6? 141232a In base 10, what is 403 - -247491? 247894 In base 15, what is -23 - -7d25b? 7d238 In base 15, what is 1dee - 1934? 4ba In base 15, what is -a2ae40 - -3? -a2ae3c In base 2, what is 10011101000001010010001 + -1101? 10011101000001010000100 In base 15, what is 29e - -8656c? 8681b In base 5, what is 4343030020 - -1? 4343030021 In base 9, what is 274711 + -1747? 272853 In base 10, what is 613 + -30557? -29944 In base 7, what is 5 + -434224? -434216 In base 16, what is c5727 - -b8? c57df In base 9, what is 3 + -6617468? -6617465 In base 6, what is 51153054 - 20? 51153034 In base 8, what is 2 - -234420677? 234420701 In base 6, what is -2 + 101421114? 101421112 In base 5, what is -323001300 + -1134? -323002434 In base 16, what is 123 + 5d70? 5e93 In base 11, what is 3450 + -976? 2585 In base 15, what is -bb + ae07b? adeb0 In base 14, what is -76298 - a5? -7635d In base 12, what is -39b313 + 43b? -39aa94 In base 2, what is 1011010100000 - 1001011000001010? -111111101101010 In base 15, what is c72e0c + 2? c72e0e In base 4, what is -1 + -1020123013201? -1020123013202 In base 16, what is 2200 + -727c? -507c In base 9, what is 868 - 60614? -58635 In base 3, what is 11222010 + 11010? 12010020 In base 5, what is -233230204 + 1021? -233224133 In base 6, what is 2 + 1311153? 1311155 In base 11, what is -1 + -11519657? -11519658 In base 6, what is 11021533105 + 0? 11021533105 In base 15, what is -1e - -33ac31? 33ac12 In base 15, what is 3a89a5 + -163? 3a8842 In base 13, what is a03c26 + 2? a03c28 In base 6, what is -2533054 + -1543? -2535041 In base 15, what is 11a - 64cd6? -64bbb In base 8, what is 5 + -124532403? -124532376 In base 12, what is 2 - 113392? -113390 In base 16, what is -31e9 + -177f? -4968 In base 11, what is 153956384 + -5? 15395637a In base 15, what is -6 + -15dd558? -15dd55e In base 3, what is -20 - 202120111121221? -202120111122011 In base 13, what is 4864264 - 3? 4864261 In base 6, what is -1002324 - -400? -1001524 In base 5, what is -1240 + 13000344? 12444104 In base 11, what is 39 - 2692368? -269232a In base 12, what is 3 - -277211? 277214 In base 16, what is 1b1b3c6 - 0? 1b1b3c6 In base 14, what is 2c72d7 - 216? 2c70c1 In base 10, what is -6058493 - -38? -6058455 In base 13, what is -334b6 - 1507? -349c0 In base 14, what is 1733b + 42d? 1776a In base 13, what is -5c92379 + -4? -5c92380 In base 10, what is -6 - -2284148? 2284142 In base 12, what is -943a + 386? -9074 In base 5, what is 1443003111 + -444? 1443002112 In base 12, what is 19 + -49ab531? -49ab514 In base 10, what is -103 - -9810973? 9810870 In base 9, what is -8 - -131466? 131457 In base 10, what is -23 + 10488393? 10488370 In base 9, what is 203343 - -2538? 205882 In base 4, what is 3013312301230 + 121? 3013312302011 In base 10, what is 4698 + -3726? 972 In base 4, what is 22223022 + 233? 22223321 In base 12, what is 50 + 2a0742? 2a0792 In base 15, what is -1280 + 4559? 32c9 In base 16, what is -4 - 5613d0a? -5613d0e In base 8, what is -2641 - 172757? -175620 In base 16, what is 7d9c - -57? 7df3 In base 2, what is -1111 + 11101100000110000? 11101100000100001 In base 6, what is 3 + -152235441? -152235434 In base 7, what is -1502424320 - 3? -1502424323 In base 16, what is 1caf7 - -3e? 1cb35 In base 5, what is 3 + -312332401? -312332343 In base 7, what is 4664133615 + 2? 4664133620 In base 13, what is -9bc - b00? -17bc In base 9, what is 42 + 161645? 161687 In base 15, what is -2b9 - 176? -440 In base 8, what is 333214 - -257? 333473 In base 3, what is -111210201211 - 21? -111210202002 In base 5, what is 213441233 + -10? 213441223 In base 10, what is 7118 + -9611? -2493 In base 5, what is 0 + 10114030213? 10114030213 In base 6, what is -1 + -1105133345? -1105133350 In base 4, what is 10 - -2122131300012? 2122131300022 In base 7, what is -1 - 1043412355? -1043412356 In base 14, what is 19 + 1767337? 1767352 In base 6, what is 2 + -1242200114? -1242200112 In base 11, what is 1534 - -3949? 5382 In base 9, what is 887236 - -2? 887238 In base 7, what is 6654626 + -5? 6654621 In base 8, what is 5 - 117034314? -117034307 In base 16, what is 1f1e0 + -10? 1f1d0 In base 13, what is -27076b9 - -13? -27076a6 In base 10, what is -36501661 - -1? -36501660 In base 11, what is -4 + -28a2310? -28a2314 In base 11, what is -245575 + -694? -246159 In base 6, what is 3051532 - -1103? 3053035 In base 3, what is 11012222011001120 - -1? 11012222011001121 In base 9, what is 12333 - -342? 12675 In base 13, what is -3 + 6ab5cb? 6ab5c8 In base 10, what is -3054080 + 14? -3054066 In base 15, what is a - 1259e? -12594 In base 2, what is 1101110 + -100000111101100111110? -100000111101011010000 In base 3, what is -201 + 112220122212? 112220122011 In base 15, what is -2 - -7c418? 7c416 In base 4, what is 131332213231 - -2? 131332213233 In base 7, what is 3 + 262215313? 262215316 In base 5, what is 20143 - 320422? -300224 In base 7, what is -111662165 + -5? -111662203 In base 12, what is -423951 - -27? -423926 In base 6, what is 1 + 24555410305? 24555410310 In base 10, what is 8866 - -140419? 149285 In base 2, what is 1011010000111000101 - -100001? 1011010000111100110 In base 7, what is -3454 - -1001515? 665031 In base 2, what is -101100001010000 - 111011100011? -110011100110011 In base 8, what is 3 - 7665602? -7665577 In base 11, what is -12 + -45983a? -459851 In base 12, what is -2534b6 + 61? -253455 In base 8, what is 4 + 5677433? 5677437 In base 13, what is -7540732 + 1? -7540731 In base 7, what is -2 - 33153213? -33153215 In base 5, what is -3 + 3202023243? 3202023240 In base 12, what is -992594 - -5? -99258b In base 6, what is 151335 + -215? 151120 In base 11, what is -45 + 99797? 99752 In base 13, what is -b112942 - -5? -b11293a In base 9, what is -284 + -8536363? -8536657 In base 10, what is 25601 + 1051? 26652 In base 4, what is -3022012221	{ "pile_set_name": "DM Mathematics" }
j) = -19j3 - 26j*2 - 5j + 46. Let d(n) = -7i(n) + 2k(n). Find the second derivative of d(s) wrt s. 24s + 8 Let x(c) be the first derivative of c6/3 - 23c*4/12 - 35c + 34. Let f(p) be the first derivative of x(p). What is the third derivative of f(s) wrt s? 240s Let s(j) = -15j*3 + 5j + 9. Let t(r) = 7r3 - 2r - 5. Let x = 75 + -73. Let q(k) = xs(k) + 5t(k). Differentiate q(f) with respect to f. 15f2 Differentiate 4t*2 - 4t*2 - 3t + 4t2 + 187 - 3t*2 + 76t with respect to t. 2t + 73 What is the third derivative of 9l - 5 - 22l2 - 59l*4 - 7l + 5 wrt l? -1416l Let g = 25 - 19. Let u(v) = v3 + 7v*2 + 5v + 1. Let x be u(-6). What is the third derivative of s*6 - 2s*2 + gs + s - xs wrt s? 120s*3 What is the second derivative of 12 + q - 30 + 3q*3 - 187 + 55q*2 - 12 wrt q? 18q + 110 Let k(d) = 4d2 + 7d + 8. Let h be k(-2). What is the second derivative of 9c + 8c + hc2 - 24c*2 wrt c? -28 Let m(o) be the second derivative of 13o*7/2520 - 13o*5/120 + 2o*4 + 15o. Let s(f) be the third derivative of m(f). Differentiate s(d) wrt d. 26d Let m(v) = 2v3 - v2 - v + 2. Let n(y) = 13y4 - 22y*3 - 6y*2 + 11y - 22. Let c(l) = 66m(l) + 6n(l). What is the third derivative of c(h) wrt h? 1872h Let x(d) be the first derivative of -77d*4/4 - 83d + 137. Differentiate x(p) with respect to p. -231p2 Let x(z) be the third derivative of 233z6/120 - z5/12 - z*4/24 + 217z2. Find the third derivative of x(u) wrt u. 1398 Let i(s) be the third derivative of s9/378 - s6/90 + s3 + 14s2. Let n(q) be the first derivative of i(q). What is the third derivative of n(y) wrt y? 480y*2 What is the second derivative of 1 + 29k*4 + 27k*4 + 3k*5 + 0k - 39k4 + 8k wrt k? 60k3 + 204k*2 Find the third derivative of 3i*5 + 2i*5 - 18i*4 + 0i4 - 6 - 10 - i4 - 2i2 wrt i. 300i*2 - 456i Suppose 6v - 30v + 96 = 0. Let q(y) be the third derivative of 0 + y*2 + 0y*3 + 3/8y*v + 0y + 1/5y5. What is the second derivative of q(s) wrt s? 24 Let b(l) = -58l*3 + 70l*2 + 5l + 5. Let z(y) = 59y3 - 71y*2 - 4y - 4. Let m(v) = 4b(v) + 5z(v). Find the third derivative of m(u) wrt u. 378 Let k(p) be the third derivative of 0p3 + 0p + 5/12p4 + 0 + 12p*2 + 1/12p*5. What is the second derivative of k(d) wrt d? 10 Let u = 24 - 42. Let v = u - -21. What is the derivative of 2 - v + 1 - 1 - 10k*3 wrt k? -30k*2 Let l = -48 - -97. What is the third derivative of 4r*2 + 17 - 17 - lr*2 + 6r*4 wrt r? 144r Find the second derivative of j*3 + 12 + 10j*2 - 12 - 10j - 16j wrt j. 6j + 20 Let n(z) be the third derivative of z*8/168 + 12z*7/35 + 10z5/3 + z2 + 24z. Find the third derivative of n(w) wrt w. 120w*2 + 1728w Find the third derivative of -212f3 + 150f*3 - 35f*2 + 92f*2 wrt f. -372 Let h be ((-1)/2)/((4/184)/(-1)). Find the third derivative of -10z5 + z2 + 9z2 - hz*2 wrt z. -600z*2 Let m(v) be the first derivative of 4v*2 + 2v + 2/3v3 + 4. Let i(a) be the first derivative of m(a). Differentiate i(h) wrt h. 4 What is the derivative of 15 + 29 + 269m*2 - 61 - 263 wrt m? 538m Let q(i) = i*2 + 5i + 3. Let v be q(-5). What is the second derivative of 3p3 - pv - 26p + 25p wrt p? 12p Let o be ((-21)/(-6))/(6/12). What is the second derivative of 2 - 3d2 - 9d - 2 - od2 wrt d? -20 Suppose 5d - 13 = -4y, 3y - 6y + d + 5 = 0. Find the second derivative of 3n + 0n2 - 3n - 2ny + 2n wrt n. -4 Let c(t) = t - 4. Let v be c(8). Suppose -vk + 17 + 3 = 0. Find the third derivative of 0s*5 - 2s*2 + 5s*2 - 2s*k - 2s*2 wrt s. -120s*2 Let b be (8 - 5) + -2 + (2 - 0). What is the third derivative of 3 + 1 - 56d*4 + 71d*4 - 3d*b + 5d*2 wrt d? 360d - 18 Let i(r) = 261r4 + 11r*3 - 11r + 569. Let t(u) = -52u4 - 2u*3 + 2u - 114. Let p(g) = -2i(g) - 11t(g). Differentiate p(y) wrt y. 200y3 Let f = 538 + -536. Let l(q) be the third derivative of -7/6q*3 - 1/6q*4 + 0 + 0q + 2qf. Find the first derivative of l(h) wrt h. -4 Suppose -13m + 94 - 16 = 0. Find the third derivative of 3j6 + 14j*2 - 4j*4 + 3j*6 - 5j*6 + 9j*m wrt j. 1200j*3 - 96j Let i(c) be the first derivative of 45c4/4 - 2c*3/3 + 35c*2/2 + 2c - 35. What is the second derivative of i(l) wrt l? 270l - 4 Suppose c - 98 + 96 = 0. Let g(i) be the second derivative of 9/2i*c + 7i - 1/3i4 + 0i*3 + 0. Differentiate g(y) with respect to y. -8y Let y(r) = -102r3 + 5r*2 - 245. Let v(k) = -101k*3 + 4k*2 - 247. Let l(n) = 3v(n) - 2y(n). What is the derivative of l(p) wrt p? -297p*2 + 4p Let z = -5 - -7. What is the derivative of -8rz + 13 + 2 + 30r*2 - 2 wrt r? 44r Let v = -12 + 24. Find the first derivative of -4t + 0t - vt2 + 4t - 3 wrt t. -24t Let x be (3/(-6)6)/(-1). Find the third derivative of -9q3 - 12q*2 - 3q*x + 3q*2 + 12q*2 wrt q. -72 Let a be (-2)/(-8)(-3 + -1). Let k be -7(a + 4/7). Differentiate -9p*4 - 2 + k - 2 - 3 with respect to p. -36p3 Let n(u) = u2 - 3u - 8. Let k be n(5). Suppose 11 = 2t - 21. What is the third derivative of y*4 + 3y*4 + 12y*k + 0y*4 - ty*2 wrt y? 96y Let f = -16 - -40. Let h = 26 - f. Differentiate -4 + 4z2 - 10z*h - 7 + 2 with respect to z. -12z Let p(l) = -36l3 + 18l + 9. Let t(g) = g*3 + g - 1. Let b(r) = -p(r) + 18t(r). What is the first derivative of b(w) wrt w? 162w2 Let h(p) be the third derivative of -p7/210 - 29p*4/12 - 34p*3 + 236p*2. What is the first derivative of h(n) wrt n? -4n*3 - 58 Let o(f) = 45f + 35. Let u(g) = g. Let x(v) = -o(v) + 25u(v). Let t(j) = -39j - 69. Let a(b) = -4t(b) + 7x(b). Differentiate a(q) with respect to q. 16 Suppose -4a + 4u + 59 = -13, -a - 2u = -24. Find the third derivative of -20 - 11l*3 + a + 9l*2 wrt l. -66 Let q be 18/99 + (-106)/(-22). What is the second derivative of -20c + 37cq + 15c + 32c wrt c? 740c3 Let u = 17 - 15. Differentiate 4 + nu - 6n2 - 2n*2 + 5n*2 wrt n. -4n Let r(n) be the first derivative of 253n4/4 - 152n + 130. Differentiate r(m) with respect to m. 759m2 Let o(v) be the first derivative of -67v*3/3 - 42v - 113. What is the first derivative of o(g) wrt g? -134g What is the second derivative of 0g*4 - 7g*3 + 14g*4 - 43 + 43 + 9g - 3g4 wrt g? 132g*2 - 42g Find the first derivative of 26 + 25 - 4f4 - 4f*4 + 52f*4 wrt f. 176f3 Let a(z) be the first derivative of z7/56 + 5z4/24 + 7z*3 + 3. Let i(d) be the third derivative of a(d). Find the first derivative of i(c) wrt c. 45c*2 Suppose -5z = -24 - 21. Let a = -5 - z. Let g(t) = t - 3. Let v(w) = -4w + 10. Let n(u) = ag(u) - 4v(u). Differentiate n(m) with respect to m. 2 Suppose 8 = 5i + 3h, -5h = 4i - 4h - 5. Let m(o) = -o2 - 1. Let a(k) = k3 + k*2 + 11k + 33. Let u(c) = im(c) + a(c). Differentiate u(s) wrt s. 3s*2 + 11 Let j be 0 + -1 - (-6 - 0). Let p be (10/3)/j3. What is the third derivative of -f2 - f4 - f4 + f4 - pf2 wrt f? -24f Let m(f) be the second derivative of 61f4/12 + 16f*3 - f - 101. What is the second derivative of m(t) wrt t? 122 Let l(j) be the first derivative of -23/4j*4 + 0j*3 + 6 + 0j - 1/2j2. Find the second derivative of l(w) wrt w. -138w Let a(y) be the second derivative of 121y5/20 + 57y*2 - 68y. Find the first derivative of a(k) wrt k. 363k2 Let q(z) be the second derivative of -209z6/30 + z4/12 - 61z3/2 - 293z. Find the second derivative of q(g) wrt g. -2508g2 + 2 Let p(c) = -c2 + 19c - 74. Let s be p(6). Let v = 10 - 5. What is the second derivative of 2q + 5q - q + vqs wrt q? 60q*2 Suppose -4q + 2x + 18 = 0, -5x = -0q + 4q - 11. Find the second derivative of 4gq - g4 - 13g - 4g4 wrt g. -12g*2 Let r(y) be the third derivative of 1/15y*6 + 0y*3 + 0y*5 + 0y - 2/3y4 + 22y*2 + 0. Find the second derivative of r(q) wrt q. 48q Let w be ((-2)/(-1) - 7) + 5. Let b(m) be the third derivative of 0m4 + 0 + wm - 3m2 - 1/10m*5 - 1/2m*3. What is the derivative of b(c) wrt c? -12c Let r(c) = 1 + 4 + 37c2 - 12c**2. Let	{ "pile_set_name": "DM Mathematics" }
7, l in increasing order. l, 0.1, 4/7 Suppose 3c - 4c = 2, 3g = 3c - 3. Let k = -0.17 - -0.2. Let o = k + 0.37. Put -4, g, o in descending order. o, g, -4 Let c = 105 + -99. Let z(f) = 3f2 - 21f + 14. Let d be z(c). Put -3, 1, d in increasing order. d, -3, 1 Let p = -74.75 + 74.9. Put p, 0, 0.8 in increasing order. 0, p, 0.8 Suppose 4s - 6 = 2s. Let h be (16/6)/(22/33). Suppose hz + 24 = -2z. Sort -1, s, z in decreasing order. s, -1, z Suppose -2z + 4k - 12 = 0, 4z + 3k - 21 = 2k. Sort 4/5, -5, z in descending order. z, 4/5, -5 Let c = -0.219 + 0.239. Put 24, 4, c, 0.1 in decreasing order. 24, 4, 0.1, c Let i = 39 + -29. Put i, 0.3, -2 in ascending order. -2, 0.3, i Let z(c) = 1 + 10c + 13c + 3 - 3c. Let x be z(3). Let k = -319/5 + x. Put 5, -2, k in ascending order. -2, k, 5 Suppose 5c + 29 = 3j, -5c - 3j + 44 = 55. Put -5, c, 11, -3 in increasing order. -5, c, -3, 11 Let d = -17 - -18. Let b be 141/(1 + 2) + d. Let r be 6/(-8)b/(-126). Sort r, 1/4, -1 in decreasing order. r, 1/4, -1 Suppose 2 + 2 = 4g. Let t be g + 6/16-2. Let a = -440 + 437. Sort a, 3/4, t in decreasing order. 3/4, t, a Let t(q) = -q3 + 3q*2 + 4q. Let d be t(4). Let x be (-16)/4 + 9 + 0. Suppose 0 = l - 3 + x. Sort l, 1, d in ascending order. l, d, 1 Let q(z) = -z*2 - 6z + 15. Let a be q(2). Let l be 18/(-21)(7 + 0) - a. Put l, -1, 3, -3 in descending order. 3, -1, -3, l Let i = 54 - 431/8. Let k = 0.8 - 0.3. Sort i, 3, k in ascending order. i, k, 3 Suppose 8 = -2n + 2, 0 = 4k + 5n + 3. Suppose -8 = 5j + 2. Let v be 0 + k/(-1) + j. Put 5, v, -1 in descending order. 5, -1, v Suppose 0 = x + 10 - 5. Let b be (-6)/(-2)(-2 + 0 + 3). Put x, b, 15 in increasing order. x, b, 15 Let d be (-6)/9 + 30/(-9). Let j be 3/(84/(-4))-7. Sort -1, d, j, 2. d, -1, j, 2 Let b = 1166/63 + -164/9. Sort -3/5, 12, b in increasing order. -3/5, b, 12 Let h = 653 + -4570/7. Sort h, 5, 0.2 in ascending order. h, 0.2, 5 Let y be 9893/(-2470) + -4(-1 - 0). Let k = y - 371/1710. Put -7, -3/7, k in descending order. k, -3/7, -7 Suppose 114 = -55q - 51. Sort 4, q, 1, -5 in ascending order. -5, q, 1, 4 Let l(u) = u2 + 18u - 3. Let y(b) = -7b + 3. Let j be y(3). Let x be l(j). Sort -8, 3, x in increasing order. -8, x, 3 Let p(o) = o2 - 3o - 7. Let u(c) = -c*3 + 5c*2 - 6c + 13. Let v be u(4). Let z be p(v). Sort -5, z, 1, 2 in descending order. z, 2, 1, -5 Let w = 0.02 - 24.02. Let o = 33 + w. Sort o, 4, -3 in decreasing order. o, 4, -3 Let x(l) = l. Let p be x(3). Suppose 0g - 18 = -3g - 3w, -4g = -pw - 3. Sort -2, 5, g in ascending order. -2, g, 5 Let r = 51 - 53. Sort -14, r, -4 in ascending order. -14, -4, r Let f = 1595/119 - 93/7. Let j be ((-2)/6)/((-3)/27). Put -0.1, j, f, -1 in descending order. j, f, -0.1, -1 Let y = -21 - -39. Put -4, 1, y, 0 in decreasing order. y, 1, 0, -4 Let s = -540.3 + 408. Let l = -101 - s. Let i = l - 31. Put 1, -2/5, i in ascending order. -2/5, i, 1 Let s be (-5)/6((-15)/300 - 0). Put 5, s, 3 in descending order. 5, 3, s Let j = 939/16 + -8419/144. Let o be (-48)/100 + (-2)/(-4). Sort j, 2/19, o in increasing order. o, 2/19, j Let j be (-4 + (4 - 5))12/(-20). Put -4/7, j, -9 in increasing order. -9, -4/7, j Let k = -556 - -548. Sort -3/7, 4, k in decreasing order. 4, -3/7, k Suppose m = -f - 3, -m = 3f - 2m + 13. Let c(y) = -5y*3 - 1. Let k be c(-1). Let r be k/(-6)(-2 + 5). Put r, f, -1 in ascending order. f, r, -1 Let q = -272 - -271.6. Let o be 15/(-10)2/(-6). Put q, -0.5, o, -4 in increasing order. -4, -0.5, q, o Let i = 733.5 - 734. Put -6/7, i, 7 in ascending order. -6/7, i, 7 Let h be -2 + 2/(6/15). Let b = -1313 + 1313. Sort h, -4, b in increasing order. -4, b, h Suppose 216 = 6v - 42. Let a = -44 + v. Suppose 7u = 4u + 6. Put u, a, -2 in decreasing order. u, a, -2 Let u(v) = -5 + 0v2 - v2 + 4v + 1. Suppose -9 = 5k - 8k. Let p be u(k). Put 1, -3, p in descending order. 1, p, -3 Let r(m) be the second derivative of -m4/12 - m3 + 7m2/2 - m. Let z be r(-7). Let x be (3/((-30)/4))/((-887)/4435). Put z, 1, x in increasing order. z, 1, x Suppose -2x - 5q + 21 = 0, -3x = -4q + 1 + 2. Suppose -xk + 2k = 5j - 27, 5k = 2j. Let a(n) = -n + 3. Let f be a(-3). Sort j, 3, f in decreasing order. f, j, 3 Let x = -58 + 61. Suppose -22 = -xo - m - 2, 0 = 3o - 5m + 10. Sort o, 2, -1, 1 in ascending order. -1, 1, 2, o Let t = 0.25 - 0.3. Let q = -1.2 + -3.3. Let f = 4 + q. Put f, t, 2/7 in descending order. 2/7, t, f Let p = -23 - -22.9. Sort p, -1/7, 1/4, -2/11 in descending order. 1/4, p, -1/7, -2/11 Let o be -3(-14)/2. Let a(w) = w3 - 6w*2 + w - 8. Let j be a(o). Let h be 6/(-12)(9 + -19). Put 3, h, j in decreasing order. h, 3, j Suppose -v - 5g + 11 = -3v, v = 4g - 10. Let m be (-1)/v(-10 - 14). Let x = m + -13. Put x, 5, 0 in descending order. 5, 0, x Let u be 2/18 - (-64)/(-9). Put 4, -1, u, 2 in decreasing order. 4, 2, -1, u Let o = 1156/11343 - -2/597. Let a = -9 + 6. Sort o, a, -0.1, -1/4. a, -1/4, -0.1, o Suppose 4p = -2g - 8, 9p - 10p - 5 = -g. Sort g, -3, 3, -1 in descending order. 3, g, -1, -3 Let c(m) = 32m + 243. Let f be c(-8). Sort -10, 4, f, 1. f, -10, 1, 4 Let k = -23.8 - -19.8. Put 3, k, -5 in descending order. 3, k, -5 Let k(r) = 0r2 - 20 + r2 - 7r - 20 + 9r. Let n be k(5). Suppose 4z - z = -24. Put n, z, 4 in descending order. 4, n, z Suppose -2d - 452 = -6d. Let j = -115 + d. Sort 8, 1, j. j, 1, 8 Let v = -2 + -1. Suppose i + 5i + 9i = -2i. Sort i, v, -16, 4 in descending order. 4, i, v, -16 Let m be (-23)/2(-6 + 8). Let u = m - -47/2. Put 6, -4, u in decreasing order. 6, u, -4 Let d(s) = s3 + 52s*2 + 50s - 35. Let n be d(-51). Sort 0, -1, n in increasing order. -1, 0, n Let y = -34.8 + 35. Let c = 7/52 + -5/13. Put y, -3/2, 0.05, c in decreasing order. y, 0.05, c, -3/2 Let q be 819/(-36) + -4 + (-1)/4. Sort -3, q, -5, 5 in decreasing order. 5, -3, -5, q Let h(r) = 0r - r2 - r + 4r2 - r3 + 2r2 + 9. Let b be h(5). Suppose 4m - 3o - 1 = -4, 2 = 2m + 2o. Sort b, m, -3 in descending order. b, m, -3 Let y = 1/30 + 19/30. Let x = 30 - 27. Let w = 0.05 + -0.05. Put x, w, y in descending order. x, y, w Let x be 1/((-4)/6 - -1). Suppose 0 = xo - 5 - 7. Let b(c) = c*2 + 15c - 32. Let u be b(-17). Sort 0, u, o in increasing order. 0, u, o Suppose -2d + m = -2, d - 2m = 7 - 0. Suppose 0 = 3n + 5 - 20. Sort -5, d, n in descending order. n, d, -5 Suppose -w - 5 = 5v - 2w, -5v - 5 = -5w. Let c(l) = -3l3 + l2 + l. Let d be c(v). Let r = 3.2 + -1.2. Sort -1/4, d, r in ascending order. -1/4, r, d Suppose 17k = -65 - 20. Put -4, k, -6 in ascending order. -6, k, -4 Suppose -67z = -68z - 12. Let s be z/10 - 12/(-60). Let f = 0.3 - 0.2. Put -0.3, f, s in decreasing order. f, -0.3, s Suppose -4w - 3d + 77 = 0, -2d = d + 3. Let v be (-4)/w + 56/(-20). Let b = 3 + -2.8. Sort b, 0.4, v. v, b, 0.4 Let g(u) = u*3 - 6u*2 + 5u - 4. Let d be g(5). Put -11, d, 1 in descending order. 1, d, -11 Let z be (4/8)/((-2)/(-444)). Let d = z + -106. Put -1, d, -3 in increasing order. -3, -1, d Let t = -1171/55 + 111/5. Let p = t + -8/33. Sort -3/2, p, -1, 0.1 in descending order. p, 0.1, -1, -3/2 Let d = 14.153 - 14.553. Let f = -6 - -6.08. Sort f, 0.2, d, -4. -4, d, f, 0.2 Let q be (-6)/(-1)172/(-258). Sort q, -3, 8, -12. -12, q, -3, 8 Let r = 297 - 295.7. Sort -0.4, -3/2, r in descending order. r, -0.4, -3/2 Let p be (2 + 196)(-2)/(-15) + -4. Let j = p - 334/15. Sort -3/8, j, 0.3 in increasing order. -3/8, j, 0.3 Let m = -667.92 - -668. Let t = 0.3 + -0.5. Put 1, t, m, 5 in decreasing order. 5, 1, m, t Let g be 19/(-2)(-10)/412. Let y = -2/103 - g. Let l be 94/(-235)(-2)/(-2). Sort -5, y, l. -5, l, y Suppose 34 = 22b - 5b. Let l = 4 - 3.6. Sort -2/7, b, l in increasing order. -2/7, l, b Let z = -2711 + 2710.8. Let b = 0.2 + -0.2. Put 0.1, z, b, -0.06 in decreasing order. 0.1, b, -0.06, z Let s = -1.1 + -3.9. Let x be -3(-58)/(-224) + (-2)/(-16). Let d = x - -15/16. Sort 1/7, s, d. s, 1/7, d Let j = -0.66 - -0.5. Let m be (((-140)/(-49))/(-20))/1. Sort -5, m, j in increasing order. -5, j, m Let a(d) = d2 + 6d - 1. Let h be a(-6). Suppose 8w - 15 = 3w. Let s be (6 - w)*8/(-6). Put h, 0.1, s in descending order. 0.1, h	{ "pile_set_name": "DM Mathematics" }
ce esee when four letters picked without replacement from {h: 2, e: 9, z: 1, s: 1, u: 7}? 7/1615 Two letters picked without replacement from {r: 1, d: 4, y: 2, x: 3, g: 2}. Give prob of sequence gd. 2/33 What is prob of sequence ffzz when four letters picked without replacement from zzzfzzzzzzzf? 1/66 Two letters picked without replacement from wzzzwwzzzzzwzzzzzzzw. Give prob of sequence zw. 15/76 What is prob of sequence ll when two letters picked without replacement from hhllhhlhhhhllh? 10/91 What is prob of sequence fcif when four letters picked without replacement from {i: 1, f: 3, c: 1}? 1/20 Four letters picked without replacement from qqcccqiqccqqqcq. Give prob of sequence qqqq. 2/39 What is prob of sequence hrl when three letters picked without replacement from {r: 7, l: 5, h: 1}? 35/1716 What is prob of sequence bbbb when four letters picked without replacement from {b: 8, g: 5}? 14/143 Calculate prob of sequence zii when three letters picked without replacement from nibzinoibzbzzzzn. 3/280 Calculate prob of sequence ifg when three letters picked without replacement from gfifigfgiifif. 25/572 Two letters picked without replacement from {y: 3, h: 3}. Give prob of sequence hh. 1/5 Two letters picked without replacement from {j: 9, h: 6, x: 1, w: 2}. Give prob of sequence hx. 1/51 What is prob of sequence idcc when four letters picked without replacement from {c: 4, o: 1, x: 2, d: 3, i: 2}? 1/165 Four letters picked without replacement from jggjgjgjgjjg. What is prob of sequence gjgj? 5/66 Two letters picked without replacement from {l: 4, r: 2}. Give prob of sequence rr. 1/15 Four letters picked without replacement from eezeeeeeeeeueezuue. What is prob of sequence uuuz? 1/6120 Calculate prob of sequence oss when three letters picked without replacement from eosqs. 1/30 Four letters picked without replacement from aoioyhiyninanioaaaoo. Give prob of sequence iyay. 1/2907 Two letters picked without replacement from {n: 1, b: 1, v: 1, q: 2, a: 2, g: 1}. What is prob of sequence ng? 1/56 What is prob of sequence xu when two letters picked without replacement from {d: 2, t: 3, a: 1, u: 1, y: 3, x: 2}? 1/66 What is prob of sequence vgvg when four letters picked without replacement from {t: 1, g: 10, v: 8}? 35/646 Calculate prob of sequence nnpo when four letters picked without replacement from {n: 4, o: 6, q: 1, p: 2}. 6/715 Two letters picked without replacement from olgl. What is prob of sequence lo? 1/6 Four letters picked without replacement from sssstfsss. What is prob of sequence tttf? 0 Three letters picked without replacement from {z: 1, d: 1, e: 2, f: 1}. What is prob of sequence eed? 1/30 What is prob of sequence id when two letters picked without replacement from {d: 2, e: 2, k: 1, l: 2, w: 5, i: 1}? 1/78 Three letters picked without replacement from gjmjmjmjgmrmnggj. What is prob of sequence jjm? 5/168 Three letters picked without replacement from brbbbkkkkkkbbkkkbkkr. What is prob of sequence rrb? 7/3420 Two letters picked without replacement from tvvrxvxrvvtvrtvvttt. What is prob of sequence rr? 1/57 Four letters picked without replacement from {k: 2, m: 9, l: 3, p: 2, c: 1}. What is prob of sequence pcpm? 3/9520 What is prob of sequence ot when two letters picked without replacement from {o: 5, t: 11}? 11/48 What is prob of sequence lkl when three letters picked without replacement from klcl? 1/12 Two letters picked without replacement from {f: 1, u: 1, q: 4, c: 3, p: 1, a: 5}. Give prob of sequence fp. 1/210 Four letters picked without replacement from {p: 5, h: 1, m: 5}. Give prob of sequence mmpp. 5/99 Three letters picked without replacement from ooeeee. What is prob of sequence eoe? 1/5 Three letters picked without replacement from {k: 1, u: 2, n: 1, l: 1, a: 2, v: 1}. What is prob of sequence uvk? 1/168 Two letters picked without replacement from {t: 1, o: 1, v: 1, g: 5, f: 7}. What is prob of sequence gf? 1/6 Two letters picked without replacement from pppppplpppllppp. Give prob of sequence pp. 22/35 Four letters picked without replacement from {l: 6, x: 1, h: 5, m: 7}. Give prob of sequence hlhh. 5/1292 Two letters picked without replacement from {e: 1, f: 1, y: 3, n: 1, s: 1}. What is prob of sequence ns? 1/42 Two letters picked without replacement from {y: 1, s: 2, d: 2, v: 1, e: 1}. What is prob of sequence dv? 1/21 Three letters picked without replacement from {m: 3, h: 2, b: 2, u: 2}. What is prob of sequence mhm? 1/42 What is prob of sequence qt when two letters picked without replacement from {n: 8, p: 2, t: 2, q: 3, v: 5}? 3/190 Three letters picked without replacement from ddwdddddddwdd. Give prob of sequence dwd. 5/39 Two letters picked without replacement from llhhllhlzhhlzlll. Give prob of sequence zz. 1/120 What is prob of sequence nz when two letters picked without replacement from bzbnbbbzzr? 1/30 Calculate prob of sequence fcfc when four letters picked without replacement from {c: 3, f: 3}. 1/10 What is prob of sequence isu when three letters picked without replacement from {s: 1, u: 1, o: 1, y: 1, i: 4}? 1/84 What is prob of sequence gg when two letters picked without replacement from ghogggebwghgehh? 1/7 Four letters picked without replacement from rrrgrrrrrgrrrg. What is prob of sequence rggr? 5/182 What is prob of sequence flz when three letters picked without replacement from {f: 1, w: 1, x: 2, l: 1, z: 2}? 1/105 What is prob of sequence xlk when three letters picked without replacement from {x: 2, r: 2, k: 4, l: 6, s: 3}? 1/85 Two letters picked without replacement from {t: 3, j: 1, a: 4, r: 4, v: 2, l: 3}. What is prob of sequence ja? 1/68 Calculate prob of sequence vlvl when four letters picked without replacement from lllvlvlllvvvll. 60/1001 Two letters picked without replacement from tppppipkppeiipkptpte. Give prob of sequence ep. 1/19 What is prob of sequence hro when three letters picked without replacement from {h: 12, o: 2, r: 4, w: 2}? 4/285 Three letters picked without replacement from hhhh. Give prob of sequence hhh. 1 Four letters picked without replacement from {l: 1, h: 2, e: 1, r: 2}. Give prob of sequence rleh. 1/90 Four letters picked without replacement from {g: 2, i: 10, f: 3, b: 3}. What is prob of sequence gbbg? 1/6120 Three letters picked without replacement from {t: 1, y: 2, e: 1, z: 1, d: 1, x: 1}. What is prob of sequence zxd? 1/210 What is prob of sequence ww when two letters picked without replacement from wgggwg? 1/15 Two letters picked without replacement from {m: 1, y: 2, p: 2, v: 4}. What is prob of sequence vm? 1/18 Four letters picked without replacement from ffff. What is prob of sequence ffff? 1 Four letters picked without replacement from {o: 5, j: 1, m: 1, p: 3, v: 2}. What is prob of sequence jvvo? 1/1188 Four letters picked without replacement from {x: 2, y: 5, u: 5}. Give prob of sequence yxyy. 1/99 What is prob of sequence oq when two letters picked without replacement from qqooq? 3/10 Calculate prob of sequence sjs when three letters picked without replacement from jjiawms. 0 What is prob of sequence mxt when three letters picked without replacement from {t: 3, w: 1, k: 1, x: 1, m: 7}? 7/572 What is prob of sequence ap when two letters picked without replacement from papap? 3/10 Calculate prob of sequence mem when three letters picked without replacement from eeemmem. 4/35 Calculate prob of sequence yyu when three letters picked without replacement from {s: 5, e: 2, m: 3, f: 2, u: 2, y: 2}. 1/840 Three letters picked without replacement from coufffffoucfuuff. Give prob of sequence cof. 1/105 What is prob of sequence lk when two letters picked without replacement from {j: 1, l: 2, k: 1}? 1/6 Two letters picked without replacement from {u: 3, x: 5, w: 2, t: 3, y: 3}. Give prob of sequence ux. 1/16 Calculate prob of sequence wnnk when four letters picked without replacement from ggkkkwkkkkwnkwkkknww. 11/11628 Two letters picked without replacement from {z: 1, b: 1, i: 1, v: 1, t: 2, d: 1}. What is prob of sequence vd? 1/42 Four letters picked without replacement from kkkkdkksddkdkk. Give prob of sequence dsdk. 9/2002 Three letters picked without replacement from {e: 1, q: 2, n: 2, h: 2, a: 1, p: 1}. Give prob of sequence pnh. 1/126 Calculate prob of sequen	{ "pile_set_name": "DM Mathematics" }
-0.01, c, 0.1, z? 0.1 Let h = 394 + -270. Let j = -624/5 + h. Let q = 6 - 8. What is the second smallest value in q, j, -6? q Let g = -5/14 - -11/70. Let f = 0.97561 + 0.02439. Let m = 13 + -8. Which is the third biggest value? (a) f (b) m (c) -8 (d) g d Suppose -3p - 5z = -32, -3p = -2z - 2 - 2. Let f = 0.4944 - 0.5444. Let o = 1.2 + -5.2. Which is the fourth biggest value? (a) o (b) 2/13 (c) f (d) p a Let p(t) = 2t2 - 2t - 27. Let r be p(-3). Let k = -21 - -20. Which is the fourth smallest value? (a) r (b) -0.5 (c) 6/7 (d) k c Let i = 55.94 + -56.14. Which is the second biggest value? (a) 10 (b) 2/9 (c) i (d) -19 b Let r be ((-477)/106)/(3/(-174)) + -6. Which is the second biggest value? (a) 4 (b) -2/5 (c) r a Let q be -349 + -1 + 0 + 0. Let z be q/91 - -41. Let r be 11/13 - 1 - (-54)/(-1170). What is the second smallest value in z, r, -37? r Suppose 4w - 5d + 81 = 340, -5d + 335 = 5w. Let a be 1/2 + (-21)/w. Let j = 3.281 + -3.181. What is the second biggest value in -0.11, 2/7, a, j? a Let d = -162 - -490/3. Let u = 38.2 + -37.2. Which is the second smallest value? (a) 0.4 (b) d (c) u c Suppose v = -n + 5, 0n + 5n + 5 = v. Let u = 2353.2 + -2356.2. Which is the third smallest value? (a) 0.3 (b) n (c) u (d) 12 a Let m(k) = k3 + k2 - 8k + 12. Let s be m(-8). Which is the second smallest value? (a) s (b) -2/3 (c) 4/3 (d) 5 b Let l = 1.1 - 0.1. Suppose -3r + 2n + n = -951, -5r - 3n = -1601. Let i be ((r/(-15))/11 - -2)6. Which is the smallest value? (a) i (b) -0.01 (c) l b Let c(a) = -33a - 32. Let v be c(0). Let b be (30/75)/(v/301). Let f = -9.09 + 9. What is the second biggest value in f, b, -2/3? b Let p = 71 + -73. Which is the third biggest value? (a) 0.094 (b) p (c) 1/4 (d) 3 a Let t = -11.25 - -0.25. Let b = -11.5 - t. Let r(q) = -q3 - 6q*2 - 6q - 2. Let w be r(-5). What is the second biggest value in 2/17, w, 0.5, b? 0.5 Let o = 0.3 + -0.5. Let v = -5.37 + 5.77. Let n = 0.07 + 0.93. What is the second biggest value in n, v, o, -1? v Let m = -6491 + 6491.361. What is the third biggest value in -0.5, -4, m, -2/13? -0.5 Let a = 1.8132 + -1.8332. What is the biggest value in a, 0.4, 1, -12? 1 Let d = -51 - -56. Let o = -22.2 + 25. Let g = -0.2 - o. Which is the third biggest value? (a) d (b) g (c) -1/7 b Let u be 0 + 74/(-14) + (-11)/((-132)/60). Which is the second biggest value? (a) 9/11 (b) -1 (c) -6 (d) u d Let r = -43 - -87. Let q = -9327 - -9327. What is the second biggest value in q, -3, r? q Let g = -18199 - -2001889/110. What is the biggest value in -4, -8, g? g Let a be 354/(-2655) + 106/(-45) + 2/(-18). What is the biggest value in 0.5, 3/2, a? 3/2 Let h(l) = -l*2 + 6l - 2. Let n be h(4). Let x be (-8)/n2/8. Let w = -3.181 + 0.181. Which is the smallest value? (a) 0.06 (b) x (c) 1 (d) w d Suppose 3h + 6h + 204 = 43h. Which is the third smallest value? (a) h (b) -3 (c) -0.1078 a Let r = 3 + -4. Let u(q) = q - 15. Let b be u(1). Let h = -40/3 - b. What is the biggest value in r, 1/3, h, 0.1? h Let v = 7121 + -7120.6. Let s = 8.82 - -0.18. What is the fourth biggest value in s, -0.5, v, -2? -2 Let m = 9.919 - 9.519. What is the third biggest value in 0.9, 1/10, m? 1/10 Let j = 10/29 - 129/290. Let s = -1 + 1.2. Which is the third smallest value? (a) s (b) 8 (c) 4 (d) j c Let o = 65.1 + -65. Suppose 3v = 8v - 55. Let x = -4 + v. Which is the fourth biggest value? (a) x (b) 1/3 (c) 1/4 (d) o d Let z = 100/3 - 234/7. Let p = -39 - -31.9. Let r = p + 6.9. What is the smallest value in r, -37, z, -1? -37 Let l = -2246/11 - -204. Let q be 4/18 + (-688)/(-144). Which is the second biggest value? (a) -1/6 (b) 1/4 (c) q (d) l b Let d = -0.6 - 0.4. Let j = 688 + -410. Let n = 277.89 - j. What is the second smallest value in n, d, 2/7? n Let b = -0.6654 + 3.6654. What is the biggest value in -17, 19, b? 19 Let d = 70/243 + -59/486. What is the fourth biggest value in -0.48, 1, 0.1, d, -1? -0.48 Let g(z) = -9z3 + z2 + 10z - 10. Let n be g(1). Let y be ((-6)/n)/((-351)/78). Which is the smallest value? (a) y (b) 14 (c) 2/5 (d) -2/9 d Let d = 0.28 + -4.28. Let f be 58/(-10) - (-93 - -86). What is the second smallest value in d, f, 1/2? 1/2 Let y = 0.16702 - 0.66702. Which is the third biggest value? (a) -2/15 (b) y (c) 12 (d) -2 (e) -3 b Let x = -48.48 - -48.44. What is the second biggest value in 0.1, x, 1.3? 0.1 Let k(b) = 8b + 114. Let o be k(-14). Let y = 0.8 - 1. Let m = -1.9 - -2.2. What is the fourth biggest value in o, m, 0, y? y Let x = 4.1 - 4. Let k be (-1)/((-32)/(-10))450/375. Let l = 4 - 3. Which is the third smallest value? (a) -2 (b) k (c) l (d) x d Let l be 395/(-632)((-7 - 0) + 2 + -3). Let q = -2.6 + -8.4. What is the fourth biggest value in l, q, 0.5, 2? q Let x = -2.2 - -1. Let s = 0.9 + x. Let l = -449 - -437. What is the second smallest value in l, s, 5? s Let q = -0.66 + 31.66. Let s = q - 30.5. Let x = -76 - -75.1. What is the biggest value in x, -1, s? s Let z(s) = 227s - 10211. Let v be z(45). Which is the biggest value? (a) -6 (b) v (c) -0.49 b Let j = -836 - -845. What is the second smallest value in -3, -53, j? -3 Let s = 2810 - 2809.5. Which is the fourth biggest value? (a) -2/15 (b) -0.2 (c) -4 (d) -5 (e) s c Suppose 0 = 19p + p + 120. Let n be 1/(-63)p7. What is the biggest value in -0.2, -3/8, n? n Let i = 4.2 - 4. Let m = i + -0.2. Let t = 649099/8 - 81137. What is the second smallest value in -1/12, m, t? m Let n(v) = 3v*2 + 22v - 15. Let s be n(-8). Suppose -14 = -2t + 10. Let q be (16/t)/(-4)s. What is the smallest value in q, 1/7, 0? q Let w be 692/(-1980) + 2/9. Let l = w - 4/55. What is the second smallest value in -0.4, l, -3/5, 10? -0.4 Let i = 3.467 - 19.867. What is the third biggest value in -5, 3, i, -0.1? -5 Let j = 1299.3 + -1299.6. Let i = 4.1 - 7.2. Let f = i - -3. Which is the second smallest value? (a) f (b) j (c) 0.5 a Suppose -133f = 187 + 212. What is the fifth smallest value in f, -11, 5, 0.05, -0.06? 5 Let g = -297 - -583/2. Let v = -10.42 - -9.92. Which is the smallest value? (a) -2/5 (b) g (c) v (d) 1 b Let p(l) = 2l*2 - 53l + 27. Let u be p(26). Let r be (-64)/(-400)((-9)/(-6) + u). Which is the biggest value? (a) r (b) -1 (c) 0 a Let t = 2240 - 15679/7. Which is the biggest value? (a) 31 (b) t (c) 3 a Let l be 4/88(10 - 12) - 20/22. Let a = 0.04 - 0.04. What is the third smallest value in l, a, -3, -1/5? -1/5 Let n be (-4)/(-10) - (-3)/(-3). Let g = n + 1/5. Let z be (1/(-4))/((-2)/287). Which is the third smallest value? (a) z (b) g (c) -2 a Let c = -4.8 - -11.9. Let a = c - 6.9. What is the fourth biggest value in -3, -0.04, -4, a? -4 Let l = 390494 - 390490.3. Let r = 1 - 0.9. Which is the third smallest value? (a) r (b) -4 (c) l c Let z = -18638 - -18637. What is the second smallest value in 273, z, -2, -0.6? z Let h = 43.2 - 222.2. Let w = h - -181. Let d = -3 + -1. What is the second smallest value in d, w, -1, 2/19? -1 Suppose 7 = b + o + 1, 3o = b + 6. Let g be (0 - (b - 8)) + -8 + 4. Let f = -5.02 - -0.02. What is the third biggest value in g, 5, f? f Let j(m) = 30m + 15. Let h be j(-1). Let o be (-2)/3 - 47/(-3). Let g = o + h. What is the third smallest value in g, -0.2, 2? 2 Suppose -91k + 7641 = -42725 + 4320. What is the third biggest value in k, 4, -4? -4 Let u = -0.02 + 0.52. What is the second smallest value in -14/13, u, 2, 1? u Let g = -15 + 14.7. Let q be -8 - -8 - 60/2. Let p be ((-16)/q - (-12)/(-60))-3. Which is the fourth smallest value? (a) 4 (b) p (c) 2 (d) g a Let r = 253/3 - 511/6. Let k(x) = 38 + 70 + 14356x - 14352x. Let g be k(-28). What is the third biggest value in g, -1, -5, r? g Let p = -5 - -3. Let m = 0.26 - -137.74. Let h = 137.5 - m. Which is the third smallest value? (a) p (b) -0.6 (c) h c Let z = -1630 - -1512. Which is the second smallest value? (a) 4 (b) z (c) -4 (d) 0.4 c Let p = -9339 - -9331. Let n = -3 + -2. Which is the second smallest value? (a) -2 (b) -0.5 (c) p (d) n d Let h be (-6 + 11)12 - 1. Let c be 9/(-168)2 + h/36. What is the biggest value in c, -1, 0.8, -5? 0.8 Let r = -25577.0244 - -25577. Which is the second biggest value? (a) 3	{ "pile_set_name": "DM Mathematics" }
t is the units digit of g(b)? 5 Let f be 12/(-3) - (0 - 2). Let s be f/(-5) - (-4)/(-10). Suppose s = -5j - 9 + 29. What is the units digit of j? 4 Suppose -28 = -o + 14. What is the tens digit of o? 4 Let u be 3/15 + 142/(-10). Let p be u/(-6) + 3/(-9). Suppose pv = -5f + 5v + 13, 0 = f - 4v - 6. What is the units digit of f? 2 Suppose 3l = 1 + 14. Let w(g) = 3g - 1. What is the tens digit of w(l)? 1 Let v(u) = -u3 + 2u*2 - u - 1. Let i be v(2). Let l be 0/(12/i - -3). Suppose 12 = -ls + 3s. What is the units digit of s? 4 What is the units digit of (-96)/(-42) - 2/7? 2 Let s(a) = -2a*2 - 1 + 2 + 0 + 3a + 2a3 - 2. What is the tens digit of s(2)? 1 Suppose 0 = -l + 2 + 2. Suppose -4q = -6q + l. What is the units digit of q? 2 Let z(o) = -1. Let q(f) = 17f + 6. Let s(i) = -q(i) - 3z(i). What is the tens digit of s(-2)? 3 Suppose -7 + 1 = 3n. Let z be 0/(0/1 - n). Suppose -4j - 12 = -2o, 3j - 5 - 7 = z. What is the tens digit of o? 1 Let s be 6/15 + (-16)/(-10). Suppose 0m + sm - 8 = 0. Suppose 2x - 12 = -4w + 6, 4x = -mw + 12. What is the units digit of w? 6 What is the units digit of ((-12)/8)/(3/(-358))? 9 What is the units digit of (-8)/(2 - (-24)/(-10))? 0 Let v = -16 - -44. What is the units digit of v? 8 Suppose -4g - 5i + 532 = 0, 0 = -5i - 27 + 7. Suppose -5a + 3d = -164, 4a - d - g = -2d. What is the units digit of a? 4 Let s(w) = 2 + w*2 - 10 + w + 6 - 6w. What is the tens digit of s(9)? 3 Let i = -68 + 72. What is the units digit of i? 4 Let l(a) = a*3 - 9a*2 + 9a - 3. Let v be l(8). Suppose v = i + 4. What is the units digit of i? 1 Let b(m) = -m*3 + 15m*2 + 19m - 15. Let j be b(16). What is the tens digit of (2 + -4)/((-3)/j)? 2 Let l be (-1 - -2)/((-3)/(-6)). Suppose l = 5w - 143. What is the units digit of w? 9 Suppose 4o - 14 = 3g, 5g - 1 + 13 = o. Let l = 6 + 0. Let m = g + l. What is the units digit of m? 4 Let i(r) = -22r3 + 4r*2 + 3r. Let w be i(-2). Suppose -5u - 3 = -3t - w, u = 4t + 40. Suppose -u = s - 5s. What is the units digit of s? 9 Suppose 0 = -3s - 619 + 1915. What is the units digit of s? 2 Suppose 3n - 2g = 7, -2g = -6g + 16. Suppose -2s - 2t + 20 = 0, nt - 20 + 70 = 5s. What is the units digit of s? 0 Let u(t) = t3 - 9t*2 + 8t - 2. Let j be u(8). Let q(f) = -f*3 + 2f. What is the units digit of q(j)? 4 Suppose 3s + s + 2z - 358 = 0, -355 = -4s - z. What is the tens digit of s? 8 What is the units digit of 13/(-1)-4? 2 Suppose 0l + 2l = 0. Suppose 5j + 25 = l, -8 = x - 0x + 2j. What is the units digit of x? 2 What is the hundreds digit of ((-1503)/(-18))/((-2)/(-4))? 1 Let j = 14 + 20. What is the units digit of j? 4 Suppose -t + 49 + 1 = 0. What is the tens digit of t? 5 Suppose -5l + 2k + 16 = 0, 5l + 2k - 4 = -0l. What is the units digit of l19 - (5 - 7)? 0 Suppose 3h + 3i = -3 + 27, -3h + 4i + 3 = 0. Let v be (-15 + h)/(-2 - 0). Suppose -vw + 23 = -17. What is the units digit of w? 8 Suppose -3b = 5o - 107, 2b - 134 = -2b + 2o. What is the units digit of b? 4 Let s be ((-15)/2)/((-9)/(-24)). What is the tens digit of (-288)/s + 2/(-5)? 1 What is the units digit of 14 + 1 - (-1 - 0)? 6 Let u = -6 + 2. Let g be (-51)/(-15) - u/(-10). Suppose 5j + 3d = g + 24, -5j + 26 = 4d. What is the units digit of j? 6 Suppose b - 392 = -7b. What is the tens digit of b? 4 Let i = 10 - 7. Suppose 3q - 3f = 165, -if - 65 = -3q + 2q. Suppose 4l + 6 - q = 0. What is the tens digit of l? 1 Let x be 2/9 - (-1992)/27. Suppose -4i - 2 = -x. What is the tens digit of i? 1 Let h(y) = -y*3 - 6y*2 - 5y + 1. Let s be h(-5). Suppose -2b = 5i + 7, b + i + s = -i. What is the units digit of b? 9 What is the hundreds digit of -1(-1)/(-5) + 14326/130? 1 Suppose -f + 3 + 3 = 0. Suppose 4q = 2a - 0a - 16, f = -2q. What is the units digit of a/(-3) - (-46)/6? 7 Suppose 9 = -x - 1. Let h = 18 + x. Suppose 5l = -h + 28. What is the units digit of l? 4 Let v = -35 + 52. Suppose 3j - 12 = -o + 4j, o + 4j - v = 0. What is the units digit of o? 3 Let u(c) = 2c - 10. Let n be 8/(-6)15/(-2). What is the tens digit of u(n)? 1 Let i(z) = -z3 - 3z*2 - 2z - 5. Suppose 4o + 12 = o. What is the tens digit of i(o)? 1 Let d = -110 + 140. What is the units digit of d? 0 Let u(z) be the third derivative of z6/720 + z5/40 - z4/12 - 2z*2. Let g(i) be the second derivative of u(i). What is the units digit of g(5)? 8 Suppose 0 = z + 2a - 22, a - 50 = -3z - a. Suppose -5d - r - r = -z, 14 = 3d + 4r. Suppose 10 = 2f, -4f + 6 + 34 = dh. What is the tens digit of h? 1 Let c(x) = -x3 + 5x*2 - 5. Let f be c(4). Let y = -6 + f. What is the units digit of y? 5 Suppose 0 = 2m + d - 3d - 12, 0 = -2m + 5d + 18. Suppose -5b - s + 37 = -2, -mb + 5s + 37 = 0. What is the units digit of b? 8 Let f = 3 - 7. Let c(k) = -k*3 - 4k*2 - 3k + 1. Let a be c(f). Suppose -1 = -2p + a. What is the units digit of p? 7 Let h(k) = -k3 + 4k2 + k - 4. Let l(b) = b2 - 1. Let q be l(2). What is the units digit of h(q)? 8 Suppose 5u + 9 = 2f - 3f, -8 = 4u. What is the units digit of f? 1 Let m = 173 - 114. What is the units digit of m? 9 Let x(s) = -s*2 + 13s - 7. Let t be x(12). Suppose 0 = -3z + tz - 8. What is the units digit of z? 4 Let u(m) = -m*3 - 6m*2 + 6m - 19. What is the tens digit of u(-8)? 6 Let p = 17 - 38. Let a = -14 - p. What is the units digit of a? 7 Suppose g - 6 = -0. Let y = g - 5. What is the units digit of y? 1 Let w(k) = -k*2 + 7k - 3. Let b be w(7). Let v be ((-5)/(-2))/(b/(-6)). Let x = 4 + v. What is the units digit of x? 9 Suppose 3g = 4 + 59. What is the units digit of ((-14)/g)/(2/(-21))? 7 Suppose 0u + 4u - 2y = -54, -4u - 57 = -3y. Suppose -6 = -0h + 2h. What is the units digit of 2/(0 + h/u)? 8 Let p(o) = -7o3 - o2 - 2o - 1. What is the units digit of p(-1)? 7 Let c = 100 - 49. What is the tens digit of c? 5 What is the units digit of (-224)/(-10) + (-30)/(-50)? 3 Let b(s) be the second derivative of s4/6 - s3/3 - 3s2/2 + 8s. What is the tens digit of b(-3)? 2 What is the tens digit of 51/6 - -1 - (-2)/4? 1 Let l be 0 + (1 - (-2 + 0)). Let d = l - 0. Suppose -f + do = -10, 0 = f - 3o + 4o - 10. What is the units digit of f? 0 Let n be 1 + 5 - 0/(-6). Suppose -p = -np + 195. What is the tens digit of p? 3 Suppose -3 = l, -5h + 2l + 1111 = -0h. What is the tens digit of h? 2 Let v(g) = -g + 2. Suppose 4 = x - 4l + 26, 3l - 5 = -5x. What is the units digit of v(x)? 4 Suppose 4l - 36 = -4. Let p = -3 + l. Suppose 15 + 25 = pr. What is the units digit of r? 8 Suppose -o + 70 = o. Suppose -3m = 2m - o. What is the units digit of m? 7 Suppose -2n = -4v + 13 + 1, 4v = -n + 5. What is the units digit of 0 - -6 - (0 + n)? 9 Suppose 5n - 5r + 50 = -0n, 5n + 44 = 3r. Let u = n - -10. What is the units digit of u? 3 Suppose 2g + 26 = 5m, -5m = 4g - 2 - 6. Suppose 0 = -mf + 5 + 11. What is the units digit of f? 4 Suppose -4a - 20 = a. Let t(i) = i - 1. Let l(w) = 2w2 - w + 3. Let j(g) = l(g) + 5t(g). What is the tens digit of j(a)? 1 Let c = 1 - -56. What is the units digit of c? 7 Let a = -103 - -59. Let z = 104 + a. Suppose q + 3q = z. What is the tens digit of q? 1 Suppose -x + 0x + 1 = 0. Suppose 3s = 4 + 2. Suppose -3l = -s - x. What is the units digit of l? 1 Suppose -2w = -2x + 2, -4w + 0w = -5x. Let u be (x - 0)/(5/(-10)). Let b = u - 1. What is the units digit of b? 7 Let m = 9 - 8. Let d be (m - -2)-2 + 1. Let a = -1 - d. What is the units digit of a? 4 Let x(n) be the second derivative of -4n + 0 - 7/12n*4 - 1/20n*5 - 4/3n*3 - 3n*2. What is the units digit of x(-6)? 6 Suppose -r = 1 + 5. Let m be 27/r(-4)/3. Suppose h = m + 12. What is the tens digit of h? 1 Let q = -6 - -13. Suppose -qb + 38 = -4. What is the units digit of b? 6 Let p = 7 - 7. Suppose v = -pv + 19. What is the tens digit of v? 1 Suppose -3y - 81 = -4x, 105 - 39 = 3x + 3y. What is the tens digit of ((0 - 1) + 2)x? 2 Suppose f + 1 = 5o - 63, 2o - 27 = -f. What is the units digit of o? 3 Let r(v) = -v + 3. Let u be r(-6). Let l = 2 - 7. Let z = u + l. What is the units digit of z? 4 Let p(q) = 40q3 + q2 - q. Let r be p(1).	{ "pile_set_name": "DM Mathematics" }
396037847. 396037847 What are the prime factors of 2074538550? 2, 3, 5, 7, 1975751 List the prime factors of 2079080445. 3, 5, 13, 3011, 3541 What are the prime factors of 64912688? 2, 4057043 List the prime factors of 482367003. 3, 19, 8462579 List the prime factors of 1713941474. 2, 7, 19, 6443389 What are the prime factors of 77136551? 77136551 List the prime factors of 1482148726. 2, 741074363 What are the prime factors of 60267243? 3, 20089081 What are the prime factors of 292824038? 2, 13, 131, 149, 577 List the prime factors of 255253931. 23, 11097997 What are the prime factors of 1709884432? 2, 106867777 List the prime factors of 1901428818. 2, 3, 17, 421, 44279 List the prime factors of 1014899616. 2, 3, 3523957 What are the prime factors of 95197083? 3, 31732361 What are the prime factors of 232840238? 2, 116420119 List the prime factors of 26039929. 2777, 9377 What are the prime factors of 3640358640? 2, 3, 5, 15168161 What are the prime factors of 2145298943? 2145298943 List the prime factors of 538958015. 5, 107791603 What are the prime factors of 36162879? 3, 12054293 List the prime factors of 1232223494. 2, 2689, 229123 List the prime factors of 54374759. 109, 223, 2237 List the prime factors of 979186783. 979186783 List the prime factors of 277430891. 137, 2025043 List the prime factors of 507984328. 2, 2791, 22751 List the prime factors of 15802032. 2, 3, 329209 What are the prime factors of 59449234? 2, 13, 67, 34127 List the prime factors of 3719145722. 2, 61, 113, 349, 773 What are the prime factors of 1832141475? 3, 5, 23, 354037 List the prime factors of 623208844. 2, 229, 2971 List the prime factors of 5406182226. 2, 3, 6857, 43801 What are the prime factors of 864287874? 2, 3, 31, 43, 12007 What are the prime factors of 64459988? 2, 17, 479, 1979 What are the prime factors of 1787308559? 53, 33722803 List the prime factors of 1145648147. 7, 23, 139, 51193 What are the prime factors of 185308003? 185308003 What are the prime factors of 36443384? 2, 263, 17321 What are the prime factors of 1699707822? 2, 3, 12457, 22741 What are the prime factors of 514839328? 2, 1871, 8599 What are the prime factors of 558262769? 19, 541, 54311 What are the prime factors of 72443790? 2, 3, 5, 23, 79, 443 What are the prime factors of 44081104? 2, 367, 7507 List the prime factors of 1905241094. 2, 952620547 What are the prime factors of 199161552? 2, 3, 43, 96493 List the prime factors of 2606886028. 2, 197, 503, 6577 List the prime factors of 188748303. 3, 4271, 14731 What are the prime factors of 127555862? 2, 7, 17, 29, 18481 What are the prime factors of 1055450241? 3, 157, 746957 What are the prime factors of 22178373? 3, 7, 1056113 What are the prime factors of 49228622? 2, 1487, 16553 What are the prime factors of 49480276? 2, 41, 73, 4133 List the prime factors of 114396558. 2, 3, 19066093 List the prime factors of 426878244. 2, 3, 13, 19, 61, 787 List the prime factors of 139065706. 2, 13, 31649 List the prime factors of 62000810. 2, 5, 6200081 List the prime factors of 524367027. 3, 353, 6113 What are the prime factors of 29604378? 2, 3, 17, 41, 7079 What are the prime factors of 898172425? 5, 23, 89, 17551 List the prime factors of 89810535. 3, 5, 29, 206461 What are the prime factors of 105944601? 3, 7, 23, 401, 547 List the prime factors of 37434971. 7, 337, 2267 What are the prime factors of 88492664? 2, 13, 850891 What are the prime factors of 14431311? 3, 181, 2953 List the prime factors of 2141587019. 11, 13, 17, 880949 What are the prime factors of 755256426? 2, 3, 125876071 List the prime factors of 91739138. 2, 45869569 List the prime factors of 90554132. 2, 113, 200341 List the prime factors of 215205751. 31, 6942121 List the prime factors of 19156459. 7, 2736637 What are the prime factors of 458163946? 2, 229081973 List the prime factors of 1861145354. 2, 29, 83, 386611 What are the prime factors of 660161360? 2, 5, 8252017 List the prime factors of 151520750. 2, 5, 606083 List the prime factors of 1419407734. 2, 53, 83, 161333 What are the prime factors of 46104606? 2, 3, 29, 59, 499 What are the prime factors of 2400980405? 5, 480196081 What are the prime factors of 104692239? 3, 17, 31, 22073 What are the prime factors of 93324472? 2, 641, 18199 What are the prime factors of 163565946? 2, 3, 19, 159421 List the prime factors of 411839656. 2, 23, 2238259 List the prime factors of 2978501551. 1063, 2801977 What are the prime factors of 30698400? 2, 3, 5, 12791 List the prime factors of 21050062. 2, 11, 19, 50359 What are the prime factors of 38095601? 41, 929161 What are the prime factors of 1471546590? 2, 3, 5, 53, 925501 List the prime factors of 4801625787. 3, 7, 29, 160907 List the prime factors of 16577892. 2, 3, 153499 What are the prime factors of 19121106? 2, 3, 19, 167729 List the prime factors of 167764653. 3, 7, 17, 31, 163 What are the prime factors of 80444492? 2, 29, 693487 What are the prime factors of 279295561? 279295561 List the prime factors of 90578334. 2, 3, 7, 11, 59, 3323 What are the prime factors of 5969316485? 5, 11, 41, 353, 7499 What are the prime factors of 3152304239? 7, 67, 6721331 What are the prime factors of 5471996305? 5, 1094399261 What are the prime factors of 49211054? 2, 24605527 What are the prime factors of 34678348? 2, 491, 17657 What are the prime factors of 1765119? 3, 19, 173, 179 What are the prime factors of 5969971? 7, 19, 44887 What are the prime factors of 2402354210? 2, 5, 463, 518867 List the prime factors of 178740818. 2, 79, 1131271 What are the prime factors of 52428026? 2, 7, 179, 20921 List the prime factors of 23645274. 2, 3, 41, 277, 347 What are the prime factors of 785141892? 2, 3, 23, 311, 3049 List the prime factors of 77332676. 2, 29, 379, 1759 List the prime factors of 3038530787. 19, 41, 263, 14831 List the prime factors of 40895106. 2, 3, 7, 19, 7321 What are the prime factors of 1282364? 2, 320591 List the prime factors of 33152905. 5, 157, 269 List the prime factors of 24809828. 2, 113, 131, 419 What are the prime factors of 75472096? 2, 7, 336929 What are the prime factors of 15179564? 2, 3794891 What are the prime factors of 90896117? 13, 71, 98479 List the prime factors of 477557898. 2, 3, 61, 1304803 List the prime factors of 455846099. 29, 15718831 List the prime factors of 23380062. 2, 3, 3896677 What are the prime factors of 3667719149? 271, 2819, 4801 What are the prime factors of 38689994? 2, 7, 17, 162563 List the prime factors of 2270043969. 3, 4127, 183349 List the prime factors of 239261966. 2, 119630983 What are the prime factors of 113845300? 2, 5, 29, 37, 1061 List the prime factors of 462125758. 2, 231062879 What are the prime factors of 303320821? 303320821 List the prime factors of 489865306. 2, 7, 499, 70121 What are the prime factors of 43491147? 3, 7, 2071007 What are the prime factors of 262734648? 2, 3, 11, 71, 107, 131 What are the prime factors of 134937640? 2, 5, 109, 30949 What are the prime factors of 179563067? 31, 41, 141277 What are the prime factors of 8396699337? 3, 13, 101, 710561 List the prime factors of 6302463951. 3, 7, 19, 15795649 List the prime factors of 137194259. 101, 1358359 List the prime factors of 976706936. 2, 3217, 37951 What are the prime factors of 86820373? 139, 624607 What are the prime factors of 47829919? 523, 91453 What are the prime factors of 162722395? 5, 11, 1451, 2039 List the prime factors of 171823108. 2, 67, 641131 What are the prime factors of 39360133? 433, 90901 What are the prime factors of 40789824? 2, 3, 212447 List the prime factors of 945461955. 3, 5, 63030797 What are the prime factors of 509837073? 3, 169945691 What are the prime factors of 11348743? 7, 231607 List the prime factors of 159603675. 3, 5, 7, 11, 29, 953 List the prime factors of 333841665. 3, 5, 17, 23, 56921 What are the prime factors of 2996085787? 29, 281, 367663 List the prime factors of 1577580574. 2, 22777, 34631 What are the prime factors of 6902225851? 3163, 2182177 List the prime factors of 88949226. 2, 3, 59, 71, 3539 List the prime factors of 1341254622. 2, 3, 823, 271619 List the prime factors of 172564861. 7, 71, 103, 3371 List the prime factors of 229134806. 2, 17, 396427 What are the prime	{ "pile_set_name": "DM Mathematics" }
rt(1280) + (sqrt(720) + -1sqrt(720))2 - (1 + sqrt(320) + -1)2)-1. -32sqrt(5) + 320 Simplify 36(-1 + -2 + sqrt(99))242. -2592sqrt(11) + 15552 Simplify -5 + sqrt(192) + 6(sqrt(192) + -2) + ((sqrt(120) - 1sqrt(120))/sqrt(10))/(sqrt(484) + (sqrt(484)2 - sqrt(484))). -17 + 56sqrt(3) Simplify ((sqrt(66) - 3(sqrt(66) + 1sqrt(66) + sqrt(66))) + 5(-2sqrt(66) + sqrt(66)))/(452sqrt(6)). -13sqrt(11)/40 Simplify ((-4sqrt(240)-4)/sqrt(12) + -3)*2. -192sqrt(5) + 5129 Simplify ((sqrt(18))*2 + -3 - (1(sqrt(2) + 0))*2) + sqrt(10)/(62sqrt(5)). sqrt(2)/12 + 13 Simplify ((sqrt(325) + (sqrt(325) - -4-2sqrt(325)) + 2 + -1)-5)*2. -1500sqrt(13) + 292525 Simplify (sqrt(384) + 1(sqrt(384) + (-1sqrt(384) - sqrt(384))))/(2sqrt(300) + (sqrt(12) + sqrt(108))2). 0 Simplify -5(sqrt(76)/sqrt(4) - sqrt(19)) + (-1sqrt(228))/sqrt(12) - (1 + (sqrt(57)/sqrt(3))*2 + 6(1 + sqrt(19))). -7sqrt(19) - 26 Simplify (2(-4(sqrt(153) - sqrt(17)) + sqrt(17) + -3) + 3)3. -42sqrt(17) - 9 Simplify (2(1 + sqrt(1700) + 5 + -2) + 5)-1. -20sqrt(17) - 13 Simplify -1((5-1(sqrt(136) + sqrt(136)-1 + sqrt(136)))/(sqrt(512) + sqrt(512)-2-2))*2. -17/64 Simplify 3((sqrt(176))*2 - sqrt(11))-2 - (sqrt(176) + (3sqrt(176))2 + 2). -2642 + 2sqrt(11) Simplify -4-2(sqrt(100)/(sqrt(25)/sqrt(5)))/(2sqrt(10)2). 2sqrt(2) Simplify (-4sqrt(270)/sqrt(6))/(sqrt(9) - (sqrt(1296) - sqrt(9)))6. 12sqrt(5)/5 Simplify (sqrt(11) - sqrt(22)/(sqrt(2)2)) + 6(sqrt(11) + -1) - sqrt(88)/sqrt(128)-5. -6 + 31sqrt(11)/4 Simplify -2 + -5(2sqrt(325) + (sqrt(13) - (sqrt(130)-2 - sqrt(130))/sqrt(10)) + 0)2. -12742 Simplify (-5 + (5 + (sqrt(5) - sqrt(20)/sqrt(4) - sqrt(5) - sqrt(5)) + sqrt(180)3 + -1)-5)2. 4000sqrt(5) + 32625 Simplify -4 + (2 + (1sqrt(19))2 + -3 + (-4 + -4sqrt(38)/sqrt(2))*2)1. 32sqrt(19) + 334 Simplify 0 + sqrt(128) + sqrt(128) + (-2(sqrt(128) + (sqrt(128) - (sqrt(128) + 2)) + sqrt(128)))*2 + 2. -240sqrt(2) + 2066 Simplify -3((sqrt(34)/sqrt(2)3 + (sqrt(204)/sqrt(6))/sqrt(2))*2 + 3). -825 Simplify (sqrt(468) + 1(2 + sqrt(468)))-1 + 2 + ((-1sqrt(91)4 - sqrt(91) - sqrt(91))/sqrt(7))2. -12sqrt(13) + 468 Simplify (sqrt(16) - (sqrt(64)-3 + sqrt(64)))/((sqrt(16)2)/sqrt(2)). 5sqrt(2)/2 Simplify 4 + (sqrt(200) + (0 + sqrt(200))3 + sqrt(200) - sqrt(200) - (sqrt(200)-1-5 - sqrt(200))). 4 Simplify 3(((sqrt(132) - 2sqrt(132))/sqrt(3))/(sqrt(4) + sqrt(4) + (1sqrt(40))/sqrt(10)) + 5)2. -10sqrt(11) + 236/3 Simplify (sqrt(75)2)2-3-2 + (sqrt(18)/sqrt(3)4 + sqrt(6))/(5sqrt(32)). sqrt(3)/4 + 1800 Simplify (-5 + sqrt(468) + (sqrt(468) - (0 + sqrt(468) + sqrt(468) + 3)) + -4 + 2)2. 100 Simplify (-1-1sqrt(38) + -5(sqrt(38) - sqrt(608)))/(sqrt(4)/(sqrt(160)/sqrt(5))). 64sqrt(19) Simplify (4(((sqrt(147) + -1)-6 - sqrt(147)) + sqrt(147))-3)*26. -435456sqrt(3) + 4603392 Simplify (sqrt(143) + (sqrt(143)-1 - sqrt(143))-1 + sqrt(143)21)/(sqrt(132)/((sqrt(144) - (sqrt(144) - sqrt(144)2))/sqrt(12))). 10sqrt(13) Simplify 4(-2 + ((sqrt(931) + 1(2 + sqrt(931)))-6)*2 + 4). 8064sqrt(19) + 536840 Simplify sqrt(77)/(-1sqrt(11)2)4 + -3. -2sqrt(7) - 3 Simplify (5(sqrt(5) + -1 - sqrt(5)) - -1sqrt(180))*2 - (3 + sqrt(180)/sqrt(4)). -63sqrt(5) + 202 Simplify ((sqrt(117) + -2sqrt(117))3 + (-3 + sqrt(117) + 0 + sqrt(117))*2)-3. -1431 + 135sqrt(13) Simplify (sqrt(35)/sqrt(252) - (0 + sqrt(5)-2) - (4(sqrt(180) + -1 + sqrt(180)) + -5))2. -825sqrt(5) + 381041/36 Simplify (sqrt(1377) + (-4 + sqrt(1377)1 + sqrt(1377) - sqrt(1377)) - (2 + 0 + sqrt(1377) + sqrt(1377)))23. 108 Simplify (sqrt(264)/(-1(sqrt(24)/sqrt(2) + sqrt(12)) - sqrt(12)))/(-2sqrt(2)6-5). -sqrt(11)/180 Simplify (((-3-1sqrt(1250) - sqrt(1250)) + sqrt(1250) - ((sqrt(1250) - (-1 + sqrt(1250))) + 5))1)2-2. -22572 + 1800sqrt(2) Simplify ((sqrt(66) - (-4(sqrt(66) - (sqrt(66) + sqrt(66)4 - sqrt(66))) + sqrt(66) - sqrt(66))) + sqrt(66))/(sqrt(378)/sqrt(7)) + 5. -10sqrt(11)/3 + 5 Simplify (-5(4 + (0 + sqrt(343) - sqrt(343)) + 3 + sqrt(343))-1)*2. 2450sqrt(7) + 9800 Simplify ((62sqrt(6))/(2sqrt(27)) - -64sqrt(18)5)*2. 262088 Simplify sqrt(117)-2 - 2sqrt(117) - (6(sqrt(52))*2 + -4). -308 - 12sqrt(13) Simplify (2(sqrt(99) + sqrt(99)5 + -5 - sqrt(99)) - (-3(sqrt(99) + 1) + 2-1sqrt(99)))2. -630sqrt(11) + 22324 Simplify 2(-4 + sqrt(3)-1 - sqrt(30)/sqrt(90)) - (-1 + (sqrt(300)-2-5)*2). -30007 - 8sqrt(3)/3 Simplify (sqrt(320) - (sqrt(320) + (sqrt(320) - (sqrt(320) - sqrt(320)-21))))/((sqrt(80)/(sqrt(40)/sqrt(5) + sqrt(8)) + sqrt(10))3). 16sqrt(2)/9 Simplify (-1(sqrt(45) + -1sqrt(180)))/(sqrt(144)-12). -sqrt(5)/8 Simplify (2 + -4(-2 + sqrt(567))2)*2. -2592sqrt(7) + 36612 Simplify ((1sqrt(156)16)/(sqrt(60)/((sqrt(80) + sqrt(5) - sqrt(5))3)))*2 + 2. 67394 Simplify (3(sqrt(1584) - (sqrt(1584) + -3 - sqrt(1584)))43)*2. 93312sqrt(11) + 2064528 Simplify ((-3-1sqrt(65) + sqrt(65))/(sqrt(5) + -1sqrt(245)))2 + -4. 16/9 Simplify 3 + -1 + ((-1sqrt(77)-6)/((sqrt(343)/sqrt(7))/sqrt(7)))2. 398 Simplify -5((0 + sqrt(432) - sqrt(432))-6 + sqrt(432) + sqrt(15)/((sqrt(60)/sqrt(4))/sqrt(3)))2. -2535 Simplify 4 + -4 + -5((sqrt(162)/sqrt(6)3)2 + 4). -1235 Simplify 2((4sqrt(39)-4)/(sqrt(12)1))2. 1664 Simplify -4(-3 + sqrt(5000)-5 + sqrt(5000)). 12 + 800sqrt(2) Simplify (-5(sqrt(36) + sqrt(144)))/sqrt(12) + (-2 + sqrt(363))3. -6 + 18sqrt(3) Simplify 5((3 + 0 + sqrt(147))*2 + 3 + -4). 210sqrt(3) + 775 Simplify -35((sqrt(315) + (sqrt(315) - (sqrt(315) + (-62sqrt(315) - sqrt(315)) + sqrt(315) + sqrt(315))) + sqrt(315) + sqrt(315))/sqrt(5))*2. -185220 Simplify 4((-3sqrt(700))/((sqrt(216)/sqrt(6) - sqrt(36)) + sqrt(36)))2. 700 Simplify (4(sqrt(189) - 1sqrt(189)-3))/(sqrt(28)/sqrt(4)2 - -3sqrt(28)). 6sqrt(3) Simplify 0 + ((1(sqrt(132) - sqrt(132)-1))/sqrt(3))/(1sqrt(64)1). sqrt(11)/2 Simplify 0 + sqrt(98) + 5 + (sqrt(98)-3)*2 + sqrt(98)3 + sqrt(98) + -5. 35sqrt(2) + 882 Simplify 3(2 + (sqrt(76) + 0 + -2 + -2)*2) + 3. -48sqrt(19) + 285 Simplify (2(sqrt(78)2-2 + sqrt(78) + sqrt(78)))/(sqrt(48)/(sqrt(24)/sqrt(3)) + sqrt(6) + sqrt(12)/(sqrt(6)/sqrt(3))) + 0. -4sqrt(13)/3 Simplify -3(1 + sqrt(425) + (5(sqrt(425) - (sqrt(425) + 0 + sqrt(425))))*2 + 2). -31884 - 15sqrt(17) Simplify 4 + -5-4(sqrt(5) + sqrt(5)1)212. 804 Simplify ((sqrt(252)/(sqrt(600) + 1sqrt(600)))/(sqrt(384)-13))*2. 7/230400 Simplify 1 + -5 + ((-2sqrt(91))/sqrt(7) - (sqrt(325) + 1)) + -2. -7sqrt(13) - 7 Simplify 4 + (3 + -1sqrt(175) + (1 + sqrt(175))-3)2. 2804 Simplify 4 + -1 + (sqrt(24)1-6)/sqrt(12). -6sqrt(2) + 3 Simplify (5(sqrt(120)/(2sqrt(12)) - sqrt(10)))/(sqrt(45)/(-2sqrt(9)-6)). -30sqrt(2) Simplify (-3(-21sqrt(5) + -1(sqrt(5) + -2))-1)*2. -108sqrt(5) + 441 Simplify (-5(sqrt(204) + sqrt(204)4 - sqrt(204)))/(-2sqrt(300)). 2sqrt(17) Simplify (-5(sqrt(121)-1-2)/((sqrt(11) - (sqrt(11) - (sqrt(11) + 2sqrt(11))))4))2. 275/36 Simplify -5 + (-5 + sqrt(114)/(-2sqrt(6)-4 + sqrt(6)))2 + -5. -10sqrt(19)/9 + 1234/81 Simplify ((sqrt(352) + sqrt(22) + sqrt(22) + sqrt(22))3)/(-4sqrt(2)1). -21sqrt(11)/4 Simplify -22(4 + 6sqrt(396)-2-2). -576sqrt(11) - 16 Simplify ((((sqrt(112)-2)/sqrt(4))/sqrt(2))/(2sqrt(28)3))2. 1/18 Simplify ((sqrt(19) + sqrt(1539) + 1 - sqrt(38)/(-1sqrt(2))) + sqrt(209)/(6sqrt(11)1))1. 1 + 67sqrt(19)/6 Simplify -2 + ((sqrt(77) - sqrt(77)-1)-4 - sqrt(77))/(1sqrt(396)) + 5. -3sqrt(7)/2 + 3 Simplify (-52sqrt(10))/(4(sqrt(4)/sqrt(2) + sqrt(2))) - sqrt(120)/((1sqrt(72) + sqrt(72) - sqrt(72))/sqrt(12)). -13sqrt(5)/4 Simplify ((sqrt(847) + -1)-5)*2 + ((-2sqrt(847) + -2 - sqrt(847))*2 - sqrt(847)) + 2(5(sqrt(847) + -1) - sqrt(847)). -341sqrt(7) + 28817 Simplify (sqrt(315)/(sqrt(36)/sqrt(4)1))/(((sqrt(90)1)/sqrt(2))/sqrt(9)). sqrt(7) Simplify (sqrt(1344) + -2sqrt(1344))/(4sqrt(27)). -2sqrt(7)/3 Simplify 4 + (1(sqrt(84)-1 + sqrt(84)))/(-3sqrt(48)/sqrt(4) + sqrt(12)) + -5. -1 Simplify -5(5 + ((sqrt(85)16 - sqrt(85)) + sqrt(85))/(sqrt(100)/sqrt(5))). -15sqrt(17) - 25 Simplify (5-2sqrt(102) - ((sqrt(102) - (sqrt(102) + sqrt(102) + (2sqrt(102) + sqrt(102))3)) + sqrt(102) + sqrt(102)))/(sqrt(60)/(4	{ "pile_set_name": "DM Mathematics" }
v2 - 3v - 1. Let w be y(-3). Suppose n = z + 3 - w, 2 = -4n - 5z. Let q = n + 10. Is 4 a factor of q? False Let g be 4/12 - (-15)/9. Suppose -5t + 5d + 105 = 0, gt - 45 = 2d + d. Is t a multiple of 6? True Suppose 5r - 5o - 20 = 0, o + 0 = -r - 4. Let i(b) = -b*2 + 48. Does 22 divide i(r)? False Suppose -3z = -0z. Suppose -4b + 4m - 4 - 4 = z, 4b + 2m = -2. Is (-10)/b(1 - -1) a multiple of 10? True Let n be 664/(-22) + (-6)/(-33). Let b = -10 - n. Does 20 divide b? True Suppose -q = -2j - 3q + 32, -2j + 28 = 4q. Does 6 divide j? True Suppose 0g - 12 = -4g. Suppose -gk + 6k = 66. Does 22 divide k? True Let c(g) = g*2 - 5g + 14. Does 9 divide c(7)? False Let m(i) = i*2 + 9i. Let y be m(-9). Suppose -3j + 60 = -yj. Is 10 a factor of j? True Suppose 0 = 2c + 653 - 93. Let s = 541 + c. Is (-4)/6 - s/(-27) a multiple of 5? False Let t(u) = -8u + 9. Is 7 a factor of t(-5)? True Suppose 0l + 2l = -22. Let n(v) = -v - 5. Is n(l) a multiple of 3? True Let j = 7 - 0. Let q(x) = -x*2 + 3x + 12. Let v(i) = -3i2 + 9i + 37. Let l(z) = -7q(z) + 2v(z). Is l(j) a multiple of 9? True Suppose 8k - 12k + 716 = 0. Does 34 divide k? False Let r(u) be the second derivative of u*5/20 + 5u4/12 - u3/6 - 7u2/2 - 3u. Let w be r(-5). Let v(g) = 5g2 + 2g. Is v(w) a multiple of 16? True Suppose -d - 1 + 21 = 0. Let n be ((-3)/5)/((-4)/d). Suppose 0 = -3b - np + p + 30, 4p = b + 4. Does 5 divide b? False Let q(x) = x3 + 7x*2 + 2x - 7. Suppose -5 - 1 = -r. Let b be r(3/3)/(-1). Does 15 divide q(b)? False Let i = 6 - 5. Let c be i/(-1(-3)/(-12)). Let k(d) = d*2 - 2d - 4. Does 10 divide k(c)? True Let f(l) = 4l - 2. Let i be f(3). Let s be (i/(-3))/(3/(-9)). Suppose -5q + s + 75 = 5t, -q + 4 = 0. Does 13 divide t? True Let k = 744 + -439. Is k a multiple of 18? False Let m = -89 + 131. Is m a multiple of 14? True Let d(x) = -x3 + x2 - 3x - 1. Is 10 a factor of d(-2)? False Let a(v) = 3v - 6. Let g be (-7)/((-7)/6) - -1. Let k be a(g). Is 4 a factor of (-1)/(-5) - (-117)/k? True Suppose -2t - 1 = n + 7, -5t - 20 = 5n. Does 28 divide t/(24/(-237))2? False Suppose 7v = 3v - 244. Let z = -29 - v. Is 8 a factor of z? True Suppose 0 = 3g - 10g + 1351. Is 33 a factor of g? False Let c(h) = -h2 - 8h + 11. Let q(d) = 10d + 1. Let l be q(-1). Let f be c(l). Suppose 7 = fo - 3. Is 3 a factor of o? False Let s be (-8)/(-3)(-39)/(-4). Suppose 4t + s = -5a, -3t + 5a + 0 = 2. Is 16 a factor of (0 - 25/4)t? False Let p = -12 + -12. Does 4 divide 2/12 + (-92)/p? True Let w be -1 + (4 - 3) + 624. Does 13 divide w/(-4)(-5)/10? True Does 8 divide (32/28 - 2)-28? True Let f be (5 - 5) + (-218)/2. Let c = 166 + f. Is c a multiple of 20? False Let a = 75 - 13. Does 13 divide a? False Suppose 4t - 5j - 17 = 118, -5t + 5j = -170. Is t a multiple of 7? True Suppose -5x = -2m - 2 - 135, -5x = -m - 136. Is 9 a factor of x? True Let g = -14 + 123. Is 5 a factor of g? False Suppose 0 = j + 7 - 12. Suppose j = m - 9. Is m a multiple of 5? False Is 16 a factor of (3/(-3) - 0)-168? False Suppose -m + 4m = 63. Does 7 divide m? True Suppose -7a + 584 = -200. Is 14 a factor of a? True Let d = -5 + 2. Is 20 a factor of 25/(d/12-4)? False Let u = 2 + -2. Is (-6 - u)-2 - -1 a multiple of 13? True Suppose -3w = 6 - 0, -w = -4b + 46. Suppose 2q - 17 = -3i, -q = i + i - b. Suppose -5f = -q - 4, -f = 5u - 61. Does 12 divide u? True Let q(s) = -3s + 2. Does 5 divide q(-19)? False Suppose 4q + 4s + s = -46, -2q - 3s - 22 = 0. Suppose 3r - 6 = 3b, r = -2b + 4r + 1. Is 17 a factor of ((-30)/b)/((-2)/q)? False Suppose 15l = 4l + 792. Does 5 divide l? False Suppose o = 3o - 108. Is o a multiple of 13? False Let w(s) be the first derivative of -s3/3 + s2/2 - 2. Let n(r) = -5r2 + 4r + 2. Let f(q) = -n(q) + 2w(q). Is f(-2) a multiple of 5? False Let u be (-76)/(-28) + 2/7. Suppose -12 = -2t - 2i + 2, 5t - ui = 35. Suppose g - t + 2 = 0. Is 2 a factor of g? False Let x(o) = -o3 + 9o*2 - 6o + 11. Is 4 a factor of x(8)? False Suppose -2440 = -10n + 1030. Is n a multiple of 28? False Suppose 3l = -5i - 192 + 777, 370 = 3i - 2l. Is i a multiple of 15? True Suppose 0 = 3s - 13 - 2. Suppose -2p = -sa + 15, -4 + 1 = -3p - a. Is 8/(-4) + (p - -28) a multiple of 11? False Let g(d) = d3 - 9d*2 + 12d - 12. Is g(9) a multiple of 6? True Does 11 divide (-14 + 16)(-31)/(-1)? False Let b be (-2)/(-11) - (-124)/44. Suppose -5p + 22 = -bp. Does 9 divide p? False Suppose 0 = 34i - 31i - 96. Is i even? True Let h = -5 - -9. Suppose -2r + r = -h. Is 2 a factor of r? True Let w(d) = -d*2 + 8d - 8. Suppose 2f + 2 = 14. Let c be w(f). Suppose -4t - 3o + 19 = 0, -3t = -0t - co - 8. Does 3 divide t? False Suppose 4c + 6 - 86 = 0. Is 9 a factor of c? False Suppose -2a = -2b, -3a - 2b = -3b - 2. Let c = a + 20. Is c a multiple of 7? True Let a(y) = y*2 - 10y + 3. Let k be a(10). Suppose -32 = -4c + kr, -5c = r - 0r - 40. Is 8 a factor of c? True Suppose 0 = 5w + 3l + 46 - 184, -82 = -3w - 2l. Does 3 divide w? True Suppose -195 = 3h - 8h. Is 13 a factor of h? True Suppose 5 - 2 = m. Suppose -3r + 140 = -5t, -3r - mt + 63 = -93. Is 21 a factor of r? False Let f(b) = b*3 + 3b*2 - 2b. Let v = -3 + 0. Let y be f(v). Suppose -5m + 14 = -y. Is m a multiple of 3? False Let i(p) = p - 2p - 6p - 3. Is i(-2) a multiple of 5? False Suppose 2l + 8 = 0, 0z = z + 2l - 28. Is 18 a factor of z? True Let d(h) = h*2 - 4h - 7. Let p be d(5). Let i = p + 28. Does 7 divide i? False Let s be 16(0 - (-12)/3). Let k = 131 - s. Does 14 divide k? False Suppose 2160 = 5x + 430. Is x a multiple of 36? False Is (-9 - -14)(2 + 1) a multiple of 5? True Let u = 72 + 49. Does 38 divide u? False Suppose -3j + 0 = -9, 3j + 311 = 4a. Is 22 a factor of a? False Let l(d) = -20d3 - 2d*2 - 3d. Let f(r) = 21r3 + r2 + 2r. Let a(x) = 4f(x) + 3l(x). Let v be a(-1). Let c = -13 - v. Does 6 divide c? True Suppose -b - 32 = -3d - 95, 3d = 3. Is 15 a factor of b? False Let p = -7 - -9. Let x be (4/6)/(p/3). Is 9 - x - 0/(-2) a multiple of 4? True Let c = -8 - -118. Is 26 a factor of c? False Let z(k) = -2k3 - k. Let l be z(1). Let a = -3 - l. Suppose 0 = -4p - c + 30, ac = 2p + 3c - 20. Does 6 divide p? False Let x(d) = -17d - 10. Let k be x(-11). Suppose -240 = -4p + 4y, -95 - k = -4p - 4y. Does 16 divide p? True Does 30 divide ((-6)/9)/((-1182)/(-297) - 4)? False Let i be 1 - -2 - (-6)/(-6). Suppose g - 2 = ic, 4c - 5 = -2g + 7. Is 2 a factor of g? True Let p be 0 - (-2 - 2) - 2. Let c be -1 + (4 + -2 - p). Is 9 a factor of (-498)/(-24) + c/(-4)? False Let h = 5 + 2. Does 5 divide h? False Suppose 3 = 3x, 116 = -4h - 5x + 693. Does 23 divide h? False Suppose 2s - s = -3l, 0 = -4s + 2l. Let v(g) = -3g + 83. Let k(r) = 2r - 42. Let f(u) = 5k(u) + 3v(u). Is f(s) a multiple of 13? True Let u = 16 - 7. Suppose -16 = -5v + u. Suppose 2h + 116 = 5i, 0 = -2i - 0h + vh + 59. Does 7 divide i? False Let o = -17 + 41. Does 16 divide o? False Suppose b + b - 12 = 0. Let t(d) = -d*3 + 6d*2 + 5d + 2. Is 13 a factor of t(b)? False Suppose -4m - b = -2m - 76, -35 = -m + b. Let p = -9 + m. Is 11 a factor of p? False Let y = -8 - -10. Suppose 2k - 4k = yg - 2, -4k = -2g + 14. Suppose 20 + 118 = gl. Is l a multiple of 23? True Let z(s) = -s + 3. Let t be 1 + 0 - (2 - 4). Let j be z(t). Let f(o) = -o3 - o2 + o + 24. Does 21 divide f(j)? False Let a(c) = -c + 4. Let i be a(7). Does 7 divide ((-2)/(-6))/(i/(-234))? False Suppose 5x = 4u + 2 + 4, -5x + 5u = -5. Suppose v + 0v - xm = 9, -2v - 3m = -25. Does 4 divide v? False Let t = 0 - -3. Suppose 2v - 2h = 144, 5h + 91 = -3v + 299. Suppose tj - v = -17. Is j a multiple of 9? True Suppose 11 + 14 = 5q, -2q = 5g - 50. Suppose 0f + 3f - 4p + g = 0, 0 = 5f - p + 2. Does 10 divide 8 + 6/3 + f? True Suppose -2p + 18 + 70 = 0. Is p a multiple of 22? True Let s be ((-1)/3)/((-5)/(-30)). Is -1(s + 3) - -3 a multiple of 2? True Suppose 3c + 75 = 2c. Let l = 105 + c. Is l a multiple of 15? True Let x(m) = 2m2 - m + 64. Does 8 divide x(0)? True Suppose -3 = -4s - 11, 4*n - 210	{ "pile_set_name": "DM Mathematics" }
16n3 - 12 - 141n*2 wrt n? 72n2 Let h(a) = -a + 4. Let q(f) = -f3 + f*2 + 3f - 2. Let t be q(2). Let w be h(t). What is the derivative of wb - 2 + 3 + 3 - 6 wrt b? 4 What is the second derivative of 14y + 21y - 46y + 16y - 18y2 wrt y? -36 Let h(v) be the second derivative of -v7/504 + v6/90 - v4/12 - 4v. Let m(j) be the third derivative of h(j). What is the second derivative of m(b) wrt b? -10 Let u(d) be the second derivative of 9d7/14 - d4/6 - 11d. Find the third derivative of u(t) wrt t. 1620t*2 Let k(p) be the first derivative of 2p*7/7 - 2p*3 + 1. What is the third derivative of k(j) wrt j? 240j*3 Let m(g) = -56g*4 - 4g*2 - 3g + 2. Let s(q) = 55q4 + 5q*2 + 4q - 3. Let f(n) = -5m(n) - 4s(n). Find the second derivative of f(v) wrt v. 720v2 Let a(s) be the second derivative of -s8/6720 + s5/30 + 5s*4/12 - 2s. Let b(h) be the third derivative of a(h). Differentiate b(g) with respect to g. -3g2 Let g(x) be the second derivative of -7x6/120 + x5/10 - 7x2/2 - 2x. Let q(a) be the first derivative of g(a). Find the third derivative of q(b) wrt b. -42 Differentiate -11f - 3f*2 + 3 + 11f wrt f. -6f Let y(c) = 13c*3 + 42c*2 + 11c - 11. Let s(f) = 7f3 + 21f*2 + 6f - 6. Let u(p) = 11s(p) - 6y(p). What is the third derivative of u(l) wrt l? -6 Let o = 0 + 2. Find the third derivative of 0d + d2 + od - d*3 - 2d wrt d. -6 What is the derivative of -3w - 5 + 3w + 3 + 3w2 wrt w? 6w Let i(k) be the second derivative of 0k3 + 0k*2 - 1/6k*4 + 0 + k + 1/5k5. Find the third derivative of i(m) wrt m. 24 Let p(d) be the first derivative of -d7/70 - d*4/24 - 3d*2/2 - 2. Let o(l) be the second derivative of p(l). What is the second derivative of o(a) wrt a? -36a2 Let c(m) be the first derivative of m5/4 + m*4/12 + 3m - 1. Let r(w) be the first derivative of c(w). What is the third derivative of r(b) wrt b? 30 Let j be -2 + (7 - (-1 + 2)). Find the third derivative of -x*4 + 0x*4 + 4x6 + xj - 3x2 wrt x. 480x*3 Let s(l) be the third derivative of 0l*5 - 1/210l*7 - 2l*2 + 0 + 0l + 0l6 + 0l*3 - 1/24l*4. What is the second derivative of s(d) wrt d? -12d2 Let g(w) = -w2 - 6w - 1. Let m(c) be the first derivative of c3/3 + 7c*2/2 + c - 2. Let z(d) = -7g(d) - 6m(d). What is the derivative of z(r) wrt r? 2r Let f(p) = 3p3 - 4p*2 + 1. Let h(u) = 10u*3 - 11u*2 + 4. Let b = 15 - 11. Let g(y) = bh(y) - 11f(y). Differentiate g(w) wrt w. 21w*2 Let g(v) = 4v*4 - 3v*3 + 9v*2 + 10v - 14. Let s(y) = y4 + y3 - y*2 - 2y + 1. Let d(j) = -g(j) - 5s(j). What is the third derivative of d(t) wrt t? -216t - 12 Let d(b) = 11b3 + 2b*2 + 24. Let q(x) = -56x*3 - 11x*2 - 120. Let w(o) = 11d(o) + 2q(o). Differentiate w(f) wrt f. 27f2 Let w(j) be the first derivative of -j4/24 + j3/6 + j2/2 - 2. Let u(r) be the second derivative of w(r). Find the first derivative of u(a) wrt a. -1 Let t(j) be the second derivative of 7j4/12 + 8j3/3 + j. Find the second derivative of t(o) wrt o. 14 Let s(h) = h4 - 7h3 + h. Let d(z) = 2z3. Let p(t) = t2. Let v be p(-2). Let o(f) = vs(f) + 14d(f). What is the second derivative of o(j) wrt j? 48j2 Let t(k) = -4 - 3k*3 - 3k4 + k3 - 2k3 - k3 + 5k. Let n(p) = -4p4 - 8p*3 + 8p - 6. Let v(m) = 5n(m) - 8t(m). Differentiate v(w) wrt w. 16w3 Let o = -6 + 15. Suppose 1 + o = 5t. What is the derivative of 5 - t - b + 0b + 2b wrt b? 1 What is the third derivative of -7i2 + 0i*3 + 6i*3 - 5i3 wrt i? 6 Let b(z) = z3 - z*2 - 2z + 3. Let s be b(2). Find the first derivative of -5n3 + 0 + 8n*s + 2 wrt n. 9n2 Let f(p) be the third derivative of -p8/42 + 7p5/60 - 8p*2. What is the third derivative of f(x) wrt x? -480x2 Let j(g) be the second derivative of -g6/10 + 7g2/2 - 3g. Differentiate j(i) wrt i. -12i3 Let k(j) be the first derivative of -3j*2/2 + 2j - 4. Differentiate k(y) wrt y. -3 Suppose -2d = -4i + 8i - 6, -4d - 18 = -2i. Let v be (d/(-2) - 0)2. What is the second derivative of 2h - h - 2h + vh + 3h*2 wrt h? 6 What is the second derivative of 3o*4 - 6o + 5o + 6o*2 - 13 - 12 + 2o wrt o? 36o2 + 12 Let q(i) be the second derivative of i5/5 - 29i*2/2 + 35i. What is the derivative of q(u) wrt u? 12u2 Let h(s) = 8s*3 - 3s - 3. Let x(v) = -9v3 + 2v + 4. Let p(j) = -4h(j) - 3x(j). What is the second derivative of p(r) wrt r? -30r Let h(v) = -6v*3 - 9v - 4. Let m(x) = 5x3 + 8x + 3. Let n(a) = -3h(a) - 4m(a). What is the second derivative of n(r) wrt r? -12r Let p(r) be the first derivative of 3r*3 + 7r - 1. What is the first derivative of p(a) wrt a? 18a Let b(h) be the second derivative of 3h*5/10 + 3h*2 - 5h. What is the first derivative of b(g) wrt g? 18g2 Suppose -5s - o = 4o - 10, 3s - 1 = 2o. Find the first derivative of -s + 7 - 7 - 2v*2 wrt v. -4v Let q(d) be the first derivative of d*6/20 + 5d*3/6 - 5d*2/2 - 3. Let k(c) be the second derivative of q(c). What is the derivative of k(f) wrt f? 18f*2 Let x(c) be the first derivative of -12c*7/7 - 2c*3 - 17. Find the third derivative of x(j) wrt j. -1440j*3 Suppose 0 = 5o + 2b + 7, b - 3 = 7o - 3o. Let c(y) = -4y + 1. Let j(z) = 0z - 1 + z - z + z. Let s(n) = oc(n) - 3j(n). Differentiate s(p) wrt p. 1 Let b(y) = -y2 - 3y + 2. Let k be 3 + -4 - (-4)/(-2). Let q be b(k). Find the second derivative of 0p - pq + 2p - 3p wrt p. -2 Let r(h) = h - 1. Suppose 2j = v, j - v = -0j + 2. Let t(o) = o - 3. Let k(z) = jr(z) + t(z). What is the first derivative of k(x) wrt x? -1 Suppose -2s + 2t = -3s + 13, -4t = -20. Find the third derivative of -3qs + 3q*2 - 29q + 29q wrt q. -18 Let c(k) = -k2. Let f(h) be the second derivative of -3h5/10 - h4/4 + 5h. Let z(g) = -5c(g) + f(g). What is the third derivative of z(r) wrt r? -36 Find the first derivative of 34 + o3 + o3 - 14o3 - 21o*3 wrt o. -99o2 Find the first derivative of -b2 + 44b3 + b2 + 91 - 121 wrt b. 132b*2 Let g(p) be the first derivative of -3p*7 + 20p*3/3 + 11. What is the third derivative of g(a) wrt a? -2520a*3 Let d be (3 - 1)/(8/12). What is the second derivative of 4m*d - 6m + 2m + m wrt m? 24m Let m(l) = 4l3 - l + 1. Let q be m(1). What is the second derivative of -qo*3 + 12o*2 - 3o - 12o2 wrt o? -24o Let w(c) be the third derivative of 0 - 1/6c4 + 0c + c*3 + 4c*2. What is the derivative of w(g) wrt g? -4 Let q(y) be the first derivative of 7y*3/3 - 10y - 4. Find the first derivative of q(x) wrt x. 14x Let y(i) = -18i4 + i2 + 14. Let k(j) = j*2 - 1. Let c(s) = -k(s) + y(s). What is the derivative of c(q) wrt q? -72q*3 Let v(a) = 33a*4 + 111. Let t(z) = -50z*4 - 167. Let u(l) = -5t(l) - 8v(l). What is the first derivative of u(m) wrt m? -56m*3 Suppose -3r - 6 = -3k, 4k = 11 + 5. Let m = 1 + 1. Differentiate -s - 2sr - m + s wrt s. -4s Let j(q) = -117q2 - 9q - 68. Let v(w) = -58w2 - 4w - 33. Let k(c) = -4j(c) + 9v(c). Differentiate k(m) with respect to m. -108m Let v(k) be the first derivative of 7k*4 - 6k*3 - 35. What is the third derivative of v(d) wrt d? 168 Let q be (0 + -2 + 6)/2. Suppose 8o - 30 = 3o. Find the third derivative of 3h*6 + 0h*2 - 2h*o + qh*2 wrt h. 120h3 Let z(o) = -o4 + 4o3 + 4o*2 + o. Suppose 5m + 2 = -18. Let k(y) = y3 + y2 - y. Let d(p) = mk(p) + z(p). Find the second derivative of d(a) wrt a. -12a*2 Let f(g) = -14g*3 - 4g*2 - 3g + 4. Let a(w) = 29w3 + 7w*2 + 6w - 7. Let v(y) = -4a(y) - 7f(y). What is the second derivative of v(h) wrt h? -108h Let d be (-1)/(-2) + 1/(-2). Suppose d = -2g - 3q + 22, -3g + 23 = q + q. What is the second derivative of 8j5 - 3j - 6jg + j wrt j? 40j3 Let t(s) = -s3 + 5s2 - 2s - 4. Let k be t(4). What is the third derivative of 0o2 + 26o*4 - 32ok - o2 wrt o? -144o Let p(l) = -3l*3 - 2l*2 - 4l - 4. Let g(f) = -f - 1. Let v(a) = -12g(a) + 3p(a). What is the third derivative of v(i) wrt i? -54 Suppose 3d = 2d - 4*c, d = -c. What is the second	{ "pile_set_name": "DM Mathematics" }
x be g(-150). Factor 160/3j - 2j*x + 0 - 2/3j*4 + 16j*2. -2j(j - 5)(j + 4)*2/3 Let b be 2/(-4 + 2)(-10 + 65). Let h(q) = 2q + 114. Let k be h(b). Factor 1/5g*3 - 3/5g*2 - 2/5 - g + 1/5g*k. (g - 2)(g + 1)*3/5 Factor -43l*4 + 8l*3 + 6l*5 + 19l*4 + 32l*5 - 56l*4 + 0l*5. 2l*3(l - 2)(19l - 2) Suppose 15n + 224 = 254. Let s be (-1)/(-4) - 66/(-56). Determine k, given that 2/7 + sk*3 + 22/7k*2 + nk = 0. -1, -1/5 Let o(w) be the third derivative of -18w2 + 0w*5 + 0w + 0 + 1/3420w6 + 0w*4 - 1/3w*3. Let g(y) be the first derivative of o(y). Factor g(q). 2q*2/19 Let c = 283730 - 3688480/13. Suppose -48/13 - ck + 2/13k2 = 0. Calculate k. -3, 8 Let q(l) be the first derivative of -2l*3/57 - 17l*2/19 + 168l/19 - 10564. Factor q(p). -2(p - 4)(p + 21)/19 Let g(w) be the third derivative of -w*5/120 + 5w*4/16 - 3w*3 - 1132w*2. Find p, given that g(p) = 0. 3, 12 Let i = 3/10235 - -10211/81880. Let g(v) be the first derivative of 0v + iv3 - 45 - 3/4v*2. Factor g(b). 3b(b - 4)/8 Let j(z) = -5z*4 + 2z*3 + 12z*2 - 21. Suppose -6 = -7a + a. Let f(o) = o4 + o3 + o*2 - 1. Let u(w) = aj(w) + 6f(w). Factor u(d). (d - 1)(d + 3)*3 Suppose 0 = -7n + 5n + 8. Find r, given that 12r*2 + 5r*n + 410r - 27 - 428r - 2r*4 - 4r*4 + 2r*3 = 0. -3, -1, 3 Factor -45/2 + 1/4z*2 - 9/4z. (z - 15)(z + 6)/4 Suppose 0 = -134q - 59q - 65q. Let x(l) be the third derivative of 18l2 + ql + 0 - 1/20l5 + 1/2l*4 - 2l3. Let x(o) = 0. What is o? 2 Let s(c) be the first derivative of -c5/30 + 49c4/48 - c3 - c2 - 36c - 98. Let x(b) be the second derivative of s(b). Factor x(i). -(i - 12)(4i - 1)/2 Let n(t) be the second derivative of t*5/30 - 337t*4/18 + 671t*3/9 - 335t*2/3 - 1688t. Determine c so that n(c) = 0. 1, 335 Let n(d) be the third derivative of 1/72d4 + 98d*2 - 1/180d*5 + 0d + 0 + 1/18d3 - 1/360d6. Determine v so that n(v) = 0. -1, 1 Let r(d) be the second derivative of d6/30 - 65d5/4 + 11663d*4/4 - 1223743d*3/6 - 1295029d*2 + 2055d. Factor r(y). (y - 109)*3(y + 2) Let x(g) be the third derivative of g*6/480 + 5g*5/6 - 67g*4/32 + 101g*2 - 3g. Suppose x(o) = 0. Calculate o. -201, 0, 1 Let 110/7g2 + 104/7g + 2/7g3 - 216/7 = 0. What is g? -54, -2, 1 Suppose 232 = 19l - 14607. Let m be (l/(-77) - -2) + 11. Suppose -md + 8/7 - 4d*2 = 0. What is d? -1, 2/7 Let f(o) be the first derivative of -2/45o*3 - 4/15o - 24 + 1/5o2. Factor f(v). -2(v - 2)(v - 1)/15 Let q(f) = 1233f + 34524. Let j be q(-28). Determine c so that j + 6/5c2 - 6/5c*4 + 0c + 3/5c3 - 3/5c*5 = 0. -2, -1, 0, 1 Let r = -518 + 468. Let o be (-20)/r25/15. Factor -og2 - 4/3 - 2g. -2(g + 1)(g + 2)/3 Let p be 0 + (4 + (7 - 2) - 4). Let u(j) = 36j2 - 20j - 6. Let l(z) = -37z2 + 18z + 5. Let g(i) = pu(i) + 6l(i). Determine v, given that g(v) = 0. 0, 4/21 Let q(w) be the first derivative of w*4 + 88w*3/3 - 480w*2 - 1013. Find d such that q(d) = 0. -30, 0, 8 Suppose -32q + 1603 = 1539. Let l(g) be the second derivative of 0gq - 3/50g*5 - 2/15g*4 - 18g + 0 + 4/15g3. Find j such that l(j) = 0. -2, 0, 2/3 Suppose 0 = 13u + 65 - 143. Factor -86 + 45x + 22 + 38 + 26 - ux*2. -3x(2x - 15) Let w(h) be the second derivative of 2h5/15 + 5381h*4/18 + 1807678h*3/9 - 452929h*2 + 4h + 88. Solve w(l) = 0 for l. -673, 3/4 Let t(f) = f4 + f3 - f*2 - f + 1. Let j(a) = 2a*5 + 32a*4 + 98a*3 + 86a*2 - 2a + 2. Let v(q) = j(q) - 2t(q). Suppose v(b) = 0. Calculate b. -11, -2, 0 Factor 5/3o - 2/3o2 - 1/3o*3 + 2. -(o - 2)(o + 1)(o + 3)/3 Let h(f) be the second derivative of -7f*7/30 - 287f*6/150 - 197f*5/100 + 71f4/60 + f3 + 3561f. Determine m so that h(m) = 0. -5, -1, -2/7, 0, 3/7 Let o(f) = f4 + 48f*3 - 285f*2. Let v = 148 - 145. Let c(m) = 3m*4 + 96m*3 - 569m*2. Let u(q) = vc(q) - 7o(q). Suppose u(j) = 0. What is j? 0, 12 Suppose 6m + 13 = h + 4m, 0 = 2h - m - 11. Suppose 3p - 7 = 4u - hu, -5u = 5. Factor -22f + 16f + 0f2 - 3f*p. -3f(f + 2) Let r(y) = -13y + 26. Suppose -92 = -28l - 18l. Let f be r(l). Let -10/3w3 + f + 20/3w + 46/3w2 = 0. Calculate w. -2/5, 0, 5 What is o in -120/7 - 164/7o*2 - 4/7o*4 + 244/7o + 44/7o3 = 0? 1, 2, 3, 5 Let f(v) = 2v*2 + 68v + 71. Let h be f(-33). Determine b, given that -hb2 - 20b*3 + 4b*2 + 56b - 32 + 24b + 9b*2 = 0. -2, 2/5, 2 Let n(g) be the second derivative of -11/6g*3 + 1/120g*5 + 4g + 0g2 + 0 - 1/90g*6 + 0g*4. Let h(t) be the second derivative of n(t). Factor h(w). -w(4w - 1) Let q be 0(119/238)/((-14)/4). Solve 0u3 - 2u*4 + 0 + qu + 2/3u5 + 8/3u*2 = 0. -1, 0, 2 Let m = 2/22595 - -22583/135570. Let g(f) be the third derivative of -4f*2 + 1/4f*4 - 3f*3 + 1/60f*6 + mf*5 + 0 + 0f. What is d in g(d) = 0? -3, 1 Let j = -1676 - -1715. Let a be 3 + (1/3)/((-13)/j). Factor -3/7 + 11/7y + 4/7y*a. (y + 3)(4y - 1)/7 Let z = 2789 - 2785. Let f(a) be the third derivative of 10/3a*3 + 10a*2 - 1/12a*5 + 0a + 0az + 0. Suppose f(u) = 0. Calculate u. -2, 2 Let p be ((-12)/(-98))/((-5469)/(-51044)). Factor -248/7u - 1922/7u2 - p. -2(31u + 2)2/7 Let c(t) be the second derivative of 3t*5/140 - 47t*4/28 + 88t*3/7 - 258t*2/7 - 7t + 8. Factor c(s). 3(s - 43)(s - 2)*2/7 Let k = -21092 - -21094. Let -4/7 - 10/7t*k - 2t = 0. What is t? -1, -2/5 Let h = 2138 + -2136. Let l(q) be the second derivative of 0 - 8/9q3 - 1/9q*4 + 9q - hq2. Factor l(g). -4(g + 1)(g + 3)/3 Let h(n) be the second derivative of -n6/75 + n5/50 + 4n*4/5 + 12n*3/5 + 361n + 2. Solve h(m) = 0 for m. -3, -2, 0, 6 Let z(y) = 4y2 + 12y + 4. Let q(v) = 11v + v + 0v*2 + 3 + 4v*2. Let a be 124/40(-50)/15. Let c(r) = aq(r) + 5z(r). Suppose c(f) = 0. What is f? -2, -1 Let t be (18/(-21))/(18/(-84)). Factor -94g*2 - 288g + tg5 - 6g*3 + 12g*4 - 34g*3 - 114g*2 - 419 + 291. 4(g - 4)(g + 1)(g + 2)*3 Suppose 217g = -260g + 245 + 709. Let k(j) be the second derivative of -7/80j*5 - 1/12j*3 + 22j + 0 - 3/16j4 + 0j*g. Factor k(u). -u(u + 1)(7u + 2)/4 Let l be (-12)/20 - ((-78)/10)/3. Factor 51q - 113q + 62q + 4q*3 - 36q*l. 4q*2(q - 9) Let c be (-1 + 3)/((-8)/(-3)). Let g(t) = 24600t + 196803. Let s be g(-8). Solve 3/4i*4 - 1/4i + 5/4is - ci2 + 0 - i5 = 0 for i. -1, -1/4, 0, 1 Let x(u) be the third derivative of -u*6/120 - 42u*5/5 + 505u*4/24 + 4794u*2. Find v, given that x(v) = 0. -505, 0, 1 Let k be -2(3/63 - 0). Let x(i) = -7i + 13. Let t be x(k). Suppose -32p3 - p5 + 4p*4 + t + 17p + 30 + 47p - 32p*2 + 5p*5 = 0. What is p? -2, -1, 2 Determine k so that 77 + 404k - 571k2 - 26k*4 + 879k*2 + 76k*3 + 91 + 52k*4 - 22k*4 = 0. -14, -3, -1 Let o(g) be the first derivative of -5g*3/12 + 5245g*2/8 + 2625g/2 - 7700. Determine v, given that o(v) = 0. -1, 1050 Let w(z) be the second derivative of z*4/4 - 9z*3/2 - 105z*2 - 1755z. Factor w(t). 3(t - 14)(t + 5) Let s(d) be the second derivative of -d*5/40 - 119d*4/32 - 785d*3/48 - 87d*2/8 + 2940d. Factor s(u). -(u + 2)(u + 87)(4u + 1)/8 Let d(t) = 2t*3 - 6t*2 - 9t - 7. Let r be d(8). Let f = 2259/4 - r. Factor -fk2 - 3/8k*3 + 0 - 75/8k. -3k(k + 5)*2/8 Suppose -23z + 13z = -230. Factor -9 - zh - 12 - 22h2 - 5h*3 + 15. -(h + 1)(h + 3)(5h + 2) Let l = 50407/151239 - -2/50413. Let n(s) be the second derivative of 24s2 + 0 + 16/3s*3 + ls*4 - 23s. Suppose n(w) = 0. Calculate w. -6, -2 Let l = -3097 + 3097. Let a(o) be the second derivative of 0o2 + 1/3o*4 + l - 10o - 4/3o3 + 1/5o*5. Solve a(q) = 0 for q. -2, 0, 1 Suppose -7q + 1213 = 1199. Let x(s) be the second derivative of -1/8s3 + 12s + 0 + 9/16sq - 1/32s*4. Factor x(o). -3(o - 1)(o + 3)/8 Let c = -260929 + 260932. Determine d, given that -22/5d*2 + 28/5 + 4/5d*c - 46/5d = 0. -2, 1/2, 7 Determine r so that 42/5 + 531/5r + 489/5r*2 = 0. -1, -14/163 Let g be (-3040)/(-2926) + 36/(-198). Factor -48/7 + 44/7h*2 + 40/7h + gh3. 2(h + 2)(h + 6)(3*h - 2)/7 Let y(a	{ "pile_set_name": "DM Mathematics" }
? -3p2 - 2p - 25 Let j(y) be the second derivative of 0 + 1/6y4 + y2 + 5/6y*3 - 20y. Let x(l) = 6l2 + 14l + 6. Determine 8j(q) - 3x(q). -2q2 - 2q - 2 Let y(u) = -5u - 2 + 0 + 7 + 6u*2. Let a be (3/(-6))/((-2)/32). Let z(q) = aq + 7 + 3q2 - 4 - 11q. Give 3y(t) - 5z(t). 3t2 Let m(p) = -2p*3 + 3p*2 - 28p + 2. Let o(l) = -l*2 - l - 1. Determine m(s) + 4o(s). -2s3 - s2 - 32s - 2 Let c(g) = -8g - 6g + 2g + 4g. Let a(u) = -3u + 2. Let d(x) = -39x + 27. Let l(o) = -27a(o) + 2d(o). What is -2c(s) - 7l(s)? -5s Let l(y) = 5y + 4. Let t(i) = -13i - 6. Let c(u) = 19u + 8. Let h(s) = -5c(s) - 8t(s). Determine 6h(q) - 11l(q). -q + 4 Let g(t) = 36t + 15. Suppose -2n = -5c + 20, n + 24 = -3c + 3. Let r(h) = -5h - 2. Give nr(l) - 2g(l). 3l Let d(j) = -5j + 4. Let s(q) = -q3 + 6q*2 + 7q - 5. Let o be s(7). Let l(i) be the first derivative of -2i2 + 3i - 23. Give od(x) + 6l(x). x - 2 Let l(v) = -4v. Let f(h) = 3h. Let n(s) = 6s - 34. Let r be n(5). Suppose -2c - 3u = 17 + 5, 35 = -3c - 5u. What is cf(i) + rl(i)? i Let r(h) = -11h + 13. Let o(u) be the first derivative of -2u2 + 4u + 124. Determine -8o(b) + 3r(b). -b + 7 Let i(s) = s*2 + s - 1. Let t(m) = -3m + 3. Suppose -3p = g - 2p + 1, g - 2p = 5. Suppose -8 + 2 = -2y. Determine gt(b) + yi(b). 3b2 Let m(a) = 10a2 - 62. Let l(z) = -z3 + 10z2 - 9z + 12. Let r be l(9). Let q(j) = 4j2 - 25. What is rq(f) - 5m(f)? -2f*2 + 10 Let u(s) = 9s*2 - 68s + 28. Let v(p) = -p*2 - p - 7. Calculate -u(n) - 4v(n). -5n2 + 72n Let c(y) = -3y + 2. Let n = -10 - -10. Suppose -9u + 8u - 3 = n. Let k(i) = 4i - 3. Let g = 4 - 6. Give gk(p) + uc(p). p Let q(x) = 21x3 - 22x*2 - 10x + 624. Let c(k) = -4k3 + 4k*2 + 2k - 125. Give 11c(o) + 2q(o). -2o3 + 2o - 127 Let r(t) = 12t. Let q(z) = 4z - 14. Let n(m) = -m + 6. Let f(b) = -7n(b) - 3q(b). Calculate -10f(j) - 5r(j). -10j Let p(y) = -169. Let b(o) = -o - 848. Give 2b(q) - 11p(q). -2q + 163 Let l(u) = 5u3 - 6u*2 - 6u + 7. Let t(v) = 6v3 - 7v*2 - 6v + 8. Calculate -7l(q) + 6t(q). q*3 + 6q - 1 Let b(g) = -5g3 - 3g*2 + 3g - 3. Let c(o) = 3o3 - o + 38o*3 - 40o3 + o2 + 1. Suppose -3 + 2 = -l. Give lb(u) + 3c(u). -2u3 Let r(w) = 31565w + 1003. Let g(p) = -189p - 6. What is 1003g(h) + 6r(h)? -177h Let w(h) = 7h3 - 9h*2 - 9h + 11. Let a(u) = 4u2 - 2u*3 - 1 - 4 + 4u - u*3. Give -9a(v) - 4w(v). -v3 + 1 Let l(p) = p3 + p2 - 1. Let f(m) = -33m*3 - 6m*2 - m + 3. Calculate f(g) + 5l(g). -28g3 - g2 - g - 2 Let v(p) = -3. Let f(s) be the second derivative of s3/6 - 2s*2 - 9s + 10. What is 3f(j) - 3v(j)? 3j - 3 Let f(l) = l - 5. Let v(a) be the second derivative of a3/6 - 2a*2 - 179a. Suppose -3k + 6 = -3o, -o + k - 23 = 3o. Determine ov(g) + 6f(g). -g - 2 Let p(i) = -i2 - 3i + 1. Let b(w) = -57w2 + 63w - 21. Determine 5b(k) + 105p(k). -390k2 Let j(v) = -v + 1. Let r(z) = -2z*2 - 3z + 4. Suppose -t + 2q = t - 12, 26 = t - 5q. Give tr(n) - 4j(n). -2n2 + n Let r(w) = 2w*2 + 1. Let i(n) = n + 1. Suppose 2y + 1 = -2y + b, 0 = -5y + 5b + 10. Determine yr(k) + 2i(k). -2k*2 + 2k + 1 Let i(b) = -2b + b + b3 - 3b*2 + 7 - 6. Let t be i(3). Let x(n) = -4n + 1. Let f(s) = 5s - 8s - 2s. Give tf(q) + 3x(q). -2q + 3 Let f(l) = -l + 3l + 0 - 2. Let b(j) = 29 + 26 + 29 - 83. Calculate -5b(g) - f(g). -2g - 3 Let u(o) = 3o*3 + 3o + 10. Let w(n) = -n + 1. Calculate -u(v) - 3w(v). -3v*3 - 13 Let u(n) = -14n*2 - 7n. Suppose 66 = 12q - 18. Let f(c) = 5c*2 + 2c. Give qf(y) + 2u(y). 7y2 Let h(i) = -235i*3 + 5i*2 + 18i + 9. Let f(t) = 59t3 - t2 - 4t - 2. Calculate 9f(u) + 2h(u). 61u3 + u2 Let w(d) = -3d*2 - 11d - 8. Let y(c) = c*2 + 4c + 3. Let j be (-30 + 36)/(6/8). What is jy(u) + 3w(u)? -u*2 - u Let z(f) = -2f - 3. Let v be 5(-18)/15 - -1. Let q(g) = -2g - 2. Calculate vz(h) + 6q(h). -2h + 3 Let z(s) = 4s*2 + 7s - 91. Let i(p) = -2p2 - 3p + 45. Determine -9i(c) - 4z(c). 2c2 - c - 41 Let t = -2 - 2. Let w(l) be the third derivative of -7l*4/24 + 7l3/6 - l2 + 1. Let n(a) = 3a - 3. Determine tw(k) - 10n(k). -2k + 2 Let j(u) = -12u - 20. Suppose 0s - 21 = -s + 4r, -5r = 5. Let v(m) = 4m + 7. Calculate sv(o) + 6j(o). -4o - 1 Let w(y) = 2y3 - 6y2 + 7. Let t(m) = -m3 + 5m2 - 7. Determine 5t(o) + 4w(o). 3o3 + o2 - 7 Let v = 1471 + -1474. Let y(w) = -w + 5. Let b(k) = -5. Determine vb(j) - 2y(j). 2j + 5 Let u(i) = -i2 + 1. Let n = 143 + -138. Let x(o) = 4o*2 - 5. What is nu(r) + x(r)? -r*2 Let i(z) = -16z3 - z2 + 31z + 11. Let m(r) = 28 - 71r*3 - 6r + 74r3 - 30. Give -2i(u) - 11m(u). -u3 + 2u*2 + 4u Let b(a) = 23a3 - 7a*2 - 7a. Let s(h) = -4h3 - 11h*3 + 5h*2 - 3609h + 3614h. Give 5b(c) + 7s(c). 10c3 Let h(v) be the third derivative of -v5/20 + v4/8 - v3/3 + 22v2 + 6. Let n(r) = -2r*2 + 2r - 2. Calculate 4h(k) - 5n(k). -2k2 + 2k + 2 Let x(h) = 2h3 - h2 - h - 1. Let i(q) = -10q3 - q2 + 8q + 4. What is i(a) + 6x(a)? 2a3 - 7a*2 + 2a - 2 Let z(i) = -7i3 - 38. Let n(a) = a3. What is 3n(l) + z(l)? -4l3 - 38 Let m(b) = -5b*2 + b - 12. Let i(d) = -9d*2 + 2d - 21. Let l(u) = 4i(u) - 7m(u). Let p(s) = 4s2 - s - 1. Calculate l(j) + p(j). 3j*2 - 1 Let l be 18(-85)/(-51)(-2)/(-10). Let k(p) = -4p*3 + 6p*2 - 4p - 1. Let x(d) = 11d3 - 17d*2 + 11d + 3. Calculate lx(z) + 17k(z). -2z3 - 2z + 1 Let c(u) = 3u2 + 2u + 1. Let m(h) = -11 + 30 - 10 - 8. Determine -c(v) + 3m(v). -3v*2 - 2v + 2 Let y(j) = -5j2 + 172. Let p(x) = 9x*2 - 343. What is -6p(m) - 11y(m)? m2 + 166 Let b(a) = -6a - 1. Let w(q) = -q. Suppose -r = -5v + 45 - 68, -3r = 3v + 3. Give vw(i) + b(i). -2i - 1 Let o = 27 + -27. Suppose -4p + op = -20. Let n(a) = a. Let r(q) = 6q + 2. What is pn(b) - r(b)? -b - 2 Let b(f) = 13f + 5. Suppose -3k + x + 18 = 0, 3k - 5x + 0x - 30 = 0. Let i(r) = -7r - 3. Calculate ki(s) + 3b(s). 4s Let f(w) = w*3 + 11w*2 + 3w + 11. Let j(t) = -t*3 - 21t*2 - 5t - 22. What is -5f(b) - 3j(b)? -2b3 + 8b*2 + 11 Let p(q) = -3q + 1. Suppose -14 = 2h - 16. Let o = 0 - -5. Suppose -w + oz = -3w - h, 4z = 4. Let c(m) = 2m - 1. Give wp(l) - 5c(l). -l + 2 Let m = -33 + 33. Let s(p) = mp2 - 2 + 2 + 3 + p2. Let q(l) = l*3 + 3l*2 + 8. Calculate 3q(g) - 8s(g). 3g3 + g2 Let r(p) = -4p - 2. Let d be (5/(-30))/((-1)/12). Let l(z) = -21z - 9. What is dl(b) - 11r(b)? 2b + 4 Let c(h) = 2h3 - h + 1. Let t(y) = y3 - 15y2 - 3y. Calculate c(o) - t(o). o*3 + 15o*2 + 2o + 1 Let z(t) = 2t2 + 11t - 47. Let l be z(3). Let f(i) = -5i - 4. Let c(b) = -6b - 4. Determine lc(u) - 5f(u). u + 4 Let i(p) = -p - 3. Let o(t) = t*2 - 37t + 255. Let v be o(9). Let m(l) = -2l - 5. Calculate vm(s) - 5i(s). -s Let k(d) = -5d + 155. Let x(y) = 17y - 466. Give -7k(s) - 2x(s). s - 153 Let l(x) = 5x + 5. Let u(t) = -t*2 - 9t - 9. Give 5l(z) + 3u(z). -3z2 - 2z - 2 Suppose -5c = 2u + 42, u + 13 = -c - 4u. Let t be (-2)/(-4) - 4/c. Let i(n) = n2 - 1. Let w(g) = -3g*2 + 4. What is tw(b) + 4i(b)? b2 Let j(n) = 6n + 44. Let k(t) = 8t + 67. What is 7j(r) - 5k(r)? 2r - 27 Let i(p) = 6p2. Let f(h) be the third derivative of h5/20 + 2h*2 + 28h. Suppose 0 = -4s + 2 + 10. Give si(t) - 5f(t). 3t*2 Let w(n) = 9n*2 - 3n + 1. Let k(i) = -16i2 + 6i - 2. What is 6k(z) + 11w(z)? 3z2 + 3z - 1 Let k(q) = -24q + 5. Let h(s) = 21s - 5. Give -5h(y) - 4k(y). -9y + 5 Let v(r) = -3r + 8. Let s(d) = 2d - 7. Let o(n) = -4n*2 + 32n - 22. Let g be o(7). Calculate gs(u) + 5v(u). -3u - 2 Let z(y) = y - 1. Let l(r) = 9r*2 - 2 + 6r - 9r2 + 4r*2 - 6r*2. What is l(g) - 3z(g)? -2g2 + 3g + 1 Let d(i) = -i2. Let u = -3 + 2. Let r(b) = -b2 - 2. Let n(q) = -q*3 - 93q*2 - 268q + 184. Let t be n(-90). What is td(h) + ur(h)? -3h2 + 2 Let t(i) = 2. Let b(y) = 13y*2 + 4y - 7. Calculate -b(a) - 3t(a). -13a*2 - 4a + 1 Let x(o) = 1. Le	{ "pile_set_name": "DM Mathematics" }
/(-3) + 2/t. Suppose -4x = -x - 18. Solve 0 = vu - a - 8, -4u - xa + 18 = -a for u. 2 Suppose -28b + 224 = 28b. Solve 0 = -5l + br - 41, -17r + 12r = 5l + 5 for l. -5 Let x(i) = -3i - 43. Let s be x(-16). Let c(h) = -44h + 223. Let b be c(s). Solve -3z - 4 = 4k - 0, -bk - 5z - 3 = 0 for k. -1 Suppose -115 - 4 = -11w - 6w. Solve 3 = q, 6q + 3 = -4j + wq for j. 0 Let m(k) = 3k + 49. Let o(f) = -f2 + 3f + 2. Let s be o(5). Let t be m(s). Solve -5i - 2a = -2i - 11, 5i = -5a + t for i. 1 Let o = -3977 + 3996. Solve -n - 11 = 3i, -5i - n = o - 0 for i. -4 Suppose -2866x + 16 = -2858x. Solve -22 = -xm + 3r, -3r + 37 = 5m - 6r for m. 5 Suppose -3c + 14 = p, -p + 6 = -c + 2c. Let f be ((-30)/105)/(p/(-98)). Solve -x - f = -5v, -2v - 2x = 1 - 9 for v. 3 Let p(h) = 6h + h*3 - 1 - 5h*2 - 8h*2 + 6h - 2. Let c be p(12). Let j be 16 + (-2 - 6/c). Solve -8 = -4l - 5z - 25, 0 = -5l - z - j for l. -3 Suppose 68p + 63 = 89p. Solve -2z - 7 = 3d + 3, pd = 2z + 10 for d. 0 Let m be 4/6(4 - -2). Let f be (-23)/(-4) + -6 - (2 - 121/4). Solve 0 = 4b + mp + f, -3p + 7 = -5b - p for b. -3 Suppose -2v - 2j + 44 + 162 = 0, v + 4j - 112 = 0. Let m be v6/156 - (-4)/26. Let t = -3 - -6. Solve -i - tf + f = 13, 0 = mi - 5f - 13 for i. -3 Let j be (-17 - 2075/(-100))/(3/4). Suppose 0 = 3v + 15, -5 = -5a + v + 30. Let y be (a/(-5))/((-1)/5). Solve -q + 4w + j = 0, 2w = -yq + q + 25 for q. 5 Suppose u = -r - 7 + 9, 11 = 3u - 2r. Solve -10 = -2s, -2v - 19 = -uv - 3s for v. 4 Suppose -2w + x + 3 = -5w, -5x = -2w + 15. Suppose wh = -4h + 8. Suppose -z = -2u + 12, 0 = -u - 5z + 4z. Solve -2n = b - 11, hb - u + 2 = n for n. 4 Let i be (136 - 121)/((-1)/4 + 39/12). Solve 2o - ic = 7, -3 = -4o - 3c - 2 for o. 1 Let l(b) be the third derivative of b4/8 + 17b*3/6 - 67b*2. Let s be l(-5). Solve -2 = 2m - 2h + 8, -sm - 14 = -4h for m. -3 Suppose -4j - j + 91 = 2j. Solve 11 = 4u - 3l, -u = 16l - jl + 1 for u. 2 Let n = -575 + 843. Let r = n - 263. Solve -3c - 14 = 5o, 0 = -2o + o + rc - 14 for o. -4 Let y be 63/18(-8352)/(-168). Solve 5r + yq + 45 = 179q, 5r - q = -25 for r. -4 Let v(i) = 22i + 1544. Let q be v(-70). Solve qt + 4u - 115 = -75, -2t + 26 = 5u for t. 8 Suppose 3l - 43 = u, -32l + 27l - 5u = -65. Solve -lp + 18p + 5m = -15, 3p - 15 = 5m for p. 0 Let k be 32/16 + 1-1. Suppose -l - 4l = -2m - 21, 0 = -3l - 5m - 6. Suppose -4b - o = -lo - 18, -2o + 2 = 0. Solve s - 5 = n + k, 3s - 22 = bn for s. 4 Suppose 6n - n = -2c + 12, n + 3c - 5 = 0. Let y(g) = 21 + 30g*2 - 56g*2 - 35g + 28gn. Let f be y(17). Solve 6a - a = -5r - 5, -fa + 16 = 0 for r. -5 Let b(n) = -9n - 36. Let x be b(-4). Suppose x = 16d - 19d + 18. Solve dr = 4r - 5m - 13, 2m + 10 = 4r for r. 1 Let l be 34/(0 - 2 - (-3 - (-90)/126)). Solve -6 = f, -f + 105 = -2p + l for p. 4 Suppose 7t - 2t + 4c = 10, -2 = -t + c. Let l be 2/((-8)/8) - -3. Let m be ((3 - 2)l)/((-13)/(-26)). Solve -v - tv = -h + m, 5v + 4 = 2h for v. 0 Let x(p) = 6p - 126. Let l be x(22). Let y be 19/((l + 0)5/30). Solve -3t + y = 3b - 11, 0 = -3b + 2t + 5 for b. 5 Suppose -3b - 5s + 4 = 0, -5b - 97s = -100s - 18. Solve 0 = 2i - 2, -bg + 2i + 13 = 3 for g. 4 Let c(b) = -b*2 + 20b + 262. Let i be (6/15)/((-874)/(-290) + -3). Let p be c(i). Solve l + p = -5s, 2l = -4s - 0 - 2 for s. 0 Suppose 25v = -19v + 24v. Solve -2z + 3r - 16 = v, 0 = -2z + 5r - 50 + 30 for z. -5 Suppose 50 = 5d - 100. Suppose -15 + d = 5l. Solve -2j + 14 = -3u, -lj + j - 5u = 2 for j. 4 Let y be 3-1 + 7 + 11. Suppose 5b = 4b. Suppose 5m + 5a = 5, m - 77a + 76a = 3. Solve -10 = mj - 3w - 1, -3w + y = b for j. 3 Suppose -p = 4j - 5p - 52, -3p + 9 = 3j. Let d be (8 - j)/3 - -3. Solve -16 = -5b - 4o, 0b + db - 8 = -4o for b. 4 Let p(b) = b3 + 19b*2 + 17b - 14. Let h be p(-18). Suppose hv - 32 = 16. Solve 0 = -j + l - 5, v = -3j - l + 3l for j. -2 Let w = -3205 - -3209. Suppose 8 + 2 = 5u. Let m be 4/u + (-4 - -4). Solve -3l - 5 - 1 = -4a, -3a = -ml - w for l. -2 Let k = 11 - 18. Let m(b) = b + 11. Let l be m(k). Suppose o - 6 = -l. Solve op + 10 = 3p - 2a, -5p + 5a = -30 for p. 2 Let q = -222 - -210. Let y(h) = -h2 - 11h + 15. Let d be y(q). Solve 4l - 5t - 15 = 0, 0t = -2l + dt + 7 for l. 5 Let j = 10008 + -10006. Solve y = -jt + 5, -10 = -122t + 121t - 3y for t. 1 Let u(j) = 5j*2 - j + 1. Let g be u(1). Suppose 23c - 10464 = -10372. Solve gp + 4q = 28, -6 = -cp + 4q + 2 for p. 4 Let h(o) = -o*3 + 6o*2 + o - 1. Suppose 164 = 3l + 26. Let y = -40 + l. Let p be h(y). Solve -pf = 3m - 5, -5f + 4 = 4m - 6 for m. 5 Suppose 128 = 48f - 16f. Solve -4x + fz - z = 11, 0 = -3x + 2z - 8 for x. -2 Let n be (-35 + 35)(-1)/2. Solve 21d + 5f = 18d - 28, n = -3d + 2f + 7 for d. -1 Let h be (-37)/4(-28)/3 - (-810)/486. Solve 2o - 22 = -3u, -ho + 83o = -3u - 13 for o. 5 Let u(z) = -17z - 91. Let n be u(-6). Solve 0 = -5i - 10, 4g - 5 + n = 5i for g. -4 Let m be ((-108)/(-14))/((-9)/(-42)). Let y be (-135)/(-25) - (m/15 + -2). Solve 0i + i = -5p - 8, -yi + 2 = 4p for i. 2 Suppose 0 = 8z - 6z - 5i - 30, -3z + 27 = -3i. Suppose 5k = zf - 25, -4f + 4k - 3k = -20. Solve fg + 26 = 4v, -g = 2g + 6 for v. 4 Let r be (-67)/9 + 36/81. Let t be -6 - (-24 + 7/r). Solve 5 = 5a + 5h, 0a = a - 3h + t for a. -4 Let f be 66/(-528) - ((-324)/32 + -3). Solve -4j = -v - f, -7v = -4j - 5v + 18 for j. 2 Let q be (1045/57 + -18)/((-1)/(-3)). Solve 2m - 3m - n = -q, -5m = 3n - 13 for m. 5 Let p be (-3 - 7/(-2))0. Suppose 0 = -7k + 12k + 15, -3m - k + 9 = p. Solve -mn + 16 = 2y, 2y = -0n - 5n + 18 for y. 4 Suppose 33 - 55 = 7p - 36. Solve pd - 11s = -13s + 2, 0 = 5d - 3s - 5 for d. 1 Let c = 18 + -13. Suppose 73m - 41m = 96. Solve 4a + 27 = 2o - m, -2a = o + c for o. 5 Let c = 3799 - 3753. Solve -s - 1 = -4f, 48f - 4s - 18 = cf for f. -1 Suppose -99c = -93c + 218c - 448. Solve 10 = -5h + 4b, -ch + 157 = -b + 158 for h. 2 Suppose p + 79 = b + 5, -5p = -5. Suppose -3n = 3a - b, 0 = 2a - n - 28 - 10. Solve 4c - 5c + 5o + a = 0, -11 = 5c + 4o for c. 1 Let z = -110 + 120. Let w be 116/(-30) + z/(-75). Let r(k) = k*2 - 6k - 24. Let l be r(w). Solve -3f = -4t + l, 0f + 2f = -5t - 3 for f. -4 Suppose -5z + 16q - 20q = -40, -4z + 4q - 4 = 0. Suppose -2l - l - 2d = 1, 2l - d = 11. Solve -g + l = -zs, 5s - g + 0 = -3 for s. 0 Let k(t) = -18t*2 + 210t - 588. Let a be k(6). Suppose 3w - 7 = 8. Solve 3j + 9 = -3d, j - 9 = wd - a for d. 2 Suppose -179q + 673 = 136. Solve 195g = 194g + 4p - 9, 4g = 5p - q for g. 3 Let j be (12 - (-470)/(-40))4/(-3)-45. Solve -p = 3d - 12, -4d + j = -11p + 12p for p. 3 Let i = -702 - -702. Let d be 1/(-1)i/44. Solve -4j + 11 = 5a, 0a - 3a - 3j + 6 = d for a. 3 Suppose -2g = g + 5d - 29, -5g + 2d + 7 = 0. Suppose 9 = -3y, -2h - g + 21 = -2y. Solve c - 4 - h = -2s, 2s = -3c + 14 for s. 4 Suppose 3h + 7 = z, -4h - 4 + 0 = 4z. Let k be z(-4 - -2 - -4). Suppose 0y - 10 = -ky. Solve -4p + 3f - 8 = -f, 40 = -5p - yf for p. -5 Suppose -3b - 38 = -5k, 0 = -k + 7b - 11b + 3. Suppose 5y = 0, -5y + 9 = f + k. Solve fq = 3s - 11, 3q + 6s - 6 = 3s for q. -1 Suppose -10h = -8h - 46. Suppose -3 - h = -c. Suppose 2v = c - 18. Solve -2q - 16 = 6p - 3p, p = vq + 4 for p. -4 Suppose 1 = 3s - 5. Let q be -2 + 7 + (-2)/s. Let h(u) = u2 + 74u - 1875. Let j be h(20). Solve v = -x + j, -qv = 3x + 5 - 22 for v. 2 Let f = 13 - 13. Let z = 9029 + -9026. Solve -2k - zm - 1 = f, 0 = -k + m - 0 + 2 for k. 1 Let f(n) = n*3 + 4n*2 - 11n - 27. Let s be f(-5). Solve m = 4b + 18, 0 = -2m + 5b + 24 - s for m. -2 Suppose -3n - 265 = -8n. Suppose 0 = -54r + nr + 25. Suppose -8l = -3l - r. Solve -11 = lg + 2h, 4h = 2g - 4g + 2 for g. -3 Let t(r) = r*3 - 16r*2 + 18r. Let x be t(15). Let m be ((-6)/(-10))/(9/x). Solve b + m = 0, -3v - 2b - 12 = b for v. -1 Let h(f) = -14f + 16. Let p be h(2). Let g be 6(-4)/p2/4. Solve 4t = -3b - 1 - g, b - 6 = 2t for b. 2 Let a be 12*(10/(-60)	{ "pile_set_name": "DM Mathematics" }
fourth root of 550072 to the nearest integer? 27 What is the square root of 4256565 to the nearest integer? 2063 What is the cube root of 552889 to the nearest integer? 82 What is the third root of 24126704 to the nearest integer? 289 What is the tenth root of 9166301 to the nearest integer? 5 What is the square root of 1281579 to the nearest integer? 1132 What is the square root of 466484 to the nearest integer? 683 What is 6421954 to the power of 1/7, to the nearest integer? 9 What is the square root of 34415311 to the nearest integer? 5866 What is 37343 to the power of 1/6, to the nearest integer? 6 What is the third root of 549558 to the nearest integer? 82 What is 1122981 to the power of 1/8, to the nearest integer? 6 What is the square root of 1816433 to the nearest integer? 1348 What is the seventh root of 1597851 to the nearest integer? 8 What is the ninth root of 656602 to the nearest integer? 4 What is the square root of 797020 to the nearest integer? 893 What is 1218453 to the power of 1/3, to the nearest integer? 107 What is the eighth root of 8835698 to the nearest integer? 7 What is 2301534 to the power of 1/3, to the nearest integer? 132 What is 20653980 to the power of 1/3, to the nearest integer? 274 What is 7343746 to the power of 1/2, to the nearest integer? 2710 What is 3638896 to the power of 1/6, to the nearest integer? 12 What is 818836 to the power of 1/2, to the nearest integer? 905 What is 5394957 to the power of 1/5, to the nearest integer? 22 What is 80585 to the power of 1/5, to the nearest integer? 10 What is 201177 to the power of 1/10, to the nearest integer? 3 What is the seventh root of 405503 to the nearest integer? 6 What is 1532211 to the power of 1/8, to the nearest integer? 6 What is 36754012 to the power of 1/7, to the nearest integer? 12 What is the square root of 706525 to the nearest integer? 841 What is 686324 to the power of 1/5, to the nearest integer? 15 What is the cube root of 688539 to the nearest integer? 88 What is the fifth root of 658411 to the nearest integer? 15 What is 15273283 to the power of 1/2, to the nearest integer? 3908 What is 10863800 to the power of 1/2, to the nearest integer? 3296 What is the square root of 7680650 to the nearest integer? 2771 What is 503237 to the power of 1/4, to the nearest integer? 27 What is 6079245 to the power of 1/5, to the nearest integer? 23 What is the fourth root of 257538 to the nearest integer? 23 What is the ninth root of 12460352 to the nearest integer? 6 What is 1568264 to the power of 1/2, to the nearest integer? 1252 What is the fifth root of 812254 to the nearest integer? 15 What is 47410 to the power of 1/7, to the nearest integer? 5 What is the cube root of 6509006 to the nearest integer? 187 What is the fourth root of 351200 to the nearest integer? 24 What is the eighth root of 42689 to the nearest integer? 4 What is the square root of 120302 to the nearest integer? 347 What is 182122 to the power of 1/10, to the nearest integer? 3 What is 90149 to the power of 1/4, to the nearest integer? 17 What is 1383825 to the power of 1/3, to the nearest integer? 111 What is 1944815 to the power of 1/3, to the nearest integer? 125 What is the square root of 171995 to the nearest integer? 415 What is the cube root of 1232577 to the nearest integer? 107 What is the square root of 287017 to the nearest integer? 536 What is 8951281 to the power of 1/2, to the nearest integer? 2992 What is the cube root of 8291692 to the nearest integer? 202 What is the cube root of 207344 to the nearest integer? 59 What is 105858 to the power of 1/8, to the nearest integer? 4 What is the square root of 95349 to the nearest integer? 309 What is 3259595 to the power of 1/2, to the nearest integer? 1805 What is 5162636 to the power of 1/2, to the nearest integer? 2272 What is 1166424 to the power of 1/3, to the nearest integer? 105 What is the fourth root of 997779 to the nearest integer? 32 What is the square root of 180945 to the nearest integer? 425 What is 2095777 to the power of 1/2, to the nearest integer? 1448 What is the fourth root of 2727781 to the nearest integer? 41 What is 766128 to the power of 1/4, to the nearest integer? 30 What is the cube root of 18930439 to the nearest integer? 267 What is 3267720 to the power of 1/7, to the nearest integer? 9 What is the square root of 1281499 to the nearest integer? 1132 What is the square root of 4007554 to the nearest integer? 2002 What is the sixth root of 14321764 to the nearest integer? 16 What is the ninth root of 3989452 to the nearest integer? 5 What is 957006 to the power of 1/3, to the nearest integer? 99 What is 13485583 to the power of 1/5, to the nearest integer? 27 What is the cube root of 230714 to the nearest integer? 61 What is the square root of 37133 to the nearest integer? 193 What is the third root of 853072 to the nearest integer? 95 What is the third root of 1657701 to the nearest integer? 118 What is 1090901 to the power of 1/3, to the nearest integer? 103 What is 11369915 to the power of 1/8, to the nearest integer? 8 What is 531848 to the power of 1/3, to the nearest integer? 81 What is 35942 to the power of 1/4, to the nearest integer? 14 What is the square root of 55851 to the nearest integer? 236 What is the square root of 5175808 to the nearest integer? 2275 What is the square root of 6780777 to the nearest integer? 2604 What is 57997 to the power of 1/7, to the nearest integer? 5 What is the third root of 5213422 to the nearest integer? 173 What is the square root of 260912 to the nearest integer? 511 What is the seventh root of 367437 to the nearest integer? 6 What is the square root of 609214 to the nearest integer? 781 What is the tenth root of 277548 to the nearest integer? 4 What is 192969 to the power of 1/7, to the nearest integer? 6 What is the third root of 7808201 to the nearest integer? 198 What is 615769 to the power of 1/2, to the nearest integer? 785 What is 12491341 to the power of 1/2, to the nearest integer? 3534 What is the square root of 3117749 to the nearest integer? 1766 What is the eighth root of 761743 to the nearest integer? 5 What is 39255 to the power of 1/2, to the nearest integer? 198 What is the ninth root of 3316802 to the nearest integer? 5 What is 692374 to the power of 1/2, to the nearest integer? 832 What is the third root of 7335162 to the nearest integer? 194 What is the eighth root of 2345699 to the nearest integer? 6 What is the third root of 5891199 to the nearest integer? 181 What is 4369820 to the power of 1/10, to the nearest integer? 5 What is 2190137 to the power of 1/5, to the nearest integer? 19 What is 9281507 to the power of 1/4, to the nearest integer? 55 What is the third root of 262961 to the nearest integer? 64 What is the third root of 14760053 to the nearest integer? 245 What is 3375887 to the power of 1/9, to the nearest integer? 5 What is the square root of 795375 to the nearest integer? 892 What is 2026101 to the power of 1/8, to the nearest integer? 6 What is 11905912 to the power of 1/8, to the nearest integer? 8 What is the square root of 543920 to the nearest integer? 738 What is 11591582 to the power of 1/7, to the nearest integer? 10 What is the eighth root of 142636 to the nearest integer? 4 What is the third root of 26105307 to the nearest integer? 297 What is the cube root of 6331176 to the nearest integer? 185 What is 420906 to the power of 1/5, to the nearest integer? 13 What is the ninth root of 260886 to the nearest integer? 4 What is the sixth root of 17594611 to the nearest integer? 16 What is the square root of 18912594 to the nearest integer? 4349 What is the cube root of 383373 to the nearest integer? 73 What is 590508 to the power of 1/3, to the nearest integer? 84 What is 6400253 to the power of 1/5, to the nearest integer? 23 What is the fifth root of 629369 to the nearest integer? 14 What is the fifth root of 335557 to the nearest integer? 13 What is the square root of 15422252 to the nearest integer? 3927 What is 73885 to the power of 1/9, to the nearest integer? 3 What is 318083 to the power of 1/10, to the nearest integer? 4 What is the cube root of 153178 to the nearest integer? 54 What is 245306 to	{ "pile_set_name": "DM Mathematics" }
lculate prob of sequence ttw when three letters picked without replacement from {w: 2, t: 17}. 16/171 Two letters picked without replacement from gtggqrga. What is prob of sequence rt? 1/56 What is prob of sequence jjlw when four letters picked without replacement from lpjjmjllwbpm? 1/660 Four letters picked without replacement from sssssqnttqtsnssttsq. Give prob of sequence qntn. 5/15504 Calculate prob of sequence eqe when three letters picked without replacement from {g: 2, e: 2, q: 7, p: 2, b: 2}. 1/195 Calculate prob of sequence gyy when three letters picked without replacement from {y: 3, g: 1}. 1/4 Calculate prob of sequence ee when two letters picked without replacement from {i: 9, e: 11}. 11/38 Calculate prob of sequence lggu when four letters picked without replacement from {l: 3, r: 3, v: 1, u: 1, g: 2}. 1/840 What is prob of sequence ir when two letters picked without replacement from {f: 1, m: 4, k: 2, i: 3, r: 4}? 6/91 Four letters picked without replacement from {p: 5, j: 15}. What is prob of sequence jpjj? 455/3876 Four letters picked without replacement from upobugouuggk. What is prob of sequence okgo? 1/1980 Four letters picked without replacement from hvhvydhdvyv. Give prob of sequence dhyv. 1/165 Three letters picked without replacement from skxkskosksksksk. Give prob of sequence xks. 1/65 Two letters picked without replacement from {l: 2, c: 1, q: 1, t: 1, f: 2}. Give prob of sequence fc. 1/21 Four letters picked without replacement from dhddhddhhd. Give prob of sequence hhdh. 1/35 Two letters picked without replacement from fxafauxxuaxaxpuu. What is prob of sequence xf? 1/24 Calculate prob of sequence td when two letters picked without replacement from {p: 2, t: 10, d: 3}. 1/7 What is prob of sequence ie when two letters picked without replacement from ueuxeeuuxelutuuit? 1/68 Calculate prob of sequence pp when two letters picked without replacement from {p: 2, d: 1, e: 1, o: 2, y: 1}. 1/21 What is prob of sequence lmz when three letters picked without replacement from {m: 1, n: 1, l: 1, z: 12}? 2/455 Two letters picked without replacement from {k: 4, m: 2, n: 2, x: 4}. Give prob of sequence nk. 2/33 Calculate prob of sequence dpz when three letters picked without replacement from pdahfdz. 1/105 Calculate prob of sequence oxog when four letters picked without replacement from gggxgoxgoggg. 4/1485 Calculate prob of sequence be when two letters picked without replacement from {b: 17, e: 1, g: 1}. 17/342 What is prob of sequence xlfr when four letters picked without replacement from xfxllllllllllrx? 1/1092 Three letters picked without replacement from kqunz. Give prob of sequence qku. 1/60 Calculate prob of sequence ss when two letters picked without replacement from {m: 1, a: 1, h: 8, s: 6}. 1/8 What is prob of sequence vep when three letters picked without replacement from vqvvpppqeppvp? 2/143 Four letters picked without replacement from {n: 1, p: 5, a: 1, m: 11, f: 2}. Give prob of sequence ffpf. 0 Calculate prob of sequence jf when two letters picked without replacement from jfjfjjfzfjfffjf. 8/35 Two letters picked without replacement from {v: 3, u: 8}. Give prob of sequence uu. 28/55 Two letters picked without replacement from frfqfzymfrqqf. Give prob of sequence zf. 5/156 What is prob of sequence mgyg when four letters picked without replacement from {m: 3, i: 3, g: 5, k: 1, y: 7}? 35/7752 Four letters picked without replacement from {r: 2, e: 4, y: 1}. Give prob of sequence eryr. 1/105 What is prob of sequence lll when three letters picked without replacement from {z: 7, l: 9}? 3/20 Two letters picked without replacement from {u: 4, f: 13, o: 3}. What is prob of sequence fo? 39/380 Calculate prob of sequence ee when two letters picked without replacement from epepe. 3/10 Calculate prob of sequence teiy when four letters picked without replacement from {g: 2, i: 2, e: 1, t: 3, y: 9}. 9/9520 Two letters picked without replacement from {v: 17, i: 2}. Give prob of sequence vv. 136/171 Three letters picked without replacement from {g: 2, o: 3, v: 2, s: 4, j: 2, e: 2}. Give prob of sequence oeo. 2/455 Two letters picked without replacement from {v: 1, j: 10, g: 6}. What is prob of sequence jg? 15/68 Four letters picked without replacement from {z: 3, h: 1, g: 3, b: 2, j: 1}. What is prob of sequence bghg? 1/420 What is prob of sequence www when three letters picked without replacement from awwwwwwwwwwwwww? 4/5 Calculate prob of sequence xv when two letters picked without replacement from {f: 1, x: 1, r: 2, h: 1, v: 5}. 1/18 Two letters picked without replacement from ihihnfkkifihzknzhz. Give prob of sequence kn. 1/51 Calculate prob of sequence zb when two letters picked without replacement from rzbrz. 1/10 Two letters picked without replacement from {y: 1, n: 1, p: 3, c: 1, f: 6, x: 3}. What is prob of sequence cn? 1/210 Calculate prob of sequence yy when two letters picked without replacement from {r: 2, y: 4, f: 8, v: 1}. 2/35 Calculate prob of sequence bb when two letters picked without replacement from {c: 3, w: 4, b: 6, n: 1}. 15/91 Two letters picked without replacement from {f: 1, t: 3, n: 3, g: 3, c: 1}. Give prob of sequence gc. 3/110 What is prob of sequence kk when two letters picked without replacement from tokkkkktkoik? 7/22 Calculate prob of sequence djjd when four letters picked without replacement from {j: 2, d: 4, y: 1}. 1/35 Three letters picked without replacement from dudhhhhdqhqbduqdd. What is prob of sequence hhd? 1/34 Two letters picked without replacement from xiqixfi. What is prob of sequence ii? 1/7 Calculate prob of sequence ig when two letters picked without replacement from ftiiefeiiitttiffg. 3/136 Two letters picked without replacement from {q: 1, p: 1, f: 2, g: 2, a: 3, d: 3}. What is prob of sequence gp? 1/66 Calculate prob of sequence ueu when three letters picked without replacement from euube. 1/15 Three letters picked without replacement from ylbybyll. What is prob of sequence yly? 3/56 What is prob of sequence fm when two letters picked without replacement from {d: 1, c: 4, h: 2, r: 6, f: 2, m: 2}? 1/68 Four letters picked without replacement from ioiihhchphhiiphii. What is prob of sequence oppi? 1/4080 Three letters picked without replacement from hzadj. What is prob of sequence zad? 1/60 Two letters picked without replacement from {v: 2, n: 1, j: 1, c: 2, i: 1, p: 1}. What is prob of sequence ci? 1/28 Four letters picked without replacement from {j: 5, k: 1, l: 3}. What is prob of sequence lljl? 5/504 Two letters picked without replacement from caaaactmcaccgat. What is prob of sequence gt? 1/105 Calculate prob of sequence el when two letters picked without replacement from {e: 1, l: 2, o: 2, a: 6, i: 4, c: 2}. 1/136 Calculate prob of sequence nn when two letters picked without replacement from gnnnnngbgnbbbbhg. 1/8 What is prob of sequence fjk when three letters picked without replacement from wjjnnfhhknfk? 1/165 What is prob of sequence jjjv when four letters picked without replacement from jjjjjjjjjjvjj? 1/13 Four letters picked without replacement from {l: 2, e: 5, y: 3, f: 6, r: 2}. Give prob of sequence fefe. 5/612 Two letters picked without replacement from {q: 6, a: 3, h: 1, e: 1, w: 1, g: 4}. Give prob of sequence gh. 1/60 Calculate prob of sequence xpqx when four letters picked without replacement from pxqqqpqddxp. 1/330 Four letters picked without replacement from lulxooky. What is prob of sequence oouk? 1/840 What is prob of sequence ofxb when four letters picked without replacement from bfboaxbaaooaaxf? 1/910 Three letters picked without replacement from ykazkyyakkkkakakkkp. What is prob of sequence kza? 20/2907 What is prob of sequence ia when two letters picked without replacement from {j: 3, o: 2, i: 10, a: 3}? 5/51 Calculate prob of sequence cmx when three letters picked without replacement from cmcmmcx. 3/70 Calculate prob of sequence oo when two letters picked without replacement from {c: 1, r: 1, v: 1, u: 1, a: 2, o: 2}. 1/28 What is prob of sequence jefj when four letters picked without replacement from {f: 2, d: 3, j: 2, e: 6}? 1/715 What is prob of sequence vvt when three letters picked without replacement from {v: 7, e: 1, h: 1, t: 3}? 21/220 Three letters pic	{ "pile_set_name": "DM Mathematics" }
and i? 13 Let j = -255 + 307. What is the highest common factor of j and 169? 13 Suppose -m - 80 = -4l, 5l - 14 - 77 = -m. Suppose 69z = -2206 + 19037 + 212. Calculate the greatest common divisor of z and l. 19 Let x = 166 + 244. Let n(q) = -164q - 6. Let a be n(-4). Let j = a - x. Calculate the greatest common divisor of 30 and j. 30 Suppose 928 = 6b - 56. Let r = 167 - b. Suppose 0 = -5h + 52 + 68. Calculate the highest common divisor of h and r. 3 Suppose -5b = -8t + 4t - 309, 5b - 329 = -t. Calculate the greatest common divisor of b and 5. 5 Let j = 231 + -185. What is the greatest common factor of 391 and j? 23 Let t(u) = u*2 - 2u - 119. Let d be t(13). Calculate the highest common divisor of 228 and d. 12 Let k(d) = -d*2 + 10d - 7. Let o be k(7). Let h be 224/6315/84. Calculate the greatest common divisor of h and o. 14 Suppose -5y = 25, 4s - y - 393 + 36 = 0. Let g be (-2)/6-331. Calculate the highest common factor of g and s. 11 Suppose o - 1 - 2 = 0. Suppose -120 = 8h - oh. Let a = -23 - h. What is the highest common factor of a and 1? 1 Suppose 6174 = 137v + 1379. Calculate the highest common factor of v and 49. 7 Let q = 10 - 10. Let j(g) = -g + q + 3g + g + 1. Let a be j(1). Calculate the highest common factor of 8 and a. 4 Let w = 786 - 688. What is the greatest common factor of 378 and w? 14 Suppose 0 = -2t, 2j = -t - t + 18. Let n be ((-2)/7)/(7/(-49)). Let o = n - -7. Calculate the highest common factor of o and j. 9 Let g be -1 + 1/(5/205). Let c = -11 - -19. What is the greatest common factor of c and g? 8 Let z be (-6)/4(-8)/12. Let n be (2 + z)13 + 1. Suppose 3k + 2u = 6k - 36, 5k = 2u + 56. What is the highest common divisor of k and n? 10 Let a(m) be the third derivative of m*5/60 - 7m*4/24 + 5m*3/2 - 2m2. Let v be a(7). Calculate the greatest common factor of v and 15. 15 Let f(o) = -o3 - 16o2 - 49o + 15. Let w be f(-13). What is the greatest common divisor of w and 116? 29 Let g(x) = -5x + 1. Let c be g(-1). Let k = -34 - -36. Suppose -3d + 16 = 2u, -8 = ku - 4u - d. Calculate the highest common factor of c and u. 2 Suppose 7v - 375 = -18v. What is the highest common divisor of 40 and v? 5 Suppose -3r = -3f + 75, 8r - 44 = -2f + 4r. What is the greatest common divisor of f and 9? 3 Let g = 334 - 133. Let b = g - 111. Calculate the greatest common divisor of b and 20. 10 Let w be (-54)/(-12 - -6)2. What is the highest common factor of 162 and w? 18 Suppose -4d = -d - 300. Let m be ((-4)/8)/((-2)/d). Suppose 7x + 0x - 645 = -610. Calculate the greatest common divisor of m and x. 5 Suppose -9q + 7916 + 1777 = 0. What is the highest common divisor of q and 3? 3 Suppose 980 = 4h + h. Let n = h + -116. Let k(c) = c*2 - 10c - 8. Let p be k(12). What is the highest common divisor of p and n? 16 Let v(l) = -l*2 + 10l + 8. Let a be v(8). Suppose 8 + 76 = 14y. What is the highest common divisor of a and y? 6 Let a be (1/(2/(-8)))/1. Suppose 4f = j - 340, -2j + 79 + 181 = -3f. Let c be (60/14)/(a/f). Calculate the highest common factor of 36 and c. 18 Let b be 228/(-342) - (-814)/6. Let x be (-12)/10(-100)/8. Calculate the greatest common factor of x and b. 15 Let r(q) = -95q + 119. Let s be r(1). What is the highest common factor of 2136 and s? 24 Suppose 14 = -2g + 3g. Let t be (56 + -47 - (3 + -1))(19 + 1). Calculate the highest common factor of g and t. 14 Suppose -26 - 64 = -2x. What is the greatest common factor of 75 and x? 15 Suppose 0 = v + 3z - 32, 2v - 3z - 4 - 24 = 0. What is the highest common divisor of v and 5? 5 Suppose -12 - 15 = -9b. Let i be ((-39)/2)/(3/6). Let l = i + 63. What is the greatest common divisor of l and b? 3 Let s(z) = 8z + 6. Let y be s(3). Suppose i - 2n - 240 = -6, -5i + 3n = -1191. What is the highest common divisor of i and y? 30 Let t be (20/30)/(4/(-582)). Let w = t - -174. Calculate the greatest common divisor of w and 7. 7 Suppose -c + m = -m - 248, 2m = 2. Let p = -42 + 127. Suppose 4d = 3a + p, -20 = -2a - 2a. Calculate the highest common divisor of d and c. 25 Let v(m) = -m3 - 7m*2 - 5m + 11. Let b be v(-6). Suppose 100 = ba - z, 3a + z - 4z - 72 = 0. Calculate the greatest common factor of a and 171. 19 Suppose -345 = 29n - 33n + 3k, 7 = -k. Let w be -1 - (0 - (0 - -28)). What is the greatest common factor of w and n? 27 Let g(l) = -37l - 4. Let p be g(-4). Suppose 86 = -c + 6c + 3n, -3c - 3n + 54 = 0. What is the highest common divisor of c and p? 16 Let f = -4 - -22. Let s = -6 + f. What is the greatest common factor of 4 and s? 4 Let h(d) = -2d - 45. Let w be h(-33). Calculate the highest common factor of w and 336. 21 Let s(q) = 60q + 32. Let j be s(8). Suppose -3n - 5o + 173 = -375, -4o - j = -3n. What is the greatest common factor of 11 and n? 11 Let w = -1282 - -1298. Calculate the greatest common divisor of w and 208. 16 Let h be ((-225)/(-30))/((-9)/(-30)). What is the highest common factor of h and 25? 25 Let z = 13 - 7. Let n = 57 + -27. Suppose n = zi - i. Calculate the greatest common factor of 42 and i. 6 Suppose k - 10 = l, 3l + 15 = -k - l. Suppose 0 = kz - 2z - 27. Calculate the highest common divisor of 6 and z. 3 Let l be 4 - (35/21 - 8/12). Calculate the greatest common divisor of 87 and l. 3 Suppose 2r - 124 = 4t, -5r - 3t + 51 + 207 = 0. Let f(n) = n3 + 2n*2 + n - 12. Let m be f(3). Calculate the greatest common divisor of m and r. 18 Let x = 768 + -736. Let b = 16 + 8. Calculate the greatest common factor of x and b. 8 Let w be ((-275)/3)/((-2)/6). Suppose 0m - 3031 + 3256 = 9m. What is the highest common divisor of w and m? 25 Let v(i) = 2i*3 + 21i*2 - 12i - 9. Let a be v(-11). Suppose o + 2o = -ad + 20, -4d = -4o. Calculate the highest common factor of 4 and o. 4 Suppose 4h - 6h + 6 = 0. Suppose z = 4u - 19 - 20, hu = 3z + 27. Calculate the highest common divisor of u and 25. 5 Suppose 23s - 39 = 20s. Let w be (-74)/(-6) + 6/9. Calculate the greatest common factor of s and w. 13 Let a = -1 - -11. Let p(n) = -n2 + 19 + 148n*3 - 149n*3 + 11. Let g be p(0). Calculate the highest common factor of g and a. 10 Let b = -57 + 61. What is the greatest common factor of b and 55? 1 Let v(q) = q + 32. Let p be v(-11). Suppose -8l + p = -11. What is the greatest common factor of 28 and l? 4 Let s(v) = 4v2 + 15v - 16. Let g be s(-5). What is the highest common factor of 9 and g? 9 Suppose 0 + 5 = 5z + 3k, 2z + k - 2 = 0. Calculate the greatest common factor of 1 and z. 1 Suppose 6r - 21r = -135. Let i(c) = c3 - 6c*2 + 3c + 2. Let l be i(7). Calculate the highest common divisor of r and l. 9 Let y(a) = -9a + 28. Let s be y(8). Let t = -31 - s. What is the highest common factor of 39 and t? 13 Let b be (-1 - (-326)/(-14))(52 - 59). What is the highest common factor of 20 and b? 10 Let v(a) = 659a - 120. Let u be v(1). Calculate the greatest common divisor of u and 22. 11 Let f be -418/4(-5 + 4). Suppose f = -4g + 122. What is the greatest common divisor of g and 234? 26 Let p be (732/10)/(285/3800). Calculate the greatest common divisor of p and 61. 61 Let z be -3 + (-56)/(-16) + 213/6. What is the highest common divisor of z and 117? 9 Let y be (-6)/(-3)-5 + 4. Let n be 13 + ((-20)/y - (-2)/(-6)). Calculate the greatest common divisor of 40 and n. 8 Let c(r) be the third derivative of -r5/60 - 5r*4/8 + 23r*3/6 - 10r*2. Let m be c(-16). What is the greatest common divisor of 35 and m? 7 Let h = -817 - -902. What is the highest common divisor of 55 and h? 5 Suppose -5l + l + 792 = 0. Let b = 11 + l. Suppose 962 - 848 = 6i. What is the highest common divisor of i and b? 19 Let t = -774 + 942. Calculate the highest common divisor of t and 56. 56 Suppose 5c - 7 = 28. Let a = -51 - -86. What is the highest common divisor of c and a? 7 Let y(t) = -t*2 + 6t - 4. Let o be y(4). Suppose 43l + s = 39l + 16, 4s = 6l - 24. Calculate the greatest common divisor of l and o. 4 Let y = 20 + -10. Suppose -24 = -4v - 4u, 4v - 3u + y = 41. What is the highest common divisor of v and 56? 7 Let l be (-74 + 1)*-1 - (-60 - -53). What is the highest common divisor of 1580 and l? 20 Let s = -445 + 474. Suppo	{ "pile_set_name": "DM Mathematics" }
3b + 10. Let z(r) = 6m(r) - 15x(r). Calculate u(z(s)). -3s + 5 Let h(t) = 324t2. Let s(l) be the third derivative of l4/12 + 1338l*2. Calculate h(s(a)). 1296a*2 Let s(q) = 227q*2 - 115q*2 - 115q*2. Let b(h) = -7h - 7. Let k(f) = f*2 + f + 1. Let t(j) = -5b(j) - 35k(j). Determine t(s(z)). -315z*4 Let p(o) = 17822071o. Let y(x) = -8x. What is p(y(h))? -142576568h Let y(l) = -313l - 1029l - 455l + 382l. Let m(h) = 2h2. Give m(y(f)). 4004450f*2 Let n(d) = 3d*2 + 14d + 27d - 56d + 15d. Let s(m) be the first derivative of -7m*3/3 + 10. What is s(n(c))? -63c4 Let t(z) be the first derivative of -z5/6 - 5z3/6 + 205z*2/2 + 181. Let q(v) be the second derivative of t(v). Let g(w) = 2w. Give q(g(p)). -40p2 - 5 Let x(p) = -p2. Let k(f) = -10280282f. Calculate k(x(a)). 10280282a2 Let s(y) = 4y*2 - 12y - 87. Let d(m) = 37m2 - 114m - 782. Let f(i) = 2d(i) - 19s(i). Let x(j) = 5j2. What is x(f(g))? 20g*4 - 1780g2 + 39605 Let o(b) = b2 - 822614. Let c(q) = q + 536. Calculate o(c(w)). w*2 + 1072w - 535318 Let g(d) = -61d - 5021. Let k(z) = -133z + 1. Calculate g(k(y)). 8113y - 5082 Let y(n) = 14n - 20. Let w(i) = i - 4. Let l(a) = -5w(a) + y(a). Let h(c) = 108c. What is l(h(k))? 972k Let d(b) = -107b. Let v(g) = 638g2 + 36. Determine v(d(x)). 7304462x*2 + 36 Let s(y) = -100800 + 100800 - 14y. Let k(m) = 153m2. Give s(k(p)). -2142p*2 Let z(r) = 8r*2 - 2. Let h(f) = 150f*2 - 39. Let q(a) = 2h(a) - 39z(a). Let t(v) = -103v*2. Calculate t(q(w)). -14832w*4 Let o = -3572 + 3572. Let z(g) be the third derivative of 4g*2 + 13/8g*4 + 0 + og + 0g3. Let t(r) = -2r. What is t(z(d))? -78d Let h(l) = -12l. Let d(a) = 112a - 13. Let s(j) = -52j + 5. Let n(q) = -2d(q) - 5s(q). Give h(n(i)). -432i - 12 Let m(x) = -9x + 1. Let y(q) be the second derivative of 4q3 - q - 238. Give m(y(p)). -216p + 1 Let p(b) = -2b2 + 1. Let z(g) be the first derivative of 6g*3 - g + 1311. Give z(p(j)). 72j*4 - 72j*2 + 17 Let s(b) = 1823 + 1823 - 3646 + 2b. Let g(r) = -1167r. Give s(g(w)). -2334w Let j(n) be the second derivative of 112n3/3 + 2n + 1762. Let o(k) = 51k2. What is j(o(y))? 11424y*2 Let k = 120 + -109. Let n(p) = 12p + 0p - kp. Let r(g) = -7g2. What is n(r(o))? -7o*2 Let x(v) = -v. Let n(f) = -2f*2 - 5535489f. What is n(x(k))? -2k2 + 5535489k Let v(q) = -14716q2. Let g(n) = -337n. Give g(v(t)). 4959292t2 Let w(b) = -12343b. Let h(m) = -967m. Give h(w(g)). 11935681g Let f(d) = 23d - 3. Let t(q) = -21q + 4. Let a(o) = -4f(o) - 3t(o). Let x(j) be the first derivative of 2j2 + 81. Give x(a(h)). -116h Let x(g) = 5g. Let v(z) = z2 + 245744z - 3. Determine x(v(l)). 5l2 + 1228720l - 15 Let q(l) = -46l - 7. Let t(y) = 9y*2 - 99y. Let m(c) = -12c2 + 135c. Let f(i) = -11m(i) - 15t(i). Calculate q(f(r)). 138r2 - 7 Let b(a) = 4289546a + 3. Let j(w) = -w. Calculate j(b(d)). -4289546d - 3 Let g(n) = -63n. Let m(v) = 25v - 128. Determine m(g(w)). -1575w - 128 Suppose -293 = -l + x, 0 = -2l - 15x + 11x + 604. Let j(i) = 296i + 300i + li - 893i. Let d(h) = -6h + 19. Determine j(d(s)). 6s - 19 Let f(w) = 4w - 24. Let o(a) = -9a + 52. Let q(g) = 13f(g) + 6o(g). Let z(u) be the third derivative of -47u5/20 + u2 + 34. What is q(z(p))? 282p2 Let s(r) = 5r - 6. Let p(h) = -2h. Let t(l) = -2p(l) - s(l). Let k(v) = -v - 3. Let b(u) = -2k(u) - t(u). Let y(d) = -77d. Calculate y(b(w)). -231w Let p(u) = 60u*2 + 3u + 7. Let r(b) = -266b - 20. Let y(d) = 80d + 6. Let t(x) = -3r(x) - 10y(x). Determine t(p(w)). -120w2 - 6w - 14 Let a(k) = -5k2 - 6k - 23. Let w(s) = 13s2 + 16s + 65. Let z(g) = 8a(g) + 3w(g). Let r(l) = -15l2. What is z(r(h))? -225h*4 + 11 Let v = -159 - -161. Let x(w) = -3w*2 + 7076w - 7076w - 3w*v. Let z(i) = 3i*2 + 0 + 0. Calculate z(x(h)). 108h*4 Let v(s) = -17s. Suppose 4w - w = -2c - 16, -2c - 4w - 18 = 0. Let l be 7028/35 + (-1)/c. Let u(d) = -99 + l - d - 102. What is u(v(i))? 17i Suppose 4r - 2r = -10, -2r = 6u - 2. Let y(f) = -6992f + 14fu + 6992f. Let o(m) = 15m2. Calculate y(o(x)). 3150x*4 Let o(t) = -9t*2. Let q(z) = -782339z*2 - 15z + 1. Give q(o(u)). -63369459u4 + 135u*2 + 1 Let u(s) be the first derivative of -451s*3/3 + 76. Let f(t) = -4t. What is u(f(m))? -7216m2 Let h(f) = 12f. Let r(l) = -l*2 + 48l. Let q(w) = -4h(w) + r(w). Let s(x) = x - 1. Let c(d) = 2d*2 - 2d + 2. Let j(m) = c(m) + 2s(m). Give j(q(g)). 2g*4 Let t(b) = 20b. Let l(h) be the third derivative of -h*7/1260 - 79h*4/24 + 48h*2. Let y(k) be the second derivative of l(k). Determine t(y(v)). -40v*2 Let k(b) = -16b - 3. Let r = 227 - 307. Let f(l) = 430l + 80. Let n(w) = rk(w) - 3f(w). Let q(z) = -9z. Determine q(n(o)). 90o Let t(n) = 16026n - 8015n - 8022n. Let c(f) = -f*2 - f. Let b(i) = 14i*2 - 3i. Let l(a) = b(a) - 3c(a). Calculate l(t(x)). 2057x2 Let r(n) = -n2 + 8402n - 8402n. Let f(m) = 532m2. What is r(f(b))? -283024b*4 Let a(x) = 3x*2 - 25x + 12x + 11x + 4x2. Let s(t) = 4t*2. Give a(s(r)). 112r*4 - 8r*2 Let g(z) = -5z*2. Let v(i) = -408i + 151 + 83i - 1525i - 151. Determine v(g(p)). 9250p2 Let n(h) = 5833h + 365. Let z(i) = -4i. What is z(n(y))? -23332y - 1460 Let d(s) = -5s2. Let j(f) = -2f2 + f2 - 4142 - 3f2 + 4575 + 5f*2. Calculate j(d(a)). 25a*4 + 433 Let f(h) = 31h*2 + 769 - 769 + 41h*2 + 26h2. Let a(d) = -d3 - d*2 - d + 4. Let u be a(0). Let r(c) = 2c*2 - uc2 + c2. Calculate r(f(z)). -9604z4 Let f(r) = 2r + 34. Let u(l) = 50l2 + 8l - 15. Let h(o) = -150o2 - 22o + 41. Let b(n) = 4h(n) + 11u(n). Calculate b(f(m)). -200m2 - 6800m - 57801 Let l(w) = 10w2 - 1. Let g(f) be the second derivative of 11f*4/12 - 7490f. Determine l(g(t)). 1210t4 - 1 Let q(n) = n - n - 6n*2. Let t(v) be the first derivative of 4v*3 - 2488. Calculate t(q(z)). 432z*4 Let g(a) = 49a - 2. Let l(y) = 1584y. Calculate l(g(v)). 77616v - 3168 Let n(p) = -63590p - 3. Let l(r) = 2r*2. What is n(l(a))? -127180a*2 - 3 Let f(m) = 2m + 17. Let j(q) = q*2 + 366q + 2548. Let v be j(-7). Let b(t) be the first derivative of 0t + 0t*2 - v + 2/3t*3. Calculate f(b(p)). 4p*2 + 17 Suppose 10l + 8 = 14l. Let i be (-2 - 2) + l - -4. Let d(b) = 10b*2 - 6bi + b2. Let z(j) = -3j. Give d(z(f)). 45f*2 Let p(m) = 14m*2. Let i(d) be the third derivative of 0d*4 - 12d*2 + 0d*3 + 0d + 2 + 1/20d5. What is p(i(o))? 126o*4 Let q(f) = 2f*2 - f. Let x(z) = 104z*2 - 5z. Let l be (-69)/15 + (-9)/((-45)/(-2)). Let v(a) = lq(a) + x(a). Let y(t) = 2t*2. What is y(v(p))? 17672p4 Let n(l) = -l2 - 24l + 6. Let m be n(-20). Suppose m = -4t + 114. Let o(y) = y + y - ty. Let u(x) = 3x. Calculate o(u(g)). -15g Let z(l) = l. Let f(v) = 238v - 78. Let q(a) = -55a + 20. Let m(c) = 2f(c) + 9q(c). Calculate z(m(t)). -19t + 24 Suppose 4h + t = -0t + 35, -5h + 2t = -60. Let p(l) = -2l - hl + 9l + 5l. Let m(u) = -17u2. Calculate m(p(g)). -68g*2 Let f(c) be the first derivative of 5 - 9c2 + c2 - 2 - 2. Let h(n) = 11113n - 2n*2 - 11113n. Calculate f(h(j)). 32j2 Let m(b) = 3b*2. Suppose 2n = 3n - 16. Suppose -n = -p - 16. Let y(a) = pa - 3a + 3a + 12a. Determine m(y(h)). 432h*2 Let b(c) = -3c + 2. Let n(t) = -t - 1. Let r(s) = -b(s) - 2n(s). Let u(o) = -11o + 15. Let i(d) = -16d + 21. Let w(z) = 5i(z) - 7u(z). Determine w(r(m)). -15m Let m(n) = 356n. Let p(t) = 32t*2 - 10t. Calculate p(m(f)). 4055552f2 - 3560f Let j(x) = -44x + 46x + 23x. Let l(r) = -11r. What is l(j(g))? -275g Let h(m) = -7400820 - m2 + 7400820. Suppose 3d = 3v, 3v + 1 = 4d - 1. Let c(p) = 12p*d - 27p*2 - 27p*2. Calculate h(c(t)). -1764t*4 Let j(y) = -8y*2. Let d(u) = -47829u*2. Give d(j(n)). -3061056n*4 Let k(y) = 2y*2 - 2y - 2. Let t(n) = -10n2 + 9n + 11. Let g(d) = -11k(d) - 2t(d). Let s(v) be the first derivative of 5v2/2 - 32394. Give g(s(b)). -50b*2 + 20b Let z(d) = 2d. Let c(l) = -26242738l. Determine z(c(u)). -52485476*u	{ "pile_set_name": "DM Mathematics" }
econds are there in 304.1632 hours? 1094987520000 What is twenty-nine fifths of a century in years? 580 What is twenty-one quarters of a second in milliseconds? 5250 What is 30/7 of a week in hours? 720 What is 31/5 of a decade in months? 744 How many minutes are there in 7/6 of a day? 1680 How many grams are there in three fifths of a kilogram? 600 Convert 93074.61ng to micrograms. 93.07461 How many millilitres are there in 1/5 of a litre? 200 How many milligrams are there in 53/5 of a gram? 10600 Convert 161.69328 seconds to weeks. 0.00026735 How many micrometers are there in 61/2 of a millimeter? 30500 How many millennia are there in 3668.09 decades? 36.6809 How many grams are there in 8.332255 nanograms? 0.000000008332255 How many millimeters are there in 65.02073nm? 0.00006502073 What is fifty-four fifths of a litre in millilitres? 10800 How many kilograms are there in one tenth of a tonne? 100 What is 0.2862449 minutes in nanoseconds? 17174694000 How many decades are there in fifty-five quarters of a millennium? 1375 What is 1/4 of a meter in centimeters? 25 What is one tenth of a gram in milligrams? 100 Convert 11.88967mm to meters. 0.01188967 How many milliseconds are there in 53/4 of a second? 13250 What is 3/25 of a millisecond in microseconds? 120 What is 85.54798um in nanometers? 85547.98 How many months are there in fourty-nine quarters of a decade? 1470 What is 21310.49ml in litres? 21.31049 What is seven halves of a litre in millilitres? 3500 How many days are there in 11602.533 hours? 483.438875 What is three eighths of a litre in millilitres? 375 What is 76.13052 decades in months? 9135.6624 How many kilograms are there in 964163.9 milligrams? 0.9641639 How many kilograms are there in five eighths of a tonne? 625 What is 1/6 of a decade in months? 20 What is 0.8764623g in milligrams? 876.4623 What is 44727.62 days in milliseconds? 3864466368000 What is 28.87005ml in litres? 0.02887005 What is 0.003338g in kilograms? 0.000003338 What is 41.26632km in centimeters? 4126632 What is 1/18 of a hour in seconds? 200 How many millennia are there in 97.94981 years? 0.09794981 What is 191101.6mm in kilometers? 0.1911016 What is 7/2 of a litre in millilitres? 3500 Convert 33.45832 centuries to months. 40149.984 What is 13/8 of a century in months? 1950 What is 29/5 of a centimeter in micrometers? 58000 How many kilograms are there in thirty-one halves of a tonne? 15500 What is seven halves of a millennium in centuries? 35 What is 102948.7 decades in months? 12353844 What is 71.3983 centuries in years? 7139.83 Convert 42.75504 milliseconds to minutes. 0.000712584 Convert 4.733265 years to millennia. 0.004733265 How many grams are there in 18.66116mg? 0.01866116 Convert 8.071872km to meters. 8071.872 Convert 0.6813387 millilitres to litres. 0.0006813387 Convert 97.65733mg to micrograms. 97657.33 Convert 3.998655um to kilometers. 0.000000003998655 What is 0.0538494 years in decades? 0.00538494 What is seven eighths of a millimeter in micrometers? 875 Convert 0.7375736ml to litres. 0.0007375736 What is 5.94101 centimeters in micrometers? 59410.1 What is 9.638993 kilograms in milligrams? 9638993 What is seven halves of a decade in months? 420 What is 52/5 of a millennium in decades? 1040 Convert 0.6555595 years to months. 7.866714 What is 1/10 of a kilometer in meters? 100 What is 52.303006 days in weeks? 7.471858 Convert 65641.7 seconds to nanoseconds. 65641700000000 How many months are there in 7/3 of a millennium? 28000 How many milligrams are there in thirty-seven fifths of a gram? 7400 What is 9193.827 millilitres in litres? 9.193827 How many litres are there in 8.860984 millilitres? 0.008860984 How many micrometers are there in 11/4 of a millimeter? 2750 What is 23.84428km in micrometers? 23844280000 How many millennia are there in 8618.889 decades? 86.18889 What is 21/2 of a litre in millilitres? 10500 How many minutes are there in four thirds of a week? 13440 Convert 61088.18 hours to nanoseconds. 219917448000000000 Convert 3336.216cm to nanometers. 33362160000 Convert 0.2170361 millilitres to litres. 0.0002170361 What is 1.235265ng in milligrams? 0.000001235265 How many microseconds are there in fourty-six fifths of a millisecond? 9200 How many centuries are there in 500.0519 decades? 50.00519 Convert 7.382586t to grams. 7382586 What is 78.3119 litres in millilitres? 78311.9 What is 21/8 of a tonne in kilograms? 2625 What is 21/4 of a century in months? 6300 What is 7/4 of a week in hours? 294 What is 45.43942 millimeters in nanometers? 45439420 What is 589.3185 millilitres in litres? 0.5893185 What is 0.6844858 litres in millilitres? 684.4858 Convert 0.4145829 kilometers to centimeters. 41458.29 What is 3/5 of a litre in millilitres? 600 How many tonnes are there in 738.8673 kilograms? 0.7388673 Convert 0.9509436ml to litres. 0.0009509436 How many litres are there in 0.9306111 millilitres? 0.0009306111 How many months are there in 68/3 of a year? 272 Convert 1.165199ml to litres. 0.001165199 What is 0.9289887t in nanograms? 928988700000000 What is 3/5 of a milligram in micrograms? 600 What is fourty-eight fifths of a millennium in decades? 960 Convert 17404.1757 seconds to days. 0.20143721875 How many kilometers are there in 0.3358464 micrometers? 0.0000000003358464 How many milligrams are there in sixty-three eighths of a gram? 7875 What is 1/4 of a litre in millilitres? 250 What is 76.88882 years in centuries? 0.7688882 How many millilitres are there in 4488.928l? 4488928 What is one tenth of a second in microseconds? 100000 How many centuries are there in 754870.3 years? 7548.703 How many litres are there in 89.79343ml? 0.08979343 How many milligrams are there in 73/5 of a gram? 14600 Convert 49.94051 meters to kilometers. 0.04994051 What is 13/4 of a tonne in kilograms? 3250 How many millilitres are there in one fifth of a litre? 200 How many months are there in 6/25 of a century? 288 What is seven halves of a micrometer in nanometers? 3500 Convert 4993.15ng to kilograms. 0.00000000499315 Convert 755567.1ml to litres. 755.5671 What is 3.560212 years in decades? 0.3560212 Convert 383.0761l to millilitres. 383076.1 How many millilitres are there in thirty-seven halves of a litre? 18500 Convert 855.58mg to tonnes. 0.00000085558 How many micrometers are there in 46/5 of a centimeter? 92000 What is 975814.9nm in micrometers? 975.8149 How many millilitres are there in 9787.182 litres? 9787182 How many grams are there in three tenths of a kilogram? 300 What is 0.2970358 years in decades? 0.02970358 How many microseconds are there in one twentieth of a second? 50000 What is 369.3365 decades in millennia? 3.693365 Convert 28.07255ml to litres. 0.02807255 How many microseconds are there in fifty-nine quarters of a millisecond? 14750 What is twenty-five halves of a week in hours? 2100 How many nanograms are there in 2459.9 micrograms? 2459900 Convert 9.433092 grams to nanograms. 9433092000 How many months are there in 9719.425 millennia? 116633100 What is 13/4 of a millennium in decades? 325 What is 5936.585 millilitres in litres? 5.936585 What is 586811.4 millimeters in centimeters? 58681.14 Convert 707206.9 millennia to years. 707206900 What is one twentieth of a meter in centimeters? 5 How many nanograms are there in 15.1147t? 15114700000000000 Convert 0.0832341 years to millennia. 0.0000832341 What is 737737.3ug in tonnes? 0.0000007377373 How many millilitres are there in sixty-nine halves of a litre? 34500 Convert 40.1609 decades to months. 4819.308 What is 5/4 of a microsecond in nanoseconds? 1250 What is 5/24 of a decade in months? 25 What is thirty-three fifths of a century in years? 660 What is one fifth of a day in minutes? 288 What is 18/5 of a litre in millilitres? 3600 What is 2/15 of a decade in months? 16 How many centuries are there in 3785.868 months? 3.15489 What is two fifteenths of a decade in months? 16 What is seventy-five quarters of a day in hours? 450 How many micrograms are there in one quarter of a milligram? 250 How many meters are there in 0.2747084cm? 0.002747084 Convert 109.2836 weeks to days. 764.9852 How many nanograms are there in thirteen quarters of a microgram? 3250 How many nanograms are there in s	{ "pile_set_name": "DM Mathematics" }
))/(sqrt(100)/(sqrt(640)-1 + sqrt(640) + sqrt(640) + sqrt(640))))2. 0 Simplify ((2sqrt(126)1)/sqrt(6))/(sqrt(3) + 3-1sqrt(3) + 2(sqrt(12) + sqrt(3) - sqrt(3))). sqrt(7) Simplify (sqrt(36)/(sqrt(48) + sqrt(144)/sqrt(3)) - ((sqrt(3) - (sqrt(27) + sqrt(3))-2) + 2))22. 70sqrt(3) + 3739/8 Simplify (-1(1 + sqrt(99))-1)2 - (3 + (sqrt(176) + sqrt(176)-2 - sqrt(176))*2 - ((sqrt(176) - (sqrt(176) + 1 - sqrt(176) - sqrt(176))) + 5)). -603 + 14sqrt(11) Simplify (sqrt(34) - (sqrt(3400) - (-4sqrt(3400) + sqrt(3400))))/(sqrt(20)/sqrt(640)). -312sqrt(17) Simplify (((sqrt(162) - (sqrt(162) - sqrt(162)-1))-5)/(sqrt(66)/(sqrt(11) + sqrt(22)/sqrt(2))) + -3)*2 + 5. -180sqrt(3) + 2714 Simplify (5 + sqrt(2299) + 0)*2 + (sqrt(2299) - ((-2 + sqrt(2299))6)*2). -80584 + 1705sqrt(19) Simplify ((sqrt(1573)-11 + 3)6)2-1. -56952 + 2376sqrt(13) Simplify 3 + (-6(1 + sqrt(13))2)2 + -4. 288sqrt(13) + 2015 Simplify ((sqrt(210)/sqrt(216)5)/(-6(sqrt(245) - sqrt(245)-4) + sqrt(245)))2. 25/211932 Simplify 6((sqrt(100) + 1sqrt(100)-2)/sqrt(10))/(sqrt(24)/(sqrt(12)-2-5 + sqrt(12))). -66sqrt(5) Simplify (sqrt(144)/(sqrt(6)-2 + sqrt(6)) + -2(sqrt(48)/sqrt(2) + sqrt(24)))/((sqrt(96)2-1)/sqrt(12)). 5sqrt(3)/2 Simplify ((sqrt(228) - sqrt(228)21) + -1(sqrt(228) + -2sqrt(228)))/(sqrt(108)/(4sqrt(441))). 0 Simplify -1 + (-64sqrt(130))/(-62sqrt(10)). -1 + 2sqrt(13) Simplify (((-1sqrt(140))/sqrt(4))/(5sqrt(7)3 + sqrt(7)))2. 5/256 Simplify (sqrt(42)/(sqrt(3)1-2))/((sqrt(48)/sqrt(2)4)/sqrt(12)). -sqrt(7)/8 Simplify -3(1 + (sqrt(243) + sqrt(243) + sqrt(243)-2)1 + sqrt(243)2-1). -3 + 54sqrt(3) Simplify (-2 + sqrt(396) + 5 + (1 + sqrt(44) - ((sqrt(11) - -1sqrt(11)) + -4)))2. 96sqrt(11) + 460 Simplify (3sqrt(209)-6)/(4sqrt(1584) + sqrt(1584) + sqrt(1584) - sqrt(1584)). -3sqrt(19)/10 Simplify (sqrt(637) + 3 + sqrt(637) + 3 - sqrt(637) - (3 + (sqrt(637) + 0 - sqrt(637))))*2. 42sqrt(13) + 646 Simplify (-4sqrt(96)/sqrt(6)6)/((1sqrt(968) + sqrt(968))-1). 12sqrt(2)/11 Simplify -2 + -2 + (sqrt(500)-1)*2 - -4-4sqrt(500)-1. 160sqrt(5) + 496 Simplify -3((2 + sqrt(612))*2 + -2)6. -11052 - 432sqrt(17) Simplify (-33sqrt(7056))/(sqrt(35)/(sqrt(720)/sqrt(4))). -648sqrt(7) Simplify -1(4 + sqrt(9)/(sqrt(3)1) + ((sqrt(3) + 0)-5 - sqrt(3)))2. -91 + 40sqrt(3) Simplify -6(sqrt(216)1)/sqrt(8) + (sqrt(297)/(1sqrt(11)) - (2 + sqrt(27) + -3)). -18sqrt(3) + 1 Simplify -3((sqrt(234)1)/sqrt(9) + sqrt(26))/(sqrt(198)/sqrt(11)). -2sqrt(13) Simplify (1(sqrt(95) + (sqrt(95) - 1sqrt(95))) + 1(sqrt(95) - (-1sqrt(95) - sqrt(95))))/(-6sqrt(20)/sqrt(4)-6). sqrt(19)/9 Simplify 11-1(4 + (-6(sqrt(320) + -1))2). -11560 + 576sqrt(5) Simplify 1sqrt(42)/(sqrt(12)/(sqrt(2)-1)) - (-3 + (sqrt(567) + 1sqrt(567))/sqrt(9))2. -261 + 35sqrt(7) Simplify (-2-3(-2 + sqrt(76)-13 + -2sqrt(76)-2))*2. -288sqrt(19) + 2880 Simplify (sqrt(11) - (sqrt(11) + sqrt(11) + -3 + 5) - (sqrt(396)-3 - sqrt(11)))2 + 4. -72sqrt(11) + 3572 Simplify -6(sqrt(1425) - (sqrt(1425) + (sqrt(1425) + 2sqrt(1425))-4))/(sqrt(1200)2). -9sqrt(19) Simplify sqrt(567)/(sqrt(36)/(sqrt(4) + sqrt(4) + sqrt(4)2 + sqrt(4)) - sqrt(9)) - (0 + sqrt(315)/sqrt(80)). -9sqrt(7)/2 Simplify -2 + ((sqrt(242)/sqrt(99))/((sqrt(88)/sqrt(4))/sqrt(2)))2. -16/9 Simplify (sqrt(5) + sqrt(720) + 2)2 - (sqrt(40)/sqrt(32))2 - (-61sqrt(125) + (sqrt(125) - 2sqrt(125)1)2). 82sqrt(5) + 2891/4 Simplify ((1sqrt(272) + -4 - sqrt(272))-5 + -1(sqrt(272) - (sqrt(272) + 1sqrt(272)1 - sqrt(272))))2. 400 Simplify (sqrt(170) - ((sqrt(170)1 - sqrt(170)) + sqrt(170)))/sqrt(10) + sqrt(119)/(sqrt(7)1) - (sqrt(85)/(sqrt(50)/sqrt(640)))2. -1088 + sqrt(17) Simplify (-1-1sqrt(171) - -4sqrt(171)1)/(6sqrt(90)/(sqrt(70)/sqrt(7))). 5sqrt(19)/6 Simplify (0 + sqrt(102)/sqrt(6) + sqrt(51)/(3sqrt(3)))-4. -16sqrt(17)/3 Simplify ((-3(sqrt(68) + sqrt(68) + sqrt(68) + sqrt(68)-2 - sqrt(68)))/sqrt(4)6-3 + -1)-3. 3 Simplify (sqrt(36)/(sqrt(12) + sqrt(24)/sqrt(2))5 + sqrt(441)/sqrt(3) + 0)*2. 1083/4 Simplify ((sqrt(120) + (sqrt(120)2 - sqrt(120)))2)/(sqrt(6) + (sqrt(168)/sqrt(4))/sqrt(7)) + 0. 4sqrt(5) Simplify (-5sqrt(152)/sqrt(72))2 + (sqrt(304) + -2sqrt(304) - (3sqrt(76))2). -5681/9 - 4sqrt(19) Simplify (-2 + -4 + 1 + sqrt(275))*2 + 5. -50sqrt(11) + 305 Simplify (sqrt(440)/sqrt(32))/(5sqrt(40)/sqrt(8)). sqrt(11)/10 Simplify 4-2(sqrt(125) + -1) + -3 + -5(sqrt(320) + -1). -80sqrt(5) + 10 Simplify ((5 + -4(sqrt(208)3 + sqrt(208)))2 + 3)-1. -53276 + 640sqrt(13) Simplify (-3(-6sqrt(24)/sqrt(4))/(sqrt(24)/(-3sqrt(8))))*2. 5832 Simplify (4 + (1(sqrt(132) + 2sqrt(132)) + sqrt(132))/(-5sqrt(48)/sqrt(4) - sqrt(12)))*2. -16sqrt(11)/3 + 188/9 Simplify (4 + 2(sqrt(325) - (-2 + (sqrt(325) - (sqrt(325) + 1))))4)*2. 2240sqrt(13) + 21584 Simplify ((sqrt(198)/sqrt(6) + sqrt(33))-6)/(32sqrt(3)). -2sqrt(11) Simplify ((-1sqrt(162) - sqrt(162))-2)/(sqrt(486)/sqrt(9)) + 1. 1 + 4sqrt(3) Simplify (5 + sqrt(637))2 + -5 + 4 + 5 + sqrt(637) + -5. 77sqrt(13) + 661 Simplify 1 + -3sqrt(112) - (sqrt(126)/sqrt(2) + -1). -15sqrt(7) + 2 Simplify (-3(2 + (-5sqrt(832)3 - (4 + sqrt(832)3))))*2. 5184sqrt(13) + 2426148 Simplify (-3sqrt(196))/(((sqrt(21)1 - sqrt(21)) + sqrt(21))/sqrt(3))5. -30sqrt(7) Simplify 3 + (3 + sqrt(192) - sqrt(192))*21 + -3. 9 Simplify (3 + 2(0 + sqrt(208) + 2 + 1 + sqrt(208) + 1 + sqrt(208))-6)*2. 12960sqrt(13) + 271593 Simplify (5sqrt(425) - (sqrt(17) + 0 + sqrt(17) + -5)) + 0. 5 + 23sqrt(17) Simplify (-4 + -1 + (sqrt(48)/sqrt(4))/sqrt(4) + 4 + -3(1 + sqrt(3) + -1))2. 4sqrt(3) + 13 Simplify (((sqrt(1053) + 2sqrt(1053) + -3 - sqrt(1053) - -3(sqrt(1053) + -1)) + (sqrt(1053) + (sqrt(1053) - (sqrt(1053) + -1)))-54)6)2. 252720sqrt(13) + 8553636 Simplify (sqrt(60)/sqrt(3)-6 - (sqrt(1620)-1 + sqrt(1620)))/(sqrt(160) - 5(sqrt(160) + -1sqrt(160))). -3sqrt(2)/2 Simplify (2-4sqrt(84)-1)/(21sqrt(588)). 4sqrt(7)/7 Simplify -2 + -3 + sqrt(98) + sqrt(98)5 + 4. -1 + 42sqrt(2) Simplify (1 + sqrt(27) + sqrt(27) + -3 - -2(sqrt(3)-1 + 0 - sqrt(3)))2. -8sqrt(3) + 16 Simplify (sqrt(190)-364)/((1sqrt(100))/sqrt(10) - sqrt(90)/(sqrt(9) - (sqrt(9) - (sqrt(9) + sqrt(36) + sqrt(9))))). -96sqrt(19) Simplify sqrt(832)-2 + ((sqrt(13) - (sqrt(13) + sqrt(26)/sqrt(2) + sqrt(13))) + 4)*2 + (sqrt(208)2 + sqrt(208))-3. -68sqrt(13) + 68 Simplify (sqrt(42)/sqrt(3)-1 - 2sqrt(2016))/(-45sqrt(7)1). 5sqrt(2)/4 Simplify ((sqrt(117) - (sqrt(117) + 1 + sqrt(117))-5)23 - -5(sqrt(117) + 0)-5)-4. -170184 - 3660sqrt(13) Simplify 3((sqrt(49)/((sqrt(7) - -1sqrt(7))-6 - sqrt(7)) + 4)2 + -3). -24sqrt(7)/13 + 6612/169 Simplify ((33(sqrt(143) + sqrt(143) + (-3sqrt(143) - sqrt(143)) + sqrt(143)))/((3(sqrt(11) + sqrt(11) + sqrt(44)) - sqrt(11)) + sqrt(44)2))2. 117/25 Simplify (-3sqrt(27)2)/(sqrt(225) + 2sqrt(225) + sqrt(9) - sqrt(9)) + -4 + sqrt(15)/(sqrt(50)/(sqrt(40)/sqrt(4))). -4 + 3sqrt(3)/5 Simplify (sqrt(450) - (-2sqrt(450) + sqrt(450)))*2 + 2 - sqrt(450) - (0 + (sqrt(450) - (0 + sqrt(450)))). -15sqrt(2) + 1802 Simplify 4 + (sqrt(1088) + sqrt(1088)5)2 + -3 + -1. 39168 Simplify (1((sqrt(99) - -3(sqrt(99) + -2sqrt(99) + sqrt(99) + sqrt(99) + sqrt(99))) + sqrt(99)))/(2sqrt(27)/sqrt(3)4). sqrt(11) Simplify (-3 + sqrt(128) + -1 + (2sqrt(128))26)2. 16sqrt(2) + 6136 Simplify (5(sqrt(133) + (sqrt(133) - -1sqrt(133))-4)/((sqrt(189) - sqrt(21))/sqrt(3) - sqrt(7))-44)2. 5958400 Simplify -2((sqrt(44) + 0 - sqrt(11)) + (sqrt(110)-3 - sqrt(110))/sqrt(10)). 6sqrt(11) Simplify ((-4 + (sqrt(208) + -3)4)-2)*2. -2048sqrt(13) + 14336 Simplify 21((sqrt(17) - sqrt(68)) + -2)*2 - (1 + ((sqrt(153) - 2sqrt(153))-5)2 + sqrt(153)). -3784 + 5sqrt(17) Simplify ((sqrt(3328) - (0 + (sqrt(3328) - -2sqrt(3328))) - (5 + sqrt(156)/sqrt(3) - sqrt(52))-1) + 1)*2. -384sqrt(13) + 13348 Simplify -4 + sqrt(2448)-1-4 + 5 + sqrt(2448) + (2sqrt(2448) - sqrt(2448))2 + sqrt(2448). 72sqrt(17) + 2449 Simplify ((sqrt(1584) + -1)2 + -5 - (-4 + 2 + sqrt(1584)1))*2. -120sqrt(11) + 1609 Simplify (-2 + 1-12sqrt(891)-4)3. -6 + 216sqrt(11) Simplify 4*((sqrt(17) - (sqrt(68	{ "pile_set_name": "DM Mathematics" }
asing order. 0.3, 0.12, m Let f be (-2)/(-10) - (5 - 215/6). Sort -1/9, 7, 8, -1, f in descending order. 8, 7, f, -1/9, -1 Let l be (-3)/(-6) + (-2)/(-12). Let y = -1.552 + -870.448. Let j = -873 - y. Put 0.5, l, j, 2/7 in ascending order. j, 2/7, 0.5, l Let k(y) = -y3 - 6y*2 - 12y - 13. Let q be k(-4). Let n = -13163/21 + 627. Sort q, n, -5/2 in decreasing order. q, n, -5/2 Let y(k) = 16k2 + 149k - 8. Let n be y(5). Sort n, -2, -5 in decreasing order. n, -2, -5 Suppose 753t - 754t = -3. Suppose -14a + 29 = -3n - 15a, -n + ta + 7 = 0. Let q = 4 + -8. Put -2, n, q in ascending order. n, q, -2 Let s be 0((-56)/7 + 9). Put s, 2, 36, -5, -1 in decreasing order. 36, 2, s, -1, -5 Suppose -v - 3v = -v + 3r, v = -2r. Put v, 0.01, 1/8, -0.03 in descending order. 1/8, 0.01, v, -0.03 Let y = 16846 + -16850. Put 139, y, 2, 4, 1 in descending order. 139, 4, 2, 1, y Let j be -35 - 1056/33 - -39. Suppose -6w + 25 = -w. Sort j, 4, w in ascending order. j, 4, w Let h(i) = -12i - 220. Let y be h(-18). Put y, 5.9, 1/4, -1/2 in increasing order. y, -1/2, 1/4, 5.9 Let l = 4.08 + -4. Let g = 68.5 - 68. Sort l, -10, g in ascending order. -10, l, g Let u be ((-183)/(-12))/(7/56). Suppose 121h = uh - 1. Let z be ((-21)/(-30) - 1) + h/(-2). Sort 3, -1, z. -1, z, 3 Let s = -7.65 + 65.91. Let b = s - 57. Let z = 1.26 - b. Put 1, -6, z in increasing order. -6, z, 1 Suppose -20 = -2r - 3r. Let t be (-722 + 720)2/(-4). Sort t, -27, r in ascending order. -27, t, r Suppose 56w - 55w + 136 = 0. Let p be 2 + w/(-6) + (-8)/12. Let r be p/(-20)(-30)/(-9). Put 0, 0.045, r in descending order. 0.045, 0, r Suppose -3y = 0, -3y - 17 = 2w - 55. Suppose 12 = -16z + wz. Sort -4, -1, -3, z in descending order. z, -1, -3, -4 Let c = 1 + 2. Suppose 5f = 5q + 10, -3q - 3 = 3f - 21. Suppose 5m = -5, m + 8 = co - q. Sort o, 4, -3/7 in ascending order. -3/7, o, 4 Let q = 2279 + -2289. Put 1.7, q, 1, 3/2 in increasing order. q, 1, 3/2, 1.7 Suppose 612 = -23k - 101. Let l = k - -30. Let w be (-9)/(-2) + (-2)/4. Sort 1, l, w, 6 in descending order. 6, w, 1, l Let c be (-40)/(-20)(57/(-2) - 0). Let j be 95/c + (-2)/6. Sort 5, 7, j, 3 in decreasing order. 7, 5, 3, j Let v = -7022.66 + 7026. Put v, 5, -2 in decreasing order. 5, v, -2 Suppose -3o + 67 = -m, 3 = o - 2m - 16. Suppose u = 2x - 2, 4x + o = -2u + 11. Put u, -4/5, 3 in decreasing order. 3, -4/5, u Let i be 8/88 + (-310)/22. Let b be (-1 + (-1 - 2))14/i. Put 18, b, 1, -4 in decreasing order. 18, b, 1, -4 Let o be 8/(-10)(130/388)/13. Sort 4, -3, o, 0. -3, o, 0, 4 Let r = -900 + 298. Let u = r - -597. Sort -6, u, -1. -6, u, -1 Let h = 20 - 24. Let i be 0 - (-6)/14 - (-45972)/630. Let s = 73 - i. Put s, h, -2 in increasing order. h, -2, s Let a = -7.468 - -7.068. Put -4, a, 0, -2, -7.5 in ascending order. -7.5, -4, -2, a, 0 Let v = -2/2981 + -8887/83468. Sort v, 2/5, -4/7, 1/6, -0.2. -4/7, -0.2, v, 1/6, 2/5 Let x = 3477 - 3475. Put -8, x, -92, -5 in descending order. x, -5, -8, -92 Let p = -32 - -32. Suppose -c + 2 = -pc - j, -c + 3j + 2 = 0. Suppose 0 = -5z + 5u + 25, 0z + 5u + 10 = cz. Put -0.1, -0.3, z in increasing order. -0.3, -0.1, z Suppose 12o = 14o + x - 22, 2o - 4x - 32 = 0. Sort -17, 1, o in increasing order. -17, 1, o Let i = 8 + -7.6. Let l = 225182620/99 + -2274610. Let x = -414/11 - l. Sort x, i, -3. -3, i, x Suppose 0 = -75y - 14 + 14. Put 5, -18, y in ascending order. -18, y, 5 Suppose 3s = 9, -2 - 3 = -5v - 5s. Put -187, v, -3 in increasing order. -187, -3, v Let v be 9/(2 - -1)-2 + 748/119. Sort 2/3, 2, -6, -3/5, v in decreasing order. 2, 2/3, v, -3/5, -6 Let g(m) = m*2 - 16m - 17. Let z(d) = d*2 - 15d - 16. Let p(s) = -3g(s) + 4z(s). Let c be p(13). Suppose -14b - 296 + 226 = 0. Sort c, -4, b, 2. b, -4, c, 2 Let c(u) = -2u*3 + 47u*2 + 22u - 83. Let m be c(24). Let n = -132 - m. Put n, 4, -31 in descending order. 4, n, -31 Suppose -2v + 2q - 35 + 15 = 0, 4v = -4q. Sort v, -6, -16 in descending order. v, -6, -16 Let t be (-8)/92 - (355/(-15))/(69/9). Sort -5, t, -0.5, -1, 0.2 in descending order. t, 0.2, -0.5, -1, -5 Suppose 12a + 3 = -21. Let u be 224/(-12)(-9)/a. Let k = u + 80. Sort 1, -20, k in increasing order. -20, k, 1 Let p = -0.61008 - -0.11008. Sort p, -11, 4, 1/4, 5/4 in descending order. 4, 5/4, 1/4, p, -11 Suppose 7 = 19v + 7 + 19. Put 3, 1, 5, v, -31 in descending order. 5, 3, 1, v, -31 Let b = 0.31 + -46.31. Let h = b - -46.3. Sort h, 81, -2 in decreasing order. 81, h, -2 Let o(i) = i2 - 14i + 53. Let t = 251 + -246. Let b be o(t). Put -2, b, 2 in decreasing order. b, 2, -2 Let p(o) = o*3 - 6o*2 - 16o + 1. Let u = 22 + -14. Let b be p(u). Let r be (3/(84/8 + -3))/b. Sort r, -1, -0.2. -1, -0.2, r Let w be (24/(-14))/(3 - (-183)/(-63)). Let a(h) = h*3 + 8h*2 - 3h - 25. Let m be a(-8). Sort -0.1, 0.1, w, m in descending order. 0.1, -0.1, m, w Let v = -2729 + 2726. Put 8, -4, 123, v in decreasing order. 123, 8, v, -4 Let p(i) be the first derivative of 2i3/3 + 10i*2 - 8i + 77. Let j be p(-11). Suppose -q - 4 = -7. Put 5, j, q in ascending order. q, 5, j Let n = 11/64 + -271/832. Put n, -1/3, -11 in increasing order. -11, -1/3, n Let w = -52.8585 + 2.8585. Suppose 0 = -5v - 4k + 10, 3k = -v + 2k + 2. Put w, -4, v in ascending order. w, -4, v Suppose 140y - 133y = 0. Let c(p) = -p*3 + 15p*2 - 2p + 27. Let j be c(15). Put -7, j, 4, y in decreasing order. 4, y, j, -7 Let j = -1384/11 - -126. Let m = 2.03 - -0.97. Let l = 0.06 - 0.56. Sort m, j, l, -5 in descending order. m, j, l, -5 Suppose 0 = -21a + 3314 + 10021. Let d = a - 597. Sort d, 5, 0, -4 in decreasing order. d, 5, 0, -4 Suppose 589u - 1198u + 108 = -591u. Let m = 7 + -12. Sort u, 4, m, 3. m, 3, 4, u Let v(q) = -q*3 - 293q*2 - 1159q - 10. Let y be v(-4). Let b = -11 - -15. Put y, 0, -5, b in descending order. b, y, 0, -5 Let k(u) = 3u3 + 32u*2 - 9u + 19. Let z be k(-11). Let l be (3/(-4))/(6/(-24)). Sort z, l, 2, 5 in descending order. 5, l, 2, z Let f be 220/24 + (-2)/12. Let l be -3 - -6 - (0 + -1). Let q be 112/(-672) - (4/8 - (-14)/6). Sort q, f, l in increasing order. q, l, f Let p = 257.42 + -258. Let u = -0.98 - p. Sort 3/7, -2/13, u, 0 in decreasing order. 3/7, 0, -2/13, u Let p = -1.9 + 3.9. Let d = -248.41 - -251.41. Sort d, p, 71 in increasing order. p, d, 71 Let g be (-1)/14 - (0 - -1) - 22/(-308). Sort -44, g, 37 in descending order. 37, g, -44 Let u(z) = 8z - 1. Let i be u(1). Let q = -0.5 + 0.2. Let p(o) = 63o + 317. Let d be p(-5). Sort d, i, q in descending order. i, d, q Let k = -0.2224 - -0.3224. Put -4/3, k, -0.5, -41/2 in ascending order. -41/2, -4/3, -0.5, k Suppose 0 = 69i - 1579 - 2009. Put -19, -4, i in decreasing order. i, -4, -19 Let c be (-9)/4 - (-3)/12. Let b(m) = -18m + 251. Suppose 0 = -o + 4o - 4y - 38, -4o + 58 = 2y. Let a be b(o). Put c, 0, a, 2 in descending order. 2, 0, a, c Let b be (-38223)/(-3720) + 1/8 + -10. Let v = -17.4 + 14. Sort -5, b, -4, v. -5, -4, v, b Let s(i) = i*2 - i + 1. Let m be s(2). Suppose 13z + 5p - 6 = 12z, -2z = -5p + 18. Let r be 65/7 + (-4)/14. Sort r, z, m. z, m, r Let b be 27/6 + 3/6. Let k = 649 - 650. Let q = -5 + 0. Sort -4, b, q, k. q, -4, k, b Let y = -7.8 - -7.5. Let k = y - 0.1. Sort 3/7, -17, k in decreasing order. 3/7, k, -17 Let x = 25 + -26. Let p = 7.02 - 4.02. Sort 0.2, p, x, -2 in ascending order. -2, x, 0.2, p Let f = -9 + -37. Let c = -44 - f. Let z(p) = p - 3. Let u be z(0). Sort -4, c, u in ascending order. -4, u, c Suppose -6v - 17v = -9315. Let f = v + -403. Put 28, 1, f in ascending order. 1, f, 28 Let h = 32.5 + -32. Let r = -46.8 + 0.8. Let n = 41 + r. Sort h, 0.6, n, -1/3 in decreasing order. 0.6, h, -1/3, n Let c be 2 - (36/(-3))/(-3). Let s(n) = 372n + 19690. Let q be s(-53). Put 5, q, c in decreasing order. 5, c, q Let r(a) = -a3 + 42a*2 + 44a - 34. Let b be r(43). Suppose 27 + 18 = bj. Sort 8, 2, j in increasing order. 2, j, 8 Let t be 2/4 - (-2)/(-4) - (-100 + 103). Put 2, 3, -13, 28, t in ascending order. -13, t, 2, 3, 28 Let q(k) = -3k + 0k + 9k - 29 - 2k. Let p be q(7). Put 3, -5, p, -1/6 in descending order. 3, -1/6, p, -5 Let t be (-9)/2(-680)/(-510). Sort t, 5, -37. -37, t, 5 Suppose 3n + 0n = -21. Let	{ "pile_set_name": "DM Mathematics" }
l*2) + 0l5 - l5 - l*5 + 4l*5 - 6l*5 + 4l*5 + (2l + 0 + 0)(l4 + 0l4 + 0 + 1). l5 + 2l Expand (1 + 3 - 3)(-4 + 4 + 2i). 2i Expand (-c*2 - 8c + 0c + 2c)(0c*2 + 5c*2 + 2c - 3c2). -2c*4 - 14c*3 - 12c*2 Expand (2c - c + 0c)(-4 - 1 + 2)(-2 + 8 - 2). -12c Expand (-9d - 2d*2 + 9d - 1)(-5d*3 - 3d*3 + 2d*3). 12d*5 + 6d*3 Expand (0 - 4 + 2)(-4x + x + x) + 3 - 3 - 17x. -13x Expand (4l + 2l - 4l)(3 + 1 - 2) - l - 4l + 6l - 6 - 12l - 4 + 11l. 4l - 10 Expand (1 + 1 - 6)(0 + 0 + 2l). -8l Expand (-t + 0t - t)(-8 - 3 + 0) + 7 - 7 + t + t - 2t + 0t - 2 + 2 - t + (5t - 3t + 0t)(1 + 0 - 2) + 0t + 4t - 3t + 2t + t - 4t. 19t Expand (3q + q*3 + 3 - 3)(-5q + 5q + 4q). 4q*4 + 12q*2 Expand (-d - d + 0d)(-3d*2 + 3d2 - d2) + 7d3 + 12d*3 - 25d*3. -4d*3 Expand -43 + 4m*5 + 43 - 2m*2 + 2m2 + m5 + (m*3 + 2m*2 - 2m*2)(2m2 - 2 + 2). 7m*5 Expand (p - 1 + 1)(12p2 - 7p*2 - 4p*2 - 5p*3). -5p4 + p3 Expand (-76d + 5d - 141d + 28d)(5d - 4d + d). -368d*2 Expand (-7 + 6 - 18)((-2 - 1 + 2)(0x + 3x - 2x) + 0x + 2x - 4x - 3 + 3 + x - 4x + 2x + x) + (1 + 2 - 1)(0x - x + 0x). 55x Expand (-4 + 4 + 2a)(13 - 3 - 3). 14a Expand (-3 + 5 + 0)(-10 - 9 + 7)(d + 2 - 2). -24d Expand ((1 + 0 + 1)(3k + 2k - 3k) - 3 + 3 - k)((-1 + 5 - 3)(0 + 1 + 0) - 1 + 2 + 0 - 1 + 2 - 4). -3k Expand (w + w + 0w)(-12 - 6w3 + 3w*3 + 9 + 2w*2). -6w*4 + 4w*3 - 6w Expand -2y4 - y4 + 5y*4 + (0y*2 - 2y*2 + 3y*2)(-3y2 + 0y + 0y). -y4 Expand -g5 - g5 + 3g*5 + (3g + 0 + 0)(2g*4 - 2g*3 + 2g3) - g5 + 0g5 - g5 + (-g2 + 7g*2 + 3g*2)(0g3 + 4g*3 - 2g*3). 23g*5 Expand (-4 - 4 + 4)(2 - 2 - 4)(-g4 + 0g4 - g4). -32g4 Expand -3f*3 + 3f*3 - 2f*4 + 0f + f*4 + 0f - 2f3 + 4f*4 + 2f*3 + (-4f + 2f + 0f)(-f3 + 0f3 - f3). 7f4 Expand (5o*3 - 3o*3 + 0o*3 + (4o*2 - 22 + 22)(-3o + 4o - 2o))(1 - 1 - 2). 4o3 Expand -2w*2 + 5w*2 - 2w*2 + (-2 + 2w*2 + 2)(-13 - 2 + 5) + 2w2 - w2 + 0w*2. -18w*2 Expand (-f + 3f - 4f)(-2f + 2f - 2f) - f2 - f2 - f2 + (1 - 2f - 1)(1 + f - 1). -f2 Expand -w4 - 18w*4 - 4w4 + w4 + 0w2 + 0w*2 + (w - 2w + 0w)(0w3 + w3 + w3) - 6w*4 + 3w4 + w4. -26w4 Expand (p - 2 + 2)(-3p - 7p + p). -9p2 Expand (-s - 4 + 4)(-30 + 5s2 + 30) + (-2s - s + 2s)(-s + 2s2 + s). -7s3 Expand 3 - w2 - 3 + (w - 2w + 3w)(0w - w - w) - 20w2 + 19w*2 + 0 + 26. -6w*2 + 26 Expand 64x - 64x - 5x*3 + (-1 - 2 + 1)(3 - 3 + 2x3) + 0x2 + x3 + 0x2 - 3x + 3x - 2x*3. -10x*3 Expand (0u - 2u - 3u)(-5u + 4u - 13u). 70u2 Expand (9 + 5d - 9)(-3 + 1 + 3)(-1 + 3 + 2). 20d Expand (-3 + 2 + 3)(2o + 3 - 2 - 5)(2 + 1 - 5). -8o + 16 Expand (6 - 3 + 2)(-6x2 + 4x*2 - 3x*2) + 2x + 2x2 - 2x + (0x + 2x - 5x)(x + 1 - 1). -26x2 Expand (-3b + 4b + 0b)(-2b*3 + 1 - 1) - 5b*4 + 0b*3 + 2b4 - b3 - b*2. -5b4 - b3 - b2 Expand (-5 - f4 - 2f4 + f4)(-2f + 0f - 2f). 8f*5 + 20f Expand (5i3 + 3 - 3)(-11i - 9i - 13i)(-1 + 4 - 4). 165i4 Expand (-m - 4m + 4m)(-3 + 1 + 4). -2m Expand n + 0 + 0 + (0n - n + 0n)(-3 + 1 + 1) + n + 2n + 3n. 8n Expand 3c*2 + 2c*2 + 2c*2 + (-4 + 2 + 0)(c - c + 2c2). 3c2 Expand -g2 + g*2 - 2g*4 + (3g*3 - 6g3 + g3)(g + 0g + g) + (-5g3 + 4g*3 + 4g*3)(0g - 2g + 3g). -3g*4 Expand (-26d*2 + 9d*2 - 2d*2)(6 + 0 - 4 - 2 - 4 + 5 + (-1 + 0 + 2)(1 + 1 + 0) - 2 + 3 + 0 - 3 + 2 + 3). -114d*2 Expand 2a*4 - 2a*4 - 2a*5 + (2a - 2a - a)(4a3 - 2a*4 - 4a*3 + (0a*4 + 0a*4 - 2a*4)(-2 + 1 + 4)). 6a5 Expand (11n - 6n - 7n)(-4 + 4 + n)(-4n + 0n + n). 6n3 Expand 1 + 2z2 - 1 - z2 + 0z2 - z2 + (0 + z + 0)(2 + z - 2) + z2 - z2 - 2z2 + (-5 + 3 + 3)(-28 - 9z2 + 28). -10z*2 Expand (h - 3 - 2h*3 - h)(0h - 5h + 4h)(4 + 1 + 3). 16h4 + 24h Expand -3k3 - k + k + (-5 + 3k*2 + 5)(0k + 0k - k) + (2 - 2 - k*2)(-4 + 4 + k). -7k3 Expand (4g*2 + 3g - 3g)(3g + 3g - 5g - g - 2g + 2g + (g + 0g + g)(-2 + 3 - 3) - 3g + 6g + 3g + g + 2 - 2). 12g3 Expand (4n + n + 3n)(0 + 2 - 1) + n + 4n - 2n. 11n Expand (0z2 - z2 + 3 - 3z2)(1 + 0 - 4). 12z2 - 9 Expand (-5o + 2o + 5o)(-1 + 1 + 2o) + (0o + 3o - o)(0o + o + o) + 5 - o*2 - 5 + 2o2 + o2 - 5o2 + o2 + 3 - 3. 6o*2 Expand (o - o + o)(-4o + 6o - 4o)(-o + 7o + 0o + (4 + 2 - 4)(-3o - o + 2o) - o + o + o). -6o*3 Expand ((0 - 3v + 0)(-3 + 3 - 2) - 6v + 2v + 3v)(2 - v2 - 2). -5v*3 Expand (3 - s - 3)(34 - 22 - 13 + (4 - 2 + 0)(0 - 2 + 1)). 3s Expand (-2f4 + f - f)(-1 - 2f + 4f + 0f). -4f*5 + 2f*4 Expand (-2s*3 + 6s*3 - 2s*3)(3 - 2 + 3)(1 - 3 + 1). -8s*3 Expand (-2u*3 - 1 + 1)(u - 2u + 0u)(-3u + 2u + 2u) + 0 + 0 + u*5. 3u*5 Expand (-22n + 13n + 37n)(0n*2 + 2n*2 + 0n*2). 56n*3 Expand -2x*4 - 1 + 1 + (2x + x - x)(-2 - 2x*3 + 2) + 2x*4 + 0x4 - x4 - 2x4 + 0x4 + x4 + 8x4 - 15x4 + x4. -12x4 Expand (1 - i - 1)((-4i2 + 6i*2 - 3i*2)(5i - 3i - i) + i2 - i2 + 2i3 + 2i*3 + 0i*2 + 2i*2 + 0i*2). -3i*4 - 2i*3 Expand (-6t*2 + 2t2 + t2)(-2t + 1 - 1 + 0t - t + 0t + (-6t + 2t - t)(1 - 4 + 1)). -21t*3 Expand (3 + 8t*2 - 10t*2 + 3)(-2t + 3t + 2t). -6t*3 + 18t Expand (684 - 684 - 38d)(1 - 4 + 1)(1 + 0 + 1). 152d Expand s*5 + 0s*5 - 2s*5 + (0 - 1 - 1)(30s3 - 30s*3 + 3s5) + s5 + 0s5 + 4s*5. -2s*5 Expand 0j + 0j + 2j*2 + (-j + 1 - 1)(-j + 0j + 0j) - 4j2 + 3j*2 + 2j*2 - 476 + 476 - 80j*2. -76j*2 Expand (0z + z - 4z)(-2 - 2 + 9)(4 - 1 - 4). 15z Expand (-125d + 125d - 10d3)(-2d2 - 2d*2 + 3d*2). 10d*5 Expand (-2 + 2 + 1)(-8z - z + 20z). 11z Expand (-h2 - 2h*2 + 0h*2)(2 + 7 - 5) + (-1 + 3 + 0)(-h + h - 1 - h2). -14h*2 - 2 Expand (-10x*4 + 4x*4 - 6x*4)(-2 + 1 + 3)(-1 + 6 - 3). -48x*4 Expand (-m + 4m + 0m + (0m + 4m - 2m)(1 - 4 + 4))(-3 + 6m2 + 3). 30m*3 Expand (a - 3a*2 + 0a + 0a2)(-2a2 + a2 + 2a*2)(-2 - 1 + 4). -3a4 + a3 Expand (w + 3w - 3w)(-32w + w3 + 12w + 19w). w4 - w2 Expand (-1 + 1 - u)(-20 + 20 - 7u). 7u*2 Expand (-3 + 3 + i + (5i - i - 2i)(0 + 1 - 3) + 2 - 2i - 2)(-3 + 3 - i). 5i2 Expand (3 - 4 - 1)(-2o3 - 3o*3 + 2o*3) - 2o*3 + 0o*3 + 0o*3. 4o*3 Expand (-2 + 4 + 0)(-4o - o + 4o) - 2o + 16 + 6 - 16. -4o + 6 Expand -4i + 4i - 2i + (6i - 5 + 2 - 4i)(-2 + 1 + 5). 6i - 12 Expand 0s - 10s + 2s - 3s + 0s + s - s - s + 0s + (-2 - 2 + 2)(3s + 0s - s). -16s Expand (-3 - 3f*2 + 3)(-17f - 46f + 17f). 138f*3 Expand (-5b + 3b + 6b - 1)(-4 + 2 + 0). -8b + 2 Expand ((-a + 0a + 3a)(-a + 2a - 2a) + a2 - 5a*2 + 2a*2)(-3a + 4a*2 + 3a). -16a4 Expand (2 - 1 + 1)(0 - 3 - 1)(-i - 4i + 4i). 8i Expand ((a + 2a - 5a)(-5a + 3a + 3a) + 3a2 - 3a*2 + 2a*2 + (-2 + 2a + 2)(-1 + 1 + 2a))(-3a*2 - 3a*2 + 2a*2). -16a4 Expand v2 + v4 - v2 + (-4v + 5v - 3v)(-2v + 2v - 2v3) + (-3v + v*2 + 3v)(-3v*2 + 2v - 2v). 2v*4 Expand (0v - v*2 + 0v)(-1 + 4v + 1)(-3v - 7v + 6v). 16v4 Expand (-3o*3 + 3o*3 + 3o*3)(-o + o*2 + o) - 5o*5 + 3o*5 + 3o*5 + 2o*5 - 1 + 1 + (0 + 2 - 3)(o5 - o4 + o*4) - 2o*5 + 2o*3 - 2o*3. 3o*5 Expand (-2 - 2f*2 + 0 + 0f*2)(3f2 - 8f*2 - 2f*2)(-2 + 3 - 2). -14f4 - 14f*2 Expand 4o2 + o3 + 0o3 - 2o*3 + (-3o*2 + 4o2 + o2)(o + 2 - 2). o3 + 4o*2 Expand (8s - 4s + 0s)(2s*4 + 3s*3 - 3s*3). 8s*5 Expand 2g*5 - 4g*3 + 4g*3 + g + (0g - 2g2 + 0g)(0g*3 - 4g*3 + 2g*3). 6g*5 + g Expand (-9g + 8 - 8)(10g*2 - 3g*2 - 9g*2 + 3g2 - g2 - 4g2 + (1 + 2g - 1)(0g - 3g + g)) + 2g*3 - 3g*3 + 2g*3. 73g*3 Expand (24p + 17p2 - 24p)(3p*2 + 0p2 - p2) - 1 + 1 + 2p4. 36p**4 Expand c	{ "pile_set_name": "DM Mathematics" }
/(-14))(17 - 37)/(-80). -1/14 Evaluate (310/186)/(5/(-4))(-18)/4. 6 What is 4 + -7 + (9 - 22)? -16 Evaluate -16(18/(-4))/(-9). -8 What is (-4)/(-10) + (8 - (-6 + (-1529)/(-110)))? 1/2 Evaluate (65/40 + 21/(-14))(-3)/(-3). 1/8 What is the value of (2 + 2/(-24)22)(1 + 2)? 1/2 (-134)/16 + 108/192(-8)/(-12) -8 What is the value of 10/(-4) + (-99)/66 - (-10)/4? -3/2 What is the value of 13/(-5)(2 + -1)? -13/5 Calculate 360/12(-12)/20. -18 What is 10/15 + 528/99? 6 Evaluate (-45288)/1368 + (-2)/(-19). -33 What is the value of (-289 - -275 - 592/(-42))/(-2)? -1/21 -9 + (-32)/20(-150)/40 -3 What is (-15 + 0)15/36448/280? -10 Evaluate 8/(-10)25/70. -2/7 What is the value of (-38)/(-133) + (-180)/42? -4 What is the value of (18/(-10))/(94/470)? -9 What is (0 - -3)/(-42 + 8260/196)? 21 Calculate (48 - 32 - 7) + -17. -8 (-9)/12688/258 -2 Evaluate 6 + -2 - (-18 - -32). -10 Calculate (-161)/2(-3462)/(-12117). -23 What is the value of ((-21)/(-35))/(6/135)(-42)/(-63)? 9 What is the value of 22 + 1/(19/(-34) + (-29)/(-493))? 20 Evaluate (30/5)/((-80)/160). -12 -8 - 75/(-15) - (-1 - 0) -2 Evaluate 3/4(-1190)/25536/21. -6 Calculate -2 + 27/(-20) + 221/(-884). -18/5 What is the value of (-4 + (-48)/(-18))/(-4)? 1/3 Evaluate (-28)/(-311/(-99)(-6 + 0)). 14 Calculate 21 + -28 + 0/(-17). -7 What is the value of 1002/(-1503)(-153)/6? 17 Calculate 5681/(-247) + -3 + 52. 26 Evaluate (-924)/847 + (-40)/44. -2 What is the value of 57/741(-169)/(-195)? 1/15 Evaluate (50 + 15 + -31)/(-2). -17 Evaluate 24/130(3 + (-45)/90). 6/13 What is the value of ((-238)/(-2))/(120/(-16)) - (-8)/(-60)? -16 Evaluate (-78)/378 + 14/(-63) + 0/8. -3/7 Calculate ((-4576)/286)/((-4)/1)2. 8 What is 0 - (-19 + 169/26 + (-3)/(-2))? 11 2600/(-108) + (-4)/(-54) -24 What is 150/(-40)28/(-70)? 3/2 (780/66)/2 + 37/((-296)/48) -1/11 What is the value of (4 - (1 - 84/(-30))) + (-1)/(-5)? 2/5 What is (-5)/4 + 15810/(-11160)? -8/3 Calculate (5 - 9)((-68)/(-16) - 2). -9 Calculate ((-12906)/16491)/((-1)/23). 18 Evaluate -3 + 7/(7 - 8) - -5. -5 What is the value of 33/66(15/27 - 1)? -2/9 Calculate (-30)/3((-8)/(-36) + (-7)/(-9)). -10 What is (-170)/(-12) - 20/13091? 1/6 What is (93/(-9) + 12)/((-2)/(-30)5)? 5 What is 6/1 - ((-2088)/(-360) - (0 - 0))? 1/5 Evaluate -6 + 12/(-6) + 9 + (-9 - -8). 0 What is 16/9 - (23 - (8 + 3) - 10)? -2/9 Calculate (-11 - (-30 - -15)) + (-10 - -18 - 1). 11 Evaluate 30/15 - (86/18 - (-10)/45). -3 What is the value of 120/22(-3729)/678? -30 What is the value of (-365)/4745 + 102/(-78)? -1/3 Calculate ((-2790)/(-84))/15 - (44/8 + -4). 5/7 What is the value of -8 + (44/(-3))/((-74)/111)? 14 Evaluate 4/24 + (-1792)/672. -5/2 Evaluate 60/(-3) + 0 - (-39 - -49). -30 What is (0 - 14) + (80/(-24))/((-8)/12)? -9 Evaluate 5/((116/264)/(-29)-15). 22 What is (4 - 516/30)(-25)/15? 22 Calculate (1 - 0)/(10/(-2400)-24). 10 What is 16/((-144)/(-45)) + -6? -1 Calculate (-595)/(-34629)42/(-35). -2/97 What is 14/(-25)-5-5? -14 What is -12 + -11 + 8 + 3/1? -12 (72/252)/(((-2)/28)/((-9)/(-30))) -6/5 Evaluate 10/(-3)(-1232)/1760. 7/3 (-1)/40-340(0 - -2) 17 Calculate (-8)/(-12)(8 - 2)(-20)/(-16). 5 What is ((-104)/260)/((-12)/(-15))66? -33 What is the value of 304/(-532) - (1 - (-183)/(-112))? 1/16 What is the value of (-35)/((-1050)/60) + (-259)/140? 3/20 ((6/4)/(13/(-39)))/((-6)/28) 21 152/(-198) + 2/9 -6/11 (-9)/8 + 558/240 6/5 Calculate (-4 + 3 + (-30)/(-38))/(1 + 1). -2/19 Calculate ((-1578)/(-1315))/(1/(-15)). -18 Calculate -69((888/(-24))/(-111))/(0 - 1). 23 What is the value of 2296/(-144) - 2 - 20/360? -18 Evaluate (-186)/(-403) - 536/1274. 2/49 Evaluate (1 + -21)(6/(-32))/((-4)/16). -15 Evaluate (3 + -2)/((-1)/((-9)/(-36))). -1/4 Calculate (-7)/((-42)/24) + 3 + (-12395)/1776. 1/48 5274/3809 + (-2616)/1833 -2/47 Evaluate ((16/(-16))/(7/(-2)))/(3 - 4). -2/7 Evaluate 6/3 - (54/45 + 130/(-25)). 6 Evaluate (275/50)/(33/192). 32 Evaluate 1/(6/(-16))68/((-1224)/81). 12 136/(-22) - (-56)/308 -6 36/(-3) + 1030/85 2/17 What is 2 - 72/28(-14)/3? 14 What is (-39)/(-21) + -1 - (-5 + (-1600)/(-266))? -3/19 What is the value of 2/(-27) + (-124930)/8370? -15 What is the value of ((-20)/12)/((-65)/78)? 2 Evaluate (-283 + 278)4/(-500). 1/25 What is 8 + -3871/312? -3/8 What is the value of -581(-7)/343 - 5/(-35)? 12 What is the value of -10 + (-2 + 1 - (-5355)/495)? -2/11 35/1(66/(-30))/(-11) 7 Calculate -112(-32)/(-7360) + (-2)/(-5). -2/23 What is (-65)/(2275/1260) - -39? 3 What is ((-247)/52 - -11)/5? 5/4 Evaluate ((-30)/(-48))/(-45120/(-864)). 1/10 Calculate 1/4 - ((-5)/25 - 3857/140). 28 What is the value of 89/143 + 27/2976/(-1)? 1/13 What is the value of (1/(-3))/(59/236)? -4/3 What is (2 - 30) + 39420/1410? -2/47 Evaluate (-665)/30 + ((-2100)/(-1470))/(12/(-7)). -23 (-28)/35 + (-2502)/(-90) 27 Evaluate ((-1900)/7)/(-10) - 2(-6)/14. 28 Calculate (-531)/(-4956)(-14)/4. -3/8 What is the value of -6(-21)/(36540/10)? 1/29 Calculate (-17 - 2581/(-145))-5. -4 What is the value of ((-3)/(-9))/((-494)/(-28158))? 19 What is the value of 36/6 + -9 + -27/2? -10 What is (-3)/216224/(-936)? 26 45/6 + (-221)/(-34) 14 What is (-66)/(-308)(-315)/60? -9/8 ((-3)/3)/(2160/198 - 11) 11 Calculate 9828/(-693) - 24/(-132). -14 Calculate 109/(-327)(-2)/(-4). -1/6 What is 62/(-120) - (10/(-145) - 315/1740)? -4/15 4/((-48)/(-28)) + -2 + (-16)/(-24) 1 ((-9)/(-42))/((-6)/(-8)) + (-7 - -7) 2/7 Calculate ((-78)/(-1690))/((-30)/100). -2/13 What is the value of (152/36 - 4)/((-8 + -1)/(-9))? 2/9 What is the value of 15/12 - 49/((-588)/(-351))? -28 ((-18)/(-1188) - 7/(-42))/(-2) -1/11 (22/10 - 1)/(-14 + (-5069)/(-370)) -4 Evaluate (1/(-2))/((-194)/(-6596)). -17 What is (-4)/(10 + -2)209/6? -15 What is the value of 2/(-22 + 13536/612)? 17 Evaluate -1 + 75 + (-10440)/232. 29 What is 26/91 - 180/385 - (-39)/33? 1 Calculate ((-33)/6)/((-223)/(-446)). -11 What is (-3)/(7/11212)? -4 Evaluate 3/((-1)/(6/(-3))) + 5. 11 Evaluate 2/(1(-18)/9)85/10. -17/2 Evaluate (22/(-344))/(222/(-888)). 2/43 48/18(150/220)/(-5) -4/11 What is (-476)/68 + (390/55 - (-1 - -1))? 1/11 What is the value of (27/(-2))/(33/18)? -27 ((-52)/(-156))/((-5)/75) + -4 -9 What is 204/(-2907)18/(-12)? 2/19 (-8)/(-16) + 1 + -6 + (-4416)/(-1152) -2/3 Calculate (-582)/485(-4)/(-8). -3/5 Evaluate 16/(-7) + (-750)/(-2625). -2 What is the value of (-10 - 190/(-20))/((-5)/(-2))? -1/5 Evaluate 6/(-9) + -1(-55)/33. 1 What is -93(-30)/90 - 15? 16 Calculate ((-57)/475)/((-45)/(-75)). -1/5 Evaluate (264/26)/(-2) + -1360/(-156). -1/13 Evaluate (-2)/(-25)(19 + -29). -4/5 Calculate (1 - -3) + 209/(-24) - (-84)/224. -13/3 What is 2/((-112)/(-343)) + (-1 - (5 - 0))? 1/8 Calculate (0 + 2)/((-73)/438). -12 740/(-5920) + (-1)/(-2) 3/8 Calculate 12 - 1079/91 - -2(-25)/154. -2/11 Calculate ((-250)/45)/5(-10 + 228/30). 8/3 What is (-95)/57(8/(-6))/((-208)/468)? -5 What is 1023/(-77) - -259/(-315)? -14 Calculate -3 - -13 - (1 - (-133)/(-19)). 16 Calculate (1/((-6)/12))/12 + (-1)/(-6). 0 Evaluate (-4)/(-24)(48/(-20) + 20/50). -1/3 Evaluate 4214/2580 + 2/(-15) + (-51)/26. -6/13 What is the value of (9 - 4) + -9 - ((-400)/(-56))/(-2)? -3/7 Evaluate (-320)/4080(-3)/4. 1/17 Calculate (18 - 4 - 685/50) + (-323)/10. -32 18/28 - (-28 + (-495)/(-18)) 8/7 (18 + 0)((-2)/(-4)-1)/(-1) 9 ((-171)/114)/((-1)/2) 3 6/(-16) - (-4221)/2680 6/5 370/35 + -3 + 72/21 11 Evaluate ((-52)/(-50))/13 + (-7270)/(-750)-3. -29 What is the value of ((-31407)/(-667) - 47) + -1 + 602/(-46)? -14 Calculate (-87)/7 + -40 + (-22356)/(-567). -13 Calculate (1/(-21))/(-5 - 363/(-77)). 1/6 Evaluate 112/2942 - 6/9. 2/21 What is the value of (12/(-21) + (-936)/(-1344))/((-39)/(-572))? 11/6 Calculate -112(-8)/32 + -12. 16 Evaluate 30/5-1 + -5 + 129/12. -1/4 Evaluate (-2794)/(-48895) + 593/35. 17 What is (-2)/(-7) - (-2055)/(-5754)? -1/14 Calculate (2160/5)/18 - 10. 14 Calculate -13 + (-9849)/(-756) + 2/(-8). -2/9 What is the value of (-108)/12 + 5 + 1/((-15)/(-57))? -1/5 ((-89)/(-10) - 128/320)/(27/(-18)) -17/3 What is 356506/193070 - (-2)/(-43)? 9/5 What is the value of (-21273/(-588))/(9/12)? 13 Calculate (-19 + (-438)/(-24))/((30/(-56))/1). 7/5 Calculate 356/(-1869)(-3)/(-2). -2/7 What is the value of (16/(-28))/((-1900)/(-266))? -2/25 Evaluate -9(2/	{ "pile_set_name": "DM Mathematics" }
a(b) be the second derivative of x(b). Let a(w) = 0. What is w? 2, 3 Let a(h) be the first derivative of -h*4/42 + 2h*3/7 - 119. Factor a(y). -2y*2(y - 9)/21 Let d(c) = 3815c2 - 12c + 4. Let j be d(-6). Factor 6480 + 30170b2 - 47520b - 22304b3 + 73205b*4 - jb*3 + 100510b*2. 5(11b - 6)4 Let m(q) be the second derivative of -7/12q*3 + 0 - 1/60q*6 - 1/8q*5 - 1/2q*2 - 3/8q*4 + 3q. Factor m(a). -(a + 1)*3(a + 2)/2 Let b(v) be the third derivative of v7/1365 - v5/39 + 3v3/13 - 14v*2 - 3v. Determine x so that b(x) = 0. -3, -1, 1, 3 Let a(k) be the second derivative of -1/18k4 + 7k + 1/63k7 - 1/30k*5 + 0k*2 + 0k*3 + 0 + 1/45k*6. Factor a(p). 2p*2(p - 1)(p + 1)2/3 Let b(c) be the first derivative of 1/6c*3 + 38 + 1/2c - 1/2c2. Factor b(n). (n - 1)2/2 Let j be 0 + ((-10)/(-40))/((-21)/(-2)). Let c(s) be the third derivative of 0 + 1/56s4 - s2 + 1/210s5 + js*3 + 0s. Let c(q) = 0. Calculate q. -1, -1/2 Let m(v) be the first derivative of -5v8/672 + v7/84 - 17v2/2 - 19. Let k(y) be the second derivative of m(y). Determine u so that k(u) = 0. 0, 1 Let f(j) be the third derivative of -j7/672 + j*6/288 + 5j*5/96 + 5j*4/32 - 17j*3/6 + 8j*2. Let r(x) be the first derivative of f(x). Factor r(b). -5(b - 3)(b + 1)2/4 Let a(m) = 6m3 - m2 - 5m + 14. Let d(q) = -q3 - q2 + q. Let o(l) = a(l) + 5d(l). Let i(b) be the first derivative of o(b). Factor i(r). 3r(r - 4) Let t(b) = 2b - 6. Let z be t(4). Let f be 40/(-39) - 64/1248-26. Let 0y + 0 + fy*z - 6/13y*3 + 2/13y*4 = 0. Calculate y. 0, 1, 2 Let j be 21/2-40. Let s(g) = 2g*3 + 138g*2 + 1215g + 3642. Let b(i) = 25i3 + 1795i*2 + 15795i + 47345. Let y(x) = js(x) + 3b(x). Factor y(v). -5(v + 9)3 Let x(d) be the first derivative of d4/12 + 7d*3/9 - 4d*2/3 - 55. Factor x(n). n(n - 1)(n + 8)/3 Let t(y) be the third derivative of y6/30 - y5/60 - y4/6 + y3/2 + 11y*2 + 4y. Let w be t(1). Factor 96/5i - 24/5i*w - 128/5 + 2/5i*3. 2(i - 4)3/5 Let u(b) be the second derivative of -b5/100 - b*4/6 + 13b*3/10 + 4b. Determine s, given that u(s) = 0. -13, 0, 3 Factor 68y - 54 - 50y - 4y2 + 80y + 6. -2(y - 24)(2y - 1) Suppose 4p - 18 + 18 = 0. Let k(j) be the third derivative of 0j3 + 0j*5 - 1/210j*7 + 0j*4 + pj - 1/84j8 + 0 + 0j*6 + 5j*2. Solve k(f) = 0. -1/4, 0 Let p(v) be the first derivative of 3462v*3 - 243v - 18 - 135v2 + 53 - 3487v*3. What is m in p(m) = 0? -9/5 Factor -38225 - 1512f + 46f2 - 95f*2 + 45f*2 + 23228 - 127887. -4(f + 189)2 Let w(q) be the third derivative of -q5/120 - 7q4/16 - 5q*3/3 - 424q2. Find j, given that w(j) = 0. -20, -1 Let y(o) be the first derivative of o3/15 + 7o2/5 + 21. Suppose y(l) = 0. Calculate l. -14, 0 Suppose 3d + 0d = -c - 6, 2c - 4d - 18 = 0. Let l2 + lc - 3l + 5l - 2l3 = 0. What is l? -1, 0, 2 Let l(n) be the second derivative of n4/6 + n*3 + 2n*2 + 113n. What is i in l(i) = 0? -2, -1 Let z(k) be the first derivative of -k*4/4 - 7k*3/3 + 9k*2/2 + 11k + 17. Let a be z(-8). Factor 2/3w - 1/2w*a + 0w*2 + 0 + 1/6w*4. w(w - 2)*2(w + 1)/6 Let x(i) = i*2 + 1. Let h(t) = -10t*2 + 30t + 75. Let s(d) = -h(d) - 5x(d). Factor s(q). 5(q - 8)(q + 2) Solve 65/4j*3 - 15/4j*5 + 0 - 10j*2 - 5j + 5/2j4 = 0. -2, -1/3, 0, 1, 2 Determine m so that -1/5m*2 - m + 14/5 = 0. -7, 2 Let l = 3343/13516 - -9/3379. Factor -3/2 + 0y*2 - 7/4y + ly3. (y - 3)(y + 1)(y + 2)/4 Let h be (-9 - 31/(-4))-4. Let a(u) be the third derivative of 0 + 1/200u6 + 3/40u*4 + 3/100u*h + 0u + 1/10u3 - 3u*2. Factor a(l). 3(l + 1)*3/5 Suppose -4n - 6 - 5 = 3w, 3w - 24 = 3n. Let p = 7 + n. Factor 0 - 1/3h*4 + 0h - 1/3h3 + 0hp. -h3(h + 1)/3 Let c(z) be the second derivative of -z5/20 + z4/4 + 3z*3/2 - 27z*2/2 - 6z. Factor c(s). -(s - 3)*2(s + 3) Suppose 4f = -f - 2y + 8, 4f = 2y + 10. Suppose -4h = -k - 4, -22 = 4h - 5h - 5k. Find j such that -2 + hj - 1/2j*f = 0. 2 Factor 3159w*4 - 42w*2 - 52w*3 + 24w + w*3 - 3144w*4. 3w(w - 4)(w + 1)(5w - 2) Let u be (-45)/(-85)(18/(-4))/3. Let d = -5/17 - u. Factor 0 - dw3 + w2 + 0w. -w2(w - 2)/2 Suppose 0 = -2s - 2s. Suppose 4z - 4 = 3q, 2z + sz = -5q + 28. What is v in v4 - v2 - 2vz - v3 - v3 = 0? -1, 0 Let f(w) be the second derivative of w5/110 - 2w4/11 - 13w*3/33 + 41w + 2. Factor f(d). 2d(d - 13)(d + 1)/11 Suppose 2l + 11 = -4g + 5g, -2g - 2l = 2. Factor gr + 0r - 45r3 - 8r + 30r2. -5r(3r - 1)*2 Let b = -277 + 282. Let n(v) be the second derivative of 0 - 1/3v*3 + 1/12v*4 + 0v*2 - bv. Factor n(w). w(w - 2) Let p(m) = -33m*4 - 45m*3 + 9m*2 + 3m. Let f(k) = 8k4 + 11k*3 - 2k*2 - k. Let z(s) = 9f(s) + 2p(s). What is b in z(b) = 0? -1, 0, 1/2 Let g(q) be the third derivative of -q7/210 - q6/15 - 7q5/60 + q2 - 6q. Factor g(w). -w2(w + 1)(w + 7) Let p be -9(-1 - 10/(-15)). Factor -4op - 36o - 15 + 15 - 24o2. -4o(o + 3)2 Suppose 232/3n + 3364/3 + 4/3n2 = 0. Calculate n. -29 Let z = -469 - -472. Let t(x) be the first derivative of -6x - x*z + 9/2x*2 + 6. Determine l, given that t(l) = 0. 1, 2 Let u be 26976/(-40446) + 2/3. Let z = u + 3302/963. Find s, given that 13/7s*2 + zs + 9/7 + 2/7s3 = 0. -3, -1/2 Suppose -3t + 13 = 6y - y, -2y + t + 14 = 0. Factor -8l2 - 2l*2 + 12l*4 + l + 4l - 2l4 - 5l*y. -5l(l - 1)3(l + 1) Let p(f) = 4f + 14. Let m be p(-3). Suppose 4 + 18g + 17g + 7g*2 + 42g*m - 7g = 0. What is g? -2/7 Factor 182p4 + 1 - 38p*3 - 376p*4 - 70p*2 + 192p*4 - 34p - 1. -2p(p + 1)*2(p + 17) Let d(m) be the third derivative of -m*5/80 - 5m*4/16 - 25m*3/8 + 224m*2. Factor d(a). -3(a + 5)2/4 Let a(j) = -j3 + 3j2 + 3j + 4. Let q be a(3). Solve -2z2 - qz*3 + 18z*3 - 3z3 = 0 for z. 0, 1 Let d(c) be the first derivative of c6/39 - 14c5/65 + 19c*4/26 - 50c*3/39 + 16c*2/13 - 8c/13 + 66. Find g, given that d(g) = 0. 1, 2 Let g = 8818/5289 - 1/1763. Find c such that 2c + 1/3c2 + g = 0. -5, -1 Let x(f) be the first derivative of -f4/18 - 58f3/9 + 59f*2/3 - 178f/9 + 459. Determine i so that x(i) = 0. -89, 1 Let z(g) be the third derivative of g*6/24 - 11g*5/12 + 15g*4/4 - 660g*2 - 2. Factor z(c). 5c(c - 9)(c - 2) Find x, given that -x3 - x4 - x*5 - 1 - x + 54x*3 + 2x*2 - 51x3 = 0. -1, 1 Let b(l) be the third derivative of -l8/4032 - l7/144 - l6/24 + 19l5/30 - 12l*2. Let k(q) be the third derivative of b(q). Factor k(n). -5(n + 1)(n + 6) Let t(j) be the third derivative of -j7/1050 + j6/20 + 8j5/75 - j4/4 - 31j3/30 + 43j*2 - 2j. Find d such that t(d) = 0. -1, 1, 31 Let h = 20136 + -20131. Factor 2/5dh + 2/5 + 2/5d*4 - 4/5d*2 + 2/5d - 4/5d3. 2(d - 1)*2(d + 1)3/5 Let d(l) be the second derivative of -l6/144 - l*5/24 - 5l*4/72 + 27l*2/2 - 23l. Let p(s) be the first derivative of d(s). Find i, given that p(i) = 0. -2, -1, 0 Suppose 2q = -0q + q. Let w be (q(-6)/12)/(2 + 0). Factor 6/7l - 2/7l3 + w + 4/7l*2. -2l(l - 3)(l + 1)/7 Let m = 98 - 101. Let q be 4/(-20)30/4 - m. Find t, given that -qt*2 - 3/2t + 0 = 0. -1, 0 Let a(t) be the first derivative of 2t3/27 - 28t*2/9 + 392t/9 - 42. Solve a(x) = 0 for x. 14 Suppose -114q = -28q - 430. Suppose y*q + 0 - 1/4y - 3/4y3 + 5/4y*4 - 5/4y*2 = 0. What is y? -1, -1/4, 0, 1 Let i(m) = -9m + 9. Let b be 8/12 + (-2)/(-6). Let g be i(b). Solve 1/4j3 - 1/4j + 0 + gj2 = 0 for j. -1, 0, 1 Let p be (60/50 - 2)/(-4). Factor 2/5 + 3/5s + ps2. (s + 1)(s + 2)/5 Let c be (-8)/(1120/(-21))-356. Let a = 659/10 + c. Factor -1/2s*2 - a + 5s. -(s - 5)*2/2 Let p be 4/14 + 111/(-21). Let h(j) = 2j*2 - 18j - 6. Let r(z) = z*2 - 17z - 5. Let x(m) = ph(m) + 6r(m). Determine a so that x(a) = 0. -3, 0 Let l(j) = -j + 15. Let v be l(10). Solve 28f3 - 4f*2 - 27f*2 + 18f + 2fv - f2 - 12f4 - 4 = 0. 1, 2 Let y(o) be the first derivative of -o4/12 + 4o3/9 + 19o*2/6 + 14o/3 - 32.	{ "pile_set_name": "DM Mathematics" }
prime factors of h(-4). 11 Let g = -51 - -94. List the prime factors of g. 43 Let g = 63 - 35. Let b = g - 9. What are the prime factors of b? 19 Suppose -5n + 190 + 55 = 2a, -5n - 100 = -a. List the prime factors of a. 5, 23 Let p = -1 + 9. Let o = -5 + p. List the prime factors of o. 3 Let m(h) = -9 + 8 + 9h - 2 + h*2. What are the prime factors of m(-10)? 7 Let m = -7 + 10. Let g = m - 0. What are the prime factors of g? 3 Let d(n) = -4n - 4n + 7n. Let c be d(0). Suppose -4p - 3v + 18 - 6 = c, -p + 3 = -v. List the prime factors of p. 3 Let i(l) = 6l. What are the prime factors of i(6)? 2, 3 Suppose -d = -4p + 2d - 7, -5p - d = 4. Let w be 3 + 0 + 0 + p. Suppose 12 - 38 = -wr. What are the prime factors of r? 13 Let h = 1 + 99. Suppose -5a = -a - h. Suppose 19 = 4z - a. List the prime factors of z. 11 Let i = 4 + 2. Suppose -5s + 69 = -i. List the prime factors of s. 3, 5 Let l = 45 + -27. List the prime factors of l. 2, 3 Suppose -5p + 0n + 13 = 4n, n = -4p + 6. Suppose 0 = q - 3 + p. List the prime factors of (2/(-2))/((-1)/q). 2 Let q be (-710)/(-15)(-9)/6. Let y = -41 - q. List the prime factors of y. 2, 3, 5 Let z(j) be the second derivative of j4/12 - j3/6 - j2/2 - j. Let m be z(2). What are the prime factors of 1 + m/1 + 4? 2, 3 Let x(j) = j3 - 4j*2 - 2j - 3. Let v = 4 - -1. Let y be x(v). Let t = -4 + y. List the prime factors of t. 2 Suppose -5j = -i - 4i - 20, -5j + 30 = 5i. What are the prime factors of j? 5 Suppose -3a = -i - a + 59, -3i + 133 = 5a. What are the prime factors of i? 3, 17 Let u = -43 + 60. Suppose -d + 6 = -u. Let j = d - 13. What are the prime factors of j? 2, 5 Let q be (-3)/(-2) + (-561)/(-34). Suppose -3c = -q - 57. List the prime factors of c. 5 Let n(o) = -o*2 + 9o + 3. Let h be n(9). Suppose -2l = z - 21, -z - hz + 62 = -3l. What are the prime factors of z? 17 Let j(s) = -s3 + 6s*2 + 9s - 1. Let a(t) = t + 12. Let m be a(-5). List the prime factors of j(m). 13 Suppose 0 = -9k + 8k + 30. What are the prime factors of k? 2, 3, 5 Suppose 4z + 0z - 316 = -2a, -2z + 162 = 3a. What are the prime factors of z? 2, 3, 13 What are the prime factors of (-3 + 52/(-8))-2? 19 Let z(u) = -u + 3. Let s be z(-5). What are the prime factors of (-3)/(-4) - (-58)/s? 2 What are the prime factors of (-4)/1 + 33 + 6? 5, 7 Let s(c) be the first derivative of c*3/3 - 2c + 4. What are the prime factors of s(-2)? 2 Let d(i) = i*2 - 3i - 2. Let w be d(4). Suppose -wt - 4h + 8 = -26, -25 = -5h. What are the prime factors of t? 7 Suppose 4p - 32 = -f + 5p, -6 = 2p. What are the prime factors of f? 29 Suppose 0 = -0p + 4p + 5j - 378, -4p = 3j - 374. List the prime factors of p. 2, 23 Suppose -4b - 13 = -s, 5b + 13 = -2s - 0. Suppose -s = -3z + 59. What are the prime factors of z? 2, 5 Let x = 9 - -19. List the prime factors of x. 2, 7 Let c(i) = 3i*3 - 2i*2 - 2i + 4. List the prime factors of c(2). 2 Let t be (-12)/8(-32)/(-6). Let q be (-4)/16 + (-42)/t. Suppose qk + 5 = -2p - 0k, 14 = p - 3k. List the prime factors of p. 5 Let x = 0 - -9. Suppose t - x = 3y, -t + 3y + 21 = 4t. Suppose w + 16 = tw. What are the prime factors of w? 2 Let j(r) = -r3 - r2 + 3. List the prime factors of j(-6). 3, 61 Let n(m) = 2m*3 + 1. Let g be n(-1). What are the prime factors of 2 - 12/g - -3? 17 Let n be ((-20)/(-6) - 3)-21. What are the prime factors of 24(n/2)/(-7)? 2, 3 List the prime factors of 31 - ((-10)/15)/(4/(-6)). 2, 3, 5 Let a(z) = 5z*2 - 2z + z + 1 + z. What are the prime factors of a(-2)? 3, 7 Suppose -456 = -5h - 2m, -h = -6h + 4m + 468. List the prime factors of h. 2, 23 What are the prime factors of 4/(-24) - (-1454)/12? 11 Suppose 6f - 5n = f + 5, 5n = -4f - 5. Suppose f = 5w - 161 + 46. Suppose -5c + w = -2. List the prime factors of c. 5 Suppose 0x - x + 4 = 0. Let n(k) = 12k*2 + k - 1. Let d be n(1). Let q = x + d. What are the prime factors of q? 2 Suppose -3r + 237 = 2r - 2l, 114 = 2r + 4l. What are the prime factors of r? 7 Let j(p) = -p*2 + 9p + 3. Suppose -3k - 63 = -21. Let d = 23 + k. What are the prime factors of j(d)? 3 Suppose 5g - 27 = 18. Suppose 3p + g = -0p. List the prime factors of 7 + (p - -2) - -1. 7 Suppose u = -0 - 2. Let n be ((-2)/6)/(u/66). Let a = n + -1. What are the prime factors of a? 2, 5 Let u(o) = -6o + 6o + 2 + 5o. Let j be u(5). Suppose 4m - 1 - j = 0. List the prime factors of m. 7 Let j be (-156)/10 + 4/(-10). Let q = -11 - j. List the prime factors of q. 5 List the prime factors of ((-4)/5)/(2/(-240)). 2, 3 What are the prime factors of (-5)/(30/(-144)) - (-1 + -1)? 2, 13 Let a(n) be the second derivative of 0 + 5/2n2 + n + 2/3n*3 - 1/20n*5 - 1/4n*4. What are the prime factors of a(-4)? 5 Let z = -5 + 2. Let c be 4/(-12) + (-16)/z. Suppose -2n = -cn + 33. What are the prime factors of n? 11 What are the prime factors of ((-18)/(-5))/(-1)(-80)/24? 2, 3 Let g(i) = 2i - 15. Let l be g(9). Suppose -5h + j + 32 = 0, -4h - 2j + 26 = -lj. What are the prime factors of h? 2, 3 Let y(a) = a2 - a + 21. Suppose 4v - 2v = 0. List the prime factors of y(v). 3, 7 Suppose 9 = 3p - 6. Suppose -n - 3n = -px - 40, 5x + 5n - 5 = 0. Let h(c) = -2c + 4. What are the prime factors of h(x)? 2, 3 Let s = 846 + -598. What are the prime factors of s? 2, 31 Suppose 4l = 0, 2j = l - 6l + 2. List the prime factors of 4 - j - -22 - 2. 23 Suppose 10u + 5u = 45. What are the prime factors of u? 3 Let p(k) = k*2 + 15k - 38. What are the prime factors of p(10)? 2, 53 Let d(i) = -2i3 - 7i*2 + 6i + 5. What are the prime factors of d(-5)? 2, 5 Let h(p) = -p*2 - 8p + 3. Let n be h(-8). Suppose 4i - 3 = ny + 97, -90 = -5i - 5y. List the prime factors of i. 2, 11 Suppose k - 6 = -2. Let d = k + -2. Suppose -dc + 40 = 3c. What are the prime factors of c? 2 Let x(k) be the first derivative of -1/4k4 - 3 + 2k*3 - 5/2k*2 + 6k. List the prime factors of x(5). 2, 3 Let o = -120 - -490. What are the prime factors of o? 2, 5, 37 Let m = 6 + 4. List the prime factors of m. 2, 5 What are the prime factors of 30/45 - (-260)/6? 2, 11 Suppose 324 = 7o - 3o. What are the prime factors of o? 3 Let w = 45 + 28. List the prime factors of w. 73 Suppose 0 = z - i - 0 - 1, 0 = 5z + 3i + 11. Let m be 6(7/(-3) - z). What are the prime factors of (m/6)/((-2)/9)? 2, 3 Suppose -2c + 6c - 12 = 0. Suppose 5a + 51 = 4i, -ci - 4a + 32 = -i. List the prime factors of i. 2, 7 Let w(r) = r2 + 4. List the prime factors of w(7). 53 Suppose 609 = 3m - 21t + 24t, 4m - 806 = -t. List the prime factors of m. 3, 67 Let t be (4/(-7))/((-14)/49). Suppose -tb - 1 = 15. Let v = 4 - b. What are the prime factors of v? 2, 3 Let q = -104 - -153. Let u = -16 + q. List the prime factors of u. 3, 11 Let o = 2 - 2. Suppose -6 = -r - or. Let x = 6 + r. What are the prime factors of x? 2, 3 Let y = -13 + 18. Suppose 4q + 0q + yj + 12 = 0, 20 = -5j. Let t = q - -1. What are the prime factors of t? 3 Let r = 3 + 1. What are the prime factors of r? 2 Let z be 121(-1)/(-2). Suppose 0 = 3g + b - 43, 4g + 3b - 53 = zb. List the prime factors of g. 2, 7 Suppose d + 2d = 48. What are the prime factors of (-35)/(-14)d/10? 2 Let o be 5/(40/36)4. Let c = 56 - o. What are the prime factors of c? 2, 19 Let i(q) = 4q2 - 2q + 8. List the prime factors of i(-4). 2, 5 Suppose 3i - 5m = -2i, -8 = -2m. Suppose ig - 73 = -3p, -p + 83 = -g + 6g. List the prime factors of g. 2 Suppose 2r + 5 = -2j - 1, -r - 5 = 3j. List the prime factors of (-3)/j + 14 + -3. 2, 7 Let j be (-7)/(-14) - (-9)/2. Let w be (11 - 1)(-3)/(-6). Suppose -wv + j = -5. What are the prime factors of v? 2 Let d(f) = 2f2 - 11f + 4. Let z be d(7). Let o = z - 18. Suppose o = c - 4a + 20, 5 = -c + 2a. What are the prime factors of c? 3 Suppose -d + 4d - 204 = 0. Suppose d = 2j - 10. List the prime factors of j. 3, 13 Let p(i) = -11i - 9. Let k(m) = m2 - 9m + 5. Let d be k(8). What are the prime factors of p(d)? 2, 3 Suppose -b - b = 0. Suppose -f + bf + 3 = 0. What are the prime factors of f? 3 Let s = -10 + 3. Let f(b) = b3 + 8b*2 + 2b + 2. What are the prime factors of f(s)? 37 Let r =	{ "pile_set_name": "DM Mathematics" }
+ 12.68637. Let b = -2.43 - -2.3. Let q = b - d. Round q to 7 dps. -0.0000018 Suppose 2144000 = -207q + 209q. Round q to the nearest one hundred thousand. 1100000 Let t = 70 - 65. Suppose 2j - 12002 = g + j, 0 = -tg - 2j - 59996. Round g to the nearest 1000. -12000 Suppose 2z - 904 - 116 = 0. Round z to the nearest ten. 510 Suppose 2o - 2408 = -2o. Suppose o = -4x + 126. What is x rounded to the nearest ten? -120 Let z(n) be the third derivative of -2n5/15 + n4/8 - 7n3/6 - 5n2. Let x be ((-7)/2)/(2/4). Let m be z(x). Round m to the nearest one hundred. -400 Let y = 182738920.1 - 181880977.320093. Let w = -858018.78 + y. Let u = w - -76. Round u to five decimal places. -0.00009 Let k(x) = -x2 + 3x. Let g be k(3). Suppose g = 4l - 20, -i - 11626557 = 2i - 3l. Let b = 375514 + i. Round b to the nearest 1000000. -4000000 Let n = 856 + -856.002936. Round n to 4 decimal places. -0.0029 Let m = 749645421507.99967 + -749651019914. Let s = -5598352 - m. Let p = 54 - s. What is p rounded to 4 decimal places? -0.0003 Let j = -212 - -202.83. Round j to the nearest integer. -9 Let k = -29.0535 + 0.1935. Let w = 30 + k. What is w rounded to one dp? 1.1 Let d = -262.0231 - -0.0231. Let n = d + 262.00394. What is n rounded to four dps? 0.0039 Let l = 1348.22 - 1336. Round l to one decimal place. 12.2 Let d(n) = 32n2 - 9n - 34. Let y be d(5). Round y to the nearest ten. 720 Let w = -28 - -17. Let i = w + 5. Let v = i - -6.0003. Round v to four decimal places. 0.0003 Let x = 0.0289 + -0.0458. What is x rounded to three dps? -0.017 Let b = -352936 + 213936. Round b to the nearest 10000. -140000 Let x = 8.77 - -0.23. Let g = 9.2 - x. Let j = -0.2000096 + g. Round j to six decimal places. -0.00001 Let b = 25.4 + -25.39194. What is b rounded to three dps? 0.008 Let p = 1.42 - -0.64. Let m = -2.06266 + p. What is m rounded to 4 dps? -0.0027 Let y = 73.4 + -10.4. Let f = -66.8 + -12.7. Let z = f + y. What is z rounded to the nearest integer? -17 Let v = -1.54 + 1.5. Let q = 0.2 - v. Let a = q + -0.23954. Round a to 4 decimal places. 0.0005 Let n(f) = -102669f + 35. Let o(m) = -m + 24. Let b be o(9). Let p be n(b). What is p rounded to the nearest one hundred thousand? -1500000 Let w be 2 + (20 - 1) + -3. Let h be 6/27 + 6746/w. Let r be -4(-1)/12h. Round r to the nearest ten. 130 Let a = -5.91 - 0.09. Let q = -7.3 - a. Let i = q + 1.29993. Round i to 5 dps. -0.00007 Let c = -4978.1 - -5204. What is c rounded to the nearest 10? 230 Let d = 0.137 - 0.073. Let t = 7.045206 + -7.1091. Let n = d + t. What is n rounded to five decimal places? 0.00011 Let d = -0.073 - 5.467. Round d to 0 dps. -6 Let k(h) = 5h*2 + 2h + 2. Let s be k(-1). Suppose si - i + 24 = 0. Let c be (-80)/4(-219)/i. Round c to the nearest one hundred. -700 Suppose -o + 3o - 334 = 0. Let i = 73 - o. Round i to the nearest one hundred. -100 Let z = 12.3 + 0.7. Let x = z - 10.4. Let c = 2.5999935 - x. What is c rounded to 6 dps? -0.000007 Let o = 1175697713 + -1175680665.620076. Let y = -17047 + o. Let m = y + -0.38. What is m rounded to 5 decimal places? -0.00008 Let o = -0.16 + 0. Let h = -0.5 - o. Let w = h - -0.3400035. Round w to 6 decimal places. 0.000004 Let s(m) = -m2 - 300000. Let k be (-2 - -1) + 2 + 1. Suppose -kd = d + 3q + 9, 3q + 9 = 4d. Let t be s(d). Round t to the nearest 1000000. 0 Let h = -41 + 57.6. Let n = h - 85.6. Let q = n + 69.000091. What is q rounded to 5 decimal places? 0.00009 Let o = -13.1 + 29.8. Let m = -1.8 + -16.2. Let l = m + o. What is l rounded to 1 dp? -1.3 Let w = 400.9647 - 401. What is w rounded to 3 decimal places? -0.035 Let s(z) be the third derivative of 151z5/12 - z4/6 - 6z2. Let y be s(-9). Let i be (-1)/4 - y/36. Round i to the nearest one thousand. -2000 Let o = 185.061 + -185. What is o rounded to 1 decimal place? 0.1 Let t = 988425882.932454283 + 0.067545717. Let d = -988425918.00000063 + t. Let f = d + 35. What is f rounded to 7 decimal places? -0.0000006 Let q = 2498.65 + -2553. What is q rounded to the nearest ten? -50 Let k = -58 + -55. Let p = -112.853 - k. Let q = p - 0.1469897. What is q rounded to six decimal places? 0.00001 Let w(t) = -t3 + 10t*2 + 50t - 231. Let i be w(39). Round i to the nearest ten thousand. -40000 Let m(l) be the second derivative of l4/3 + l3/3 + 3l2/2 - 8l. Let w be m(3). Let i be 27/w + 418/(-5). Round i to the nearest 10. -80 Let s be 60/(-45) - 2/3. Let d be (-5992008)/56 - s/14. What is d rounded to the nearest one hundred thousand? -100000 Let n = 11131 - 11130.92889. What is n rounded to 3 decimal places? 0.071 Suppose p = -0p - 4j + 26, 0 = -p + 2j + 44. Suppose -3t + 0i + 32 = -5i, 4t = 2i + p. Let d = t + -9. What is d rounded to the nearest 10000? 0 Let p(y) = -2y2 - 14y - 15. Let d be p(-5). Suppose 4h + 19 = a - 31, -da = 3h + 26. What is h rounded to the nearest integer? -12 Let z be 20504 - (2 - 2 - -1). Suppose -5m + 0m = -10. Suppose 4h - z - 7877 = mb, 3h = 5b + 70985. What is b rounded to the nearest 1000? -14000 Let h = -0.014200325 - -0.0142. What is h rounded to seven decimal places? -0.0000003 Let y(o) = o + 14. Let t be y(-7). Let r(p) = -105p + 105p + t + 4p*2. Let a be r(-5). Round a to the nearest 10. 110 Suppose 2d - 15 = -5a, 5d - 3a + 0a + 9 = 0. Let s(m) be the first derivative of -m3/3 + m2/2 - 193m + 1. Let v be s(d). Round v to the nearest ten. -190 Let r = -260297 - -460097. What is r rounded to the nearest ten thousand? 200000 Let u(s) = 90s + 110. Let r be u(-41). What is r rounded to the nearest one thousand? -4000 Let z be ((-4)/(-8))/((-2)/(-8)). Suppose 0 = zy - 118061 - 6189. Suppose y = -3o - 84875. Round o to the nearest 10000. -50000 Let x(v) = -v*2 + 17v - 2000. Let q be x(0). What is q rounded to the nearest one hundred? -2000 Let g = -0.00610503 - -0.0061. Round g to six decimal places. -0.000005 Let c be (-18305)/45 + 4/(-18). Let t = -368 - -231. Let l = t - c. Round l to the nearest one hundred. 300 Let m = -0.74 + 86.74. Let b = m - 86.000002. Round b to 5 decimal places. 0 Let u = 653.74 + -677. Let p = -23 - u. Let h = 0.269 - p. What is h rounded to 2 dps? 0.01 Let r = 407.9998234 - 408. What is r rounded to 4 dps? -0.0002 Let j = 236 + -131. Let n = 23810162.96 - 23810057.95999887. Let d = j - n. Round d to seven decimal places. -0.0000011 Let v(y) = -4y2 + y. Let p be v(-1). Let l = p + 7. Suppose -2q + 1894 = -7q - 2z, 0 = 3q - lz + 1146. Round q to the nearest 100. -400 Let l(h) = 5h - 65. Let i be l(14). Suppose -1592 = -4c - 4a + 2a, -ic - 4a + 1984 = 0. Round c to the nearest 100. 400 Let z(r) = -2r + 10. Let i be z(5). Suppose -4t - j - 19999997 = i, -5t + 3j - 8830562 = 16169447. What is t rounded to the nearest 1000000? -5000000 Suppose -6x + x - 15 = -4d, 0 = 2d. Let p = 7 + x. Suppose -t = 4k - 479996, 3k + pt - 9t = 360020. What is k rounded to the nearest 10000? 120000 Let d = -4.564 + 5.9636. Let u = -71.6 + 73. Let t = u - d. Round t to four decimal places. 0.0004 Let r = 1259.014 - 1259.16399842. Let i = 0.15 + r. What is i rounded to 7 decimal places? 0.0000016 Let m = 0.01559742 - 2003236.01559742. Let k = 2003235.8079913 + m. Let p = 0.192 + k. What is p rounded to six decimal places? -0.000009 Let d be -9 + 7 + 2 + 2. Suppose 18 = 4o - 2. Suppose -2s = 3n + 1599991, 2s - on = -dn - 1600009. What is s rounded to the nearest 100000? -800000 Let r = 23.1369 - 18.836494. Let f = r - 4.3. What is f rounded to 5 dps? 0.00041 Let l be (-670)/((-90228)/11280 - -8). Round l to the nearest 100000. -600000 Let r = 966 + -964.906. Let x = r - 1.67. Round x to one dp. -0.6 Let d = 0.0086 + 200.9914. Let i = 0.3307362 + 200.6561638. Let z = i - d. What is z rounded to three decimal places? -0.013 Let k be (256/(-20))/(4/(-10)). Suppose 139 = -v + k. What is v rounded to the nearest 10? -110 Let l(p) = -9p*2 + 10p + 125. Let w be l(-27). What is w rounded to the nearest 100? -6700 Let y = 92 - 47. Let t = y - 49.8. What is t rounded to zero dps? -5 Let g = -32.6 - -36. Let o = g - 3.39991. What is o rounded to four decimal places? 0.0001 Let r = 21 + 1.8. Let n = -25 + r. Let p = n + 2.1. What is p rounded to 2 dps? -0.1 S	{ "pile_set_name": "DM Mathematics" }
e -ou = -4c - 784, c = 3u + 3c - 760. What is the highest common factor of 8 and u? 8 Suppose 4 + 0 = 2i. Suppose d + id = 24. Suppose 5g + 172 = 2w + 6, 4w - 5g = 342. What is the greatest common factor of w and d? 8 Suppose 4d + 4n + 30 = 254, 0 = -5d - n + 280. Let a = d + 12. What is the highest common divisor of a and 4? 4 Suppose -22r + 0r + 144 = -6r. Let i = 233 + -161. Calculate the highest common divisor of r and i. 9 Suppose -i = -0w - 2w + 23109, -i = 2w - 23119. What is the highest common factor of 273 and w? 91 Let w be 1/3 - 3(-24)/27. Let b be w/(-8)-2 + (-21)/(-4). Suppose -bj = -87 - 81. Calculate the greatest common divisor of 4 and j. 4 Suppose 0 = 15d - 45d + 16866 + 34974. Calculate the greatest common factor of d and 513. 27 Let i(x) = -45 - 31x + 15x - 2x2 + 0x2 + x2. Let y be i(-11). What is the highest common divisor of y and 10? 10 Let l = -304 - -308. Suppose -lk + 22 + 44 = -5g, 0 = 2k - 2g - 32. What is the highest common factor of 77 and k? 7 Suppose -239 = 4u - 43. Let d = -46 - u. Suppose dl = 0, -3h + 3l + 312 + 33 = 0. What is the greatest common factor of 46 and h? 23 Let l(p) = -4 + 4p - 9p*3 - 6p*3 + 13p*3 + 2p*2. Let u be l(-4). Calculate the highest common factor of u and 112. 28 Let r(p) = -6p + 35. Let s(c) = 5c - 36. Let a(d) = 2r(d) + 3s(d). Let h be a(10). Let n = 28 + h. What is the highest common divisor of n and 160? 20 Let x(t) = 5t*2 - 1155t - 6950. Let l be x(-6). What is the highest common divisor of l and 1880? 40 Suppose 19z - 25596 = 77289. Calculate the greatest common divisor of z and 456. 57 Suppose 31w = 62w - 0w - 806031. What is the greatest common factor of w and 243? 243 Suppose 3b + 8210 = 14u - 13u, -4b + 16470 = 2u. Calculate the highest common factor of u and 35. 35 Let r be 7/(-21) - -1483/9. What is the greatest common factor of 2401 and r? 49 Let c = 49 - 31. Let s be 3/c - (671/(-6) + 0). Let t be (48/(-4))/((-6)/8). What is the highest common factor of t and s? 16 Suppose -4w + 4b + 1162 = w, -3w = -5b - 705. Let y(o) = 2o2 - 263o + 1275. Let l be y(5). Calculate the highest common factor of w and l. 10 Suppose 4v = 4b - 132, -112b + 186 = -107b + 2v. Let z = 40 + -23. Let q = 25 - z. What is the greatest common divisor of b and q? 4 Suppose 3j - 3 - 16 = -2s, -15 = -j - 5s. Let g(v) = -4 + 1 + j + 1 + 37v. Let f be g(1). Calculate the greatest common divisor of 10 and f. 10 Suppose -226k = -69k - 10205. Calculate the greatest common divisor of k and 793. 13 Let y = -3970 - -4210. Calculate the highest common factor of y and 912. 48 Let n = -125 - -127. Let k(s) = s3 + 12s*2 + 30s - 5. Let h be k(-4). Calculate the greatest common factor of h and n. 1 Suppose -46 = -3a - 7. Suppose -3x - a = -127. Let i = 113 - x. What is the greatest common divisor of i and 15? 15 Let x(f) = f + 4. Let o be x(10). Let v(y) be the third derivative of y5/60 - y4/24 + y2. Let z be v(2). Calculate the highest common factor of o and z. 2 Let o = 10395 - 8540. What is the greatest common divisor of o and 2385? 265 Let u(w) = -w3 - 21w2 + 22w + 21. Let a be (-10)/15 - 200/(-3). Let l = a + -88. Let s be u(l). What is the highest common divisor of 3 and s? 3 Suppose -105 + 25 = -5q. Let k = -670498 - -670578. Calculate the highest common divisor of q and k. 16 Let i = 343 + -167. Let y(s) = -3s + 11. Let o be y(-9). Let a = -16 + o. Calculate the highest common factor of i and a. 22 Suppose 8 = 39a - 37a. Suppose f = -n + 149 + 21, af - 340 = -2n. Calculate the highest common divisor of n and 20. 10 Suppose 5d = -f + 5f + 9, 16 = 4d - f. Suppose -r + d - 1 = 0. Suppose rl + 37 = 289. What is the highest common divisor of l and 9? 9 Suppose m + 6m = 1960. Suppose 0t + 8 = 2t, m = 5d + 5t. What is the highest common factor of 39 and d? 13 Suppose -6m = -2m - 320. Let l(u) = -u3 + 8u*2. Let q be l(8). Suppose -9f + 14f - m = q. Calculate the greatest common divisor of 144 and f. 16 Let l = 72 + -68. Suppose -12 = -ld + 4m, 3m = -m - 12. Suppose -4c - 4c + 16 = d. Calculate the greatest common divisor of c and 8. 2 Let f be (-60)/(-27) - 2/9. Let t be 32 + 0f/6. Suppose 2z - n - 49 = 267, z = 3n + 148. Calculate the greatest common divisor of z and t. 32 Suppose 37c + 975 = 40c. Let j be 1 + 4 + -31 + 26 + c. Calculate the greatest common factor of j and 25. 25 Let m(l) = 5l*2 + 16l + 4. Suppose 9o + 5 = 8o. Let v be m(o). What is the greatest common divisor of v and 196? 49 Suppose 0 = 2x + 1554 - 1618. Calculate the greatest common factor of 568 and x. 8 Suppose 7h + 2371 = 7586. Calculate the highest common divisor of h and 1043. 149 Suppose 0 = -42u - 40u + 9840. Calculate the highest common divisor of 228 and u. 12 Suppose 70 = 10p - 90. Suppose -5a + 839 = 5w - p, 2a = -4w + 334. What is the greatest common divisor of 35 and a? 35 Let b be 36/(-3)28/6. Let t = -51 - b. Suppose -tu + 8 = -17. What is the highest common factor of 55 and u? 5 Let b be (-191)/(-7) + 68/(-238). Let y be (9/2)/(1194/396 + -3). What is the highest common divisor of b and y? 27 Let a(n) = 3n*2 - 93n - 655. Let o be a(-7). What is the greatest common divisor of 1235 and o? 13 Let l(x) = -30x - 17 + 8 + x3 + 12 - 13x*2 + 42 + 4x. Let z be l(15). What is the highest common divisor of 140 and z? 35 Suppose -5a + 158 = 4q - 77, 0 = a + 2q - 53. Let n(u) = -u3 + 5u*2 + 72u - 84. Let s be n(-8). Calculate the greatest common divisor of a and s. 43 Let s = -666 - -663. Let m be s + (210/(-4))/((-4)/8). Calculate the greatest common factor of m and 6. 6 Suppose 0 = x - i - 14, 3x + 0i + 5i - 26 = 0. Let p be 235 - ((-2 - 3) + 0). Calculate the highest common divisor of p and x. 12 Let b = 191 + -998. Let o = -729 - b. What is the greatest common divisor of o and 273? 39 Suppose 2l - 3g - 373 = 0, 2g - g + 1 = 0. Suppose 4o - 6o + 12 = 0. Let t = o - -31. Calculate the highest common divisor of t and l. 37 Let v be -12(-708)/24. Suppose -2x + 241 = 5. What is the greatest common factor of x and v? 59 Suppose 8p - 135 = -31. Suppose 0z = -z + 13. Suppose -2m + 13 = -z. Calculate the greatest common divisor of p and m. 13 Let i = 15471 - 15357. Calculate the highest common factor of i and 28. 2 Let o = -3586 - -3670. Calculate the greatest common factor of o and 147. 21 Let a(z) = z*3 - 72z*2 - 78z + 372. Let i be a(73). What is the highest common factor of 4501 and i? 7 Let x(p) = -p*3 + 24p*2 + 51p + 88. Let c be x(26). Let v(g) = 18g2 + 2g - 1. Let h be v(-3). Calculate the highest common divisor of h and c. 31 Let v be (2/(-5))/((-12)/(-30)) - -8 - -123. What is the highest common factor of v and 30? 10 Let d(r) = r*2 - 19r - 17. Let y be d(20). Suppose -5l - 34 = -3n + 45, -yn - 3l = -63. Let t = -7 - -30. Calculate the greatest common factor of t and n. 23 Let x(z) = 2024z2 - 177z - 538. Let w be x(-3). What is the greatest common divisor of w and 139? 139 Let w(p) = 7p2 - 16 + 0p*2 + 4p*2 + 18 + 2p*2 - p. Let s be w(-1). What is the greatest common divisor of s and 256? 16 Suppose 254 + 772 = 54m. Suppose -mf + 17f = -12. What is the highest common divisor of f and 20? 2 Let c(g) = 7g2 - 4g - 28. Let x be c(-4). Calculate the greatest common factor of 235 and x. 5 Let a be ((-1)/3 + 61/3)(-29279)/(-1748). What is the highest common factor of 1541 and a? 67 Let n be (6/(-5))/(5 + -10 + 1729/350). Suppose -3u = u - 16. What is the highest common factor of u and n? 4 Suppose -38h + 2673 = -11h. Let n = -57 - -139. Let p = -16 + n. What is the greatest common divisor of p and h? 33 Let q(o) = 25o3 - 16o*2 + 58o + 6. Let k be q(3). What is the greatest common factor of k and 135? 9 Let b be (4/6 - 1/3)402. Let f = 153 + b. Calculate the greatest common divisor of 41 and f. 41 Suppose 4d - 52 = -4l, -3l + 25 = 2l - 5d. Let a = -507 + 291. Let t be (58/(-18) - 48/a)-3. Calculate the greatest common factor of l and t. 9 Let f(k) = 289 - k - 539 - k + 0k + 270. Suppose 2 = -a - 11. Let m be f(a). What is the greatest common divisor of 23 and m? 23 Let m = -93 + 97. Suppose -2 = 5l - mg -	{ "pile_set_name": "DM Mathematics" }
z - 4876 wrt l. 4lz + 28928z - 3 Find the second derivative of -3n*2u*2 + 315n*2u + 2nu - 630u4 - u3 - 108u wrt u. -6n2 - 7560u*2 - 6u What is the third derivative of -427722c5 - 5c*2 + 5764c? -25663320c2 Find the second derivative of -1487c*2g*3 + 2c*2 - 75cg3 + 2cg + 125g + 1 wrt g. -8922c2g - 450cg What is the third derivative of -327j4 + 1578j3 - j2 - 599398j - 1 wrt j? -7848j + 9468 What is the second derivative of -368g3 + 958g*2 + 5435245g wrt g? -2208g + 1916 What is the third derivative of -66030u*5 + 3526u*2 + 6u? -3961800u2 Find the second derivative of 1539494i*2 + 4926i - 123. 3078988 What is the third derivative of -338r6 + 1140r*2 - 15r wrt r? -40560r3 Find the third derivative of 15171h*4 - 66h*2 - 62. 364104h What is the derivative of -131f4z - 1053f3 + 2fz - 455340z wrt f? -524f3z - 3159f2 + 2z What is the second derivative of -4512q2r*2 + 165q*2r - 4080qr*2 + 2qr - 6r*2 wrt q? -9024r*2 + 330r Find the third derivative of 220m5 - 350m*3 + 11m*2 - 1579. 13200m*2 - 2100 What is the first derivative of 206458fw - 212333f wrt w? 206458f What is the first derivative of -1158il - 151i + 63l + 772 wrt l? -1158i + 63 Differentiate 358090o3 - 139921 wrt o. 1074270o2 Find the third derivative of f6 - 6511f5v + 1336f2v + 6f2 wrt f. 120f*3 - 390660f*2v Find the first derivative of 29a2d2 - a2d + 2a*2 - 89ad2 - 3958a + 3 wrt d. 58a2d - a*2 - 178ad Find the first derivative of -106984m*2 - 81587 wrt m. -213968m What is the third derivative of -612726h3k*3 + 6h*3k*2 + 24h*2k*2 + 2hk + k2 + 24 wrt k? -3676356h*3 Find the first derivative of 2x*2y*2 - 30x*2y + xy2 - 413x + 79273y2 wrt x. 4xy2 - 60xy + y2 - 413 Find the second derivative of n3 + 170310n*2 + 5n + 3239. 6n + 340620 Find the third derivative of 175082l*2y*3 + 2632l*2y - 4y2 wrt y. 1050492l*2 What is the third derivative of 5b*6p - 471b4p*2 - 5b*2p*2 + 2b*2p - 17bp*2 + 6b + 11p2 wrt b? 600b*3p - 11304bp*2 What is the third derivative of -139129f4 - f3 + 7f2 - 206f - 12? -3339096f - 6 What is the second derivative of -605c*2l*3 + 19c*2 + 5cl3 + 2311l*3 wrt c? -1210l*3 + 38 What is the third derivative of -4jp3r + 26929jp*3 + 3jp2r - 2613j + 2p*2r + 9pr wrt p? -24jr + 161574j What is the second derivative of -23235q*3x*2 - 27q*3x - 722qx wrt x? -46470q3 Find the first derivative of 22688b + 9966. 22688 Find the third derivative of -94401w3 - 4243w*2 - 22w. -566406 Differentiate -510866f2v*3 + 1406f*2 + 17f wrt v. -1532598f2v*2 What is the third derivative of 20it6 - 694it3 - 2it2 + 57173t*2 wrt t? 2400it3 - 4164i What is the derivative of 973c3 + 26c*2 + 10c + 132098 wrt c? 2919c2 + 52c + 10 What is the third derivative of 10597os*3w - os2 - 2s*3w - 51s2 + 4936w wrt s? 63582ow - 12w Find the second derivative of 37481g*2 + 15535g wrt g. 74962 What is the second derivative of gx3 - 5gx2 - 51429gx - 524x*3 + 1 wrt x? 6gx - 10g - 3144x What is the third derivative of 193p*4 - 136p*3 - 4766978p*2? 4632p - 816 Find the second derivative of 23q3 - 328q*2 + 28723q wrt q. 138q - 656 Differentiate 60813pv3 - 4v*3 - 8v*2 + 967v wrt p. 60813v3 Find the second derivative of 65i*4 + 211i*2 - 11i - 814. 780i2 + 422 What is the third derivative of 3853485c*5 - 297143c*2 wrt c? 231209100c*2 What is the third derivative of -723717p*5 + 5814p*2 + 12p? -43423020p2 Differentiate 333624p - 1215682. 333624 What is the second derivative of -126121f4 + 181228f? -1513452f2 Find the first derivative of -2445k*2m*3 + 61kmo*2 + 13143m*3o*2 - 20m*3o wrt k. -4890km*3 + 61mo2 What is the third derivative of 2dj2v*3 - djv3 + djv2 + 4dv2 - 1063j*2v*3 - 143j*2 + 1 wrt v? 12dj2 - 6dj - 6378j*2 Find the third derivative of -9835g*5 + 51g*4 - 147g*2 - 168g. -590100g2 + 1224g What is the first derivative of 10447g2v*2 - 805609g*2 - 48v*2 wrt v? 20894g*2v - 96v What is the first derivative of -87km3 + 18km2 + 3km + 6k - 2m3 - 694m*2 - 134 wrt k? -87m*3 + 18m*2 + 3m + 6 What is the third derivative of 478b4 + 460b*3 - 2b*2 - 7b - 246 wrt b? 11472b + 2760 Find the third derivative of -621b*5 + 10101b*2. -37260b*2 Find the second derivative of -135k*3 + 61k*2 - 42724k wrt k. -810k + 122 What is the derivative of 9257b*4 + bv + 20767v wrt b? 37028b*3 + v Find the third derivative of 916478m*4t + 12m2 - 19541mt wrt m. 21995472mt Find the second derivative of -23m*4 + 54m*3 + 36m*2 + 308938m - 2. -276m2 + 324m + 72 What is the first derivative of -3905961d2 + 610906 wrt d? -7811922d What is the third derivative of -373496j3 - 574739j*2? -2240976 Find the third derivative of 3s*6 - 7s*4 + 3725s*3 + 772s*2 + 199s + 1. 360s3 - 168s + 22350 What is the third derivative of -22n5qr - 243n*3q*2r - 166n2q2 + q2r - 9q*2 - 3 wrt n? -1320n*2qr - 1458q*2r What is the third derivative of 3a6 + 19039a*4 - 24a*3 - 32a*2 + 9a + 46 wrt a? 360a3 + 456936a - 144 What is the third derivative of 41y6 + 17y*4 + 18y*3 + 48388y*2 - 3y + 2? 4920y3 + 408y + 108 What is the second derivative of h*4 + 8302h*2 - 2h + 7640 wrt h? 12h2 + 16604 What is the second derivative of -2x*5 + 42804x*3 - 18717x wrt x? -40x3 + 256824x What is the third derivative of -60fz*5 + 1748fz3 - 749f + 11z2 wrt z? -3600fz2 + 10488f Differentiate 2lv*3 + 3lv2 + 7lv + 771l + 1110683v3 with respect to l. 2v*3 + 3v*2 + 7v + 771 Find the second derivative of -106u5 + 455u*3 - 90561u wrt u. -2120u3 + 2730u Find the third derivative of -7k4x*3 + 13794k*4x*2 - 3k*2x*3 - 2k*2 + 3kx3 - 5345 wrt k. -168kx3 + 331056kx2 Find the third derivative of -14990f*3 + 188f2 + 15 wrt f. -89940 What is the third derivative of h3j3 - 97h*3j*2 - 131h*3j + 2h3 + 4h*2j*3 + 4hj3 - 115j + 2 wrt h? 6j3 - 582j*2 - 786j + 12 Find the third derivative of -5675o4 + 575o*2 - 2o - 34 wrt o. -136200o What is the third derivative of 61gr3 + 2gr2 - 38gr + 2g + 22288r3 + 7r*2 wrt r? 366g + 133728 Find the second derivative of -950569u2 - 766815u. -1901138 What is the third derivative of -8g4 - 654g*3 + 160g*2 + 4g wrt g? -192g - 3924 Differentiate f2j + 4fj + 2018f - 43542j wrt f. 2fj + 4j + 2018 What is the first derivative of v3 - 154318v + 42627? 3v2 - 154318 Find the third derivative of -84568c*4v*3 + 59c*2v*2 + 2c*2v - 396v3 wrt c. -2029632cv3 What is the second derivative of 74082b*2ns3 + b2n - b*2s - 6b + 100ns3 - ns wrt b? 148164ns*3 + 2n - 2s What is the second derivative of 2j*3z*2 - 786j*3z + 7j3 + 45jz2 - 3j + 31z2 wrt j? 12jz2 - 4716jz + 42j Find the first derivative of 27j2 + 80j - 45939 wrt j. 54j + 80 Find the first derivative of -368p3 - p2 + 2p - 13196. -1104p*2 - 2p + 2 Find the second derivative of 249121rz*2 + 2r + 101z - 154 wrt z. 498242r Find the second derivative of 102356z3 - 607793z wrt z. 614136z What is the third derivative of 528578l3 + l2 + 188349l wrt l? 3171468 Differentiate 678581v*2 + 669878 wrt v. 1357162v Find the third derivative of 300216d6 - 34091d*2 - 2. 36025920d*3 Find the third derivative of 278c*3h*2l - 45c3hl3 + 2c*2h*2l*3 - 14c*2h*2l - 2c2hl2 + 2ch2l*3 - ch + 4l2 wrt c. 1668h*2l - 270hl*3 Differentiate -966c*3n4 + c3 - 322c2 - 21cn3 - 2c wrt n. -3864c3n*3 - 63cn2 Find the third derivative of -6892l*3 + 3766l*2 wrt l. -41352 What is the third derivative of 9223d*4 + 66689d*2 wrt d? 221352d What is the third derivative o	{ "pile_set_name": "DM Mathematics" }
*2 + cl + ol4 + k + ul*3 and give o. 51048 Express (14 + 7r - 14)(-14r*3 - 5r3 + r3)(2 + 0 - 4)(10 + 0 + 1) as d + br + yr*4 + lr*3 + pr*2 and give y. 2772 Rearrange 0a - 9 + 2a - 37 - 4a + 3 to x + ka and give k. -2 Rearrange -126458 + 56a*2 + 63232 + 63228 + 11a to the form ca + o + ua*2 and give o. 2 Rearrange -15064r - 9r3 - 202r*3 + 15063r - 1 to the form hr + mr*3 + ar2 + o and give h. -1 Express 10 + o2 - 8o3 + 4114o + 4106o + 4113o - 12341o as no*2 + h + vo*3 + qo and give n. 1 Rearrange 0b2 + 13b + 67b3 - 175b*3 + 109b*3 + 1 + 0b*2 + 2b*2 to the form tb*3 + db*2 + lb + r and give l. 13 Rearrange (32 - 84 + 43)(-15 - 14 + 7)(0 - 3 + 1)(k2 - k2 + 4k*2) to the form ok + hk2 + f and give h. -1584 Express (-2g*2 - g + g)(1 - 2 + 3 + 5 + 50 - 9 + (-2 - 1 + 2)(-3 - 2 + 7) + 0 - 3 + 6)(6 - 1 - 3) in the form b + cg + lg*2 and give l. -196 Express -2 + 5243l + 0 - 1504l as d + al and give d. -2 Express (1 - 1 + 1)(-1 + 0 + 0)(804j - 13443 + 13443) in the form y + nj and give n. -804 Rearrange -89x3 - 87x*3 + 174x*3 - 7x*2 + 26 + 2x + 11 to vx3 + nx*2 + b + sx and give v. -2 Rearrange k*4 - 2k*2 + 234 + 36 + 2k*3 - 270 - 755k to the form x + pk2 + dk + zk4 + hk*3 and give p. -2 Express -108 + 367z*2 - 110z*2 - 248z*2 in the form uz + y + gz2 and give u. 0 Rearrange -2860m + 0 + 0 + 2672m + 15689m to the form cm + i and give c. 15501 Rearrange (108h*2 + 6h - 4h + 1610h*2 - 2h)(-3 + 2 - 4) - h2 + 0h*2 + 2h*2 to m + th*2 + rh and give t. -8589 Rearrange (13 - 18 + 106 + (0 - 1 + 0)(1 - 3 + 1) + 3 - 3 + 2)(q + 2q - 2q + (10 - 1 + 2)(-2q + 1 - 3 + 0)) to yq + j and give y. -2184 Rearrange (-43n*2 + 79n*2 + 1 - 17n*2)(190n + 151n + 148n) to the form in*2 + vn + un3 + d and give u. 9291 Express -3w + 63w3 + 8w*4 + 6 - 2 + 1 - 62w*3 + 6w*2 - 6w*4 as a + sw*2 + qw + nw3 + rw*4 and give s. 6 Rearrange (-107z*2 + 60 + 48z*2 + 61z*2)(11 + 39z - z2 + 46z - 86z) to yz*2 + d + oz + vz4 + jz*3 and give d. 660 Express -26041500 + 26041500 - 26682m as q + xm and give x. -26682 Rearrange 198p*2 + 927 + 208p*2 - 218p*3 - 406p*2 + 211p*3 to h + qp + fp3 + ap*2 and give h. 927 Rearrange 12s*2 - 2908s + 2907s - 2 - 2s*2 - 4s*2 - 3s*3 to cs*3 + ns*2 + v + rs and give n. 6 Rearrange (3 + 2 + 3)(1 - 2n - 1)(-6 + 2 + 0 + (-3 + 4 + 0)(0 + 1 + 0) + 474 + 372 - 156 + 71) to the form t + an and give a. -12128 Rearrange -636c - 43c3 + 628c - 51c4 + 18c*3 + 10c*3 + 17c*3 to the form f + ac*2 + dc*3 + mc + rc4 and give r. -51 Rearrange -342y*4 - 5y + 4y + y3 - 37 + 339y4 - y2 + 30 to the form jy + c + dy*3 + iy*4 + ry*2 and give c. -7 Rearrange 21s + 13s + 16s - 2s2 - 90 - 50s to the form ds2 + ns + i and give i. -90 Express 9a + 270298a*3 - 270303a*3 - 12a4 + 19 - a2 - 18 in the form sa + u + ka*4 + pa*2 + ha*3 and give u. 1 Rearrange 2p + 2p - 2p + 2p + 2p - 2p + 3p + p - 2p + 2p - p + 0p + (-4 + 4 - 1)(-6p + 3p + p) + 5717p - 39p - 105p to b + lp and give l. 5582 Express 25b + 1259881b2 + b3 - 1259881b2 + 217 in the form jb*3 + tb*2 + f + hb and give f. 217 Express 205827x4 + 14x*2 - 205824x*4 + 3x*3 + 144x*2 as m + zx*4 + sx*3 + wx*2 + vx and give s. 3 Rearrange -880a3 + 1773a*3 - 2a + 117 + a*2 - 892a*3 to the form b + oa*3 + la*2 + ua and give l. 1 Express -a*3 + 3036 + 212a*4 + 3a*2 - 213a*4 - 3080 in the form x + ua*4 + va*3 + ra + wa2 and give w. 3 Rearrange (2 - 2 + j)(0 - 2 - 2)(-55j + 32j + 5j) to the form mj2 + dj + u and give m. 72 Rearrange -5011p - 7128p + 516p + 145p to bp + k and give b. -11478 Rearrange (2k - 2k + 2k)(-4k + 5k - 2k)(-156k*2 - 5086 + 5086) to the form qk*2 + tk*4 + nk*3 + hk + w and give w. 0 Rearrange (-4 + 2 + 3)(1 - 1 - 2s)(1 + 1 + 0)(33818 - 64886 + 26299) to c + fs and give f. 19076 Express (-1 + 0 + 3)((-2 + 1 - 1)(0z + z + 10z) - 13z + 8z + 39z) in the form d + gz and give g. 24 Rearrange 6 + 18v*3 + 10 - 19v3 + v4 - 2v2 + 17 - 2v*2 to the form j + fv*2 + bv*4 + dv*3 + ov and give d. -1 Express (-2 + 6 + 9k2 - 2)(598k + 519k - 945k) in the form ok*2 + zk + v + sk3 and give s. 1548 Rearrange -106r + 4 - 3r2 + 104r + 58r - 15 to the form t + fr*2 + vr and give v. 56 Rearrange (-5 + 1 + 2)(-21798z - 358041660 + 358041660)(7z - 3z - 2z) to the form w + lz + rz*2 and give r. 87192 Express ((0c + c + c)(2 + 0 + 0) + 0c - 2c + 6c)(-5 + 4 + 5)(19c - 287 + 287) in the form pc*2 + yc + s and give p. 608 Express -1423q - 2741q + 802q - 2496q + 936q in the form jq + f and give j. -4922 Rearrange -4507y - 1317y - 2120y + 1564y to l + cy and give c. -6380 Express -85v - 86v + 242v - 81v - 63 in the form ov + a and give o. -10 Express -4132l + 1248l - 2003l in the form vl + w and give v. -4887 Express 4t + 2t2 - 46 + t3 + t*2 - 2t + 92 - 30 - t*4 as yt*3 + q + vt*2 + rt*4 + ct and give v. 3 Rearrange (-6j3 + 5j*3 + 0j*3)(-44j + 88j - 42j) + 1351j*2 - 1353j*2 + 8 - 2j + 4 - j*4 to aj*4 + ij + pj2 + h + dj*3 and give h. 12 Rearrange -127q + 83q - 1 + 82q + 48q - 5 to y + iq and give i. 86 Express (582 - 50 + 270)(-r - 2r + 8r) as i + wr and give w. 4010 Express (-4 + 0 + 3)(5r - 5r + 2r*3) - 16 - 8850r*3 + 33 - 17 - 6258r*3 in the form sr*2 + fr + wr3 + u and give s. 0 Rearrange -3 + 21k*4 - 1 + k - 10k + 2k3 - 19k*4 - 4k to lk3 + u + hk + fk2 + xk*4 and give u. -4 Express -7j2 + j2 - j*2 + (3 - 4 + 2)(2j2 + 0j + 0j) + 4j*2 + 2j*2 - 3j*2 + (-74 + 74 - 97j)(-2j + 1 - 1) as hj2 + kj + s and give h. 192 Express 15d + d2 - 2d*4 + 100d*3 - 292d*3 + 96d*3 - 43d + 97d3 + 2 as s + pd*3 + jd + md2 + xd*4 and give p. 1 Express (5x - 2x - 4x)(4x - x - 2x) - 2185x*2 + 15336x - 46010x + 15340x - 1 + 15338x in the form vx + p + ox2 and give p. -1 Express (8b - 2b - 3b)((0b - 2b + b)(2 - 5 + 1) + 0b + 4b + 0b + 2b - 3 + 3)(-454b - 1146 + 1146) as a + zb + fb*2 + nb*3 and give n. -10896 Rearrange (-2 + 2 + 2r)(-1623 + 3831 + 3375) + 3r + 3r - 5r to t + cr and give c. 11167 Rearrange (-1188t*4 - 1233t*4 + 850t*4)(-4 - 7 + 4) to the form it2 + ct + u + st4 + dt*3 and give s. 10997 Express (-f + f + f)(-293 - 1514 + 108f - 109f) in the form q + gf2 + jf and give g. -1 Rearrange (5s - 3s + 0s)(2534s2 + 6s*3 - 4s + 4 + 2s - 2528s*2) to the form o + zs*2 + as*4 + cs + us3 and give z. -4 Rearrange 11508v*3 - 544v - 4v2 + 11504v*3 - 23010v*3 to the form ov + w + lv3 + yv*2 and give y. -4 Express -191s - 2 + 652s + 343s + 822s + 490s in the form ms + i and give m. 2116 Express ((4 + 1 + 5)(4 - 3 - 2) - 2 + 3 - 2)(100f + 454f - 9f) in the form i + pf and give p. -5995 Express 37758a + 8 - 37907a + 14a*2 - 15a*2 + (-4a + 3a + 3a)(-2a + 7a - 4a) in the form xa2 + na + s and give s. 8 Express -2x4 - 3x*2 + 3x*3 - 5x*3 + 54211 + x - 54209 in the form mx*4 + wx + ox2 + z + nx3 and give o. -3 Rearrange -u3 + 117u2 + 5u + 178u2 - 15 - 292u*2 to cu + i + hu3 + au*2 and give a. 3 Rearrange 7745l4 - l2 - 4l3 + 2 + 7755l*4 - 15597l*4 to vl + bl4 + n + hl*2 + kl*3 and give b. -97 Rearrange -112 + 845k + 2 - 810k - 103 to d + bk and give d. -213 Rearrange r*2 - 38r*3 + 19r - 5r + 2 + 28r*3 - 2r*4 + 8r*3 to gr*3 + o + ir + xr4 + lr*2 and give g. -2 Express (131j - 914j2 + 57j + 911j2)(2 + 0 - 4) as oj + uj*2 + a and give u. 6 Rearrange -24b + 3b2 + 649 + 689 - 1305 to db*2 + ib + o and give d. 3 Express -2924s2 - s3 - 8569s*2 - 1670s*2 - 2307s*2 - 1514s*2 as ws*3 + hs*2 + as + k and give w. -1 Rearrange 3645 - 4o + 0o + o - 3103 to a + lo and give l. -3 Rearrange -323821y*2 + 8y**3	{ "pile_set_name": "DM Mathematics" }
2 - 7d. Suppose -9 = -3s + 15. Let l be u(s). What is l rounded to the nearest 10000? -130000 Suppose 7 = 4n + 3. Suppose 0 = 3t + 12, 3i - n = 2t - 23. What is i rounded to 0 decimal places? -10 Let m = -175280 - -176406.01. Let z = m - 1131. Round z to zero decimal places. -5 Let f(y) = -472y - 17. Let d be f(-5). Suppose -a = 260 - 2017. Let n = d + a. Round n to the nearest 1000. 4000 Let z be 51875(409 + (-36)/4). What is z rounded to the nearest one hundred thousand? 20800000 Let m = -0.799 + 0.089. Let d = m + 5.01. Round d to the nearest ten. 0 Let f = 31.96 + -38. What is f rounded to 0 dps? -6 Let a = -2.788 + 23.244. Let y = 0.156 - a. What is y rounded to 0 dps? -20 Let j(u) = 55u2 + 9u. Let i(g) = g*2 + g. Let o(l) = -5i(l) + j(l). Let f be o(5). What is f rounded to the nearest 100? 1300 Let i(z) = z*2. Let y(x) = -4x*2 - 5x - 4. Let t(w) = -3i(w) - y(w). Let p be t(-3). Let r be (p - -5)/(10/(-70)). Round r to the nearest 10. -20 Suppose -8v + 13 = -27. Suppose -4913882 = vb - 213882. Round b to the nearest one hundred thousand. -900000 Suppose j - 5827 = -b, 5j = -2b + 4j + 11650. Let v = -32737 + -12440. Let y = v - b. What is y rounded to the nearest ten thousand? -50000 Let x = 15 + -2. Let h = -14 + x. Let d be (h - -94501)(-80)/12. What is d rounded to the nearest 100000? -600000 Let o = 4393.51 - 4372. Round o to 0 dps. 22 Let k = 118.038 + 2.262. What is k rounded to the nearest one hundred? 100 Let r be 5/(28/8 + -1). Suppose 5758 = rd - 2402. Round d to the nearest one thousand. 4000 Let c = -80.077 - 0.123. What is c rounded to the nearest ten? -80 Let l = -13 - -13. Let u = -0.03 - -0.0304. Let r = l - u. What is r rounded to three dps? 0 Let g = -14944.8489 + 14944. Round g to one decimal place. -0.8 Let b = 1.57 - -0.13. Let m = -1.22 + b. What is m rounded to 1 decimal place? 0.5 Let u = 0.6 - 0.8. Let c = u + 0.20000044. What is c rounded to 7 dps? 0.0000004 Let p = 21.4 + 4.5. Let t = -2170.38081 + 2144.482. Let v = t + p. What is v rounded to 4 decimal places? 0.0012 Let v = 14.2 - 14.152. What is v rounded to two dps? 0.05 Let j = -2579.7378009 + 2578.6978. Let f = -1.04 - j. Round f to 6 decimal places. 0.000001 Let y(m) = 1529m - 60. Let v be y(10). Round v to the nearest one thousand. 15000 Let o = 4235 + -4234.7659. What is o rounded to two dps? 0.23 Let h = 2.841 + -0.036. Let z = -3 + h. Round z to two dps. -0.2 Suppose -2o + 6o - 16 = -2h, 0 = -4h + 5o - 7. Suppose -18 - 7 = -p. Suppose 4z + 0d = -hd + 51190, 0 = -5d - p. What is z rounded to the nearest 1000? 13000 Let r = 153.83 - -3.17. Let l = r + -156.99999777. Round l to 6 dps. 0.000002 Let o = -2424869465 + 2424809028.84029. Let z = o + 60470.16. Let y = 34 - z. What is y rounded to 4 dps? -0.0003 Let l(z) = 2z2 - 2z - 1. Let r be l(2). Suppose rf = 40 + 74. Suppose -5p = -0p + 5t + 70, 5p + f = 3t. Round p to the nearest ten. -10 Let m = 68.98 - 74.5. Round m to the nearest integer. -6 Let l = -19 + 40. Let c = l - 18. Let b = 5.6 + c. What is b rounded to the nearest integer? 9 Let u(q) = 27808q + 526q + 3 - 7. Let o be u(6). What is o rounded to the nearest 100000? 200000 Let l = 11 + -9. Suppose -8 = s + c, 2s - 6c - 14 = -lc. Let v(n) = 2022223n*2 + 3n + 2. Let q be v(s). Round q to the nearest 1000000. 18000000 Let o = -8 - -4. Let g = -4.02 - o. What is g rounded to 2 dps? -0.02 Let i = 715.3 - 722. Let q = -161689933.6999943 - -161689927. Let f = i - q. Round f to 6 decimal places. -0.000006 Let h = -108922 - -108968.0116. Let a = h + -46. What is a rounded to three dps? 0.012 Let p = 0.09 + -0.0900002012. What is p rounded to seven decimal places? -0.0000002 Let n(w) = 53w + 23. Suppose -6z + 11z = 50. Let s be (-4)/z + (-371)/35. Let h be n(s). Round h to the nearest one hundred. -600 Let l = -2591949 - -2591952.449026. Let j = 2.949 - l. Let q = j - -0.5. Round q to 5 dps. -0.00003 Let t = 33.021 - 0.021. Let g = 32.99988 - t. What is g rounded to 4 decimal places? -0.0001 Let x = -236.2476 - -41.1506. Let d = -205 + 400. Let a = d + x. What is a rounded to two decimal places? -0.1 Let z = -412 - -211. Let b = -201.00162 - z. What is b rounded to three decimal places? -0.002 Let k(n) = -3n*2 + 4n - 5. Let f(l) = l*2 - 14l + 17. Let o be f(13). Let a be k(o). Round a to the nearest 10. -40 Suppose 3h - 255f - 49 = -256f, 33 = h - 3f. Round h to zero dps. 18 Let g(d) = -d - 546000. Let k be (28/(-18))/7 - (-2)/9. Let p be g(k). What is p rounded to the nearest 100000? -500000 Suppose -15h = -14h - 446000. Round h to the nearest 100000. 400000 Let t = 3.58 + 2.29. Let c = -0.07 + t. What is c rounded to the nearest integer? 6 Suppose -2i + 0l - 4l = -2168, 0 = -4i + 2l + 4336. Suppose -5a - i = 1966. Round a to the nearest 100. -600 Let y = 20.3 + -20.299839. What is y rounded to 5 decimal places? 0.00016 Let y be (1459266/15 + 6)/(2/(-505)). Let d = y - -5265826. What is d rounded to the nearest one million? -19000000 Let f(v) = 2481v + 135. Let x be f(-5). Round x to the nearest one thousand. -12000 Let t = 10 + -71. Let d = -1.3073894 + 62.3076994. Let n = d + t. Round n to 4 dps. 0.0003 Let u be -32/(-15) + 1678/5. Let g = -566 + u. What is g rounded to the nearest 10? -230 Let d = -2025.270691 - -2025.08. Let y = d + -12.808789. Let w = -13 - y. Round w to 4 decimal places. -0.0005 Let c = 0.073 + -2.973. Let i = -6.9 - c. Let k = 4.00000009 + i. What is k rounded to seven decimal places? 0.0000001 Let g = -544.659998 + 486.44637999. Let l = g + 61.3836163. Let p = 3.17 - l. Round p to 7 dps. 0.0000017 Let p be (-2)/5 + 294/(-15). Let a be p(200-13)/1. Suppose 3z = z + a. What is z rounded to the nearest 10000? 30000 Let z(r) = -r3 - 7r*2 - 2r - 5. Let n be (7/4)/(9/(-36)). Let u = n - -2. Let i be z(u). What is i rounded to the nearest ten? -50 Let c = -20404 - -20392.179. Let f = c + -0.079. What is f rounded to zero decimal places? -12 Let t = 14 + -18. Let r be (-2)/(t/64000 + 0). Round r to the nearest 10000. 30000 Let z = -598 + 843. Suppose -5445 = 4p - z. What is p rounded to the nearest one hundred? -1300 Let x be (-2308)/8-1-4. Suppose h = 4c - 44834, 0 = -2h + 3h + 3c + 44855. Let g = x + h. Round g to the nearest ten thousand. -50000 Let y = 16077 + -5503. Let b = y + -10550.004. Let i = b - 24. Round i to two decimal places. 0 Suppose -5 = -5r, -2a + 10016 = -0a - 4r. What is a rounded to the nearest 100? 5000 Let u = 0.945 - -0.015. Let c = 48.96 - u. Let k = -48.84 + c. What is k rounded to 1 decimal place? -0.8 Let s = 15.81 + 0.19. Let h = -16.0000053 + s. What is h rounded to 6 decimal places? -0.000005 Let v = 11.205 - 11. Let o = -0.205194 + v. What is o rounded to five decimal places? -0.00019 Suppose -52 = -7f + 11. Let j = -7 + f. Let k be 2180005 - j - (4 + -1). Round k to the nearest one hundred thousand. 2200000 Let b = 8781 + -8780.95689. Round b to 3 decimal places. 0.043 Let t be 56438 - ((-11 - (0 + -6)) + 3). Round t to the nearest one thousand. 56000 Let a(z) = 135z2 - 18z + 9. Let c(v) = -v*2 + v + 1. Let x(i) = -a(i) + 2c(i). Suppose n - 2n + 13 = 0. Let p be x(n). Round p to the nearest 1000. -23000 Let a = -98.128 + -0.172. What is a rounded to the nearest ten? -100 Suppose 2m - 20028 = 4h, -m = 3m + h - 40047. Suppose -2b + m = w, -4w = b - 6b + 25017. Suppose 5j - b = 2645. What is j rounded to the nearest 100? 1500 Let u = 206654 - 206654.02200037. Let y = u + 0.022. What is y rounded to 7 dps? -0.0000004 Let d = -12.14 - -7.71. What is d rounded to zero decimal places? -4 Let w = 0.631 - -290.369. Let j = w + -290.9999739. What is j rounded to 6 dps? 0.000026 Suppose 0 = -a - 1 + 3. Suppose -8162 = -3r - ap, 2r = 5r - 3p - 8157. Round r to the nearest 100. 2700 Let f(y) = -5y - 1. Let b be f(-1). Let r be (260/(-15))/(b/(-6)). Let g be ((-1)/(-2)*r)/(-1). What is g rounded to the nearest ten? -10 Let j = 505.0081 - 505. Round j to one decimal place. 0 Let j = -696375023.62038 + 696986310.62. Let k = -611325 + j. Let p = -38 - k. Round p to 4 dps. 0.0004 Let p = 4 - -76. Let f = 80.00000051 - p. What is f rounded to seven decimal places? 0.0000005 Let j = 10397270 - 10397270.1	{ "pile_set_name": "DM Mathematics" }
Two letters picked without replacement from sspsoskspssrrrsosoc. What is prob of picking 2 s? 4/19 Three letters picked without replacement from {u: 2, y: 1, v: 4, g: 1, t: 1, a: 3}. What is prob of picking 3 v? 1/55 Calculate prob of picking 4 u when four letters picked without replacement from uuuuccucuucc. 7/99 What is prob of picking 1 g, 1 i, and 1 w when three letters picked without replacement from {y: 1, a: 1, j: 1, i: 1, g: 2, w: 1}? 2/35 Three letters picked without replacement from vvvvvvv. Give prob of picking 3 v. 1 What is prob of picking 2 c and 2 t when four letters picked without replacement from {m: 7, t: 3, l: 7, c: 3}? 3/1615 Calculate prob of picking 1 h and 2 b when three letters picked without replacement from rzbrzzh. 0 What is prob of picking 2 l and 1 s when three letters picked without replacement from {s: 8, l: 2}? 1/15 Two letters picked without replacement from lqgg. Give prob of picking 1 l and 1 q. 1/6 What is prob of picking 2 q and 1 k when three letters picked without replacement from tcykyttttqcyfc? 0 Three letters picked without replacement from gggkgksgsksr. Give prob of picking 1 g, 1 s, and 1 k. 9/44 What is prob of picking 1 u, 1 q, and 2 i when four letters picked without replacement from {u: 4, o: 1, i: 10, q: 1, p: 4}? 12/323 Two letters picked without replacement from dpdpjpwmjpdjd. Give prob of picking 1 m and 1 p. 2/39 Calculate prob of picking 2 f and 1 r when three letters picked without replacement from hrzhzuuzfrzrzfzu. 3/560 Two letters picked without replacement from {f: 3, q: 3}. What is prob of picking 2 f? 1/5 Calculate prob of picking 3 n and 1 c when four letters picked without replacement from cncnncncccccccnc. 11/182 Three letters picked without replacement from {i: 1, a: 1, m: 1, h: 1, g: 1}. Give prob of picking 3 m. 0 Calculate prob of picking 1 f, 2 l, and 1 v when four letters picked without replacement from ptlplfvtvpptvt. 3/1001 Two letters picked without replacement from zkzkkkkzzkkpphzk. Give prob of picking 1 h and 1 p. 1/60 Four letters picked without replacement from bfejffbgfjejeij. What is prob of picking 1 g, 2 j, and 1 i? 2/455 Two letters picked without replacement from {t: 2, s: 3, k: 4}. Give prob of picking 2 k. 1/6 What is prob of picking 2 f when two letters picked without replacement from qqcjwjjwqjjjcjcjfqf? 1/171 Calculate prob of picking 2 f and 1 w when three letters picked without replacement from {f: 4, w: 1, t: 1, e: 4}. 1/20 Two letters picked without replacement from pjixyxxiyixxpi. What is prob of picking 1 j and 1 x? 5/91 Two letters picked without replacement from {h: 6, i: 3, g: 1, x: 7}. What is prob of picking 2 i? 3/136 Calculate prob of picking 1 y and 1 q when two letters picked without replacement from {q: 7, y: 2}. 7/18 What is prob of picking 2 e and 1 n when three letters picked without replacement from eenennenenneennneene? 15/38 Two letters picked without replacement from kkzzkkkkkkzkkkkkzkk. Give prob of picking 1 k and 1 z. 20/57 Three letters picked without replacement from nhnnnnnnnnnnnnnnnnnn. Give prob of picking 2 n and 1 h. 3/20 Four letters picked without replacement from {b: 1, l: 1, u: 1, w: 2, i: 2, f: 1}. What is prob of picking 1 i, 1 u, 1 f, and 1 l? 1/35 Three letters picked without replacement from {k: 14, p: 4}. Give prob of picking 3 k. 91/204 What is prob of picking 2 z and 1 o when three letters picked without replacement from mbmdmzmzzzmo? 3/110 Calculate prob of picking 1 f and 3 k when four letters picked without replacement from ffffkfkkffffffff. 1/140 What is prob of picking 1 f and 1 m when two letters picked without replacement from fffffffffffmffffffm? 34/171 What is prob of picking 2 o and 1 x when three letters picked without replacement from ouxxxouoooonox? 3/13 What is prob of picking 4 w when four letters picked without replacement from {y: 5, w: 14}? 1001/3876 Calculate prob of picking 1 b and 1 v when two letters picked without replacement from {v: 6, a: 4, b: 2}. 2/11 Four letters picked without replacement from {s: 4, d: 2}. What is prob of picking 4 s? 1/15 What is prob of picking 3 o when three letters picked without replacement from {x: 4, o: 6, m: 7}? 1/34 What is prob of picking 2 s, 1 n, and 1 o when four letters picked without replacement from {s: 5, q: 1, k: 1, o: 2, n: 1}? 2/21 Three letters picked without replacement from ppp. Give prob of picking 3 p. 1 Four letters picked without replacement from {f: 1, a: 1, o: 1, w: 1, d: 2, b: 2}. Give prob of picking 1 b, 2 a, and 1 f. 0 Calculate prob of picking 1 d, 1 r, and 2 p when four letters picked without replacement from {z: 6, d: 1, p: 2, r: 2}. 1/165 What is prob of picking 1 e and 1 u when two letters picked without replacement from {e: 2, p: 3, u: 15}? 3/19 Three letters picked without replacement from dbduthuuhtdddduuiu. Give prob of picking 1 u, 1 i, and 1 t. 1/68 Two letters picked without replacement from {e: 1, u: 3, x: 9, a: 4, o: 2}. Give prob of picking 1 x and 1 o. 2/19 What is prob of picking 3 n when three letters picked without replacement from {i: 2, y: 1, k: 2, n: 1, d: 2, q: 1}? 0 Four letters picked without replacement from {e: 5, q: 7}. Give prob of picking 2 q and 2 e. 14/33 Calculate prob of picking 2 y when two letters picked without replacement from {a: 5, y: 2}. 1/21 Two letters picked without replacement from aaabbb. Give prob of picking 2 a. 1/5 Calculate prob of picking 1 t and 3 u when four letters picked without replacement from tttcuuuucuuu. 7/33 Three letters picked without replacement from ttaaa. Give prob of picking 3 a. 1/10 What is prob of picking 2 i when two letters picked without replacement from ihhhihioh? 1/12 Two letters picked without replacement from {j: 4, g: 3, d: 2}. Give prob of picking 1 g and 1 j. 1/3 What is prob of picking 1 p and 2 t when three letters picked without replacement from dtdptddddttddddpptp? 40/969 Three letters picked without replacement from {n: 2, s: 7, f: 2, w: 1}. What is prob of picking 1 s and 2 f? 7/220 Calculate prob of picking 4 h when four letters picked without replacement from ooooohoohhh. 1/330 Calculate prob of picking 1 y and 1 v when two letters picked without replacement from yyyvyvvyvv. 5/9 Three letters picked without replacement from {c: 7, f: 12}. What is prob of picking 1 c and 2 f? 154/323 Calculate prob of picking 4 t when four letters picked without replacement from tttttthhhh. 1/14 What is prob of picking 3 j when three letters picked without replacement from jjjjjjkjkjjj? 6/11 Calculate prob of picking 3 p when three letters picked without replacement from pppmnmmummbpumpm. 1/56 Four letters picked without replacement from {o: 6, m: 9, s: 2}. Give prob of picking 2 m and 2 o. 27/119 What is prob of picking 1 u and 1 i when two letters picked without replacement from iiuvivi? 4/21 What is prob of picking 2 y and 2 i when four letters picked without replacement from {y: 14, i: 5}? 455/1938 Four letters picked without replacement from {r: 4, y: 4, f: 3}. Give prob of picking 3 y and 1 r. 8/165 Calculate prob of picking 2 t and 2 u when four letters picked without replacement from {u: 3, t: 12}. 66/455 What is prob of picking 2 x when two letters picked without replacement from {x: 2, v: 3, c: 4}? 1/36 Calculate prob of picking 2 d when two letters picked without replacement from {d: 2, s: 8}. 1/45 Four letters picked without replacement from {m: 4, p: 6, n: 1, w: 4}. What is prob of picking 1 p, 1 n, 1 m, and 1 w? 32/455 Two letters picked without replacement from madrw. What is prob of picking 1 m and 1 a? 1/10 Calculate prob of picking 1 x and 1 d when two letters picked without replacement from {c: 1, i: 1, l: 2, d: 2, n: 1, x: 2}. 1/9 What is prob of picking 1 b and 3 m when four letters picked without replacement from {m: 5, b: 12, y: 2}? 10/323 Two letters picked without replacement from {y: 10}. Give prob of picking 2 y. 1 Calculate prob of picking 1 a and 1 c when two letters picked without replacement from sjsyjsbcacjysa. 4/91 Four letters picked without replacement from ffoffofffqfsoqfsfqso. What is prob of picking 1 o and 3 s? 4/4845 Two letters picked without replacement from {l: 8, c: 4, v: 8}. Give prob of picking 2 l. 14/95 Three let	{ "pile_set_name": "DM Mathematics" }
5? 0.4 Which is the closest to -2/3? (a) 10723 (b) -3 (c) -21 b Which is the closest to -1/2? (a) -69 (b) 0.5 (c) 70 b Which is the closest to -1? (a) 5 (b) -432/11 (c) 4 (d) -3 (e) -5 d What is the nearest to -1/3 in 104, -2, -111, 6? -2 What is the nearest to -1 in -60, 0.6, 2/17, 0.3? 2/17 Which is the closest to 0.15? (a) 13 (b) -1/3 (c) -0.3 (d) 0.2 d Which is the closest to -3/19? (a) -7 (b) 2.95 (c) 4/5 c Which is the nearest to -2/1349? (a) -0.5 (b) 4 (c) 25 (d) -1/9 (e) -0.03 e What is the nearest to 20 in -1/4, 1/21, 0.5, -2? 0.5 Which is the nearest to -2? (a) 4 (b) 0.07 (c) 13/212 c What is the closest to -4/9 in 0.5, 2/4353, -0.1? -0.1 Which is the closest to -11? (a) -2/11 (b) -1/9 (c) -3.1 c What is the closest to -2.2 in 167, -9, -0.5, 1? -0.5 What is the closest to -1.07 in 2/21, 1/2, -5/2, -3? 2/21 Which is the nearest to -13? (a) -0.3 (b) -1/13 (c) 0.2 (d) -1/4 a What is the closest to -0.1 in -4788, 0, 1, 0.3? 0 Which is the nearest to -6/47? (a) 3 (b) -0.2 (c) -450 (d) -0.5 b Which is the closest to 4/3? (a) 2/9 (b) -5 (c) -15 (d) 0 a Which is the nearest to 0.1? (a) 5 (b) 1/2 (c) -90 (d) 3 (e) 1 b What is the closest to -1 in 0.5, -3.9572, 22? 0.5 Which is the nearest to -2? (a) 0.4 (b) -5 (c) 2010 (d) -1/9 d Which is the closest to -4? (a) 1.3 (b) -49 (c) 4.8 a Which is the closest to 1? (a) -1/7 (b) -2/3 (c) -21781 (d) -2/5 (e) 3 a Which is the closest to 0? (a) 15 (b) 51/4 (c) 1 (d) 0.5 d Which is the nearest to 0.2? (a) -0.3 (b) 1 (c) -2 (d) 3 (e) -35/11 a Which is the closest to -1? (a) 1/5 (b) -0.2 (c) -1 (d) 0.1 c Which is the nearest to 1? (a) 4 (b) -1/5 (c) 1/6 (d) -43 c What is the closest to -0.51 in -1, -0.1, -4, -6? -0.1 What is the closest to -0.1 in 2, -1/8, 4/5, 34? -1/8 Which is the closest to -1/4? (a) 3/4 (b) 1/5 (c) -0.1 (d) 4 (e) -0.052 c What is the nearest to 3 in 8/9, 18.8, 5, 2/7? 5 What is the closest to 0 in 0.02, 1/5, 202/7, -2? 0.02 What is the nearest to 7/4 in 0.07, -1/8, -6? 0.07 What is the nearest to 5 in -418, -2/7, 1/4? 1/4 Which is the closest to 0.1? (a) -0.4 (b) 0.3 (c) -365 (d) -47 (e) 2/7 e Which is the closest to 12? (a) 53/12 (b) 0.3 (c) 1 (d) 5 (e) -0.4 d What is the closest to 1/10 in 368, 2, 0.5? 0.5 Which is the closest to 3.9? (a) 5 (b) 0 (c) 0.2 (d) 2 (e) -6 a Which is the closest to 1124/7? (a) -2 (b) -1/7 (c) -3 b Which is the nearest to 1? (a) -1.4 (b) -2/895 (c) -1.6 b What is the closest to 0.1 in -1/603, -4, -5.3? -1/603 What is the closest to 0 in 0, 19/165, 0.11? 0 What is the closest to 0.1 in 2, 54, -2.9, -2/13? -2/13 Which is the closest to -23/2? (a) -5 (b) 0 (c) -2/21 a Which is the closest to 211/3? (a) 10 (b) 5 (c) -2 a What is the nearest to -1 in -1/8, 107, 35? -1/8 Which is the nearest to -14.8? (a) -2 (b) -29 (c) -3/8 (d) 0.3 a What is the closest to -2 in 0.1, 4/3, 7, 220? 0.1 Which is the closest to 2? (a) -5 (b) -2/3 (c) 0 (d) 2/15 d Which is the nearest to -0.08? (a) -1.18 (b) -5 (c) 0 (d) -0.06 d Which is the nearest to -53? (a) 2 (b) -0.4 (c) 5 (d) -19/2 (e) -55 e Which is the nearest to 2? (a) -1/9 (b) 1/6 (c) -1/3094 b What is the nearest to -0.1 in 0.11, 0.3, 8/31? 0.11 What is the nearest to 1/7 in -5, 3, -3/8, -63, 1.28? -3/8 Which is the closest to 0.1? (a) 4 (b) 2 (c) 1001 b What is the closest to 14 in -4, 0, -69, -2? 0 What is the nearest to 2/9 in -15, 2, -1.5, 0.3, 27/5? 0.3 Which is the closest to 2? (a) -2/13 (b) 2 (c) 83 (d) 6 b Which is the closest to -2? (a) -2 (b) -0.2 (c) 38801 a What is the closest to 1/2 in -1/157, -1, -0.05? -1/157 What is the nearest to 56/61 in 0.6, -3, 0.3? 0.6 Which is the nearest to -2? (a) -4 (b) -48.1 (c) -1/4 c What is the nearest to -0.11 in -27, -2/9, 1? -2/9 What is the closest to 0.19 in 9, -2, -5, -0.7? -0.7 Which is the closest to 3? (a) -0.58 (b) -0.1 (c) -0.351 (d) 2 (e) -4 d What is the closest to -13.3 in 2, -128, -1/9, 0.2, -2/5? -2/5 Which is the closest to 3/49? (a) 36 (b) -15 (c) 1 c Which is the closest to 2? (a) -128 (b) 1/9 (c) -13 b What is the nearest to 10.26 in -2/3, -5, -0.4, 0.5, 3? 3 Which is the closest to 2/7? (a) -1/4 (b) -0.827 (c) -2/77 (d) -3 c What is the closest to 0.1 in -1, 0.5, 2, 3/191? 3/191 What is the nearest to -0.3 in 0.2, -3, -1, -2947? 0.2 What is the closest to 9 in -2/5, 55, -2/3? -2/5 Which is the closest to -6? (a) 3/14 (b) 2/1539 (c) 4 b Which is the nearest to 3? (a) 0.5 (b) -0.3 (c) 18 (d) -3/7 a What is the closest to -1 in -6, 5/3, 1, -4, -1? -1 What is the closest to -0.13 in 11, -8, -7/6? -7/6 Which is the nearest to 779.2? (a) 0.1 (b) -5 (c) -0.8 a Which is the closest to -1? (a) -1/5 (b) -2 (c) -4/5 (d) 101/2 c What is the nearest to -9 in -1/3, 3, -0.18, -0.1? -1/3 Which is the nearest to -0.2? (a) 2 (b) 0.143 (c) 5 (d) 2/7 b Which is the nearest to 2/5? (a) 368 (b) 6 (c) 14 b Which is the closest to -0.071? (a) -6 (b) 7 (c) -0.5 (d) 1/7 d Which is the nearest to 58/3? (a) 3/5 (b) -2/5 (c) 0 (d) 3/4 d Which is the nearest to -392? (a) 5 (b) -0.4 (c) 0.4 b Which is the closest to 2? (a) -18 (b) -16 (c) -0.5 (d) -4 c What is the closest to -2 in 384/5, 5, 1/3, 0.2, -0.03? -0.03 What is the closest to -1/6 in 55, 0.2, 13? 0.2 What is the nearest to -0.2 in -168, 82, 0.1? 0.1 What is the closest to 10 in -18, -45, -0.1, 4? 4 What is the closest to -2 in 5, 0.28, -0.4, 0.5, -21? -0.4 Which is the nearest to 2/7? (a) -2 (b) 0.5 (c) -0.59 (d) -16/3 (e) -0.3 b What is the nearest to 1/4 in -2/1179, 0.17, 0.11? 0.17 Which is the closest to -27/7? (a) 3/5 (b) -458 (c) -0.4 c Which is the nearest to 1/3? (a) -0.3 (b) -52 (c) -581/4 a Which is the nearest to -0.2? (a) 0 (b) -2/7 (c) -603 (d) -0.084 (e) 0.5 b Which is the nearest to -22? (a) -0.2 (b) -0.201 (c) -2 c Which is the nearest to 1? (a) 2/9 (b) -5 (c) -8 (d) 88/15 (e) -4 a Which is the closest to -0.2? (a) 32.47 (b) 0.1 (c) 5 (d) 6 (e) -5 b Which is the closest to 0? (a) 4 (b) -1/4 (c) 1 (d) 35 (e) -0.08 e Which is the closest to -3? (a) -33 (b) 0.5 (c) 0.2 (d) -5 (e) 3 d Which is the nearest to -2/9? (a) -0.17 (b) 0.8 (c) -3 (d) 7 (e) -4 a What is the nearest to 1 in 1097, -0.4, 11, 5? -0.4 Which is the closest to -1.2? (a) 0.3 (b) -1 (c) 4/5 (d) -1/75 b Which is the closest to 4? (a) -3 (b) -5 (c) -0.1 c What is the closest to 1/3 in 2/3, -56, -1/5, 2? 2/3 What is the closest to -2 in -1, 0.17, 0, -2/13, -2.1? -2.1 What is the closest to -5/4 in 3, -0.4, 4? -0.4 What is the closest to 2 in -3, -61.94, 0? 0 What is the closest to 2/2147 in 2/5, 0, -5? 0 What is the nearest to -7/54 in -0.1, -6/5, 5, -1/3? -0.1 What is the closest to 1 in 22, 1/5, -4, -429? 1/5 What is the nearest to 3 in 26, -1/2, -2/437? -2/437 What is the nearest to 3 in -609, 1.2, 2? 2 Which is the nearest to -1/3? (a) -2 (b) 5495 (c) 5 (d) -3/2 d Which is the closest to -2? (a) 5 (b) -13/3 (c) -0.1 (d) -1/4 (e) -15 d Which is the closest to 2/9? (a) -0.5 (b) -3.1 (c) -3 (d) 2/21 d Which is the closest to 2? (a) -25 (b) -117 (c) -0.2 c Which is the closest to 441? (a) 0.09 (b) 0 (c) 2/23 (d) -2/3 a What is the nearest to 2/7 in 4, -1/2, 5, -0.7? -1/2 Which is the closest to 80/13? (a) 0.08 (b) 3 (c) 1/6 b What is the nearest to -0.15 in 0, -264, -2, 3/7? 0 Which is the closest to 2? (a) -44/7 (b) 121 (c) -2/9 c Which is the closest to 1/6? (a) 12 (b) 0.03 (c) -3/7 (d) 1.99 (e) 3 b What is the closest to 0.094 in 0, 4, 0.94? 0 Which is the closest to 2/7? (a) 5 (b) -159665 (c) 0.4 c What is the nearest to 1 in -17289, 0.4, 4, 5? 0.4 Which is the nearest to 0? (a) -0.012 (b) 1/2 (c) 0.3 (d) -25/3 (e) -1/5 a What is the nearest to 4 in 34/25, 0.4, 10? 34/25 Which is the closest to -0.3? (a) -3/5 (b) 5 (c) -0.161 (d) -1 (e) 3/7 c Which is the closest to -2? (a) -28 (b) -3/4 (c) 0.4 (d) -3/7 b What is the closest to 15 in -30, 0.6, -100, -3? 0.6 Which is the closest to -0.2? (a) 0.2404 (b) 1/4 (c) -0.2 c Which is the closest to 3? (a) -35 (b) 3 (c) -2/19 (d) 0.9 b What is the nearest to 2/5 in 0.2, 3, -0.4, -12, -38? 0.2 What is the close	{ "pile_set_name": "DM Mathematics" }
at is the thousands digit of 18466? 8 What is the units digit of 1104? 4 What is the units digit of 102? 2 What is the hundreds digit of 792? 7 What is the thousands digit of 5096? 5 What is the thousands digit of 62220? 2 What is the units digit of 81092? 2 What is the units digit of 132696? 6 What is the units digit of 1967? 7 What is the thousands digit of 12910? 2 What is the hundreds digit of 433? 4 What is the tens digit of 1548? 4 What is the ten thousands digit of 21206? 2 What is the tens digit of 125? 2 What is the tens digit of 14063? 6 What is the thousands digit of 45025? 5 What is the units digit of 1449? 9 What is the tens digit of 4579? 7 What is the hundreds digit of 2933? 9 What is the thousands digit of 45693? 5 What is the hundreds digit of 1774? 7 What is the hundreds digit of 9675? 6 What is the units digit of 1936? 6 What is the ten thousands digit of 13575? 1 What is the thousands digit of 1469? 1 What is the tens digit of 77186? 8 What is the hundreds digit of 58516? 5 What is the tens digit of 36304? 0 What is the thousands digit of 1733? 1 What is the ten thousands digit of 29993? 2 What is the tens digit of 9385? 8 What is the hundreds digit of 8774? 7 What is the tens digit of 7496? 9 What is the units digit of 1586? 6 What is the hundreds digit of 167? 1 What is the units digit of 289? 9 What is the units digit of 18833? 3 What is the hundreds digit of 927? 9 What is the units digit of 559? 9 What is the units digit of 1987? 7 What is the hundreds digit of 59067? 0 What is the tens digit of 22603? 0 What is the thousands digit of 1086? 1 What is the hundreds digit of 11860? 8 What is the ten thousands digit of 23076? 2 What is the tens digit of 7891? 9 What is the ten thousands digit of 11525? 1 What is the ten thousands digit of 15402? 1 What is the thousands digit of 1623? 1 What is the hundreds digit of 10652? 6 What is the tens digit of 17888? 8 What is the thousands digit of 39613? 9 What is the ten thousands digit of 40001? 4 What is the thousands digit of 5653? 5 What is the ten thousands digit of 30308? 3 What is the units digit of 1675? 5 What is the tens digit of 1378? 7 What is the units digit of 5290? 0 What is the ten thousands digit of 109588? 0 What is the units digit of 10206? 6 What is the units digit of 1281? 1 What is the ten thousands digit of 13825? 1 What is the ten thousands digit of 41241? 4 What is the units digit of 125? 5 What is the ten thousands digit of 19421? 1 What is the tens digit of 19943? 4 What is the hundreds digit of 1204? 2 What is the hundreds digit of 3586? 5 What is the units digit of 26328? 8 What is the tens digit of 27213? 1 What is the units digit of 2566? 6 What is the tens digit of 62? 6 What is the hundreds digit of 774? 7 What is the hundreds digit of 860? 8 What is the tens digit of 73? 7 What is the hundreds digit of 144049? 0 What is the tens digit of 109771? 7 What is the tens digit of 7338? 3 What is the tens digit of 22254? 5 What is the units digit of 170520? 0 What is the tens digit of 395? 9 What is the thousands digit of 2179? 2 What is the ten thousands digit of 29549? 2 What is the hundreds digit of 202? 2 What is the units digit of 995? 5 What is the ten thousands digit of 45774? 4 What is the thousands digit of 1296? 1 What is the hundreds digit of 19528? 5 What is the thousands digit of 8525? 8 What is the tens digit of 126103? 0 What is the tens digit of 439? 3 What is the units digit of 3499? 9 What is the ten thousands digit of 93691? 9 What is the hundreds digit of 113704? 7 What is the ten thousands digit of 85069? 8 What is the tens digit of 2912? 1 What is the ten thousands digit of 22936? 2 What is the units digit of 2410? 0 What is the tens digit of 4225? 2 What is the thousands digit of 98766? 8 What is the units digit of 1485? 5 What is the ten thousands digit of 57979? 5 What is the units digit of 20804? 4 What is the units digit of 34943? 3 What is the tens digit of 2913? 1 What is the units digit of 43638? 8 What is the tens digit of 706? 0 What is the hundreds digit of 655? 6 What is the thousands digit of 18520? 8 What is the tens digit of 36792? 9 What is the thousands digit of 3876? 3 What is the thousands digit of 1077? 1 What is the units digit of 9213? 3 What is the hundreds digit of 422? 4 What is the tens digit of 758? 5 What is the units digit of 72462? 2 What is the thousands digit of 12468? 2 What is the units digit of 6534? 4 What is the hundreds digit of 8133? 1 What is the hundred thousands digit of 139178? 1 What is the hundreds digit of 14435? 4 What is the units digit of 218? 8 What is the units digit of 9441? 1 What is the units digit of 10405? 5 What is the units digit of 8480? 0 What is the thousands digit of 20568? 0 What is the ten thousands digit of 118762? 1 What is the ten thousands digit of 20521? 2 What is the thousands digit of 2389? 2 What is the units digit of 5840? 0 What is the hundreds digit of 3768? 7 What is the hundreds digit of 2959? 9 What is the hundreds digit of 2017? 0 What is the units digit of 25575? 5 What is the tens digit of 677? 7 What is the thousands digit of 47048? 7 What is the thousands digit of 2611? 2 What is the thousands digit of 9417? 9 What is the hundreds digit of 8250? 2 What is the thousands digit of 23467? 3 What is the tens digit of 439? 3 What is the hundreds digit of 1883? 8 What is the tens digit of 2249? 4 What is the hundreds digit of 122476? 4 What is the tens digit of 35967? 6 What is the hundreds digit of 1703? 7 What is the hundreds digit of 5401? 4 What is the thousands digit of 1910? 1 What is the units digit of 3837? 7 What is the units digit of 8150? 0 What is the thousands digit of 1305? 1 What is the thousands digit of 29831? 9 What is the tens digit of 3104? 0 What is the units digit of 1921? 1 What is the ten thousands digit of 19961? 1 What is the units digit of 89138? 8 What is the units digit of 25697? 7 What is the tens digit of 1215? 1 What is the units digit of 3769? 9 What is the thousands digit of 13762? 3 What is the units digit of 5967? 7 What is the units digit of 2351? 1 What is the hundreds digit of 2876? 8 What is the ten thousands digit of 23524? 2 What is the units digit of 14508? 8 What is the thousands digit of 1002? 1 What is the units digit of 7330? 0 What is the tens digit of 1047? 4 What is the hundreds digit of 846? 8 What is the tens digit of 932? 3 What is the ten thousands digit of 26705? 2 What is the hundreds digit of 19454? 4 What is the tens digit of 86893? 9 What is the tens digit of 2050? 5 What is the tens digit of 697? 9 What is the hundreds digit of 495? 4 What is the ten thousands digit of 15421? 1 What is the tens digit of 2374? 7 What is the units digit of 1265? 5 What is the tens digit of 27? 2 What is the units digit of 91790? 0 What is the units digit of 10504? 4 What is the hundreds digit of 1645? 6 What is the thousands digit of 5728? 5 What is the hundreds digit of 1829? 8 What is the tens digit of 5695? 9 What is the tens digit of 5505? 0 What is the hundreds digit of 14791? 7 What is the ten thousands digit of 83106? 8 What is the thousands digit of 18349? 8 What is the hundreds digit of 48696? 6 What is the tens digit of 1152? 5 What is the units digit of 18919? 9 What is the ten thousands digit of 18162? 1 What is the units digit of 10503? 3 What is the tens digit of 152014? 1 What is the units digit of 9167? 7 What is the hundreds digit of 468? 4 What is the tens digit of 12932? 3 What is the hundreds digit of 7256? 2 What is the units digit of 318? 8 What is the hundreds digit of 16481? 4 What is the units digit of 1283? 3 What is the ten thousands digit of 19304? 1 What is the tens digit of 197? 9 What is the hundreds digit of 464? 4 What is the ten thousands digit of 71246? 7 What is the hundreds digit of 448? 4 What is the units digit of 3991? 1 What is the thousands digit of 56726? 6 What is the units digit of 4260? 0 What is the units digit of 61713? 3 What is the units digit of 106379? 9 What is the hundreds digit of 695? 6 What is the thousands digit of 70012? 0 What is the tens digit of 4734? 3 What is the tens digit of 2292? 9 What is the units digit of 184? 4 What is the thousands digit of 19	{ "pile_set_name": "DM Mathematics" }
*2 - it*2 + 0. Let m be g(12). Solve -ms = -2h + 3h - 1, 11 = s + 4h for s. -1 Let x be 0(24/9 + (-45)/15). Solve x = -f + 3o - 20, -3o + 6o - 10 = -f for f. -5 Suppose 4x - 2p - p - 17 = 0, 3x - 9 = p. Solve -xz + 23 = -5y + 3, 3y + 4z + 12 = 0 for y. -4 Let x(b) = -b + 11. Let s be x(11). Solve 8u - 3u = -20, s = -3h - 4u - 1 for h. 5 Suppose 4x = 5l - 25, 65l - 67l - 13 = 3x. Solve a = -4f + 7, l = -2a + f - 3 for a. -1 Let v be (-10)/(-40) + 22/8. Let y be 35/(-14)21. Let b be (-4 + 1 - y)/1. Solve -5c - 7 = vl, 2c - bl - 11 = -c for c. 1 Let u be 0/((1 + 1)/(-4 - -2)). Suppose 5g + 3s = 20 + 14, 2s + 4 = 0. Let m be u + 3 - g/(-4). Solve -3k + m = 4h, 4k = -5h + 5 - 0 for k. -5 Suppose -15 = -3j - 2j. Solve 5a = 5t + 5, -2a + 7t = jt - 4 for a. 0 Let t(b) = 16b*2. Let h be t(1). Suppose 3q + h = 5q. Suppose 5r - 8 = -2c, -2r + 5c + q + 1 = 0. Solve -4a + 24 = -3a - 5o, -ro = 10 for a. -1 Suppose 13 = 4t + 9. Solve 3m = -2m - 5b - 5, -m - 3b - t = 0 for m. -1 Let l(v) = -2v2 - 9v - 8. Suppose -k + 5r = 0, -2k + 5r - 7 = -2. Let z be l(k). Let f = -13 - z. Solve 2o - 9 = -3x - fo, 0 = -3x + 3o + 9 for x. 3 Let q(i) = -2i3 + 28i*2 - 26i + 8. Let o be q(13). Solve -3g - o + 0 = 4n, 0 = -3n - 3g - 3 for n. -5 Let b(h) = h + 26. Let x be b(-17). Suppose -2g - 5 = -x. Solve 0 = 5o - 4s - 4, -go + s - 5 = 6s for o. 0 Let q = -1377 - -1383. Solve -qs - 20 = -s - 3o, s - 14 = -3o for s. -1 Suppose 4r - 17 = -5x - 33, 3x - r - 4 = 0. Solve x = 2u - m + 1, -5u + 2 + 3 = 5m for u. 0 Let y = -30 + 54. Suppose -y = -7n + 4. Solve -nb - 5h = 11, -5b + h - 19 = 2h for b. -4 Suppose -35z = -9z - 52. Solve 3f - z = -4q - 21, 4q = f + 1 for q. -1 Suppose 6c - 19 = 29. Suppose c = 3t - 1. Solve 0i - 4 = 4i - tk, -i - 4k = 1 for i. -1 Let y(l) = -2l3 + 3l*2 + 2l - 3 + 0 + l*3. Let x = 135 + -133. Let m be y(x). Solve 20 = mu, 0 = j - 5j + 2u - 24 for j. -4 Let d be 05/15 + 5. Let f be (-1 - -4 - -1)d. Solve -i = -4b - f, b - 2i + 0 + 12 = 0 for b. -4 Let c = 7 - 28. Let u = c - -65. Suppose 5g - 16 = l - u, 2g = 2l - 16. Solve -w - 15 = 3b, 2w + 3b = lw - 15 for w. 0 Suppose 3j + 2j = 15. Suppose 0 = -2h + h - jl - 7, -4h = 5l + 14. Let b be 1/h1 + 22. Solve 5g = g + 5d - b, -5d = 3g + 7 for g. -4 Let w = -160 - -163. Solve 4x = -wj + 2x, 2j - 2x = -10 for j. -2 Let f be 12 + (-9)/((-27)/(-12)). Let o be 0 + (1 - 33). Let h be f - (-1 + o/(-2)). Solve 6 = -4w + 4x + x, -hw - x + 7 = 0 for w. 1 Suppose -11s - 3a + 21 = -8s, 2 = -4s + 2a. Solve -p = 2n - 5, sp - 25 = -5n - 3p for n. 0 Suppose 0 = -3f + 61 - 55. Solve 0v + 4x - 22 = -v, fv - 14 = -2x for v. 2 Let v = -19 + 21. Solve -5k = 4z - 4, -4z - v + 6 = 4k for k. 0 Let c(g) = -g + 1. Let d be c(1). Suppose -i - 3 = -4j + 2, d = -3j + 12. Solve -4p + 0p = -5s + 6, -5p = 3s - i for p. 1 Suppose -2s + 6 = 0, 2s + 24 = 3u + 7s. Solve -20 = 4v + ur, 3v + 5 + 10 = r for v. -5 Let n be (42/15)/(-7) - (-358)/(-5). Let u = -69 - n. Solve -2l - 5 = 3y, uy - y = -l - 5 for y. -5 Let t(x) = -x*2 + 10x + 20. Let q be t(12). Let l = 7 + q. Solve 4 = z + lb, 5z + b = 5b + 20 for z. 4 Let a(b) = -b2 + 8b + 88. Let t be a(14). Solve 0 = -j - f, -5j + t = -3j + 4f for j. -2 Suppose -2y = -1 - 1. Let d = 3 - 11. Let p be (2/2)/((-4)/d). Solve 5g = -t + 18, -pg - 8 = -5t + y for t. 3 Let m = -786 + 788. Solve 2u = -2y - 8, -my + 3 = -3u + 1 for u. -2 Suppose -37p + 28p + 45 = 0. Solve pi = -10, i - 7 = 5j + 1 for j. -2 Let u(w) = w2 + 3w + 2. Let z be u(-1). Suppose 5f + i - 15 = z, -2f = -i - 3i - 6. Solve 3t = -0m - m + 2, -4t - 4 = fm for m. -4 Suppose y = 4g + 3y - 2, 4y + 4 = -4g. Solve -3h + 1 = 2b + 5, gh = -5b + 1 for b. 1 Let q be (-27)/6(-4)/6. Suppose -4b + 13 + 9 = 2p, 5p - 4b = 83. Suppose 0 = -25r + 20r + p. Solve -rs + 7 = -2d, qd = 2d - 2s for d. -2 Let z(d) = 4d - 15. Let c be z(5). Let k be (-5 + c/1)/(-1). Solve -12 = 2r + 2r - 4q, -4q = k for r. -3 Suppose 0 = -3y + 5y - 12. Let w = -3 - y. Let c be 18/12 + w/(-2). Solve z + c = o, -o - z = -5z - 21 for o. 1 Suppose 0 = 2k + 3f + 7, 5f + 2 + 35 = 3k. Solve 2o - 3j - 7 = 0, ko - 2 + 13 = j for o. -4 Let j(c) = -c + 18. Let l be j(6). Suppose -2i = i - l, -i + 18 = 2z. Solve -3k + 4u + 6 = 0, 2k - 2u = -zu + 4 for k. 2 Let x be (-1)/(-4) + 1015/(-24). Let d(r) = r*2 - r + 1. Let s(n) = -5n + 13. Let p(u) = d(u) - s(u). Let t be p(x). Solve 2h + 2y = t, 0 = -y + 2 for h. -2 Let j be (-2 - -9)((-228)/42 - -6). Solve 3a + j = 5d, 4a - 5 = -2d + 7 for d. 2 Suppose -35z = -31z - 12. Let r = 40 - 31. Solve -2g - i = -r, 5i = -4g + zg for g. 5 Suppose 33f - 12 - 87 = 0. Solve -3b = -2u - 15, fu + 21 = -0u + 4b for u. -3 Suppose -5q + 3m + 6 = 0, 25q - 20q = -4m + 27. Let f = 30 + -22. Solve -qc = a - f, -5c + 0a = -a for c. 1 Suppose 0 + 0 = 10m. Let l(z) = 3 + 2z + 0z - z. Let u be l(m). Solve -ug - 2g + 15 = -5h, 4g = 3h + 9 for h. -3 Let m(c) = 5c*2 + 3. Let s be m(2). Solve 5n = r - s, -2n - 2n - 28 = -4r for n. -4 Let d(n) = 1. Let c(w) = -w2 + 8w + 14. Let v(q) = c(q) - 2d(q). Let r be v(9). Solve -3j + 20 = -7j, -rh = j + 2 for h. 1 Suppose -222 = -0o - 6o. Let h(a) = -a*2 + 12a - 19. Let c be h(13). Let s = o + c. Solve -i - 8 = 3r, 2i - sr = 4i + 15 for i. -5 Let w(p) = p + 11. Let h be w(-9). Suppose 6l = h + 64. Let d = 16 - l. Solve dz - 25 = 0, 5z = 5t - 0t + 30 for t. -1 Let t(a) = -14a + 58. Let q be t(4). Solve qm = 3h - 4 - 9, -4h + 6 = 3m for h. 3 Let l = 9 - 10. Let j be l/(((-4)/20)/(-1)). Let h = j + 6. Solve -3z - 5r + h = 3, 0 = 5z + 3r + 14 for z. -4 Suppose -57w - 4g - 16 = -59w, -4g - 10 = w. Solve -23 + 6 = wn + 3b, -b = -5n - 17 for n. -4 Suppose -9f = -5f - 20. Suppose fm + 3 = 118. Let d = m + -19. Solve -4 = p - 5p + dv, p + 3v = 5 for p. 2 Let l(z) = 6z*2 + 2z - 3. Let d be l(1). Solve 0 = 5w + 10, -11 = dj - 0w + 3w for j. -1 Let j = 299 - 288. Solve -3f = 2f + 3q - 37, -3f + q + j = 0 for f. 5 Suppose -3n + 5x + 27 = 0, n - x = 2x + 9. Let v = 12 - n. Solve 3z = 2k - v, -3k + 2z = 4z + 15 for k. -3 Let f(n) be the second derivative of n*3/6 - 5n*2/2 + 4n. Let k be f(7). Let m be (-4 + 16 + -4)/k. Solve mi + 2q = 18, 25 = -i + 6i + 3q for i. 2 Let d(q) = -q*2 - 15q + 233. Let z be d(9). Solve 4w + 26 = -4b + 6b, -3w + b = z for w. -4 Let a(m) = -m*2 + 2m + 9. Let h be a(9). Let l be (-29)/9 - 12/h. Let q = l - -7. Solve qg + 4 = -z, 2z + 7 = 3g + 21 for z. 4 Let m(d) = -d2 + 5d. Let k be m(4). Suppose 4i - 30 = -2v, ki + i = 2v + 15. Let h = v - 1. Solve 0 = j + 3s - 2, -3j - 4s + 7 = -h for j. 5 Suppose 0 = d + q, -3q - 5 = -2d + 15. Suppose -2u = -u - d. Suppose 4z = -0z + 8. Solve -3v = b + u, v - 6 = zv + 5b for v. -1 Let q(c) = -c2 + 21c + 52. Let a be q(23). Solve 0 = 4u + 2 + a, -5u = 2t + 18 for t. -4 Suppose 5l + 40 = 4u + l, -4l = 0. Let d(z) = z*2 - 10z + 3. Let c be d(u). Solve 0 = -2r - 5x - 4 - c, -2r = -x + 1 for r. -1 Suppose -297a - 9 = -4k - 302a, -k + 2a = -12. Solve -4d + 22 = -4z - kd, -4z - 5d = 25 for z. -5 Suppose 54w + 15 = 51w. Let t(g) = 15g + 45. Let f(o) = -7o - 22. Let v(h) = 5f(h) + 2t(h). Let y be v(w). Solve -11 = x + 2d, d = -yx - 4d - 35 for x. -3 Let r(x) = x3 - 10x*2 - 6x - 40. Let h be r(11). Solve 0 = -3b, -3b = -3g - 6b + h for g. 5 Suppose -2j = 9 - 1. Let u be (-1 - -19)/((-6)/j). Let v be (8/(-10))/(2/(-5)). Solve -3h + 4f = -14, u = -0h - h - vf for h. -2 Let l be (-2)/(-12) + (-290)/(-60) + -5. Solve l = -3r - 2r - 5n + 20, 0 = 2r + 4n - 8 for r. 4 Let j(d) = d*2 + 1. Let q be j(-1). Suppose -s = qs + u - 24, -40 = -5s - 4u. Suppose -5r - 15 = -sr. Solve 4f - 19 = -rz, 2z - 4f + 2 - 4 = 0 for z. 3 Suppose -4 = 10l - 4. Suppose -7s + ls = 0. Solve s = -5w + 10, 6 = -3b + w + 1 for b. -1 Suppose -364r = -350r - 112. Solve -rf + 9f + 1 = q, 0 = 5q - 5 for f. 0 Let m(b) = b*3 + 1 - b - 5b - 4b*2 + 9 - 1. Let q	{ "pile_set_name": "DM Mathematics" }
mplify (z(-2))(-26)(zzzz((zzz/(zzzz*(2/17)z))/z)/z)/(z/z7) assuming z is positive. z(1001/17) Simplify ((w((w/(w(2/3)w))/ww)/ww)/ww)(-29)(w/(w/(ww0w)))/www(-5) assuming w is positive. w(-38/3) Simplify (y*(-4/5)yyy*(-1))/(yy*0/yyy)18 assuming y is positive. y(-179/5) Simplify ((zz(z(zzz*(-2))/zz)/zz)4)(-31) assuming z is positive. z(-372) Simplify l(11/2)/lll(-2/5) assuming l is positive. l(51/10) Simplify (p(-1/6)p*(-10)/pp)(6/7) assuming p is positive. p(-61/7) Simplify (bb/b(-2/37))/b(-12) assuming b is positive. b(520/37) Simplify (b(-1)bb(-1/2))/(b(-1/5)bb(8/3)) assuming b is positive. b(-119/30) Simplify (m/(m/((mm*(2/5)/m)/m)))/(mm/(m(((m/(m(-7/2)/m))/m)/m)/m))m*(-2/15)m/(m(-1)/m) assuming m is positive. m(113/30) Simplify (i*(-1/3)iii/(i3/i))(-1/53) assuming i is positive. i(-2/159) Simplify s10/ss/s21 assuming s is positive. s(-11) Simplify (q(-49))(-3/8) assuming q is positive. q(147/8) Simplify (j/(j0/j))(-1/6)/(((j(jj(-6))/jj)/j)/j2) assuming j is positive. j(20/3) Simplify ((s(-2))(-18/11))(-7) assuming s is positive. s(-252/11) Simplify ((v*(-14)v)/v)(-34) assuming v is positive. v476 Simplify x1/(x(-1/5)/x)(x7x)/x(1/3) assuming x is positive. x(148/15) Simplify (bb9b/(b/(bbb*5bb)))37 assuming b is positive. b703 Simplify ((cc*(-3))/(cc/(c*(-6)c)))(-32) assuming c is positive. c288 Simplify ((cc(1/4))(-1/20))(-8/3) assuming c is positive. c(1/6) Simplify ((m(-3))(-28))39 assuming m is positive. m3276 Simplify (m(2/85))23 assuming m is positive. m(46/85) Simplify ((x(-7)/x)/x(-2/25))(3/11) assuming x is positive. x(-54/25) Simplify (z(-4/5))(7/2) assuming z is positive. z(-14/5) Simplify (vv*(2/109)vv)/(v/(v/(v(4/11)/v)v)) assuming v is positive. v(5581/1199) Simplify c(-2/7)/(cc/(c/(c(-5/2)c)))(c/(c/(c/(cc(-2/17)))))/c(4/9) assuming c is positive. c(-241/2142) Simplify (((u(-12)/uu)/uu)/(uuu(-12)))(-20) assuming u is positive. u*40 Simplify (zz*(-1/12)z)/z(-2/33) assuming z is positive. z(87/44) Simplify (j*(-2/73)j)/jj19j assuming j is positive. j(1458/73) Simplify p(-17/5)/(p(pp*(4/33)p)/pp) assuming p is positive. p(-1076/165) Simplify (r/(rr/r*(2/3)))/(r/((rr*(-6))/rr)r)(r0)(-28) assuming r is positive. r*(-22/3) Simplify (ww6)/(w/w(2/3))(w(2/7))(-5/13) assuming w is positive. w(1790/273) Simplify c5cc(4/5)ccc*5c4 assuming c is positive. c(89/5) Simplify uu/(uuuuu(16/3)u)u(-14/3) assuming u is positive. u(-13) Simplify (u/(u(-2/55)/u)u)/u(2/119) assuming u is positive. u(19763/6545) Simplify (h/h(-7))47 assuming h is positive. h376 Simplify c5c(-4/7)(c*(-2/3)/c)/(c/(c(cc(-6))/c)) assuming c is positive. c(-68/21) Simplify f(-1/13)/(f0f) assuming f is positive. f(-14/13) Simplify (k(2/7))*(-7/5)((k*(-1)/k)/k)/(k/(k/(k((k*(3/2)k)/k)/k))) assuming k is positive. k(-49/10) Simplify (d/(d/(d/((d/((d(2/29)/d)/d)d)/d))))(-15/7) assuming d is positive. d(120/29) Simplify (n(3/7)n(nn(2/7))/n)/(n/((n/n(-7))/n)(n/(n/n3))/n) assuming n is positive. n(40/7) Simplify (((v/(v6/v))/v)/(v/(v(3/5)v)))(-41) assuming v is positive. v(902/5) Simplify (y/y*(-2/9))/yyyyy(y/(yy/(y(yy/y(26/3))/y)y))/y assuming y is positive. y*(-49/9) Simplify (ff*(-21))/(f(f(-11/6)/f)/f) assuming f is positive. f(-103/6) Simplify p/(p/(p/((p/(pp/(p(-3/8)p)ppp))/p))p)(p/(pp*(-8/5)p))/p assuming p is positive. p*(159/40) Simplify ((y(((y*1yy)/yy)/y)/y)(-31))(3/31) assuming y is positive. y(-6) Simplify y(-4)yy((y(-4/5)/yy)/y)/y assuming y is positive. y(-24/5) Simplify m/((m/m(-2/77)mmmm)/mm)m(-1/75) assuming m is positive. m(-23327/5775) Simplify ((u*(-2/5)u)/u*(-5/7))/(uu*(-6)uu(-1/4)) assuming u is positive. u(779/140) Simplify ((w(-3/7))(3/28))44 assuming w is positive. w(-99/49) Simplify b(4/7)b*(-3/5)b*(1/5)bb7 assuming b is positive. b(286/35) Simplify ((kk(-2/25))/k(-2/27))/((kk5k)/((kk(9/2)k)/k)) assuming k is positive. k*(-683/1350) Simplify (k/(kk/(k*1/kk)))(4/3)/(k(-2/3)k4) assuming k is positive. k(-10/3) Simplify ((((h/((((hh/(hh26h)h)/h)/h)/h))/h)/hh)/h)/(h/h*(-9/2)h) assuming h is positive. h*(41/2) Simplify (((t/(ttt(-2/43)/t)t)/t)/t)/(t/(tt(-12))) assuming t is positive. t(-557/43) Simplify (j(-2/9)/jj((((j/(jj5/j))/j)/j)/j)/j)/(j(-2/13)/jjjj(-5/6)) assuming j is positive. j(-1927/234) Simplify ((y(2/7)y)/y)(-18/13)/(y0)26 assuming y is positive. y(-36/91) Simplify (aa/(aaa35))(-23) assuming a is positive. a805 Simplify ((iii(2/5)i)/i)*(1/10)/(i/(ii(-1/2)/i))(-3/14) assuming i is positive. i(393/700) Simplify c(-3)/(c*(-6)cc) assuming c is positive. c Simplify (c(3/5)/c(-3))36 assuming c is positive. c(648/5) Simplify (i(-1/3)i*(-1))/((ii4)/(i/i(-11))) assuming i is positive. i(17/3) Simplify (q/q(2/3))*(-2/21)(q/q(2/11))/q3 assuming q is positive. q*(-1534/693) Simplify ((y/(yy(3/4)))/(((y/(y/(y/(y/(y(-2/19)/y)))))/y)/y))/(y(2/5))(2/55) assuming y is positive. y*(48921/20900) Simplify (((pp/(p/(p*(-14)/p)))/p)/p)/(ppp/(p/(p/(p/(pp(-25)))))) assuming p is positive. p6 Simplify ((m(m/m7)/m)/m)(-19) assuming m is positive. m133 Simplify a9a/a24 assuming a is positive. a(-14) Simplify ((oo/o(-3/2))/o)(-2/17) assuming o is positive. o(-5/17) Simplify ((l/(ll(1/2)))/l)/l(-8)(ll(-7))/((l/(l/l(-1/7)))/l) assuming l is positive. l(23/14) Simplify o(-2/85)oooo(1/4) assuming o is positive. o(1097/340) Simplify (q(-1))(1/7)/(q/(q/(q/((qqqqq/(((qqq*(-1/3))/q)/q)q)/q))q)(qqq(q/(q/q(-8)))/qq)/qq) assuming q is positive. q(214/21) Simplify (jj/(jj(2/19)j))/(j/j29) assuming j is positive. j(530/19) Simplify (bb2)(-1) assuming b is positive. b(-3) Simplify kkk(-5)/kkk7/kk8/k(-7) assuming k is positive. k*18 Simplify (gg*(-21)g)/(g/(g*(3/11)ggg)) assuming g is positive. g(-184/11) Simplify y13yyy/(yy*(-1/3)/y)y assuming y is positive. y*(52/3) Simplify (((t/(t/(t/(t/((((tt*(-2/9))/t)/tt)/t)))))/t)/t)/tt(-3/5)t/t*(-5)(t/(tt(1/5))tt)/t assuming t is positive. t(89/45) Simplify (x(xx(-2/37))/x)49 assuming x is positive. x(1715/37) Simplify (v(5/3)v*(-1/6))/(v/(vv*(2/3)vvv))33 assuming v is positive. v(245/2) Simplify g*0g(-2/3) assuming g is positive. g(-2/3) Simplify (f/((ff3)/fff)f*0/f)/(ff*(2/9)f/(f*4f)f) assuming f is positive. f(-29/9) Simplify ((w/((w(2/15)w)/wwwww))/w)/(www*(-2/7))w*(-6)www(-2/9) assuming w is positive. w(-3172/315) Simplify g*(-7)g*(-2/9)g/g*(-2/7)g*(-5/6)g assuming g is positive. g(-727/126) Simplify y(2/7)/y15 assuming y is positive. y(-103/7) Simplify f(-3/2)/f(2/15)f(f*(-2)/f)/f((f*(-1/4)f)/f)/f assuming f is positive. f*(-353/60) Simplify (s/(ss/(ss(-12))s))(-23) assuming s is positive. s299 Simplify ((ll/(l(-1/3)l))16)47 assuming l is positive. l(3008/3) Simplify (h(-2/7))50/((h/(h/h(2/7)))/(h/(h/((h/h(-7))/h)))) assuming h is positive. h(-53/7) Simplify y/((y(y(y/(yy/y(2/5)))/yy)/y)/yy)y/(y/(y*8/yy))y(-1)/y(4/5) assuming y is positive. y(34/5) Simplify (r/(r(2/3)/rrr)(rrr*1r)/r)/(r1/r)24 assuming r is positive. r(7/3) Simplify (i(-2/5))*(17/6)i*1/((ii2)/i) assuming i is positive. i(-32/15) Simplify q*(-28)/qq(-11) assuming q is positive. q(-40) Simplify (f/(f2/f))(-2/39)/(f*(-5)ff/(f/((ff*(-7)f)/f))ff) assuming f is positive. f8 Simplify (z(1/6))(-23) assuming z is positive. z(-23/6) Simplify t*4/tttt*(-2/3)t(t/((t(ttt(tt(((t/(t(-1/4)/t))/t)/tt)/tt)/ttt)/t)/t))(-46) assuming t is positive. t(1481/6) Simplify ((u/u(-5))/(u(2/21)u))/(((((u/(u/(u*	{ "pile_set_name": "DM Mathematics" }
f*2 - 5159f + 368. Let z be p(-23). Find a, given that -5a - 1/3a*3 - 16/3a*2 + z = 0. -15, -1, 0 Let y = 3720 + -7439/2. Let n(r) be the second derivative of 1/4r*4 + 0 - 7r + yr3 - 3/2r*2 - 3/20r*5. Solve n(i) = 0 for i. -1, 1 Let 1399/5x - 1398/5x2 + 93x*3 - 933/10 + 1/10x*4 = 0. What is x? -933, 1 Suppose -15s = -12s + 4a - 682, 2s + 3a = 453. Factor -13 + 318p + 101 - 4p*2 - sp. -4(p - 22)(p + 1) Let v(x) = -36x2 + 37x*2 + 40x - 38x. Let u(f) = -9f*2 - 242f - 3364. Let g(z) = -u(z) - 5v(z). Solve g(s) = 0 for s. -29 Let v(i) be the first derivative of -3i*5/5 + 495i*4/4 - 7206i*3 + 49440i*2 - 115200i + 7577. Factor v(g). -3(g - 80)2(g - 3)(g - 2) Let g(v) be the third derivative of -v6/96 - 27v*5/160 - 5v*4/16 - 21v*3/2 - 6v*2. Let l(z) be the first derivative of g(z). Factor l(h). -3(h + 5)(5h + 2)/4 Let c be (1/4)/(1/(-2)) - (-62755)/11410. Let w(j) be the second derivative of 40/3j3 + 0 - 17/12j*4 - 32j*2 + 1/20j*c - 31j. Factor w(m). (m - 8)*2(m - 1) Let k(v) be the third derivative of -1/105v7 + 9/2v*3 + 0v - 255v2 + 0 - 7/20v*5 + 13/120v*6 - 3/8v*4. What is g in k(g) = 0? -1, 3/2, 3 Let w(c) be the third derivative of 283c*2 + 0 + 0c + 1/2c5 - 9/8c*4 - 1/40c*6 + 0c*3. Determine a so that w(a) = 0. 0, 1, 9 Let p = 737 - 501. Let -24g*2 + 451 - p + 54g - 243 - 2g3 = 0. What is g? -14, 1 Let p(h) be the second derivative of -h5/20 + 6h*4 - 70h*3/3 - 2219h. Determine o, given that p(o) = 0. 0, 2, 70 Let p(g) be the third derivative of 3g7/560 + 247g*6/80 - 25g*5/6 - 413g*4/12 - 55g*3 - 6g*2 - 108g. Find c such that p(c) = 0. -330, -2/3, 2 Let s(u) be the second derivative of 183u5/20 + 94u*4 + 609u*3/2 + 135u*2 - 294u - 7. Factor s(n). 3(n + 3)2(61n + 10) Suppose -63z + 47z + 1050 = 134z. Let c(b) be the third derivative of 0b3 + 1/45b*5 + 0 + 0b + zb2 + 13/18b*4. Factor c(v). 4v(v + 13)/3 Let m(r) = r3 + 13r*2 - 74r - 635. Let a be m(-15). Let c(g) be the second derivative of -1/8g4 - g3 + 0 + ag - 9/4g2. Factor c(i). -3(i + 1)(i + 3)/2 Suppose -80d*2 + 4d4 - d4 - 18d3 + 219d + 27d2 + 51d - 58d2 = 0. What is d? -5, 0, 2, 9 Let m(w) be the first derivative of -27 + 1/140w*5 - 11w + 0w3 + 1/42w*4 + 0w2. Let q(z) be the first derivative of m(z). Factor q(r). r2(r + 2)/7 Let y(z) = -z2 - 5561z - 22226. Let i be y(-4). Let w be (-1426)/(-72) + 6/(-24). Factor 386/9qi + 32/9 - 50/9q*5 - wq + 230/9q4 - 422/9q*3. -2(q - 1)*3(5q - 4)2/9 Let z be ((-30)/(-14) + -2)/((-729)/(-7290)). Factor 2/7u*3 - 2/7u - zu2 + 10/7. 2(u - 5)(u - 1)(u + 1)/7 Suppose -9i + 388 - 91 = 0. Determine a, given that -74 - ia*2 + 141 - 94 + 57a + 3a3 = 0. 1, 9 Determine y, given that 140/11 - 2/11y*2 - 6/11y = 0. -10, 7 Let t be 1 + (-27)/(-9)-1. Let f be (-10 - t - 2) + 10. Solve 1/2q*3 + 3/2q*2 + f + 0q = 0 for q. -3, 0 Solve 0 + 62/3g2 + 22/3g*3 - 4g = 0. -3, 0, 2/11 Let n = -20530 + 102654/5. Factor -n + 4/5c2 - 2/5c + 2/5c3. 2(c - 1)(c + 1)(c + 2)/5 Let a(x) be the first derivative of -x*4/10 - 14x*3/5 + 301x*2/5 - 558x/5 - 678. Factor a(t). -2(t - 9)(t - 1)(t + 31)/5 Let j(l) = l + 19. Suppose -f + 2f = -8. Let b be j(f). Factor bq4 + 17q*2 - 3q*4 + 16q3 - q2 - 4q4. 4q*2(q + 2)*2 Determine c so that 15972 - 252c*3 - 1/2c*5 + 2057/2c - 19c4 - 1177c*2 = 0. -11, -8, 3 Let c(g) be the second derivative of -32g*5/5 + 2088g*4 - 272484g*3 + 17779581g*2 - 3g - 76. Factor c(v). -2(4v - 261)*3 Let a(n) be the first derivative of -3n*5/35 - 6n*4 - 159n*3/7 + 6n*2/7 + 636n/7 - 1371. Let a(q) = 0. Calculate q. -53, -2, 1 Let j(u) = -u*3 - 5u*2 - 5u - 2. Let z be j(-5). Find b such that 970b4 - 64b - 966b4 + b2 + zb*2 + 36b*3 = 0. -8, -2, 0, 1 Factor -212/3z - 2/3z2 + 370. -2(z - 5)(z + 111)/3 Suppose 4l - l = 3z - 30, 0 = 4l + 24. Let h(b) be the first derivative of 0b + 6/5b*3 - 27/10b*2 - 3/20b*z + 23. Factor h(y). -3y(y - 3)2/5 Let j(d) be the first derivative of 15/2d*2 + 0d + 1/150d5 - 1/60d*4 - 2/15d*3 - 45. Let c(x) be the second derivative of j(x). Factor c(v). 2(v - 2)(v + 1)/5 Let w(g) be the third derivative of g7/168 - 19g*6/12 + 325g*5/2 - 21875g*4/3 + 156250g*3/3 + 57g*2 + 13. Find x, given that w(x) = 0. 2, 50 Let n(h) be the first derivative of -5h*3/3 + 1275h*2/2 + 9170h + 4853. Suppose n(d) = 0. Calculate d. -7, 262 Factor 125n + 10798 - 11568 + 4n*2 - 9n*2. -5(n - 14)(n - 11) Let t = -79 - -105. Let 27y*4 + 4y*2 + 4y - 4y3 + 8 - 16y*2 + ty*4 - 49y*4 = 0. What is y? -1, 1, 2 Let t(r) be the second derivative of -3r*4/8 - 1801r*3/6 - 200r*2 - 6301r. Factor t(p). -(p + 400)(9p + 2)/2 Suppose 0 - 5/7b2 + 12b - 1/7b3 = 0. What is b? -12, 0, 7 Find c, given that -605/4c*2 - 359/4c - 21/2 - 301/4c3 - 13/4c*4 = 0. -21, -1, -2/13 Let u(q) = 4q + 4q + 2q - 50q2 + 94q*3 - 37q4. Let z(j) = j4 - j*2 - j. Let x(w) = -u(w) - 2z(w). Suppose x(i) = 0. Calculate i. 0, 2/7, 2/5, 2 Let p(o) be the third derivative of -o*8/112 + 71o*7/70 + 371o*6/40 + 677o*5/20 + 265o*4/4 + 76o*3 + 16o*2 - 11o. Factor p(r). -3(r - 76)(r + 1)*3(r + 2) Factor -26/25r2 + 2/5r*3 + 14/25r + 0 + 2/25r4. 2r(r - 1)2(r + 7)/25 Let r(q) be the second derivative of -4q7/63 - 284q*6/45 - 5029q*5/30 + 430q*4/9 + 15691q*3/9 + 10082q*2/3 + 1895q + 1. Solve r(w) = 0. -71/2, -1, 2 Suppose -4h = -3i + 7i - 16, i = 4h + 9. What is f in if2 - 588f - 20 + 1170f - 567f = 0? -4, 1 Let b be 3/(-4)(45 + -49). Let o be (-205)/(-33) - (3 + (-10)/b). Determine h, given that -162/11h*2 - oh - 8/11 = 0. -2/9 Suppose 12725 - 5h2 - 990h - 13145 - 48585 = 0. Calculate h. -99 Let u(o) be the third derivative of -o*7/70 + 59o*6/40 + 17o*5/5 - 117o*4/2 - 360o*3 - 320o*2 + o - 1. Factor u(r). -3(r - 60)(r - 3)(r + 2)*2 Let q be (1 - 11)/(-31 - (35 + -62)). Factor -qj*3 + 0 + 5/2j + 5/2j4 - 5/2j*2. 5j(j - 1)2(j + 1)/2 Let x(o) = o - 1. Let j(i) = 5i2 + 45i - 1315. Let r(n) = -j(n) - 5x(n). Let r(p) = 0. Calculate p. -22, 12 Let f(t) be the first derivative of 3/4t*4 - 13t*3 + 147t + 105/2t2 - 45. Factor f(o). 3(o - 7)*2(o + 1) Let v(c) = 6c2 + c + 3. Let l(d) = -14d*2 + 316d + 314. Let h(r) = l(r) + 2v(r). Factor h(y). -2(y - 160)(y + 1) Determine u, given that 3 - 1964u - 26605u2 + 26604u*2 - 3 = 0. -1964, 0 Let n(z) = 25z*2 + z - 2. Let v(a) = 155a*2 + 9506a - 12. Let b(h) = -6n(h) + v(h). Factor b(p). 5p(p + 1900) Find p, given that -108p + 2p3 + p3 + 42p*2 - 168 - 5p*3 + 116p = 0. -2, 2, 21 Let z(d) = -d*3 - 3d*2 - 397d - 790. Let w be z(-2). Solve w + 8h + 2/9h*4 + 20/9h*3 + 22/3h*2 = 0. -4, -3, 0 Let g(d) = 4d*2 - 2132d + 2131. Let s be g(1). Find v, given that 3/10vs + 1/10v*4 + 1/10v*2 - 1/5 - 3/10v = 0. -2, -1, 1 Let m(b) be the second derivative of b*4/4 + 585b*3 + 1026675b*2/2 - 459b + 3. Factor m(p). 3(p + 585)2 Let s be (4311/97716)/((-6)/(-34)). Find g such that -9/4 + 1/4g*3 + sg*2 - 9/4g = 0. -3, -1, 3 Let j(q) be the third derivative of -q8/4032 - q7/126 - q*6/12 + 89q5/30 - q2 + 60q. Let m(p) be the third derivative of j(p). Factor m(h). -5(h + 2)(h + 6) Let w = 2/253919 + 507832/761757. Find m such that 4m*2 + 24m - wm3 - 144 = 0. -6, 6 Suppose -i - 9 = -4d, 0 = 2d - 159i + 157i. Let o be (-55)/(-77) - 2/7. Solve -6/7z*2 + 9/7z*d + 0 + 0z*4 - oz*5 + 0z = 0. -2, 0, 1 Determine z, given that 19z2 - 128/7 - 5/7z*4 + 318/7z - 318/7z3 = 0. -64, -1, 2/5, 1 Let c(y) = 4y*3 + y - 1. Let n be c(-2). Let s = n + 48. Factor -9t*4 + 19t*4 + 3t*3 - st*4. -3t*3(t - 1) Let q(f) be the second derivative of 5f4/24 - 2405f*3/3 + 1156805f*2 + 6044f. What is d in q(d) = 0? 962 Let r = 354 - 352. Factor 2 + 18k2 - r - 13k*2 + 5k. 5k(k + 1) Let i(f) be the first derivative of 6f - 2f*3 + 3/4f*4 - 3/2f**2 - 79. Determine u so	{ "pile_set_name": "DM Mathematics" }
etermine f(p). -19 Let m(i) = 145i + 1010. Suppose 4g + 31 = -s, -4g - 45 = -21. What is m(s)? -5 Let m(q) be the first derivative of q3/3 - 3q*2/2 - 31q + 1907. What is m(-4)? -3 Let p(s) be the first derivative of -s*2/2 - 14s - 1303. Let o be 4/6 - (-69)/(-9). Calculate p(o). -7 Let p be (-1 - -4 - 6)-3. Let g(b) = b3 - b2 - b + 1. Let n(k) = 5k*3 + 2k*2 + 2k + 7. Let d(u) = -6g(u) + n(u). Give d(p). -8 Let c(v) = v3 - 6v*2 + v + 9. Suppose -20y + 19y = 38y - 156. Calculate c(y). -19 Let k(d) be the second derivative of d4/6 - d3/6 - d*2 + 847d. Calculate k(2). 4 Let k(s) = s - 5. Let p be k(0). Let i(h) = 14h2 + 19h + 1. Let b(r) = -34r2 - 47r - 2. Let y(z) = 5b(z) + 12i(z). Determine y(p). -13 Suppose 2678 = -36z + 23z. Let g = z - -193. Let p(o) = -o*2 - 14o - 16. Calculate p(g). -3 Let c(k) be the third derivative of -k6/360 + k4/6 + 2k3/3 + 3k*2. Let g(y) be the first derivative of c(y). Let d be 4 + 8/16-8. What is g(d)? 4 Let p(u) be the second derivative of 1/2u2 + 0 + u3 - 2u + 1/12u4. Let n = 45 - 51. Determine p(n). 1 Let w(s) be the third derivative of s6/720 + s5/8 + 7s*4/4 + 36s*2. Let u(t) be the second derivative of w(t). Give u(0). 15 Let v(m) = m - 1. Let u(n) = 10n - 3. Let f(h) = -u(h) + 4v(h). Let d(t) = 2t*3 - 31t*2 - 35t + 33. Let a be d(16). Let i = 269 + a. Determine f(i). 11 Let b(j) = j*3 + 6j*2 - 3j + 43. Let p be b(-7). Suppose 18 = 3g - 3t, 30g + 5t = 26g + p. Let k(l) = l3 - 4l*2 - 3l - 11. Determine k(g). -1 Let w(a) = 0a3 - a2 - 12 + 9a*3 - 8a*3 - 15 + 28. Let j(t) = -3t*3 + 5t*2 - 3. Let p = 0 + 1. Let b(k) = pj(k) + 4w(k). Determine b(-2). -3 Suppose g - 6g + 55 = 5q, 5g - 55 = 4q. Let j(f) = 6f*2 - 7f + 18. Let h(z) = 7z2 - 6z + 19. Let x(n) = 5h(n) - 6j(n). Determine x(g). -2 Let m(y) = 4y2 - 7y - 25. Let x be m(-5). Let z = x + -108. Let h(j) = j. Let p(q) = 2q - 2. Let t(d) = -3h(d) - p(d). Give t(z). -8 Let v(y) = y*3 + 3y*2 - 3y + 3. Let c(n) = 19n + 3. Let g be c(-3). Let i = g + 50. What is v(i)? -1 Suppose -45s + 30 - 581 = 394. Let u(y) = 8y + 171. What is u(s)? 3 Let t(x) = 3 + 8x*2 - 8x + 2 - 10x3 + 11x*3. Suppose 23q = 77q + 486. Determine t(q). -4 Suppose -3r + 22 = 4m, 9m - 25 = 4m - 5r. Let p(z) = -m + 21 + z - 6z2 - 15. Determine p(1). -6 Let b(j) = j3 - 7j*2 + 8j - 5. Let k(f) = 4f2 + 5f. Let u(z) = -2z - 2. Let t(y) = k(y) - 4u(y). Let o be t(-3). Give b(o). -15 Let b be 2 + 1 - 0/(-1). Let g(f) = 9f - 3. Let l(i) = 164i - 56. Let q(t) = -18g(t) + l(t). Give q(b). 4 Let c(r) = -2r*2 - 13r + 21. Let a = -48 + 55. Let d(w) = 15 - 16 + aw - 10 + w2. Let y(x) = -6c(x) - 11d(x). Calculate y(4). 15 Let h be (1 - 0) + -4 + 2. Let c(a) = 37a - 40a + 2 + a2 - 3 + a. Give c(h). 2 Let l(i) = 3i*3 + 3i*2. Suppose 9b - 14b = 45. Let x be -5 + (-5 - b - 1). Determine l(x). -12 Let c(n) = -9n + 260 + 209 + 62 - 305 + 46n. Calculate c(-6). 4 Let c = 45 + -44. Let r(b) = b2 - 6b + 1. Let f(w) = 2w2 - 7w + 1. Let i(g) = -4f(g) + 5r(g). Determine i(c). -4 Let o(w) be the first derivative of w - 1/2w2 - 4. Let u be 5 + (0 + 1)-5. Calculate o(u). 1 Suppose 0 = 5o - 32 + 22. Let i(r) = -or + 8 + 12r - 9. Let c be i(1). Let z(t) = t3 - 8t*2 - 10t + 11. Give z(c). 2 Let k(i) = 92i + 9 + 210 + 57i + 57i - 211i. Determine k(41). 14 Let s(y) = -27y - 293. Let d(b) = -6b*2 - 309b + 145. Let q be d(-52). What is s(q)? 4 Let c(h) = h - 6h + 1 - h. Let t(b) = -1422b + 24177. Let l be t(17). Determine c(l). -17 Let a be (-12)/42 - 46/(-14). Let p(u) = 6 - 4u + 3u + 4u2 - 9 + ua. Let n = -638 + 634. Calculate p(n). 1 Let n(k) = 5k*3 - k. Let h be n(1). Suppose -2o + 6 = -4u, 0u = ho - 2u - 18. Let p(b) = -b*2 + 6b + 2. What is p(o)? 7 Suppose -1 + 2 = -s. Let p(o) be the first derivative of o5/20 + o4/24 - 16o3/3 + 2o - 103. Let t(m) be the third derivative of p(m). Determine t(s). -5 Let d = -5172 - -5187. Let c(v) = -v*2 + 15v - 24. Determine c(d). -24 Let h be 3 - -2(-50)/40 - 75/6. Let i(s) = -9 + s2 + 3 + 12s - 8. Determine i(h). -14 Let j(x) be the second derivative of -x*3/6 + 12x*2 - 78x + 4. Calculate j(15). 9 Let w(d) = 13 - 5d - 36 + 6 + 3. Calculate w(-7). 21 Let n = -143 + 149. Let r be 1(-1 - (-12)/n). Let f(d) = 24d3 + d2. Give f(r). 25 Let y(b) = b2 + 0b*2 - 14747 + 14739 + 12b. Give y(-13). 5 Let k(p) = -6p + 59 + 50 - 6 - 2 - 1. Determine k(18). -8 Suppose -827 = -20m - 409 - 398. Let y(w) be the second derivative of -29w3/6 + 2w. What is y(m)? -29 Let x(h) = 8h - 1555 + 1555. Let c = 67 - 47. Let z = -21 + c. Give x(z). -8 Let w be ((-2)/(-6))/(1/15). Let h(o) be the third derivative of o4/12 - 2o*3/3 + 21714o2. Calculate h(w). 6 Let f(r) be the third derivative of r6/120 + r*5/4 - 7r*4/12 - 5r*3/3 - 197r2. Determine f(-16). -42 Let c = -7391 + 7394. Let v(y) = y3 - 4y2 + 2y + 7. What is v(c)? 4 Let u(b) be the third derivative of b6/360 - b5/15 - b*4/2 + 29b*3/3 + 22b*2. Let n(s) be the first derivative of u(s). Give n(9). -3 Let n(j) = 8j3 - j2 + 3j + 4. Let k be n(-1). Let o(t) = 0 - 7 - 155t + 0 - 131t + 284t. What is o(k)? 9 Suppose -3j + 26 = t, 14 = 4t + 4j - 58. Let k(o) be the first derivative of -o4/4 + 5o*3 - 7o*2 - 3o - 26234. What is k(t)? -3 Let l be 8 + 0 + (29 - 31). Let d(k) = k*2 + 5k - 29. Calculate d(l). 37 Let g(d) = -30494d - 1 + 30505d - 7. Calculate g(5). 47 Let s(c) = c - 70. Let k be s(-13). Let f = -85 - k. Let d(j) = 7j + 2. Determine d(f). -12 Suppose 19 = -s - 4p, 243s + p = 238s. Let d(y) = -69y2 - 1. Give d(s). -70 Let h = 3861 - 3861. Let w(o) = 6o. Determine w(h). 0 Let v(n) = n*2 + n - 3. Let a(m) = -4m*2 - m + 33. Let u(q) = a(q) + 3v(q). Determine u(7). -11 Let q(t) be the second derivative of -t*6/180 + 23t*5/120 - 11t*4/24 + 97t*3/3 - 2t - 15. Let o(z) be the second derivative of q(z). Give o(11). 0 Let n(s) = 25s - 65. Let l(a) = 156a - 388. Let c(g) = 3l(g) - 19n(g). What is c(10)? 1 Suppose 1790 = 13x - 30. Let l(z) = xz - 69z - 1 - 69z. Let o(r) = -r*2 + 7r + 12. Let j be o(8). Determine l(j). 7 Let n(i) = i*2 - 7i + 2. Let p be (-13 - -19)(-5)/2. Let x = 22 + p. Calculate n(x). 2 Let q(r) be the second derivative of r4/12 - r2 + r. Let k be q(0). Let b(p) = 211p - 2p3 - 3p*2 + 204p + 200p - 616p. What is b(k)? 6 Suppose 5m + 0m - 4j + 187 = 0, 189 = -5m + 3j. Let r = 40 + m. Let y be r10(6 + -5). Let q(d) = d2 - 10d - 3. What is q(y)? -3 Let v be (1 + -2)32/((-384)/108). Let m(w) = -2w + 25. What is m(v)? 7 Let y(g) = 35 + 70g - 8 - 8g - 65g. Let l be y(14). Let c(t) = t2 + 17t + 14. Give c(l). -16 Let a(w) be the second derivative of 3w5/20 + 3w*4/4 + 4w*2 + 4w + 20. Give a(-4). -40 Let t(u) = 26 - 15u2 - 2u - u*3 + 24u - 105 - 27u. Determine t(-15). -4 Let t be (-119)/342-1. Let z(w) be the third derivative of w6/120 - 7w5/60 - w4/12 + 7w3/6 - 1044w*2. What is z(t)? -7 Let w(g) = -12g + 1. Let i(y) be the third derivative of 5y4/24 + 49y*3/6 + 15y*2 + 4y. Let k be i(-10). Give w(k). 13 Let x = -430 - -858. Suppose 140 = -32b + x. Let c(g) = 2g - 5. Determine c(b). 13 Let p(c) = -2c. Let q = 80 - 79. Let b be 14/(-8)(q + 2 + 1). Calculate p(b). 14 Let w(v) be the second derivative of -v*4/12 - 5v*3/2 + 39v*2 - 101v. Let j be w(-19). Let l(a) = a*2 - 4a - 2. Give l(j). -6 Let i(n) be the third derivative of -1/6n4 + 1/3n*3 + 0n + 2n2 + 0. Let q = -21786 + 21784. Calculate i(q). 10 Let p(l) = 2l*3 - 5l*2 - l - 3. Let m be 4/42 - 3034/(-777). Calculate p(m). 41 Let o(v) = 4v - 4. Suppose 3w - 5w - 170 = 4k, 2w + 2k = -164. Let s = w + -2. Let p = s + 87. What is o(p)? 20 Let v(u) = 3u - 257u2 + 43 - 207u*2 + 463u*2. Give v(-7). -27 Suppose 4t - 2113 = 567. Let p = -675 + t. Let v(h) = h*2 + 2h - 4. Give v(p). 11 Let i(m) be the third derivative of m*6/120 + 29m*5/60 + 79m*4/24 + 10m*3/3 - 13m*2 - 27. Give i(-26). -6 Suppose -s + 1 = o - 1, -s - 3 = -4o. Let a = s + -4. Let b(y) = -y	{ "pile_set_name": "DM Mathematics" }
. Let q = 0 + 1. Let u(l) = -1 + q + 14l - 13l. What is u(s(j))? j Let r(h) be the first derivative of -h*5/60 + 5h*3/3 - 4. Let j(l) be the third derivative of r(l). Let g(c) = 15c*2. Give g(j(u)). 60u*2 Let r(a) = 4a - 4. Let h(s) = -19s2 + 1. Determine r(h(k)). -76k*2 Let o(v) be the third derivative of -11v7/5040 + v5/30 + 3v2. Let a(r) be the third derivative of o(r). Let i(n) = -2n. Give a(i(m)). 22m Let g(v) = 17v. Let m(c) = -194c. Determine g(m(q)). -3298q Let w(d) = -d*2. Let u be 51 - 2/(-4)-2. Let m(b) = -50 - 5b2 + u. What is w(m(p))? -25p*4 Let c(s) = -2s*2. Let x(z) = -1125z. Calculate c(x(y)). -2531250y2 Let u(m) be the third derivative of -m5/15 + m4/12 + 14m*2. Let c(s) = 2s. Give u(c(x)). -16x2 + 4x Let l(f) = -f. Let a(i) = -10i + 35. Give l(a(r)). 10r - 35 Let k(x) = x*2 + 5x - 5. Let w(a) = a - 1. Let c(n) = k(n) - 5w(n). Let m(y) = -2y. Calculate c(m(r)). 4r2 Let k(z) = 7z + 3. Let u(i) = 50i + 20. Let l(c) = -20k(c) + 3u(c). Let d(y) = -y - 5y + 4y. Give l(d(o)). -20o Let i(w) = -5w. Let k(l) = 2l - 12l + l + 0l. What is i(k(h))? 45h Let g(h) = -h2. Let r(t) = 3t - 4. Let x(y) = y*2 + 3y - 5. Let p be x(-5). Let j(a) = -4a + 5. Let z(n) = pr(n) + 4j(n). Give g(z(o)). -o2 Let f(u) = -86u. Let m(z) = 4z2. Calculate m(f(w)). 29584w2 Let f(y) = -y2. Let k(b) = 52b2 - 9b. Calculate k(f(j)). 52j4 + 9j*2 Let c(m) = 2m - 6. Let r(j) = -223j. Give r(c(v)). -446v + 1338 Let o(b) be the third derivative of -b*4/24 + 6b*2 + 2b. Let m(w) = -23w. What is m(o(a))? 23a Let c(l) = 3l. Let j(v) = 13v + 15. What is j(c(p))? 39p + 15 Let j(t) = -6t - 68. Let z(k) = 8k2. Determine j(z(f)). -48f*2 - 68 Let c(z) = -2z + 29. Let k(v) = v. Determine c(k(m)). -2m + 29 Let m(c) = -3c. Let v(y) = 82y. What is m(v(x))? -246x Let d = 5 + -5. Let t(a) = 5a - 5a + a*2 + da. Let q(w) = -2. Let o(k) = -k + 7. Let f(p) = 2o(p) + 7q(p). Give f(t(u)). -2u2 Let g(l) = -858l*2 - 2. Let y(f) = -2f. Give g(y(k)). -3432k2 - 2 Let s(u) = -5407u. Let r(b) = -2b. Give s(r(y)). 10814y Let s(c) be the first derivative of 2c3/3 + 2. Let p = -12 - -24. Let v(a) = 3a - pa + 10a. Calculate v(s(j)). 2j2 Let h(w) = -w. Let m(u) = u3 - 7u*2 + 6u + 2. Let n be m(6). Let a(g) = -g*2 - 3g*n + 0g*2. Calculate a(h(p)). -4p*2 Let w(k) = -10k*2. Let i(g) be the second derivative of 4g + 0 + 0g3 + 0g*2 - 1/6g*4. Calculate w(i(t)). -40t*4 Let q(p) = -17p2. Let k(v) = v2 + 5v - 5. Let l(z) = -z + 1. Let f(x) = k(x) + 5l(x). What is q(f(u))? -17u4 Let h(f) = 41f. Let j(q) be the second derivative of -q*4/12 - 9q. Give j(h(b)). -1681b2 Let i(a) = 113a*2 - 108a*2 + 4 - 4. Let h(o) = 3o*2. Calculate h(i(q)). 75q*4 Let k(q) = 2q. Let d(r) = -r. Let p(o) = d(o) - 4k(o). Let x(h) = 6h*2. What is p(x(t))? -54t*2 Suppose 4z - 12 = -t, -2t - 12 = -4z + t. Let h(d) = -z + 1 + 2 - 2d. Let i(k) = -9k. Give i(h(o)). 18o Let r(g) = -14g*2. Let w(v) = v. Give w(r(b)). -14b*2 Suppose 3 = -y + 4y. Let k be (y + 3 - 3) + 1. Let z(q) = 0q2 - q2 - q2 + 0q*k. Let v(t) = 4t*2. Calculate z(v(i)). -32i*4 Let k(o) = -308o*2. Let r(f) = -2f. What is r(k(l))? 616l2 Let s(c) = 8c + 3c - 8c. Let u(r) = -7r2. Give u(s(t)). -63t2 Let o(c) = -c. Let l(a) = a. Calculate o(l(i)). -i Let o(g) be the third derivative of -g7/1008 - g*5/20 - 4g*2. Let m(f) be the third derivative of o(f). Let l(y) = -y. Calculate m(l(h)). 5h Let p(z) = 7z2 - 3z. Let s(x) be the first derivative of -x*3/3 + 16. Give s(p(r)). -49r*4 + 42r*3 - 9r*2 Let o(n) = 3n*2. Let v(u) = 19u*2 - 2. Determine v(o(r)). 171r4 - 2 Let b(g) = g. Let x(k) be the second derivative of k3/3 + 5k2 + 23k. Calculate x(b(z)). 2z + 10 Let x(t) = -2t*2. Let m(a) = -141a. Give m(x(j)). 282j2 Let c(t) = 97t. Let w(a) = -41a. Calculate c(w(s)). -3977s Let l(w) = -w + 1. Let r(d) = -3d + 2. Let v(x) = -2l(x) + r(x). Suppose 4 = z + z - 3b, -2z = -5b - 4. Let f(j) = z - j2 - 2. What is f(v(o))? -o2 Let c(q) = -2q + 2 - 1 - 1. Let x(v) = 5v. Give x(c(w)). -10w Let x(n) = -54n. Let b(v) = -v2 + v + 1. Let d(i) = -i - 1. Let w(g) = -b(g) - d(g). What is w(x(z))? 2916z2 Let v(m) be the first derivative of m2 - 7. Let l(d) be the first derivative of d*2 - 1. Calculate l(v(w)). 4w Let n(a) = -7a2 - 17a*2 - 4a*2 - 5a*2. Let q(f) = 2f. What is n(q(y))? -132y2 Let t(g) = 2g*2. Let k(d) = 7d + 3. Let p(i) = 20i + 8. Let c(j) = 8k(j) - 3p(j). What is c(t(f))? -8f*2 Let m(k) = 7k. Let s(o) = 5o - 7. Let t(z) = 4 - 4z - 4z + 4z + z. Let p(i) = -4s(i) - 7t(i). Calculate m(p(a)). 7a Let q(i) = 3i - 5i + 3i. Let k(x) = -x*2 + x - 1. Let h(c) = -30c*2 + 20c - 20. Let j(l) = -h(l) + 20k(l). Determine q(j(v)). 10v2 Let f(c) = c2. Let d(g) be the second derivative of -10g3/3 - 11g. Determine f(d(s)). 400s2 Let y(z) = 10z - 7z - 5z. Let h(o) = -2o. Determine h(y(l)). 4l Let w(l) = -l. Let m(f) be the second derivative of 0f3 - 4f + 1/4f4 + 0 + 0f*2. What is w(m(r))? -3r*2 Let b(m) = 4m. Let o(u) = -u*2 + 47u. Determine b(o(d)). -4d2 + 188d Let h(b) = -4b2. Let m(g) = -9g*2. Let t(s) = 80s*2. Let p(c) = -52m(c) - 6t(c). Give p(h(a)). -192a*4 Let j(f) be the third derivative of -3f4/8 + f3/2 + 21f2. Let d(s) = -s. Give d(j(r)). 9r - 3 Let z(x) = -2x2. Let w(a) = -2a*2 + 6a + 15. Calculate w(z(c)). -8c4 - 12c*2 + 15 Let c(j) = -28893j*2. Let m(s) = -2s*2. Calculate m(c(l)). -1669610898l4 Let x(g) be the third derivative of g5/60 + 3g2. Let f(w) = 1. Let p(i) = 2i + 2. Let z(r) = 4f(r) - 2p(r). Give z(x(v)). -4v2 Let d(a) = -a. Let m(q) = -4q. Let x(w) = 6d(w) - m(w). Let c(y) = -22y + 5. Let g(l) = 341l - 77. Let z(i) = 77c(i) + 5g(i). Determine z(x(v)). -22v Let q(a) = 2a + 2. Let y(j) = 2j*2. Give y(q(f)). 8f*2 + 16f + 8 Let m(f) = -14f + 16. Let z(k) = -9k + 10. Let c(t) = -5m(t) + 8z(t). Let g(s) = -3 + 3 + s. Give c(g(n)). -2n Let z(j) = 3j. Let f(l) = 12l - 17l + 13l. What is f(z(y))? 24y Let l(p) = 52p. Let z(t) = 6t. Give l(z(h)). 312h Let g(s) = -13s + 1. Let p(x) = -29x. Determine g(p(f)). 377f + 1 Let x(d) = -131d. Let i(a) = 5a. Calculate x(i(f)). -655f Suppose 3b = 7b + 2d - 92, 0 = b - 5d - 1. Let u(o) = -o - 21 + b. Let f(z) = z2. What is u(f(k))? -k2 Let h(a) = a2 - a. Let t(p) = 6p*2 - 6p. Let k(f) = 11h(f) - 2t(f). Let n(c) = 5c2 - 6c. Let y(u) = 6k(u) + n(u). Let v(b) = 3b. Give v(y(w)). -3w2 Let v(f) = -4f*2 + 5f - 5. Let o(t) = 3t2 - 4t + 4. Let c(a) = -5o(a) - 4v(a). Let q(g) = 3g2 + 3g. What is c(q(p))? 9p4 + 18p*3 + 9p*2 Let c(h) = 5h*2. Let g(i) = -4i*2. Let q(s) = 3c(s) + 4g(s). Let j(n) = 1. Let l(z) = z - 3. Let d(a) = 12j(a) + 4l(a). Determine q(d(x)). -16x*2 Let b(q) = 4q2. Let x(a) = -a2 + 8a - 2. Let m be x(6). Suppose 0 = 5p + 2i - m, 5i + 2 = p. Let s(f) = -1 - 3 + 2fp + 4. Give b(s(l)). 16l*4 Let u(j) = 37j. Let y(i) be the first derivative of i*2/2 + 18. Calculate u(y(d)). 37d Let u(d) be the first derivative of 7d3/3 - 1. Let m(o) = -2o*2. Give m(u(z)). -98z*4 Let i(o) = 22964o. Let l(h) = 2h. Calculate i(l(m)). 45928m Let r(b) = 19b. Let g = 27 - -1. Let a(s) = g - 17 + s - 11. What is a(r(t))? 19t Let h(c) be the first derivative of c*2/2 - 5. Let f(d) = -4d. Determine f(h(u)). -4u Let v(s) = s. Let r(w) = w3 + w2 - 3w - 1. Let t be r(-2). Let u(y) = y + 1. Let a(f) = 2f + 4. Let d(l) = ta(l) - 4u(l). What is v(d(o))? -2o Let z(d) = -3d + d - 5d + d. Let a(v) = 4 + 2v - 4. Determine z(a(o)). -12o Let r(w) = -2w - w + 6w. Suppose 3k - 5c = 16, 8c = 5k + 5c - 16. Let s(o) = k - 2 - 2o*2. Calculate s(r(n)). -18n2 Let u(f) = -2 - f2 + 2. Let g(d) be the second derivative of 4d - 2/3d*3 + 0d*2 + 0. Give g(u(o)). 4o*2 Let l(w) = 7w2. Let z(u) be the third derivative of u8/10080 - u5/30 - u2. Let c(a) be the third derivative of z(a). Give c(l(n)). 98n4 Let c(b) = 21b. Let f(x) b	{ "pile_set_name": "DM Mathematics" }
3p - 3/2p*3 + 0 - dp*5 = 0. -2, -1, 0, 1 Find i, given that 0i + 0 - 3/2i3 + 3/2i*2 = 0. 0, 1 Let p(a) be the first derivative of a + 1/3a*4 - 1/5a6 + a2 + 1/21a7 - a3 - 3 + 1/5a*5. Let h(c) be the first derivative of p(c). Factor h(n). 2(n - 1)*4(n + 1) Suppose 5n + 9 = 2g - 9, g = -4n - 4. Suppose -3 = -2j + 1. Factor -2yj + 2y*4 - gy*2 + 4y*2. 2y*2(y - 1)(y + 1) Let w(a) be the first derivative of -2a - 2 + 1/3a2 + 2/9a*4 + 7/20a*5 - 11/18a*3. Let i(h) be the first derivative of w(h). Factor i(t). (t + 1)(3t - 1)(7t - 2)/3 Let h(f) = 3f*2 + 11f - 27. Let s(k) = -k*2 - 6k + 14. Let l(g) = 2h(g) + 5s(g). Factor l(t). (t - 4)*2 Let h be 2 + (-12)/20 + -1. Factor 2/5y*4 - hy*3 - 2/5y*2 + 2/5y + 0. 2y(y - 1)*2(y + 1)/5 Let f = 13/4 - 11/4. Find z such that -1/4z2 - 3/4z - f = 0. -2, -1 Let z(s) be the third derivative of -s11/1663200 + s9/151200 - s7/25200 - s5/30 + 2s2. Let m(u) be the third derivative of z(u). Factor m(i). -i(i - 1)*2(i + 1)2/5 Let i(l) be the second derivative of -l6/27 + 2l5/15 - 2l*4/27 - 7l. Factor i(j). -2j2(j - 2)(5j - 2)/9 Let d be -5(5/20 + 172/(-560)). Factor dr*3 + 0 + 0r + 2/7r2. 2r*2(r + 1)/7 Factor 12t3 - 3t3 - t3 - t*4 + 5t*4. 4t*3(t + 2) Let n = 494/3 - 162. Find y such that -ny4 + 8y*2 - 10/3y - 4/3 - 2/3y3 = 0. -2, -1/4, 1 Let d(g) = 3g*3 - 9g*2 + 9g - 5. Let l(q) = 12q3 - 36q*2 + 36q - 21. Let t(z) = 9d(z) - 2l(z). Let t(a) = 0. What is a? 1 Let p be (-4)/26 - (-1952)/(-156). Let q = p - -13. Factor y + 1/3 + qy3 + y2. (y + 1)3/3 Suppose 2b - 60 = w, -120 = 2w + 3b - 0b. Let k be 2/(-12) + (-25)/w. Suppose -1/4j + 1/2j2 - kj*3 + 0 = 0. Calculate j. 0, 1 Let p be (-20)/(-70)(-7)/(-4). Suppose -pu4 - 1/2u*3 - 1 + 3/2u*2 + 1/2u = 0. Calculate u. -2, -1, 1 Let g(h) = -5h2 - 2h + 4. Let c(o) = -9o2 - 4o + 7. Let z be (1 + 0)/((-11)/(-44)). Let u(y) = zc(y) - 7g(y). What is s in u(s) = 0? -2, 0 Suppose -2b = b. Let z(a) be the third derivative of 0a*6 + ba + 0 + a*2 - 1/72a*4 + 1/60a*5 - 2/315a*7 + 0a*3. Factor z(i). -i(i + 1)(2i - 1)*2/3 Let u(v) be the third derivative of 0v*5 - 1/9v*3 - 1/90v*6 + 1/315v*7 + 6v*2 + 0 + 1/18v*4 + 0v. Find y, given that u(y) = 0. -1, 1 Determine d, given that 5/8 + 1/8d3 - 1/8d - 5/8d2 = 0. -1, 1, 5 Factor -2/21l*3 - 6/7l*2 - 8/21 - 22/21l + 2/21l4. 2(l - 4)(l + 1)3/21 Let b = 22 - 17. Let o(a) be the first derivative of 1/9a*3 + 0a*2 + 0a - 1/15ab + 0a4 - 1. Let o(h) = 0. What is h? -1, 0, 1 Let k(n) be the third derivative of n6/60 - n5/30 - n4/2 - 25n2. Factor k(v). 2v(v - 3)(v + 2) Suppose -4o - r + 49 = 0, -4r - 3 = -o - 12. Let x(a) = -2a. Let h be x(-1). Let -24z*2 + 18z + h - 6 + oz3 - z3 = 0. Calculate z. 2/5, 1 Let m(c) be the first derivative of -c2 - 10c - 5. Let y be m(-6). Suppose 2/9fy + 0 + 4/9f = 0. Calculate f. -2, 0 Factor -25/3p2 - 9p - 2/3. -(p + 1)(25p + 2)/3 Let z(u) = 3u2 - u + 1. Let m(h) = h2 + 0h2 + h2 - 2h. Let p(s) = -5m(s) + 4z(s). Factor p(n). 2(n + 1)(n + 2) Let i = 815/9 - 269/3. Let m(o) be the first derivative of 2/3o*2 + 0o - 1/15o5 - io*3 + 1 + 5/12o4. Solve m(j) = 0 for j. 0, 1, 2 Let l(y) be the first derivative of -y5 - 15y4/4 - 5y*3 - 5y*2/2 + 31. Factor l(x). -5x(x + 1)3 Suppose -4p = -60 + 12. Let c = p + -12. Let -2/7y2 + cy + 0 + 2/7y3 = 0. Calculate y. 0, 1 Let v(t) be the third derivative of 7t*6/480 + 19t5/240 + t4/12 - t3/6 + t2. Suppose v(b) = 0. Calculate b. -2, -1, 2/7 Let s(j) = -8j - 117. Let x be s(-15). Factor -6/5v*2 + xv - 6/5. -3(v - 2)(2v - 1)/5 Let w be -5 + (-10)/(-5 - -3). Let 3/2o*4 + 0 + 0o + 0o2 + wo*3 = 0. What is o? 0 Let w = 38 + -38. Let y(a) be the third derivative of 1/280a*7 + 0a*5 + 0 + wa*3 + 0a - 1/240a6 + 0a*4 - 3a2. Factor y(b). b3(3b - 2)/4 Let s = 13/3 - 17/4. Let x(y) be the second derivative of 0 - y + sy4 + 2/3y*3 + 2y2. Factor x(q). (q + 2)2 Let j(c) be the third derivative of -c6/60 + c4/12 + 7c2. Factor j(i). -2i(i - 1)(i + 1) Let n = -1469/2 + 736. Suppose 3/2l + l2 - 1 - nl3 = 0. What is l? -1, 2/3, 1 Let b(g) be the second derivative of g7/1050 - g6/600 - g5/300 + g4/120 + g2 + g. Let z(l) be the first derivative of b(l). Factor z(f). f(f - 1)2(f + 1)/5 Let c(w) be the third derivative of 1/50w6 + 0w*4 + 0 + 0w + 1/525w7 + 3/50w*5 + 0w*3 - 3w*2. Suppose c(p) = 0. Calculate p. -3, 0 Let c(v) be the first derivative of 3/5v*2 - 2/25v*5 - 2/15v*3 - 3/10v*4 + 4/5v + 1. Solve c(g) = 0 for g. -2, -1, 1 Let n(j) be the first derivative of -j*4/28 + 4j*3/21 - 5j*2/14 + 2j/7 - 7. Factor n(a). -(a - 2)(a - 1)2/7 Factor 1/8f*5 - 1/2f*4 + 0 + 3/4f*3 + 1/8f - 1/2f2. f(f - 1)*4/8 Let d = -21 - -15. Let u be (-8)/d + 4/(-6). Factor -u - 2/3a*3 + 2/3a + 2/3a2. -2(a - 1)*2(a + 1)/3 Let s(d) be the first derivative of -d4/60 - d3/15 + 3d2/10 + 6d - 2. Let t(f) be the first derivative of s(f). Factor t(m). -(m - 1)(m + 3)/5 Let x(f) = f3 - 3f2 + 4. Let q be x(3). Solve o2 + 3o3 - 2o*2 + qo*2 = 0 for o. -1, 0 Suppose 0 - 8/3l*2 + 4/3l*3 + 4/3l = 0. Calculate l. 0, 1 Let g*2 + 0g - 2g - 5g*2 - 3g - 2 - g*3 = 0. Calculate g. -2, -1 Suppose 9/5q*3 - 3/5q*5 + 0q + 6/5q2 + 0 + 0q*4 = 0. What is q? -1, 0, 2 Let k(g) be the first derivative of -3/14g*2 + 2 - 1/28g*4 - 1/7g - 1/7g3. Factor k(j). -(j + 1)3/7 Let h(w) be the second derivative of -1/3w*3 + 1/10w*6 + 0w*2 - 1/4w*4 + 4w + 1/20w5 + 1/42w*7 + 0. Factor h(i). i(i - 1)(i + 1)2(i + 2) Let d(f) = 2f + 35. Let g be d(-16). Factor go*2 + 5/4o*3 + 1/2 + 9/4o. (o + 1)*2(5o + 2)/4 Let h = 4 + -1. Suppose -ha - 14 = -4l, -4l + 4 = -3a - 2l. Find y, given that -2/13 - 2/13ya - 4/13y = 0. -1 Let d(o) be the second derivative of -1/16o4 + 0 + 1/24o*3 + 0o*2 - o. Factor d(r). -r(3r - 1)/4 Let d = -46 - -46. Let l be 12/36(d + 2). Let 1/3k2 + l - k = 0. What is k? 1, 2 Let f = -135 - -78. Let t be -2(-3 + f/(-21)). Determine o so that to - 2/7o2 - 2/7 = 0. 1 Let g(c) be the third derivative of -c7/315 - c6/360 + c5/180 + 10c2. Suppose g(i) = 0. Calculate i. -1, 0, 1/2 Let g = 7 - 5. Let x be ((-5)/(-2))/(g/4). Factor xw3 + w3 + 10w4 + 0w*3 - 4w*2. 2w*2(w + 1)(5w - 2) Let i = -98 - -103. Let h(z) be the third derivative of 0z + 0 + 1/270z*i + 1/27z*3 - 1/54z*4 - 4z*2. Factor h(y). 2(y - 1)2/9 Let k(a) be the first derivative of -a6/180 - a5/60 + a4/6 - 4a3/3 - 4. Let z(v) be the third derivative of k(v). What is b in z(b) = 0? -2, 1 Factor -3/5m*2 + 12/5 + 9/5m. -3(m - 4)(m + 1)/5 Find c, given that 0 - 3/8c4 + 3/4c*2 + 11/8c*3 - c = 0. -1, 0, 2/3, 4 Let i be (-10689)/(-165) - 6/(-15). Let j = i + -65. Factor 6/11d*4 - 2/11d*5 - 6/11d*3 + 0 + jd*2 + 0d. -2d2(d - 1)*3/11 Let r(z) be the first derivative of -1/3z*3 + 0z*2 - 9/5z*5 - 3/2z*4 - 1 + 0z - 2/3z6. Factor r(g). -g2(g + 1)*2(4g + 1) Let x(z) be the first derivative of z5/20 + z4/4 + z3/3 - 5. Factor x(m). m2(m + 2)2/4 Let x(j) be the third derivative of -j8/1008 - j7/630 + j6/180 + 8j2. Factor x(t). -t3(t - 1)(t + 2)/3 Let l(w) be the third derivative of w6/210 - w5/105 - w4/42 + 2w*3/21 + 5w*2. Find r such that l(r) = 0. -1, 1 Let 3/5b*2 - 1/5b*4 + 2/5b + 0b3 + 0 = 0. What is b? -1, 0, 2 Let x = -114/5 + 342/5. Let g = 46 - x. Factor 2/5 + 0d - gd2. -2(d - 1)(d + 1)/5 Let y = 22 + -20. Let l(s) be the first derivative of 2/5s - 3/10sy - 2 + 1/15s*3. Let l(j) = 0. Calculate j. 1, 2 Let o(z) = 2z. Let d be o(1). Let w(f) be the first derivative of -3f3 - 2 + 5fd + f3 + 0f2 - 4f. Solve w(j) = 0 for j. 2/3, 1 Let t(w) be the first derivative of -5w6/6 + 2w*5 + 15w*4/4 - 20w*3/3 - 10w*2 - 42. Factor t(k). -5k(k - 2)2(k + 1)*2 Let i(l) be the second derivative of 0l**2 + 1/	{ "pile_set_name": "DM Mathematics" }
st common multiple of 286734 and 105. 1433670 What is the common denominator of -77/3315 and 17/36855? 626535 Calculate the lowest common multiple of 1216 and 121904. 487616 Calculate the common denominator of 61/53816 and -125/126852. 1775928 Calculate the least common multiple of 619095 and 37395. 5571855 Calculate the lowest common multiple of 72 and 22104. 22104 Calculate the common denominator of 113/192 and 157/960. 960 What is the lowest common multiple of 508344 and 3? 508344 What is the common denominator of 55/162306 and -131/162306? 162306 What is the common denominator of -111/196 and -31/532? 3724 Calculate the smallest common multiple of 26040 and 7161. 286440 Find the common denominator of 129/14030 and -63/440. 617320 What is the least common multiple of 3699 and 1918? 51786 What is the lowest common multiple of 45 and 2406? 36090 Calculate the smallest common multiple of 8 and 64736. 64736 Calculate the smallest common multiple of 68 and 44948. 44948 Calculate the lowest common multiple of 22422 and 78477. 156954 What is the common denominator of -65/33802 and 38/7? 236614 Calculate the lowest common multiple of 9213 and 5976. 221112 Find the common denominator of -145/6 and 11/96678. 96678 Calculate the lowest common multiple of 5396 and 228. 16188 Calculate the common denominator of -157/8940 and -27/4. 8940 What is the least common multiple of 152220 and 1290? 152220 What is the common denominator of 7/30 and -45/1099? 32970 Calculate the lowest common multiple of 115787 and 7735. 7526155 Calculate the lowest common multiple of 57684 and 924. 403788 Calculate the common denominator of 25/617298 and -9/1131713. 6790278 Find the common denominator of -77/1061848 and 7/7218. 9556632 Calculate the common denominator of -37/32 and -5/464612. 3716896 What is the least common multiple of 880 and 20? 880 What is the common denominator of -65/46 and -95/1506? 34638 What is the common denominator of 27 and -41/29600? 29600 What is the least common multiple of 8592 and 10740? 42960 What is the common denominator of -21/932 and -19/932? 932 Calculate the lowest common multiple of 2 and 79264. 79264 What is the least common multiple of 4 and 1118503? 4474012 Find the common denominator of -77/32 and 7/300740. 2405920 Find the common denominator of 13/381843 and -53/495. 1909215 Calculate the smallest common multiple of 642 and 458. 147018 What is the common denominator of 67/24 and 61/570? 2280 Calculate the lowest common multiple of 96 and 3222. 51552 Calculate the lowest common multiple of 134 and 315. 42210 Calculate the lowest common multiple of 1476 and 24. 2952 Find the common denominator of -41/672 and -9/19072. 400512 What is the common denominator of 71/675 and -1/132246? 3306150 What is the lowest common multiple of 20 and 645756? 3228780 What is the smallest common multiple of 28 and 54420? 380940 Calculate the common denominator of 131/3210 and -99/4280. 12840 What is the least common multiple of 168 and 7170? 200760 What is the lowest common multiple of 716958 and 260712? 2867832 Calculate the lowest common multiple of 94 and 282. 282 What is the lowest common multiple of 5746 and 187? 63206 What is the least common multiple of 1152 and 12978? 830592 Calculate the least common multiple of 858 and 396. 5148 What is the common denominator of 181/660 and -197/108900? 108900 What is the common denominator of -87/8012 and -11/24? 48072 Calculate the common denominator of -20/909 and 45/712. 647208 What is the least common multiple of 304 and 47728? 47728 What is the common denominator of 19/57312 and 61/1216? 2177856 What is the lowest common multiple of 10 and 723613? 7236130 Find the common denominator of -53/5184 and 49/27. 5184 What is the lowest common multiple of 13840 and 13840? 13840 Calculate the common denominator of 169/1865160 and -47/594. 1865160 What is the lowest common multiple of 9888 and 24? 9888 What is the common denominator of 35/151 and -12/1705? 257455 What is the common denominator of 2/271775 and -107/815325? 815325 Calculate the least common multiple of 3610 and 3971. 39710 Calculate the common denominator of 107/2790 and 5/65844. 329220 Calculate the common denominator of -33/35 and 88/78645. 78645 Calculate the common denominator of 61/36 and -125/259344. 259344 Calculate the lowest common multiple of 1 and 8285. 8285 Calculate the common denominator of -133/6 and 1/596802. 596802 What is the common denominator of -53/7 and -50/373127? 2611889 Calculate the smallest common multiple of 33000 and 200. 33000 Calculate the common denominator of -151/458754 and 67/12. 917508 Find the common denominator of -37/114 and -86/705. 26790 Find the common denominator of 59/576 and 67/2700. 43200 Calculate the lowest common multiple of 139263 and 21. 974841 What is the least common multiple of 580983 and 12? 2323932 Find the common denominator of -89/15 and 79/216786. 1083930 Calculate the common denominator of -101/6616 and -107/18194. 72776 Calculate the common denominator of -37/1243 and 19/406800. 4474800 What is the least common multiple of 23856 and 112? 23856 Calculate the smallest common multiple of 24984 and 324. 224856 What is the smallest common multiple of 149996 and 171424? 1199968 What is the lowest common multiple of 345 and 17365? 52095 What is the smallest common multiple of 58896 and 58896? 58896 What is the common denominator of -61/1815579 and -70/9? 1815579 Calculate the smallest common multiple of 1052068 and 14. 7364476 Calculate the common denominator of 169/3570 and -103/10570. 539070 What is the smallest common multiple of 3440 and 1040? 44720 Calculate the common denominator of -29/87622 and -36/7. 613354 Calculate the common denominator of -89/1230 and 59/1863450. 1863450 Calculate the smallest common multiple of 221820 and 44364. 221820 Find the common denominator of 115/24094 and -17/9. 216846 Calculate the smallest common multiple of 275425 and 575. 275425 Calculate the least common multiple of 70 and 280. 280 What is the least common multiple of 339 and 135? 15255 What is the common denominator of -31/890 and 36/76273? 762730 Calculate the common denominator of -7/27960 and -25/168. 195720 Calculate the smallest common multiple of 368 and 3376. 77648 Calculate the least common multiple of 22587 and 97877. 293631 Calculate the common denominator of 95/25036 and -91/612. 3830508 Calculate the common denominator of -45/10766 and 41/4046. 3111374 What is the least common multiple of 1072808 and 167? 1072808 Calculate the smallest common multiple of 8483 and 6487. 110279 Calculate the common denominator of -119/141480 and 17/13100. 707400 What is the lowest common multiple of 98 and 322? 2254 Find the common denominator of 75/14 and -187/971460. 971460 Calculate the lowest common multiple of 74085 and 53880. 592680 Calculate the lowest common multiple of 45472 and 3136. 90944 What is the least common multiple of 126312 and 189468? 378936 What is the smallest common multiple of 14 and 87984? 615888 What is the least common multiple of 15113 and 217? 468503 Find the common denominator of 30/12397 and -5/14. 24794 What is the common denominator of 123/10850 and 67/6125? 379750 Calculate the lowest common multiple of 637908 and 6018. 637908 What is the common denominator of 29/39015 and 64/81? 117045 What is the common denominator of 51/305 and -139/76860? 76860 What is the common denominator of 11/8336 and 57/164636? 658544 Find the common denominator of 37/24610 and 107/390. 959790 Calculate the common denominator of -49/310640 and -51/28240. 310640 Calculate the common denominator of 40/5191 and -43/820715. 23800735 Calculate the least common multiple of 114 and 487704. 9266376 What is the smallest common multiple of 418 and 342? 3762 Calculate the common denominator of -61/19306 and -21/2. 19306 Calculate the lowest common multiple of 26028 and 540. 130140 Calculate the lowest common multiple of 125 and 2. 250 What is the smallest common multiple of 78760 and 78760? 78760 Find the common denominator of -71/6060 and 151/4242. 42420 What is the common denominator of 49/64 and 19/6776? 54208 What is the common denominator of -47/28340 and -87/2834? 28340 What is the least common multipl	{ "pile_set_name": "DM Mathematics" }
reds digit of o? 1 Let c(x) be the first derivative of -2x2 - 16x + 2. Let f be c(-5). Suppose -4o = 4m - 505 - 111, 4 = -fo. What is the units digit of m? 5 Suppose 0 = -4f - 8 - 24. Suppose -6b = 12b + 2232. Let s = f - b. What is the tens digit of s? 1 Suppose h - 16 = 9h. Let l = -33 + 41. What is the units digit of (l/8)/(h/(-4))? 2 Let f(w) be the second derivative of w5/30 - 17w*3/3 - 9w*2 + 37w. Let g(x) be the first derivative of f(x). What is the units digit of g(6)? 8 Suppose -d = -17d. Suppose 4m - 583 = -dc + c, -m - 2c = -157. What is the hundreds digit of m? 1 Suppose -3q = -0q - 15, 92 = 3z - 2q. Let c = z - -37. Let p = c - -184. What is the tens digit of p? 5 Let l = 996 - 1002. Let m(s) = 15s2 + 70s + 387. What is the hundreds digit of m(l)? 5 Suppose -b + 40 = 37. What is the units digit of (6/(-8))/(b(-7)/7392)? 4 Let h be 4/((-20)/75-3). Suppose 3l + hf = 1618, -5l + 0f + 3f + 2708 = 0. What is the hundreds digit of l? 5 Suppose 0 = 5k - v - 7 + 2, -5k - 2v = 10. Suppose k = -f + 2j + 615, 4j = -2f + 7f - 3045. What is the units digit of f? 5 Let y(o) = 18o + 85. Let v be y(-4). Suppose -4h - 5i + 417 = 0, -v = -2i - 3. What is the tens digit of h? 9 Let l = -7 + 13. Suppose -3w = -lw + 2j + 13, -j - 6 = -w. What is the units digit of 23w - (-1 + 4 - 0)? 0 Let p(q) = 7q2 + 8q + 21. Let o(d) = 6d - 49. Let v be o(7). What is the units digit of p(v)? 8 Suppose 10t = d + 6t - 5645, 2d + 2t = 11250. What is the thousands digit of d? 5 Let c be (4/10)/((-34)/(-1360)). What is the units digit of (-1554)/(-4) - (-8)/c? 9 Let f(l) = -120l + 17. Let z(p) = 121p - 16. Let o(s) = -4f(s) - 5z(s). What is the hundreds digit of o(-2)? 2 Suppose -45 - 54 = -b. Let j = b - 86. Suppose 3u - ju = -1570. What is the tens digit of u? 5 What is the tens digit of (120/(-80))/(18/(-736068))? 3 Let d(x) = -17x*2 - x + 10. Let o be d(-3). Let a = o + 446. What is the units digit of a? 6 Let h(s) = 37s*2 + 12s + 1. Let v = 147 + -148. What is the tens digit of h(v)? 2 Suppose -4c = -3g + 2173, 9g - 5g + c - 2910 = 0. Let j(y) = 6y2 - y. Let d be j(1). Suppose -da + 218 = -g. What is the units digit of a? 9 What is the ten thousands digit of 2/(-5) - 1427033/(-95)? 1 Suppose 3g + 2 = -2p, -5g + 2p - 6 = -6g. What is the tens digit of 72/(-32)g - -1064? 7 Suppose -5o - 15 = -4d - 19, 4o + 3d - 28 = 0. Suppose 2v - 3502 = -ou, 4u - 581 = 5v - 9364. What is the thousands digit of v? 1 Let g be -2 + (3/2)/((-3)/(-8)). Suppose -10 = -3y + gr - r, -r + 25 = 4y. Suppose -3b - 5m + 173 = -0m, -5m - 235 = -yb. What is the units digit of b? 1 What is the tens digit of (1 - 3)/(-10 + (-4676)/(-468))? 3 Suppose 9q - 4q = n + 9254, -3n = 12. Let o = q + -749. What is the units digit of o? 1 Let k(q) = -22q + 5. Let c be k(-2). Suppose -4y - 5w = -7y + 48, -5y - 2w + c = 0. Let i = y - -93. What is the hundreds digit of i? 1 Suppose -3i + 7 = -3x + i, -5x - 5i = -35. Suppose -80 = -4u + xu. What is the units digit of u? 0 Let o be (-4)/1 + 225/5. Let v = o + 152. What is the hundreds digit of v? 1 Suppose 3g + 2n = 16, -3n + 0n - 10 = -4g. Suppose 4b + 18 = -5w - 17, 2b - 2 = gw. What is the units digit of -281(b - 3)? 4 Let i = -649 + 654. Let a(h) = 913h + 1. Let q be a(1). Suppose iy + 4n = 919, -5y - 2n = -3n - q. What is the hundreds digit of y? 1 Let n be 16 + 15/(-3) + 4. Suppose 5g + 958 = 3t, 10t - nt = -5g - 1580. What is the hundreds digit of t? 3 Suppose 0 = -4t + b + 28567, 489 - 494 = -b. What is the thousands digit of t? 7 Let y(z) = 10z3 - 11z*2 - 6z + 14. Suppose 0 = 4k + n - 25, 2k - 2n = -3n + 13. What is the units digit of y(k)? 2 Let m(y) = 9y2 + 10y + 8. Let z be (-3)/64 + (-150)/(-15). What is the units digit of m(z)? 4 Let k = 2946 + 6044. What is the tens digit of k? 9 Suppose -393 = -16s + 13s. Let f be (s/4 + -1)(24 - 20). Suppose -2o - 3l = -268, f + 165 = 2o - 3l. What is the units digit of o? 0 Let v be (-2)/(-9) - (-214088)/504. Let t = -118 + v. What is the units digit of t? 7 Suppose -3d + 6d - 3 = 0. Let g be (3/((-36)/(-20)))/(d/378). Suppose 5o - 325 = -l + o, 0 = -2l - 3o + g. What is the tens digit of l? 0 Suppose 0 = -2o + 7j - 6j + 9706, j - 24265 = -5o. What is the units digit of o? 3 Let b be (-16)/6 - (-2)/(-6). Let m(l) = -26l - 698. Let s be m(-22). What is the units digit of 1097/7 - (-12)/sb? 7 Let w = 15786 - -183. What is the ten thousands digit of w? 1 Let b be 0/((3 + 0)2/(-3)). Suppose 15 = 3i - b. Suppose 4 - 16 = -d + 3z, 0 = -id + z + 46. What is the units digit of d? 9 Let w be (-156)/(-15) - (48/20)/(-4). Suppose -3j - 34 = -7j + 2x, -j = -x - w. Let f(z) = 3z2 - z + 1. What is the tens digit of f(j)? 0 What is the tens digit of (479493/2065)/((-6)/(-1210))? 2 Let j = 143 + 1885. Suppose 43w + j = 49w. What is the hundreds digit of w? 3 Suppose 0 = 4n + 4h - 20, 6 + 5 = 3n + 2h. Let p(z) = 965z*2 + 6z - 7. What is the tens digit of p(n)? 6 Suppose -2c = 5c. Suppose -3f = 4h - 0 - 1168, c = -2h + 5f + 610. Suppose 2d + 2b = 4b + 126, -h = -5d + b. What is the units digit of d? 8 What is the hundreds digit of 35418 + (60/(-2) + 15 - (3 - 12))? 4 Suppose -2d = 2d + 5p - 21, 5p = 25. Let u(k) = 345k2 + 5k + 3. What is the tens digit of u(d)? 4 Suppose -6 = 2y - 4. Let w be (-193 + y)14/28. Let v = w + 163. What is the tens digit of v? 6 Let z = -966 + 501. Suppose -26h - 3874 - 1018 = -1018. Let b = h - z. What is the hundreds digit of b? 3 Let c(f) = 3f + 9. Let m be c(3). Suppose -4a + m = -2a. Let w = 218 - a. What is the hundreds digit of w? 2 Let v(r) = -2r2 + 3r + 248. Let d be 4(-3)/2 + 6. What is the tens digit of v(d)? 4 Let j(f) be the second derivative of 7f*3/6 + 36f*2 - 2f + 32. What is the units digit of j(-8)? 6 Let v(a) = -46a2 - 6 + 20a - 25a + 262a*2 + 9. What is the tens digit of v(1)? 1 Let l be (-37)/(-5) - 7 - 212/5. What is the units digit of -1((-9674)/l)/(2/(-6))? 1 Suppose -k + 5w = -15794, -2w = -322k + 321k + 15794. What is the ten thousands digit of k? 1 Suppose 0 = 9u - 38 - 16. Suppose uo - 9o + q = -5792, -q = 2. What is the hundreds digit of o? 9 Suppose 0 = -2r - 3n - 3 + 16, r = 3n - 7. Suppose 3a - 78 = rh, -3h + 5h + 3a = -102. Let o = 139 + h. What is the units digit of o? 4 Suppose -564783 = -18q - 72771. What is the tens digit of q? 3 Let y = -1627 - -10571. What is the tens digit of y? 4 Let u be 14/1 + (-39 - -22) + 9. Suppose -4g + 176 = 2o, -4o + 2g + 182 = -2o. Suppose 5b - 135 = s - us, 5b = 4s - o. What is the units digit of s? 5 Suppose -20t = -16t + 12. What is the units digit of (-9)/(-18)(-1326)/t? 1 Let h(n) = -n*3 + 11n*2 + 17n - 30. Let q be h(12). Suppose -25781 = t - qt. What is the units digit of t? 9 Let r = -519 + 532. Suppose -o - 7872 = -ro. What is the tens digit of o? 5 Suppose 0 = -g - 5z + 22846, -10 = -5z - 15. What is the ten thousands digit of g? 2 Let u = 111 - 49. Suppose 12h = -76 + 112. Suppose 4b - u = -hn - 0n, 4b = -n + 10. What is the tens digit of n? 2 Suppose -176k + 2r - 19181 = -179k, -5r + 6411 = k. What is the units digit of k? 1 Let z(f) = 11f + 5. Let r be z(4). Let y = 32 - r. Let p = y + 114. What is the tens digit of p? 9 What is the thousands digit of (-8 + 12 + -3 - 24)-2467? 6 Let y(o) = o3 - 9o*2 - 3o + 24. Let q be y(9). What is the units digit of -12420/(-8) - q/3? 1 Suppose -138v - 309611 = -82676 - 1080051. What is the thousands digit of v? 6 Let o(g) be the third derivative of 3g5/20 + 19g*4/24 + 35g*3/2 + 5g*2 + 9. What is the tens digit of o(-6)? 1 What is the hundreds digit of 7336 - 19/((-190)/100)? 3 Let n = -45031 + 67193. What is the thousands digit of n? 2 What is the tens digit of -54(-25 + 21)/(24/1724)? 1 Suppose -11l + 6l = 4z - 41, 4z - l = 11. Suppose 4v + zo = 336, 4v - 236 = v + 5o. What is the units digit of v? 2 Suppose 4n - 2 = 3n. Let x = 1842 + -1647. Suppose -137 = np - x. What is the units digit of p? 9 Let v(p) = -p3 + 13p*2 + 3p - 29. Let q be v(13). Suppose -5*t + x - 1372 = -q	{ "pile_set_name": "DM Mathematics" }
s in -126h3 - 108h*3 + 37h*3 - 18h*3. -215h*3 Collect the terms in -341w*3 + 170w*3 - 14w + 174w3. 3w*3 - 14w Collect the terms in -8460 - 6m + 347 + 2m. -4m - 8113 Collect the terms in 158h + 87h - 2h - 47h. 196h Collect the terms in -2964q + 993q + 984q + 998q. 11q Collect the terms in 84j*3 - 419j*3 + 84j*3 + 81j*3 + 81j*3 + 91j*3. 2j*3 Collect the terms in 248k*3 - 47k*3 - 65k*3. 136k*3 Collect the terms in 3 + 166g*3 - 168g*3 + 165g - 3. -2g3 + 165g Collect the terms in -107x2 + 157x*2 - 38x*2. 12x*2 Collect the terms in -1113 + 4345 + 5a - 1007 - 1116 - 1109. 5a Collect the terms in w - 836w*2 + 785w*2 - w. -51w*2 Collect the terms in 10 - 10 + 6183s. 6183s Collect the terms in 49t*3 + 65t*3 - 375t*3 - 267t*3. -528t*3 Collect the terms in -4z*2 + 90016 - 90016. -4z*2 Collect the terms in 260i - 135i - 125i - 6i2 + 2i*2. -4i*2 Collect the terms in 3 - 16d + 50d2 + 8d*2 - 4. 58d*2 - 16d - 1 Collect the terms in 5u3 - 16u - u - 13u - 2u. 5u3 - 32u Collect the terms in 532k3 + 324k*2 - 1053k*3 - 46k + 523k3 + 46k. 2k3 + 324k*2 Collect the terms in -3j*2 - 17j*3 - 12j*3 + 8 + 6j*3. -23j*3 - 3j*2 + 8 Collect the terms in 139z + 93532 - 139z + 8z*3 - 93532. 8z*3 Collect the terms in 120u*3 - 188u*3 + 82u*3 - 26 + 26. 14u*3 Collect the terms in 13943w*2 - 6107w*2 + 12879w*2. 20715w*2 Collect the terms in -3i - 3i + 41i - 20i. 15i Collect the terms in -9 - 10 + 14 - 38y. -38y - 5 Collect the terms in -23o + 4o + 7o - 6o + 6o. -12o Collect the terms in 2c2 - 439c*3 - 7c*2 - 7c*2 + 12c*2. -439c*3 Collect the terms in 3f*2 - 1292f*3 + 2264f*3 - 964f*3 - 3f*2. 8f*3 Collect the terms in -6c - 11c - 3c + 5c. -15c Collect the terms in -616h - 3 - 613h - 617h + 1841h. -5h - 3 Collect the terms in 14 - 14 - 229m*2 + 233m*2. 4m*2 Collect the terms in -2294b*3 + 4588b*3 + 555b - 2296b3 - 555b. -2b3 Collect the terms in 1187o + 1418o + 648 - 322 - 10o - 327. 2595o - 1 Collect the terms in 5k + 32k - 50k. -13k Collect the terms in -851o*3 - 854o*3 - 51o + 1704o3. -o3 - 51o Collect the terms in -25 - 4t2 + 2t*2 - 31t*3 + 25. -31t*3 - 2t*2 Collect the terms in 3 + 4 - 24g*3 - 7 + 4g*3. -20g*3 Collect the terms in 71764v - 35883v - 35897v. -16v Collect the terms in 40824r*2 + 28953r*2 - 21709r*2. 48068r*2 Collect the terms in -108x - 48x + 13x - 2x. -145x Collect the terms in 3 - 5 - 4 - 366a + 3. -366a - 3 Collect the terms in 17b + 11b*2 - 16 - 16b*2 - 17b + 3b2. -2b*2 - 16 Collect the terms in 1 + 3t + 67t3 - 3 + 295t*3. 362t*3 + 3t - 2 Collect the terms in 276637 - 15g2 - 276637. -15g*2 Collect the terms in 2d - 6d + 1399 - 442 - 633. -4d + 324 Collect the terms in 1069l2 + 1075l*2 + 6l*3 - 2144l*2. 6l*3 Collect the terms in -802u*3 - 3 - 1 - 10. -802u*3 - 14 Collect the terms in 156m + 1884 - 1884. 156m Collect the terms in 176 - 240 + 4g2 + g2 - 1023. 5g2 - 1087 Collect the terms in 3564o*3 - 338 + 338. 3564o*3 Collect the terms in -1086g + 119 + 541g + g2 + 545g. g*2 + 119 Collect the terms in -35k - 34k + 169k - 38k - 33k - 34k. -5k Collect the terms in 3z2 - 11z*2 + 11z*2 - 25z. 3z2 - 25z Collect the terms in 7 + 2 + 6p3 - 12p*2 + 15p*2 - 9. 6p*3 + 3p*2 Collect the terms in 8 - 136g - 154g - 70g. -360g + 8 Collect the terms in -30m*2 - 33m*2 - 5 + 58m*2 + 7m*2 - 3m + 3m. 2m*2 - 5 Collect the terms in -4265 + 4265 - 36543y*2. -36543y*2 Collect the terms in -12669n*2 - 12675n*2 + 25363n*2. 19n*2 Collect the terms in 361044y - 722103y + 361058y. -y Collect the terms in -255w2 + 506w*2 - 251w*2 + 16088w*3. 16088w*3 Collect the terms in -6944b*2 - 47622b*2 + 5019b*2. -49547b*2 Collect the terms in 0n*2 + 2n*2 + 3n*2 - 6n*2 - 87n + 2n2. n2 - 87n Collect the terms in 416558 + 7h3 - 416558. 7h*3 Collect the terms in -32 - 3m*2 - 15 - 10 + 57. -3m*2 Collect the terms in -17n + 92 - 248 + 127. -17n - 29 Collect the terms in 3k*3 - 46 - 11k*3 + 415k - 414k. -8k*3 + k - 46 Collect the terms in 915f*3 + 21f - 20f + 2565f*3 - f. 3480f*3 Collect the terms in 0g + 9g - 10g - 26g + 29g + g. 3g Collect the terms in 520r - 225r - 281r. 14r Collect the terms in 11783 + 11780 - 23563 + 164q*2. 164q*2 Collect the terms in -345d*2 - 43d*3 + 30 + 345d*2 - 30. -43d3 Collect the terms in o2 + 16740 - 8373 - 8367. o*2 Collect the terms in 5955c*2 + 4875c*2 + 26388c*2. 37218c*2 Collect the terms in -14 + 0 - 2 - 14f + 0f. -14f - 16 Collect the terms in -322c2 - 2c + 149c2 + 154c*2. -19c*2 - 2c Collect the terms in 21578d - 7193d + 5d3 - 7189d - 7196d. 5d*3 Collect the terms in 365062o*3 - 365044o*3 + 462o - 462o. 18o*3 Collect the terms in -242m*2 + 677m*2 - 226m*2 - 214m*2. -5m*2 Collect the terms in -21588v*2 + 13471v*2 - 20764v*2. -28881v*2 Collect the terms in 1213 + 1210 + 2z + 0z - 2423. 2z Collect the terms in -18z3 - 35z*3 - 3 + 98z*3 + 3 - 34z*3. 11z*3 Collect the terms in -4l + 12l + 23l - 7l - 12l. 12l Collect the terms in 0 - 578i + 0 + 824i. 246i Collect the terms in 472c2 - 5 - 179c*2 - 224c*2 + 5. 69c*2 Collect the terms in -3376 + 60p + 1686 + 1690 + 42p. 102p Collect the terms in 2107377x - 1510x*2 - 2107377x. -1510x2 Collect the terms in 3057b + 0 + 2 + 2722b. 5779b + 2 Collect the terms in 155j2 + 6453j*3 - 155j*2. 6453j*3 Collect the terms in 11 + 528h + 10 - 511h + 3 - 22. 17h + 2 Collect the terms in -13i - 3i*2 + 23i + 167 - 10i. -3i*2 + 167 Collect the terms in 518j3 + j2 - 3j2 - 5j*2 + 39j*3. 557j*3 - 7j*2 Collect the terms in -20t*2 - 39959t*3 + 20t*2 + 39999t*3. 40t*3 Collect the terms in -9831p - 9856p + 19734p. 47p Collect the terms in 973t*3 - 1952t*3 + 968t*3. -11t*3 Collect the terms in 2a - 301a2 - 234a*2 - 2a + 47a2. -488a*2 Collect the terms in 7o*2 + 1131 - 2237 + 1106. 7o*2 Collect the terms in -27q*3 + 2q - 5q + 6q*3 - 4q. -21q3 - 7q Collect the terms in -106g - 122g + 323g - 100g. -5g Collect the terms in -354x + 93x + 89x + 87x - x2 + 87x. -x*2 + 2x Collect the terms in -10s - 15 + 8s + 7s + 23. 5s + 8 Collect the terms in -100392z + 101103z - 4 + 4. 711z Collect the terms in 368p + 144p - 483p. 29p Collect the terms in i3 + 6i*3 + 0i*3 - 58i*2 + 2i*3 - 10i3. -i3 - 58i2 Collect the terms in 26 + u2 - 20 - 2u2 - 83. -u2 - 77 Collect the terms in 149097u - 149098u - 3 + 3. -u Collect the terms in -15k + 201k - 19k. 167k Collect the terms in -37t3 - 74t + 74t + 109t*3 - 37t*3 - 33t*3. 2t*3 Collect the terms in -6529v*3 - 1 + v + 4v - 5v. -6529v*3 - 1 Collect the terms in 1307c*3 + 3124c*3 - 669c*3. 3762c*3 Collect the terms in 87213 - p - 87213. -p Collect the terms in -19b + 39b - 4b + 3b2 - b2 - 3b. 2b2 + 13b Collect the terms in 40p - 225276 + 225276. 40p Collect the terms in -128o2 - 171o*2 - 52o*2. -351o*2 Collect the terms in 50953a*2 + 4754a - 50946a2 - 4754a. 7a2 Collect the terms in 259670 + 1643u*2 - 259670. 1643u*2 Collect the terms in 5b*3 - 4b*3 - 2b*2 - 706 + 3b*3 - 2b*3. 2b*3 - 2b*2 - 706 Collect the terms in -40f*3 + 466776f*2 - 2f - 466776f2 + 5. -40f*3 - 2f + 5 Collect the terms in -127v + 127v + 2 - 42v2 - 2. -42v*2 Collect the terms in -11l + 62l + 45l. 96l Collect the terms in -11852g*2 + 92g*3 + 11852g*2. 92g*3 Collect the terms in 213r*2 - 2r*3 - 287r*2 + 3r3 - 12. r3 - 74r2 - 12 Collect the terms in -123m - 94m + 465m - 187m. 61m Collect the terms in -374 + 141 - 3y - 391. -3y - 624 Collect the terms in -93661x3 + 46829x*3 + 46833x*3 - 4x2. x3 - 4x2 Collect the terms in 2432w*2 - 961w*2 + 3 + 6. 1471w**2 + 9 Collect the terms in	{ "pile_set_name": "DM Mathematics" }
s picked without replacement from {q: 1, a: 3, z: 1, m: 1, c: 1}? 1/21 What is prob of picking 1 a and 1 z when two letters picked without replacement from zkzkkkaklaskaklkk? 3/68 Four letters picked without replacement from {r: 10, l: 10}. What is prob of picking 3 l and 1 r? 80/323 What is prob of picking 2 m and 2 w when four letters picked without replacement from {w: 2, r: 5, m: 5}? 2/99 Calculate prob of picking 1 q and 1 e when two letters picked without replacement from oeqeeeeek. 1/6 Two letters picked without replacement from hdrhrrdhhrddhhrrh. Give prob of picking 1 r and 1 h. 21/68 Three letters picked without replacement from {o: 2, r: 2, x: 8, l: 3}. What is prob of picking 3 x? 8/65 Calculate prob of picking 1 c and 1 l when two letters picked without replacement from {l: 3, c: 1}. 1/2 Two letters picked without replacement from mszjsmjossooszjmos. What is prob of picking 1 s and 1 j? 2/17 Two letters picked without replacement from {q: 2, y: 2, w: 5}. What is prob of picking 2 w? 5/18 What is prob of picking 2 e when two letters picked without replacement from {y: 5, a: 5, e: 3}? 1/26 Two letters picked without replacement from {l: 3, h: 9}. Give prob of picking 2 h. 6/11 What is prob of picking 3 o and 1 h when four letters picked without replacement from {b: 2, z: 8, h: 7, o: 3}? 7/4845 What is prob of picking 2 w when two letters picked without replacement from fffww? 1/10 Three letters picked without replacement from {v: 4, z: 2, t: 5, c: 2}. Give prob of picking 1 v, 1 t, and 1 c. 20/143 Calculate prob of picking 2 m when two letters picked without replacement from fmmmmmfmmmfmmmmmmmff. 21/38 Calculate prob of picking 4 p when four letters picked without replacement from ppppppppp. 1 Four letters picked without replacement from {c: 5, t: 3, p: 1}. What is prob of picking 1 p and 3 t? 1/126 What is prob of picking 2 a, 1 z, and 1 w when four letters picked without replacement from awazzzzadazaaa? 15/143 Two letters picked without replacement from {i: 1, j: 1, o: 2}. Give prob of picking 1 i and 1 o. 1/3 Two letters picked without replacement from {k: 5, l: 4, n: 1, w: 3}. What is prob of picking 1 l and 1 w? 2/13 Two letters picked without replacement from nnwnnnnnunnnnnnn. What is prob of picking 2 n? 91/120 Calculate prob of picking 2 a when two letters picked without replacement from {a: 4, f: 2, y: 10, b: 1}. 3/68 Two letters picked without replacement from aaayycay. What is prob of picking 1 y and 1 a? 3/7 Calculate prob of picking 1 i and 1 s when two letters picked without replacement from suyyysiyyyyyyy. 2/91 Three letters picked without replacement from {e: 6, y: 4}. Give prob of picking 1 y and 2 e. 1/2 Four letters picked without replacement from xjaaajjpraaaj. Give prob of picking 1 j, 1 x, 1 p, and 1 a. 24/715 Four letters picked without replacement from {m: 1, x: 4, h: 3, j: 2}. What is prob of picking 1 h and 3 x? 2/35 Three letters picked without replacement from yabia. What is prob of picking 1 y, 1 i, and 1 b? 1/10 What is prob of picking 4 u when four letters picked without replacement from uujiuujuijiui? 3/143 Two letters picked without replacement from {g: 2, w: 6, d: 1, z: 2, t: 1, u: 5}. Give prob of picking 1 w and 1 g. 3/34 Calculate prob of picking 2 a when two letters picked without replacement from aapaaopboapop. 5/39 Three letters picked without replacement from {z: 7, g: 9}. Give prob of picking 3 g. 3/20 Two letters picked without replacement from rrrrhrhr. Give prob of picking 2 r. 15/28 Calculate prob of picking 3 d when three letters picked without replacement from ffddpfpffdfpdddff. 1/34 Three letters picked without replacement from {g: 2, y: 1, p: 1, c: 1, a: 1, i: 2}. What is prob of picking 1 a, 1 y, and 1 p? 1/56 Calculate prob of picking 2 d when two letters picked without replacement from {d: 2, v: 4, a: 4, r: 1}. 1/55 Two letters picked without replacement from {i: 4, o: 2, z: 1, u: 2, j: 5}. Give prob of picking 1 z and 1 j. 5/91 Calculate prob of picking 1 w, 1 t, and 1 c when three letters picked without replacement from {c: 4, t: 6, w: 7}. 21/85 What is prob of picking 1 f and 2 i when three letters picked without replacement from csfisiicsfs? 2/55 What is prob of picking 1 j, 1 w, 1 u, and 1 x when four letters picked without replacement from uwkjknx? 1/35 What is prob of picking 2 e and 1 h when three letters picked without replacement from hhehhee? 12/35 What is prob of picking 1 r and 1 l when two letters picked without replacement from {g: 1, r: 4, l: 10, c: 2}? 5/17 What is prob of picking 1 d and 1 h when two letters picked without replacement from dhhlhzz? 1/7 Calculate prob of picking 2 e when two letters picked without replacement from {e: 11, z: 4, d: 3}. 55/153 What is prob of picking 1 v and 3 a when four letters picked without replacement from vvavvvvvaav? 4/165 What is prob of picking 1 s and 3 w when four letters picked without replacement from mwismsimiwmiiwiiii? 1/1530 Calculate prob of picking 2 r when two letters picked without replacement from {r: 7, p: 1}. 3/4 Calculate prob of picking 1 s and 1 k when two letters picked without replacement from {k: 2, s: 2, a: 5}. 1/9 Three letters picked without replacement from ybyykpbbcbpb. What is prob of picking 1 p and 2 y? 3/110 What is prob of picking 1 r, 1 h, and 1 f when three letters picked without replacement from ffhqrfrfqqh? 16/165 Three letters picked without replacement from ocnpb. What is prob of picking 1 c, 1 o, and 1 b? 1/10 Calculate prob of picking 1 k, 1 m, and 1 q when three letters picked without replacement from {i: 1, k: 1, q: 3, d: 5, p: 4, m: 1}. 3/455 Four letters picked without replacement from {g: 2, w: 6}. What is prob of picking 2 w and 2 g? 3/14 Calculate prob of picking 2 j and 1 w when three letters picked without replacement from {w: 1, j: 2, i: 1, b: 1}. 1/10 What is prob of picking 2 y when two letters picked without replacement from zzyzyzzzz? 1/36 What is prob of picking 1 f and 1 e when two letters picked without replacement from feejcfn? 4/21 What is prob of picking 1 c and 1 x when two letters picked without replacement from xceec? 1/5 Two letters picked without replacement from llallfillliffflali. Give prob of picking 2 l. 4/17 Four letters picked without replacement from {q: 5}. What is prob of picking 4 q? 1 What is prob of picking 2 z, 1 d, and 1 e when four letters picked without replacement from dedpddzzo? 2/63 Calculate prob of picking 2 u when two letters picked without replacement from {q: 4, u: 2, t: 3, f: 3, n: 2, k: 2}. 1/120 Three letters picked without replacement from xyyx. Give prob of picking 1 y and 2 x. 1/2 Two letters picked without replacement from {u: 17, j: 3}. Give prob of picking 1 j and 1 u. 51/190 Two letters picked without replacement from {z: 10, v: 4}. Give prob of picking 2 v. 6/91 Four letters picked without replacement from {y: 8, v: 3, f: 2, b: 6}. What is prob of picking 1 b, 2 f, and 1 v? 3/646 What is prob of picking 1 x and 1 n when two letters picked without replacement from xcxcxxxxnltctt? 6/91 What is prob of picking 1 v and 1 h when two letters picked without replacement from pwwpwhpwpfwvwprrv? 1/68 Four letters picked without replacement from {c: 6, d: 6}. What is prob of picking 1 c and 3 d? 8/33 Two letters picked without replacement from {l: 3, e: 1, x: 3}. Give prob of picking 1 e and 1 x. 1/7 Four letters picked without replacement from eevyekeeygky. What is prob of picking 1 y and 3 e? 2/33 Four letters picked without replacement from {n: 4, p: 14}. Give prob of picking 3 p and 1 n. 364/765 Two letters picked without replacement from wwawwaawawwaaawaaw. What is prob of picking 2 w? 4/17 Three letters picked without replacement from qqqqpqiqqqpqpqiigqpp. What is prob of picking 1 q, 1 p, and 1 g? 11/228 Calculate prob of picking 1 i and 3 c when four letters picked without replacement from {b: 1, w: 2, i: 1, c: 9}. 84/715 Two letters picked without replacement from {g: 1, s: 2, c: 3, o: 1}. What is prob of picking 2 s? 1/21 What is prob of picking 1 g and 2 l when three letters picked without replacement from llorollolooglllo? 1/20 What is prob of picking 2 t and 1 r when three letters picked without replacement from {s: 1, r	{ "pile_set_name": "DM Mathematics" }
Let r = t - 0.7. Let m = -3 + 3.3. What is the third biggest value in r, -2/3, m? -2/3 Let s = -6.237 + -0.063. Let p = 0.7 - s. Let c = 6.5 - p. What is the third smallest value in 4/5, c, -5? 4/5 Let p = -21 - -19. Which is the third smallest value? (a) 2 (b) -2/19 (c) p a Suppose 2i - 10i = -32. What is the second smallest value in -2, -0.09, i? -0.09 Let r = 55.4 - 51. Let u = r + -0.4. Which is the second smallest value? (a) 5/6 (b) -3 (c) u a Let f = -0.5 - -0.1. Let q = 6.84 - -0.16. Let p = q + -6.8. What is the second biggest value in p, f, -3/5? f Let b = -22 + 27. Suppose 2i + 18 = -4m + 5m, 0 = -m - 5i - 17. What is the smallest value in -2/5, b, m? -2/5 Let c = 1 - 1. Suppose -2u - 4a + 20 = c, a - 64 = -5u - 2a. Let b be u/(-40) + 2/(-8). What is the biggest value in b, 5/2, -5? 5/2 Let d = -3 - -2. Which is the second smallest value? (a) -2/7 (b) 0.4 (c) d a Let r = -3 + 3. Let p = 5 - 4. What is the third biggest value in -1, p, r? -1 Let w = 4 - 6. Let p = -1.5 - w. Let x = 2 - 6. What is the biggest value in x, p, 1/6? p Let s = 2.5 - 2.2. Which is the smallest value? (a) 8 (b) s (c) -5 c Suppose 159 + 114 = -3i. Let g = -453/5 - i. Which is the smallest value? (a) 4/5 (b) -1/2 (c) g b Let t(q) = q + 1. Let k be t(-5). Which is the second smallest value? (a) 0.4 (b) -1/12 (c) k b Let z(g) = g3 + 7g*2 + 3g. Let q be z(-5). Let d be ((-28)/q)/(2/5). What is the second biggest value in -1, d, -2/11? -1 Let w = 2.1 + -13.1. Let d = w + 16. What is the third biggest value in d, 2/21, 2? 2/21 Let o = 3.4 - -0.8. Let n = -0.2 + o. Which is the second smallest value? (a) 1/6 (b) 1/5 (c) n b Let z = -145 - -142. What is the second smallest value in -7, 4, z? z Suppose 5x - 111 = 3p, -2p + 6p = -5x + 97. Let a be (-4)/(-14)x/(-27). What is the second biggest value in 2, a, 1? 1 Suppose -m - 10 = -6m. Suppose 0 = -0q - mq - 2. Which is the third smallest value? (a) q (b) -1/9 (c) 0.2 c Let k = 8.9 - 9.2. Which is the fourth biggest value? (a) 1 (b) -2 (c) k (d) -4 d Let d = -11 + 6. Which is the second biggest value? (a) d (b) 2 (c) -2 c Suppose -24 + 2 = v - 2p, -25 = v - p. Let i be (4/v)/(12/(-14)). Which is the third biggest value? (a) 1 (b) i (c) -2/5 c Let z = 1.15 + -0.05. Let f = z - 1.6. Which is the third smallest value? (a) -0.4 (b) 4/5 (c) f b Let q = 60 - 63. Which is the second biggest value? (a) q (b) -7 (c) 1/4 a Let u = 3.1 - 3. Let l = -3.1 + u. Let v = 4 - -1. Which is the second smallest value? (a) l (b) v (c) 0.3 c Suppose 6x + 59 = -7. What is the biggest value in -0.4, 5, x? 5 Let z = 3.7 - 3.2. Let x = -2/455 + 473/4095. Let r = -11 + 7. Which is the smallest value? (a) r (b) z (c) x a Let l = 214 + -219. Suppose -u - 3u - 12 = 0. Which is the third biggest value? (a) u (b) 1 (c) l c Let b = 84.1 + -84. What is the smallest value in 1, -0.3, b, 7? -0.3 Let s = 0.17 + -10.17. Let i = s - -6. What is the smallest value in i, -0.4, 0.5? i Let l = 34 + -135/4. What is the fourth biggest value in l, 19, 0.5, -2? -2 Let n = 0.08 + -5.08. Let b = 2 + n. What is the third biggest value in 4, -1, b? b Let p(z) = -z + 12. Let n be p(7). Which is the smallest value? (a) -1 (b) n (c) -0.2 a Let v(m) = 9m - 22. Let p be v(2). What is the smallest value in -0.7, p, -1? p Let d(q) = q3 + 3q*2 + q + 4. Let s be d(-6). Let p be 4/s1-5. Which is the biggest value? (a) -1 (b) -0.2 (c) p c Let u = 23.6 - 27. Let p = 1.4 + u. Let t = -4 - -14/3. What is the third biggest value in t, -5, p? -5 Let j = -4 + 4.1. Let a = 0.1 - j. Let u = 4 - a. What is the biggest value in 2/5, 5, u? 5 Let u = -18 - -20. Let h be u/10 - (-57)/15. Which is the second biggest value? (a) 3/2 (b) h (c) 0.2 a Let h = 3.55 - -2.69. Let y = h + -6. Let l = -0.04 + y. What is the third biggest value in l, 4, 1/9? 1/9 Let h = -0.57 + 0.27. Which is the third smallest value? (a) h (b) 5/7 (c) 3/2 c Let f = 1019/2496 - 13/64. Let b = -196/195 + f. What is the third biggest value in -4, b, -3? -4 Let m be -4 + 4 - 1 - -3. Let v = 7 + -3. Which is the smallest value? (a) m (b) v (c) -2/3 c Let k = -144 + 143. What is the fourth smallest value in 2/3, k, 1/5, -0.3? 2/3 Let j be 1/((-3)/(-4)) - 1. Let r = 1135 + -5699/5. Let i = 62/15 + r. What is the biggest value in j, 3, i? 3 Let d = 5.5 + 1.5. Let h = -3 + d. Let j = h + -4.4. Which is the smallest value? (a) -3 (b) 2/7 (c) j a Let w = 6 + -5.94. Let h = 10 - 10. What is the biggest value in -4, w, h? w Let y = -3 + 5. What is the second biggest value in 0, -5, y? 0 Let f be 9 - 31/3. Let x = 12 - f. Suppose -3g + 3y + 0y = 0, -xg + 2y = 0. Which is the third smallest value? (a) 2/7 (b) -4 (c) g a Let g = -3 + 3.2. Suppose z = 5u + 139, -4z + u = -0u - 518. Let l = z + -1159/9. Which is the smallest value? (a) l (b) g (c) -5 c Let n = 0.5 + 0. Let f = 2.4 - 5.4. What is the second smallest value in n, f, -0.1? -0.1 Suppose 0 = -5u - 3s - 40, -u + 5s = 3u + 32. Let l be 30/(-45)(-3)/u. Which is the second smallest value? (a) l (b) -3 (c) 1 a Let m = -1 + -2. Which is the smallest value? (a) m (b) 4 (c) 1/4 a Let i = 5 - 6. Which is the third biggest value? (a) 4 (b) 5 (c) i c Let n = 668/5 + -134. What is the biggest value in n, -20, -1/2? n Let h = 0.1 + 0. Let u = -8 - -12. Which is the smallest value? (a) 0.2 (b) h (c) u b Let b = -0.1 + -0.9. Let i = -5.3 + 0.3. Let w = 2 + -1. What is the third biggest value in i, w, b? i Let l = 49 - 44. Let n be (2/3)/(1 + 4). Which is the second biggest value? (a) n (b) -1 (c) l a Let q be (-6)/10 + 104/240 + 1. Which is the biggest value? (a) -1/2 (b) q (c) -4/3 b Let y = -11 + 8. Let f = 280.2 + -280. Which is the biggest value? (a) f (b) y (c) -2/9 a Let k be -1(3 - 3 - -1)7. Which is the third biggest value? (a) k (b) -2/3 (c) 0 a Let t be (-5)/(-5) - 35/25. What is the second smallest value in t, -1, -5? -1 Let d = 17.1 - 17. Let h(k) = k3 - 9k*2 - 2k + 13. Let x be h(9). What is the biggest value in x, -4/3, d? d Let x = -93/13 + 7. What is the second biggest value in 0, x, 0.1, 5/4? 0.1 Let u be 3/604 - 22/60. What is the third biggest value in u, -0.5, -19? -19 Let o = -94 + 90.05. Let m = -0.05 + o. What is the second biggest value in 0.2, -1/11, m? -1/11 Suppose 10c + 2c + 24 = 0. What is the third smallest value in -1, 0.4, c? 0.4 Let n = 21/50 + 2/25. Let f = 9 - 9. What is the second smallest value in f, -0.5, n? f Let t = -53/168 + 4/21. Let j be -12(-4)/63 + -3. Let s = 18/7 + j. What is the biggest value in 1/5, t, s? s Suppose 4i - i + 126 = 0. Let r be (-1)/(-14) + (-18)/i. What is the second biggest value in -4, r, 0.4? 0.4 Let z = 6 + -3. Suppose 3g + g = 3k - 5, zk = -5g - 13. What is the second biggest value in g, 5, 1/2? 1/2 Let x be (-116)/203 - (-4)/(-14). Let l(w) = w + 1. Let v be l(-1). Which is the second smallest value? (a) x (b) 1 (c) v c Suppose i + 2c - 5 = 0, 5c - 13 = -3. Let v(f) = 6f - 1. Let r be v(i). Let o = 0.1 + 0. What is the third biggest value in 0.4, r, o? o Let x = -64.5 - -64. What is the fourth biggest value in 2/11, x, 0, 3? x Let i(x) = 12x - 1. Let s(o) = -o2 + 6o - 1. Let l be s(6). Let g be i(l). Let r = 9 + g. What is the biggest value in -3, -1/4, r? -1/4 Let b = -99 - -395/4. What is the third biggest value in -1, b, -1/8, -2/7? -2/7 Let c = -1.6 + 1.6. What is the second smallest value in 0.5, -5, c? c Let r = 318/299 + -28/23. Which is the second biggest value? (a) r (b) 2/5 (c) 2 b Let k = -7.9 - -0.9. Let a = 6.6 + k. What is the third biggest value in a, -2/9, 2/7? a Let m = -4 + 4.4. Let j = 0 + m. Let q = 148.1 - 148. Which is the second biggest value? (a) j (b) q (c) 1/6 c Let i = 0.1 + -2.1. Let m = i - -1.9. Which is the smallest value? (a) -2 (b) 3 (c) m a Let z = -0.28 - 4.72. What is the smallest value in 1, z, 6? z Let i = 40 + -39.5. Which is the third biggest value? (a) 0.1 (b) i (c) -0.01 c Let y = -0.5 + -2.5. Which is the smallest value? (a) y (b) -1/2 (c) -4 c Let m = 0.5 - 0.1. Let v be (-5)/110*-4 + (-36)/77. Let t = 116 - 810/7. What is the third biggest value in t, m, v? v Let r = 12 + -17. Let b = 22.1 -	{ "pile_set_name": "DM Mathematics" }
ve ay - f + 21 - n = 0, 10 = -4y - 3f for y. -4 Let p(l) = 9l - 79. Let s be p(7). Let z(v) = 4v + 89. Let d be z(s). Solve i + 15 = -2i - m, 4m = -5i - d for i. -5 Let a = 18973 + -18972. Solve -2r - 6 = 10y - 6y, 0 = -y + a for r. -5 Suppose -864 = 11f - 919. Solve u = fk - 17, -2k + 1 + 5 = 0 for u. -2 Suppose 0 = 4u - 5r - 25, 6r + 20 = 2u + 2r. Let m = 12 - 8. Suppose -mq = 2q - uq. Solve -2f + 4k - k - 6 = q, -4f - 2k = -4 for f. 0 Suppose 2p + 3b - 29 = 0, 3b + 9 = -p + 31. Let c = -4 + 6. Solve -2 = 5x - p, -c = -m - 5x for m. -3 Suppose 0 = -2y, 5a + 500 = 3a + 4y. Let g = a + 253. Solve -2t - gl = 10, -2t - 25 = 3t + 3l for t. -5 Let m be (-3)/(-1)40/6. Let w be (14 + -19)-324/15. Let v = w - m. Solve 21 - 5 = -vf, 2r = -2f - 6 for r. 1 Suppose 4 = -2d - 5l, -139d + 135d + 44 = -3l. Let z = -7 - -11. Let r be 2/(-9) - 94/(-18). Solve 3m - n - z = -rn, -d = 5m + 3n for m. -4 Let j(b) = -b3 - 8b*2 + 14b + 48. Let q be j(-9). Let v be (-65)/26(-8)/10. Suppose -p = p - v. Solve -20 = -f - 4m, 5f - p = qm - 16 for f. 0 Let u(g) = 48g + 1010. Let x be u(-21). Solve 4c = -11p + 8p - 22, -4c - 20 = xp for p. -2 Suppose -59 = -5d - g, 2d + 8g - 38 = 4g. Let y be 6(-9)/81 - d/(-3). Solve u = -o + 3 - 0, o + 2u = y for o. 3 Let r be (-2 - -31/(-6))-2. Suppose -3b = -rd - 0b + 405, 287 = 4d + 5b. Let w = 81 - d. Solve -10 - 3 = -2c + 3f, -wf - 15 = 0 for c. -1 Let o be -2 + (2 + -1)5. Suppose -15d + 9030 = -0d. Let k = 607 - d. Solve -of + 4f - 8 = kb, f - 2b = 5 for f. 3 Let a(g) = 60g*2 + 663g + 35. Let d be a(-11). Solve 2b + 12 = -0n - dn, 5b + 29 = -4n for b. -5 Let i(j) be the second derivative of -j4/12 - 23j*3/6 - 19j*2/2 - 44j. Let z be i(-22). Solve 4h + zr = 0, -h - r = -2h for h. 0 Suppose -31c + 12 = 4g - 27c, 5c = 2g + 1. Solve 0 = 2k + t + 2, 4k - 5 = 3k - gt for k. -3 Let c = 13 + -9. Suppose 4y - l = 4l + 17, -y + 5l = 7. Let q(i) = i2 - 6i - 12. Let o be q(y). Solve 0 = ok - 2x + 4x - 2, -4 = -4k - cx for k. 0 Suppose z - 2 = 2. Let j = -33740 + 33742. Solve 0 = -2h + b - 2, zb + 5 = -jh - 3h for h. -1 Suppose -r + n = 13, 3r + 5n - 2n + 69 = 0. Let x be 6 + -1 - (r - -19). Solve p + 1 + 0 = -l, 0 = 3l + xp + 3 for l. -1 Suppose -4c - 418 = -942. Let k be c + -131 - (1 - 0)/(-1). Solve -3f - 2f + 4t = -1, -2t = -3f - k for f. -3 Let v = -2 - 2. Let n be v/(-14) + (-4)/14. Suppose -14 = -2i, -877j + 875j = -3i + 13. Solve 0 = d, jd + n - 6 = 2b for b. -3 Suppose -b + 5b - 12 = 0. Let l be 4 + -172 + (1 - (-15)/(-3)). Let m = l - -172. Solve -3s + 15 = bi, ms - 4s + 12 = 0 for i. 2 Let o = -2777 - -2781. Solve -3x = -x + ok - 6, 0 = 3k - 3 for x. 1 Let r be ((-1)/2 + (-40)/(-48))/(1/54). Solve 2b = i + 4, 19b = i + rb for i. 4 Let n = -5417 + 5457. Solve 5g - n = 5x, 2x + 30 - 2 = 4g for g. 6 Let n = -3 - -21. Suppose 8 - 26 = -nk. Solve -2y = 4s + 6, 3y = s - k + 13 for y. 3 Let q = -37 + 52. Suppose 6p - 7p = 3d - q, 5p - 31 = -4d. Solve -2w + ph = h + 12, 14 = -4w - h for w. -4 Let j(v) = 3v*2 + 6v - 9. Let u be j(2). Suppose -a + 11 = 4t, -a = -ut + 13t + 1. Solve 2w - 3q = -20, -2q + 8 = -aw - 3q for w. -4 Let t(i) = -i - 3. Let o be ((-19)/(-38))/((-2)/24). Let r be t(o). Solve rn + 17 = 2f - 5, 5f - 17 = -2n for n. -4 Suppose -7g - 3 = -8g, 0 = -3v - 5g + 33. Solve 2j + v = -4o, 5o + 3j = 1 - 7 for o. -3 Suppose 208 + 16 = 112k. Solve 3w = n - 0 - k, 2w - n + 1 = 0 for w. -1 Let b = -163 - -187. Suppose -6o + 0 + b = 0. Solve 2i + 8 = -3h + i, -5h = -oi - 15 for h. -1 Suppose -5 = 3o - 11. Suppose 51d = -15d + 156 + 108. Solve -ow - 26 = 4z + 3w, dz - 2w = -12 for z. -4 Let t be -1 + (-6)/(-6) + 4. Suppose -a = -2c - 5, 0 = ta - 0a - 2c - 14. Solve -z - 3 = -ax, 6z = 3z + x - 9 for z. -3 Let z(r) = -33r*2 - 4r + 24. Let x be z(0). Solve -2y = 2p + 18 - x, 0 = -3y - 2p + 6 for y. 0 Suppose -3r + 12 = -a + 23, 4r + 8 = 0. Solve 22l = 21l + 7, al - 34 = -x for x. -1 Let u be -12((-8)/10)/(66/110). Solve 2f + 1 = -h, h + u = f + 12 for h. -3 Suppose 0 = -144w + 9289 + 4535. Solve 3z + v + 113 - w = 0, 5z = 4v for z. -4 Let n = -1849 - -1851. Solve 5d - 4o = 2, o + n = d + d for d. 2 Suppose 367 + 1983 = 94t. Solve 0 = 27l - tl - 10, -l - 5 = 2m for m. -5 Let m(u) = -5u + 24. Suppose 17k = 12k + 10. Let c be m(k). Solve -4w - 3r - 1 + c = 0, -11 = -5w - 2r for w. 1 Suppose 0 = -w - 2 - 6. Let x be (-4 + (-5 - w))/(1/(-1)). Suppose -4z = -2q - 8, 7 + x = 4z - q. Solve -2k + 35 = 3k + 2y, zk - 3y + 5 = 0 for k. 5 Let m be (-6)/(-4) + 385/70. Suppose 4s = ms - 111. Solve -3g + 21 = 3t, -5g - 14 + s = t for t. 3 Suppose -4 = -2l - 0. Suppose -lr = 3r - 95. Let o(u) = -2u + 42. Let f be o(r). Solve 3y + 4 = 4h, y = -0y + fh - 4 for y. 0 Suppose -5u + 0u + 5 = 0. Suppose -2k = 3d + 9, 5k - 149 = -d - 152. Let b be -4 + u + 21 + d. Solve 0 = -5o - 15, 3f - o - 2o = b for f. 2 Let h be ((-85)/3 - -9)/(2/(-3)). Solve 3w - 3t - 29 = -32, w - h = -5t for w. 4 Let u be 37/6 + -2 - (-644)/(-552). Solve 10 = -2f, -uf - 21 = -2v - 0f for v. 3 Let c = 2 - 0. Suppose -t + 263 = 3g - 5t, -g = 4t - 77. Let q = 87 - g. Solve -ci = -2v - 0i, 0 = -qi + 6 for v. 3 Suppose -204h + 208h - 21 = -5f, -2f + 5h + 15 = 0. Solve 24 = fz + 4g, -44 + 35 = -z - 5g for z. 4 Suppose -120 = 11926c - 11930c. Let a(t) = t - 3. Let s be a(8). Solve -4x + v + 10 = c, 0 = -x - sv - 5 for x. -5 Let v = 71 - 67. Suppose -19k = -17k + i - 56, -vi = k - 28. Solve -s - m - 6 = 0, 5s + 0m + k = -3m for s. -5 Let d be (-216)/(-81)(-54)/(-4). Suppose -12u + du = 0. Solve uw - 2w + 12 = 5x, -8 = -3x - w for x. 4 Let x(o) = -o*3 + 44o*2 + 50o - 225. Let i be x(45). Solve i = -4c + 2q - 6, -5c + 15 = -6c - 4q for c. -3 Let r = 159 - 157. Let y(h) = -5h + 3 + h*3 + 0h + 4h. Let a be y(0). Solve -5 = -5p - rf + af, f = -4p + 4 for p. 1 Let q be 1 + (108/(-108))/(0 - -1). Solve q = -3j + 5m, 12 = j + 5m - 8 for j. 5 Let d = -8000 + 8008. Solve 0 = 5l - 9l - d, 0 = -3p + 3l + 21 for p. 5 Suppose 0u + 49 = -5a + u, 3a = 4u - 43. Let n(w) = -2w - 9. Let m be n(a). Let h(d) = -3d + 40. Let g be h(m). Solve 7k - g = 3k - 5v, 20 = 4v for k. -3 Let z be ((-9)/6)/((-33)/24 + 1). Let y be 7 + z/(-2) + 0. Let t(j) = -j*3 - 5j*2 + 5j - 2. Let c be t(-6). Solve 1 = cb - p + y, 0 = -b + p - 1 for b. -1 Let l(s) = 3s*2 + 3s*2 + 9 + 12s - 8s2 - 5s. Let k be l(4). Solve -17 = ky - 4g, -y - 5g + 14 = -0y for y. -1 Suppose -3243d + 3219d + 27 = -21. Solve 2t - 5w - 28 = 0, -w + 2 - 14 = -dt for t. 4 Suppose 5t + y = 9, -34t + 13 = -29t - 3y. Solve 20 = 2n + tn - 2l, 0 = 2n - 4l - 22 for n. 3 Let x = 3934 + -3917. Solve 0 = 2t - 3w - 9 + x, 0 = 2t + 4w - 6 for t. -1 Let r(z) = z*3 + 6z*2 + 13z + 22. Let s be r(-4). Solve -4f - 17 = 5w, -5f - 118 = -sw - 138 for w. -5 Let s(o) = o*3 - 66o*2 + 64o + 70. Let g be s(65). Solve -5w + 4y + 23 = 0, w - 53y + g = -57y for w. 3 Let g be (-8)/(-3)48/32. Suppose -s - 1 - 4 = z, -gz - 5s = 23. Let u be -10(z + (0 + 2)/2). Solve -2k + u = -4x + 38, 2x = 10 for k. -4 Suppose -26v + 7 = -45. Solve t = vh - 3, 9t + 4h = 7t - 6 for t. -3 Suppose 75n - 12n = -n + 384. Solve w - 6 = -4q, 141w = 139w - 5q + n for w. -2 Let j = -396 - -409. Suppose 0f + j = -f - 4u, -20 = 5u. Solve 0i + fi + 35 = -5p, 4i + 16 = p for p. -4 Suppose 0w + w + 55 = 2t, 4t = 3w + 105. Suppose tq = 20q + 40. Let s(l) = 3l*2 - 1. Let z be s(1). Solve -qp = -c - 17, -5c - p = zp + 16 for c. -5 Let d = -4455 + 4460. Solve w + 13 = ds, -9 + 8 = -s + w for s. 3 Let s = -283 + 303. Let j(v) = v - 14. Let h be j(s). Solve 0 = p + y + h, -2y + 3y = 3p + 2 for p. -2 Let d be 3630/429 - 6/13. Solve 3k + p + 18 = 0, 67p + d = -5k + 69p for k. -4 Let k = -42510 + 42535. Let h(i) = -i*3 - 6i*2. Let l be h(-6). Solve 0 = -m - 5u - k, -9 = m - lm + u for m. -5 Suppose 6b = 1244 + 208. Let d = 244 - b. Solve 2*z + 8 = q, -z - 2 - d = 0 for q. 0 Suppose 5	{ "pile_set_name": "DM Mathematics" }
/210 - 7q6/90 - 2q*5/5 + 37q*3/6 + 4q*2 + 10. Let s(a) be the first derivative of x(a). Solve s(r) = 0. -4, -3, 0 Let r(l) be the second derivative of 2l*6/45 + 2l*5/9 - 65l*4/27 + 160l*3/27 - 56l*2/9 + 2l + 324. Let r(f) = 0. Calculate f. -7, 2/3, 1, 2 Suppose 16x = 629x + 354x - 2901. Factor 3/5q*5 + 0 - 21/5q*2 + 27/5q*3 - xq*4 + 6/5q. 3q(q - 2)(q - 1)3/5 Let q(v) be the third derivative of v6/50 + 43v*5/150 + 23v*4/30 - 19v*3/3 + 2772v2. Suppose q(y) = 0. What is y? -5, -19/6, 1 Let b(x) = x2 + 1. Let m(d) = 9d2 - 3936d + 1936519. Let j(u) = 14b(u) - 2m(u). Determine c so that j(c) = 0. 984 Let z(m) = 2m2 - 28m + 82. Let t be z(4). Let i(b) be the first derivative of 10 + 0b + 2/39b*3 + 4/13b*t. Factor i(o). 2o(o + 4)/13 Let n(o) be the third derivative of -18o*4 + 8o*2 - 56/3o*3 + 0o + 2/35o7 - 4/15o*6 + 1 - 5o5. Let n(a) = 0. What is a? -2, -1/3, 7 Let r(u) be the third derivative of -u7/210 - 89u6/120 - 1739u*5/60 + 11045u*4/24 + 2u*2 + 435u. Determine k, given that r(k) = 0. -47, 0, 5 Let n be (-12)/(-10)400/15. Let j = n + -28. Factor -3m*j + 24m*3 - 30m*3 - 6m*4 - 3m*5. -3m*3(m + 1)(m + 2) Let h(s) = 19s - 5. Let y be h(7). Suppose 8k - 16k + y = 0. Factor -4z2 + 14z + 18z - k - 13z*2 + 5z*2. -4(z - 2)(3z - 2) Let q be 0 + (126/(-26) - 46/299). Let m(x) = -24x3 - 42x*2 - 26x - 2. Let p(g) = 23g3 + 42g*2 + 27g + 3. Let r(c) = qm(c) - 6p(c). Factor r(i). -2(i + 1)(3i + 2)2 Find o, given that -1183 + 2889 - 902 + 732o + 4o2 + 76o = 0. -201, -1 Suppose -75f = 206f + 137f + 112f. Find p, given that 2/13p3 - 18/13p*2 + f + 16/13p = 0. 0, 1, 8 Let i(c) = -2c3 + 4c*2 + 2c - 4. Let h = -2 + 10. Suppose -9m - h = -7m. Let q(w) = w*3 - 4w*2 - w + 4. Let l(r) = mi(r) - 6q(r). Factor l(n). 2(n - 1)(n + 1)(n + 4) Let o = 2/1817 + 1813/3634. Let s(c) be the second derivative of 0 - 1/4c5 + 5/6c*3 + 0c*2 + oc*6 + 4c - 5/4c4. Factor s(x). 5x(x - 1)(x + 1)(3x - 1) Suppose r + y + 2 = 0, -19r + 17r + 3y + 26 = 0. Let b(c) be the second derivative of 1/2c*3 - 1/48c*4 + 0 + rc - 9/2c2. Factor b(s). -(s - 6)2/4 Let u(m) = 5m + 104. Let n be u(-18). Find l, given that -9 + 50l - 5l*2 - 62 + 40 - n = 0. 1, 9 Let w(k) be the third derivative of -147k*5/20 + 287k*4 - 13448k*3/3 + 8997k*2. Factor w(s). -(21s - 164)*2 Let t(h) be the second derivative of 8/35h*5 + 12/7h*2 + 92/21h*4 - 40h - 95/21h3 + 1. Factor t(c). 2(c + 12)(4c - 1)*2/7 Suppose -5o = z - 2z + 59, 4o = -z + 14. Suppose 20r - 34 = -z. Suppose 1/9k*3 + 0k - 2/9k2 + r = 0. Calculate k. 0, 2 Suppose 4m + 20 = 2a - a, 0 = 4a - 3m - 80. Let q be 3 + (-65)/25 - (-32)/a. Factor -16/3j*q - 2j + 0 - 4j3 + 2/3j*5 + 0j*4. 2j(j - 3)(j + 1)*3/3 Let l be 201/315 - (-1077)/(-16155). Solve -74/7y*3 + 24/7y*4 + ly*2 + 0 + 6/7y = 0 for y. -1/4, 0, 1/3, 3 Solve -17/3i2 + 22/3 - 185/3i = 0. -11, 2/17 Find c such that -c*2 - 36691c - 450 + 73389c - 36793c = 0. -90, -5 Find d such that 5d5 + 69d - 8d4 + 19d*2 + 5d*3 - 2d*5 - 29d*3 + 11d*2 + 30 - 4d4 = 0. -1, 2, 5 Let i(f) be the second derivative of f6/140 + 89f5/140 - 45f*4/56 - 85f*2 + 9f - 5. Let a(z) be the first derivative of i(z). Factor a(s). 3s(s + 45)(2s - 1)/7 Let t = -178259/20 + 8913. Let w(k) be the first derivative of -3/8k4 + 11 - 3/2k*2 + k + 13/12k*3 + tk5. Factor w(h). (h - 2)2(h - 1)2/4 Let w(d) be the first derivative of 22d*5/45 + 125d*4/18 + 286d*3/9 + 415d*2/9 + 200d/9 + 1611. Suppose w(s) = 0. Calculate s. -5, -1, -4/11 Let u(c) = 19c2 - 1076c + 1105. Let m(z) = 22z2 - 1074z + 1108. Let g(s) = -6m(s) + 7u(s). Suppose g(j) = 0. What is j? 1, 1087 Let z(f) be the third derivative of f*7/105 - 9f*6/20 + 11f*5/5 + 38f*4/3 - 64f3 - f2 + 450f. Find w, given that z(w) = 0. -2, 1, 4, 24 Let p(k) be the second derivative of 1/100k*5 + 7/6k*3 - 11/5k*2 + 128k + 0 - 7/30k4. Solve p(o) = 0. 1, 2, 11 Let w(g) = -2g3 - g2 - 27g. Let c(j) = 3j*3 + 369j*2 + 108j. Let k(b) = -c(b) - 4w(b). Factor k(q). 5q*2(q - 73) Let x(z) = 7z2 - 22z + 18. Let j(p) = 61p2 - 176p + 145. Let m(l) = 6j(l) - 51x(l). Find o such that m(o) = 0. -8, 2/3 Factor 0m + 0 - 29/4m*3 - 15/2m*4 - 1/4m*5 + 0m2. -m3(m + 1)(m + 29)/4 Suppose -5k + 20 = -10k - q, 3k = q - 20. Let m be (1 - 37/k) + 0. Let -mh*2 + 27/5h*4 + 72/5h*3 - 48/5h - 9/5 = 0. What is h? -3, -1/3, 1 Let f(u) be the first derivative of -u*3/6 - 377u*2 - 284258u + 1317. Factor f(z). -(z + 754)*2/2 Let j(f) be the second derivative of -7/39f*3 - 29 - 8/13f*2 + f + 1/78f*4. Factor j(h). 2(h - 8)(h + 1)/13 Let p = 20863 - 834519/40. Let z(o) be the third derivative of -7/20o*5 + 7/4o*4 + 0o + po6 + 0 - 4o*3 - 47o*2. Determine k so that z(k) = 0. 1, 2, 4 Let b(n) be the second derivative of 56n - 2n3 + 5/6n*4 + 1/10n*5 + 0n*2 - 1. Factor b(f). 2f(f - 1)(f + 6) Let v(w) be the second derivative of 90w + 1/30w6 - w2 + 1/12w4 + 0 - 1/2w*3 + 3/20w*5. Factor v(h). (h - 1)(h + 1)*2(h + 2) Let p(d) = -3d2 - 15d - 10. Let u be p(-4). Factor 82zu + 7z*4 - 60 - 37z + 72z2 + 5z*2 + 34 - 103z*3. (z - 13)(z - 1)*2(7z + 2) Let z(v) be the first derivative of 25v*6/2 - 782v*5 + 51215v*4/4 - 6500v*3/3 - 1690v2 - 1154. Let z(d) = 0. Calculate d. -1/5, 0, 1/3, 26 Let x(l) be the third derivative of l5/75 + 28l4/5 - 33l*2 + 10. Factor x(o). 4o(o + 168)/5 Factor 0 + 0j + 2/3j4 - 98/3j*3 + 196j*2. 2j*2(j - 42)(j - 7)/3 Let k(m) = 24m*3 - 2m*2 - 4m + 1. Let y be k(-1). Let r be (y/63)/(6/(-54)). Determine u, given that -1/6ur + 2/3u*2 - 1/2u + 0 = 0. 0, 1, 3 Let t(o) be the third derivative of -1/840o8 + 1/150o*6 - 20o*2 + 1/75o*7 - 7/75o*5 - o + 0 - 1/60o*4 + 7/15o*3. Find b such that t(b) = 0. -1, 1, 7 Let m = 5304 - 37122/7. Let r(f) be the second derivative of -6f*4 + mf*7 - 4f*2 + 4/5f*5 + 8/3f*6 + 0 + 23f - 26/3f3. Factor r(z). 4(z - 1)(z + 1)3(9z + 2) What is r in -1104r*2 - 92/11r*4 - 3168r - 2/11r5 + 0 - 1586/11r3 = 0? -12, -11, 0 Let h(q) = q3 + 32q2 + 59q - 27. Let o be h(-30). Let -4s4 + 100 - 132s - 11546s3 - 164s + 288s2 + 11458s*o = 0. What is s? -25, 1 Let -8/3v + 0 - 50/3v2 + 11/3v*4 - 31/3v*3 = 0. What is v? -1, -2/11, 0, 4 Let 0 - 472/15x*3 + 746/15x*2 - 26/15x*4 - 84/5x + 4/15x5 = 0. What is x? -9, 0, 1/2, 1, 14 What is i in 56i - 10i + 16i - 33i + 3i*2 + 22i - 414 = 0? -23, 6 Let o = -226670 - -2493372/11. Suppose 8/11n + on*2 + 6/11 = 0. Calculate n. -3, -1 Let i be (-5(-7)/(-70))/(2/(-68)). Let n(j) = -11j3 + 11j*2 - 29j - 17. Let m(q) = -4q3 + 4q*2 - 10q - 6. Let c(o) = im(o) - 6n(o). Factor c(s). -2s(s - 2)(s + 1) Solve -4280i - 1173i3 + 3300i*3 + 2497i*3 - 4290i*2 - 344i*3 + 5i*4 + 4285 = 0. -857, -1, 1 Let m(z) be the second derivative of 3z*6/10 + 57z*5/20 - 163z*4/2 + 464z*3 - 720z*2 - 9z - 76. What is k in m(k) = 0? -15, 2/3, 4 Suppose -5j + 5o = 10o + 710, 3j = 2o - 441. Let z = j - -148. Determine k, given that -18/5k + 18/5kz - 8/5k*4 + 4/5k*2 + 4/5 = 0. -1, 1/4, 1, 2 Solve -2/5x*2 - 966/5x + 0 = 0. -483, 0 Solve 1/5n3 - 212/5n - 10n2 - 216/5 = 0. -2, 54 Let c(u) be the second derivative of 2u + 0u2 - 5/12u*4 - 5u*3 + 12 + 1/6u*6 + 3/2u*5. Factor c(j). 5j(j - 1)(j + 1)(j + 6) Let l(a) = 5a*3 + 233a*2 + 387a - 615. Let m(j) = -70j3 - 3271j*2 - 5414j + 8610. Let z(g) = 29l(g) + 2m(g). Suppose z(s) = 0. Calculate s. -41, -3, 1 Let o(j) be the second derivative of -j*4/42 + 19j*3/21 + 780j*2/7 + 33j + 87. What is b in o(b) = 0? -20, 39 Let t(q) be the first derivative of 13q6/21 - 472q*5/35 - 1355q*4/14 - 4252q*3/21 - 836q*2/7 + 368q/7 + 719. Solve t(p) = 0 for p. -2, -1, 2/13, 23 Let b be -14(-1938)/9310 - (-1 + 30/42). Factor 9/5t*4 + 48/5 - 112/5t + bt2 + 12t*3. (t + 2)(t + 6)*	{ "pile_set_name": "DM Mathematics" }
(b) -1/9 (c) -1/3 (d) f a Let o = -186 + 181. Which is the third biggest value? (a) 17 (b) o (c) 0.29 b Suppose -80s = -75s + 70. Let d be (-2)/5(9 + s). Let i = 2 + -5. What is the second biggest value in i, 4, d, 0.3? d Let w = -408.1 - -411. Let o = 95.9 + -88. Let u = w - o. Which is the third biggest value? (a) -0.3 (b) u (c) 0 b Let h = -204645 - -204644.8. Let z(k) = -4k*3 - 1. Let m be z(1). What is the second smallest value in m, h, -53? m Let d = -0.35 + 2.35. Let b = -1054 - -13704/13. What is the biggest value in 1/4, 5, d, b? 5 Let j = -2.6 + 4. Let z be 1701/2528/9. Which is the fourth biggest value? (a) 1 (b) 5 (c) z (d) j a Let g(l) = 4l - 19. Let v be g(28). Suppose -vz - 376 = -101z. What is the fourth biggest value in -5, 3, z, 4? -5 Let r = 1/148 - 449/740. Suppose -2y = -3b - 8, -47y + 4b + 13 = -42y. What is the biggest value in y, r, 4, -0.1? 4 Let h = 0 - -3. Let x = -6749 + 6751. What is the second smallest value in h, x, -1, 2/35? 2/35 Let d be -2(45/10 - 2). Let n be ((-1)/(-3 + 4))/((-10)/4). Let x = -19 - -18.5. What is the second smallest value in n, x, 4/7, d? x Let t = 916 + -418. Let y = -496 + t. What is the fourth smallest value in 3, -3, -0.1, y? 3 Let w be 1719/(-345) + (-452)/25990. Let k be (-1 - -1) + 6/7. Let p = 3 - -1. Which is the smallest value? (a) k (b) p (c) 2 (d) w d Let m be 19(-8 + -5 + 10). Let t = -53 - m. Let v = 24 - 11. Which is the smallest value? (a) v (b) 0.1 (c) t b Let m be 1005/(-10)(9 + 0 - 15). What is the third smallest value in -2, m, -3? m Let a = 11 - 6. Let x = 0.3 + 0.1. Let q = -343 - -343. What is the second smallest value in q, x, a? x Let t = -20 - -104. Let c be (-23)/((-9)/9). Let r be (0 - (-8)/t)/(c/9). What is the third smallest value in r, -2/11, 3/5, -0.1? r Let j = 38249/15 - 2550. Which is the third smallest value? (a) 0.5 (b) -3 (c) -12 (d) j d Let g = 122 + -122.118. Let o = -0.178 - g. Let p = 2202/11 - 200. What is the third biggest value in o, p, 5? o Let q be (-86)/(-8) + 28 + -39. Let h = -0.1 - -0.5. Let o(i) = -2i - 25. Let u be o(-15). Which is the second biggest value? (a) h (b) u (c) q a Suppose 5y - 6y + 5 = 0. Let l = -2/39 + 121/78. Let n = -4807.2 - -4807. Which is the third biggest value? (a) -4 (b) l (c) n (d) y c Let r = -0.159 + 61.159. Let h = -56 + r. Let t be (-6)/8(-4)/8. Which is the biggest value? (a) h (b) -1 (c) t a Let q = -0.06 - -0.13. Let f = 0.029 + -3.129. Let z = f - -3.1. What is the third biggest value in 1/2, z, -0.3, q? z Let f = 4253 - 4134. Which is the second biggest value? (a) 0.1 (b) -4 (c) f a Let q = 0.04419 + 0.15581. Which is the smallest value? (a) -10 (b) 1 (c) q (d) 3 (e) 1/10 a Let o be ((-5)/(-45))/(123/(-369)). Which is the third smallest value? (a) 16 (b) o (c) 583 c Let f = 15.7 - 2.7. Let v = -10 + f. Suppose 153k = 145k - 16. Which is the biggest value? (a) k (b) v (c) 2/3 b Let c = -890 + 890.14. What is the second biggest value in 16, -2/7, c, -2/9? c Let o = 6191 + -6182. Which is the fifth biggest value? (a) -3/4 (b) o (c) 0.5 (d) -5 (e) -0.23 d Let u = -356.6 - -432.6. What is the second smallest value in -4, -1, u? -1 Let q = -37 - -54. Let i = -148.6 - -148.1. What is the second smallest value in i, -0.3, q? -0.3 Let a = -51.702 + 121.585. Let d = a - -0.117. What is the second smallest value in -3, d, 0? 0 Let a = -50 + 50.4. Let d = -0.1 + a. Let k = -20.5 - -20. What is the second smallest value in d, -2/5, -4, k? k Let n = -1.37645 + 1.45645. Let o = -563/420 + 1/140. What is the second biggest value in 1/2, o, n? n Let h = 1.1 - 0.3. Let z = 1 - h. Let t = -39493 + 39492.9. Which is the third biggest value? (a) z (b) t (c) -4 (d) -1 d Let h = -2 - 3. Let y = 42840/13 - 85719/26. What is the third biggest value in 0.1, y, h, 1/31? y Suppose 4v - 2q - 24 = 8, -3v - 3 = 3q. Which is the third biggest value? (a) -10 (b) -3/5 (c) v (d) -5 (e) 0 b Let v = -1 - -1.47. Let y = -0.459502 - -0.059502. What is the biggest value in v, y, 0? v Let a = -13/8 - -3/2. Let n = 14.89 + -0.89. Let i = -22 + n. What is the third biggest value in -1, i, a? i Let t = 5.24 - -59.56. Let n = t + -65. Let u = -0.045 - -1.045. Which is the second biggest value? (a) u (b) n (c) 3 a Let w be (2 + 306/(-248))2. Let m = w - 1/31. Let o = 12.842 + -13.142. Which is the second smallest value? (a) o (b) m (c) 5 b Let f = 84 - 76.7. Let b = -0.15 - 0.15. Let n = b + f. What is the smallest value in 5, n, 5/3, -1/5? -1/5 Suppose -37 = -7q - 611. Let o = -250 - q. Let m be 54/o - (-2 + (-30)/(-21)). What is the biggest value in m, -1/10, 4/3, 5? 5 Suppose 2 = -2z + z. Let l(y) = -2y*2 + 280y - 9413. Let x be l(56). Let b = 1 - 0. What is the third smallest value in z, 5, b, x? b Let f = 0.59 + -0.79. Which is the second biggest value? (a) -16 (b) f (c) 1.2 (d) 2/5 (e) 0.01 d Let i = -86262.43 + 86262. Let l = 0.2 + -0.2. Which is the third smallest value? (a) l (b) i (c) 3/5 c Let i be 1418(1 + 6/8)/((-252)/(-72)). What is the fourth smallest value in 2/5, -2/7, i, 2/7? i Let s be (-12)/27(-36)/(-40). What is the third smallest value in s, 0.02, -1/4? 0.02 Let f = -31 + 26. Let r = 1.234 - 1.734. Which is the second smallest value? (a) -0.08 (b) r (c) 4 (d) f b Let j = 44.1 - 45.1. Let z(c) = c*2 - 12c + 13. Let k be z(15). Let l be k/(-15) - (-1 + -3). What is the third smallest value in 3/5, 0, l, j? l Let m = 0.166 + 1.334. Let w = -2.5 + m. Which is the fourth smallest value? (a) w (b) -4 (c) 7 (d) -0.4 c Let b be ((-7)/(98931/(-14)))/(-1). Let u = b + 1348/2019. Let i(x) = -4x + 1. Let a be i(3). What is the second biggest value in u, 0.2, a, 0? 0.2 Let c = 0.3066 + -0.4366. What is the second smallest value in -0.3, 0.3, c, 0.5? c Let j = -2 - 2. Let z(y) = -28y - 22. Let p be z(3). Let c = -637/6 - p. What is the second smallest value in c, 7, j? c Suppose -m - 4c - 9 = 0, -46c + 9 = -3m - 49c. Let l = -0.13 - -0.13. Let w = l + -0.2. What is the third biggest value in -4, w, m? -4 Let j be ((-186)/(-24) - 4)/((135/12)/(-15)). Which is the third biggest value? (a) 19 (b) 2 (c) 9 (d) j (e) 0.03 b Let h = 1355 + -1259. Which is the second biggest value? (a) h (b) 2/7 (c) 3/2 c Let q = 165 - 156. Let m = q - 6. What is the second biggest value in m, -2/3, 1/7? 1/7 Let w be ((-34)/68)/(21/(-188)). Let y = -36/7 + w. What is the third biggest value in 13, y, -0.1? y Let f = 817 + -532. Let o = f + -295. What is the third biggest value in o, -11, -4? -11 Suppose -5h = 29h - 510. Suppose 0 = d + 2g + 3, -5g = 5d + h - 0. Which is the third biggest value? (a) -1 (b) 4 (c) d c Let k be (-3)/((-144)/717)4. Let o = -59 + k. Which is the smallest value? (a) 5 (b) o (c) 1/7 (d) -1/7 d Suppose 18q = 15q + 57. Suppose q + 62 = -3u. Let w be (-18)/u(-6)/(-20). Which is the third biggest value? (a) -0.5 (b) 0 (c) w a Let m(z) = z*2 + 67z + 737. Let i be m(-53). Let t = 6.5 - 20. Let k = t + 14. Which is the third smallest value? (a) k (b) i (c) 6.5 c Let k = 0.5 - 4.5. Let i = 924/103 + -4929/515. Let j = 1.5 - 2. Which is the third smallest value? (a) k (b) j (c) i b Let n = -2077.37 - -2086. Let g = 50.63 - 51. Let j = n - g. What is the third smallest value in -0.1, -1, j? j Let p = 1661 - 1666. Which is the smallest value? (a) -2 (b) 3 (c) p (d) -2/5 (e) 9.9 c Let h(f) be the second derivative of f*3/2 - 31f*2/2 + 14f. Let c be h(10). Let s = 6.033 + -0.033. What is the second smallest value in c, 0.4, -4, s? c Suppose 0 = -3y - 2p + 4, -2y + 263p - 260p + 20 = 0. Which is the second biggest value? (a) -5 (b) 1 (c) -3 (d) 14 (e) y e Let a(h) = 4h + 170. Let b be a(-42). Let k be (-36)/(-120)*(0 - -2). What is the biggest value in b, k, 3/53? b Let s = -38 + -8. Let p = 17571 - 17524.91. Let d = p + s. What is the second smallest value in 1, 2, d? 1 Let g = -1965 + 1976.93. Let f = 12 - g. Let u be (-56)/(-84) - 32/66. Which is the third smallest value? (a) u (b) -0.4 (c) f a Let m = -1345.1 + 1221. Let x = 124 + m. Let r(o) = -o + 1. Let q be r(-1). What is the third smallest value in q, -1/2, x, 1/9? 1/9 Let z = -2.1285 + 0.1285. Which is the b	{ "pile_set_name": "DM Mathematics" }
c) -2 (d) -0.4 (e) -360 b Which is the closest to 1/3? (a) 293 (b) 2/3 (c) -7405 (d) -5 b Which is the nearest to -2/49? (a) 5/668 (b) 2/5 (c) -514 a What is the nearest to 4.5 in 5, 582, 10? 5 What is the nearest to -1 in 2052682, 1, 2? 1 Which is the nearest to 2/49? (a) -9/4 (b) -172 (c) 0.2 c Which is the closest to 1.814? (a) 4 (b) 29 (c) 13 a What is the nearest to -15.315 in -1, -3, 7? -3 What is the nearest to -88/21 in 0.3, 6118, -1? -1 Which is the nearest to 0? (a) 356 (b) 9 (c) 0.2 (d) 0.037 d Which is the closest to -0.029? (a) -0.3 (b) -1 (c) -3 (d) -2639 a What is the nearest to 0.1 in -0.2, -787, -5, 2143, -1? -0.2 What is the nearest to -2 in 17, 4/5, -1, 10318, 1/4, 3? -1 Which is the closest to 0.2? (a) 0.04 (b) 3 (c) -5 (d) 0.1028 (e) -21 d Which is the closest to -5? (a) 5 (b) -832/5 (c) -34 (d) 3 d Which is the closest to 1? (a) 0.21 (b) 4 (c) 354.39 a What is the nearest to -0.3 in 2, 383, -38, -5, -1/4, 1/3? -1/4 Which is the nearest to 0? (a) 6067 (b) 0.4 (c) -4 (d) -0.23 (e) -1/12 (f) 0.2 e Which is the closest to -1/4? (a) -3 (b) 1/3 (c) 993 (d) -5504 b What is the closest to 2.12 in 14, -1/4, -1/6, 33.5? -1/6 Which is the nearest to 385.853? (a) 5 (b) -0.2 (c) 6 c Which is the nearest to -8? (a) 1 (b) 12/13 (c) -0.2 (d) 21.754 (e) -1/4 e What is the nearest to -2404 in 10, 1/2, 1, -3/7, -2/9, 6? -3/7 Which is the closest to -0.43? (a) -1/21 (b) -0.7 (c) 381 (d) 4 b Which is the closest to 3? (a) -2/3 (b) -3761 (c) 2/9 (d) 1/4 d What is the closest to -21/4 in 565, 5, -1, 18/5, -4? -4 Which is the closest to -9? (a) -1/9 (b) -1325 (c) -1/10 (d) 0.3 (e) -1/8 e What is the closest to -3238/27 in 4/3, -0.1, -4, 2, -1? -4 What is the nearest to -1/2 in -0.1, 0.33, -2/11, -224? -2/11 Which is the nearest to -4? (a) -11 (b) 0.05 (c) 1.8 (d) -63 (e) 0.2 b Which is the nearest to -1? (a) 1.4 (b) 0 (c) 3/13 (d) 334 b Which is the closest to -37? (a) 4 (b) -0.1 (c) -2/15 (d) -3/11 (e) -5/22 d Which is the nearest to -0.6? (a) -0.3 (b) -3410/13 (c) -5 (d) 2/3 (e) -4 a Which is the closest to 1.2? (a) 2 (b) -4/5 (c) 12 (d) -4064 a Which is the nearest to 0? (a) 1.2 (b) -2/3 (c) 3920 (d) 4 b What is the closest to 0.2 in -8382, 0.2, -0.8, -1/61, 2/11? 0.2 What is the closest to 0.1 in 2/3, 16586213, 3? 2/3 What is the nearest to 0 in 44.9, 9/35, -1/8? -1/8 Which is the nearest to 2? (a) 3 (b) -427 (c) -2/13 (d) -2216 (e) 2 e What is the closest to 20 in -99, 0.2, -16, -11? 0.2 What is the nearest to -3/5 in -0.1, 285/503, -1/6? -1/6 Which is the closest to -5? (a) -1 (b) -543 (c) 3 (d) -1/6 (e) 2 (f) 68 a What is the nearest to 0 in 1/50, 13, -0.5, -2/3, 1, 8/45? 1/50 Which is the closest to 2? (a) 5 (b) -10 (c) -0.1 (d) -10868 c Which is the closest to 1? (a) -3 (b) -687 (c) 2/11 (d) 20 (e) 21 c What is the closest to 1 in 4179.7, 0.5, 101, -2/13? 0.5 What is the nearest to -2 in 40, -12, 613, 27? -12 What is the nearest to -0.03 in 2/9, 14/9, 0.3, 392? 2/9 What is the nearest to -3 in -2/11, -0.04, 42, 3.4, 2/11? -2/11 Which is the nearest to -2? (a) -13/73 (b) 18 (c) -2/9 (d) -1.5 d What is the closest to -1/3 in -80281/5, 1/6, 4, -1, -0.8? -0.8 What is the nearest to -2/17 in 0.06, 0.4, -0.007, -5/8? -0.007 Which is the nearest to -6? (a) -5 (b) -0.0682 (c) -1/9 (d) -0.3 (e) 0.2 a What is the nearest to 0.33 in 0, -2/7, 5, -4405, 1/3? 1/3 Which is the closest to -2? (a) -11 (b) 25 (c) -86.32 a What is the nearest to -6225 in 0.03, 0.3, -151/2, 3? -151/2 Which is the nearest to 45? (a) -17 (b) -0.43 (c) 1 (d) 3 (e) -3/2 d Which is the closest to -10? (a) -2/13 (b) 3/13 (c) -16 (d) -20.2 (e) 5 c Which is the nearest to -26? (a) -0.05 (b) 1 (c) -16 c What is the nearest to 1 in 3.8, 0.013444, 0.5, 0? 0.5 Which is the nearest to -26? (a) -1.56 (b) -1/5 (c) 1/29 (d) -2 (e) -0.8 d What is the nearest to -9879 in 0.59, -3, 1/7? -3 What is the nearest to -0.02 in 1/3, 0.06141, 2/11? 0.06141 Which is the nearest to -112.7? (a) -7 (b) 29 (c) -4/3 (d) -20 d Which is the nearest to -178? (a) -6 (b) -0.3 (c) 0.77 a What is the nearest to 1/2 in 20, 2434, -0.2, -0.074? -0.074 What is the nearest to -6/25 in 20, -10983, 0.4? 0.4 Which is the closest to -27? (a) 4/5 (b) -3/8 (c) -3/2 (d) -2 (e) 3 (f) -0.24 d Which is the closest to -0.1? (a) -63 (b) -0.0291 (c) -5 (d) -1/15 (e) 0.06 d Which is the closest to 510.9? (a) -2 (b) 5.8 (c) 1/5 (d) 3 (e) -69 b Which is the closest to 50? (a) 2553 (b) 0 (c) -2/67 (d) -1 b Which is the closest to 1/4? (a) -0.033 (b) -0.01 (c) 10284 b What is the nearest to 0.319 in 2/13, -2.3, -0.4, -4/127? 2/13 Which is the nearest to -0.6? (a) -174 (b) 2/275 (c) -12 b What is the closest to -14/3 in 1, -112, 7, -3? -3 What is the nearest to -7/502 in 72/7, 0.2, -0.6? 0.2 What is the closest to -4801 in 1, 4, -1/8, 40? -1/8 What is the closest to -15 in -9/5, 0.3, -8/13, 0.1, -1/57? -9/5 What is the nearest to -0.3 in 57/167, -5, -2/147? -2/147 Which is the closest to 2? (a) -40/1303 (b) -2/21 (c) -0.6 (d) 0.06 (e) 3/4 e Which is the closest to -2? (a) 3 (b) -1313 (c) -3/7 c Which is the closest to -0.2? (a) -0.08 (b) 3/2 (c) 2/9 (d) -151 (e) 5/8 a Which is the nearest to -0.1? (a) -1/3 (b) -0.02 (c) -0.1 (d) 111 (e) -819 c Which is the nearest to -0.029? (a) 0 (b) 5 (c) 0.5 (d) -4010 a Which is the nearest to 1? (a) 1 (b) -5/6 (c) 0.5503 (d) 0.1 (e) 89 a What is the closest to 0.3 in 4/3, -8/89, -0.3, 9? -8/89 What is the closest to -1 in 1, 27986, -0.1, 13? -0.1 What is the closest to -553407 in 1/6, 0.4, -4, 0.3? -4 Which is the nearest to 2/5? (a) -1 (b) 11/4 (c) -45179 a What is the closest to 0 in 1428/11, -6.4, -0.1, 5, 6? -0.1 What is the closest to -1/2 in 36, -2/13, -17292? -2/13 What is the nearest to 1 in 6, 0.39, 5, 62, -2? 0.39 Which is the closest to -8/3? (a) 5 (b) -0.15 (c) -0.078 (d) -0.5 d Which is the closest to 0? (a) 183 (b) 5 (c) -12 (d) 3 (e) -62 d Which is the closest to 1? (a) 122 (b) -3 (c) -0.7 (d) 1.8 d Which is the closest to 10? (a) 14 (b) -2/11 (c) -2349 a Which is the nearest to 6? (a) 4 (b) 0.916 (c) -23 (d) 0 a What is the closest to 87 in -316, 0, -1.8, 4? 4 What is the closest to 2/7 in -2, -32, -5/3, -13? -5/3 Which is the closest to 0.3? (a) 1 (b) 1.41557 (c) 8 (d) 0 d What is the closest to 1 in 3/5, 0, 4, -56, -439, -2/39? 3/5 Which is the nearest to 2? (a) 4/7 (b) 0.127 (c) -0.16283 a Which is the nearest to 5? (a) 2 (b) -1/12 (c) 102/7 (d) -0.5 (e) 2/37 a What is the nearest to 0 in 59771, -0.5, -0.01, 4? -0.01 What is the closest to -2 in -465, 4/11, -3? -3 What is the nearest to -1 in 3/5, 1644, -119, -1/5? -1/5 Which is the closest to -0.4? (a) 30580 (b) 1 (c) -16 (d) -5 b What is the closest to 0.05 in 4, 83, 24358? 4 Which is the closest to 1/4? (a) 4547 (b) 0.5 (c) -4/7 (d) -433 b Which is the nearest to -1/15? (a) 3/2 (b) 1 (c) 2/5 (d) -4 (e) 0.019 (f) 0.1 e Which is the closest to -96? (a) -8 (b) 0.4 (c) -29 c Which is the nearest to 1/2? (a) 13/69 (b) 0.1494 (c) 5 a What is the nearest to -3/8 in -7, -1/6, -1, -0.08, 1273, -3? -1/6 What is the closest to 0.205 in 1/5, -8, -293? 1/5 Which is the nearest to 1.06? (a) -0.1 (b) -41 (c) -0.2 (d) 229 a Which is the nearest to -1? (a) 4 (b) 0.2 (c) -3/1663 (d) 5 (e) 12 (f) 0.4 c Which is the nearest to -2/7? (a) -0.03987 (b) -102 (c) 0.2 (d) -0.3 d What is the closest to 8 in -4/3, 12, -19, 2/3, -2, -0.0685? 12 Which is the closest to 1? (a) -616 (b) -1.2 (c) 395 b Which is the nearest to 2? (a) 7/260 (b) -0.5 (c) -724 a Which is the closest to 0.3? (a) -1/87 (b) -0.5 (c) 4 (d) 0.09 (e) -1.5 d Which is the nearest to 13541? (a) 0.4 (b) 4 (c) 1/7 b Which is the nearest to 11470? (a) 4 (b) -2 (c) 0.14 (d) -0.2 a Which is the nearest to -0.1? (a) -0.2 (b) 2054 (c) -7.1 (d) 0.06 (e) 0.2 a What is the closest to -69 in -0.3, -4, -0.04, -593/7, 2, 0? -593/7 What is the nearest to 3 in 0.1, -4/93, 0.3, 3, -2, -5/17? 3 What is the nearest to 14 in 5/11, -5, 25, 0? 25 What is the closest to 0.05 in -5, 2/9, 1.335, -2/7, 0? 0 Which is th	{ "pile_set_name": "DM Mathematics" }
the c'th term of -13, 23, 107, 239, 419, 647, 923? 24c2 - 36c - 1 What is the p'th term of 30, 110, 250, 450, 710? 30p2 - 10p + 10 What is the c'th term of 8899, 8900, 8901, 8902? c + 8898 What is the x'th term of 12, 52, 120, 216, 340, 492? 14x2 - 2x What is the k'th term of 53, 89, 99, 71, -7, -147? -2k3 - k2 + 53k + 3 What is the u'th term of -280, -300, -320, -340, -360? -20u - 260 What is the s'th term of -18, -29, -40, -51, -62, -73? -11s - 7 What is the k'th term of -2, -20, -50, -98, -170, -272? -k*3 - 11k + 10 What is the n'th term of -508, -1000, -1492? -492n - 16 What is the y'th term of 811, 3220, 7231, 12838, 20035, 28816, 39175? -y3 + 807y*2 - 5y + 10 What is the x'th term of 40, 82, 146, 226, 316, 410, 502, 586? -x*3 + 17x*2 - 2x + 26 What is the g'th term of -290, -583, -888, -1211, -1558, -1935, -2348? -g*3 - 286g - 3 What is the v'th term of 69, 144, 219, 294, 369? 75v - 6 What is the g'th term of -337, -338, -339, -340, -341, -342? -g - 336 What is the l'th term of -126, -104, -82, -60, -38? 22l - 148 What is the p'th term of 26, 30, 26, 8, -30? -p*3 + 2p*2 + 5p + 20 What is the o'th term of 5111, 10219, 15327? 5108o + 3 What is the z'th term of -6, -16, -14, 6, 50, 124, 234, 386? z3 - 17z + 10 What is the x'th term of 131, 139, 147, 155, 163? 8x + 123 What is the s'th term of -13, -53, -117, -205, -317? -12s*2 - 4s + 3 What is the o'th term of -72, -74, -76, -78? -2o - 70 What is the a'th term of -206, -171, -112, -29? 12a*2 - a - 217 What is the v'th term of 1306, 1303, 1300, 1297? -3v + 1309 What is the i'th term of 192, 768, 1728, 3072? 192i2 What is the d'th term of -4, -28, -70, -130, -208? -9d*2 + 3d + 2 What is the a'th term of -18, -64, -140, -246, -382, -548, -744? -15a2 - a - 2 What is the u'th term of -764, -1529, -2296, -3065, -3836, -4609? -u2 - 762u - 1 What is the z'th term of 694, 688, 682, 676? -6z + 700 What is the s'th term of -8, -31, -60, -89, -112, -123, -116, -85? s3 - 9s*2 - 3s + 3 What is the k'th term of -9, -14, -19, -24, -29? -5k - 4 What is the b'th term of -374, -375, -376, -377, -378, -379? -b - 373 What is the y'th term of 310, 339, 366, 391, 414, 435, 454? -y2 + 32y + 279 What is the q'th term of -113, -111, -109, -107, -105? 2q - 115 What is the s'th term of -9, -38, -91, -168? -12s*2 + 7s - 4 What is the a'th term of -8, -6, 16, 52, 96? -a*3 + 16a*2 - 39a + 16 What is the d'th term of -7, 10, 29, 44, 49, 38? -d*3 + 7d*2 + 3d - 16 What is the i'th term of 10, 44, 136, 316, 614, 1060, 1684, 2516? 5i3 - i2 + 2i + 4 What is the z'th term of -224, -454, -682, -902, -1108? z*3 - 5z*2 - 222z + 2 What is the b'th term of 919, 949, 981, 1015, 1051, 1089, 1129? b*2 + 27b + 891 What is the h'th term of -1, 6, 13, 20, 27, 34? 7h - 8 What is the p'th term of 5158, 5157, 5156? -p + 5159 What is the b'th term of -215, -190, -149, -86, 5, 130? b3 + 2b*2 + 12b - 230 What is the m'th term of -191, -316, -441, -566, -691? -125m - 66 What is the f'th term of 148, 140, 118, 76, 8, -92? -f3 - f2 + 2f + 148 What is the b'th term of -93, -175, -231, -249, -217, -123? 2b3 + b2 - 99b + 3 What is the s'th term of 1364, 1383, 1404, 1427, 1452, 1479, 1508? s*2 + 16s + 1347 What is the y'th term of -27, -130, -301, -540, -847, -1222, -1665? -34y2 - y + 8 What is the c'th term of 68, 71, 84, 113, 164, 243, 356, 509? c3 - c2 - c + 69 What is the z'th term of -41, -85, -129, -173, -217, -261? -44z + 3 What is the c'th term of -241, -493, -759, -1045, -1357, -1701, -2083? -c3 - c2 - 242c + 3 What is the y'th term of 186, 132, -18, -312, -798, -1524, -2538? -8y*3 + 2y + 192 What is the w'th term of 311, 624, 937? 313w - 2 What is the c'th term of 473, 473, 475, 479, 485? c2 - 3c + 475 What is the d'th term of -10, -28, -58, -100, -154? -6d2 - 4 What is the b'th term of 13, 11, 5, -5, -19, -37, -59? -2b*2 + 4b + 11 What is the f'th term of 4, -3, -12, -23, -36, -51, -68? -f*2 - 4f + 9 What is the k'th term of 26, 48, 74, 110, 162, 236, 338, 474? k*3 - 4k*2 + 27k + 2 What is the j'th term of -2650, -2649, -2648, -2647, -2646? j - 2651 What is the j'th term of 194, 195, 196, 197, 198, 199? j + 193 What is the j'th term of 680, 1346, 2012? 666j + 14 What is the w'th term of 35, 54, 119, 254, 483, 830, 1319? 4w3 - w2 - 6w + 38 What is the y'th term of -91, -360, -809, -1438, -2247? -90y*2 + y - 2 What is the h'th term of 210, 215, 220, 225, 230, 235? 5h + 205 What is the h'th term of -62, -60, -58, -56, -54, -52? 2h - 64 What is the v'th term of -18, -36, -58, -84? -2v*2 - 12v - 4 What is the d'th term of 126, 139, 154, 171? d*2 + 10d + 115 What is the x'th term of 333, 662, 991, 1320? 329x + 4 What is the f'th term of 55, 129, 219, 331, 471, 645? f3 + 2f*2 + 61f - 9 What is the o'th term of -13, -108, -349, -808, -1557, -2668, -4213, -6264? -12o3 - o2 - 8o + 8 What is the h'th term of 351, 346, 331, 300, 247? -h3 + h2 - h + 352 What is the j'th term of -32, -64, -94, -122, -148, -172, -194? j*2 - 35j + 2 What is the k'th term of 11, -11, -71, -187, -377, -659? -3k3 - k2 + 2k + 13 What is the h'th term of -9, -18, -27? -9h What is the w'th term of 130, 264, 398? 134w - 4 What is the m'th term of 39, 298, 1003, 2376, 4639? 37m3 + m2 - 3m + 4 What is the s'th term of -8, -52, -126, -230, -364, -528? -15s2 + s + 6 What is the c'th term of 68, 112, 156? 44c + 24 What is the y'th term of 2, 14, 32, 56? 3y2 + 3y - 4 What is the r'th term of 54, 89, 124, 159, 194, 229? 35r + 19 What is the y'th term of 1345, 2704, 4063, 5422, 6781? 1359y - 14 What is the a'th term of -6153, -6156, -6161, -6168, -6177, -6188, -6201? -a2 - 6152 What is the m'th term of 69, 136, 205, 276, 349, 424, 501? m2 + 64m + 4 What is the i'th term of 54, 95, 122, 129, 110? -i3 - i2 + 51i + 5 What is the r'th term of 31, 83, 145, 217, 299, 391, 493? 5r2 + 37r - 11 What is the f'th term of 153, 159, 161, 153, 129, 83? -f*3 + 4f*2 + f + 149 What is the u'th term of 32, 70, 84, 62, -8, -138, -340, -626? -2u*3 + 52u - 18 What is the p'th term of 67, 90, 121, 154, 183, 202? -p*3 + 10p*2 + 58 What is the l'th term of -986, -985, -984? l - 987 What is the p'th term of -118, -193, -318, -493, -718? -25p2 - 93 What is the d'th term of 119, 248, 385, 536, 707, 904, 1133? d3 - 2d2 + 128d - 8 What is the v'th term of 716, 1445, 2150, 2819, 3440, 4001, 4490? -2v3 + 743v - 25 What is the b'th term of -37, -28, -15, 2, 23, 48? 2b2 + 3b - 42 What is the v'th term of 129, 269, 411, 555, 701? v*2 + 137v - 9 What is the v'th term of -64, -70, -76, -82, -88? -6v - 58 What is the i'th term of -12, 5, 46, 123, 248, 433, 690? 2i*3 + 3i - 17 What is the a'th term of 138, 120, 102, 84? -18a + 156 What is the d'th term of -40, -354, -1198, -2836, -5532, -9550, -15154, -22608? -44d3 - d2 - 3d + 8 What is the j'th term of 12, 24, 48, 90, 156, 252? j3 + 5j + 6 What is the y'th term of 3167, 3166, 3165? -y + 3168 What is the z'th term of 13, 41, 69, 97, 125, 153? 28z - 15 What is the f'th term of 169, 339, 511, 685, 861, 1039? f2 + 167f + 1 What is the j'th term of -307, -311, -317, -325? -j*2 - j - 305 What is the w'th term of -72, -66, -54, -36? 3w*2 - 3w - 72 What is the y'th term of 317, 315, 313, 311? -2y + 319 What is the k'th term of -68, -34, 8, 58, 116, 182, 256? 4k*2 + 22k - 94 What is the h'th term of 71, 150, 231, 314, 399, 486, 575? h*2 + 76h - 6 What is the d'th term of -87, -280, -601, -1050, -1627, -2332, -3165? -64d2 - d - 22 What is the a'th term of -127, -539, -1235, -2215? -142a*2 + 14a + 1 What is the y'th term of -246, -247, -248, -249, -250, -251? -y - 245 What is the i'th term of 568, 1150, 1732, 2314, 2896, 3478? 582i - 14 What is the u'th term of 62, 132, 240, 380, 546, 732, 932? -u3 + 25u*2 + 2u + 36 What is the c'th term of -134, -268, -402, -536? -134c What is the c'th term of 281, 560, 825, 1070, 1289, 1476? -c3 - c2 + 289c - 6 What is the k'th term of 23, 43, 77, 125, 187, 263, 353? 7k2 - k + 17 What is the u'th term of -24, 68, 228, 462, 776? u3 + 28u**2 + u - 54	{ "pile_set_name": "DM Mathematics" }
y(m). -10m*3 Let i(u) = 154u + 4. Let a be i(2). Let k(w) = 6w3 - 301 + 11w*2 + a - 8w3. Let j(l) = l2 + 1. What is -22j(n) + 2k(n)? -4n3 Let z(l) = -384l*3 + 13l*2 - 88l. Let v(c) = 189c3 - 6c*2 + 46c. Determine -11v(o) - 5z(o). -159o3 + o2 - 66o Let u(l) = 21l + 21. Let n(g) be the third derivative of 5g*4/24 + 5g3/6 - g2 + 12g + 15. Calculate -9n(c) + 2u(c). -3c - 3 Let v(f) = -14905f + 29806f - 14900f. Let a(n) = 9n*2 + 7n. Give 3a(m) - 21v(m). 27m2 Let l(k) = 5k + 19. Let z(i) be the second derivative of 2i3/3 + 10i*2 + 4353i. Determine 3l(f) - 4z(f). -f - 23 Let m(v) = -v + 1. Let o be (-4 + 2)/(322/1449). Let x(j) = 4j - 5. Determine om(u) - 2x(u). u + 1 Let s be 0 - -42/4. Let v(i) = -434 + i*2 - si*2 + 2i + 214 + 224. Let h(o) = -6o2 + 11o + 19. Give -2h(w) + 11v(w). w*2 + 6 Suppose -v - 3w = -26, -3v + 2w + 15 = -30. Suppose 5s = v + 108. Let u(x) = 28x + sx - 54x. Let d(j) = j - 1. What is d(l) + 3u(l)? -2l - 1 Let k(x) = 16x2 + 11x + 3. Let p(q) = -5q2 - 4q - 1. Suppose 3v - 23 = -5s, -7v + 6v = -5s + 19. Calculate sk(b) + 11p(b). 9b2 + 1 Let z(u) be the first derivative of -u4/24 + 10u2 - 137. Let h(w) be the second derivative of z(w). Let t(b) = 8b - 2. Determine -5h(x) - t(x). -3x + 2 Let f(i) = i + 9i2 - i + 61 + 61 - 127 + 3i. Let u(l) = l*2 - l + 1. Calculate f(q) + 4u(q). 13q2 - q - 1 Let c be (3 - (3 + -5)) + -1 + 1. Let r(b) = -c + 0b - 5b + 5 + 3 + 0. Let t(v) = -v + 1. Give r(k) - t(k). -4k + 2 Let c(u) = u*3 + 5u*2 + 4. Let n(a) = 13a*3 + 20a*2 + 326. Let x(q) = -3q*3 - 5q*2 - 73. Let s(b) = -2n(b) - 9x(b). Determine 5c(w) - 4s(w). w3 + 5w*2 Let j(g) be the third derivative of -5g*4/12 - 5g3/6 + g2. Let c(p) = 717p + 9. Let d(v) = -538v - 7. Let x(o) = -3c(o) - 4d(o). Give j(u) + 5x(u). -5u Let t(k) = 76k2 + 5k - 5. Let b(d) = -151d2 - 11d + 7. Give 4b(z) + 9t(z). 80z2 + z - 17 Let u(l) = -66l*3 + 14l*2 + 1422l - 7. Let q(h) = 47h3 - 10h*2 - 948h + 5. Determine -7q(y) - 5u(y). y*3 - 474y Let g(p) = 164p3 + 10p*2 - 4p. Let h(v) = v*3 - 2v*2 + v. Give g(y) + 6h(y). 170y3 - 2y*2 + 2y Let r(s) be the second derivative of -s*2 + 53s + 0 - 1/2s3. Let d(i) = 2i + 3. What is 5d(q) + 4r(q)? -2q + 7 Let y(r) = -7r + 2. Let g(i) = -938i + 8. Give g(b) - 3y(b). -917b + 2 Let v(g) = -45g*2 + 16g. Let l = 542 + -538. Let q(i) = 3i2 - 11i + 7. Let u be q(l). Let p(x) = -9x2 + 3x. Calculate up(k) - 2v(k). -9k2 + k Let s(z) = 3z*2 + 9z + 31. Let p(u) = 8u2 + 17u + 61. What is 2p(x) - 5s(x)? x*2 - 11x - 33 Let s(i) = -7i3 + 3i*2 - 5i. Let p = -13128 - -13123. Let u(h) = -10h3 + 5h*2 - 8h. Give pu(q) + 8s(q). -6q3 - q2 Let o(w) = 3w*2 - 1. Let t(k) = 3k*3 + 12k*2 + 5k - 8. Calculate -6o(i) + t(i). 3i*3 - 6i*2 + 5i - 2 Let d(r) = r. Let w(b) = -6b3 - 2b*2 + b - 5. Let x be w(0). Let c(o) = -12o - 2. What is xd(l) - c(l)? 7l + 2 Let n(s) = 5s + 1. Let k(d) = 1. Let w = -2580 + 2581. Calculate wk(r) - n(r). -5r Let f(x) = -4x + 5. Suppose -5n + 3n - 18 = 3k, -22 = 4k + 2n. Let c(l) = 16 + 12 - 53 + 8l + 16. Determine kc(y) - 7f(y). -4y + 1 Let h = -2 - -5. Let u(j) be the first derivative of -3j - 58. Let m(i) = i - 5. Determine hm(x) - 5u(x). 3x Let u(l) = -2l - 346. Let o(p) = p + 173. Calculate 7o(r) + 4u(r). -r - 173 Let o(f) = -7f3 - 9f*2 + 9. Let x(k) = -75k*3 + 195k*3 - 1 + 0 - 119k*3 + 3k*2 - 2k*2. Give -4o(t) - 36x(t). -8t*3 Let j(t) be the third derivative of 0 + 0t + 1/6t3 - 29t*2. Let c(o) = o - 1. Let x be 5/10 + 2/4. Give xc(d) + 3j(d). d + 2 Let i(c) = -5882c*2 + 2c - 5. Let p(g) = -11796g2 + 5g - 11. Determine 7i(d) - 3p(d). -5786d2 - d - 2 Let s(f) be the second derivative of -5f*4/3 + 11f*2 + f. Let a be 40/(-16)4/(-5). Let b(u) = 67u2 - 1 - 66u*a + 0. Give -44b(z) - 2s(z). -4z*2 Let i(x) = -10920x - 54. Let a(r) = -5459r - 23. Calculate 7a(l) - 3i(l). -5453l + 1 Suppose 5y = d + 34, -145 = 5d - 5y - 115. Let l(f) = -f3 + 2f*2 - 4f - 29. Let q(w) = -w*2 + w - 1. Determine dl(m) + 2q(m). -m3 - 2m - 31 Let y = 1494304 - 1494311. Let b(f) = -2 + 0f2 + 3f + f + f*2. Let w(z) = -5z - 3 + 4z + 7z + 2z2. What is yb(l) + 5w(l)? 3l*2 + 2l - 1 Let d(k) = -k*3 + 6. Let c be (-2 + -12)/(-12 + 10). Let q(t) = -7. Let p(r) = -4. Let l(g) = -7p(g) + 3q(g). Give cd(n) - 6l(n). -7n*3 Suppose 5d = -m - 5, 2d = -5m + 14 + 30. Let n(k) = 19 - 27 + m. Let x(q) = q + 1. Give 3n(g) - 4x(g). -4g + 2 Let f(s) = -s2 - 164s - 170s + 334s + 2 - 3. Let r(a) be the first derivative of 5a4/4 - 2a*3/3 - 2a + 1. What is -2f(p) + r(p)? 5p*3 Let k(l) = 9l*3 - 41l*2 - 11l + 13. Let u(r) be the first derivative of 5r4/4 - 7r*3 - 3r*2 + 7r - 1731. Give -6k(d) + 11u(d). d*3 + 15d*2 - 1 Let k(l) = 7l - 2. Suppose 0x - 11x = -176. Let d be x + -14 - (-4)/1. Let c(p) = 8p - 2. Give dk(o) - 5c(o). 2o - 2 Let g(f) be the first derivative of -f*2/2 - 2f - 1013. Let m(n) = -3n - 4. Calculate -10g(o) + 4m(o). -2o + 4 Let b(i) = 42i. Let m(u) = 145u. What is -4b(d) - 88m(d)? -12928d Let x(c) = 21c*3 + 11c*2 + 11. Let k(o) = -4o + 4o + 2 + 7o*3 - 5158o*2 + 2 + 5162o*2. Determine 11k(w) - 4x(w). -7w*3 Let m(b) = 2b*2 + 5b - 3. Let p(i) = i - 1. Let s(h) = 3h + 85. Let r be s(-25). Suppose 35 = -rv - 25. Let x = 54 - 53. What is vp(f) + xm(f)? 2f2 - f + 3 Let p(s) = -5s*3 + 2s2 - s + 2. Let b(h) = h3 - h*2 + h - 1. Let q = 3375 - 3377. Determine qp(x) - 4b(x). 6x*3 - 2x Let s = -366 - -363. Let v be (540/(-36))/(s + 0). Let w(r) = 4r2 + 7r + 5. Let t(x) = 6x2 + 11x + 8. What is vt(o) - 8w(o)? -2o2 - o Let t(w) = -28w - 1161. Let i be t(-41). Let p(k) = 10k2 + 8. Let o(u) = -20u*2 - 17. Determine ip(v) - 6o(v). -10v*2 - 2 Let l(s) = -43s + 5. Let y(m) = 14m - 1. Let r(i) = -l(i) - 5y(i). Let j(h) = 9h. Determine 17j(g) + 6r(g). -9g Let g(x) = -32x2. Let s be 4/(-16) - 43/4. Let q(r) = 5968 + 11r*2 - 5968. Calculate sq(m) - 4g(m). 7m*2 Let i(q) = 4q*3 - 15q*2 + 3. Let g(x) = -3x*3 + 16x*2 - 2. Let t be 32/6(-273)/364. Give ti(h) - 6g(h). 2h3 - 36h*2 Let l(d) = 4d*3 + 35d*2 - 10580d. Let t(i) = 3i3 + 25i*2 - 7053i. Calculate -5l(c) + 7t(c). c*3 + 3529c Let j(h) = 9h3 - 4h*2 - 11414h - 4. Let y(q) = -7q3 + 3q*2 + 11417q + 3. Give -3j(c) - 4y(c). c*3 - 11426c Let f(k) = -42k - 15. Let w(g) = 51g + 90. Let r be w(-5). Let h be (r/(-22))/(3/(-6)). Let s(p) = -6p - 2. Calculate hs(d) + 2f(d). 6d Let x(z) = 91z2 - 4z - 9. Let n(w) = -46w2 + 2w + 5. Determine 5n(v) + 3x(v). 43v2 - 2v - 2 Let b(d) = 2d3 + 321d*2 - 4. Let j(n) = -2n*2. Give b(q) - 7j(q). 2q3 + 335q2 - 4 Let t(u) = -u2 - u + 1. Let k(w) = -15w2 - 4w + 2. Suppose -61n - 72 = 172. What is nt(a) + k(a)? -11a2 - 2 Let l(q) = -15q*3 + 3q*2 - 2q + 3. Let w(a) be the second derivative of 7a5/10 - a4/6 + a3/3 - a2 - 34a - 8. Give 2l(o) + 3w(o). 12o3 + 2o Let w(c) = -9c - 4. Let u(q) = 22q + 10. Let k(o) = -5u(o) - 12w(o). Let t(d) be the first derivative of d*2/2 + d + 53. Determine 4k(s) + 10t(s). 2s + 2 Let j(v) = -5v + 2. Let m(b) be the first derivative of -5/2b*2 - 29 + 2b. What is 4j(c) - 3m(c)? -5c + 2 Let o(t) = 2t - 10. Let d(f) = 4f - 21. Give d(l) - o(l). 2l - 11 Let x(u) = -167u3 + 36u*2 - 2u - 7. Let s(d) = -d*3 - 7d*2 + d + 1. What is -5s(j) - x(j)? 172j3 - j2 - 3j + 2 Let o(r) = -51r + 66. Let q(w) = -13w + 17. Let l(k) = 4o(k) - 15q(k). Let n(z) = 5z - 4. Let h be (-2)/((-51)/(-78) - 2/13). Determine hl(a) - 9n(a). -9a Let l(u) = -2u3 - 6u*2 + 48u - 140. Let k(m) = m*2 - 8m - 1. Give -6k(g) - l(g). 2g*3 + 146 Let q(r) = 495r*3 + 3r*2 - 9r - 1. Let g(w) = -1980w3 - 13w*2 + 39w + 3. Determine 3g(j) + 13q(j). 495j3 - 4 Let s(r) = 12. Let f(l) be the first derivative of l2/2 - l + 83. Calculate -4f(w) -	{ "pile_set_name": "DM Mathematics" }
-40.00170931 What is 49068713928006 take away -0.5? 49068713928006.5 -0.02921 - -781399.8018 781399.77259 -1233967243 - -8311 -1233958932 What is -6190868 + 694291? -5496577 What is -14123757.3 minus -129539? -13994218.3 Put together -76 and 1410605146. 1410605070 Add 61258 and -609447237. -609385979 What is -7772646 - -16751? -7755895 What is the difference between -241 and 8.045892295? 249.045892295 What is -25.3 take away 0.03281189592? -25.33281189592 What is -0.0737 + 6009762705? 6009762704.9263 What is the difference between -0.082 and 2492922263350? 2492922263350.082 Subtract -0.5 from -5206.68717. -5206.18717 815525.4345+-0.25 815525.1845 Subtract 1361.51391 from 5179. 3817.48609 Put together 97102143052510 and -5. 97102143052505 -8641.7+-183864082 -183872723.7 What is 1.51 take away -4.92918801? 6.43918801 133747148957791 - -0.4 133747148957791.4 6448055909 - -14 6448055923 Calculate -38735 - 37737538. -37776273 What is the difference between -0.2 and 19509795746474? 19509795746474.2 What is 28101348.23 - 689? 28100659.23 Subtract -76732773466 from 5. 76732773471 What is the distance between 37043352054563 and 3? 37043352054560 What is -1098889864 - -1300.5? -1098888563.5 What is 0.03 less than -6151220168479? -6151220168479.03 Sum -1028477473 and 0.25. -1028477472.75 8503074.906 - -230.9 8503305.806 -5.7537684 - 15311 -15316.7537684 What is 0.1 + -102619083237234? -102619083237233.9 Calculate 0.80088 - -38.1. 38.90088 Put together 1615080253 and 201. 1615080454 Work out 7.73948402 + 0.01488. 7.75436402 Put together 0.17 and -6395689304180. -6395689304179.83 Calculate -213037536943 - 1. -213037536944 What is the difference between -0.25 and -419558.73649? 419558.48649 -42254 + 61117004.6 61074750.6 Subtract -44286620 from 16. 44286636 What is 175.892321 minus 0.0407168? 175.8516042 What is 70689786 - -74214? 70764000 What is 0.3 less than -1259481808.42? -1259481808.72 What is 1145881782144 + -94? 1145881782050 What is 0.3 minus -2918281049? 2918281049.3 What is -1214169 - -2.94337? -1214166.05663 Calculate 0.2 - -2132593382917. 2132593382917.2 What is the difference between -0.1185 and -8725416062? 8725416061.8815 -68+-301158437155 -301158437223 What is -5 + -70688516626? -70688516631 Subtract -9046713450 from -285. 9046713165 -41215 - -5551.50301 -35663.49699 Add -2589157685 and 237. -2589157448 217531854 + 0.118596 217531854.118596 -575+2.705210879 -572.294789121 What is 0.5032973649122 take away -5? 5.5032973649122 What is 0.05 - -25683512559764? 25683512559764.05 -0.833487715+-0.00722 -0.840707715 What is -0.8 minus 217184.47841? -217185.27841 Subtract -26.4091 from -3130391. -3130364.5909 Calculate -1.2137988138 + 1.5. 0.2862011862 Work out -3292824867 - 0.006. -3292824867.006 What is -3748863997718.5 - 0.18? -3748863997718.68 What is 12.2750895903 + 0.01? 12.2850895903 708.3657+494704 495412.3657 Add together 2.2 and 1062.0687024. 1064.2687024 Total of -0.5947 and 2520140019. 2520140018.4053 -433752929421+90 -433752929331 Calculate 24977851242.3 + -36.8. 24977851205.5 What is -52801126 minus -77.9597? -52801048.0403 Work out 0.1 + 13933140013571. 13933140013571.1 What is 29049990125209 - -3? 29049990125212 Subtract -47.63 from -144875.75. -144828.12 What is the difference between -101146645393 and 25? 101146645418 What is the distance between -175.4 and -2688508.7348? 2688333.3348 Work out 3 + -12204247489.6. -12204247486.6 Subtract -33 from 3080.2334083. 3113.2334083 Work out -382 + 29054697930. 29054697548 Work out -0.0496 + -411035245. -411035245.0496 Total of 0.4 and 249154350410. 249154350410.4 What is -6176 + -2.62886197? -6178.62886197 What is the difference between -2 and 1724551022085? 1724551022087 Sum -948851 and 2796823. 1847972 Add together 913349218 and 2.78. 913349220.78 Calculate -18044858780981 + -31. -18044858781012 What is -3786.1 - 5884244850? -5884248636.1 What is the difference between 9.325625 and 0.61125? 8.714375 What is 0.125 plus -6852045452? -6852045451.875 Calculate -0.0212 + -12.4673142. -12.4885142 -2.16 - -938065598 938065595.84 Sum -69452909085 and -0.079. -69452909085.079 Sum -24.699645703 and 0.74. -23.959645703 Work out -64110421 - -24.75. -64110396.25 Subtract 65358 from 6682987.6. 6617629.6 Put together -397724 and -17.58612. -397741.58612 -0.0383 - 1772336314 -1772336314.0383 Put together -580323.37083 and -28. -580351.37083 Subtract -270 from -6999608457. -6999608187 What is the difference between -638.1 and 1263118494? 1263119132.1 2449+-21.53866631 2427.46133369 5488998983726 - -0.3 5488998983726.3 Calculate -6.89272 + -878.7. -885.59272 3157843 - 4610648 -1452805 Subtract 51288 from -27733888. -27785176 What is 210094022 plus 954? 210094976 What is the difference between -129.2 and 94.475787? 223.675787 Work out -8955103 - -103.85. -8954999.15 What is the distance between -2630 and 4811187579? 4811190209 Subtract 4 from -2768745.3497558. -2768749.3497558 9.5749+-3457000875 -3457000865.4251 Add together -4344974438 and 0.089. -4344974437.911 Calculate 4.9 - -1005788676841. 1005788676845.9 Calculate -7785.3941403 - -159. -7626.3941403 Sum 0.05204499 and -37536. -37535.94795501 Calculate 1 - -3.81826734686. 4.81826734686 Work out -5353585603.32 + 128. -5353585475.32 Total of 0.1629071491 and 0.176. 0.3389071491 Subtract -114 from 194039741463. 194039741577 Add together 10186363654 and 0.18. 10186363654.18 Sum -12043564249 and 0.144. -12043564248.856 Work out 9661771996.64 + -0.157. 9661771996.483 What is -2 less than -13009926357256? -13009926357254 Work out -10299374167 - 0.12. -10299374167.12 Subtract 81247239932722 from -1. -81247239932723 What is 8238148 minus 7012906? 1225242 What is the distance between 758900 and 20795.3? 738104.7 -3+115950127270153 115950127270150 Add -28424175776 and -0.248. -28424175776.248 What is 19872018 minus 10902.392? 19861115.608 What is -913074028752.84 less than 0.5? 913074028753.34 0.725 - 13579889.101 -13579888.376 Add -5.660211 and 2588325. 2588319.339789 Work out -133502553 + 153392. -133349161 What is the distance between -1000296139.708 and -0.1? 1000296139.608 What is 1114399977265 take away 0.06? 1114399977264.94 Add together 0.2 and -515.81087962. -515.61087962 Add -1239100026 and -167. -1239100193 What is the distance between -534 and -49034465883? 49034465349 What is 333.1960478026 + -0.41? 332.7860478026 Work out 719107.107653 + -4. 719103.107653 What is -0.507281473 minus 0.167? -0.674281473 4.8719+43942789 43942793.8719 Sum 947894156 and -9746. 947884410 -50027368341 + 924 -50027367417 Put together 903.5 and 3.14860501. 906.64860501 Work out -14.16 - -91.29676. 77.13676 0.26+-98400414434 -98400414433.74 What is the distance between -0.07155 and 3984080679? 3984080679.07155 -19970939.404 - -0.005 -19970939.399 What is -0.01097 - 0.15034216434? -0.16131216434 4 - -83661238579 83661238583 Calculate -7.1 + -2606162130. -2606162137.1 Add -0.1187 and -30745.503957. -30745.622657 0.1 + -73340922944.1 -73340922944 Calculate -58 - -1563.259589. 1505.259589 Total of 0.35575919 and 0.3974. 0.75315919 Add together -82081.207537 and 0.19. -82081.017537 What is 5.5083 less than -716660? -716665.5083 -28979239301682 - -0.3 -28979239301681.7 Total of 0.14 and -818041791254. -818041791253.86 Work out -9.96 - -91986456. 91986446.04 Sum 136699670.492 and 0.5. 136699670.992 Sum -0.0277 and 194178473.571. 194178473.5433 Sum -3239837745 and 65449. -3239772296 Calculate -208 - -988773912. 988773704 Work out -0.3 - 527490693008. -527490693008.3 135450110144 - 2556 135450107588 What is 0.4 take away -0.026229307552188? 0.426229307552188 Add together 166.086401 and -1.89. 164.196401 Work out -0.07530581847 - 2056. -2056.07530581847 Calculate -555799488 - 861. -555800349 -46746+1263.698455 -45482.301545 -3371844318 - 0.01 -3371844318.01 Add together 86.849 and 2603226340. 2603226426.849 Add -265706687 and 132631. -265574056 Calculate 44 - 470.0396823. -426.0396823 What is 8694 + 13511131? 13519825 1917237.99425 + 0.08 1917238.07425 Work out -42.6884 - 5.544473. -48.232873 What is the difference between -0.31184387686819 and -59? 58.68815612313181 Calculate -39.90675626 - -368. 328.09324374 What is 68185884275.3 - -15? 68185884290.3 What is -0.015 - 13046468272?	{ "pile_set_name": "DM Mathematics" }
-0.4 in decreasing order. v, -1/4, -0.4 Let d = 5.08 - 5. Let o = 3.92 + d. Let w = -0.3 - -0.1. Put w, o, 0 in descending order. o, 0, w Let l = 2 + 0. Let r = 0.305 - 0.505. Sort -1.3, r, l in increasing order. -1.3, r, l Let q = -29 + 24. Sort q, -4/9, 2 in decreasing order. 2, -4/9, q Let v = 18 - 16.4. Let c = v + 0.4. Let q be 2/7 + 45/(-84). Put q, -3, c in decreasing order. c, q, -3 Let a(r) be the first derivative of -r*4/4 + 2r*3 - 5r*2/2 + 4r + 4. Let p be a(5). Let u = 1 - p. Sort -5, 1, u in decreasing order. 1, u, -5 Let j = 15 + -10. Put j, -2, -3 in decreasing order. j, -2, -3 Let d be 0/((-9)/3) - 4. Suppose 15 = -4b + 2t - 1, 0 = 3t - 12. Let m be 6/d - b/4. Sort 3, 0, m in decreasing order. 3, 0, m Let t = -13 - -11. Let o be (1 + t)(-8 + 3). Sort o, 4, 0 in descending order. o, 4, 0 Suppose -5i - 4s = s - 15, -3i + 10 = 2s. Suppose 2 + 1 = 3z. Suppose -4x - 3k + 11 = 0, 0 = -2x - 4k + 14 + 4. Put i, z, x in ascending order. x, z, i Suppose 0 = 3p - 3. Let w be p - (0 + 0)/(-1). Suppose t = 6 - w. Put -3, t, 1 in increasing order. -3, 1, t Let l be 3/(2 + (-2)/(-4) + -1). Put 8, l, 6 in descending order. 8, 6, l Let k = 3 - 3.1. Suppose 3n - 6 = n. Let s be 1/(-2) - -225/140. Sort k, n, s in increasing order. k, s, n Let i(v) = v*3 + 13v*2 + 21v - 6. Let t be i(-11). Sort -3, -4, t in descending order. t, -3, -4 Let b be (0 + 0)5/(-15). Let d = 0.21 - 0.11. Sort b, d, -2 in descending order. d, b, -2 Let t(d) = d3 + 3d*2. Let l be t(-3). Let x be -6 + 8 - (0 + -2). Let n be x - 2 - 24/10. Put 5, l, n in ascending order. n, l, 5 Let q = 16 - 10. Let t be (-2)/(-4)q/3. Let g(u) = u - 6. Let d be g(4). Sort d, t, -5 in decreasing order. t, d, -5 Let c = -5 + 5.4. Let d = 0 + c. Let h = d - 0.2. Put -0.5, h, -3 in decreasing order. h, -0.5, -3 Suppose t = -d + 10, -3d - 2d = 2t - 20. Let l be (4/t)/((-5)/25). Put l, 5, 0 in decreasing order. 5, 0, l Let c be 2/(-6) - (-5)/(-21). Let q be -2(-414)/(-4). Let h = 55/2 + q. Put c, h, 5/3 in increasing order. c, h, 5/3 Let a = 0.8 - 1.5. Let r be (-2 - -3) + 2 - 8. Sort r, a, 4. r, a, 4 Let o(f) = -f + 2. Let p be o(-8). Suppose -3x + 10 = h, -4h - p = 3x + h. Put x, 4, 1 in ascending order. 1, 4, x Let r be (-10)/(-45) + (-2)/3 - 2. Put -3/8, r, 5, 1/4 in decreasing order. 5, 1/4, -3/8, r Let y(a) = -3a + 3. Let g be y(2). Let w be (1 + -11)/(6/g). Sort 1, -3, w in decreasing order. w, 1, -3 Let g = -2 + 4. Let t be 12 + -5 + 2 + -4. Put g, -5, t in descending order. t, g, -5 Let x = 241 - 236.04. Let d = -0.04 - x. Sort d, -4, -3 in increasing order. d, -4, -3 Let f be (-6)/(-9) - 62/(-6). Let n(x) = x - 14. Let h be n(f). Suppose 2m + 0m + 2 = 0. Put h, 0, m in increasing order. h, m, 0 Let q(i) = 5 + 0i + 8i2 - 5i + 4i - i3. Let d be q(8). Sort d, -2, -0.2 in ascending order. d, -2, -0.2 Suppose 0 = 4l - 0l + 24. Put -5, -3, l in increasing order. l, -5, -3 Suppose 2a + 11 = 5. Let n be (-9)/42(-8)/a. Let s = -7/12 - -5/6. Sort s, n, -0.4. n, -0.4, s Let b = 14 + -15. Put 0, 2/9, b, -2/17 in increasing order. b, -2/17, 0, 2/9 Let s = -2.6 + 5.7. Let h = 0.9 + s. Put h, 0.5, 0.4 in increasing order. 0.4, 0.5, h Let c be 6/(-2)2/(-6). Let k be c/4 - 18/8. Put 2, -1, k in ascending order. k, -1, 2 Let o(x) = x*3 - 8x*2 + x - 6. Let g be o(8). Suppose 4k = gq - 28, -k - 3k - q = 16. Put k, -2, 5 in decreasing order. 5, -2, k Suppose -x - 20 = -5m + 9, 4m - 2x - 28 = 0. Let k = 0 - m. Let a = -4 + 6. Sort 4, k, a. k, a, 4 Let s = 34 - 29. Sort 0.4, 4/3, s, 0.3 in descending order. s, 4/3, 0.4, 0.3 Let g(z) = -z3 - 2z*2 + 2z + 1. Let l be g(-2). Suppose c = 3 + 3. Put l, -4, c in ascending order. -4, l, c Suppose 4 = 5h - 11. Let r = h + -6. Let x be 3/(5/2 - 1). Put x, 0, r in increasing order. r, 0, x Suppose q + 2q = 0. Suppose q = -5v - 24 + 4. Let s(w) = w3 + 5w*2 + 5w + 1. Let h be s(-4). Put -1, h, v in descending order. -1, h, v Let m = 27 + -38. Let l = m - -6. Let r = -172.1 - -172. Sort l, 0.1, r. l, r, 0.1 Let l = 0.81 + 0.09. Sort -1, l, -2/3 in ascending order. -1, -2/3, l Let c(x) = 2x - 7. Let f be c(4). Let p = 11 - 6. Suppose ps + 15 = -5. Put s, f, 0.5 in descending order. f, 0.5, s Let q = 1 - 4. Put 5, q, 9, 0 in descending order. 9, 5, 0, q Let r = -5 + 4.7. Let s = r + 0.5. Let j = -0.1 + s. Sort 2, j, 1/8 in increasing order. j, 1/8, 2 Suppose 2 = -8x + 10. Put 3, x, -4 in decreasing order. 3, x, -4 Suppose p - 6 = 5c, 12 = 3p + 3c - 6. Suppose -pz - 25 = -11z. Let g be 6/4 + z/(-3). Sort 1/6, g, 3. g, 1/6, 3 Suppose -4j - 5r = -8, -3j - 2j + 4r + 51 = 0. Sort -2/13, j, -1/9. -2/13, -1/9, j Let t = 0.04 - -0.1. Let u = 5.14 - t. Put u, 0, 4/3 in decreasing order. u, 4/3, 0 Suppose -3r = -2r - 4i - 24, -3i = 2r + 7. Suppose 5q = ra - 0 + 5, q + a - 1 = 0. Let j be (-1 - 0) + (-16)/(-18). Sort 1/8, j, q in ascending order. j, 1/8, q Let m = -12 + 11.5. Let g(c) = c*2 + 7c + 6. Let u be g(-6). Suppose 4h + uh = 16. Sort m, -2/5, h in ascending order. m, -2/5, h Let q = -1.1 - -5.1. Let j = -1.2 - -4.2. Sort 0.3, q, j in increasing order. 0.3, j, q Let u = 0.255 - 0.135. Put 5, 0.2, -5, u in descending order. 5, 0.2, u, -5 Let l = 15.7 - 16. Let z = -8 - -22/3. Let o = 0.6 + 1.4. Sort o, z, l in increasing order. z, l, o Suppose -3k + 5 = 2k. Let p(r) = -r*2 + 2r + 3. Let s be p(3). Put s, 3, k in ascending order. s, k, 3 Let m be ((-9)/(-18))/(1/10). Let l be 3/m - (-14)/10. Sort -5, l, -1. -5, -1, l Let r = 114 - 108. Sort -4, 2, -0.4, r in increasing order. -4, -0.4, 2, r Let j = 0.23 + -0.03. Suppose -o + 2d + 10 = -3d, -d - 2 = 0. Sort j, 2/5, o in ascending order. o, j, 2/5 Let h = -145 + 1012/7. Let g = h + 1/35. Sort 2/25, g, -0.5. -0.5, g, 2/25 Suppose 5 = -4j + 21. Suppose 3n = 16 - j. Sort n, 2/11, 0.3 in ascending order. 2/11, 0.3, n Suppose 1 = u - 3. Suppose 5t - 2 = 23. Suppose -4c + 3o = 4o + 11, -2c - 19 = to. Put 3, u, c in descending order. u, 3, c Suppose 0k = -3r + 2k - 50, 2k = 8. Let u(l) = l + 14. Let c be u(r). Sort c, 5, -1. -1, c, 5 Let a(n) = 2n - 6. Let v be a(5). Let m = 4 - -4. Suppose 2q + 2 + m = 0. Sort v, 5, q in decreasing order. 5, v, q Let u = 0.05 - 3.05. Put u, 4, 0.05 in increasing order. u, 0.05, 4 Let v(x) = x - 1. Let k be v(5). Let r be 33/6 - 1/2. Suppose -5o + r = -0o. Sort k, -3, o in ascending order. -3, o, k Let j = 26 - 24. Sort -5, 0.1, j. -5, 0.1, j Let s = -3 - -1.2. Let o = s - -2.1. Let r = 0.1 - 0.3. Put o, 0, r in decreasing order. o, 0, r Suppose 0a + 4a - 24 = 0. Suppose aw - 3w = 0. Let b be -1 + -2 + w/3. Sort b, 3, -4. -4, b, 3 Suppose -2k = -2p, -7k - 5p + 18 = -6k. Sort -8, -1, k in descending order. k, -1, -8 Let c = 29 - 19. Let y be 1/(2 - (-36)/(-20)). Let q be 6/cy/4. Put q, -5, -0.2 in increasing order. -5, -0.2, q Let d = 118 + -117.8. Sort 3, -0.3, d, -9 in decreasing order. 3, d, -0.3, -9 Let r = 11 + -25. Let x = -19 - r. Put x, 4, -0.2 in descending order. 4, -0.2, x Let u be (5 + 48)-1 - -3. Sort u, -1, -1/9, -2/3. u, -1, -2/3, -1/9 Let d = 16 - 20. Sort 6, 5, -1, d in decreasing order. 6, 5, -1, d Let f = 5.83 + -1.83. Put f, 0.3, -1/6, -1/3 in descending order. f, 0.3, -1/6, -1/3 Let k be (-24)/62/(-4). Suppose -i = -2z + 12, 2i + 0i - 24 = -4z. Sort z, k, -1. -1, k, z Let t = 1.1 + -1.8. Let f = t + 0.3. Sort -5, f, 0.2 in ascending order. -5, f, 0.2 Suppose 5g = 5r, 3r - 7r - 10 = -2g. Sort 6, r, -2 in decreasing order. 6, -2, r Let p be (3/(-6))/(-1 - -3). Let c = -8 - -8.04. Let h = c + -1.04. Put h, p, -2 in descending order. p, h, -2 Suppose 0 = 2j - 0 + 8. Suppose -3i + 2 = -2i. Let p be 4/6 + i/6. Sort j, p, 3 in ascending order. j, p, 3 Let x = -0.9 - -3.9. Sort -5, 1/4, x in descending order. x, 1/4, -5 Let q = 24/23 - 27/92. Let c = 0.4 + -0.2. Let s = 0.3 - c. Put s, -3, q in decreasing order. q, s, -3 Let k = -10 + 14. Let p be -21(k - 2). Put 6, -3, p in descending order. 6, -3, p Let j(y) = y*3 + 5y*2 - 6y - 5. Let g be j(-6). Let l(a) = -a*3 + 20a*2 - 19a + 5. Let x be l(19). Sort g, x, 0. g, 0, x Suppose r + 9 = -2r, -r - 15 = -3v. Suppose 0 = -5f + m, -m = -2f + v*f - 7. Sort 0, 3, f. 0, f, 3 Let n = -16 -	{ "pile_set_name": "DM Mathematics" }
sequence hxx. 3/56 Three letters picked without replacement from klfaf. Give prob of sequence alk. 1/60 Three letters picked without replacement from jlddlb. Give prob of sequence ljd. 1/30 Calculate prob of sequence ysyl when four letters picked without replacement from {s: 11, l: 4, y: 4}. 11/1938 Four letters picked without replacement from {q: 4, v: 1, p: 3}. What is prob of sequence vppq? 1/70 Two letters picked without replacement from {a: 4}. What is prob of sequence aa? 1 Four letters picked without replacement from {s: 12, g: 2, y: 3}. Give prob of sequence gsss. 11/238 What is prob of sequence zjjj when four letters picked without replacement from {j: 9, z: 5}? 15/143 What is prob of sequence tib when three letters picked without replacement from tkktfib? 1/105 Three letters picked without replacement from uuiuuuiliuli. What is prob of sequence iul? 2/55 Two letters picked without replacement from {u: 7, q: 6, j: 2}. What is prob of sequence qj? 2/35 Two letters picked without replacement from {x: 2, z: 2, s: 1, m: 1}. What is prob of sequence zs? 1/15 Four letters picked without replacement from {q: 14, v: 1}. Give prob of sequence qvvq. 0 Two letters picked without replacement from {d: 1, t: 1, w: 1, i: 2}. What is prob of sequence td? 1/20 What is prob of sequence by when two letters picked without replacement from {b: 1, y: 2}? 1/3 Four letters picked without replacement from ttetee. Give prob of sequence tete. 1/10 Calculate prob of sequence rii when three letters picked without replacement from ihiirirrhiir. 1/11 Three letters picked without replacement from auejzuiuzaea. What is prob of sequence jiu? 1/440 What is prob of sequence fwm when three letters picked without replacement from {m: 6, e: 2, f: 1, x: 3, w: 5}? 1/136 Calculate prob of sequence nk when two letters picked without replacement from {n: 6, f: 1, k: 3, i: 2, r: 2}. 9/91 Calculate prob of sequence dd when two letters picked without replacement from ddkmmdmmm. 1/12 What is prob of sequence dr when two letters picked without replacement from rdddr? 3/10 Four letters picked without replacement from {t: 5, j: 3, r: 2, s: 2}. Give prob of sequence srrt. 1/594 Three letters picked without replacement from msmds. What is prob of sequence dss? 1/30 Three letters picked without replacement from oocoooooomo. Give prob of sequence cmo. 1/110 Calculate prob of sequence tttt when four letters picked without replacement from tttttttttt. 1 What is prob of sequence ogp when three letters picked without replacement from {m: 1, p: 1, o: 1, g: 1, q: 1}? 1/60 What is prob of sequence qi when two letters picked without replacement from {q: 3, i: 2}? 3/10 What is prob of sequence bbv when three letters picked without replacement from {b: 5, d: 3, r: 1, t: 3, h: 3, v: 3}? 5/408 Three letters picked without replacement from {k: 2, r: 2, h: 3, d: 7, i: 4}. Give prob of sequence rkk. 1/1224 What is prob of sequence nj when two letters picked without replacement from jnnjnjn? 2/7 What is prob of sequence ddnd when four letters picked without replacement from {k: 4, y: 7, n: 1, d: 8}? 14/4845 What is prob of sequence etq when three letters picked without replacement from {q: 3, t: 1, z: 4, e: 2, y: 1}? 1/165 Four letters picked without replacement from znnnzzzznnznnz. Give prob of sequence zzzn. 35/572 Three letters picked without replacement from xidiitxxmhmdix. Give prob of sequence ddh. 1/1092 Calculate prob of sequence kkrl when four letters picked without replacement from lrarllaaalalklrl. 0 Three letters picked without replacement from {p: 1, n: 2, b: 7, s: 4, u: 3}. Give prob of sequence uss. 3/340 Two letters picked without replacement from {r: 7, n: 4}. What is prob of sequence nr? 14/55 Four letters picked without replacement from txtxttttttttxtttxtt. Give prob of sequence ttxx. 35/1292 Two letters picked without replacement from eeeeueeeeue. What is prob of sequence ue? 9/55 Three letters picked without replacement from {k: 2, l: 6, z: 1, c: 3, f: 2, n: 1}. What is prob of sequence zkl? 2/455 Three letters picked without replacement from {v: 3, o: 11}. Give prob of sequence ovv. 11/364 What is prob of sequence tz when two letters picked without replacement from tzttktttttttzt? 11/91 Three letters picked without replacement from {n: 3, m: 1, r: 2, w: 4, v: 2}. Give prob of sequence wnn. 1/55 Two letters picked without replacement from {j: 4, u: 3}. What is prob of sequence uj? 2/7 Four letters picked without replacement from ubuuluvnubblnu. What is prob of sequence nvln? 1/6006 Three letters picked without replacement from {l: 2, n: 1, x: 4, d: 3, f: 1, z: 1}. What is prob of sequence nfx? 1/330 Three letters picked without replacement from {n: 3, b: 3, h: 3, s: 1}. What is prob of sequence nhh? 1/40 Two letters picked without replacement from vkddgdddkgvvddddf. Give prob of sequence vd. 27/272 What is prob of sequence hdh when three letters picked without replacement from hhhhddhhhdhdhhhhhhh? 140/969 What is prob of sequence kcc when three letters picked without replacement from kckckckckk? 1/10 Calculate prob of sequence yyyy when four letters picked without replacement from {y: 9, u: 3}. 14/55 Calculate prob of sequence dd when two letters picked without replacement from ddydydddddd. 36/55 What is prob of sequence rrp when three letters picked without replacement from rqqqraqqqfqarqpraff? 2/969 What is prob of sequence xj when two letters picked without replacement from nxdjg? 1/20 Two letters picked without replacement from {m: 2, t: 1, e: 1, u: 6, f: 3}. Give prob of sequence ft. 1/52 What is prob of sequence iajw when four letters picked without replacement from wiumwuuwwiaaija? 1/910 Calculate prob of sequence uumu when four letters picked without replacement from guuugugumuuggguuuggu. 11/1292 What is prob of sequence bb when two letters picked without replacement from xbxbbxxxbbxbxbxbxxxb? 18/95 Four letters picked without replacement from jjjjjjjqqjqjjj. What is prob of sequence qqjq? 1/364 Calculate prob of sequence af when two letters picked without replacement from {f: 2, a: 4}. 4/15 Four letters picked without replacement from kuyjyyuyjkycyyy. What is prob of sequence ykjc? 4/4095 Two letters picked without replacement from {y: 11, k: 3, w: 2, v: 2, f: 1}. Give prob of sequence kf. 1/114 Two letters picked without replacement from fzzfffyyzskyflfylf. Give prob of sequence yf. 14/153 Three letters picked without replacement from pllllxphxhzz. Give prob of sequence hhz. 1/330 What is prob of sequence xjj when three letters picked without replacement from {h: 1, j: 2, x: 7}? 7/360 Calculate prob of sequence sq when two letters picked without replacement from fqsqqqffffffqsfqfqff. 7/190 What is prob of sequence off when three letters picked without replacement from {o: 4, n: 2, f: 7}? 14/143 Three letters picked without replacement from {b: 4, s: 3, k: 1, g: 7, y: 3}. What is prob of sequence bbk? 1/408 Calculate prob of sequence txx when three letters picked without replacement from tttttttxtxttttxttt. 5/272 What is prob of sequence sx when two letters picked without replacement from {c: 1, b: 2, s: 4, x: 1}? 1/14 What is prob of sequence nssn when four letters picked without replacement from nnssssnnnssnnsnsnsn? 45/646 What is prob of sequence oib when three letters picked without replacement from {i: 1, b: 1, t: 1, o: 1, s: 1}? 1/60 Three letters picked without replacement from gzxxsxz. Give prob of sequence zzx. 1/35 Two letters picked without replacement from {s: 7, a: 4}. What is prob of sequence as? 14/55 Four letters picked without replacement from ijtza. Give prob of sequence ztji. 1/120 Three letters picked without replacement from {c: 11, m: 9}. Give prob of sequence mmc. 11/95 Three letters picked without replacement from ayytdyrdyxtr. What is prob of sequence yyt? 1/55 Three letters picked without replacement from {w: 11, p: 2, d: 2}. Give prob of sequence dwd. 11/1365 Two letters picked without replacement from {a: 3, v: 3, c: 1, h: 1, l: 3}. Give prob of sequence hl. 3/110 Three letters picked without replacement from {b: 6, i: 1, h: 1, e: 3, r: 4, a: 3}. Give prob of sequence rrh. 1/408 Calculate prob of sequence if when two letters picked without re	{ "pile_set_name": "DM Mathematics" }
when two letters picked without replacement from {a: 2, o: 1, m: 4}? 1/21 What is prob of sequence fcq when three letters picked without replacement from wqqqqqffccfg? 1/44 Two letters picked without replacement from {h: 6, i: 2, u: 2, x: 2}. Give prob of sequence ui. 1/33 Calculate prob of sequence sss when three letters picked without replacement from {s: 3, c: 12}. 1/455 Calculate prob of sequence usr when three letters picked without replacement from {u: 1, s: 1, r: 3}. 1/20 Calculate prob of sequence vnv when three letters picked without replacement from {f: 1, v: 2, n: 1}. 1/12 What is prob of sequence bbq when three letters picked without replacement from qbvvvqqb? 1/56 Two letters picked without replacement from {m: 3, v: 2}. What is prob of sequence mv? 3/10 Two letters picked without replacement from radrrcd. What is prob of sequence dd? 1/21 Four letters picked without replacement from {f: 10}. Give prob of sequence ffff. 1 Four letters picked without replacement from {r: 2, g: 5, c: 4}. Give prob of sequence rgrc. 1/198 What is prob of sequence jjtj when four letters picked without replacement from {t: 3, j: 8}? 7/55 What is prob of sequence ez when two letters picked without replacement from ppzpezee? 3/28 Two letters picked without replacement from sqqmssqssm. Give prob of sequence ms. 1/9 Two letters picked without replacement from rrsikriiisli. What is prob of sequence sl? 1/66 Four letters picked without replacement from {x: 1, m: 1, c: 2, n: 2}. What is prob of sequence mnxn? 1/180 Two letters picked without replacement from gqsuyyx. What is prob of sequence yy? 1/21 Calculate prob of sequence rrr when three letters picked without replacement from {p: 4, z: 3, r: 4, c: 2, k: 1, t: 1}. 4/455 Calculate prob of sequence idi when three letters picked without replacement from {d: 5, v: 7, i: 7}. 35/969 What is prob of sequence crc when three letters picked without replacement from ccrrrccrcrrcr? 35/286 Three letters picked without replacement from ljjjjjljjjjjljjjjj. What is prob of sequence lll? 1/816 Four letters picked without replacement from oxmow. Give prob of sequence owmx. 1/60 Two letters picked without replacement from {u: 5, k: 8, b: 3}. Give prob of sequence uk. 1/6 What is prob of sequence yqyy when four letters picked without replacement from bbyhhzzhbqhy? 0 What is prob of sequence rc when two letters picked without replacement from xxcmmmmcmcrxrxcmmms? 4/171 Two letters picked without replacement from {o: 3, k: 7, r: 7, t: 3}. Give prob of sequence ot. 9/380 What is prob of sequence nkem when four letters picked without replacement from wewknnekooemowoeeke? 1/2584 Two letters picked without replacement from rrkbbrrbub. What is prob of sequence bk? 2/45 Three letters picked without replacement from iaaajajaaaaaaaaajaaa. What is prob of sequence iai? 0 What is prob of sequence el when two letters picked without replacement from eyeylxii? 1/28 Four letters picked without replacement from {b: 7, g: 7, e: 4}. What is prob of sequence gegb? 49/3060 Three letters picked without replacement from {u: 3, a: 1, l: 5, o: 1}. What is prob of sequence auo? 1/240 Two letters picked without replacement from {p: 1, r: 1, t: 1}. What is prob of sequence tr? 1/6 What is prob of sequence gvy when three letters picked without replacement from {g: 5, y: 4, v: 1, x: 6}? 1/168 Four letters picked without replacement from eceppecpexpeeee. What is prob of sequence pexp? 4/1365 Four letters picked without replacement from kttakkafktkhkkkkzf. What is prob of sequence zath? 1/12240 Three letters picked without replacement from sgzpg. Give prob of sequence gzg. 1/30 What is prob of sequence fjo when three letters picked without replacement from ofjel? 1/60 Four letters picked without replacement from {q: 4, v: 3, y: 8, f: 2}. What is prob of sequence fqyy? 2/255 What is prob of sequence fbj when three letters picked without replacement from {f: 2, b: 1, j: 1}? 1/12 Calculate prob of sequence sq when two letters picked without replacement from {l: 3, s: 3, z: 2, q: 7}. 1/10 Two letters picked without replacement from {k: 1, b: 2, s: 1, z: 1}. Give prob of sequence kz. 1/20 Three letters picked without replacement from {j: 7, i: 5}. Give prob of sequence jij. 7/44 Two letters picked without replacement from ubycjjsc. What is prob of sequence us? 1/56 Two letters picked without replacement from {t: 3, l: 4, h: 2}. What is prob of sequence lh? 1/9 Calculate prob of sequence rm when two letters picked without replacement from {s: 2, m: 1, r: 1}. 1/12 What is prob of sequence pn when two letters picked without replacement from nnnnnnnpnnnnn? 1/13 Three letters picked without replacement from ixxxxxxx. Give prob of sequence ixx. 1/8 Two letters picked without replacement from {y: 2, r: 1, x: 3, t: 1, c: 3, k: 1}. What is prob of sequence cc? 3/55 Four letters picked without replacement from namlmmmmemmllmmlma. Give prob of sequence almm. 1/102 Two letters picked without replacement from rrubvej. Give prob of sequence rv. 1/21 Three letters picked without replacement from hccxcuhhuquxuuhhxc. Give prob of sequence qux. 5/1632 What is prob of sequence onmm when four letters picked without replacement from mmonnnonmm? 2/105 Two letters picked without replacement from {i: 5, q: 5}. What is prob of sequence qi? 5/18 What is prob of sequence wwtt when four letters picked without replacement from tttttttwwttt? 1/66 What is prob of sequence kisn when four letters picked without replacement from {i: 2, s: 2, j: 1, k: 1, n: 2, e: 4}? 1/1485 Calculate prob of sequence yy when two letters picked without replacement from {y: 3, k: 7}. 1/15 What is prob of sequence kfh when three letters picked without replacement from {k: 2, r: 1, c: 4, h: 3, i: 4, f: 6}? 1/190 Two letters picked without replacement from aaaaaitiaiaeaeeaaeaa. What is prob of sequence ae? 12/95 Three letters picked without replacement from dtnsydonnyystdn. What is prob of sequence dtn? 4/455 What is prob of sequence uu when two letters picked without replacement from luuuuuluuulullll? 3/10 What is prob of sequence aaia when four letters picked without replacement from {i: 8, z: 1, a: 4}? 8/715 What is prob of sequence bdz when three letters picked without replacement from {p: 1, b: 6, d: 6, z: 1, j: 6}? 1/190 What is prob of sequence mh when two letters picked without replacement from mmmmhhmmmmmmmmmmmhmm? 51/380 Two letters picked without replacement from {i: 2, h: 10, c: 2, x: 6}. Give prob of sequence cc. 1/190 Three letters picked without replacement from mvvmkwmwkvkwkmmw. Give prob of sequence wwv. 3/280 Three letters picked without replacement from oaaoaooaoaaaaaaaoa. What is prob of sequence oao? 5/68 What is prob of sequence xb when two letters picked without replacement from xbzzzxbxzxbx? 5/44 Three letters picked without replacement from ffqfaafqfafffafffaff. Give prob of sequence qaa. 1/171 Two letters picked without replacement from {u: 1, n: 1, y: 3, j: 4, x: 9}. Give prob of sequence jx. 2/17 What is prob of sequence wwqw when four letters picked without replacement from {o: 2, h: 6, m: 5, q: 1, w: 3}? 1/9520 What is prob of sequence dz when two letters picked without replacement from zddz? 1/3 Three letters picked without replacement from {m: 3, w: 5}. What is prob of sequence mww? 5/28 Calculate prob of sequence isd when three letters picked without replacement from diidddbibddsdbsid. 4/255 What is prob of sequence kjoo when four letters picked without replacement from {j: 6, o: 2, k: 9, p: 2}? 3/2584 Calculate prob of sequence ab when two letters picked without replacement from caaxaaxb. 1/14 Three letters picked without replacement from auuuaaaaaaaa. What is prob of sequence auu? 9/220 Four letters picked without replacement from {e: 1, i: 6, o: 5, f: 1, v: 2, l: 2}. Give prob of sequence ioeo. 1/476 What is prob of sequence ad when two letters picked without replacement from aaaddahddaahd? 5/26 Two letters picked without replacement from kykkykkkkykkyk. Give prob of sequence yk. 20/91 Calculate prob of sequence oj when two letters picked without replacement from nibnojg. 1/42 Calculate prob of sequence gg when two letters picked without replacement from {p: 1, g: 2}. 1/3 Wha	{ "pile_set_name": "DM Mathematics" }
i) = i*2 - 3i + 3. Let q be m(7). Let f(h) = 12 - q + 19 + 14h. Let v(d) = -3d. Let a(x) = x. Let j(r) = -10a(r) - 4v(r). Determine f(j(l)). 28l Let w(f) = 19f - 22. Let j(g) = -3g2 + 628. Determine j(w(a)). -1083a*2 + 2508a - 824 Let i(v) = -37v + 1. Let c(j) = -10756293j. Calculate i(c(s)). 397982841s + 1 Let n(z) = 6342421 - 19z - 6342421. Let l(y) = -110y + 1. Calculate n(l(i)). 2090i - 19 Let j(w) = 2w2. Let x(h) = 4235200h*2 + 7941h - 15882. Let y(a) = 2667a2 + 5a - 10. Let v(p) = -5x(p) + 7941y(p). What is v(j(k))? 10588k4 Let f(k) = 30k*2. Let d(l) be the second derivative of -1 + l + 0l*3 + 0l*2 + 1/4l*4. What is f(d(y))? 270y*4 Let p(x) = 118x*2 - 5x + 10. Let c(a) = 24a2 - a + 2. Let w(o) = 5c(o) - p(o). Let j(n) = -1071n. Give w(j(d)). 2294082d*2 Let g(z) = -7z. Let s be 2 - (-1 - (-3 - -2))/2. Let q(r) = 17r2 + 15r*s - 25r*2. Calculate g(q(t)). -49t*2 Suppose 7g = 69318 + 18868. Let z(s) = s*2 + g - 12598. Let t(y) = 43y*2. What is t(z(f))? 43f*4 Let s(y) be the third derivative of -11y*4/12 + 86y*2 - 4. Let f(c) = -80c*2. Determine f(s(i)). -38720i*2 Let b(r) = 10r. Let m(v) = -1070307v2. Calculate b(m(w)). -10703070w*2 Let o(l) = -l. Let p(z) be the third derivative of 64z2 - z4 - 13z2 + 9z*4 - 9z*4. Determine o(p(n)). 24n Let z(j) = 457j2 - 2j. Let y(q) = 70q + 66q + 51q - 182q. Determine y(z(i)). 2285i2 - 10i Let z(q) be the second derivative of -3q4/2 - q2/2 - 3138q. Let d(o) = 39o2. Calculate z(d(t)). -27378t*4 - 1 Let s(i) = 2i*2 + 309i. Let t(a) be the first derivative of a*4/24 - 281a*2/2 - 23. Let n(m) be the second derivative of t(m). Determine s(n(l)). 2l*2 + 309l Let l(w) = 12w - 2w - 7w. Let a(z) = 396z*2 - 45z + 45. Let t(h) = -18h2 + 2h - 2. Let o(k) = -2a(k) - 45t(k). What is o(l(s))? 162s2 Let w(c) = -17c + 57c2 - 12c - 55c2 + 29c. Let g(n) = -457n2. Give g(w(q)). -1828q*4 Let k(w) = 65915080w*2. Let s(j) = 2j. Calculate s(k(n)). 131830160n2 Let y(n) be the first derivative of 75n*2/2 - 1. Let u(i) be the first derivative of -2i*3/3 - 12864. What is u(y(o))? -11250o*2 Let s(o) = -101o*2 - o. Let d(w) = 620w + 2. Calculate d(s(p)). -62620p2 - 620p + 2 Let o(q) = -4 + 4 - 13506q + 13519q. Let z = 7 + -2. Let l(g) = zg2 + 0g*2 - 4g*2. Give o(l(k)). 13k*2 Let m(g) = 124g*2. Let j(h) = h + 3. Let f(r) = 8r + 18. Suppose -c = 4c + 10, 4k - 32 = 4c. Let i(z) = kj(z) - f(z). Give i(m(l)). -248l2 Let f(a) = -36199897a. Let q(t) = 3t2. Determine q(f(u)). 3931297628431827u*2 Let u(c) = 2c - 7. Let d(t) = -35t + 140. Let w(z) = d(z) + 20u(z). Let g(l) = 1100l. What is w(g(k))? 5500k Let l = -59261/6 + 9877. Let s(u) be the second derivative of -9/2u2 + 0 - lu*3 + 8u. Let p(i) = 2i2. What is p(s(f))? 2f*2 + 36f + 162 Let i(v) be the third derivative of 1261v5/30 + 2v*2 + 98v. Let c(x) = x. Calculate c(i(q)). 2522q2 Let g(m) = -802378 + 1604836 + 9m - 802401. Let p(a) = 3a. Calculate g(p(u)). 27u + 57 Let z(h) be the third derivative of h*4/12 + 2h*3 - 2h*2 + 166. Let b(i) = -2i - 1. Determine b(z(n)). -4n - 25 Let a(r) = -16r. Suppose 4k + p + 136 = 4p, -2p + 140 = -4k. Let t = 45 + k. Let b(f) = -tf2 + 2f*2 + 13f*2 - 8f*2. Determine a(b(l)). 16l*2 Let a(p) = 8p. Let r(w) = -10w. Let t = 1 - 21. Let q(k) = -3k. Let g(l) = tq(l) + 5r(l). What is a(g(o))? 80o Let x(w) = 3w. Let p(j) be the first derivative of -3j5/40 + 19j*3 + 26. Let m(r) be the third derivative of p(r). Calculate m(x(s)). -27s Let h(a) = 3. Let d(l) = -l + 1. Let f(o) = -3d(o) + h(o). Let u(r) be the third derivative of 3r4/8 - r3/3 - 9r2 + 17r. Give f(u(v)). 27v - 6 Let r(q) = -7q*2 + 16q*2 - 5q*2 + 0q*2 - 6q*2. Let n(l) = 2140l*2. What is n(r(d))? 8560d*4 Let x(w) = 5w*2. Let g(o) = -4o - 1. Suppose -4f - 9f = 156. Let t(r) = -18r - 6. Let p(s) = fg(s) + 2t(s). What is p(x(v))? 60v*2 Let y(h) = -29h. Let g(q) = -880q2 - 128. Let r(u) = 135u*2 + 20. Let t(d) = 5g(d) + 32r(d). Calculate t(y(c)). -67280c*2 Let m(k) = -246k - 23. Let a(x) = 551x. Determine a(m(u)). -135546u - 12673 Let y(b) = -14b2. Let s(u) be the second derivative of -u5/15 + 91u*2/2 + 57u. Let p(f) be the first derivative of s(f). Determine p(y(a)). -784a4 Let y(m) = -90779m. Let f(c) = -c - 18. What is f(y(b))? 90779b - 18 Let f be 4 - -2(4 + -5). Suppose 0 = -4h + 10 - f. Let a(j) = 54 - 48jh - 54. Let m(t) = -t2. Determine m(a(d)). -2304d4 Suppose 2d = -473 + 1313. Let r(q) = 840q - 421q - dq. Let y(k) = -58k. Give r(y(w)). 58w Let p(l) = -367l - 2 - 96l + 68l + 2. Let v(q) = 2q2. What is p(v(z))? -790z*2 Let h(x) be the second derivative of 7x*4/12 + 1809x. Let v(k) be the first derivative of 2 + 0k2 + 0k - 1/3k3. What is v(h(n))? -49n*4 Suppose -1080 = 3l - 15l. Let m = -87 + l. Let p(c) = c - 5c + mc - 2c. Let x(k) = 26k2. What is p(x(v))? -78v2 Let l(f) be the first derivative of f4/12 + 35f2 - 2f - 236. Let m(c) be the second derivative of l(c). Let t(a) = -4a2 - 1. Calculate t(m(s)). -16s*2 - 1 Let q(c) = -7c*2 - 30c - 8. Let d(k) = 43 - 30 - 36 - 85k - 20k*2. Let x(t) = 6d(t) - 17q(t). Let w(p) = p. Determine x(w(o)). -o2 - 2 Let m(u) = -2u*2 + 69u - 4. Let q(y) = 15y2 - 552y + 31. Let l(s) = -46m(s) - 6q(s). Let d(i) = -2i. Determine l(d(r)). 8r*2 - 276r - 2 Let h(j) = -2j. Let b = 9810 - -1738. Let o(a) = 14a*2 - b + 11548. What is h(o(r))? -28r*2 Let u(p) = 2p*3 + 13p*2 - 8p + 20. Let r be u(-7). Let b(w) = 839w - r + 27 - 838w. Let o(t) = -5 + 30t + 5. Give b(o(l)). 30l Let x(c) be the third derivative of 1 + 36c2 + 1/24c*4 + 0c + 1/2c3. Let y(d) = d. Give y(x(q)). q + 3 Suppose -5q + n = 8, 7q - 3q = 4n. Let d(m) = 8m - 2. Let f(h) = -78h + 21. Let y(g) = qf(g) - 21d(g). Let t(w) = -9w. What is t(y(j))? 108j Let h(c) = -19394c. Let y(g) = -73g + 2. Calculate h(y(a)). 1415762a - 38788 Let l(n) = 898918n. Let z(y) = -73y. Calculate l(z(d)). -65621014d Let j be (-2 - -1)1/(25/(-20)). Suppose -p = 2 - 8. Let c(y) = 4y*j - 2y*2 - py*2. Let a(q) = -q. What is a(c(t))? 4t*2 Let a(k) = -14k*2 - 20k + 17. Let i(o) = 5o2 + 7o - 6. Let g(b) = 6a(b) + 17i(b). Let m(r) be the first derivative of -r*3 + 15511. Give m(g(c)). -3c*4 + 6c*3 - 3c*2 Let f(t) = -223t + 19. Let j(l) = -47l + 4. Let k(x) = -4f(x) + 19j(x). Let r(p) = -19p. Let m(i) = -10i. Let w(y) = -7m(y) + 4r(y). Determine w(k(h)). 6h Let i(w) = 0 - w + 1 - 1. Let v(q) = -q - 374. Let h(z) = z + 447. Let p(g) = 2h(g) + 3v(g). What is p(i(u))? u - 228 Let z(d) = 11d2 - 8d - 26. Let o be z(-9). Let q(a) = 13 - 931a - 13 + oa. Let g(x) = x. What is q(g(n))? 6n Let c(m) = -13m. Let h(a) be the second derivative of 25a3/3 - 2a - 659. What is h(c(u))? -650u Let a(z) = -3z*2. Let r(s) be the first derivative of -84s*2 + 1317. Give r(a(u)). 504u*2 Let i(q) = 271q*2 - 102q. Let a(j) = 1142j2. What is i(a(z))? 353428444z*4 - 116484z*2 Let y(a) = -52a*2 - 1567. Let q(c) = -15c*2 - 5. Give y(q(x)). -11700x*4 - 7800x*2 - 2867 Let o(k) = 513k. Let z(s) be the second derivative of -s*5/60 - 21s*3/2 + 71s. Let t(y) be the second derivative of z(y). Determine o(t(d)). -1026d Let c(a) = 1 - 12a*2 - a - 2a*2 + 15a*2. Let h(d) = 4d*2 + 2d - 2. Let i(y) = 4c(y) + 2h(y). Let s(k) = -2k2. Calculate s(i(p)). -288p*4 Let p(j) = -315j + 183. Let k(u) = -2u - 999. Calculate k(p(o)). 630o - 1365 Let r(d) = 5d - 12. Let z(l) = 6l - 14. Let p = -479 - -485. Let u(n) = pz(n) - 7r(n). Let i(m) = -28m. Determine i(u(q)). -28q Let v(o) = 7o2 - 189o - 63. Let n(h) = 3h + 1. Let m(z) = -252n(z) - 4v(z). Let w(b) = 80b. Calculate w(m(r)). -2240r2 Let z be 0 + 3/6 - (-822)/4. Let u(c) = -421c + zc + 211c. Let f(b) = -11b. Calculate u(f(q)). 44q Let w(h) = -16h + 2217484 - 2217484. Let f(l) = -16l - 1. What is w(f(i))? 256i + 16 Let q(w) = 3w. Let m(l) = -2l - 375427. What is q(m(z))? -6z - 11262	{ "pile_set_name": "DM Mathematics" }
22152970057 a prime number? True Is 22659860087 a prime number? False Is 30462189839 composite? False Is 2063621657 a composite number? True Is 6756657197 prime? False Is 13176102233 composite? True Is 36765310279 a composite number? False Is 170487214489 composite? True Is 620969095 prime? False Is 9081624491 composite? True Is 700607573 composite? False Is 516166561 composite? False Is 3891564941 a composite number? True Is 1654641991 composite? False Is 1089467929 a composite number? True Is 127013300866 prime? False Is 1362578417 a prime number? True Is 6061442137 prime? False Is 814037869 prime? False Is 1944189803 a composite number? True Is 289868827 a composite number? False Is 12525603863 prime? True Is 92627113 prime? True Is 22873056145 a prime number? False Is 30557067994 a composite number? True Is 297612233 a composite number? True Is 461015551 composite? False Is 160699519 a prime number? True Is 605198189 a composite number? True Is 186632791 a composite number? False Is 5079020297 a prime number? False Is 40654366439 a prime number? True Is 2953042093 a prime number? True Is 19727549297 a prime number? False Is 3019954871 composite? False Is 57396197 a prime number? False Is 6059889629 composite? False Is 64637519659 prime? True Is 165486287327 a prime number? False Is 58851847 composite? False Is 45920047427 prime? True Is 383819809 a prime number? True Is 106202538191 composite? True Is 810026207 composite? False Is 67685597297 prime? True Is 2734180733 prime? False Is 5192971213 composite? False Is 10883221 composite? False Is 4448193791 a prime number? True Is 3380805797 composite? False Is 10385553983 a composite number? True Is 1422560087 composite? True Is 11437865083 prime? False Is 47525924389 composite? False Is 1125419531 a prime number? True Is 2005488907 composite? False Is 6015902929 a composite number? True Is 563179273 composite? True Is 1137495911 a composite number? True Is 403248845 a prime number? False Is 916974923 prime? False Is 28114994767 a composite number? True Is 1182464471 a prime number? True Is 63479561 prime? False Is 96310535291 a prime number? False Is 8251319033 composite? True Is 311332993295 a prime number? False Is 1173744526 composite? True Is 9976946059 a composite number? False Is 14220064253 a prime number? False Is 850374761 a prime number? True Is 9087221953 a prime number? True Is 85009356589 composite? True Is 29848303651 a prime number? False Is 5080192951 a prime number? False Is 1098753569 composite? True Is 9676687331 prime? True Is 118928707 a prime number? True Is 556878901 prime? True Is 16704690053 a prime number? False Is 1983398947 prime? True Is 4568558089 composite? True Is 154771192034 a prime number? False Is 344450213 a prime number? True Is 1399097251 composite? True Is 18560268113 prime? True Is 7529368943 prime? False Is 21845038331 composite? False Is 80568405529 a composite number? False Is 4259351633 a prime number? True Is 35261713231 prime? True Is 1043779661 a composite number? False Is 4068266161 a composite number? False Is 14496639869 a prime number? True Is 2118030659 a prime number? True Is 10964385193 prime? True Is 532951274 composite? True Is 6038076907 a composite number? False Is 2761337429 composite? False Is 39556999 a prime number? False Is 31390087 prime? True Is 1708501687 prime? True Is 5255755223 prime? False Is 121954157 a composite number? True Is 24612509057 prime? True Is 728358311 prime? True Is 141256097 a composite number? True Is 14753738947 composite? False Is 2393819689 a prime number? True Is 732518443 a composite number? False Is 4411650731 a prime number? True Is 3859369013 prime? True Is 8247307598 a prime number? False Is 181139501 composite? False Is 20425842037 prime? False Is 1152455033 composite? True Is 2384204843 a composite number? False Is 22166834117 a composite number? False Is 720936509 a composite number? False Is 147974483 prime? True Is 7480245749 prime? False Is 31306549331 composite? False Is 16059465809 a composite number? False Is 1103066693 a prime number? True Is 400967129 a composite number? False Is 19073577779 a prime number? False Is 80295041 a composite number? False Is 1670527 a prime number? True Is 738618905 prime? False Is 175690267 composite? True Is 7792562345 composite? True Is 4868414261 a composite number? False Is 407548931 a composite number? True Is 226978129 prime? False Is 152397863 composite? False Is 134771961637 a composite number? True Is 9793546253 a prime number? True Is 3514311239 composite? True Is 292344799 a composite number? True Is 1872616849 a composite number? True Is 1473610907 a prime number? False Is 8789902021 composite? True Is 26745887 prime? False Is 567563723 composite? True Is 2683609769 composite? False Is 39045780107 prime? True Is 738000947 a prime number? True Is 23023557659 composite? False Is 684869093 prime? False Is 1868801227 a prime number? True Is 60110958059 a prime number? False Is 305368801 prime? True Is 4679082677 a composite number? False Is 1185824213 composite? True Is 405709683 a prime number? False Is 77989901 composite? True Is 1294886339 a prime number? True Is 11263102843 a prime number? False Is 63463550771 composite? True Is 1891425353 composite? True Is 13237664519 composite? False Is 12494092231 a composite number? False Is 59544965549 prime? True Is 3572677253 composite? False Is 486524009 composite? True Is 166428839 a composite number? False Is 2293485889 a composite number? False Is 29683892101 a prime number? False Is 1109007197 composite? False Is 11048974477 composite? False Is 265437953 a composite number? True Is 5528983753 prime? False Is 857507359 prime? True Is 33378828479 a composite number? True Is 460833533 a composite number? False Is 585493813 a composite number? True Is 3382964527 composite? False Is 1053122029 a composite number? True Is 28224715661 a composite number? True Is 86177342 prime? False Is 3874739665 prime? False Is 2590653526 composite? True Is 12933754277 prime? True Is 75148067419 composite? True Is 18983291867 a prime number? False Is 1896171217 a prime number? False Is 1564293307 a prime number? True Is 182193395651 a composite number? False Is 28975367 a composite number? False Is 941909987 composite? False Is 3204114971 composite? True Is 52604503 prime? False Is 20417101 a composite number? False Is 2298524307 prime? False Is 4411255711 a prime number? False Is 125476937 a composite number? True Is 781099219 prime? False Is 832625191 composite? False Is 139252791253 a composite number? False Is 3912103883 a prime number? True Is 4676240941 a prime number? False Is 1953090397 a composite number? True Is 1043146141 composite? False Is 9980746577 a composite number? True Is 219400879 a composite number? True Is 12657852037 composite? False Is 7984271487 composite? True Is 11193249527 a composite number? False Is 2451133207 a composite number? True Is 4222658963 composite? False Is 173494936969 prime? True Is 157295261 composite? False Is 2686412329 a composite number? True Is 5211306703 a composite number? False Is 33712250873 composite? True Is 34452783671 a prime number? True Is 376451363 a composite number? False Is 11710455727 a composite number? True Is 1529395091 a composite number? True Is 537555157 a composite number? True Is 6834738073 composite? True Is 4438712147 prime? True Is 64074639479 a prime number? False Is 461181131 a composite number? False Is 22036206943 a composite number? False Is 56271433 a composite number? True Is 2382619387 composite? False Is 56143811 a composite number? False Is 810032246 a composite number? True Is 16770080681 a composite number? False Is 53015677817 prime? True Is 103209839189 prime? False Is 423860597 a composite number? True Is 59779037807 composite? False Is 13086688237 prime? False Is 13871210819 composite? False Is 153112888567 a composite number? False Is 705203747 a composite number? False Is 622563591389 a prime number? True Is 3116449181 a composite number? True Is 399290219 a composite number? False Is 1491863537 a composite number? False Is 5250529793 prime? True Is 990491507 prime? False Is 6062948809 a composite number? False Is 15704202	{ "pile_set_name": "DM Mathematics" }
44459o/6 - 20372/3 = 0. -3704, -11, -1, 1 Solve -g2/7 - 4832g/7 + 4833/7 = 0. -4833, 1 Factor 2u4/9 + 68u*3 - 410u*2/3 + 616u/9. 2u(u - 1)*2(u + 308)/9 Factor z*3 + 2312z*2 + 1334021z - 2677298. (z - 2)(z + 1157)2 Factor 2f*2 + 11818f - 94672. 2(f - 8)(f + 5917) Factor -6c3 - 206c*2 - 604c + 496. -2(c + 4)(c + 31)(3c - 2) Suppose 4v2 + 1443896v - 1443900 = 0. What is v? -360975, 1 Solve -2n5/5 + 16n*4/5 + 10n*3 - 328n*2/5 + 72n = 0. -5, 0, 2, 9 Factor 5s3 - 630s*2 - 2580s - 2600. 5(s - 130)(s + 2)*2 Factor -4i*3 + 2520524i*2. -4i*2(i - 630131) Determine p, given that -4p4 - 3172p*3 - 12644p*2 - 15788p - 6312 = 0. -789, -2, -1 Factor 2r3/9 + 58r*2/3 + 2464r/9 + 1960/3. 2(r + 3)(r + 14)(r + 70)/9 Suppose 2q*5/5 - 508q*4/5 + 7262q*3/5 - 21796q*2/5 - 46144q/5 + 61184/5 = 0. What is q? -2, 1, 8, 239 Determine p, given that -2p4 + 1820p*3 - 374066p*2 - 18192720p - 199840032 = 0. -21, 476 Let -17o2 + 19871o + 2338 = 0. What is o? -2/17, 1169 Factor j*4/3 + 16663j*3/9 + 16660j2/9. j2(j + 1)(3j + 16660)/9 Determine d, given that -50d*5 + 96160d*4 + 752202d*3 + 1714192d*2 + 1034920d + 185376 = 0. -4, -3, -2/5, 1931 Suppose -2g4 - 26g*3 + 136g*2 + 2520g + 7200 = 0. What is g? -12, -6, -5, 10 Determine h so that -20h5 - 328h*4 - 1536h*3 - 1496h*2 + 404h + 672 = 0. -8, -7, -1, 3/5 What is o in -27o4/4 - 435o*3/4 - 423o*2/4 + 435o/4 + 225/2 = 0? -15, -10/9, -1, 1 What is q in -2q2/5 + 487046q/5 - 487044/5 = 0? 1, 243522 Solve 12065u3 - 132685u*2 + 289230u + 720 = 0 for u. -6/2413, 3, 8 Find z, given that -8z4/11 - 974z*3/11 - 16792z*2/11 - 4736z = 0. -407/4, -16, -4, 0 Solve -12x2/5 + 2097x - 58305 = 0. 115/4, 845 Suppose -m*5/3 + 15m*4 + 193m*3/3 + 49m2 = 0. What is m? -3, -1, 0, 49 Factor x4/7 + 942x3/7 + 270948x*2/7 + 14763970x/7 - 2640819957/7. (x - 69)(x + 337)3/7 Let 7k*5 - 26k*4 + 4k*3 + 42k*2 - 27k = 0. Calculate k. -9/7, 0, 1, 3 Factor -m*4 + 99m*3 + 9315m*2 + 147609m - 529254. -(m - 162)(m - 3)(m + 33)*2 Determine g so that 2g*4/11 + 10880g*3/11 + 21752g2/11 = 0. -5438, -2, 0 Find d, given that d3 - 25246d2 + 159314880d + 318730752 = 0. -2, 12624 Solve -y*5/6 + 31y*4/3 - 290y*3/3 - 1721y*2/3 + 29381y/6 + 59290/3 = 0 for y. -5, -4, 11, 49 Let 4o2/3 - 825404o/3 - 275136 = 0. What is o? -1, 206352 Factor 2r2/13 - 29306r/13 - 87936/13. 2(r - 14656)(r + 3)/13 Find t such that 2t5/15 + 3004t*4/5 + 10170026t*3/15 + 13524008t*2/5 + 40536008t/15 = 0. -2251, -2, 0 Suppose 147p5/5 - 69909p*4/5 - 528096p*3/5 + 318876p*2/5 - 46368p/5 = 0. What is p? -8, 0, 2/7, 483 Factor 4d3/5 - 448d*2/5 - 254476d/5 - 17263688/5. 4(d - 338)(d + 113)*2/5 Solve 3l*2/4 - 1125l/2 - 6777/4 = 0 for l. -3, 753 Factor 2q4/13 - 119154q*3/13 + 238300q*2/13. 2q*2(q - 59575)(q - 2)/13 Factor -5u*2 - 530u - 12920. -5(u + 38)(u + 68) Factor -h*3 - 2280h*2 - 9107h - 6828. -(h + 1)(h + 3)(h + 2276) Find g, given that 2g4/15 + 2612g*3/15 + 847576g*2/15 - 684868g/3 + 171610 = 0. -655, 1, 3 Factor -m*3/2 - 405m*2/2 - 54567m/2 - 2445363/2. -(m + 123)(m + 141)2/2 Factor c3/4 + 41c*2 - 167c/4 - 165/2. (c - 2)(c + 1)(c + 165)/4 Factor 3z2 + 17547z + 35082. 3(z + 2)(z + 5847) Suppose -5j4 + 140j*3 + 10860j*2 - 160160j - 6852160 = 0. Calculate j. -28, 38, 46 Factor 25c3 - 685c*2 + 380c + 28000. 5(c - 25)(c - 8)(5c + 28) Suppose -b*4 - 196b*3 + 812b*2 + 2400b = 0. Calculate b. -200, -2, 0, 6 Factor 2q2 + 166960q + 667808. 2(q + 4)(q + 83476) Factor 11848712k2 + 29208k + 18. 2(2434k + 3)*2 Factor -4w*4/5 - 124w*3/5 + 2324w*2/5 - 1764w. -4w(w - 7)*2(w + 45)/5 Let 5j5/2 + 10j*4 - 1820j*3 - 35j*2 + 10835j/2 + 3625 = 0. Calculate j. -29, -1, 2, 25 Find f, given that 57f3 + 4554f*2 + 89295f - 9450 = 0. -45, -35, 2/19 Factor 576n4 - 70368n*3 + 1618756n*2 + 34201492n. 4n(n + 13)(12n - 811)2 Let k4/5 - 389k3/5 - 783k*2/5 + 389k/5 + 782/5 = 0. Calculate k. -2, -1, 1, 391 Factor 2l5/5 + 52l*4/5 + 386l*3/5 + 624l*2/5 + 288l/5. 2l(l + 1)*2(l + 12)*2/5 Solve 2w*4/15 + 1118w*3/15 - 2w*2/15 - 1118w/15 = 0 for w. -559, -1, 0, 1 Solve -b*4/4 + 25b*3/2 - 539b*2/4 + 245b/2 = 0. 0, 1, 14, 35 Let 45i3 + 2010i*2 + 1325i + 220 = 0. Calculate i. -44, -1/3 Let 15o2 - 805o + 9880 = 0. Calculate o. 19, 104/3 Find p such that 5p5 - 67p*4 - 5299p*3 - 59425p*2 - 161278p + 74360 = 0. -13, -5, 2/5, 44 Factor -3k5/8 + 1299k*4/8 + 2607k*3/8 + 1305k*2/8. -3k*2(k - 435)(k + 1)2/8 Let -n3/3 + 10555n*2/3 - 9285761n + 9282243 = 0. What is n? 1, 5277 Determine l, given that l*5/4 - 21l*4/2 + 137l*3/2 - 9l*2 - 1067l/4 - 357/2 = 0. -1, 3, 7, 34 What is j in 2j4/7 - 20j*3 - 78j*2 + 7660j/7 + 2336 = 0? -8, -2, 7, 73 Let -4x3 + 2848x*2 - 11340x + 8496 = 0. Calculate x. 1, 3, 708 Let -5x5 + 1255x*4 - 103365x*3 + 2764125x*2 + 2868750x = 0. Calculate x. -1, 0, 75, 102 What is u in 4u3 - 328u*2 - 6884u + 15048 = 0? -19, 2, 99 Factor -5o5 + 8760o*4 - 34990o*3 + 52460o*2 - 34965o + 8740. -5(o - 1748)(o - 1)4 Factor q2/4 - 1490905q/4. q(q - 1490905)/4 Factor -7771k2/4 - 38851k/4 + 5. -(k + 5)(7771k - 4)/4 Find s such that -18s5/5 + 258s*4/5 - 786s*3/5 - 18s*2/5 + 804s/5 - 48 = 0. -1, 1/3, 1, 4, 10 Suppose -2v4/23 + 18v*3/23 - 6v*2/23 - 74v/23 - 48/23 = 0. Calculate v. -1, 3, 8 Factor -2z4 - 14z*3 + 20z*2 + 32z. -2z(z - 2)(z + 1)(z + 8) Suppose -v*4/8 + 261v*3/8 - 17609v*2/8 + 80139v/8 + 49005/4 = 0. What is v? -1, 6, 121, 135 Find h, given that 38h4 + 288h*3 + 360h*2 = 0. -6, -30/19, 0 Factor -5g4 - g3 + 122g2 + 340g + 264. -(g - 6)(g + 2)2(5g + 11) Solve c4 - 12646c*3 + 39866353c*2 + 720670248c + 3247632144 = 0. -9, 6332 Factor -3s2 + 333s + 29406. -3(s - 169)(s + 58) Suppose -3n4/7 - 86445n*3/7 - 118453914n*2 - 376670907396n + 14871067330392 = 0. What is n? -9618, 39 Let -2d5/9 + 1718d*4/9 - 168568d*3/3 + 54812704d*2/9 - 1143803200d/9 + 2148495200/3 = 0. What is d? 10, 15, 278 Find l, given that -2l3/11 + 23072l*2/11 - 6061624l + 796815456/11 = 0. 12, 5762 Let -2h3 + 49552h*2 - 306776378h - 1842442572 = 0. Calculate h. -6, 12391 Suppose 4a3/7 + 92a*2/7 - 200132a/7 - 200220/7 = 0. What is a? -235, -1, 213 Find v, given that -2v2 + 27912v = 0. 0, 13956 Solve 3k2 - 1815k - 18450 = 0 for k. -10, 615 What is m in 4m5/3 + 346m*4/3 + 3014m*3 + 67264m*2/3 + 125344m/3 - 26880 = 0? -40, -36, -7, -4, 1/2 Factor 2o2/9 + 48280o/9 + 10728. 2(o + 2)(o + 24138)/9 Suppose 6s2/17 - 12862s/17 - 4288/17 = 0. Calculate s. -1/3, 2144 Let -25k4 - 2340k*3 - 16435k*2 - 8100k + 6020 = 0. Calculate k. -86, -7, -1, 2/5 Factor -3l3/8 + 6279l*2/8 - 3135l + 6267/2. -3(l - 2089)(l - 2)2/8 Let -o2/4 + 269o/2 + 2715/4 = 0. What is o? -5, 543 Factor 2a*2/3 - 1195924a/3 + 178779276722/3. 2(a - 298981)2/3 Factor 5a*3 + 34305a*2 + 274200a + 548240. 5(a + 4)2(a + 6853) Factor m*2/3 - 209513m/3 + 139674. (m - 209511)(m - 2)/3 Let 2h*3 + 452h*2 + 3078h + 2628 = 0. What is h? -219, -6, -1 What is i in -4i2 + 1856i + 1860 = 0? -1, 465 Solve 2m2/5 - 6132m/5 + 1226 = 0 for m. 1, 3065 Factor -54y3 - 13548y*2 - 2316992y/3 - 38299904/3. -2(y + 178)(9y + 328)2/3 Factor -3d*2 + 132d - 1020. -3(d - 34)(d - 10) Factor -9l3 + 883l*2 - 971l + 97. -(l - 97)(l - 1)(9l - 1) Factor y4 - 476y*3 + 2825y*2 - 2350y. y(y - 470)(y - 5)(y - 1) Find z such that -5z*4 - 5340z*3 - 1365225z*2 + 32672750z = 0. -545, 0, 22 Factor 2b3/3 - 1544b*2/3 + 308506b/3 - 4021948/3. 2(b - 379)2(b - 14)/3 Let -4t3/7 - 18908t*2/7 - 245072t/7 + 37712 = 0. Calculate t. -4714, -14, 1 Determine x, given that -461650x2 + 461655x - 5 = 0. 1/92330, 1 Factor 2q5 - 6796q*4 + 5766402q*3 + 11553200q*2 + 5780000q. 2q(q - 1700)*2(q + 1)**2 Determine h so	{ "pile_set_name": "DM Mathematics" }
7637 a composite number? True Is 266123465 prime? False Is 29248382327 prime? True Is 9950083537 composite? True Is 55001117 composite? False Is 730694249 a composite number? False Is 86538217 a composite number? True Is 1375635101 prime? True Is 15188156777 a composite number? True Is 2693655031 prime? True Is 17508137639 a composite number? False Is 48007845527 composite? True Is 15411530791 prime? True Is 857030269 prime? False Is 1533420337 prime? True Is 1152355429 prime? False Is 5834587327 composite? False Is 872351063 composite? False Is 4479292969 a composite number? True Is 21327104083 prime? True Is 640325899 a prime number? True Is 139623587 composite? False Is 23556719 a prime number? True Is 304609037 prime? False Is 8290221337 a composite number? True Is 175822159 composite? True Is 260199523 prime? False Is 905166053 a prime number? False Is 9937537693 a composite number? False Is 381394297 a composite number? False Is 88217650211 prime? True Is 7289762819 prime? True Is 49048511627 a composite number? True Is 217594043 a prime number? False Is 26941525181 a composite number? False Is 12058958221 a prime number? True Is 55050915079 composite? True Is 24033419771 prime? True Is 990963815 a composite number? True Is 814581613 a composite number? False Is 4326059033 a prime number? False Is 899504083 composite? False Is 40669270139 a prime number? False Is 80785517 a prime number? True Is 8604854897 composite? False Is 83768091767 a prime number? True Is 33753447619 composite? True Is 7809900179 composite? True Is 67882071181 prime? True Is 85961291131 a composite number? True Is 244134827737 a composite number? False Is 291847463 composite? False Is 64505156273 prime? False Is 11072962211 a composite number? False Is 53230334951 a prime number? True Is 48938818277 a prime number? False Is 5791693837 prime? True Is 33420827387 a prime number? True Is 5060504753 composite? True Is 264395487467 prime? False Is 1384374919 a prime number? True Is 143537437 composite? False Is 9250524571 a composite number? False Is 865024967 prime? True Is 5418506035 prime? False Is 543713791 prime? False Is 6987461567 a prime number? False Is 5665204607 prime? False Is 4467031237 prime? False Is 3442431061 composite? False Is 77320237 prime? True Is 71948442539 a composite number? False Is 1094136977 a composite number? False Is 20611527526 a prime number? False Is 2556097319 composite? False Is 17409229399 a composite number? False Is 60346668563 a composite number? False Is 2498003639 a prime number? True Is 1212832897 a prime number? False Is 328423526 composite? True Is 4293360611 composite? False Is 237099493 prime? False Is 130053019 composite? False Is 1261621637 composite? False Is 5624589833 prime? True Is 38512599038 a prime number? False Is 8503044943 a prime number? True Is 16895839309 a composite number? False Is 2880706791 a prime number? False Is 2016779747 a composite number? False Is 45285299309 a prime number? False Is 4943092643 a composite number? False Is 1123161437 a composite number? False Is 8182674193 prime? True Is 2337867221 a prime number? True Is 463950449 prime? True Is 66894563 composite? False Is 1510638791 prime? True Is 3486262399 a composite number? True Is 3299019221 a composite number? True Is 1661747627 a prime number? False Is 3399429827 a prime number? False Is 3168385135 prime? False Is 7740057389 prime? False Is 402418399 a composite number? True Is 11714646787 prime? False Is 359708653 prime? True Is 294426464759 composite? True Is 3318089899 a prime number? False Is 245994367 a prime number? False Is 355539949 a composite number? False Is 451219333 composite? True Is 5074500367 a prime number? True Is 225483227 a prime number? True Is 1284378161 a composite number? True Is 75675248063 a prime number? False Is 51832616593 a prime number? True Is 1074610513 a prime number? True Is 55229422849 a prime number? False Is 1916751727 prime? False Is 668442881 composite? True Is 491432999 composite? False Is 169434683 a prime number? False Is 395314643 prime? True Is 74510352394 a prime number? False Is 140679235 prime? False Is 6184833817 a prime number? True Is 3413103367 composite? True Is 4213587827 prime? False Is 62735837 a composite number? False Is 9174720467 prime? False Is 399179147 a prime number? False Is 59629131179 a composite number? False Is 681290057 composite? True Is 23137046689 composite? False Is 4880648963 prime? False Is 8270414853 a composite number? True Is 1071200051 a composite number? False Is 13348610147 prime? False Is 191843808071 a prime number? True Is 408809599 prime? False Is 846531671 a composite number? False Is 3515681567 composite? False Is 1737896231 a prime number? True Is 4720129171 composite? False Is 114185147 prime? True Is 27544643891 a prime number? False Is 13545907 a prime number? True Is 193424381 prime? False Is 407458273 composite? True Is 856729409 composite? False Is 3367319491 prime? True Is 315425501 composite? True Is 11775396601 a prime number? True Is 51424899577 a prime number? False Is 44300088923 a composite number? False Is 22959955 prime? False Is 21153963169 a prime number? False Is 26659655479 a composite number? False Is 692476441 prime? True Is 25223218469 a composite number? True Is 4265726951 a prime number? False Is 359538719 composite? False Is 17293973 a prime number? False Is 86143555277 composite? True Is 178127345839 a composite number? True Is 16868320991 a composite number? False Is 77848706797 prime? False Is 8327580941 a prime number? False Is 5495057 composite? True Is 11343183127 prime? True Is 9053592133 a composite number? True Is 1591299487 composite? False Is 218517097 a prime number? True Is 10392937703 composite? False Is 47349072427 a composite number? False Is 125018518033 composite? True Is 4873002397 a prime number? False Is 8676312739 a prime number? True Is 140345137 a composite number? False Is 20890800079 prime? True Is 23437078259 composite? True Is 5957262841 composite? False Is 6755350183 prime? False Is 22037779 prime? False Is 12901772263 composite? True Is 1513943867 composite? True Is 832070453 a composite number? True Is 434100529 a composite number? True Is 1100779763 prime? False Is 2563439623 a prime number? False Is 690502063 a composite number? True Is 23254550251 a composite number? True Is 11166338371 prime? False Is 47485134187 prime? True Is 849605401 a composite number? True Is 32589600739 composite? False Is 17184308273 a composite number? True Is 595898341 a composite number? False Is 401506345441 prime? True Is 12417907211 prime? False Is 7713777371 prime? True Is 1899535331 prime? True Is 901040923 prime? True Is 8704313507 a prime number? True Is 1321992143 a prime number? True Is 281946373 composite? True Is 833815429 a prime number? False Is 12081235295 prime? False Is 64563171263 a prime number? False Is 16904557 composite? False Is 24117970007 a prime number? True Is 3297402793 a composite number? True Is 369009637 prime? False Is 22738253 a prime number? False Is 566559143 composite? True Is 1295877797 prime? True Is 48001639931 a prime number? False Is 22333543 composite? False Is 131048686 a prime number? False Is 5490864583 a prime number? False Is 759828961 prime? True Is 14225923031 prime? True Is 82006099649 composite? True Is 45213197039 a prime number? False Is 3253788943 a prime number? True Is 31354998271 a prime number? False Is 1329521551 a prime number? True Is 1585235857 prime? False Is 1409908853 prime? False Is 38030423633 prime? True Is 10545310381 prime? True Is 1883848231 composite? True Is 972531841 composite? False Is 3653374463 a prime number? True Is 20628858181 prime? True Is 35290952059 a prime number? False Is 308921069 a composite number? True Is 23450462633 composite? True Is 9023953361 composite? False Is 10130972039 a prime number? False Is 777355711 prime? False Is 1895563211 prime? False Is 2104070957 prime? False Is 105782818637 prime? False Is 467098585 a composite number? True Is 773226743 a composite number? False Is 4424676101 a prime number? False Is 3214260307 prime? True Is 18746731019 composite? False Is 679522799 composite? False Is 58126801847 a p	{ "pile_set_name": "DM Mathematics" }
0006887585 How many months are there in 43/2 of a year? 258 How many centimeters are there in 17/2 of a meter? 850 How many seconds are there in 4.205471 minutes? 252.32826 Convert 42.04789ml to litres. 0.04204789 Convert 2630.624 weeks to milliseconds. 1591001395200 What is 2906.756m in micrometers? 2906756000 How many micrograms are there in thirteen fifths of a milligram? 2600 How many weeks are there in 971.893944 nanoseconds? 0.0000000000016069675 How many years are there in 6/5 of a millennium? 1200 How many millilitres are there in one twentieth of a litre? 50 Convert 95651.22ml to litres. 95.65122 How many millilitres are there in 39777.8l? 39777800 Convert 62.08406l to millilitres. 62084.06 How many micrometers are there in three eighths of a millimeter? 375 How many micrometers are there in three fifths of a millimeter? 600 What is twenty-one eighths of a millisecond in microseconds? 2625 How many microseconds are there in 71674.7 nanoseconds? 71.6747 What is 5/8 of a milligram in micrograms? 625 What is 95986.34 weeks in milliseconds? 58052538432000 How many grams are there in 1/10 of a tonne? 100000 How many centimeters are there in seven halves of a meter? 350 What is 52/5 of a gram in milligrams? 10400 Convert 0.6548017t to milligrams. 654801700 How many weeks are there in 149334.2298s? 0.2469150625 What is one tenth of a hour in minutes? 6 How many millilitres are there in 6/25 of a litre? 240 How many weeks are there in 815135.832ns? 0.0000000013477775 What is 31.54394 centimeters in millimeters? 315.4394 How many milligrams are there in 7/2 of a gram? 3500 How many weeks are there in 11705494.5 hours? 69675.5625 How many nanometers are there in 912705.9mm? 912705900000 What is 91757.42 kilometers in micrometers? 91757420000000 What is seventy-three quarters of a kilogram in grams? 18250 Convert 1.065574nm to micrometers. 0.001065574 What is thirty-two fifths of a century in decades? 64 How many millilitres are there in 21/4 of a litre? 5250 How many milligrams are there in 27/5 of a gram? 5400 How many minutes are there in twenty-nine fifths of a week? 58464 What is 88008.11g in micrograms? 88008110000 What is 45/4 of a gram in milligrams? 11250 What is 0.5277582 litres in millilitres? 527.7582 How many tonnes are there in 3.0637mg? 0.0000000030637 How many millilitres are there in eighty-seven quarters of a litre? 21750 Convert 813.6348ug to kilograms. 0.0000008136348 What is 6/5 of a litre in millilitres? 1200 What is 1/4 of a hour in seconds? 900 What is 31.305438 microseconds in hours? 0.000000008695955 What is 2/125 of a centimeter in micrometers? 160 How many decades are there in seven halves of a millennium? 350 What is 7/2 of a litre in millilitres? 3500 How many minutes are there in twenty-two ninths of a week? 24640 What is one tenth of a tonne in grams? 100000 What is 0.6750803s in nanoseconds? 675080300 How many millilitres are there in 0.534513 litres? 534.513 How many kilograms are there in 3/8 of a tonne? 375 What is 49/5 of a litre in millilitres? 9800 How many decades are there in 3019.377 months? 25.161475 How many micrograms are there in 11/8 of a milligram? 1375 What is eleven eighths of a gram in milligrams? 1375 How many months are there in one sixth of a millennium? 2000 What is 1/10 of a decade in months? 12 Convert 37650.51 millimeters to kilometers. 0.03765051 Convert 92.14164 nanometers to meters. 0.00000009214164 How many years are there in one twentieth of a millennium? 50 What is 8.859512mm in nanometers? 8859512 What is 0.22331 kilograms in nanograms? 223310000000 Convert 443.2884 weeks to minutes. 4468347.072 What is three fifths of a litre in millilitres? 600 Convert 6254.38ml to litres. 6.25438 How many millilitres are there in eighteen fifths of a litre? 3600 How many micrometers are there in 726143.2 meters? 726143200000 Convert 1114.929 kilometers to centimeters. 111492900 Convert 658144.3 litres to millilitres. 658144300 What is twenty-one halves of a litre in millilitres? 10500 How many nanometers are there in 0.588194 kilometers? 588194000000 How many minutes are there in ten thirds of a hour? 200 What is sixty-seven quarters of a tonne in kilograms? 16750 What is twenty-six fifths of a milligram in micrograms? 5200 What is eleven sevenths of a week in hours? 264 Convert 5585.891 centimeters to meters. 55.85891 What is four thirds of a week in hours? 224 What is 13/8 of a litre in millilitres? 1625 How many nanoseconds are there in 43112.41 minutes? 2586744600000000 How many millimeters are there in 18750.58m? 18750580 How many millilitres are there in eleven eighths of a litre? 1375 How many months are there in 0.0158894 decades? 1.906728 What is 0.7397066 milligrams in micrograms? 739.7066 What is 12/25 of a microsecond in nanoseconds? 480 What is 69.98613m in micrometers? 69986130 What is 17/4 of a tonne in kilograms? 4250 What is five sixths of a year in months? 10 How many millilitres are there in one quarter of a litre? 250 What is 0.3492196 millennia in decades? 34.92196 How many millimeters are there in six fifths of a meter? 1200 What is 3/8 of a centimeter in micrometers? 3750 What is 77475.53 microseconds in nanoseconds? 77475530 What is 33.20352ms in minutes? 0.000553392 What is 1/10 of a litre in millilitres? 100 Convert 0.7659171ug to milligrams. 0.0007659171 Convert 182163.7m to micrometers. 182163700000 How many days are there in 16.563114 hours? 0.69012975 What is twenty-six fifths of a milligram in micrograms? 5200 Convert 1.427263 kilograms to nanograms. 1427263000000 Convert 1.921951 years to millennia. 0.001921951 Convert 258.3504 millennia to decades. 25835.04 What is 57/5 of a litre in millilitres? 11400 How many nanometers are there in 3/5 of a micrometer? 600 How many milligrams are there in 4431.944 kilograms? 4431944000 How many millimeters are there in 2.873364 micrometers? 0.002873364 What is 3/8 of a week in minutes? 3780 How many hours are there in 5/6 of a day? 20 Convert 4.7448m to millimeters. 4744.8 What is one twentieth of a litre in millilitres? 50 What is sixty-nine halves of a litre in millilitres? 34500 How many millilitres are there in 6/5 of a litre? 1200 How many years are there in 43/2 of a millennium? 21500 Convert 70.7356 grams to tonnes. 0.0000707356 How many decades are there in 33/5 of a century? 66 How many decades are there in thirty-seven fifths of a millennium? 740 What is fourty-three halves of a hour in seconds? 77400 What is 33/5 of a milligram in micrograms? 6600 How many hours are there in seventy-four thirds of a week? 4144 What is 1/4 of a gram in milligrams? 250 What is three fifths of a millennium in decades? 60 How many days are there in 10/7 of a week? 10 What is 13/4 of a century in years? 325 What is three fifths of a microgram in nanograms? 600 What is one tenth of a second in milliseconds? 100 How many litres are there in 52.1043ml? 0.0521043 What is twenty-one halves of a day in minutes? 15120 What is 62.554734 milliseconds in hours? 0.000017376315 How many millennia are there in 130618.4 centuries? 13061.84 What is 2/75 of a century in months? 32 How many minutes are there in seventeen halves of a hour? 510 How many millilitres are there in 763.172l? 763172 What is 21/8 of a week in minutes? 26460 Convert 91631.67 weeks to milliseconds. 55418834016000 What is seventeen quarters of a litre in millilitres? 4250 How many micrograms are there in 1/5 of a milligram? 200 How many litres are there in 80.18643 millilitres? 0.08018643 How many decades are there in 49/4 of a millennium? 1225 What is twenty-five quarters of a milligram in micrograms? 6250 What is 18/5 of a centimeter in micrometers? 36000 What is 7/8 of a centimeter in micrometers? 8750 What is 19/4 of a year in months? 57 How many decades are there in 24075.816 months? 200.6318 How many months are there in seven eighths of a millennium? 10500 What is 898590.9 kilometers in micrometers? 898590900000000 What is 88943.1 tonnes in milligrams? 88943100000000 How many months are there in 9562.493 centuries? 11474991.6 What is fourty-seven quarters of a millimeter in micrometers? 11750 How many days are there in 81704.133 milliseconds? 0.0009456496875 Convert 363.	{ "pile_set_name": "DM Mathematics" }
72 4577664 divided by -393 -11648 -13 divided by -3400 13/3400 Calculate 22050 divided by 175. 126 -38 divided by -1433 38/1433 What is 216000 divided by -540? -400 Divide 19716 by 4. 4929 -2651230 divided by 530246 -5 What is 2494 divided by 2367? 2494/2367 Calculate 15872 divided by 3. 15872/3 -6 divided by -8935 6/8935 What is 5 divided by 81438? 5/81438 What is 23667 divided by -21? -1127 Divide 1140 by 10. 114 Divide -993 by 53. -993/53 Divide 2 by -104061. -2/104061 What is -630 divided by -32? 315/16 What is 33172665 divided by 5? 6634533 -385236 divided by -3 128412 Divide 1417934 by 708967. 2 Calculate -37538 divided by -137. 274 Calculate 6095 divided by -5. -1219 Divide 36 by 780. 3/65 Divide -56005 by -11201. 5 What is 2 divided by -1961? -2/1961 What is -714 divided by 35? -102/5 What is -1046 divided by 759? -1046/759 Divide 13 by 70254. 13/70254 What is -179120 divided by -40? 4478 Calculate 272128 divided by 2. 136064 359268 divided by 28 12831 -426465 divided by -10935 39 Calculate 2575066 divided by -1. -2575066 7014 divided by -6 -1169 What is 1264860 divided by 2? 632430 What is -64480 divided by 26? -2480 Divide 65610 by -1458. -45 Calculate -27300 divided by 273. -100 Divide 14012 by 452. 31 Calculate 778408 divided by 2. 389204 Divide -486 by 9. -54 What is -1 divided by 10706? -1/10706 What is 832240 divided by -16? -52015 Divide 2217 by 23. 2217/23 Calculate 67498 divided by -33749. -2 Calculate 92615 divided by -92615. -1 Calculate 19217 divided by 3. 19217/3 64 divided by 11835 64/11835 What is 40 divided by 51? 40/51 Divide -75826 by 1. -75826 Calculate -5 divided by 11816. -5/11816 -2691 divided by 5 -2691/5 -1 divided by 3406 -1/3406 Divide 1010862 by -5679. -178 Divide 562 by 888. 281/444 What is 1833396 divided by 6? 305566 Calculate -24619 divided by -1. 24619 Divide -126196 by -7. 18028 57707 divided by 1 57707 What is 213 divided by -2? -213/2 Divide 3 by -41345. -3/41345 What is 3485 divided by -33? -3485/33 -129234 divided by 3 -43078 Divide 140840 by -28. -5030 Divide -2550 by -2. 1275 -593 divided by -436 593/436 What is 67032 divided by -56? -1197 Calculate 64090 divided by 442. 145 260128 divided by 8 32516 Divide 96965 by -4. -96965/4 134777 divided by 1 134777 What is 12 divided by -3390? -2/565 Calculate -399156 divided by -2. 199578 Divide 2397 by 2020. 2397/2020 What is 120 divided by -5028? -10/419 What is -68096 divided by -152? 448 Divide 20410 by -5. -4082 Divide 38 by 1135. 38/1135 -58630 divided by -29315 2 Divide -1044 by 20. -261/5 -2 divided by -1323 2/1323 Divide 25588 by 2. 12794 -98364 divided by -7026 14 Calculate -58 divided by 1298. -29/649 What is -3144640 divided by 2536? -1240 Divide -12 by -1282. 6/641 Calculate -10 divided by 12841. -10/12841 Calculate -2329825 divided by 1025. -2273 -239961 divided by 1 -239961 426660 divided by -10 -42666 Divide 155913 by 3. 51971 Calculate -1777 divided by 13. -1777/13 Calculate -52 divided by -4868. 13/1217 What is -116436 divided by 6? -19406 What is -3990780 divided by 22171? -180 Divide 95278 by -4. -47639/2 -45568 divided by -712 64 What is -4 divided by 11467? -4/11467 Divide -628364 by -14281. 44 Calculate 60 divided by 11. 60/11 -1359522 divided by -2 679761 Calculate 3795 divided by 23. 165 What is 4 divided by -8380? -1/2095 Divide 2839440 by 4. 709860 -13163 divided by -12 13163/12 9019 divided by -9019 -1 What is 17759 divided by -6? -17759/6 111 divided by 5032 3/136 Calculate -673 divided by -4199. 673/4199 What is 461089 divided by -3? -461089/3 What is -4 divided by -3018? 2/1509 176200 divided by -88100 -2 -4 divided by 860230 -2/430115 What is -778370 divided by 10? -77837 2262204 divided by -126 -17954 21909 divided by -7303 -3 -2163 divided by 3 -721 Divide 122287 by -1. -122287 Calculate -261995 divided by 52399. -5 Divide 46056 by -23028. -2 -516258 divided by 129 -4002 Divide -21294 by -10647. 2 Calculate 69173 divided by 26. 5321/2 69209 divided by 9887 7 Divide -11068734 by 6. -1844789 Calculate -67575 divided by 5. -13515 Divide 1412 by -86. -706/43 Divide -5 by -27140. 1/5428 What is 8 divided by 82474? 4/41237 Divide 117893 by 6. 117893/6 -74172 divided by 2 -37086 What is 690048 divided by -57504? -12 What is -547956 divided by 1? -547956 Divide 492360 by -98472. -5 Calculate 970 divided by 51. 970/51 Divide 40896 by 13632. 3 Divide 29212 by -4. -7303 Divide -562 by 1370. -281/685 Divide 88752 by -172. -516 Calculate 26687 divided by -10. -26687/10 Divide 3 by 892813. 3/892813 Divide 8 by -3611. -8/3611 -6046 divided by -18 3023/9 192775 divided by 5 38555 Calculate -226120 divided by 10. -22612 Divide 31 by 342. 31/342 -76393 divided by 79 -967 Calculate 7 divided by -9461. -7/9461 What is 572460 divided by -329? -1740 -569184 divided by 142296 -4 Divide -8 by -1243. 8/1243 What is -54048 divided by -6? 9008 38617 divided by 3 38617/3 513012 divided by -6 -85502 Divide 1 by -52983. -1/52983 What is 1 divided by 1745? 1/1745 What is 311400 divided by -150? -2076 What is -183657 divided by 87? -2111 Calculate -607235 divided by -121447. 5 Calculate -316415 divided by -11. 28765 Calculate 2190 divided by -14. -1095/7 Divide -147760 by -2. 73880 Calculate -223746 divided by 15. -74582/5 Divide -942795 by 2583. -365 292 divided by 36 73/9 Divide -3 by 313520. -3/313520 -14 divided by 2211 -14/2211 Calculate -90 divided by -2554. 45/1277 What is 1313010 divided by -9? -145890 What is 315216 divided by 6? 52536 Divide -2 by 304. -1/152 Divide 0 by 165457. 0 Divide 33720 by 9. 11240/3 Calculate 597268 divided by 83. 7196 -5441 divided by 838 -5441/838 Calculate -3 divided by -2875. 3/2875 What is -76335 divided by -15267? 5 Divide 280904 by 140452. 2 What is 179276 divided by 4? 44819 -22 divided by 2279 -22/2279 What is 5 divided by 10576? 5/10576 Calculate 4112 divided by 759. 4112/759 Divide 93016 by -8456. -11 Divide 12390 by 5. 2478 8330 divided by -85 -98 Divide -5 by -417. 5/417 What is -41 divided by 8477? -41/8477 -4719077 divided by 1 -4719077 What is 9 divided by 43595? 9/43595 Divide -574854 by -2. 287427 Divide -7035 by -335. 21 Calculate -1521232 divided by -4. 380308 What is -257 divided by -2201? 257/2201 -5 divided by 5288 -5/5288 -3440773 divided by 7 -491539 What is 195 divided by -38? -195/38 Calculate 18869 divided by -2. -18869/2 304505 divided by 5 60901 Calculate 36 divided by 11931. 12/3977 860841 divided by 1 860841 Calculate 11 divided by -3891. -11/3891 -31 divided by 2075 -31/2075 -929401 divided by 4 -929401/4 Divide -177 by -1276. 177/1276 -5 divided by 240676 -5/240676 Divide -35712 by 17856. -2 Divide -974354 by 5. -974354/5 What is 621 divided by -455? -621/455 -2 divided by -97086 1/48543 Divide 529792 by -4. -132448 Calculate 590337 divided by 979. 603 What is 27 divided by -108123? -9/36041 Divide -5993 by -8. 5993/8 What is -587 divided by -61? 587/61 Divide -26036 by -6509. 4 168720 divided by 95 1776 Divide 10 by -5439. -10/5439 -588012 divided by 196004 -3 Divide 675270 by 45. 15006 What is 22 divided by 7055? 22/7055 Divide -407926 by 1. -407926 What is -61 divided by 49707? -61/49707 Calculate -4427 divided by 12. -4427/12 Divide 13 by -3545. -13/3545 Divide 1152785 by -4. -1152785/4 Divide 0 by 6823. 0 Calculate 4 divided by 87836. 1/21959 33321 divided by 3 11107 Calculate -193 divided by -2097. 193/2097 Calculate 18339 divided by -6113. -3 Divide 2297 by -5. -2297/5 Divide -69 by -69. 1 -545857 divided by 41989 -13 Divide 13095 by 291. 45 Divide -175570 by -10. 17557 What is 284380 divided by 71095? 4 78120 divided by -210 -372 Divide 2 by 57609. 2/57609 Calculate -4 divided by 4153. -4/4153 Divide -65185 by 6. -65185/6 1798560 divided by 4 449640 Calculate -451872 divided by -4707. 96 Divide 1013610 by 14690. 69 What is 81871 divided by -19? -4309 -220780 divided by -11039 20 Divide 0 by 125933. 0 Divide 272928 by -3. -90976 25186 divided by 3598 7 34155 divided by 23 1485 Divide 173 by -320. -173/320 Divide 2345 by -335. -7 Divide -121968 by -168. 726 -15628 divided by -30 7814/15 What is -5 divided by -23770? 1/4754 Calculate 19454 divided by -9727. -2 -6735 divided by -1 6735 Calculate 143436 divided by -143436. -1 Calculate 16012 divided by -8006. -2 Divide 19 by 15	{ "pile_set_name": "DM Mathematics" }
629, 927, 1205, 1457, 1677, 1859, 1997? 2085 What comes next: 13, 109, 361, 847, 1645? 2833 What is the next term in -666, -675, -698, -741, -810? -911 What comes next: 80, 108, 184, 332, 576, 940, 1448, 2124? 2992 What is the next term in 4185, 8371, 12557? 16743 What is next in 70, 139, 204, 265, 322, 375? 424 What is the next term in -18, 30, 144, 324, 570? 882 What is the next term in 113, 239, 435, 707, 1061, 1503, 2039, 2675? 3417 What is the next term in -18, -43, -98, -195, -346? -563 What comes next: 308, 563, 818, 1073, 1328? 1583 What comes next: 71, 285, 649, 1169, 1851, 2701, 3725? 4929 What comes next: -1741, -1753, -1779, -1825, -1897? -2001 What is next in -51, -109, -171, -237, -307, -381, -459? -541 What is the next term in 1723, 1728, 1745, 1780, 1839, 1928, 2053, 2220? 2435 What is the next term in 1714, 3426, 5138, 6850, 8562? 10274 What is next in -30, -22, -14, -6? 2 What comes next: 284, 1209, 2750, 4907, 7680, 11069, 15074? 19695 What is the next term in 60, 50, 34, 12, -16, -50, -90? -136 What is next in 84, 879, 3040, 7251, 14196, 24559? 39024 What is next in -69, -100, -127, -150, -169, -184, -195? -202 What comes next: 12, -4, -52, -150, -316, -568, -924? -1402 What is next in -3, 36, 109, 216, 357? 532 What is the next term in -130, -505, -1128, -1999? -3118 What is the next term in -341, -649, -967, -1301, -1657, -2041, -2459? -2917 What is next in -2, 24, 88, 208, 402, 688? 1084 What comes next: -372, -744, -1116, -1488? -1860 What is the next term in -284, -1119, -2510, -4457, -6960, -10019? -13634 What is the next term in -648, -2581, -5810, -10341, -16180? -23333 What is the next term in 7, 25, 69, 151, 283, 477, 745? 1099 What comes next: 129, 100, 29, -102, -311, -616, -1035? -1586 What is the next term in 1872, 1874, 1876, 1878, 1880, 1882? 1884 What is the next term in 247, 269, 319, 403, 527, 697, 919, 1199? 1543 What comes next: -7516, -7518, -7520, -7522, -7524? -7526 What is the next term in 677, 678, 679, 680? 681 What is the next term in -20, -12, 2, 22, 48, 80? 118 What is the next term in -340, -1349, -3030, -5383, -8408, -12105? -16474 What is next in -6, -7, 2, 27, 74, 149? 258 What comes next: 351, 699, 1047, 1395? 1743 What is the next term in -182, -1417, -4756, -11249, -21946, -37897, -60152, -89761? -127774 What comes next: -26, -44, -84, -158, -278, -456? -704 What comes next: -223, -440, -659, -880? -1103 What is the next term in -114, -107, -100? -93 What is the next term in -3036, -3031, -3016, -2985, -2932, -2851, -2736? -2581 What comes next: -491, -490, -489, -488, -487? -486 What is the next term in -877, -874, -869, -862, -853? -842 What comes next: -697, -2772, -6231, -11074, -17301, -24912, -33907? -44286 What comes next: 164, 346, 538, 746, 976, 1234? 1526 What is the next term in 60, 82, 118, 168? 232 What is next in 18, 14, 0, -30, -82, -162? -276 What comes next: 19, 77, 167, 283, 419, 569? 727 What is next in 136, 255, 374, 493? 612 What is next in 31, 64, 97, 130? 163 What is next in -57, -63, -69, -75, -81, -87? -93 What is next in -51, -85, -95, -69, 5, 139? 345 What comes next: -1773, -3544, -5315, -7086, -8857, -10628? -12399 What is next in -9, 20, 87, 210, 407, 696, 1095, 1622? 2295 What comes next: 29, 34, 39, 44? 49 What is next in 352, 736, 1120, 1504, 1888, 2272? 2656 What is the next term in 5, 49, 117, 203, 301, 405, 509, 607? 693 What comes next: 11, 25, 39, 53, 67? 81 What is next in -17, -52, -97, -158, -241, -352, -497, -682? -913 What comes next: -84, -216, -398, -636, -936, -1304, -1746? -2268 What comes next: -58, -163, -318, -523, -778, -1083, -1438? -1843 What is the next term in 151, 268, 385, 502? 619 What is the next term in -75, -308, -697, -1242, -1943? -2800 What comes next: -64, -68, -82, -112, -164? -244 What comes next: 228, 238, 252, 270, 292, 318? 348 What is the next term in 491, 533, 607, 719, 875? 1081 What is next in 41, 268, 869, 2030, 3937, 6776, 10733? 15994 What comes next: 27, 104, 225, 384, 575, 792, 1029? 1280 What comes next: -15921, -15922, -15923, -15924, -15925, -15926? -15927 What is next in 11, 20, 31, 44? 59 What comes next: 3964, 3957, 3940, 3907, 3852? 3769 What is next in 972, 975, 978, 981, 984? 987 What is next in 7872, 7870, 7868, 7866, 7864, 7862? 7860 What comes next: 11143, 22285, 33427, 44569, 55711, 66853? 77995 What is next in 500, 483, 452, 401, 324? 215 What comes next: 2749, 2747, 2745, 2743? 2741 What comes next: 5, 80, 205, 380, 605, 880? 1205 What is the next term in -1750, -1728, -1692, -1642, -1578, -1500? -1408 What is the next term in -31, -73, -129, -205, -307, -441, -613? -829 What is next in -197, -404, -621, -854, -1109, -1392, -1709, -2066? -2469 What comes next: -24, -46, -80, -132, -208? -314 What is next in -14, -54, -124, -224? -354 What is next in -2, 13, 28, 43, 58? 73 What is next in 1573, 1576, 1581, 1588, 1597, 1608, 1621? 1636 What is the next term in -11, 5, 49, 133, 269? 469 What is next in -2, 4, 0, -26, -86? -192 What comes next: 9, -18, -93, -240, -483? -846 What is the next term in -2, 15, 46, 85, 126, 163, 190, 201? 190 What is the next term in -478, -936, -1394? -1852 What is next in -19, -30, -37, -40, -39, -34? -25 What is next in 153, 318, 485, 654? 825 What is the next term in 212, 190, 168, 146? 124 What is next in -5, -3, -9, -23, -45? -75 What comes next: 3481, 3491, 3513, 3553, 3617, 3711, 3841, 4013? 4233 What is next in -5, -11, -13, -5, 19, 65, 139? 247 What is the next term in -102, -387, -860, -1521, -2370, -3407? -4632 What comes next: 52, 55, 56, 55, 52? 47 What is next in -137, -156, -181, -212, -249, -292? -341 What is next in 165, 224, 321, 456, 629? 840 What is the next term in 21, 70, 151, 264, 409? 586 What comes next: -574, -582, -596, -616, -642, -674? -712 What is the next term in -41, -89, -137, -185? -233 What comes next: -211, -265, -327, -403, -499? -621 What is the next term in 44, 41, 36, 29, 20? 9 What comes next: -66, -62, -58, -54? -50 What is next in 5210, 10422, 15634, 20846? 26058 What is next in 2156, 4312, 6468? 8624 What is next in 362, 724, 1086, 1448? 1810 What comes next: -6870, -6878, -6896, -6930, -6986, -7070? -7188 What is next in 81, 368, 837, 1482, 2297, 3276? 4413 What comes next: -71, -74, -77, -80, -83, -86? -89 What is next in -124, -276, -436, -610, -804, -1024? -1276 What comes next: 78, 160, 242, 324, 406, 488? 570 What is next in -44169, -44168, -44167, -44166, -44165, -44164? -44163 What is the next term in -56, -46, -28, -2, 32, 74, 124? 182 What comes next: 29, 52, 75, 98, 121, 144? 167 What is next in -258, -514, -768, -1020, -1270, -1518? -1764 What is the next term in 974, 1060, 1158, 1274, 1414, 1584, 1790? 2038 What is the next term in 25, 1, -71, -215, -455? -815 What is next in -761, -771, -791, -821, -861, -911, -971? -1041 What is the next term in 633, 1279, 1947, 2643, 3373? 4143 What comes next: 6, 21, 52, 105, 186, 301? 456 What comes next: 23, 38, 75, 146, 263, 438? 683 What is the next term in 97, 397, 897, 1597, 2497, 3597, 4897? 6397 What comes next: 360, 719, 1076, 1431, 1784? 2135 What comes next: 16995, 16994, 16993? 16992 What comes next: 19, 82, 217, 448, 799, 1294, 1957, 2812? 3883 What is the next term in -76, -145, -214? -283 What comes next: 151, 304, 457, 610, 763? 916 What comes next: -29, -60, -85, -98, -93, -64, -5? 90 What is the next term in -1862, -1864, -1866, -1868? -1870 What is next in -34, -64, -92, -118, -142? -164 What is next in -26, -48, -80, -122, -174? -236 What is next in 747, 1510, 2273, 3036? 3799 What is the next term in -875, -1761, -2647, -3533? -4419 What is the next term in -12, -48, -106, -186, -288? -412 What comes next: 106, 114, 122, 130, 138, 146? 154 What is next in -40, -53, -66? -79 What comes next: -801, -1603, -2405? -3207 What is next in 18, 46, 78, 114? 154 What is next in 32, 67, 100, 131, 160, 187? 212 What is next in 11, 16, 25, 38? 55 What is next in 113, 220, 415, 704, 1093, 1588, 2195? 2920 What is the next term in 97, 93, 85, 73, 57, 37? 13 What is the next term in -33, -33, -31, -27, -21, -13, -3? 9 What comes next: -21, -43, -65, -87, -109? -131 What comes next: -641, -642, -643? -644 What is the next term in -73, -147, -221? -295 What is next in	{ "pile_set_name": "DM Mathematics" }
t is the hundred thousands digit of 8174967? 1 What is the thousands digit of 3510524? 0 What is the tens digit of 5748396? 9 What is the thousands digit of 22759? 2 What is the thousands digit of 5441444? 1 What is the thousands digit of 346008? 6 What is the hundreds digit of 582505? 5 What is the millions digit of 7212237? 7 What is the ten thousands digit of 167045? 6 What is the tens digit of 627928? 2 What is the hundred thousands digit of 214888? 2 What is the hundred thousands digit of 150333? 1 What is the hundreds digit of 5605972? 9 What is the hundreds digit of 1712393? 3 What is the units digit of 386975? 5 What is the hundreds digit of 19856? 8 What is the hundred thousands digit of 1014742? 0 What is the hundred thousands digit of 8932571? 9 What is the hundred thousands digit of 20977523? 9 What is the hundreds digit of 94236? 2 What is the thousands digit of 29771335? 1 What is the ten thousands digit of 57715? 5 What is the ten millions digit of 13777123? 1 What is the units digit of 837206? 6 What is the thousands digit of 1601845? 1 What is the thousands digit of 1218855? 8 What is the units digit of 2869292? 2 What is the ten millions digit of 14178341? 1 What is the hundreds digit of 86992? 9 What is the hundreds digit of 1436052? 0 What is the tens digit of 29647979? 7 What is the tens digit of 14605607? 0 What is the thousands digit of 103350? 3 What is the ten thousands digit of 16682244? 8 What is the thousands digit of 147063? 7 What is the ten thousands digit of 206761? 0 What is the ten thousands digit of 332913? 3 What is the units digit of 22500? 0 What is the tens digit of 560951? 5 What is the millions digit of 1022770? 1 What is the hundreds digit of 13357700? 7 What is the hundred thousands digit of 1057526? 0 What is the ten thousands digit of 82801? 8 What is the tens digit of 6391523? 2 What is the millions digit of 1474738? 1 What is the millions digit of 8868997? 8 What is the hundreds digit of 1882889? 8 What is the hundred thousands digit of 554034? 5 What is the units digit of 2118796? 6 What is the tens digit of 27559? 5 What is the thousands digit of 278057? 8 What is the hundred thousands digit of 1253647? 2 What is the units digit of 310689? 9 What is the units digit of 191060? 0 What is the tens digit of 41166? 6 What is the ten thousands digit of 4447202? 4 What is the tens digit of 2601406? 0 What is the ten thousands digit of 77629? 7 What is the ten thousands digit of 1630243? 3 What is the hundreds digit of 1501222? 2 What is the hundreds digit of 17137957? 9 What is the thousands digit of 1860932? 0 What is the tens digit of 3329375? 7 What is the hundred thousands digit of 6719014? 7 What is the hundreds digit of 1014618? 6 What is the ten thousands digit of 272359? 7 What is the millions digit of 6333150? 6 What is the ten thousands digit of 299387? 9 What is the units digit of 3586600? 0 What is the units digit of 3114985? 5 What is the ten thousands digit of 547035? 4 What is the millions digit of 2422561? 2 What is the units digit of 30207? 7 What is the tens digit of 153173? 7 What is the thousands digit of 597567? 7 What is the hundreds digit of 354222? 2 What is the millions digit of 6388879? 6 What is the hundreds digit of 11318997? 9 What is the hundred thousands digit of 124609? 1 What is the hundred thousands digit of 201442? 2 What is the hundred thousands digit of 9150891? 1 What is the tens digit of 39444? 4 What is the units digit of 163610? 0 What is the hundreds digit of 214560? 5 What is the ten thousands digit of 88334? 8 What is the units digit of 3188649? 9 What is the ten thousands digit of 641045? 4 What is the units digit of 13613746? 6 What is the millions digit of 10678277? 0 What is the units digit of 526945? 5 What is the millions digit of 1989529? 1 What is the ten thousands digit of 2353632? 5 What is the tens digit of 23441756? 5 What is the thousands digit of 452276? 2 What is the ten thousands digit of 138999? 3 What is the ten thousands digit of 2671187? 7 What is the ten thousands digit of 2549493? 4 What is the tens digit of 2987944? 4 What is the units digit of 12952127? 7 What is the ten thousands digit of 976302? 7 What is the units digit of 7108526? 6 What is the hundred thousands digit of 1802390? 8 What is the units digit of 56610? 0 What is the hundreds digit of 6503309? 3 What is the ten thousands digit of 3176272? 7 What is the hundred thousands digit of 474310? 4 What is the hundred thousands digit of 7171296? 1 What is the tens digit of 385779? 7 What is the units digit of 2286646? 6 What is the millions digit of 3912360? 3 What is the units digit of 988065? 5 What is the tens digit of 310259? 5 What is the thousands digit of 5547093? 7 What is the hundreds digit of 155355? 3 What is the thousands digit of 1059992? 9 What is the tens digit of 240840? 4 What is the hundreds digit of 1390293? 2 What is the hundreds digit of 1362044? 0 What is the hundreds digit of 1118671? 6 What is the ten thousands digit of 588252? 8 What is the ten thousands digit of 2941985? 4 What is the units digit of 905897? 7 What is the millions digit of 1008914? 1 What is the units digit of 2597143? 3 What is the hundreds digit of 1933396? 3 What is the ten thousands digit of 218741? 1 What is the millions digit of 4285470? 4 What is the thousands digit of 2290174? 0 What is the hundred thousands digit of 1357300? 3 What is the units digit of 2036680? 0 What is the tens digit of 43130? 3 What is the hundreds digit of 1623182? 1 What is the thousands digit of 81152? 1 What is the ten thousands digit of 1012878? 1 What is the thousands digit of 3311? 3 What is the units digit of 2061097? 7 What is the thousands digit of 2139976? 9 What is the ten thousands digit of 186631? 8 What is the tens digit of 5448426? 2 What is the tens digit of 7010121? 2 What is the thousands digit of 1121761? 1 What is the ten millions digit of 10298417? 1 What is the thousands digit of 3552016? 2 What is the thousands digit of 7613296? 3 What is the ten millions digit of 21090641? 2 What is the hundreds digit of 1063109? 1 What is the units digit of 1780496? 6 What is the thousands digit of 3488512? 8 What is the ten millions digit of 21027312? 2 What is the tens digit of 430174? 7 What is the thousands digit of 4234457? 4 What is the hundred thousands digit of 467489? 4 What is the tens digit of 1068232? 3 What is the thousands digit of 404463? 4 What is the hundred thousands digit of 1242439? 2 What is the tens digit of 696144? 4 What is the millions digit of 20484782? 0 What is the thousands digit of 220452? 0 What is the ten thousands digit of 1298930? 9 What is the tens digit of 799121? 2 What is the tens digit of 111551? 5 What is the ten thousands digit of 20237453? 3 What is the tens digit of 2256114? 1 What is the ten thousands digit of 46637? 4 What is the thousands digit of 31608? 1 What is the ten millions digit of 18215900? 1 What is the millions digit of 1769931? 1 What is the tens digit of 36124765? 6 What is the units digit of 3468120? 0 What is the hundreds digit of 2656229? 2 What is the millions digit of 3288863? 3 What is the hundreds digit of 6666689? 6 What is the ten thousands digit of 395744? 9 What is the ten thousands digit of 90768? 9 What is the tens digit of 16932064? 6 What is the hundreds digit of 10157497? 4 What is the ten thousands digit of 1477048? 7 What is the hundreds digit of 9115783? 7 What is the hundreds digit of 8089089? 0 What is the millions digit of 6271497? 6 What is the hundred thousands digit of 198308? 1 What is the hundreds digit of 202904? 9 What is the thousands digit of 73764? 3 What is the thousands digit of 1559779? 9 What is the hundred thousands digit of 1803694? 8 What is the thousands digit of 155490? 5 What is the hundreds digit of 550049? 0 What is the millions digit of 1709652? 1 What is the hundreds digit of 18613? 6 What is the units digit of 265087? 7 What is the hundred thousands digit of 15318188? 3 What is the tens digit of 236598? 9 What is the thousands digit of 88638? 8 What is the units digit of 9998657? 7 What is the hundreds digit of 2259646? 6 What is the tens digit of 33654? 5 What is the thousands digit of 1643	{ "pile_set_name": "DM Mathematics" }
d biggest value in m, j, n? n Let n = -0.54 + 9.74. Let c = -9 + n. What is the smallest value in 0.3, c, -0.04? -0.04 Let m = 144 + -1300/9. Which is the third smallest value? (a) 2/15 (b) 0 (c) 3/4 (d) m a Let n = -1105 - -1398. Which is the smallest value? (a) 1/4 (b) 2/9 (c) -3/8 (d) n c Let f(x) = 4x - 5. Let u(s) = 3s - 4. Let g(k) = -4f(k) + 5u(k). Let y be g(-2). Which is the second biggest value? (a) 5/2 (b) 4/7 (c) y (d) -3/5 c Let y = 248 + -251. What is the second smallest value in 5, 0.4, 2/113, y? 2/113 Let o be (4 + 9 + -7)/(4/2). Suppose 5x - 4f = 32, -2f = 5x - 0f - 14. Suppose x = -k + o. Which is the smallest value? (a) k (b) -0.5 (c) 1 a Let o = 6 + -3. Let m = o + -7. Let t = 49 - 48.6. What is the third biggest value in 0.1, t, m? m Let d = -1179 + 1178.5. Which is the third biggest value? (a) -0.3 (b) d (c) -53 c Let i = -2 - 3. Let s = 0.328 + -133.328. Let y = 138 + s. Which is the smallest value? (a) y (b) -2 (c) i c Let g = -1/99 - -106/693. Which is the second smallest value? (a) 1/2 (b) -3 (c) 5 (d) g d Let d = -857 - -859. Let h = 0.05 - -3.95. Which is the third smallest value? (a) h (b) d (c) -2/53 a Let b = 2 - -19. What is the third smallest value in -0.3, 0.4, b? b Let f = -196 + 196.1. Which is the second smallest value? (a) f (b) -1 (c) 1/6 a Let i = 1 - 3. Let m be 147/i5/(-10). Let q = 37 - m. Which is the smallest value? (a) -3 (b) -1 (c) q a Let w = 0.052 - -2.948. Let s = -8 - -8.3. What is the second smallest value in -2, s, w? s Let k(w) = -w*2 - 30w - 2. Let j(t) = -t*2 - 60t - 3. Let l(o) = 3j(o) - 5k(o). Let r be l(15). What is the second smallest value in 1/3, -4, r? 1/3 Let j(k) = -k*3 + 14k*2 - 34k + 5. Let q be j(11). Let n be 1 + 1/q + (-145)/150. What is the third biggest value in n, 1/7, 0? n Let f(x) = 3x2 - 34x + 36. Let b be f(10). What is the second biggest value in 0.3, b, 1/2, -11? 0.3 Let o = 71 - 51. Let x = -142/7 + o. Which is the third smallest value? (a) 2/7 (b) 5 (c) x (d) -1 a Let x = -498 + 510. What is the second smallest value in 0.1, -0.09, x, -0.2? -0.09 Let u = -0.52 - -0.62. Which is the fourth smallest value? (a) 0.5 (b) -0.4 (c) 1 (d) u c Let p = 0.26 - 0.06. Let w = 0 - p. Suppose 5y = v - 17, 4v + 0v = 5y + 8. Which is the third biggest value? (a) w (b) 0.5 (c) v c Let s = 0.21 + 8.79. Let j(q) = q2 - 4. Let v be j(3). What is the second smallest value in s, v, 0? v Let r = -22 + 36. Let d(h) be the third derivative of -h4/24 + 3h3 - 6h*2 - 1. Let l be d(r). Which is the smallest value? (a) 0.5 (b) -1 (c) l b Let f be (2/(-4))/(5/(-54)). Which is the biggest value? (a) -0.2 (b) f (c) -4 b Let n(r) = 2r - 3. Let m be n(4). Let f = 5075 - 5075.4. Which is the biggest value? (a) m (b) f (c) -0.3 a Let p = -540896/15 - -35975. Let w = p + 251/3. Let g = 2/3 + w. Which is the smallest value? (a) g (b) 4 (c) -3 c Let n = 181.7 + -182. What is the biggest value in n, 4, -245? 4 Let y = -656 - -653. Which is the second biggest value? (a) -3/7 (b) 0.1 (c) y a Let s = -0.1373 - 0.1627. What is the third biggest value in s, 0.3, -0.104, 0? -0.104 Let i(j) = 3j + 103. Let s be i(-35). What is the third biggest value in s, 3, 1? s Let t = -0.6387 - -0.1387. Let y = 0.02 + 1.98. Which is the second biggest value? (a) -0.3 (b) -1/4 (c) t (d) y b Let j(s) = 19s*2 + 2s - 5. Let a be j(-3). Let t be -4 + 0 - (-719)/a. Let i = t - 3/32. What is the second biggest value in 2, i, 1/4? i Let k(y) = 2y - 21. Let r be k(12). Let o be (-2)/r60/8. What is the third smallest value in o, -3, 1/3? 1/3 Let b = -0.935 - 27.065. Let l = 0.9 + -1.4. What is the second smallest value in -1/3, l, b? l Let q = 131.036 - 131. Let c = q - 4.036. Let b = -4.7 + 5. What is the third biggest value in b, c, 1/5? c Let l be (-10)/(-6)-1 - -2. Let x = 0.24 - 3.24. Let r = 1568/5 - 314. What is the biggest value in l, r, x? l Let n = -948.43 - -953. Let u = -0.43 - n. What is the third biggest value in u, 4, -1/5? u Let c = -14 + 10. Let u = 6 + c. What is the smallest value in u, -0.7, 2/7? -0.7 Let r = 7.09 - 0.09. Let t = -0.442 - -0.042. What is the third smallest value in r, 2/5, t? r Suppose -8h = -6h + 2j + 8, 0 = 3j. What is the smallest value in 5, 4, h, -1? h Let u = 33/28 + -13/14. Which is the third biggest value? (a) u (b) -1 (c) -133 c Let o = -8.2 - 1. Let l = o - -5.2. Which is the fourth biggest value? (a) 0.3 (b) l (c) 2 (d) -0.3 b Let b be ((-2)/4)/(12/30). Let y = b - -27/28. Let w = 1 + 1. What is the third biggest value in w, y, -3? -3 Let h = 4.5 - 4. Which is the third smallest value? (a) 0 (b) 3/8 (c) h c Let p(w) = -w - 2. Let i be p(-2). Suppose 42j - 44j + 30 = i. Let v = 1 - 2. Which is the second biggest value? (a) j (b) 0.5 (c) v b Let w = -12.46 - -0.46. Let i = w - -13. What is the second biggest value in i, -5, 6? i Let d(j) = -j2 + 4j - 5. Let o be d(4). Let u = 53533/2 - 26766. What is the biggest value in u, o, -2/3? u Let o = -3 + 3.2. Let n = 36/11 + -83/22. What is the second smallest value in o, n, -3? n Let p be -2 - (8 - 0)/(-2). Which is the second biggest value? (a) 0.12 (b) p (c) 0.4 (d) 3 b Let n = -0.087 - -0.031. Let w = n + 0.056. What is the second biggest value in -0.01, -4, -0.3, w? -0.01 Let o = -85/57 - -3/19. Let s = -1282 + 1281.9. Which is the second smallest value? (a) o (b) 0.3 (c) s c Let i be 13/18 - (-2)/(-4). Let l = 1/132 + 43/132. Which is the biggest value? (a) i (b) 2 (c) l b Suppose 3s = -0s. Let u = 12 + 18. Let t be 13/(-104) - u/(-112). Which is the third smallest value? (a) t (b) s (c) 0.1 a Let n = 48 + -48.06. Let h = 11 - 8. Let l = -3.1 + h. Which is the second smallest value? (a) n (b) l (c) 3 a Let y = -2 - -1.9. Let i = -229 + 2297/10. Which is the third biggest value? (a) i (b) 5 (c) y c Let q = 2.05 - 2. Let j = 4847.3 + -4847. What is the third biggest value in j, 4, q? q Let i = 0.03 + -0.43. Let x = 29.5 + -29. Let h = 0.12 + -0.42. Which is the second biggest value? (a) x (b) h (c) i b Suppose 25i + 16 = -34. Which is the third smallest value? (a) 3/2 (b) -1/47 (c) i a Let r be ((-9)/(-30))/(4/8). Which is the second smallest value? (a) -1/5 (b) r (c) 0.03 c Let p = 149/1380 + -4/69. Let t(s) = s2 + 4s + 3. Let l be t(0). What is the third smallest value in -1, p, l? l Let g = 88 - 49. Let l = g - 39. Which is the third smallest value? (a) 2/3 (b) -0.03 (c) l a Let k be ((-8)/6)/(24/72). Which is the third biggest value? (a) -1.61 (b) -1 (c) k c Let o = 59.71 + -60. Let r = o - -0.29. Let m = 3.7 + -4. Which is the smallest value? (a) -1/4 (b) m (c) r b Let m = -7.4 + 7.7. What is the second smallest value in m, 2/15, 2, -3? 2/15 Suppose -7r - 6r = 26. Which is the third biggest value? (a) -3/7 (b) -3 (c) r (d) 2/3 c Let f = -61 - -58. Let p be (-1)/5 - 27/15. What is the biggest value in 1/5, f, p? 1/5 Let k = 304 - 2429/8. What is the second biggest value in -1, k, 3? k Let x = 292 - 286. Which is the second biggest value? (a) 2 (b) -46 (c) x a Let x = -10/3 + 4. Suppose 2h = h + 2i + 5, 3h - 1 = -i. Let c = h + -3. What is the second biggest value in c, x, 3? x Suppose -3o = -5f - 6o - 113, 5f + 115 = -5o. What is the third smallest value in 3, f, 0.1? 3 Let p = 0.214 - -0.086. What is the second smallest value in -5, -1, p, -3/4? -1 Let i = 32 - 16. Let t = i - 16.1. Let n = -54 - -54. Which is the third biggest value? (a) t (b) n (c) -11 c Let u be -6 + -1 - 372/(-60). Let d be (2/8)/(3/(-4)). What is the third smallest value in u, -1/6, d? -1/6 Let u = -11.9015 + -0.0985. Which is the smallest value? (a) -5 (b) u (c) 1/5 b Let j = 0.19 + -0.14. Let a = 0.27 - j. Let s = a + -0.02. What is the biggest value in s, -0.3, 1/4? 1/4 Let s = -22 + 24.4. Let w = 6.4 - s. Which is the third biggest value? (a) -0.5 (b) w (c) -16 c Let r = 529 - 576. What is the biggest value in r, -0.5, -2, 5? 5 Let y = 6.68 - 8.68. Let t be 27/12 + (-1)/4. Suppose -8 = -2u - 4f - f, -5u - tf = -20. What is the third biggest value in 1, u, y? y Let v be (-2)/(-3)*(-5)/15. Let t = -16.8 + 17. Let z = -1.2 + 2.2. What is the biggest value in v	{ "pile_set_name": "DM Mathematics" }
hen two letters picked without replacement from {m: 1, h: 3, s: 2, t: 1, p: 3, c: 1}? 3/55 Four letters picked without replacement from {e: 3, s: 2, m: 2, l: 6, y: 5}. Give prob of picking 1 l, 1 e, and 2 y. 1/17 What is prob of picking 1 t and 2 u when three letters picked without replacement from tututtttuuuututuut? 27/68 What is prob of picking 3 c and 1 k when four letters picked without replacement from {c: 3, k: 8}? 4/165 What is prob of picking 1 l and 1 p when two letters picked without replacement from {p: 2, h: 1, l: 1, z: 1, a: 5}? 2/45 What is prob of picking 2 s and 1 u when three letters picked without replacement from yyzuyzyusszzysssss? 7/136 Four letters picked without replacement from ozzdxcczqcq. Give prob of picking 2 q and 2 c. 1/110 Calculate prob of picking 2 n and 2 h when four letters picked without replacement from {h: 2, n: 4}. 2/5 Two letters picked without replacement from {e: 1, d: 2, a: 1, i: 1}. What is prob of picking 1 e and 1 i? 1/10 Three letters picked without replacement from nnfccfcnffcnfc. What is prob of picking 3 n? 1/91 Two letters picked without replacement from iimuigbi. What is prob of picking 1 g and 1 i? 1/7 Four letters picked without replacement from {c: 7, b: 6}. Give prob of picking 3 c and 1 b. 42/143 Calculate prob of picking 2 e when two letters picked without replacement from eeeeceeeeeeeeeeeee. 8/9 Calculate prob of picking 2 a and 2 t when four letters picked without replacement from {t: 9, a: 7}. 27/65 What is prob of picking 1 u, 1 s, and 1 b when three letters picked without replacement from uquusbq? 3/35 What is prob of picking 1 r, 1 v, and 2 s when four letters picked without replacement from rvvrrsvrs? 2/21 Four letters picked without replacement from {n: 2, s: 2, e: 1, x: 1, a: 5, l: 4}. What is prob of picking 1 a, 2 n, and 1 x? 1/273 Three letters picked without replacement from hhhuuuhuuuuhhhhh. Give prob of picking 3 u. 1/16 Two letters picked without replacement from {u: 1, d: 1, o: 3}. What is prob of picking 1 d and 1 u? 1/10 Two letters picked without replacement from nxtzk. What is prob of picking 1 t and 1 x? 1/10 Three letters picked without replacement from {b: 1, h: 1, v: 1, o: 2, l: 1, w: 1}. Give prob of picking 1 b, 1 w, and 1 o. 2/35 Four letters picked without replacement from iiuoa. Give prob of picking 1 a, 1 i, 1 o, and 1 u. 2/5 Four letters picked without replacement from jyjevekekheejyjkeh. What is prob of picking 1 e, 1 v, 1 y, and 1 j? 4/255 Two letters picked without replacement from {l: 4, y: 3}. Give prob of picking 2 l. 2/7 Three letters picked without replacement from pjuuuuuujobuuuuoupu. Give prob of picking 1 u, 1 j, and 1 b. 8/323 Four letters picked without replacement from {f: 1, g: 3}. What is prob of picking 1 g and 3 f? 0 Two letters picked without replacement from {q: 5, y: 5}. What is prob of picking 2 q? 2/9 Three letters picked without replacement from iiiiaiiaiiiiiiaiaiii. What is prob of picking 2 a and 1 i? 8/95 Two letters picked without replacement from iitiiikiikiiii. What is prob of picking 2 k? 1/91 Four letters picked without replacement from kbkkrkgxbkkkkrxkyx. Give prob of picking 1 y, 1 k, 1 r, and 1 b. 1/85 What is prob of picking 2 p when two letters picked without replacement from bxibbpbpbbxpxpipb? 5/68 What is prob of picking 3 q and 1 a when four letters picked without replacement from qqqqqqqaqaaqqqqq? 33/70 Three letters picked without replacement from {l: 4}. What is prob of picking 3 l? 1 What is prob of picking 2 p when two letters picked without replacement from {c: 7, p: 7}? 3/13 Four letters picked without replacement from jqiuji. What is prob of picking 1 j, 1 u, 1 i, and 1 q? 4/15 Three letters picked without replacement from gxvnnvkr. Give prob of picking 1 n, 1 v, and 1 g. 1/14 Two letters picked without replacement from {s: 2, k: 16}. What is prob of picking 2 s? 1/153 Two letters picked without replacement from {s: 2, i: 4, x: 4, k: 6, e: 1}. What is prob of picking 1 x and 1 s? 1/17 Calculate prob of picking 1 a and 1 h when two letters picked without replacement from {q: 1, h: 2, l: 5, a: 4, k: 2}. 8/91 Two letters picked without replacement from uujjuuuuuuuuuuuuuu. What is prob of picking 2 u? 40/51 Calculate prob of picking 2 x and 1 r when three letters picked without replacement from {x: 2, r: 1, v: 2, a: 2, b: 1}. 1/56 Three letters picked without replacement from {d: 3, v: 1, n: 5, b: 3}. What is prob of picking 2 b and 1 d? 9/220 Two letters picked without replacement from ttsmssqtstttssst. What is prob of picking 1 m and 1 q? 1/120 Four letters picked without replacement from uuuu. What is prob of picking 4 u? 1 What is prob of picking 1 z, 2 p, and 1 b when four letters picked without replacement from zzpbbbpbpbzz? 4/33 What is prob of picking 1 n and 1 s when two letters picked without replacement from ubsbngnsuenbs? 3/26 Two letters picked without replacement from {g: 1, f: 4, s: 2, k: 6, d: 2}. Give prob of picking 1 g and 1 f. 4/105 Two letters picked without replacement from {f: 2, y: 1}. What is prob of picking 1 y and 1 f? 2/3 What is prob of picking 1 y and 1 r when two letters picked without replacement from {u: 1, k: 2, g: 1, r: 1, y: 2}? 2/21 What is prob of picking 2 a when two letters picked without replacement from vaa? 1/3 Four letters picked without replacement from {w: 9, d: 2, k: 2}. What is prob of picking 2 w and 2 k? 36/715 Calculate prob of picking 3 o and 1 h when four letters picked without replacement from uaoyhawooyhahwwh. 1/455 What is prob of picking 1 q and 1 d when two letters picked without replacement from {d: 3, c: 1, q: 1}? 3/10 Calculate prob of picking 3 m and 1 f when four letters picked without replacement from mfffmmmmmmmfmm. 480/1001 Two letters picked without replacement from {h: 4, e: 3, q: 1}. What is prob of picking 2 h? 3/14 Four letters picked without replacement from lgnvngyyvvyz. Give prob of picking 2 g, 1 y, and 1 n. 2/165 Calculate prob of picking 1 t and 2 m when three letters picked without replacement from mmmmttmmmm. 7/15 What is prob of picking 2 z and 1 t when three letters picked without replacement from {t: 3, z: 2}? 3/10 What is prob of picking 2 a and 1 d when three letters picked without replacement from tmaud? 0 What is prob of picking 1 x and 1 l when two letters picked without replacement from xxxxxlxxzlllx? 16/39 What is prob of picking 2 y when two letters picked without replacement from yhsyryhrrrrsrrr? 1/35 What is prob of picking 1 e and 3 f when four letters picked without replacement from {u: 1, e: 3, f: 3}? 3/35 Calculate prob of picking 2 t and 2 k when four letters picked without replacement from {t: 6, k: 4}. 3/7 Calculate prob of picking 2 p and 1 b when three letters picked without replacement from bppp. 3/4 Three letters picked without replacement from hbhhhhbhhhh. What is prob of picking 1 h and 2 b? 3/55 What is prob of picking 2 q and 2 x when four letters picked without replacement from {q: 4, x: 6}? 3/7 Three letters picked without replacement from aaa. Give prob of picking 3 a. 1 Calculate prob of picking 1 o and 1 b when two letters picked without replacement from {o: 6, p: 6, b: 3}. 6/35 What is prob of picking 4 d when four letters picked without replacement from drrddyddrdrprrr? 1/91 Calculate prob of picking 1 n, 1 e, and 2 y when four letters picked without replacement from {l: 1, y: 2, n: 9, v: 2, b: 2, e: 4}. 12/1615 Four letters picked without replacement from {q: 4, k: 2, t: 1, n: 1, l: 2, x: 2}. Give prob of picking 1 x, 2 k, and 1 l. 4/495 Calculate prob of picking 2 s when two letters picked without replacement from {b: 2, s: 2, r: 8, u: 1, n: 2}. 1/105 Four letters picked without replacement from {o: 2, c: 8, a: 5, b: 2, q: 2}. Give prob of picking 2 c and 2 b. 7/969 What is prob of picking 1 x and 1 w when two letters picked without replacement from xwwxiinxzmii? 1/11 What is prob of picking 2 j and 2 e when four letters picked without replacement from hshsjhjhhjehe? 3/715 Two letters picked without replacement from {w: 3, s: 2, c: 4, o: 2, x: 1}. Give prob of picking 1 w and 1 c. 2/11 Calculate prob of picking 1 t and 2 i when three letters picked without replacement from {i: 6, t: 2, x: 5,	{ "pile_set_name": "DM Mathematics" }
e Does 39 divide 447290727? True Is 6708 a factor of 362565080? False Is 23277961 a multiple of 571? False Is 199788653 a multiple of 127? True Is 28 a factor of 63341096? True Is 37319595 a multiple of 7? False Does 374 divide 904649014? False Does 4788 divide 160259148? True Is 41418762 a multiple of 17? False Is 55977153 a multiple of 1517? False Is 17 a factor of 3562989? False Does 33 divide 453477675? False Is 321311657 a multiple of 31? False Is 1016970402 a multiple of 5586? True Is 635852886 a multiple of 17? False Is 22649004 a multiple of 42? True Is 31706428 a multiple of 52? True Is 7671616 even? True Does 627 divide 11428329? True Is 30561300 a multiple of 900? True Does 135 divide 24993225? True Is 2083731266 a multiple of 5716? False Does 241 divide 159759180? False Is 715 a factor of 440555115? True Does 36 divide 243253600? False Does 183 divide 35023455? True Is 63 a factor of 2205716184? True Does 1006 divide 9039916? True Is 22934631 a multiple of 3? True Is 8293 a factor of 1370517766? True Is 994 a factor of 443708678? True Is 1054 a factor of 672996461? False Is 770 a factor of 36377344? False Is 11575298 a multiple of 5? False Does 67 divide 18342255? True Does 820 divide 75601540? True Does 60 divide 1896030092? False Does 1260 divide 11041380? True Does 97 divide 73028626? False Does 16 divide 80347602? False Does 46 divide 749404366? False Is 25 a factor of 27398225? True Is 5 a factor of 1185644071? False Does 271 divide 76162783? False Is 85 a factor of 4658151725? True Does 44 divide 13152392? True Is 472650676 a multiple of 90? False Is 26 a factor of 20270058? False Is 28068460 a multiple of 7? True Is 9 a factor of 133378070? False Is 66247644 a multiple of 3? True Is 17 a factor of 206694376? False Does 4013 divide 76888026? False Is 346131213 a multiple of 265? False Is 2058056492 a multiple of 6? False Is 1135339956 a multiple of 37? False Is 869824181 a multiple of 1761? False Is 118 a factor of 49427143? False Is 205928580 a multiple of 15? True Is 74560852 a multiple of 3453? False Is 31 a factor of 279968068? True Is 1114600681 a multiple of 9707? False Is 284627148 a multiple of 2590? False Does 15 divide 208403408? False Is 22886587 a multiple of 226? False Is 2067833610 a multiple of 310? True Does 57 divide 262188598? False Is 1993669 a multiple of 2? False Is 205817664 a multiple of 416? True Is 4 a factor of 15241361? False Is 663 a factor of 416981916? True Does 10 divide 511064275? False Is 29 a factor of 25545550? False Does 111 divide 1741722212? False Is 551937215 a multiple of 5? True Does 19 divide 22708914? True Does 23 divide 68657852? True Is 2799 a factor of 3783080817? True Is 17 a factor of 618391860? False Does 26 divide 1161834154? True Is 71863112 a multiple of 973? False Is 37 a factor of 1935137? True Does 419 divide 667291817? False Is 51979220 a multiple of 63? False Is 394767363 a multiple of 1513? False Does 76 divide 30312556? False Does 1185 divide 177933185? False Is 209 a factor of 99877342? False Is 247611067 a multiple of 407? True Does 18 divide 14275764? True Does 13 divide 103385665? False Is 418072703 a multiple of 5644? False Is 2281625049 a multiple of 1030? False Is 151811973 a multiple of 924? False Is 24971994 a multiple of 2084? False Does 104 divide 3309738848? True Does 105 divide 29050875? True Does 6 divide 244771260? True Does 239 divide 692876001? False Is 850 a factor of 305172950? True Is 2235 a factor of 934527255? True Is 275 a factor of 116539225? True Does 45 divide 22200319? False Is 22413110 a multiple of 12? False Is 17 a factor of 441803956? True Is 38 a factor of 99862176? True Is 583098875 a multiple of 10203? False Does 493 divide 503937698? True Does 1255 divide 89087430? True Does 2428 divide 33054792? True Is 27 a factor of 257906916? True Is 5 a factor of 179970? True Does 9 divide 78215658? False Is 2867212816 a multiple of 47? True Is 20 a factor of 34622020? True Is 13 a factor of 5319951? True Is 2321 a factor of 905702941? True Does 204 divide 3487112964? True Is 46641325 a multiple of 48? False Is 41156985 a multiple of 32? False Does 26 divide 4373356? True Does 2188 divide 151203722? False Is 924 a factor of 67568424? True Does 168 divide 15794520? True Does 17 divide 1144326111? False Is 55249222 a multiple of 9? False Is 30 a factor of 61510530? True Is 54419586 a multiple of 30? False Is 1274 a factor of 647212384? True Is 71 a factor of 1123870458? False Does 5731 divide 842137064? False Does 183 divide 1714087068? True Is 221 a factor of 18921357? True Is 157488029 a multiple of 88? False Is 1774622178 a multiple of 18? True Does 408 divide 2622740106? False Does 20 divide 52919374? False Is 1209 a factor of 136429605? True Is 148097417 a multiple of 66? False Is 17574560 a multiple of 14? False Is 63612164 a multiple of 63? False Is 3760 a factor of 46808573? False Is 1979832 a multiple of 4? True Is 447897665 a multiple of 644? False Does 818 divide 2941451926? True Is 606 a factor of 16434720? True Is 56248743 a multiple of 20? False Does 49 divide 48005888? True Is 7334 a factor of 1453743819? False Is 172474640 a multiple of 10? True Is 1561320246 a multiple of 2576? False Does 16 divide 981830153? False Is 1988976906 a multiple of 18? True Is 21 a factor of 1101649899? True Does 1191 divide 1940796455? False Is 27 a factor of 43487045? False Is 137 a factor of 6565177? True Is 29 a factor of 357548? False Does 21 divide 17815755? False Is 156 a factor of 358251660? True Does 232 divide 107675756? False Is 991 a factor of 3374793160? False Does 6 divide 100634532? True Does 2631 divide 2774081673? True Is 519846912 a multiple of 288? True Is 924614658 a multiple of 16? False Is 106 a factor of 42783231? False Does 118 divide 1639466781? False Does 10 divide 309151600? True Does 19 divide 20489182? True Does 64 divide 1387840037? False Is 1150457030 a multiple of 19? True Is 42 a factor of 91363210? False Is 424 a factor of 874546216? True Is 45032442 a multiple of 206? False Is 27958098 a multiple of 34? True Is 129 a factor of 85649532? False Does 3716 divide 4463871012? True Does 4 divide 43115862? False Is 76475280 a multiple of 10? True Is 326110613 a multiple of 24? False Does 2628 divide 654460031? False Is 1730 a factor of 518362419? False Does 2289 divide 175766475? False Does 4 divide 35920350? False Is 17217888 a multiple of 841? False Does 664 divide 123401166? False Is 475160686 a multiple of 110? False Is 12 a factor of 124401583? False Does 615 divide 1318954242? False Does 31 divide 42867575? True Is 4994 a factor of 2203347806? True Does 13 divide 82276220? True Is 204 a factor of 3864061? False Is 189467524 a multiple of 692? True Is 370 a factor of 1675757380? True Is 65 a factor of 42634147? False Does 103 divide 153699896? True Is 28144310 a multiple of 54? False Does 40 divide 207085920? True Is 112671622 a multiple of 7? True Is 921897210 a multiple of 2920? False Does 13 divide 37334544? True Does 115 divide 76698675? True Is 185 a factor of 44689710? True Is 35 a factor of 32949336? False Is 212 a factor of 5067664960? True Is 738 a factor of 51172472? False Is 196220646 a multiple of 18? True Is 1190630203 a multiple of 21? False Is 3262717600 a multiple of 20? True Does 58 divide 134220294? True Is 54099860 a multiple of 837? False Is 1225257800 a multiple of 260? True Is 23 a factor of 21485565? True Does 107 divide 475556918? False Is 33 a factor of 844950557? False Is 26342011 a multiple of 323? False Is 31019723 a multiple of 282? False Is 2003427702 a multiple of 157? True Does 8 divide 476529488? True Does 33 divide 7917228? True Does 107 divide 3485446462? True Is 884221115 a multiple of 51? False Is 13 a factor of 1405452956? False Does 242 divide 94678144? True Does 73 divide 17828129? False Is 126 a factor of 24308936? False Is 179 a factor of 139396071? True Does 1315 divide 84232325? True Does 30 divide 1509256770? True Does 28 divide 279251393? False Does 1459 divide 1334389728? True Is 1506 a factor of 97319655? False Does 22 divide 380578? True Is 531155350 a multiple of 370? True Is 21 a factor of 25858045? False Is 1897402164 a multiple of 7588? True Is 323 a factor of 488	{ "pile_set_name": "DM Mathematics" }
+ o*5/5 + 5o*4/8 - 2o*3/3 + 185o*2. Calculate n(13). 22 Let l be 1 + 6 + -4 - 1. Suppose c - 5 = -5s, 8 = lc + 5s + 3. Let d(f) = f3 - f2 + f - 10. What is d(c)? -10 Let k(p) = p*2 - 4p + 1. Suppose 5o = 3x + 6, -11o = -3x - 7o - 3. Determine k(x). -2 Let p(i) = -6i*3. Suppose 0f + 3 = -3f - 3z, -4f + 2z + 26 = 0. Suppose -3 = -fo + 1. What is p(o)? -6 Let v be -3((-15)/9 + 4). Let k(o) be the second derivative of -8o + 1/3o*3 + 5/2o2 + 0. Give k(v). -9 Let d(i) be the first derivative of -i3/2 + 3i2 - i - 11. Let r(w) be the first derivative of d(w). Give r(4). -6 Let w(d) = d3 + 5d*2 + 3d - 3. Suppose -8 + 32 = 3a. Suppose -9p + ap = -5. Suppose 3c + 3 = -pg, 4c = -4 + 20. What is w(g)? 6 Let f = 277 + -271. Let x(m) = m*2 - 8m + 4. Give x(f). -8 Let c(o) = -12o3 - 1. Let x(r) = r2 + r - 2. Let n be x(-4). Let v(j) = -j2 + 9j + 9. Let d be v(n). Give c(d). 11 Suppose 2u + 0u - 20 = 0. Suppose 6y - 4y - u = 0. Let g(s) = s - 5. Calculate g(y). 0 Let g(y) be the third derivative of -1/12y5 + 1/6y*3 - 1/120y*6 + 0 + 5y*2 - 1/24y*4 + 0y. Suppose 2t + 2 = -8. Calculate g(t). 6 Let b = -244 - -252. Let z(u) = u3 - 9u*2 + 11u - 12. What is z(b)? 12 Suppose 6o - 2o = 20. Let i(t) = -6 + 3t + 2 + o. Let n(k) = -k + 1. Let g(m) = i(m) + 6n(m). What is g(5)? -8 Let q(p) = p - 1. Let d = -145 + 150. Calculate q(d). 4 Let l(o) = 11 - 4o + 4 - 6 - 4o + 7o. Let n be (1/(-2))/(-1)0. Calculate l(n). 9 Let d(u) = -u*2 - 3u + 6. Suppose -9x - 4 = -4. Let r be d(x). Let f(p) = p2 - 5p - 3. Determine f(r). 3 Let n(a) = -a*2 + 7a + 11. Let s be n(8). Suppose -6l + sl = 15. Let z be 1/(-2)0 + l. Let g(i) = -i2 - 3i + 5. Give g(z). -5 Let h be (-17 + 17)/(-31). Suppose 2w + 3w + y - 35 = h, -5y = -25. Let r(l) = -1 + l*3 - 3l - 2l - wl*2 + 7 + 3l. Calculate r(6). -6 Let w(h) = h + 2. Let l = -16 - -18. Suppose -3 + 7 = -ln. Give w(n). 0 Let v(h) = -16 + 39h - 31h - 20. Let w be v(4). Let y(a) = -a2 - 4a + 4. Calculate y(w). 4 Let h(k) = k*3 + 6k*2 + 3k - 7. Let n be (-210)/(-21)2/(-4). Give h(n). 3 Let y(p) = -2p + 14. Let u be y(4). Suppose uz - 12 = 10z. Let r(v) = 5v - 1. Let h(g) = -1. Let w(m) = -4h(m) + r(m). Give w(z). -12 Suppose -9d = -477 + 432. Let w(r) = 3r + 6. Give w(d). 21 Let g(d) be the first derivative of -d4/4 - d3/3 - 13d + 334. Calculate g(0). -13 Let j(l) = l3 + 2l*2 - 5l + 3. Let i(s) = s - 18. Let f be i(21). Determine j(f). 33 Suppose 71 - 247 = 4k. Let g be (-11)/k + 38/8. Suppose -21 = 3o + 4p, 5 = -go - p - 13. Let f(q) = q*2 + 4q - 1. Determine f(o). -4 Let z(o) = 4 - 1 - 7o + 14o + o*2 + 1. Suppose 0 = 3k + 2g + 26, -14 = 3k - 2g + g. What is z(k)? -2 Let w(p) be the first derivative of -5p - 1/3p3 - 22 - 3/2p*2. Let q(n) = -n - 2. Let l be q(2). What is w(l)? -9 Suppose 5f - 7 - 8 = -5k, 9 = -5f + k. Let m(w) = -3w + 2. Let a(t) = 2t - 1. Let q(h) = -8a(h) - 5m(h). Determine q(f). -1 Let n(f) = 19 - 36 + 16. Let c(w) = w + 4. Let r(q) = -c(q) - 6n(q). Give r(2). 0 Suppose -6 = -x - 9. Suppose -3n + 7n = 8. Let u(v) = 2v - 4 + 3 + 4vn - 3v*2. Determine u(x). 2 Let a(m) = 5m - 4. Let q(g) = -4g + 4. Let b(l) = 5a(l) + 6q(l). Let n be (138/(-15))/2 + 2/(-5). Determine b(n). -1 Suppose 9 = 3p + 3. Suppose 4t - 33 = -j, j + pj + 2t = 79. Suppose -4h - h = j. Let w(q) = q*2 + 2q - 6. What is w(h)? 9 Let j(n) = -2n3 + 3n*2 - 2n + 2. Let z(f) = 7f - 68. Let d be z(10). What is j(d)? -6 Let p be -1 + -4 - (2 - 1). Let l be p/84/(-6)12. Let i(b) = -b2 + 7b - 5. Calculate i(l). 1 Let q(j) = -j*2 - 6j - 1. Let o be (-2)/(4 - 2)-4. Let v(b) = 5b + b*3 + 4 - 4b + 1 - 5b2 + b. Let w be v(o). Give q(w). 8 Let q(a) be the second derivative of -1/3a*3 - 23a - 1/12a4 - a2 + 0. Determine q(-3). -5 Let t = 11 - 16. Let j(o) = 6o + 3. Let w(s) = -7s - 2. Let c(z) = tw(z) - 6j(z). Let x be c(-9). Let l(r) = -5r*3 + 2r - 1. What is l(x)? -4 Suppose 14 = -2x - 5q, 0q - 23 = -5x + 2q. Suppose -23 - 7 = 5h + w, xh = 5w - 18. Let d(n) = -n*3 - 7n*2 - 7n + 7. Give d(h). 13 Let i(u) = -3u + 7. Suppose 6v = -4 + 22. What is i(v)? -2 Let y(c) = -c*2 - 6c + 2. Let m be y(-4). Let p be (-1)/5 + 62/m. Let r(v) = 6v + v + 6 - 9v + v. What is r(p)? 0 Let f(x) = 65x3 - x2 + 2x - 1. Suppose 14 = 3516u - 3502u. Give f(u). 65 Let h(f) = 5f + 45. Let a be (-708)/1770 + (0 - 66/10). Determine h(a). 10 Let b(s) be the third derivative of s7/2520 - 13s5/60 - s2 - 2. Let f(p) be the third derivative of b(p). Let w be -3 + 2 - (0 + 0). Calculate f(w). -2 Suppose -797 + 779 = 3d. Let p(b) = b3 + 6b*2 + 6b + 28. What is p(d)? -8 Let r(b) be the first derivative of -b*4/4 - 8b*3/3 + 7b*2/2 - 21b + 1. What is r(-9)? -3 Let l(j) = j*3 + 4j*2 - 6j + 1. Let w = 437 + -298. Let d = -144 + w. What is l(d)? 6 Let v(j) = -j*3 + 4j*3 - 2j*3 - 4j*2 - 2 + 2j. Let w = 152 + -150. What is v(w)? -6 Let l(x) be the third derivative of 1/12x4 + 27x*2 + 1/6x*3 - 1/12x*6 + 0x*5 + 0x + 0. Determine l(-1). 9 Let z(q) = 3q2 + 16q + 5. Let b be z(-5). Let j(u) = 2u2 + 2u + 10. What is j(b)? 10 Let f(c) = 73684c - 4 - c3 - 73681c - 2c3 - 10c*3. Calculate f(1). -14 Let v(y) = 2y*3 - 3y*2 - y - 5. Let z be v(3). Let q = 27 - z. Let o(s) = -2s - 2. Give o(q). -18 Let w be (7 + 6 + -8)/(5/6). Let d(q) be the second derivative of q*3/6 - 7q2 + q. What is d(w)? -8 Let n(q) be the second derivative of q6/720 + 7q5/120 - 5q*4/4 + 15q. Let z(u) be the third derivative of n(u). Determine z(-5). 2 Let z(l) = l*2 - 3l - 3. Let n(k) = -k*2 + 10k + 15. Suppose -2u + 3t - 4t = -18, 0 = -5t - 20. Let r be n(u). Determine z(r). 1 Let y(a) = -a*2 + 43a - 288. Let i be y(8). Let r(l) = l*2 + 6l - 6. Determine r(i). 10 Let v(o) be the first derivative of 2o3/3 - 3o*2/2 + 2o + 4. Give v(2). 4 Let n(p) = -p*3 + 6p*2 - 7p + 4. Let a(b) = -b3 - b2 - 3b - 3. Let h be a(-3). Suppose -21y = -hy + 12. Determine n(y). 8 Let m(d) = d3 + 7d*2 - 10. Suppose -i - 4q = -13, 2i - i + 3q = 8. Determine m(i). -10 Let f(n) be the first derivative of 2 + 1/2n2 + 1/4n*4 - 4/3n*3 - 3n. Let m be 8/((6 - 4)1). Determine f(m). 1 Let h(j) = -j3 - 5j*2 + 2j + 6. Let u be h(-5). Let x(m) = 4m + 569 + 5m - 5m - 571. What is x(u)? -18 Let p(f) = 2f*2 + 2. Let s(z) = -11z*2 - z - 17. Let g(w) = -6p(w) - s(w). Determine g(4). -7 Let z(n) = -4 + 5 + 2 + 4n. Suppose 5d - a - 25 = 0, 3a = -0a. Suppose 5s = -d - 5. What is z(s)? -5 Let u be 1/6 - 26/12. Let k = 6 + u. Let q(p) be the first derivative of -p4/4 + 5p*3/3 - 2p*2 - 4p + 172. Give q(k). -4 Let s = -134 + 129. Let j(i) = -i*3 - 5i*2 - 2i + 6. What is j(s)? 16 Let v(d) = -d*3 - 11d*2 - d - 8. Let q be v(-11). Let h(i) = 11i*2 + 13i*2 + q - 2i - 25i2 - 4. Determine h(-1). 0 Let u = 0 + -1. Let d(x) be the second derivative of -4x3/3 + x2/2 + 3107x. Give d(u). 9 Let h(o) = -o2 - 5o + 8. Let a = -286 - -279. Calculate h(a). -6 Let v(z) be the first derivative of -z*4/4 + 2z*3/3 + 3z*2/2 + 6z - 68. Determine v(3). 6 Let q = 107 - 90. Let t(o) = -27o3 + qo3 + o2 - 1 + 11o3. Let d be 1/20/1. What is t(d)? -1 Let q = 40 - 61. Let o = 23 + q. Let c be 24/(-2)o/4. Let w(d) = -d3 - 7d*2 - 3d + 4. Determine w(c). -14 Let h(n) = n*3 - 8n*2 + 8n - 4. Let s be h(7). Let p(a) be the second derivative of -1/20a5 + 1/4a*4 + 17a + 3/2a2 + 0 + 1/6a*3. Give p(s). 6 Suppose 55i - 20i = -140. Let d(o) = 4o*2 + 12o + 7. Let b(n) = 2n2 + 6n + 3. Let r(t) = 5b(t) - 2d(t). What is r(i)? 9 Let j be ((-4)/12-15)/1. Suppose -jl = 4i - 60, 3l + l - 4i = 12. Suppose 0 = 2g - 0g + l. Let h(f) = f3 + 4f*2 + 1. What is h(g)? 1 Let n be (-4)/6 + 20/(-6). Let k be 4 + (-6)/(-5)70/(-21). Let d = k + n. Let p(m) = m*3 + 3m*2 - 3m + 5. Calculate p(d). 1 Let l(i) = i*2 - i + 2. Let o be l(2). Let z(q) = -q + 2. Let h be z(2). Suppose os + hs = -4. Let n(c) = 2c*3 - 2c*2 - 2c - 1. Give n(s). -3 Let z(v) be the first derivative of -v**2 + 1. Let r(	{ "pile_set_name": "DM Mathematics" }
b) = 6b. Let s(z) = -z2 - 13z - 13. Let y be s(-12). Calculate o(y). -6 Let n(g) = g - 2. Let o be (36/10)/((-6)/(-20)). Let p be 8/(-3)(-18)/o. What is n(p)? 2 Let t(r) = 5r - 1 - 6r - 2r. Let a(p) = 2p2 + 1 - p2 - p + 0p*2 - 3p. Let w be a(4). Give t(w). -4 Let r be 26/(-22) - (-5)/((-55)/(-2)). Let b(s) = -5s2 - 1. Calculate b(r). -6 Let n(u) = -9u - 25. Let x(p) = 5p + 13. Let m(g) = 6n(g) + 11x(g). Determine m(5). -2 Suppose -2s = c + 3, -4c + 0 + 10 = -3s. Let j be (1 + 3)s/(-4). Let v be (1 + 5)j/(-3). Let z(w) = -w*2 - 5w - 2. Determine z(v). 2 Let o(t) be the first derivative of -4t3 + t2/2 - t - 16. What is o(1)? -12 Let z(s) = -4 + 40s - 86s - s2 + 40s. Determine z(-3). 5 Let d(h) = -h*3 - 5h*2 - 2h + 5. Suppose -2t + t - 4 = 0. Give d(t). -3 Let v(b) = -b2 - 7b + 2. Suppose -10z + 3z - 35 = 0. Determine v(z). 12 Let i(f) = 7f + 3 + 3 - 12f + 7f. Give i(-6). -6 Let m(f) = f2 + 6f - 1. Let c = -10 - -13. Let s(a) = -a - 3. Let w be s(c). Determine m(w). -1 Let a(g) = g - 7. Let i be a(6). Let y(v) be the first derivative of v3/3 + v2/2 - 1. Let m(q) = 18q2 + 9q. Let o(p) = -m(p) + 9y(p). Give o(i). -9 Suppose -2 = -4p - 6. Let b(r) = r*3 + 6r*2 - 5. Let w(s) = -3s3 + 3 - 3 + s3 + 9 - 11s2. Let h(y) = 11b(y) + 6w(y). Determine h(p). 0 Let g(m) = -4. Let h(w) = -w. Let d(b) = -g(b) + 4h(b). Let j be -61(-1)/2. Calculate d(j). -8 Let x(g) = -4g + 3. Let a(c) be the third derivative of c5/60 + c4/24 + c3/2 + c2. Let j be a(0). Give x(j). -9 Let i(j) be the third derivative of j5/15 - j3/3 + 13j*2. Give i(2). 14 Suppose -5i + 18 = -h, -4i + 0i + 6 = -5h. Let g(b) be the second derivative of hb - 4/3b3 + 1/2b*2 + 0. Give g(1). -7 Let r(p) be the second derivative of p + 0 + 1/6p*3 + 4p*2. Let i(h) = 3h + 25. Let w(a) = -2i(a) + 7r(a). What is w(-5)? 1 Let u(g) = -g2 - g - 1. Let i be 0 + (2 - 0) + -9. Let n(b) = -b - 7. Let k be n(i). Determine u(k). -1 Let u(w) = -w2 - 6w + 1. Suppose g + 32 = -4y, -3y - g + 0g - 25 = 0. Give u(y). -6 Let y(o) = -o2 - o - 1. Let w(t) = t2 + 2t + 4. Let j(n) = w(n) + 4y(n). Suppose k - 3 = -5. Calculate j(k). -8 Let s(b) = b*2 - 4. Let c be ((-4)/5)/(3/15). Calculate s(c). 12 Suppose 3w - 12 = -3. Let f(j) = 10 + 7j + 7j*2 + j + 10j*3 - 9j*w - 2. Determine f(-6). -4 Let w = -35/2 + 18. Let m(s) be the first derivative of -ws*4 + 0s2 - s3 + s + 2. Give m(-2). 5 Let k(m) = m*3 + 4m*2. Suppose -n + 8 = 5. Suppose 2l = -nl - 20. Let v be k(l). Let q(y) = -y2 - 2. Calculate q(v). -2 Let s(g) be the first derivative of g3 + g2/2 - g + 13. Determine s(1). 3 Let t(b) = -3b + 1. Suppose 0l + 5n = -l - 23, -4l + 23 = -3n. Give t(l). -5 Let h(n) = 0n - 2n + 3n2 + n3 + 2n - 4n. Let s = 0 + 1. Let p be ((-2 - -3)-4)/s. Give h(p). 0 Suppose 4r - 9 = r. Let t(f) = -9f*r + f + 0f + 10f3 + f + f2. Determine t(-2). -8 Suppose 4b = 2b + 8. Suppose 0v + 3w + 5 = 4v, -17 = 5v + bw. Let k(r) be the second derivative of -3r5/20 + r4/12 + r. Calculate k(v). 4 Let p(w) = 7w + 13. Let n(i) = 11i + 19. Let z(q) = -q3 - 9q*2 + 1. Let d be z(-9). Let t be ((-10)/25)/(d/20). Let j(r) = tp(r) + 5n(r). Give j(-6). -3 Suppose -2i + 6 = -4. Suppose 4b + 25 = ij - 5, -3b = j + 13. Let n(m) = m2 + 2m - 2. Give n(j). 6 Let t = 1 - 1. Suppose t = -0l + l + 5. Let f(w) be the second derivative of -w5/20 - 5w4/12 - w3/6 + w*2/2 - 28w. Calculate f(l). 6 Let d(w) = w*2 - 3w + 3. Suppose 0 = 4u + 1 - 17. Calculate d(u). 7 Let i(m) = m2 + 4m + 5. Let j(q) = -2q2 - 7q - 9. Let c(s) = -11i(s) - 6j(s). What is c(3)? 2 Let g(z) be the third derivative of -z5/60 - z4/4 + z*3/2 - 24z*2. Calculate g(-7). -4 Suppose 5t - 16 = 4t. Suppose -2 = o + 2i, -2o + 4o - t = i. Let j(r) be the second derivative of -r*3/6 + 5r*2 + 3r. Determine j(o). 4 Let b(u) = -4 + 4u - u - 2. Let o = -10 + 15. Let w(t) = -3t + 7. Let d(c) = ow(c) + 6b(c). What is d(-2)? -7 Let d(k) be the second derivative of k7/2520 + k6/180 - k5/20 - k4/2 - 7k. Let s(u) be the third derivative of d(u). Calculate s(-5). -1 Let q(h) = -2h - 9. Let i be q(-6). Let m(x) = x + x*2 - 3x*3 - 4 + 2x*i + 1 + 0x*2. Determine m(0). -3 Suppose -3y + 5 + 4 = 0. Let j(l) = -5l3 - 3l + 2l + ly + 2l*2. Calculate j(1). -3 Let g be ((-1)/3)/(2/(-6)). Suppose -3b + 0j + 5j = -11, 3b + j - 5 = 0. Let d(v) = 10v*3 + 1 - 4v*2 - 3v*3 - 2 + 2v*2 + bv. What is d(g)? 6 Let z(l) = -2l + 1. Let i be (-1)/(-5) - 355/25. Let a = -9 - i. Calculate z(a). -9 Suppose 2a = o - 5o + 6, 0 = -o - 2a + 3. Let l(q) = -5q + 1. What is l(o)? -4 Let s(k) = k3 + 3k2 - 4. Let z be s(-3). Let v(r) = r2 + 4r + 2. What is v(z)? 2 Let t(u) = -7u + 1. Let f(y) = -y*3 + 2y*2 + 2y - 2. Let q be f(2). Let v be 0/(-2 - -3) - q. Determine t(v). 15 Let j(w) = -2w + w + 2w2 - w2 + 1. Suppose 0 = 2q - 6q. Let n be j(q). Let p(z) = 3z3 - z2 + 1. Determine p(n). 3 Let m(h) be the first derivative of -h2 - 3h + 48. Determine m(-6). 9 Let z(x) = -2. Let m(f) = -f. Let i(q) = -3m(q) - z(q). Suppose 0 = 54k - 52k - 4. Determine i(k). 8 Let t(z) be the first derivative of -z4/6 + z3/3 + 3z2/2 - z + 4. Let r(h) be the first derivative of t(h). Give r(3). -9 Let i(r) be the second derivative of -r4/24 + r*2/2 + 3r. Let x(a) be the first derivative of i(a). Let o(g) = 2g - 3. Let n be o(3). What is x(n)? -3 Let c(l) = -l - 6. Let i be c(-7). Let q(o) = -2o + 1. Calculate q(i). -1 Let z(j) = j*3 - 5j*2 - 7j + 7. Let r be z(6). Let m(v) = 17v2 - 1. Determine m(r). 16 Let m(j) be the third derivative of -j5/60 + j4/8 - 2j*3/3 + 3j*2. Let v = 10 + -7. Determine m(v). -4 Let q(f) = -4f + 11. Let p be q(4). Let c(x) = -x*3 - 6x*2 - 4x. Calculate c(p). -5 Let g(z) = z*2 + 8z + 9. Let w = 2 + -15. Let y = w - 2. Let f = y - -9. Determine g(f). -3 Let m(q) = -q*2 - 6q - 3. Suppose 0 = j + 5 - 0. Let c be (-5)/(-2 - (j + 2)). What is m(c)? 2 Let y be 124/(-28) + 12/28. Let s(f) = f + 4. Determine s(y). 0 Let c(r) = 0r3 + 7r*3 + 1 - 60r*2 + 6r*3 + 59r*2. Suppose -o + 3o - 2 = 0. Calculate c(o). 13 Let w(k) be the second derivative of 1/20k5 + 9k + 4/3k3 - 2/3k*4 - 5k*2 + 0. What is w(7)? -3 Let m(o) = 3o*2 + 1 - 2o*2 - 4o*2 + 2o2. Let p be (-2)/(-5) + (-12)/5. What is m(p)? -3 Let h be (-4 + 2)/(4/10). Let t(a) = a3 + 6a2 + 5a + 2. Calculate t(h). 2 Let t be 2/(-4) - 6/4. Let k(n) be the first derivative of -n*5/20 + 2n*3/3 + 3n*2/2 + n - 1. Let s(l) be the first derivative of k(l). Determine s(t). 3 Let k(s) = 11s*2 + 3s - 13. Let x(h) = -5h2 - h + 6. Let f(j) = -6k(j) - 13x(j). Suppose -b + 5z - 16 = 0, 3b + z - 2z + 20 = 0. Calculate f(b). -6 Let l(f) = -4f3 - 2f - 6f - 10f*2 - 12f*2 - 25 - 4f. Let n(b) = 3b3 + 15b*2 + 8b + 17. Let h(c) = 5l(c) + 7n(c). What is h(6)? 6 Let x be (-8)/12 - (-24)/9. Let t(i) = -i*x - 1 + 7i - 6i + 2i2. Calculate t(-4). 11 Let f(z) = -z3 + z*2 - 1. Let q(g) = 4g*3 + 9g*2 + g + 17. Let b(o) = -3f(o) - q(o). Calculate b(-12). -2 Let x(w) = w*2 + 4w. Let j be x(-2). Let m = j - -10. Let y(u) = u + 4 - m - u - u. Calculate y(-4). 2 Suppose -2z = -3z + 3. Let k(l) = 5l - 2l - z - 4. Give k(6). 11 Suppose 0 = -2u + 4s - 20, s - 5 = -4u - 0s. Suppose ul = -2l - 8. Let i(d) = d*2 + 3d + 2. What is i(l)? 6 Let t(d) = -4 - 2 + d - 1. Let w = 25 + -20. Calculate t(w). -2 Suppose 6 = 2x - 3x. Let v(n) = -n*2 - 5n + 3. Calculate v(x). -3 Let a(g) be the third derivative of -g8/6720 + g7/630 - g6/240 - g5/120 + g*4/12 + 2g2. Let r(d) be the second derivative of a(d). What is r(3)? -1 Let j(t) = -t2 - 3. Suppose 2r + 0 = 6. Calculate j(r). -12 Let b(j) be the third derivative of j4/24 - j3/6 - 13j2. Calculate b(-4). -5 Let z(g) be the third derivative of -g5/60 - g*3/3 + 9g*2. Determine z(0). -2 Let r(f) = 2f - 1. Let n = -37 + 16. Let d be (-3)/((-27)/(-6))n. Suppose -3x + 4g = -g - 1, -4x = g + d. Determine r(x). -7 Let a(n) = -6n2 + 2 + 8n3 - n3 - 7*n	{ "pile_set_name": "DM Mathematics" }
or of 2 and 25? 1 Calculate the highest common divisor of 1417 and 109. 109 Calculate the highest common factor of 207 and 36. 9 What is the highest common factor of 77 and 1001? 77 What is the highest common factor of 95 and 15? 5 Calculate the greatest common divisor of 17897 and 11. 11 Calculate the greatest common divisor of 81 and 135. 27 What is the greatest common divisor of 320 and 180? 20 Calculate the greatest common divisor of 29 and 1943. 29 Calculate the greatest common divisor of 110 and 1782. 22 Calculate the highest common factor of 58 and 12557. 29 What is the highest common divisor of 98 and 287? 7 What is the greatest common factor of 24 and 1792? 8 What is the highest common factor of 108 and 171? 9 What is the greatest common divisor of 106 and 2? 2 Calculate the highest common divisor of 244 and 305. 61 Calculate the greatest common factor of 624 and 6. 6 Calculate the highest common divisor of 30 and 1830. 30 Calculate the greatest common factor of 1 and 487. 1 What is the highest common divisor of 71 and 1136? 71 Calculate the highest common divisor of 51379 and 191. 191 What is the greatest common divisor of 1024 and 288? 32 Calculate the highest common divisor of 46283 and 31. 31 Calculate the highest common divisor of 50 and 1150. 50 What is the greatest common divisor of 414 and 18? 18 What is the highest common divisor of 31 and 2015? 31 Calculate the greatest common factor of 256 and 160. 32 What is the highest common factor of 2964 and 1596? 228 Calculate the highest common divisor of 75 and 915. 15 What is the highest common divisor of 2130 and 210? 30 What is the greatest common divisor of 319 and 261? 29 Calculate the greatest common divisor of 1040 and 30. 10 What is the highest common factor of 12 and 210? 6 Calculate the greatest common factor of 78 and 273. 39 What is the highest common divisor of 234 and 65? 13 Calculate the highest common divisor of 249 and 7387. 83 Calculate the highest common divisor of 1485 and 55. 55 What is the highest common divisor of 595 and 350? 35 Calculate the highest common factor of 35 and 140. 35 Calculate the greatest common factor of 2613 and 78. 39 Calculate the highest common divisor of 600 and 210. 30 Calculate the highest common divisor of 1248 and 234. 78 Calculate the greatest common factor of 221 and 39. 13 Calculate the highest common factor of 14 and 3661. 7 What is the greatest common factor of 79 and 5? 1 Calculate the greatest common factor of 4320 and 72. 72 What is the highest common divisor of 18 and 1962? 18 What is the highest common factor of 16 and 13712? 16 Calculate the greatest common factor of 4 and 122. 2 Calculate the highest common factor of 1752 and 32. 8 Calculate the greatest common factor of 2941 and 17. 17 Calculate the greatest common divisor of 49 and 28. 7 What is the greatest common factor of 24 and 552? 24 What is the highest common factor of 31 and 279? 31 What is the greatest common divisor of 21 and 35? 7 What is the greatest common divisor of 174 and 6? 6 What is the highest common divisor of 44 and 32? 4 Calculate the greatest common factor of 903 and 105. 21 What is the greatest common divisor of 976 and 61? 61 What is the highest common factor of 110 and 350? 10 What is the greatest common factor of 208 and 32? 16 Calculate the highest common divisor of 684 and 152. 76 What is the highest common divisor of 414 and 2116? 46 Calculate the highest common divisor of 17 and 18173. 17 Calculate the highest common divisor of 243 and 36. 9 Calculate the greatest common factor of 91 and 325. 13 Calculate the highest common factor of 29824 and 128. 128 What is the highest common divisor of 3652 and 22? 22 Calculate the greatest common divisor of 19 and 57. 19 What is the greatest common factor of 696 and 96? 24 Calculate the highest common factor of 9936 and 18. 18 Calculate the greatest common divisor of 18 and 708. 6 What is the greatest common factor of 35 and 77? 7 Calculate the highest common divisor of 406 and 116. 58 What is the greatest common factor of 88 and 2156? 44 Calculate the greatest common factor of 171 and 95. 19 What is the greatest common factor of 3424 and 642? 214 What is the highest common divisor of 954 and 1219? 53 What is the greatest common divisor of 84 and 63? 21 What is the greatest common factor of 620 and 62? 62 What is the highest common divisor of 11 and 7601? 11 Calculate the highest common divisor of 2279 and 424. 53 Calculate the greatest common divisor of 425 and 17. 17 What is the highest common factor of 34 and 986? 34 What is the greatest common factor of 8694 and 6? 6 What is the greatest common factor of 128 and 320? 64 Calculate the highest common factor of 116 and 14. 2 Calculate the highest common divisor of 58 and 34. 2 What is the greatest common divisor of 90 and 1035? 45 Calculate the greatest common divisor of 784 and 16. 16 Calculate the highest common divisor of 18 and 8958. 6 Calculate the greatest common factor of 336 and 21. 21 Calculate the greatest common divisor of 41 and 13817. 41 What is the greatest common factor of 1331 and 33? 11 Calculate the highest common factor of 59 and 2. 1 What is the highest common divisor of 42 and 8862? 42 What is the highest common factor of 6244 and 84? 28 What is the highest common factor of 98 and 406? 14 Calculate the greatest common divisor of 1 and 9. 1 What is the highest common divisor of 8889 and 3? 3 Calculate the highest common divisor of 68 and 36074. 34 What is the greatest common factor of 126 and 1638? 126 Calculate the greatest common factor of 77 and 371. 7 Calculate the highest common divisor of 910 and 130. 130 Calculate the highest common divisor of 52 and 182. 26 Calculate the greatest common divisor of 32 and 928. 32 What is the highest common divisor of 11615 and 46? 23 Calculate the highest common divisor of 3242 and 2. 2 Calculate the greatest common divisor of 26 and 13. 13 What is the greatest common factor of 512 and 352? 32 What is the greatest common factor of 3 and 687? 3 Calculate the greatest common divisor of 2 and 1298. 2 What is the highest common factor of 231 and 495? 33 What is the highest common divisor of 820 and 20? 20 Calculate the greatest common divisor of 7584 and 576. 96 What is the highest common factor of 147 and 245? 49 What is the highest common factor of 42 and 12? 6 What is the highest common divisor of 2759 and 2047? 89 What is the highest common factor of 294 and 52? 2 What is the highest common factor of 1683 and 99? 99 What is the greatest common factor of 40 and 15? 5 Calculate the highest common factor of 848 and 1961. 53 Calculate the greatest common divisor of 20 and 1250. 10 Calculate the greatest common factor of 380 and 608. 76 Calculate the highest common factor of 3267 and 33. 33 What is the greatest common factor of 306 and 561? 51 Calculate the greatest common factor of 400 and 16. 16 Calculate the greatest common divisor of 13 and 4966. 13 Calculate the highest common divisor of 280 and 1170. 10 What is the highest common divisor of 19312 and 272? 272 What is the greatest common divisor of 1029 and 14? 7 What is the greatest common divisor of 12 and 124? 4 Calculate the highest common factor of 10 and 670. 10 Calculate the greatest common factor of 231 and 42. 21 Calculate the highest common divisor of 20 and 3750. 10 Calculate the greatest common factor of 182 and 224. 14 What is the greatest common divisor of 114 and 1653? 57 What is the greatest common divisor of 48 and 72? 24 What is the highest common factor of 62 and 279? 31 Calculate the highest common divisor of 6 and 6378. 6 Calculate the highest common divisor of 15 and 105. 15 What is the greatest common divisor of 10 and 8180? 10 Calculate the greatest common factor of 799 and 34. 17 What is the highest common divisor of 204 and 276? 12 What is the highest common divisor of 13 and 793? 13 Calculate the greatest common divisor of 308 and 224. 28 What is the greatest common divisor of 3708 and 1339? 103 Calculate the greatest common divisor of 44 and 55. 11 Calculate the greatest common divisor of 172 and 2. 2 Calculate the highest common divisor of 20 and 565. 5 What is the highest common factor of 39 and 7397? 13 W	{ "pile_set_name": "DM Mathematics" }
ple of 219? True Is 904 a factor of 449254780? False Is 13851792 a multiple of 2? True Is 201 a factor of 1077361608? True Is 9645 a factor of 2038647022? False Is 169060514 a multiple of 1005? False Does 55 divide 1661793980? True Is 10 a factor of 4893160? True Is 16468720 a multiple of 80? True Does 191 divide 22838856? False Does 5044 divide 707168800? True Does 161 divide 259572169? False Is 1091 a factor of 282569529? False Is 42508039 a multiple of 257? False Is 1568 a factor of 730908318? False Is 34 a factor of 172118826? False Is 5 a factor of 6321076? False Does 253 divide 381325395? True Does 1484 divide 243879076? True Does 5633 divide 556686858? True Is 13 a factor of 491675247? False Does 981 divide 8410268? False Is 25439940 a multiple of 3? True Is 7 a factor of 334115621? True Is 13906536 a multiple of 366? True Does 1060 divide 308412300? True Does 4278 divide 363596365? False Is 19527322 a multiple of 3? False Is 54551926 a multiple of 144? False Does 7500 divide 1021321375? False Is 932 a factor of 40729332? True Is 124 a factor of 41938900? False Does 5139 divide 2361309065? False Is 12046487 a multiple of 3? False Is 243 a factor of 14611833? True Does 51 divide 1317349? False Is 78 a factor of 44961306? True Is 16760472 a multiple of 164? True Is 2189 a factor of 10283922? True Does 1276 divide 182009883? False Does 24 divide 15216221? False Does 69 divide 16312479? False Is 207228318 a multiple of 66? True Is 320 a factor of 454072789? False Is 55105932 a multiple of 84? True Is 71 a factor of 13632355? True Is 527 a factor of 1294919104? True Does 23 divide 1691712? False Is 58372317 a multiple of 2931? False Does 73 divide 57311862? True Is 30 a factor of 178923990? True Is 249214776 a multiple of 12? True Is 409 a factor of 154114523? False Is 44282476 a multiple of 49? True Is 262754822 a multiple of 2882? True Does 3388 divide 1128578701? False Is 286202591 a multiple of 1044? False Is 19 a factor of 136137698? True Does 4083 divide 75945327? False Is 506 a factor of 3893041548? True Is 21 a factor of 14714364? True Is 1497236471 a multiple of 161? False Is 5 a factor of 45728098? False Is 136392554 a multiple of 11? False Is 37 a factor of 16013818? False Does 150 divide 78951172? False Is 651911130 a multiple of 234? True Is 926973183 a multiple of 28? False Is 72 a factor of 299802888? True Is 46200694 a multiple of 142? True Does 2 divide 7955650? True Is 447323203 a multiple of 3347? True Is 722960357 a multiple of 1964? False Is 1100422 a multiple of 2? True Does 11 divide 6254435? True Is 116428 a multiple of 26? True Does 313 divide 17726129? True Does 29 divide 19145655? True Does 31 divide 307371045? True Is 2664740678 a multiple of 2053? False Is 12544770 a multiple of 246? True Is 7488250 a multiple of 385? True Is 4104 a factor of 88932516? False Is 201 a factor of 1183015851? True Is 25942996 a multiple of 801? False Does 17 divide 637888405? False Does 231 divide 84592712? False Does 2359 divide 96728436? True Is 54 a factor of 888418? False Is 4116124 a multiple of 119? False Is 24 a factor of 69142303? False Is 65674347 a multiple of 1474? False Is 743 a factor of 140568170? True Is 35159639 a multiple of 5? False Is 155667828 a multiple of 386? False Is 8887594 a multiple of 8? False Does 19 divide 107628978? False Is 108672663 a multiple of 75? False Is 67 a factor of 24628865? True Does 16 divide 43142192? True Is 91 a factor of 140667163? True Is 57953525 a multiple of 175? True Is 1442075922 a multiple of 14? True Does 100 divide 31874700? True Is 359 a factor of 313603373? True Is 842548485 a multiple of 5? True Is 229053864 a multiple of 237? True Does 409 divide 94136083? False Is 134608427 a multiple of 263? False Does 15 divide 2690520849? False Is 15090025 a multiple of 58? False Does 69 divide 1509352161? True Is 976 a factor of 31744400? True Does 1531 divide 59001678? True Is 99854390 even? True Is 718 a factor of 12338915? False Does 26 divide 45413542? False Is 50577230 a multiple of 506? True Does 20 divide 580461652? False Is 2577 a factor of 1532338317? True Is 108129228 a multiple of 19? True Is 107 a factor of 869224124? False Does 20 divide 24546840? True Is 109 a factor of 34759205? False Is 110395703 a multiple of 211? False Is 55393376 a multiple of 1451? True Is 12 a factor of 508339487? False Is 306 a factor of 2668089221? False Is 55800958 even? True Does 161 divide 335990921? False Is 26 a factor of 426943? False Is 493276074 a multiple of 5806? False Is 1415 a factor of 25537016? False Is 50 a factor of 15162100? True Does 9 divide 280869381? True Is 403910156 a multiple of 52? True Is 369856185 a multiple of 95? True Is 36 a factor of 2120832? True Is 66 a factor of 57817819? False Is 297 a factor of 2406687968? False Is 757390619 a multiple of 107? True Does 108 divide 3218940? True Does 17 divide 33780751? True Is 1619 a factor of 992024441? True Is 2780 a factor of 384557400? True Is 25946987 a multiple of 275? False Is 7796 a factor of 8357312000? True Is 110577132 a multiple of 18? True Is 580071960 a multiple of 4? True Is 692 a factor of 46758? False Is 1158301043 a multiple of 154? False Is 19 a factor of 3295904522? False Is 122 a factor of 3447842? True Is 31 a factor of 526607301? False Is 6206067 a multiple of 161? True Does 282 divide 225110448? True Is 136 a factor of 18984920? True Is 558 a factor of 61141734? True Does 12 divide 2335910160? True Does 4 divide 197225028? True Is 70 a factor of 60123420? True Is 9 a factor of 89533170? True Is 14 a factor of 2352244412? True Is 258441882 a multiple of 204? False Is 12845360 a multiple of 80? True Does 999 divide 361973664? True Is 4850062 a multiple of 271? False Is 892997010 a multiple of 863? False Does 6 divide 230062260? True Is 11574021 a multiple of 65? False Is 121 a factor of 2162973367? False Does 244 divide 88644822? False Is 93 a factor of 2562313855? False Is 315 a factor of 254767058? False Is 70 a factor of 1570357? False Does 70 divide 548634125? False Is 476725534 a multiple of 886? False Is 70 a factor of 233310? True Is 39034498 a multiple of 1086? False Is 1750082490 a multiple of 30? True Is 33999570 a multiple of 366? True Is 146243616 a multiple of 1256? True Is 658 a factor of 1772063702? False Is 355496860 a multiple of 68? True Is 32916383 a multiple of 162? False Is 9 a factor of 175742001? True Does 49 divide 787214596? True Is 2026590462 a multiple of 78? True Is 35 a factor of 50713339? False Does 2 divide 107764217? False Does 64 divide 41571325? False Is 308544702 a multiple of 111? True Is 2047350041 a multiple of 15? False Is 264867750 a multiple of 515? False Is 306800138 a multiple of 36? False Does 1249 divide 285128516? False Is 396 a factor of 4084269642? False Is 111269055 a multiple of 404? False Does 707 divide 58005698? False Is 4 a factor of 1209754? False Is 322467445 a multiple of 71? True Does 13 divide 726242530? True Is 6 a factor of 2086798? False Is 46 a factor of 1392956682? True Is 29 a factor of 529932012? False Does 178 divide 862667566? True Is 63 a factor of 23106380? False Does 11 divide 208152285? True Is 259 a factor of 36772302? True Is 2546 a factor of 14686868? False Does 62 divide 11702134? False Does 687 divide 136564608? True Is 134 a factor of 52142345? False Is 150 a factor of 2759366799? False Does 28 divide 131739057? False Is 3855384 a multiple of 52? True Is 27 a factor of 168032297? False Is 18886474 a multiple of 86? False Is 30956593 a multiple of 4? False Is 238 a factor of 2328983121? False Is 105318035 a multiple of 23? True Does 64 divide 348127887? False Is 1222 a factor of 7158320806? True Is 28934382 a multiple of 77? False Does 2 divide 9965716? True Is 940 a factor of 397777920? True Does 17 divide 98719676? False Is 219 a factor of 1833694493? False Does 801 divide 3982572? True Is 26733442 a multiple of 40? False Is 27390670 a multiple of 1186? True Is 79 a factor of 790448076? False Is 7556835 a multiple of 55? True Does 141 divide 6269988? True Is 3180553966 a multiple of 46? False Is 1198 a factor of 184512366? True Is 5 a factor of 36674910? True Does 5 divide 32990092? False Does 982 divide 20836076? True Is 4	{ "pile_set_name": "DM Mathematics" }
380q2 - 108864q + 186624 = 0 for q. 8, 9 Factor h*3/2 + 11h*2/2 - 21h. h(h - 3)(h + 14)/2 Find r, given that 2r2/9 + 364r/9 + 362/9 = 0. -181, -1 Factor -r*3/3 + 68r*2/3 - 1156r/3. -r(r - 34)2/3 Factor -j2/4 + 2385j/2 - 5688225/4. -(j - 2385)*2/4 Find f such that 3f*3/2 - 3f*2/2 - 15f/2 - 9/2 = 0. -1, 3 Let 2c4/3 + 2c*3 - 16c*2 - 56c/3 + 32 = 0. Calculate c. -6, -2, 1, 4 Factor -24y4/7 - 1434y*3/7 - 28440y*2/7 - 26400y + 48000/7. -6(y + 20)3(4y - 1)/7 Factor -4y*3 - 4y*2 + 16y + 16. -4(y - 2)(y + 1)(y + 2) Factor 3n*5 - 2n*4 - 4n*3 + 2n*2 + n. n(n - 1)*2(n + 1)(3n + 1) Factor 2t2/7 + 214t/7 + 2444/7. 2(t + 13)(t + 94)/7 Solve -s*2/10 - 75s/2 + 1532/5 = 0 for s. -383, 8 Determine r, given that -r*4/3 + 6r*2 - 27 = 0. -3, 3 Let 3w*3/7 - 81w*2/7 + 330w/7 + 144 = 0. Calculate w. -2, 8, 21 Determine l, given that -2l3/5 - 96l*2/5 + 198l/5 - 20 = 0. -50, 1 Suppose 140o5 - 402o*4 + 1956o*3/7 - 520o*2/7 + 48o/7 = 0. What is o? 0, 2/7, 3/10, 2 Let -h*4/7 + 3h*3 - 19h*2/7 - 3h + 20/7 = 0. What is h? -1, 1, 20 Let -12s5 + 261s*4 - 114s*3 - 1557s*2 - 378s = 0. What is s? -2, -1/4, 0, 3, 21 Solve -2x4/3 + 328x*3 - 120044x*2/3 - 81016x - 122018/3 = 0. -1, 247 What is k in 2k5 + 18k*4 + 46k*3 + 22k*2 - 48k - 40 = 0? -5, -2, -1, 1 Factor -3t2 - 183t - 522. -3(t + 3)(t + 58) Suppose 2s2/17 - 6s/17 + 4/17 = 0. What is s? 1, 2 Factor 4z4 + 76z*3 + 256z*2 - 336z. 4z(z - 1)(z + 6)(z + 14) Solve 50h3/9 + 1240h*2/9 + 968h/9 + 64/3 = 0. -24, -2/5 Factor -x*4/3 - 2x*3 - 3x2. -x2(x + 3)2/3 Find r, given that -5r*5 + 5r*4 + 45r*3 - 65r*2 - 40r + 60 = 0. -3, -1, 1, 2 Factor -2l5/11 - 10l*4/11 - 6l*3/11 + 18l*2/11. -2l*2(l - 1)(l + 3)2/11 Factor -2a*4/15 + 2a*3/15 + 2a*2/3 + 2a/5. -2a(a - 3)(a + 1)2/15 Factor y5 - 19y*4/7 + 15y3/7 - y2/7 - 2y/7. y(y - 1)*3(7y + 2)/7 Factor -x3/4 + 255x*2/4 - 16383x/4 + 16129/4. -(x - 127)*2(x - 1)/4 Find x, given that x*2/7 - 16x/7 + 64/7 = 0. 8 Determine t, given that t2 - 9 = 0. -3, 3 Factor -x5/3 + 2x4 + 5x*3 + 8x2/3. -x2(x - 8)(x + 1)2/3 Factor r4/3 + 22r3 + 428r*2/3 + 298r + 177. (r + 1)(r + 3)2(r + 59)/3 Let -2l2 - 601l/7 + 43/7 = 0. Calculate l. -43, 1/14 Determine n, given that -3n5/2 + 183n*4/2 + 645n*3/2 - 4515n*2/2 + 3189n - 1344 = 0. -7, 1, 2, 64 Determine j so that -5j2 + 5380j - 1447220 = 0. 538 Determine o, given that -o*5 - 4o*4 + 6o*3 + 36o*2 + 27o = 0. -3, -1, 0, 3 Factor -5n3 - 20565n*2 - 21156240n - 21135680. -5(n + 1)(n + 2056)*2 Suppose -48s*4 - 168s*3 + 117s*2 + 87s + 12 = 0. Calculate s. -4, -1/4, 1 Suppose f*2 + 22f + 121 = 0. Calculate f. -11 What is h in -2h4/5 - 4h*3/5 + 2h*2 + 12h/5 = 0? -3, -1, 0, 2 Suppose 2j2/7 + 20j/7 + 48/7 = 0. Calculate j. -6, -4 Factor -1770125m5/6 + 1091825m*4/3 - 460780m*3/3 + 71224m*2/3 - 2024m/3 + 16/3. -(5m - 2)3(119m - 2)2/6 Factor 2l*4/3 - 6l*3 + 16l*2/3. 2l*2(l - 8)(l - 1)/3 Solve -10x*2/11 - 1272x/11 - 254/11 = 0 for x. -127, -1/5 Factor -2y2/7 - 208y/7. -2y(y + 104)/7 Factor 2a4 + 28a*3 + 78a*2 - 108a. 2a(a - 1)(a + 6)(a + 9) Suppose 4j3/7 + 9600j*2/7 + 5760000j/7 = 0. What is j? -1200, 0 Determine j, given that -5j5 - 5j*4 + 280j3 = 0. -8, 0, 7 Find g, given that g3/2 + 7g2/2 - 22g = 0. -11, 0, 4 Solve -125d5 - 375d*4 - 155d*3 + 315d*2 + 280d + 60 = 0. -2, -1, -3/5, -2/5, 1 Let 20s5 - 48s*4 - 4s*3 + 48s*2 - 16s = 0. Calculate s. -1, 0, 2/5, 1, 2 Solve -i*4/4 - 9i*3/2 - 31i*2/4 + 9i/2 + 8 = 0 for i. -16, -2, -1, 1 What is u in u*4/4 + 25u*3/2 - 3u*2/4 - 37u + 25 = 0? -50, -2, 1 Suppose 4z5/7 + 36z*4/7 + 116z*3/7 + 172z*2/7 + 120z/7 + 32/7 = 0. What is z? -4, -2, -1 Suppose -2w2/9 + 130w/9 + 44/3 = 0. What is w? -1, 66 Suppose n*5/3 + 4n*4/3 + 2n*3/3 - 4n*2/3 - n = 0. What is n? -3, -1, 0, 1 Find b such that 8b*4/11 - 714b*3/11 - 558b*2/11 + 1624b/11 - 360/11 = 0. -2, 1/4, 1, 90 Suppose t*3 - 4t*2 + 4t = 0. What is t? 0, 2 Factor q*2 + 4q - 357. (q - 17)(q + 21) Factor 13f*4/4 + 29f*3/2 + 6f2. f2(f + 4)(13f + 6)/4 Solve 2h*5/13 - 16h*4/13 + 44h*3/13 - 56h*2/13 + 34h/13 - 8/13 = 0. 1, 4 Find x, given that 5x2 + 105x - 360 = 0. -24, 3 Factor -15t3/7 - 3t*2/7 + 99t/7 - 81/7. -3(t - 1)(t + 3)(5t - 9)/7 Factor -6r2/11 - 4486r/11 + 136. -2(r + 748)(3r - 1)/11 Suppose -v3 + 176v*2 + 4v - 704 = 0. What is v? -2, 2, 176 Factor 2z2/3 + 16z - 50/3. 2(z - 1)(z + 25)/3 Find i such that -2i5 + 143i*4/2 - 698i*3 + 1045i*2 - 272i - 289/2 = 0. -1/4, 1, 17 Factor 2y2/3 + 700y/3 - 3550/3. 2(y - 5)(y + 355)/3 Determine i so that 33i5/5 - 27i*4 + 177i*3/5 - 81i*2/5 + 6i/5 = 0. 0, 1/11, 1, 2 Let -2c4/11 - 32c*3/11 - 48c*2/11 + 640c/11 - 800/11 = 0. What is c? -10, 2 Factor -j4/4 + j3/4 + j2/2. -j2(j - 2)(j + 1)/4 Determine h so that 11h3 - 46h*2 - 124h + 24 = 0. -2, 2/11, 6 Find g such that 18g4 - 282g*3 + 182g*2 - 30g = 0. 0, 1/3, 15 Suppose 98v5/5 - 56v*4/5 + 8v*3/5 = 0. Calculate v. 0, 2/7 Solve -7j*3/4 - 3j*2/4 + 7j/4 + 3/4 = 0 for j. -1, -3/7, 1 Factor v*3/7 - 22v*2 - 311v/7 - 156/7. (v - 156)(v + 1)2/7 Factor 6a*3/11 + 186a*2/11. 6a*2(a + 31)/11 Factor u*4/5 - 28u*3/5 + 36u*2/5 + 2592u/5. u(u - 18)2(u + 8)/5 Factor -5s2/4 - 3135s/2 - 1965645/4. -5(s + 627)2/4 Factor -4t*2/5 + 948t/5 + 1912/5. -4(t - 239)(t + 2)/5 Solve j*5/2 - 10j*4 - 47j*3/2 + 33j*2 = 0. -3, 0, 1, 22 Determine j, given that -4j*3 - 4j*2 + 4j + 4 = 0. -1, 1 Determine u, given that 2u4/3 - 4u*3 + 22u*2/3 - 4u = 0. 0, 1, 2, 3 Find d such that -2d3/13 - 18d*2/13 + 9072d/13 - 209952/13 = 0. -81, 36 Factor j*2 - 120j + 119. (j - 119)(j - 1) Find u, given that -2u*4 + 26u*3 - 122u*2 + 246u - 180 = 0. 2, 3, 5 Solve 225f4 - 30f*3 - 224f*2 + 30f - 1 = 0. -1, 1/15, 1 Factor 25a4 + 390a*3 + 2025a*2 + 3780a + 1620. 5(a + 3)(a + 6)*2(5a + 3) Factor 2a*3 + 6a*2 - 8a - 24. 2(a - 2)(a + 2)(a + 3) Factor x3 - 57x*2 - 180x. x(x - 60)(x + 3) Let 15w4/4 + 57w*3/2 + 147w*2/4 + 3w - 9 = 0. Calculate w. -6, -1, 2/5 Factor -5f5 + 515f*4 + 2110f*3 + 3190f*2 + 2135f + 535. -5(f - 107)(f + 1)*4 Factor 2v*5/13 + 434v*4/13 + 31958v*3/13 + 838510v*2/13 + 2984272v/13 + 2863288/13. 2(v + 2)2(v + 71)*3/13 Determine p so that 2p*5/5 + 184p*4/5 + 628p*3 - 54264p*2/5 - 57222p/5 = 0. -51, -1, 0, 11 Solve 4s5 + 24s*4 - 148s*3 + 136s*2 + 144s - 160 = 0 for s. -10, -1, 1, 2 Find u such that -5u4 + 75u*3 - 180u*2 - 1280u + 3840 = 0. -4, 3, 8 Suppose -3b2/7 + 6360b/7 - 3370800/7 = 0. Calculate b. 1060 Factor -3l4/7 - 789l*3/7 + 2385l*2/7 - 2391l/7 + 114. -3(l - 1)3(l + 266)/7 Factor 4j4 + 124j*3 + 120j*2. 4j*2(j + 1)(j + 30) Find r, given that r5 + 95r*4 + 278r*3 + 184r*2 = 0. -92, -2, -1, 0 Let 2m*2/19 - 6m/19 = 0. What is m? 0, 3 Solve 24t2 - 21t - 3 = 0 for t. -1/8, 1 Factor -10n4/3 - 484n*3/3 - 1816n*2/3 - 592n. -2n(n + 2)*2(5n + 222)/3 Let -t4/3 - 4t*3 + 77t*2 + 242t/3 = 0. What is t? -22, -1, 0, 11 Determine k, given that k*5/4 + 119k*4/4 + 105k*3/4 - 1559k*2/4 - 1481k/2 - 354 = 0. -118, -3, -1, 4 Suppose s*4 + 105s*3 + 308s*2 + 204s = 0. Calculate s. -102, -2, -1, 0 Let -3x4/5 + 27x*3/5 - 6x*2/5 - 252x/5 - 216/5 = 0. Calculate x. -2, -1, 6 Solve -4s4 - 4s*3 + 12s*2 + 4s - 8 = 0. -2, -1, 1 Find j such that 2j4 - 52j*3 - 8j*2 + 208j = 0. -2, 0, 2, 26 Suppose -2h4/11 + 32h*3/11 - 28h*2/11 - 32h/11 + 30/11 = 0. Calculate h. -1, 1, 15 Solve -v*5/5 + 7v*4/5 - 8v*2 + 16v/5 + 48/5 = 0 for v. -2, -1, 2, 6 Factor 4h2 - 936h - 5760. 4(h - 240)(h + 6) Factor -2v2/11 + 408v/11 - 808/11. -2(v - 202)(v - 2)/11 Factor b*2/2 - 69b/2 + 189. (b - 63)(b - 6)/2 Factor t3 + 45t*2 - 46t. t(t - 1)(t + 46) What	{ "pile_set_name": "DM Mathematics" }
j - z = k for j. -1 Suppose 2p - w + 15 = 2w, -3 = -w. Let j be ((-15)/p + -4)4. Solve -jt + 14 + 2 = 0 for t. 4 Suppose 1 = -2i - 2s + 27, -2s - 14 = -3i. Solve -12 = -u - i for u. 4 Let d = 18 - 46. Let c = d + 16. Let j be (-111)/c + (-1)/4. Solve 0 = -2b + 1 - j for b. -4 Let j = 338 - 328. Solve -3s - 5 = j for s. -5 Let k(n) = n3 - 9n*2 - 2n + 33. Let s be k(9). Solve -10g + 13g + s = 0 for g. -5 Let b = -470 + 488. Solve 0 = -bk + 14k for k. 0 Suppose 6g = 14 + 76. Let x be 34/36g. Solve -xa = -0a - 5 for a. 1 Let v = 7 - 6. Let h be (-4v + 2)(-2)/4. Solve d - 2 = -h for d. 1 Let h = 137 - 100. Suppose 0 = 33v - hv. Solve -5s + 20 = -vs for s. 4 Suppose -29 + 122 = u - 3o, 0 = -5o - 5. Solve -2v - 82 = -u for v. 4 Let x(h) = 14h - 4h2 + 4 - h2 + 5h2 - h2. Let n be x(13). Solve 0 = 5q - n - 8 for q. 5 Let r be (0/6)/((-1 + 4)/1). Let w(b) = b*3 - 2b*2 + 2b - 2. Let o be w(2). Solve 0u - u + o = r for u. 2 Let a(w) = -w3 + 11w*2 - 11w + 16. Let v be a(10). Let y be ((-9)/v)/((-2)/20). Solve -3d - 2d = -y for d. 3 Let g = 7 + -5. Let i = 22 + -18. Suppose 4c - 5n - 87 = 0, 2c - 5n - 31 = 20. Solve -ik + g = -c for k. 5 Let k = 52 + -46. Suppose 5x - k = 3x. Solve -5m - 8 = -x for m. -1 Let h(y) be the second derivative of -y*5/20 - 5y*4/4 - 13y*3/3 + 21y. Let b be h(-13). Solve 2g + 2g + 8 = b for g. -2 Let t = -344 + 345. Let v = -3 - -4. Solve -g = -t - v for g. 2 Let b(n) = -n*3 - 12n*2 + 2n - 1. Let s be b(-12). Let d = s - -27. Solve -g = dg for g. 0 Suppose -2 = -4c - 21v + 24v, 5v = c + 8. Solve 7 = k + c for k. 5 Let b = -10 - -7. Let u be 12/(-4)5/b. Suppose uh = -5v + 30, -4 = 2h - 14. Solve -4s = -v + 21 for s. -5 Let b = -1271 + 1279. Solve -20 = -4n - b for n. 3 Suppose 128 = 2y + 2y + w, -5y + 160 = -3w. Suppose -3f - o - 5 = -6o, 4f + 3o - y = 0. Solve fq + 0q = 20 for q. 4 Let o = -8 + 14. Let p(i) = i3 - 55i*2 - 6i + 335. Let n be p(55). Solve -4 = -nl + o for l. 2 Suppose 0 = 2b - 185 + 143. Solve 0 = 16n - bn for n. 0 Suppose -16h = -17h - 18. Let o = 21 + h. Solve -oi + 0i + 9 = 0 for i. 3 Suppose 0 = -33v + 31v + 4. Suppose -2n = vh - 14, 2n = 5n - h - 5. Solve ny + 6 = -9 for y. -5 Let s(i) = -3i*3 - 6i*2 - 2i + 4. Let g be s(-3). Solve 36p - 3 = gp for p. -3 Let p be (-12 + 19)(1 - -1 - -1). Solve 5z - pz = 32 for z. -2 Let i = 6 - 6. Suppose 0 = -il + 2l + 8. Let b be (-18)/l(-2)/(-3). Solve j = bj + 2 for j. -1 Let o(h) be the first derivative of h2/2 + 16h + 4. Let b be o(-14). Solve -br = -0r - 6 for r. 3 Let b be ((-456)/(-28))/(-6)-7. Solve -22v + 6 = -bv for v. 2 Suppose -17 = -5v + 2v - 2q, -20 = -4v - 2q. Solve -vo - 4 = -5o for o. 2 Let c = -109 + 113. Solve cu - 13 - 3 = 0 for u. 4 Suppose -66c = -70c + 24. Let y be (12)/((-24)/(-60)). Solve z - y = cz for z. -1 Let b(a) = a2 - 3a + 10 - 10a + 12a - 5a. Let x be b(4). Solve -t = -xt for t. 0 Let o be ((-2)/(-3) - 0)117/26. Suppose os + 26 = 2d + 1, -s = 4d - 29. Let l(h) = 2h3 - 2h*2 - 3h + 2. Let r be l(2). Solve -rp = d + 12 for p. -5 Suppose -3d - 2n = -35, -18d - 2n = -13d - 53. Solve -3m - 24 = -dm for m. 4 Suppose 0 = -a - 0 + 20. Suppose 0 = 5k + 5r - 40, -2r + 3r = -4k + a. Suppose 5p - 24 = 4c, 2p = -kc + 8c + 12. Solve -py + y + 15 = 0 for y. 5 Let f be (2 + -2 + 2)/(61/305). Solve 0 = w + 6 - f for w. 4 Suppose -3q - 2s + 38 = -7s, -3s + 18 = 5q. Solve 0 = 3p + 9 + q for p. -5 Let v(u) = 2u - 24. Let t be v(10). Let m(a) = a*2 + 10a + 2. Let q be m(t). Let b = 25 + q. Solve bn = -3 - 9 for n. -4 Suppose 5t - 19 = 6. Suppose -5k + 42 - 2 = 0. Suppose g - 4s = 2g + 17, 4s = -20. Solve -gx + k = -tx for x. -4 Let r(n) = -14n + 86. Let k be r(6). Solve y + k = 3y for y. 1 Let r be 1 + (1 - 6) + -2413/(-52). Suppose 0 = -a - 2k, 2k - k = 5a. Solve ay = -ry for y. 0 Let u = 29 + -24. Solve -u = -3t + 4 for t. 3 Let d(r) = r3 - r + 49. Let c be d(0). Suppose 5y = -4n + c, -n + 4n - 53 = -5y. Let q = 13 - y. Solve qm = 2m + 4 for m. -2 Suppose -4b = 3b + 4b. Solve b = j - 10j - 36 for j. -4 Suppose 0w + 15w = 0. Solve 7l + 21 = -w for l. -3 Let m be 3/4 + (246/24 - 6). Solve 3s - m - 1 = 0 for s. 2 Suppose 4w - 4d - 20 = 0, w = 2d - 3d + 11. Solve -wg + 10 - 2 = 0 for g. 1 Let q(h) = h*2 - 4h - 3. Let m be q(-1). Let f be -11 - (m + 0 + -3). Solve 5l - l = f for l. 0 Let q(a) = 4a. Let m be q(5). Let s = 28 - 29. Let z be (1 - (3 - s)) + (-88)/(-11). Solve -m = l - zl for l. 5 Let o(v) = v*3 + 7v*2 + v + 10. Let h be o(-7). Suppose 2x + 0x + hw = -2, 4w = 5x - 18. Solve -1 - 3 = -xf for f. 2 Let h = -76 - -83. Solve 2b - 9 = -h for b. 1 Let z = 553 - 537. Solve -8 = -4g - z for g. -2 Let z = -5 - -4. Let c be (7 - z) + (1 - 3). Let t(u) = -u2 - 13u + 30. Let s be t(-15). Solve c = -sp + 2p for p. 3 Let o be (-7 - -19) + 8/(-1). Solve -o - 11 = -3l for l. 5 Let t be 14((-102)/(-14) + -7). Solve -t = 2b - 2 for b. -1 Let a(m) = 17m - 63. Let c(t) = 6t - 21. Let o(r) = 4a(r) - 11c(r). Let n be o(12). Solve -z = nz - 12 for z. 3 Suppose -2z - 32 = y, -17z - 5y + 74 = -20z. Let n = 31 + -10. Let j = n + z. Solve -jx = -x + 6 for x. -3 Let w(j) = j3 - 6j*2 - 11j - 28. Let x be w(8). Solve 12 = -15a + xa for a. -4 Let m(w) = -w*3 + 14w*2 - 14w + 15. Let s be m(13). Let u be s/(-6) + 44/(-3). Let k be (-3)/5 - 39/u. Solve 0x + kx = -8 for x. -4 Let v be 1653/116 + 0 + (-5)/4. Solve v = -b + 12 for b. -1 Let y(x) = -2x + 12. Let l be y(12). Let m = l - -17. Suppose -v - 5t - 17 = 0, -mv + t = 5t + 1. Solve p + vp = 16 for p. 4 Suppose 2b + 11 = b + 3v, 0 = -3v + 3. Let x(y) = -y*2 - 7y + 9. Let i be x(b). Solve -5q + i = -14 for q. 3 Suppose 147 = 10r + 87. Solve 6 - 18 = rg for g. -2 Let v(x) = -4x - 2. Let u(k) = -k. Let d(j) = -21u(j) + 3v(j). Let o be d(1). Solve os + 2 = 5s for s. 1 Let k be 6/27 + (-64)/(-36). Suppose 2q = 2d + 18 + 60, -4d = kq + 126. Let y = d - -50. Solve y = 2i + 6 for i. 5 Let x = -66 - -45. Let f be (-154)/6 + (-14)/x. Let i be 10/f - 44/(-10). Solve ip = 3 + 13 for p. 4 Suppose 27h + 7h - 68 = 0. Solve -hb - 15 = -7b for b. 3 Let g(m) = -m*3 - 4m*2 + 5m + 3. Let b be g(-5). Solve bd + 4 = -d for d. -1 Let o(l) = l3 + 8l*2 + 5l - 2. Suppose -5 = -3p - 26. Let f be o(p). Suppose f = 5j + 2. Solve -22 = -5q - j for q. 4 Let q = -879 - -910. Solve -26n = -q - 73 for n. 4 Let o = 15 + -28. Let v = -12 - o. Let u be (5 + v)(-6)/(-4). Solve 0 = -2l - l - u for l. -3 Let s = -39 + 27. Let z = s - -12. Suppose z = q - 2 - 4. Solve -h = -3h - q for h. -3 Suppose g + 51 = -4k, 0g + g = 4k - 11. Let m = g - -31. Solve m = 2v + 1 + 9 for v. -5 Let y = -32 - -38. Let k be 0/(-2)(1 + (-3)/y). Solve k = -c + 5 for c. 5 Suppose -5d + 3d + 12 = -3w, -4 = -5d + w. Solve -6h + 2h = d for h. 0 Let g be (9/(-1))/((-21)/(-14)). Let x be -1 + (-1)/(-2)g. Let w be (3/x)/((-3)/12). Solve -w + 4 = v for v. 1 Let l be 2 - (12/(-9)3)/2. Let a be -1 - (-3 - -1) - -27. Let f(x) = -x*3 - 5x*2 - 7x - 4. Let i be f(-4). Solve lp - i = -a for p. -5 Let w = 70 - 67. Solve -4z - w + 11 = 0 for z. 2 Suppose -118o = -117o - 14. Solve 5t = 1 + o for t. 3 Let m(c) = c + 14. Let r be m(-10). Let d be (-9)/r32/(-12) + -2. Solve -5s + ds = 0 for s. 0 Let r(g) = -27g + 63. Let v be r(2). Solve -x + 5 = v for x. -4 Let x(p) = 122 - 4p*2 + 5p*2 - 119 - 4p. Let t be x(3). Solve 2m - 3 + 7 = t for m. -2 Let u be 2-27/7. Let c be (4/u)/((-2)/(-4)). Let j be ((-8)/16)/(c/20). Solve 9 + 16 = jg for g. 5 Let x(u) = -5u3 + 3u2 + u + 2. Let w(b) = b3 - b. Let y(t) = 6w(t) + x(t). Let s be y(2). Solve 0f = -4f + s for f. 3 Let a = 78 + -73. Let l(z) = -3z - 19. Let g be l(-9). Suppose 6 = 3y - 0q - 3q, y = -4q + 7. Solve -ai - y = -g for i. 1 Suppose 32c - 4c = 56. Solve cw = -0w - 6 for w. -3 Suppose -4y = 4f + 28, 3f + 7y + 23 = 2y. Let j be f/45 + 96/45. Solve -jr = r for r. 0 Suppose 3s = 3, 8z = 3z - 5s + 25. Let o(b) = -b - 13. Let i(x) = 2x + 27. Let j be i(-21). Let w be o(j). Solve -z*	{ "pile_set_name": "DM Mathematics" }
s the o'th term of 52, 138, 316, 586, 948, 1402, 1948? 46o2 - 52o + 58 What is the v'th term of 1339, 1507, 1675, 1843, 2011? 168v + 1171 What is the h'th term of 9036, 17781, 26526, 35271? 8745h + 291 What is the q'th term of 866, 1726, 2586, 3446, 4306, 5166? 860q + 6 What is the q'th term of 966, 2000, 3108, 4290, 5546? 37q*2 + 923q + 6 What is the m'th term of 755277, 755273, 755261, 755235, 755189, 755117? -m*3 + 2m*2 - 3m + 755279 What is the w'th term of 1479, 5877, 13215, 23499, 36735, 52929, 72087, 94215? w*3 + 1464w*2 - w + 15 What is the t'th term of 963, 896, 829, 762, 695? -67t + 1030 What is the u'th term of 52, 478, 1636, 3892, 7612? 61u3 - u - 8 What is the a'th term of 141, 280, 425, 570, 709? -a3 + 9a*2 + 119a + 14 What is the p'th term of -60, -72, -86, -102, -120, -140, -162? -p*2 - 9p - 50 What is the u'th term of -132, -319, -590, -987, -1552, -2327, -3354? -7u3 - 138u + 13 What is the p'th term of -34750, -69498, -104246? -34748p - 2 What is the j'th term of -850, -3354, -7522, -13354, -20850, -30010, -40834? -832j*2 - 8j - 10 What is the g'th term of -105, -414, -937, -1686, -2673, -3910? -2g3 - 95g*2 - 10g + 2 What is the p'th term of -4257, -4220, -4171, -4104, -4013, -3892? p*3 + 30p - 4288 What is the o'th term of -58329, -58354, -58379, -58404? -25o - 58304 What is the p'th term of 483292, 966590, 1449900, 1933228, 2416580, 2899962, 3383380, 3866840? p3 + 483291p What is the x'th term of -27236, -27237, -27238, -27239, -27240? -x - 27235 What is the a'th term of 63186, 252767, 568736, 1011093, 1579838, 2274971? 63194a2 - a - 7 What is the f'th term of 51, 130, 263, 480, 811, 1286, 1935, 2788? 5f*3 - 3f*2 + 53f - 4 What is the a'th term of 39554, 79087, 118596, 158081, 197542? -12a2 + 39569a - 3 What is the f'th term of 11, 69, 169, 311, 495, 721, 989? 21f2 - 5f - 5 What is the n'th term of -9901, -9881, -9857, -9829, -9797? 2n2 + 14n - 9917 What is the k'th term of -4354, -4343, -4312, -4249, -4142, -3979, -3748, -3437? 2k3 - 2k*2 + 3k - 4357 What is the k'th term of -80279, -80279, -80277, -80273, -80267, -80259? k*2 - 3k - 80277 What is the w'th term of 1160, 4647, 10402, 18377, 28524, 40795, 55142? -8w3 + 1182w*2 - 3w - 11 What is the w'th term of 229213, 229211, 229207, 229201, 229193? -w*2 + w + 229213 What is the t'th term of -375, -353, -315, -261? 8t*2 - 2t - 381 What is the n'th term of -192, -214, -226, -222, -196? n3 - n2 - 26n - 166 What is the k'th term of 6150629, 6150630, 6150631, 6150632? k + 6150628 What is the g'th term of 1459, 2987, 4515? 1528g - 69 What is the d'th term of 10930, 21886, 32842, 43798, 54754? 10956d - 26 What is the j'th term of -153, -726, -1689, -3048, -4809? -j3 - 189j*2 + j + 36 What is the l'th term of -2178, -4392, -6584, -8742, -10854? 2l3 - l2 - 2225l + 46 What is the y'th term of 70649, 70652, 70655, 70658, 70661? 3y + 70646 What is the z'th term of 5700, 45608, 153914, 364812, 712496? 5699z3 + 5z2 - 4 What is the n'th term of 260588, 260597, 260618, 260657, 260720, 260813? n3 + 2n + 260585 What is the h'th term of 21634, 43270, 64906, 86542, 108178? 21636h - 2 What is the p'th term of -7675, -7433, -7029, -6463, -5735? 81p2 - p - 7755 What is the z'th term of 994787, 994789, 994793, 994799? z2 - z + 994787 What is the j'th term of 1208969, 1208970, 1208971, 1208972, 1208973? j + 1208968 What is the g'th term of 30379, 60755, 91131, 121507, 151883? 30376g + 3 What is the q'th term of 1444, 4755, 13744, 31249, 60108, 103159, 163240, 243189? 473q3 + q2 - 3q + 973 What is the n'th term of 1279, 1159, 955, 661, 271, -221? -n*3 - 36n*2 - 5n + 1321 What is the y'th term of 1643, 3290, 4937, 6584? 1647y - 4 What is the z'th term of -2137, -4248, -6359, -8470? -2111z - 26 What is the w'th term of -46, 23, 162, 407, 794? 6w3 - w2 + 30w - 81 What is the r'th term of 50481, 100965, 151449, 201933? 50484r - 3 What is the w'th term of -15, -54, -101, -156? -4w*2 - 27w + 16 What is the n'th term of 441396, 441397, 441398, 441399, 441400? n + 441395 What is the t'th term of 689321, 1378643, 2067965, 2757287? 689322t - 1 What is the k'th term of -738, -1303, -1868, -2433? -565k - 173 What is the l'th term of -373, -581, -901, -1333, -1877, -2533, -3301? -56l2 - 40l - 277 What is the v'th term of 562, 538, 492, 412, 286, 102, -152, -488? -2v3 + v2 - 13v + 576 What is the q'th term of 41741, 41739, 41737? -2q + 41743 What is the q'th term of 2211088, 2211089, 2211090, 2211091, 2211092, 2211093? q + 2211087 What is the b'th term of 382, 357, 332, 307, 282? -25b + 407 What is the z'th term of -31, -263, -659, -1231, -1991, -2951? -2z3 - 70z*2 - 8z + 49 What is the m'th term of -403, -437, -507, -625, -803, -1053, -1387, -1817? -2m3 - 6m*2 - 2m - 393 What is the w'th term of -1350247, -1350248, -1350249, -1350250, -1350251, -1350252? -w - 1350246 What is the z'th term of -2504654, -5009310, -7513966, -10018622? -2504656z + 2 What is the f'th term of -726542, -726544, -726546, -726548, -726550? -2f - 726540 What is the w'th term of -78, -111, -54, 141, 522, 1137? 8w3 - 3w*2 - 80w - 3 What is the s'th term of 6008, 6011, 6014? 3s + 6005 What is the f'th term of -2038, -1258, -480, 296, 1070, 1842? -f2 + 783f - 2820 What is the y'th term of -535, -475, -381, -259, -115, 45, 215, 389? -y*3 + 23y*2 - 2y - 555 What is the n'th term of -2304, -3426, -4544, -5658, -6768? 2n2 - 1128n - 1178 What is the r'th term of 170, 405, 646, 893? 3r2 + 226r - 59 What is the c'th term of 242, 1805, 5942, 13907, 26954, 46337, 73310, 109127? 209c3 + 33c*2 + c - 1 What is the j'th term of -400751, -400761, -400771, -400781? -10j - 400741 What is the j'th term of 172307, 172310, 172315, 172322, 172331? j*2 + 172306 What is the t'th term of -14089, -14113, -14137? -24t - 14065 What is the i'th term of 156524, 156527, 156530, 156533, 156536? 3i + 156521 What is the c'th term of -55568, -55570, -55572, -55574, -55576? -2c - 55566 What is the n'th term of -2379, -2386, -2393, -2400, -2407, -2414? -7n - 2372 What is the t'th term of 4630, 9230, 13786, 18292, 22742, 27130, 31450? -t3 - 16t*2 + 4655t - 8 What is the a'th term of -4758, -9565, -14370, -19179, -23998, -28833? -a*3 + 7a*2 - 4821a + 57 What is the o'th term of -17, -173, -603, -1445, -2837, -4917, -7823, -11693? -23o3 + o2 + 2o + 3 What is the b'th term of 2060, 16285, 54852, 129929, 253684, 438285? 2028b3 + 3b*2 + 20b + 9 What is the q'th term of -1859, -1841, -1831, -1835, -1859, -1909? -q*3 + 2q*2 + 19q - 1879 What is the f'th term of -119, -158, -155, -110, -23, 106? 21f2 - 102f - 38 What is the v'th term of -13696, -27387, -41078, -54769, -68460? -13691v - 5 What is the b'th term of -159, -181, -217, -267, -331, -409? -7b2 - b - 151 What is the p'th term of 267944, 267939, 267932, 267923? -p2 - 2p + 267947 What is the h'th term of -5298, -10291, -15284? -4993h - 305 What is the n'th term of 1422, 4045, 7862, 12873, 19078? 597n2 + 832n - 7 What is the c'th term of -981590, -981590, -981588, -981584? c*2 - 3c - 981588 What is the v'th term of 81323, 162639, 243953, 325265, 406575, 487883? -v*2 + 81319v + 5 What is the r'th term of 1211, 4867, 10961, 19493, 30463? 1219r2 - r - 7 What is the b'th term of 3207, 3713, 4555, 5733, 7247? 168b*2 + 2b + 3037 What is the i'th term of 1354, 1340, 1326, 1312? -14i + 1368 What is the v'th term of 86, 96, 60, -22? -23v*2 + 79v + 30 What is the k'th term of 66464, 66433, 66402, 66371, 66340, 66309? -31k + 66495 What is the g'th term of -910, -12, 886? 898g - 1808 What is the l'th term of -9025, -18068, -27127, -36202, -45293, -54400? -8l2 - 9019l + 2 What is the n'th term of 66202, 66218, 66244, 66280, 66326, 66382? 5n2 + n + 66196 What is the b'th term of 31099, 62239, 93379, 124519? 31140b - 41 What is the a'th term of 17, -213, -595, -1129, -1815, -2653, -3643? -76a2 - 2a + 95 What is the p'th term of 127, 221, 319, 421? 2p2 + 88p + 37 What is the a'th term of -395, -691, -975, -1241, -1483, -1695, -1871, -2005? a*3 - 303a - 93 What is the m	{ "pile_set_name": "DM Mathematics" }
rom {p: 6, d: 5, c: 3, b: 1}. Give prob of picking 2 d. 2/21 What is prob of picking 1 v and 2 y when three letters picked without replacement from vvyyyyyyyyvvvyyy? 55/112 Calculate prob of picking 2 d when two letters picked without replacement from dxdxxddddddddddxdx. 26/51 Three letters picked without replacement from jwwjjjwwjw. What is prob of picking 2 j and 1 w? 5/12 Four letters picked without replacement from {y: 3, e: 9, v: 7}. Give prob of picking 1 v, 2 y, and 1 e. 63/1292 What is prob of picking 2 z and 1 g when three letters picked without replacement from {z: 5, g: 2}? 4/7 Three letters picked without replacement from {k: 1, u: 3, x: 3, r: 2, w: 10}. Give prob of picking 1 u, 1 x, and 1 r. 6/323 Calculate prob of picking 1 y, 1 p, and 1 z when three letters picked without replacement from pwyzpwzwwzwwwpwwpww. 4/323 Two letters picked without replacement from uvvvuvvuvvvvukkv. What is prob of picking 1 u and 1 v? 1/3 Three letters picked without replacement from {w: 2, e: 2, h: 1, j: 3, o: 4}. What is prob of picking 1 o and 2 w? 1/55 What is prob of picking 2 d when two letters picked without replacement from {d: 2, j: 1, h: 5, a: 1, x: 1}? 1/45 What is prob of picking 1 p and 2 h when three letters picked without replacement from hqhqhqqqqhqqhqpqhq? 5/272 Calculate prob of picking 2 i and 1 p when three letters picked without replacement from wiirbpninrrnww. 3/364 What is prob of picking 2 c and 2 s when four letters picked without replacement from hcdccihchhcccccdshcs? 3/323 Calculate prob of picking 2 n when two letters picked without replacement from {n: 17, m: 2}. 136/171 What is prob of picking 1 b and 2 t when three letters picked without replacement from tbbtttttttttt? 5/13 Two letters picked without replacement from {u: 9, r: 4, m: 1, j: 2}. Give prob of picking 2 j. 1/120 Two letters picked without replacement from emeicll. What is prob of picking 1 c and 1 e? 2/21 Four letters picked without replacement from {i: 1, u: 2, d: 1, l: 1, o: 1, x: 2}. Give prob of picking 1 u, 1 l, 1 x, and 1 i. 2/35 Calculate prob of picking 1 u and 2 z when three letters picked without replacement from {a: 1, t: 1, z: 5, u: 2}. 5/21 Calculate prob of picking 1 s and 1 e when two letters picked without replacement from euszdsess. 2/9 Calculate prob of picking 1 o, 1 a, and 1 k when three letters picked without replacement from {k: 2, c: 1, s: 3, o: 2, e: 1, a: 3}. 3/55 Four letters picked without replacement from bggbgb. What is prob of picking 2 b and 2 g? 3/5 Calculate prob of picking 1 s and 1 t when two letters picked without replacement from {i: 3, t: 2, s: 4, y: 1}. 8/45 What is prob of picking 2 m when two letters picked without replacement from mpppmmmpppmpp? 5/39 Calculate prob of picking 1 h, 1 b, and 1 t when three letters picked without replacement from {b: 11, t: 2, h: 2}. 44/455 Calculate prob of picking 2 f when two letters picked without replacement from eeuqefef. 1/28 What is prob of picking 2 z when two letters picked without replacement from zzzz? 1 Two letters picked without replacement from ecccmcem. What is prob of picking 1 e and 1 c? 2/7 Calculate prob of picking 1 j and 1 q when two letters picked without replacement from {w: 2, j: 7, q: 6}. 2/5 Calculate prob of picking 1 x and 1 t when two letters picked without replacement from xdatda. 1/15 Calculate prob of picking 1 l and 1 o when two letters picked without replacement from {h: 1, o: 1, b: 2, l: 1}. 1/10 What is prob of picking 2 i and 1 k when three letters picked without replacement from kpsiiwks? 1/28 Four letters picked without replacement from tttjjjjjjttjjtjtjtt. What is prob of picking 1 j and 3 t? 70/323 What is prob of picking 2 b when two letters picked without replacement from {u: 3, b: 2}? 1/10 Calculate prob of picking 1 z and 1 s when two letters picked without replacement from vvvqzqsqquqvvvqvvvv. 1/171 Calculate prob of picking 2 p when two letters picked without replacement from {a: 1, b: 6, p: 4}. 6/55 Calculate prob of picking 2 f when two letters picked without replacement from yqqqcqqfffyyfyqycqq. 2/57 What is prob of picking 1 a and 3 d when four letters picked without replacement from aaaddaaadd? 4/35 What is prob of picking 3 j when three letters picked without replacement from {w: 2, j: 3}? 1/10 What is prob of picking 2 q and 1 y when three letters picked without replacement from qyyyyyyqyyyyyyqy? 39/560 Three letters picked without replacement from {a: 4, k: 2, v: 2}. What is prob of picking 2 v and 1 k? 1/28 Four letters picked without replacement from rffffrf. What is prob of picking 4 f? 1/7 Four letters picked without replacement from xxooxggogxo. What is prob of picking 1 x, 1 g, and 2 o? 12/55 Three letters picked without replacement from {a: 2, l: 4, o: 2, f: 4}. Give prob of picking 3 l. 1/55 What is prob of picking 1 i and 1 u when two letters picked without replacement from kimue? 1/10 Four letters picked without replacement from jjjjjj. Give prob of picking 4 j. 1 Calculate prob of picking 1 g and 2 v when three letters picked without replacement from ggvv. 1/2 Two letters picked without replacement from ggmmgmjhmtm. Give prob of picking 1 j and 1 t. 1/55 Calculate prob of picking 1 x and 1 b when two letters picked without replacement from {y: 1, b: 1, w: 1, x: 9}. 3/22 Calculate prob of picking 1 m and 1 u when two letters picked without replacement from {m: 3, u: 9}. 9/22 What is prob of picking 1 a, 1 r, and 1 v when three letters picked without replacement from rvvaqrrarvrarrrrrqrr? 9/95 What is prob of picking 1 x and 2 n when three letters picked without replacement from xnwnzgd? 1/35 What is prob of picking 1 u and 2 h when three letters picked without replacement from ughghgghuhhhuh? 9/52 Two letters picked without replacement from {v: 2, n: 3, l: 4, m: 9}. What is prob of picking 1 m and 1 n? 3/17 What is prob of picking 1 r, 1 e, and 1 f when three letters picked without replacement from uluuluflpeuefurlue? 1/136 What is prob of picking 1 b and 1 n when two letters picked without replacement from bnbnbnnbnn? 8/15 What is prob of picking 2 r and 1 w when three letters picked without replacement from {w: 5, p: 1, r: 8, k: 5, c: 1}? 7/57 What is prob of picking 2 v and 1 i when three letters picked without replacement from {v: 8, n: 6, i: 3}? 21/170 Three letters picked without replacement from rrmrddmrrmmdrrmqm. What is prob of picking 2 d and 1 r? 21/680 Four letters picked without replacement from {w: 1, k: 1, o: 1, n: 1, q: 1}. Give prob of picking 1 q, 1 o, 1 w, and 1 n. 1/5 What is prob of picking 1 y and 1 z when two letters picked without replacement from {y: 6, z: 4, g: 2}? 4/11 What is prob of picking 2 g and 1 j when three letters picked without replacement from {g: 2, n: 3, j: 2, y: 8}? 2/455 Four letters picked without replacement from {u: 7, q: 2, c: 7, p: 1, k: 1}. Give prob of picking 1 q, 2 u, and 1 k. 7/510 Three letters picked without replacement from {s: 3, a: 4, f: 4}. What is prob of picking 1 s and 2 f? 6/55 What is prob of picking 2 c when two letters picked without replacement from xxcxxcxc? 3/28 Calculate prob of picking 1 d, 1 r, and 1 c when three letters picked without replacement from {z: 1, d: 1, r: 2, h: 1, q: 1, c: 1}. 2/35 What is prob of picking 2 c and 2 m when four letters picked without replacement from mmcmmc? 2/5 Three letters picked without replacement from avavvaaaaa. What is prob of picking 3 a? 7/24 Calculate prob of picking 1 r and 1 o when two letters picked without replacement from {h: 2, o: 1, r: 2, j: 1}. 2/15 Calculate prob of picking 1 c and 1 l when two letters picked without replacement from {c: 4, r: 4, i: 1, l: 3, z: 1}. 2/13 Two letters picked without replacement from {b: 1, p: 1, g: 2, w: 2, n: 1, f: 1}. Give prob of picking 1 w and 1 n. 1/14 Calculate prob of picking 3 r when three letters picked without replacement from rlldrctlrdqc. 1/220 Three letters picked without replacement from awwwawawaapappwwap. Give prob of picking 1 w and 2 a. 49/272 Three letters picked without replacement from {h: 3, y: 4, g: 1, c: 2}. Give prob of picking 1 y, 1 h, and 1 g. 1/10 Two letters picked without replacement from {s: 7, p: 2}. What is prob of picking 2 p? 1/36 W	{ "pile_set_name": "DM Mathematics" }
99) + 4)) + 1) + 1(sqrt(2299) + 1 + sqrt(2299) + 5)-6)*2. 12320sqrt(19) + 452204 Simplify (1sqrt(784))/(sqrt(21)/sqrt(3)3) + (sqrt(63) - (sqrt(63) + (sqrt(63) + sqrt(1575))-6)) + sqrt(63) + sqrt(63) + 4. 4 + 346sqrt(7)/3 Simplify 4(1(3 + -3sqrt(3)) + 4)-5 + 0. -140 + 60sqrt(3) Simplify 1 + sqrt(55)/(sqrt(176) + sqrt(11)) + 4 - (sqrt(405) + 2 + -3 + -2 + 5). -44sqrt(5)/5 + 3 Simplify ((-5 + -5 + 12sqrt(605))3 + 5)2 + 4. -3300sqrt(5) + 22409 Simplify (0 + 2sqrt(405) - (3 + sqrt(405) + 1sqrt(405) - sqrt(405)) - -1-3sqrt(405)1)2 + -5. 108sqrt(5) + 1624 Simplify (sqrt(60) - sqrt(960)2 - (sqrt(60) + -2sqrt(960)))/(-42(sqrt(108) + (sqrt(108) - (sqrt(108)2 + sqrt(108))))) + -3. -3 Simplify 5 + (4sqrt(225)-2)/(-6(sqrt(75)2 + sqrt(75)) + sqrt(75) + sqrt(75)). sqrt(3)/2 + 5 Simplify (-6(-5 + 2 + sqrt(2) + (sqrt(32) - sqrt(32)-2) + -3))2 + 1 + 1. -5616sqrt(2) + 13466 Simplify ((4sqrt(72) - sqrt(8)) + sqrt(1152)2)/(-4sqrt(400)2 + sqrt(400) - ((-6(sqrt(400) - 1sqrt(400)) + sqrt(400) - sqrt(400)) + sqrt(400))). -7sqrt(2)/16 Simplify -2(1 + sqrt(243)-3 + 0 + (sqrt(243) + -1sqrt(243) + -5)*2). -52 + 54sqrt(3) Simplify (sqrt(51)/(2sqrt(48)) - (sqrt(17)-2 + 1 - (sqrt(17) - sqrt(34)/sqrt(2))-2)) + (-4 + -1sqrt(2448) + 2-3sqrt(2448))*2. 5393sqrt(17)/8 + 119967 Simplify ((-3sqrt(104)-2 + (sqrt(104) - (3sqrt(104) + sqrt(104))3) + sqrt(104))/(sqrt(56)/(sqrt(7) + 1sqrt(7)) - (sqrt(16)1)/sqrt(2)))2. 832 Simplify (-2 + (sqrt(539) - (sqrt(539) + 2)2))-4 + -2 + 5 + 5((sqrt(539) + -1 + sqrt(539))2)2. -476sqrt(11) + 45323 Simplify 4(-3(sqrt(136) + -2(sqrt(136) - 2sqrt(136))))/(-6(sqrt(8) - sqrt(72)/(3sqrt(9))))-2. -18sqrt(17) Simplify ((sqrt(209) - (-3sqrt(209) - sqrt(209)))6 - 1(sqrt(209)3 + sqrt(209)))/(6(1sqrt(110))/sqrt(10)-2). -13sqrt(19)/6 Simplify (-3sqrt(475))2 + -1 - -1(2sqrt(475) + sqrt(475)) - (2 + (sqrt(304)4 - (sqrt(304) + 5)) + -3)*2. 159sqrt(19) + 1502 Simplify (1sqrt(19) + -2 - (1sqrt(1539) + sqrt(1539)) - (sqrt(152) + sqrt(152)2-4 - sqrt(152))/(sqrt(40)/(sqrt(5)-2)))2. 132sqrt(19) + 20695 Simplify -1((sqrt(5) + (sqrt(80)/sqrt(2))/sqrt(8) - sqrt(5)) + sqrt(180) + sqrt(180)4 + (sqrt(60) + sqrt(240)-2)/(sqrt(300)2 - sqrt(300))). -152sqrt(5)/5 Simplify (((sqrt(240) - 2sqrt(240)) + sqrt(240))/(sqrt(540)/sqrt(12)))*2 + (2sqrt(72)/sqrt(3))/(sqrt(8) + (sqrt(8) - (sqrt(128) + sqrt(8)))6). -2sqrt(3)/23 Simplify ((1-1sqrt(84) - (-1(-2sqrt(84) - sqrt(84)) + sqrt(84)))1)/(-3-3sqrt(96)/sqrt(8)-2). 5sqrt(7)/18 Simplify ((sqrt(54)/((sqrt(864) + sqrt(24))/sqrt(4)))/(1sqrt(300)1 + sqrt(300))-6)*2. 27/4900 Simplify ((-1 + (sqrt(84)-21 - sqrt(84))/(sqrt(60)/(-1sqrt(5))))5 + 1)2. -120sqrt(7) + 1591 Simplify -5 + ((-11sqrt(68) - sqrt(68)) + 6-2sqrt(68) + sqrt(68) + sqrt(68))*2 - (-54((-2sqrt(204))/sqrt(12))2 + -5). 11152 Simplify -3 + ((sqrt(4)/sqrt(2) + 1 - (-2 + sqrt(8)/sqrt(4)))24 - ((sqrt(128)-2)*2 + 5 - -51sqrt(128))). -484 - 40sqrt(2) Simplify (-2 + (4-2sqrt(242))*2 - (sqrt(18)/(sqrt(36)/sqrt(4)) - sqrt(10)/(-1sqrt(5)))) + 2. -2sqrt(2) + 15488 Simplify (-6(3 + -3sqrt(704)) + -2)2 + ((sqrt(55)/(2sqrt(5)) + -2sqrt(1584))2 + -3)-3. -5760sqrt(11) + 841123/4 Simplify (((sqrt(76) - sqrt(76)-2 - sqrt(76))-6 + sqrt(76))5)/((sqrt(400)3)/sqrt(4))-1. 11sqrt(19)/3 Simplify -4(-6(sqrt(1573) + 3) + sqrt(1573)) + 4 + (3(sqrt(1573) + -2) + 2)*2-4. -56616 + 1276sqrt(13) Simplify (((sqrt(208)/sqrt(4))/sqrt(2) - sqrt(26))31)/(sqrt(288) - (sqrt(288) + -2sqrt(288)2) - -2(1sqrt(288) + sqrt(288) - sqrt(288))). 0 Simplify (sqrt(704) - (sqrt(704) + -3 + 2) - -4sqrt(704)4) + (-4 + -1 + sqrt(704) + sqrt(704) - ((sqrt(704)-2-4 - sqrt(704))2 - sqrt(704))). -34500 + 152sqrt(11) Simplify (-3(sqrt(91) + sqrt(91)-1) + (sqrt(91) - (sqrt(91) - (-13sqrt(91) + sqrt(91) - sqrt(91)) - sqrt(91))))/((-1sqrt(2401))/sqrt(7)1). 2sqrt(13)/7 Simplify (-4-4(-32sqrt(405) + -1)-5-1)2. 691200sqrt(5) + 93318400 Simplify -1(-1-6sqrt(400)-2)/((sqrt(128) - (sqrt(128) - 2sqrt(128)))-6 - sqrt(128)). -15sqrt(2)/13 Simplify -2 + (-4(3(sqrt(612) + 0 + sqrt(612)) - 4(0 + sqrt(612)))3)2 + -5. 352505 Simplify (5sqrt(128)2 + 0)2 + 2 + 3((sqrt(128) - (0 + sqrt(128)))5 + -1 + sqrt(128) + -3 + sqrt(128))2 + -2. -384sqrt(2) + 14384 Simplify (-5 + (sqrt(500) - (sqrt(500)1 - sqrt(500)) - sqrt(500))6)-6 - (3 + (0 + sqrt(500) + 5)2 + -1). -497 - 100sqrt(5) Simplify (sqrt(500)/(sqrt(1280)/sqrt(2) - sqrt(10)) + sqrt(300)/(sqrt(54)/sqrt(324)))*2. 92450/49 Simplify 5 + (3(sqrt(143) - (sqrt(143) + 1sqrt(143) + sqrt(143))) - sqrt(143))/((-1sqrt(1331) - sqrt(1331)) + sqrt(11)) + 4 + (-1 + 2sqrt(208))2. -47sqrt(13)/3 + 842 Simplify 0 + (sqrt(216) + (sqrt(216) + (sqrt(216) + (sqrt(216) - sqrt(216)2) + sqrt(216))-2 - sqrt(216)) - sqrt(216))/(sqrt(48)/(sqrt(36)/sqrt(54)))5. -10sqrt(3) Simplify 0 + (sqrt(153)2 + -4 + (4 + sqrt(833))-1)*2-6. -486 - 96sqrt(17) Simplify -14(sqrt(4608) + -1 + 1 - (-3 + -1 + sqrt(4608)) - (5 + sqrt(4608)2)*2-4). -295328 - 15360sqrt(2) Simplify 4((sqrt(49) - (-5(sqrt(49) + sqrt(49)-1 - sqrt(49)) - sqrt(49))) + sqrt(49)-2-6)/(sqrt(77)/(1sqrt(11)) + sqrt(175)1)-4. -24sqrt(7) Simplify 5 + (-24(sqrt(2299) + 0) + (5(sqrt(2299) + 1) - sqrt(2299)) + -2sqrt(2299)3 + sqrt(2299) + -3)2. -396sqrt(19) + 186228 Simplify (6(sqrt(847) + 0 + (1sqrt(84))/sqrt(12)) + (sqrt(84)/(sqrt(20)/sqrt(5)))/(sqrt(12)/sqrt(16)))*2. 38332 Simplify ((sqrt(171)/(sqrt(9)2) - (-4(sqrt(19) + 2 + sqrt(19)) + sqrt(19))) + (0 + sqrt(304) - (2 + sqrt(19) + -3)) + 5)-4. -42sqrt(19) - 56 Simplify 2 + 4(sqrt(396) - (sqrt(396) - sqrt(396)4 - sqrt(396) - sqrt(396)) - sqrt(44))/((-3sqrt(48))/sqrt(12) + sqrt(4))2 + -1. -68sqrt(11) + 1 Simplify (2sqrt(567) + (sqrt(35)/sqrt(5) + 1 - sqrt(7)) - (sqrt(28)/sqrt(4) + -4 + 4)-2)*2. 40sqrt(7) + 2801 Simplify (5(-1sqrt(304)-2 - (3 + 0 + sqrt(304)) - (1sqrt(304) + 1)-6))2. 4200sqrt(19) + 372625 Simplify (61(sqrt(136) - 2sqrt(136)2)-5)/(25(sqrt(512)-2 + (sqrt(8) - -1sqrt(392)))). -9sqrt(17)/8 Simplify -4 + ((2sqrt(320) + 4 - (-1 + sqrt(320) + -1)) + 2 + (sqrt(320) + sqrt(320) + 0 + 1)6)*2. 2912sqrt(5) + 54272 Simplify (((sqrt(392) + sqrt(392)-1)3)/(sqrt(112)/sqrt(4) + sqrt(28)))/((-6sqrt(72)2 - sqrt(72) - sqrt(72))/(sqrt(18)/(sqrt(4)/sqrt(2))))-6. 0 Simplify ((-3(sqrt(171) - 1sqrt(171)))/(sqrt(27)/(sqrt(15)/sqrt(5))) + ((sqrt(95)1 - sqrt(95) - sqrt(95))5 + sqrt(95))/sqrt(5)-3)5. 60sqrt(19) Simplify -1(1 + (-4 + (sqrt(612) - sqrt(612)-1) + 1)*2)-6 + 3. -432sqrt(17) + 14751 Simplify ((4sqrt(63))*2 + 0 + -4 + sqrt(7)-3 + 3)-2. -2014 + 6sqrt(7) Simplify ((6(-2sqrt(200) + 5) + -4(sqrt(200) + sqrt(200) + sqrt(200) + 6(sqrt(200) - (sqrt(200) + 3))))*2 + 2)-2. -251212 + 97920sqrt(2) Simplify (3 + 1sqrt(112)21)*2 - 3((sqrt(126)/sqrt(2))/sqrt(9) + sqrt(7) - (sqrt(77)-1)/sqrt(11)). 39sqrt(7) + 457 Simplify (((sqrt(160) - 1sqrt(160))/(sqrt(4)2-4))/((sqrt(5) + sqrt(320)-1 - sqrt(45)-2)1))*2. 0 Simplify ((sqrt(484) + -6((1sqrt(484) - sqrt(484)) + sqrt(484)) + sqrt(484))/(sqrt(44)/(sqrt(24)/sqrt(6))))/(((sqrt(5184)-1 - sqrt(5184)) + sqrt(5184))45). sqrt(11)/180 Simplify 4 + 0 + (sqrt(396) - (sqrt(396) + (sqrt(396)-2)2)-4 - (0 + sqrt(396) + 1))-5. -31671 - 120sqrt(11) Simplify (3 + (sqrt(156)/(-2sqrt(75)))/((sqrt(484)-2 - sqrt(4)) + -1sqrt(64)))2 + 3. sqrt(13)/45 + 874813/72900 Simplify (-2(-4 + (sqrt(1080)/sqrt(6) - sqrt(5))1 + 5 + sqrt(5)-4 + -5 + 1))*2. -24sqrt(5) + 56 Simplify ((sqrt(42)/sqrt(6)-4 + ((2sqrt(14))/sqrt(2) - sqrt(7)))-2 + -6(-3 + (sqrt(1008) + 1 - sqrt(1008))) + -1)*2. 132sqrt(7) + 373 Simplify (-1-2sqrt(208) - sqrt(208) - (sqrt(208) - (sqrt(208) + 1sqrt(208) + sqrt(208)))6)/((sqrt(384)/sqrt(8))/sqrt(12)-2). -13sqrt(13) Simplify (1 + 1 + (3(sqrt(768) + 1))2)-6 + 0. -41538 - 1728sqrt(3) Simplify (-1(sqrt(75)/(-2sqrt(5) + sqrt(5)))/(3sqrt(20)/sqrt(4)))*2 + (5(sqrt(81) - sqrt(9)) - sqrt(9))/(-2sqrt(192)). -9sqrt(3)/16 + 1/3 Simplify (-2(-5 + 1 + sqrt(512) + 1 + -5 + 5))2. -384sqrt(2) + 2084 Simplify (-5((-6sqrt(3600) + sqrt	{ "pile_set_name": "DM Mathematics" }
h: 3, a: 4, m: 1}. 2/55 What is prob of picking 1 a, 2 v, and 1 u when four letters picked without replacement from auuvvuvjvavavuvavjvv? 48/323 Two letters picked without replacement from {x: 3, y: 7}. Give prob of picking 2 y. 7/15 Calculate prob of picking 2 z when two letters picked without replacement from zzzzzzzzzz. 1 What is prob of picking 1 x and 3 f when four letters picked without replacement from {f: 1, n: 1, x: 1, c: 2, w: 2, u: 2}? 0 Two letters picked without replacement from fppafpf. Give prob of picking 2 f. 1/7 Two letters picked without replacement from {x: 2, b: 2}. Give prob of picking 1 x and 1 b. 2/3 Calculate prob of picking 1 f and 1 h when two letters picked without replacement from {h: 5, f: 15}. 15/38 Three letters picked without replacement from aydeedaddddidymi. What is prob of picking 2 e and 1 y? 1/280 Four letters picked without replacement from {z: 6, h: 6}. Give prob of picking 1 z and 3 h. 8/33 Three letters picked without replacement from fffffffffeffffeefuff. Give prob of picking 1 u, 1 f, and 1 e. 4/95 Four letters picked without replacement from pppppkkpkkrkkk. What is prob of picking 4 k? 5/143 Four letters picked without replacement from {u: 1, k: 5, y: 1, i: 3, x: 3}. Give prob of picking 1 y, 1 x, and 2 k. 6/143 Four letters picked without replacement from oqqqiiqiiiriqrirq. What is prob of picking 1 r, 2 q, and 1 o? 9/476 Three letters picked without replacement from {k: 3, j: 6, s: 1, h: 4, a: 4, z: 2}. Give prob of picking 1 z, 1 s, and 1 j. 1/95 Four letters picked without replacement from {c: 5, b: 2, f: 1, q: 1, v: 3}. What is prob of picking 1 v, 1 q, and 2 c? 2/33 Three letters picked without replacement from {w: 2, o: 7, t: 5, s: 4}. What is prob of picking 1 t and 2 s? 5/136 What is prob of picking 1 e and 1 u when two letters picked without replacement from uehuuuyfzfeezzz? 4/35 Calculate prob of picking 1 f and 1 c when two letters picked without replacement from reeclflrh. 1/36 Two letters picked without replacement from {f: 2, d: 1, s: 1}. Give prob of picking 1 d and 1 s. 1/6 Calculate prob of picking 3 m and 1 h when four letters picked without replacement from mmmhmmmmmmmh. 16/33 Calculate prob of picking 1 t and 2 l when three letters picked without replacement from lmtlltltfllmtmltlt. 7/34 What is prob of picking 1 h and 2 f when three letters picked without replacement from {y: 1, n: 1, d: 1, f: 2, h: 1, i: 1}? 1/35 Calculate prob of picking 2 m and 1 q when three letters picked without replacement from {h: 1, a: 1, q: 11, m: 2}. 11/455 Two letters picked without replacement from {x: 1, r: 2}. Give prob of picking 1 x and 1 r. 2/3 Two letters picked without replacement from jjj. What is prob of picking 2 j? 1 What is prob of picking 1 a and 1 e when two letters picked without replacement from {e: 2, a: 17}? 34/171 Three letters picked without replacement from {l: 9, z: 9}. Give prob of picking 3 l. 7/68 Three letters picked without replacement from zlzlzluzuzlluzzzuzz. Give prob of picking 2 l and 1 z. 100/969 Three letters picked without replacement from powoonoooonn. What is prob of picking 1 p, 1 w, and 1 o? 7/220 Two letters picked without replacement from {o: 5, q: 11}. Give prob of picking 2 o. 1/12 Two letters picked without replacement from {i: 2, p: 2}. Give prob of picking 2 p. 1/6 Two letters picked without replacement from {l: 1, i: 5, f: 3}. Give prob of picking 1 i and 1 f. 5/12 Two letters picked without replacement from {g: 4, s: 4, b: 2, w: 1}. What is prob of picking 1 g and 1 b? 8/55 Four letters picked without replacement from {i: 4, w: 7, n: 6}. Give prob of picking 3 w and 1 i. 1/17 Calculate prob of picking 4 x when four letters picked without replacement from {x: 9}. 1 What is prob of picking 2 b when two letters picked without replacement from bbbyby? 2/5 Two letters picked without replacement from {c: 9}. What is prob of picking 2 c? 1 Calculate prob of picking 2 y and 1 x when three letters picked without replacement from xhyqxxxy. 1/14 What is prob of picking 1 v and 1 n when two letters picked without replacement from {n: 3, v: 4}? 4/7 Four letters picked without replacement from {o: 6, k: 3, n: 4, l: 3, b: 2}. Give prob of picking 4 n. 1/3060 Four letters picked without replacement from {f: 5, l: 2, m: 2, c: 9}. Give prob of picking 2 l and 2 m. 1/3060 Calculate prob of picking 1 t and 1 r when two letters picked without replacement from {j: 2, l: 1, r: 2, n: 1, t: 1}. 2/21 What is prob of picking 2 o and 2 q when four letters picked without replacement from qqoqqqooqqqq? 12/55 Four letters picked without replacement from ldztddddr. Give prob of picking 1 r, 1 l, 1 d, and 1 z. 5/126 What is prob of picking 1 z, 1 j, 1 p, and 1 w when four letters picked without replacement from {z: 2, r: 1, e: 1, w: 1, j: 2, p: 2}? 4/63 Three letters picked without replacement from ebeahbbbaaecbababee. What is prob of picking 1 a, 1 e, and 1 b? 175/969 What is prob of picking 2 k when two letters picked without replacement from wwwwwwwwkkwwwwwwwwww? 1/190 What is prob of picking 2 m and 2 r when four letters picked without replacement from mrmmmr? 2/5 Three letters picked without replacement from yyyyybyyybbybybayya. Give prob of picking 2 y and 1 b. 110/323 Calculate prob of picking 2 q when two letters picked without replacement from qqaqqqqaqaqqqqaqqq. 91/153 Calculate prob of picking 1 h and 1 c when two letters picked without replacement from cdhcmdd. 2/21 Two letters picked without replacement from {p: 6, v: 1, x: 4}. Give prob of picking 2 p. 3/11 Two letters picked without replacement from xxlxxlxlll. Give prob of picking 2 l. 2/9 Calculate prob of picking 1 o, 1 i, and 1 f when three letters picked without replacement from fifohhphpopii. 6/143 Calculate prob of picking 1 s and 3 i when four letters picked without replacement from iiababassicabi. 8/1001 Calculate prob of picking 2 i and 2 o when four letters picked without replacement from iooooioioi. 3/7 Two letters picked without replacement from {j: 5, c: 5}. What is prob of picking 1 c and 1 j? 5/9 Calculate prob of picking 2 f, 1 l, and 1 r when four letters picked without replacement from rlzrlfrjrfrdj. 2/143 Calculate prob of picking 2 l when two letters picked without replacement from lfuuululguuullff. 1/12 Four letters picked without replacement from ddiodnv. Give prob of picking 1 i, 1 n, 1 o, and 1 d. 3/35 What is prob of picking 1 j, 2 k, and 1 n when four letters picked without replacement from ftkmkjn? 1/35 What is prob of picking 1 k and 2 b when three letters picked without replacement from bkbbbbbbbbbbb? 3/13 Four letters picked without replacement from xrvrvrrrprrvxrrxrxpx. What is prob of picking 2 p, 1 v, and 1 x? 1/323 Calculate prob of picking 3 k and 1 f when four letters picked without replacement from ffbkbfffkkffhhkf. 8/455 Calculate prob of picking 1 s and 1 z when two letters picked without replacement from {z: 1, s: 2, t: 1}. 1/3 Four letters picked without replacement from {y: 2, h: 2, o: 1, b: 1, e: 1, t: 1}. What is prob of picking 2 h, 1 t, and 1 o? 1/70 What is prob of picking 1 q and 2 j when three letters picked without replacement from {v: 4, j: 2, f: 3, t: 1, q: 2}? 1/110 Three letters picked without replacement from {w: 1, g: 4, h: 3, t: 2, v: 1}. What is prob of picking 1 t, 1 g, and 1 h? 8/55 What is prob of picking 1 p and 2 q when three letters picked without replacement from qqppapqpa? 1/7 Two letters picked without replacement from zzzzkzzzkzk. What is prob of picking 1 z and 1 k? 24/55 Calculate prob of picking 2 w when two letters picked without replacement from wwwwfwffwfwwww. 45/91 Four letters picked without replacement from lnnjl. What is prob of picking 3 l and 1 n? 0 Calculate prob of picking 3 e when three letters picked without replacement from {x: 3, a: 3, e: 2}. 0 Calculate prob of picking 1 y and 1 e when two letters picked without replacement from pmmypeypkpppyppmppyy. 1/38 Four letters picked without replacement from titwttmi. Give prob of picking 1 m and 3 t. 2/35 What is prob of picking 1 f and 1 o when two letters picked without replacement from {f: 1, o: 14}? 2/15 Calculate prob of picking 3 d and 1 x when four letters picked without replac	{ "pile_set_name": "DM Mathematics" }
greatest common factor of u and x? 11 Let o = -53 + 56. Suppose -15 = -od - 4q + 25, 4d + q - 49 = 0. What is the greatest common factor of 156 and d? 12 Let i be -536/30 + 46. Calculate the highest common divisor of i and 180. 20 Let y = 12 - 9. Let n = 27 - 18. Calculate the highest common divisor of y and n. 3 Let t be 0/2 + 4 + 34. Let g be (t + 0 - 2)1. Suppose 0 = -0o + 2o - p - 12, 0 = 4o + 4p. Calculate the highest common divisor of o and g. 4 Suppose 0 = -0g + 7g - 28. Suppose -gu - 10 = 50. Let n be (9/(-27))/(1/u). Calculate the greatest common divisor of n and 10. 5 Suppose 2x + 714 = 7t - 3t, -2x = t - 186. Calculate the greatest common factor of 225 and t. 45 Suppose 396 = 3n - 36. What is the highest common factor of 64 and n? 16 Let s(t) = -7t + 206. Let p be s(29). What is the greatest common divisor of p and 327? 3 Let p(d) = -d*2 - 16d + 1. Let o be p(-12). Suppose 0s - 1 = -3s - f, -2s - 2 = -2f. Suppose sj = j - o. What is the highest common divisor of j and 7? 7 Let h(y) = -y3 + 8y*2 + 32y + 26. Let g be h(11). Calculate the greatest common factor of 585 and g. 15 Let w be 77/4 - (-49)/(-196). Calculate the greatest common factor of 608 and w. 19 Let a = -100 + 201. Let b be (-10)/15 - (-1 + a/(-3)). What is the highest common factor of b and 102? 34 Let z(j) = -j + 14. Let o be -1 - (-3)/3 - -4. Suppose 2f + o = -4a, 5 = -5f - a + 4. Let x be z(f). What is the greatest common divisor of x and 28? 14 Let h be (-24 - (-1 - -4))/(-2 - -1). Let j = h - 13. What is the highest common factor of 7 and j? 7 Suppose -5b = 2w - 5w - 12, -1 = -2b + 5w. What is the highest common factor of 2 and b? 1 Let m(x) = -3x2 - 19x - 6. Let s be m(-7). Suppose 2r - 6r - 20 = 0. Let q be s/(-50) + (-28)/r. What is the greatest common factor of q and 30? 6 Let i(v) = 2v3 - 2v*2 + 68v - 291. Let a be i(4). Calculate the highest common divisor of a and 187. 11 Let y = -18 - -29. Let j be (-3 + -3)((-15)/50 + (-7)/210). What is the highest common divisor of y and j? 1 Suppose -12 = -2g + 204. Suppose 5c + 4h = -g, -4c - 45 = -h + 54. Let k = 82 + c. What is the highest common divisor of 145 and k? 29 Suppose -20g = -3153 - 3567. What is the highest common divisor of g and 16? 16 Suppose 3n - 19 = 116. Let p = -11 - -19. Suppose -3x - 5s = -ps - 87, -5x + 3s + 147 = 0. What is the greatest common factor of x and n? 15 Suppose 956 - 236 = 40n. What is the highest common divisor of n and 675? 9 Suppose -7q + 3q + 108 = 0. Let w be 774/(-4)2/(-3). Suppose 4z = 3f - 223, -2z + 124 = 3f - w. What is the highest common factor of f and q? 27 Let p(t) = 8t2 - 4t + 96. Let a be p(-12). What is the highest common divisor of 27 and a? 27 Let h(w) = w + 31. Let d be h(-11). What is the highest common factor of 190 and d? 10 Suppose g - 3 + 0 = 0. Suppose -w - 2 - 1 = -2x, 2x = -5w + 21. Let p(i) = i2 - 4i + 9. Let o be p(w). What is the highest common divisor of g and o? 3 Suppose 2h = -5x - 10, 2x - 3h - 15 = 6x. Suppose 4z - 256 = -xz. Suppose -z = 3i - 7i. What is the highest common divisor of 80 and i? 16 Let b = 24 - 32. Let n be b/60 + 17/15. Suppose l = -2l - 5q - n, -4l - 3q = -6. Calculate the highest common divisor of l and 27. 3 Let m(t) be the second derivative of t4/12 + 5t3/6 + t2/2 - 16t. Let c be m(-7). Calculate the greatest common factor of 5 and c. 5 Let f be ((-72)/(-40))/((-2)/(-30)). Suppose 3w + 287 = 935. Calculate the highest common factor of w and f. 27 Let b = -1271 + 1391. Calculate the greatest common factor of b and 300. 60 Suppose -4v + 393 = -287. What is the greatest common factor of 51 and v? 17 Let a be (38/12)/((-17)/(-102)). What is the greatest common factor of 2 and a? 1 Suppose 221 = 2f - 37. What is the highest common factor of 86 and f? 43 Suppose 8s - 4s + 136 = 0. Let p = -3 - s. Let k be p + 2(-6)/(-3). What is the greatest common factor of k and 14? 7 Suppose -5i = -54 - 6. Let q be (-108)/30 + (-6)/(-10). Let l = 6 + q. What is the highest common factor of l and i? 3 Let m(l) = -l2 - 5. Let o(z) = z2 - z + 4. Let h(b) = 3m(b) + 4o(b). Let g be h(-4). What is the highest common divisor of 11 and g? 11 Suppose 4o = -d + 193, d + d - 3o = 375. What is the greatest common factor of 21 and d? 21 Let l = -708 + 723. Calculate the highest common factor of l and 9. 3 Let n(r) = r*2 + 21r + 117. Let u be n(-7). What is the highest common factor of 95 and u? 19 Let g(f) = -f - 21f3 + f - 1. Let w be g(-1). Let h be (-8 + 4)30/8-2. Calculate the greatest common factor of w and h. 10 Let v be 26/(-1)(-77)/22. Let n = -1 + 14. What is the highest common factor of n and v? 13 Suppose z - 52 = -2a, 4a = 2z - 137 + 33. What is the highest common divisor of z and 91? 13 Let v be 376/(-11)-1 + (-2)/11. What is the greatest common factor of v and 85? 17 Suppose -2a + 3j + 17 = 0, -12 = -2j - 2j. Suppose -146 - 205 = -ai. What is the greatest common divisor of i and 243? 27 Suppose 6258 = 20f + 1498. Calculate the greatest common divisor of 85 and f. 17 Let n = 104 - 16. Suppose 5h - n = -33. Calculate the greatest common factor of 33 and h. 11 Let m be (89/(-2))/((-1)/2). Suppose -54 = 3b - b - 5r, r - m = 5b. Let v = b - -18. What is the greatest common divisor of 3 and v? 1 Suppose 0 = 2b - 5g + 37, 3b + 21 = 2b + 5g. Suppose -3p = -5p + 60. Let j = p + b. Calculate the highest common factor of j and 21. 7 Suppose 2g = -2g + 5x + 102, -4g = -x - 94. Suppose s + g = 44. What is the highest common factor of 189 and s? 21 Suppose 234 = 3b - 27. Let g be b + 1(-4 + 7). Calculate the highest common divisor of 10 and g. 10 Suppose -2z = 6, 2l = -z + 31 - 2. Suppose ld = 15d + 18. Calculate the greatest common factor of 90 and d. 18 Suppose 0 = 4b + 5n - 102 - 8, 3n - 84 = -3b. What is the greatest common factor of b and 378? 6 Let x be (-3 - (-33)/15)/((-5)/175). What is the highest common factor of 161 and x? 7 Suppose -3o - 2 = w - 47, 47 = 4o - 3w. Suppose -o + 338 = 4a. Calculate the highest common divisor of 9 and a. 9 Suppose -6 - 94 = -4n. Suppose 5f - n = 4f. Let t(w) = -6w + 175. Let m be t(25). Calculate the greatest common factor of f and m. 25 Let n = 138 - 106. What is the greatest common factor of n and 8? 8 Let a(r) = r + 35. Let d be a(-9). Suppose 3l - 266 = -32. What is the highest common divisor of d and l? 26 Let u = 0 + 1. Let z(s) = s*2 - 84s + 1051. Let q be z(69). Calculate the greatest common factor of q and u. 1 Suppose 5y - 690 = -5l, -20y + 6 = -23y. Let a(k) = -57k3 - 1. Let g be a(-1). What is the greatest common divisor of l and g? 28 Suppose 18 = y + 5r - 453, 5r = y - 431. Calculate the highest common divisor of y and 22. 11 Let h(k) = -37k*3 + 2k + 1. Let b be h(-1). Let y = -119 - -209. What is the greatest common factor of b and y? 18 Let q be (-393)/(-6) + 6/(-12). Suppose -68t = -qt - 42. What is the highest common divisor of 35 and t? 7 Let s be (-3)/(((-90)/(-312))/(-5)). Calculate the greatest common divisor of s and 28. 4 Let s = 0 + 12. Let p be (1/(-2) + 1)/(14/84). What is the highest common factor of p and s? 3 Suppose 3w = -2w - 30. Let h be (-72)/3w/8. Calculate the highest common factor of 6 and h. 6 Suppose -41u + 895 + 1032 = 0. Let i be -2 + 1 - 96/(-2). What is the highest common divisor of u and i? 47 Let k be ((-2)/(-4))/((-2)/(-20)). Let q = 8 - k. Let g(b) = -b*2 - 25b - 82. Let c be g(-21). Calculate the greatest common factor of c and q. 1 Suppose 11n - 368 = 94. What is the greatest common factor of 14 and n? 14 Suppose -2q - 45 = -7q. Let v(o) = -o2 + 12o - 9. Let z be v(q). Suppose -7k + 90 = -6k. Calculate the greatest common divisor of z and k. 18 Let z(r) = -59r + 6. Let w be (-42)/18 - (-2)/(-3). Let p be z(w). Let q = 303 - p. Calculate the highest common factor of 48 and q. 24 Let j(q) = 155q*2 + 21q + 19. Let r be j(-1). Calculate the greatest common factor of 36 and r. 9 Let d be (50/(-15))/((-4)/6). Let j(v) = 0v - 4v - d - 1. Let z be j(-7). What is the greatest common factor of 55 and z? 11 Let p(t) = -3t*2 - t - 9. Let u be p(-4). Let g = u - -58. Calculat	{ "pile_set_name": "DM Mathematics" }
r. 16.3, -4/5, -1, -3, -6 Sort 2, -51, 7, -7. -51, -7, 2, 7 Put -0.0661, 1, 0.2 in descending order. 1, 0.2, -0.0661 Sort 0.5, 1/6, -0.7, 21/5, 2/11 in decreasing order. 21/5, 0.5, 2/11, 1/6, -0.7 Sort -408, -2/19, 0.11, -0.1, -3 in decreasing order. 0.11, -0.1, -2/19, -3, -408 Sort -3, 8001, -2 in decreasing order. 8001, -2, -3 Put 2, 0.3, -18, -3 in decreasing order. 2, 0.3, -3, -18 Sort 1, -76, -1/108, -2/3 in descending order. 1, -1/108, -2/3, -76 Put -22, 352, -5, 0 in decreasing order. 352, 0, -5, -22 Put 14, 0.2, 1/7, 1/4, -3, -132 in ascending order. -132, -3, 1/7, 0.2, 1/4, 14 Put 0.3, 0, 1029, -1/5, 5 in decreasing order. 1029, 5, 0.3, 0, -1/5 Sort -24816.8, 6, -5 in ascending order. -24816.8, -5, 6 Put 6, 11151, 4 in increasing order. 4, 6, 11151 Put -2252.4, 4, 0.3 in decreasing order. 4, 0.3, -2252.4 Sort -64.81, -0.4, 26 in increasing order. -64.81, -0.4, 26 Put 2, 4, 2380 in descending order. 2380, 4, 2 Sort 2, -65, -2437 in ascending order. -2437, -65, 2 Sort -7566, -5, 43, 0 in descending order. 43, 0, -5, -7566 Put -5, 805, -32 in ascending order. -32, -5, 805 Sort -1, 2/9, 0.3, -13, -0.18, 0.1 in decreasing order. 0.3, 2/9, 0.1, -0.18, -1, -13 Sort -2, -5, -1206, 12, 2, 4 in decreasing order. 12, 4, 2, -2, -5, -1206 Sort 15, 741, -1 in decreasing order. 741, 15, -1 Sort 4, -39, 5, 18, -12. -39, -12, 4, 5, 18 Put 1/2, 35/2, -0.073 in ascending order. -0.073, 1/2, 35/2 Sort 10, -1, 0.3, 93, -2/9 in increasing order. -1, -2/9, 0.3, 10, 93 Put 3, 90, 4, 0, -20 in descending order. 90, 4, 3, 0, -20 Put -2, 39, 881 in ascending order. -2, 39, 881 Put -2/29, 5, 1/3089, 1/3 in increasing order. -2/29, 1/3089, 1/3, 5 Sort -15, 2, 5, -2/3, 4 in decreasing order. 5, 4, 2, -2/3, -15 Put -1/3, 20, 22, 0.05, 2 in ascending order. -1/3, 0.05, 2, 20, 22 Sort -1, 38, 167, 5, -5, 1 in decreasing order. 167, 38, 5, 1, -1, -5 Put 4/9, -5, -1382, 1/8, -7, -0.5 in decreasing order. 4/9, 1/8, -0.5, -5, -7, -1382 Sort -5, -2, 33212, -4 in increasing order. -5, -4, -2, 33212 Sort -9, 80, 15 in increasing order. -9, 15, 80 Sort 19, 0.3, 217. 0.3, 19, 217 Sort 8, 5, -3, 3, -33, 1 in descending order. 8, 5, 3, 1, -3, -33 Put -10, 0.11, -5, -2/11, -7, 0 in ascending order. -10, -7, -5, -2/11, 0, 0.11 Sort -57, -0.06, -2/3, 3 in increasing order. -57, -2/3, -0.06, 3 Sort -3, 9, -4, -9 in decreasing order. 9, -3, -4, -9 Put 4, -2, -1119 in ascending order. -1119, -2, 4 Sort -584, -11/9, 0.5 in decreasing order. 0.5, -11/9, -584 Put -1, -2, 6, -3546 in increasing order. -3546, -2, -1, 6 Put -0.5, -15, 1.29, 5 in increasing order. -15, -0.5, 1.29, 5 Sort 1298, -107, -4 in descending order. 1298, -4, -107 Put -75212, 26, 2/11 in descending order. 26, 2/11, -75212 Sort 5, -0.26, -1249. -1249, -0.26, 5 Put 2/7, -1/2, 287 in increasing order. -1/2, 2/7, 287 Sort 0, 22, 3, -3, 92 in decreasing order. 92, 22, 3, 0, -3 Sort -0.5, 1/5, -30/679, -3 in increasing order. -3, -0.5, -30/679, 1/5 Put -1/2, 591, 1/3 in ascending order. -1/2, 1/3, 591 Sort 3, -3, -248, 1 in descending order. 3, 1, -3, -248 Put 2, 689, -3, -5, -1 in descending order. 689, 2, -1, -3, -5 Put 9, 0, -2, -7, -3, 2 in decreasing order. 9, 2, 0, -2, -3, -7 Sort -2/15, -583882, -1/2 in ascending order. -583882, -1/2, -2/15 Put 1, -41, 1483, -4, 2 in ascending order. -41, -4, 1, 2, 1483 Put -25, 1/3, 5, -2/7, -0.3, 87 in increasing order. -25, -0.3, -2/7, 1/3, 5, 87 Sort 1/5, -3/4, -0.1, -465/152 in decreasing order. 1/5, -0.1, -3/4, -465/152 Put -0.1419, -4, 4, 2/7 in decreasing order. 4, 2/7, -0.1419, -4 Put 5.18683, -0.4, -0.1 in increasing order. -0.4, -0.1, 5.18683 Put 9, -5/6, -7, -4/3, 2/7 in ascending order. -7, -4/3, -5/6, 2/7, 9 Put 39569, 2, -6 in descending order. 39569, 2, -6 Sort 2994, 160, -3 in descending order. 2994, 160, -3 Sort 2, 0.1, 2/7, 20, -220 in decreasing order. 20, 2, 2/7, 0.1, -220 Put -2/5, 79766, -2/9, -1 in descending order. 79766, -2/9, -2/5, -1 Put -3/7, -415, 21/5 in descending order. 21/5, -3/7, -415 Put -0.057, 0, -1/8, -1700, 4 in decreasing order. 4, 0, -0.057, -1/8, -1700 Sort -5, 3, 42, -864. -864, -5, 3, 42 Sort 4, -4, 2, 34, -3, 0 in ascending order. -4, -3, 0, 2, 4, 34 Put 0, -0.5, 144 in decreasing order. 144, 0, -0.5 Sort 28, 285, 2/9, -1 in decreasing order. 285, 28, 2/9, -1 Sort 1/6, -0.8, 839, 4. -0.8, 1/6, 4, 839 Sort 80779, -5, 2, -3, 4 in decreasing order. 80779, 4, 2, -3, -5 Sort -33, 18, 4, 5, -1. -33, -1, 4, 5, 18 Put -9/14, -2/3, 1/6, 1/4 in descending order. 1/4, 1/6, -9/14, -2/3 Sort 2/9, 4, -55.63, 1/4 in increasing order. -55.63, 2/9, 1/4, 4 Sort 651, 6/17, 17 in decreasing order. 651, 17, 6/17 Sort 4, -2, -39, 7, 2, 3 in ascending order. -39, -2, 2, 3, 4, 7 Put -1, 65, -12558 in ascending order. -12558, -1, 65 Sort 0, -2, 16, -3, -4 in ascending order. -4, -3, -2, 0, 16 Put 2, -549, -0.3, -2 in ascending order. -549, -2, -0.3, 2 Sort -0.4, 0.5, 0.2, -1/618. -0.4, -1/618, 0.2, 0.5 Put -4, 1, -1353 in decreasing order. 1, -4, -1353 Put 622, -2, -1, 4/5, -41 in decreasing order. 622, 4/5, -1, -2, -41 Sort -14, -2, 12, 1, -3. -14, -3, -2, 1, 12 Sort 3, -4/3, 15, 1/17, 1 in increasing order. -4/3, 1/17, 1, 3, 15 Put 1, -148430, -3 in descending order. 1, -3, -148430 Put -2, 2, 5, 1907 in increasing order. -2, 2, 5, 1907 Put -78, 69, -1/2 in ascending order. -78, -1/2, 69 Sort -5/4, 57/13, 1/5 in descending order. 57/13, 1/5, -5/4 Sort 2, -1/12, 2/41, -2, 4 in decreasing order. 4, 2, 2/41, -1/12, -2 Put 19, 0, 3, -123 in decreasing order. 19, 3, 0, -123 Put 0, 1/4, 0.5, 358/3 in decreasing order. 358/3, 0.5, 1/4, 0 Sort -102, 26, 6 in ascending order. -102, 6, 26 Put 4, -2, -28844, 3 in decreasing order. 4, 3, -2, -28844 Put 3, 85, 50, -6, -4, -3 in ascending order. -6, -4, -3, 3, 50, 85 Put -3, 0, -1, -79 in increasing order. -79, -3, -1, 0 Put 22948, 5, 7 in descending order. 22948, 7, 5 Put 6, -3/20, 5/24 in ascending order. -3/20, 5/24, 6 Sort 48, 4/7, -218, -2 in ascending order. -218, -2, 4/7, 48 Sort -155, 268, 0 in descending order. 268, 0, -155 Put -838, -1, 5, 26, 0.3 in increasing order. -838, -1, 0.3, 5, 26 Sort 0.3, -4, 2/13, 0.4, 1. -4, 2/13, 0.3, 0.4, 1 Put 1595, 10, 0, 5 in decreasing order. 1595, 10, 5, 0 Sort 1/3, 3, -2/13, 5/8, 10.8 in increasing order. -2/13, 1/3, 5/8, 3, 10.8 Sort 0, 2, -78879 in decreasing order. 2, 0, -78879 Sort 3, -2, 11/9, 0.1, 4 in decreasing order. 4, 3, 11/9, 0.1, -2 Sort 0.06, 0.0699, -6 in increasing order. -6, 0.06, 0.0699 Sort -22, 3, 51 in decreasing order. 51, 3, -22 Sort -1, -11, 23, -2, -0.3, 3/44 in decreasing order. 23, 3/44, -0.3, -1, -2, -11 Sort 46, -0.08, -1, 3/5. -1, -0.08, 3/5, 46 Sort -2, 22, 150, 1, 44. -2, 1, 22, 44, 150 Sort -3462, -0.3, 0.21 in ascending order. -3462, -0.3, 0.21 Sort -5, 2, 4/3, -0.116, -0.3, -3 in descending order. 2, 4/3, -0.116, -0.3, -3, -5 Sort -1/377, 0.4, 1/4 in decreasing order. 0.4, 1/4, -1/377 Sort -2520/19, -3, 5, 0.1 in descending order. 5, 0.1, -3, -2520/19 Sort -20, 11, -578 in descending order. 11, -20, -578 Sort -1.6, -4, 0.2, 77, -1/2, 5 in increasing order. -4, -1.6, -1/2, 0.2, 5, 77 Put -1/23, -2, -0.0663 in descending order. -1/23, -0.0663, -2 Sort 0.04301, -2, 2, 6. -2, 0.04301, 2, 6 Put -9086, -4, 5 in decreasing order. 5, -4, -9086 Put 0.1, -0.04, -5838 in decreasing order. 0.1, -0.04, -5838 Put -2, -141, 191, 3 in descending order. 191, 3, -2, -141 Put 0.12, -4, 2/3, -4/43 in ascending order. -4, -4/43, 0.12, 2/3 Sort 0, -0.3, -54, 86 in descending order. 86, 0, -0.3, -54 Sort 0, 14, -168, 2, 1. -168, 0, 1, 2, 14 Put -0.3, 45, 0, 1367 in descending order. 1367, 45, 0, -0.3 Sort -1.1, -3.4, -3/7, 1.4, -5/2. -3.4, -5/2, -1.1, -3/7, 1.4 Put 64742, -1, 3 in ascending order. -1, 3, 64742 Sort 6, 6/7, -1.3, 1.36, 1/4 in decreasing order. 6, 1.36, 6/7, 1/4, -1.3 Put -5, 4, -323, -4 in ascending order. -323, -5, -4, 4 Put -74, -13, -132 in increasing order. -132, -74, -13 Sort 47, 95, -3 in descending order. 95, 47, -3 Sort -2, 3/34, 28, -0.3, 1/6 in increasing order. -2, -0.3, 3/34, 1/6, 28 Put 0.03, 2, -0.3, 3, 4, 16 in ascending order. -0.3, 0.03, 2, 3, 4, 16 Sort 0.0925, -0.4, -4, 4/5 in ascending order. -4, -0.4, 0.0925, 4/5 Sort 0.4, 1/5, 3, 531, -4, 1 in decreasing order. 531, 3, 1, 0.4, 1/5, -4 Sort -0.05, -0.3, -2572, 4 in descending	{ "pile_set_name": "DM Mathematics" }
rivative of -d*4/12 + d. Let r(k) be the second derivative of -271k - 25/6k3 - k2 + 0. What is x(r(f))? -625f*2 - 100f - 4 Let a(k) = 55k2 + 3k - 3. Let x(t) = -108t2 - 4t + 5. Let y(c) = 5a(c) + 3x(c). Let b(r) = -r*2. Calculate b(y(u)). -2401u*4 + 294u*3 - 9u*2 Let u(f) = 6f. Let s(r) = -36 - 51r - 49 - 51 + 124. Calculate s(u(i)). -306i - 12 Let k(v) = 22v + 4. Let u(y) = 22y + 3. Let n(p) = -3k(p) + 4u(p). Let l(s) be the first derivative of 194 + 0s2 + 0s + 2/3s3. What is n(l(o))? 44o*2 Let j(h) be the second derivative of -11h*5/60 + 7h*4/24 + 39h*2 + 74h. Let c(b) be the first derivative of j(b). Let t(y) = -2y2. Give c(t(l)). -44l*4 - 14l*2 Let c(m) = 2m + 122. Let g(k) = 54k2 - 45k - 225. Let y(j) = j*2 - j - 5. Let l(d) = -g(d) + 45y(d). Give c(l(v)). -18v2 + 122 Let g(z) = 5z2. Let s(l) be the third derivative of -l5/2 + l*3/6 - 2142l*2. Calculate s(g(n)). -750n*4 + 1 Let u(w) = -14w. Let z(x) = -3x - 1. Let g(y) = 41y - 21y + 27 - 28y + 83y. Let j(t) = 2g(t) + 54z(t). Calculate j(u(n)). 168n Let g(b) = 7b. Let n(q) = 45 - 6q*2 + 8q*2 - q - 44. Let u(d) = -2d*2 - 3d + 3. Let h(k) = -3n(k) + u(k). Give h(g(t)). -392t*2 Let n(l) = -77l*2 - 70l*2 - 17l*2 + 165l*2. Let s(z) = 6795z*2. Determine n(s(q)). 46172025q*4 Suppose -3p = -a - 3a + 7, 0 = 5a - 5p - 5. Let z(k) = -8k - ak + 19k - 4k. Let v(h) = -3h. Give z(v(i)). -9i Let g(k) = -8345k + 1. Let r(i) be the second derivative of -i*3/3 - 19i - 11. Give g(r(f)). 16690f + 1 Let p(c) be the second derivative of 0c*2 - 10c + 0 - 1/6c3. Let t(i) = i2 + 2. Calculate t(p(w)). w2 + 2 Let q(y) = -27y. Let z = -1542 + 2310. Let j(o) = -zo + 380o + 381o. Calculate j(q(k)). 189k Let z(b) = -170b2 - 2 + 1 + 1 + 169b*2. Let l(q) = -6q + 9q - 10q - 29q. What is z(l(u))? -1296u*2 Let o(a) = -510a + 4. Let i(j) = 568j - 5. Let n(q) = 4i(q) + 5o(q). Let d(g) = -10g*2. Determine d(n(s)). -772840s*2 Let o(x) be the first derivative of 237x*3 - 576. Let a(g) = 2g*2. What is o(a(p))? 2844p*4 Let o(t) = 48074585t. Let n(l) = 6l. Determine n(o(q)). 288447510q Let x(a) = 59a - 44. Let u(l) = -21l + 16. Let f(k) = -11u(k) - 4x(k). Let y(v) = 132v2 + 2v. Determine f(y(j)). -660j2 - 10j Suppose 10 = -6o + 34. Suppose -oq = -2n, -q - 5 = 5n - 27. Let x(g) = -133 - qg - 6g + 133. Let v(f) = 3f. Give x(v(j)). -24j Let p(d) be the first derivative of 9d2 - 2. Let m(j) = 338j. Let r(x) = 16x. Let a(z) = m(z) - 21r(z). What is p(a(o))? 36o Let b = 75 - -11. Let p(m) = b + 9m*2 - 86. Let y(d) = 2d - 3. Let j(r) = -r + 2. Let z(t) = -3j(t) - 2y(t). Calculate p(z(u)). 9u2 Let q(w) = w. Suppose -5n - x + 30 = 0, -7n - x + 23 = -3n. Let r be 17/(3(-3)/(-9)). Let p(o) = -17 + r - no + o. Give p(q(h)). -6h Let n(u) = 10u. Let j(b) = -4468679b - 2. Determine n(j(i)). -44686790i - 20 Let m(h) = -13h. Let j(c) = c + 38. Let x(v) = -192v + 74. Let p(r) = -2j(r) + x(r). Give m(p(q)). 2522q + 26 Let m(t) = -28t2. Let p(v) be the first derivative of v5/60 + 37v*3 + 3. Let r(q) be the third derivative of p(q). What is r(m(i))? -56i*2 Let h(m) = -27 + 49 - 22 + 2m + 3m. Let d(l) = 26 - 53 + 27 + l2. What is h(d(o))? 5o*2 Let l(m) = -27m + 1. Let c(o) be the third derivative of -11o5/12 + 1720o*2. Calculate c(l(p)). -40095p*2 + 2970p - 55 Let j(c) = 34c2. Let k(x) = 12x + 55. Let n(s) = 11s + 84. Let u(w) = -3k(w) + 2n(w). Calculate j(u(o)). 6664o*2 - 2856o + 306 Let z(o) = 9o - 49o - 10 - 10o + 8o - 45o. Let s(p) = -p. Determine s(z(g)). 87g + 10 Let p(j) = -11j. Let u(t) be the first derivative of -299t*2/2 - 1533. Calculate p(u(v)). 3289v Let z(v) = 8v2 + 12v. Let j(g) = -57299511g + 57299511g + 19g2. What is z(j(n))? 2888n*4 + 228n*2 Let p(h) = -5h*2 - 2h + 6. Let u(v) = -32v2 - 13v + 39. Let y(z) = 39p(z) - 6u(z). Let w(x) = 403x2. Give y(w(b)). -487227b*4 Let u(z) = -3z + 2z + 0z + 0z. Let c(h) = 4 + 10295h - 10344h - 4. Calculate u(c(f)). 49f Suppose 4x - 1295 = -155. Suppose -5a = -35 - x. Let f(h) = -117 + a + 53 + 8h2. Let o(j) = j. Give f(o(g)). 8g*2 Let w(h) = -2h + 39901. Let f(u) = 3u. What is f(w(m))? -6m + 119703 Let l(a) = 11690a - 42. Let f(w) = w. Determine l(f(c)). 11690c - 42 Let r(k) = 8k2 + 17. Let a(x) = 6x + 384. Let m(b) = -b - 40. Let g(i) = -5a(i) - 48m(i). Calculate g(r(t)). 144t2 + 306 Let b(m) be the third derivative of 0m + 81m2 + 0m*3 + 13/30m*5 + 0 + 0m*4. Let u(g) = -3g*2. Determine u(b(n)). -2028n*4 Let f(p) = -9p*2 + 66p + 247. Let h(y) = -13y2. Give f(h(u)). -1521u*4 - 858u*2 + 247 Let h(d) = -3016d. Let y(s) = -244s + 2. Determine y(h(b)). 735904b + 2 Let f(h) = 37h2 + 20. Let z(q) = 19q*2 + 9. Let y(b) = 3f(b) - 7z(b). Let g(c) = c - 2. Let r(o) = -o + 1. Let d(v) = g(v) + 2r(v). What is y(d(j))? -22j2 - 3 Let i(k) = k + 49. Let n(d) be the third derivative of d5/12 - 2d*2 - 1174d. Calculate n(i(g)). 5g2 + 490g + 12005 Let o(b) = -28b2. Let y(f) = -326362f*2. Calculate y(o(t)). -255867808t*4 Let t(y) = 199y. Let z(h) = -6h2 + 28h*2 - 8h*2 - 9h*2 + 0h*2. Give t(z(x)). 995x*2 Let q(z) = -2z*2. Let o(m) = -2m - 12. Let y be (14/(-3))/((-22)/(-33)). Let d be o(y). Let t(b) = -db + 2b - 3b - 17b. What is t(q(p))? 40p2 Let g(h) = 566h*2. Let q(u) = 3808u. Determine g(q(v)). 8207489024v2 Let m(t) = 2t. Let p(s) = -2s - 130745. What is p(m(f))? -4f - 130745 Let o(t) = 277t2. Let d(n) = 36n - 14. Let g(j) = 42j - 16. Let c(q) = 8d(q) - 7g(q). Determine o(c(i)). 9972i*2 Let v(o) = -8o. Let z(g) be the second derivative of -3/4g4 + 0g*2 + 2 + 0g*3 - 51g. Give v(z(u)). 72u2 Let w(c) = 9c - 65. Let g(h) = 10h2. Let a(v) = 7v*2. Let q(s) = -4a(s) + 3g(s). Give q(w(m)). 162m*2 - 2340m + 8450 Let v(d) = 11d. Let g(r) = -4348177r*2. Give v(g(j)). -47829947j2 Let x(i) be the third derivative of -i4/12 + 3i2 - i + 3. Let l(v) = -64v - 1. Calculate x(l(a)). 128a + 2 Let m(v) = -137v*2 - 140v*2 - 140v*2 + 691v*2 - 135v*2 - 126v*2. Let y(p) be the second derivative of -1/6p*3 + 0p*2 + p + 0. Give y(m(x)). -13x*2 Let u(k) = k. Let c(h) be the second derivative of -7h*3/6 + 35h*2 + 109h + 2. Calculate c(u(s)). -7s + 70 Let w(g) = 6g*2 + 34 - 11 - 23. Suppose -5b + 10 = -5d, 5d + 4b = -0b + 35. Let z(u) = 9u2 - 5u*2 - du*2. Determine z(w(m)). 36m*4 Let l(z) = -4z. Let v(h) be the third derivative of 0h3 + 1 - 12h*2 + 0h*4 - 43/60h*5 + 0h. Determine l(v(x)). 172x2 Let s(w) = -23w + 2. Let j(c) = -166c2 - c + 13. What is s(j(u))? 3818u*2 + 23u - 297 Let t(l) = -2625l. Let j(h) be the third derivative of h5/15 + 733h*2 + 5h. Determine t(j(w)). -10500w2 Let w(j) = 37j - 9. Let k(p) = 9p - 2. Let x(u) = 9k(u) - 2w(u). Let o(z) = -12z. Let i(q) = 3o(q) + 5x(q). Let t(m) = 48m. Determine t(i(h)). -48h Let h(x) = -26x2 - 26x*2 - 56x2. Let n(u) be the first derivative of -u3/3 - 11443. Give h(n(a)). -108a4 Let j(z) be the second derivative of -7z*3/6 + 93z + 5. Let l(g) = 10g - 17g + 7g + 13g*2. What is l(j(f))? 637f*2 Let t(v) = 7v + 65. Let n(m) = -481180 + 481180 + m*2. Determine n(t(c)). 49c*2 + 910c + 4225 Let u(k) = 42 + 8k - 79 + 37 - 14k. Let z(s) = -7s - 47. Give z(u(i)). 42i - 47 Let o(f) = -120f. Suppose -3x - x + 472 = 0. Let a(g) = 61g + 59g - xg. Determine a(o(w)). -240w Let j(f) = -3589f2 + 14745. Let w(o) = -2o*2. Determine j(w(u)). -14356u*4 + 14745 Let k(d) be the third derivative of -3961d*5/15 - 3948d*2. Let h(b) = 2b*2. Determine h(k(a)). 502064672a*4 Let r(n) be the second derivative of 59/3n*3 + 0n*2 - 2n + 169. Let p(m) = 3m. What is r(p(t))? 354t Let p(h) = 3h. Let v(y) = 2y. Let s(j) = -4p(j) + 5v(j). Let c(z) = -72z2 + 125z*2 + 123z*2 + 75z*2 + 96z*2. Determine c(s(b)). 1388b*2 Let g(r) = 535r. Let z(f) = 10804f. What is z(g(a))? 5780140a Let w(h) = -8h2. Let g(l) = -533721l. What is w(g(v))? -227886	{ "pile_set_name": "DM Mathematics" }
e factors of 78874130? 2, 5, 19, 23, 18049 List the prime factors of 23954998. 2, 137, 87427 List the prime factors of 3070590064. 2, 29, 139, 47609 What are the prime factors of 4237457267? 4237457267 What are the prime factors of 59013154? 2, 17, 1735681 What are the prime factors of 574243828? 2, 109, 157, 8389 What are the prime factors of 2425950005? 5, 485190001 List the prime factors of 906652545. 3, 5, 19, 3181237 List the prime factors of 3921111198. 2, 3, 31, 191, 36791 List the prime factors of 52644201. 3, 17548067 What are the prime factors of 9013676473? 9013676473 List the prime factors of 1318055390. 2, 5, 17, 887, 8741 List the prime factors of 104401570. 2, 5, 7, 13, 47, 2441 What are the prime factors of 960359852? 2, 17, 14122939 What are the prime factors of 31392224? 2, 41, 71, 337 What are the prime factors of 1826037602? 2, 913018801 What are the prime factors of 331199931? 3, 23, 4799999 List the prime factors of 280306722. 2, 3, 71, 619, 1063 What are the prime factors of 1206958947? 3, 402319649 What are the prime factors of 209976518? 2, 61, 1297, 1327 List the prime factors of 2273703127. 53, 42900059 What are the prime factors of 21631026? 2, 3, 41, 87931 What are the prime factors of 153634139? 153634139 What are the prime factors of 803658047? 1979, 406093 List the prime factors of 65172622. 2, 19, 821, 2089 What are the prime factors of 374948878? 2, 73, 269, 9547 List the prime factors of 32769225. 3, 5, 43, 1129 List the prime factors of 415998833. 41, 47, 61, 3539 What are the prime factors of 138475248? 2, 3, 2884901 What are the prime factors of 19086? 2, 3, 3181 List the prime factors of 350406115. 5, 109, 642947 List the prime factors of 361544460. 2, 3, 5, 6025741 List the prime factors of 1147977212. 2, 1579, 181757 List the prime factors of 116387584. 2, 43, 97, 109 What are the prime factors of 48274902? 2, 3, 13, 206303 List the prime factors of 67457995. 5, 11, 89, 13781 List the prime factors of 1821295702. 2, 43, 21177857 What are the prime factors of 156891860? 2, 5, 7844593 List the prime factors of 1011050431. 1223, 826697 List the prime factors of 6413174602. 2, 3206587301 What are the prime factors of 6643841313? 3, 1511, 1465661 What are the prime factors of 3425775399? 3, 8753, 43487 What are the prime factors of 119630431? 119630431 What are the prime factors of 150996446? 2, 29, 727, 3581 List the prime factors of 236847947. 7, 719, 47059 What are the prime factors of 429329705? 5, 7, 677, 18119 List the prime factors of 326160345. 3, 5, 7, 787, 3947 List the prime factors of 131106603. 3, 1433, 30497 What are the prime factors of 271334847? 3, 7, 31, 416797 What are the prime factors of 791202965? 5, 7, 313, 72223 List the prime factors of 353810093. 7, 13, 3888023 List the prime factors of 7461237908. 2, 19, 7177, 13679 What are the prime factors of 46773130? 2, 5, 4677313 List the prime factors of 4378868273. 13, 1129, 298349 What are the prime factors of 1078852139? 97, 11122187 List the prime factors of 852530786. 2, 7621, 55933 What are the prime factors of 37571664? 2, 3, 13, 19, 3169 What are the prime factors of 6036187290? 2, 3, 5, 7, 61, 471209 List the prime factors of 33131932. 2, 31, 267193 List the prime factors of 125505988. 2, 31376497 List the prime factors of 1360753611. 3, 7, 64797791 What are the prime factors of 44137294? 2, 22068647 List the prime factors of 228789626. 2, 13, 8799601 List the prime factors of 472647013. 43, 10991791 What are the prime factors of 3880596141? 3, 143725783 What are the prime factors of 648514481? 107, 911, 6653 What are the prime factors of 44799341? 37, 1210793 What are the prime factors of 118021947? 3, 23, 73, 23431 List the prime factors of 2948845275. 3, 5, 13105979 What are the prime factors of 3774356963? 13, 290335151 List the prime factors of 2941749929. 31, 94895159 List the prime factors of 51408182. 2, 7, 3672013 List the prime factors of 5074889697. 3, 37, 359, 42451 What are the prime factors of 161456679? 3, 229, 26113 What are the prime factors of 37669843? 37669843 List the prime factors of 49103374. 2, 24551687 What are the prime factors of 251258752? 2, 1962959 What are the prime factors of 353650271? 13, 4217, 6451 What are the prime factors of 2278758765? 3, 5, 151917251 What are the prime factors of 3564925315? 5, 7, 101855009 What are the prime factors of 5332247999? 13, 17, 24127819 List the prime factors of 80533948. 2, 11, 23, 79579 List the prime factors of 21001583. 1879, 11177 What are the prime factors of 59824607? 59824607 List the prime factors of 54854103. 3, 23, 71, 11197 What are the prime factors of 152058390? 2, 3, 5, 11, 197, 2339 List the prime factors of 74002121. 74002121 List the prime factors of 36441399. 3, 31, 83, 4721 List the prime factors of 1547021442. 2, 3, 257836907 What are the prime factors of 84324186? 2, 3, 1561559 List the prime factors of 31120177. 11, 2829107 What are the prime factors of 21872555? 5, 4374511 List the prime factors of 3412723054. 2, 13, 79, 271, 6131 What are the prime factors of 694767954? 2, 3, 115794659 List the prime factors of 494338675. 5, 19, 97, 10729 List the prime factors of 155807099. 7, 1063, 20939 What are the prime factors of 2290040850? 2, 3, 5, 15266939 List the prime factors of 1702484548. 2, 1283, 331739 List the prime factors of 37465864. 2, 67, 69899 What are the prime factors of 643811793? 3, 214603931 What are the prime factors of 625873159? 41, 149, 102451 List the prime factors of 1821929465. 5, 401, 569, 1597 What are the prime factors of 31585533? 3, 7, 1504073 What are the prime factors of 1960375484? 2, 490093871 What are the prime factors of 41906686? 2, 743, 28201 List the prime factors of 121371825. 3, 5, 1618291 List the prime factors of 1071209110. 2, 5, 269, 398219 List the prime factors of 17673683. 23, 307, 2503 List the prime factors of 6038917656. 2, 3, 251621569 What are the prime factors of 70108904? 2, 8763613 What are the prime factors of 101549377? 9887, 10271 What are the prime factors of 166687020? 2, 3, 5, 131, 7069 What are the prime factors of 20518026? 2, 3, 1063, 3217 List the prime factors of 923806060. 2, 5, 2207, 20929 What are the prime factors of 745995554? 2, 37, 67, 379, 397 List the prime factors of 14947280. 2, 5, 186841 List the prime factors of 1561982793. 3, 7, 359, 207187 What are the prime factors of 761776597? 41, 193, 96269 List the prime factors of 1855663531. 25747, 72073 List the prime factors of 1091274239. 11, 239, 443, 937 What are the prime factors of 422735184? 2, 3, 839, 3499 List the prime factors of 48795091. 229, 213079 List the prime factors of 107462040. 2, 3, 5, 7, 127931 What are the prime factors of 957956899? 37, 233, 111119 What are the prime factors of 219630333? 3, 13, 193, 29179 List the prime factors of 1347398872. 2, 179, 940921 What are the prime factors of 53944375? 5, 86311 List the prime factors of 492502943. 492502943 List the prime factors of 430380980. 2, 5, 43, 500443 List the prime factors of 2245485583. 11, 47, 4343299 List the prime factors of 627236480. 2, 5, 13, 75389 List the prime factors of 7447800. 2, 3, 5, 12413 What are the prime factors of 207495156? 2, 3, 11, 142903 List the prime factors of 1603368802. 2, 7, 114526343 What are the prime factors of 139644972? 2, 3, 293, 1471 List the prime factors of 2480673242. 2, 919, 983, 1373 List the prime factors of 3558998909. 17, 23, 401, 22699 List the prime factors of 865184385. 3, 5, 13, 1753, 2531 List the prime factors of 7968234. 2, 3, 127, 10457 List the prime factors of 25652464. 2, 1603279 List the prime factors of 3649183716. 2, 3, 181, 1680103 List the prime factors of 1662656183. 24071, 69073 What are the prime factors of 2060506691? 71, 29021221 What are the prime factors of 337847069? 7, 17, 23, 53, 137 List the prime factors of 13126601. 17, 37, 41, 509 List the prime factors of 1607247093. 3, 61, 71, 123701 What are the prime factors of 784473627? 3, 7, 23, 1624169 What are the prime factors of 110050626? 2, 3, 7, 2620253 What are the prime factors of 156683770? 2, 5, 15668377 What are the prime factors of 75317395? 5, 17, 331, 2677 What are the prime factors of 108698470? 2, 5, 79, 137593	{ "pile_set_name": "DM Mathematics" }
j in -6j5/5 + 34j*4/5 - 10j*3 - 2j*2 + 56j/5 - 24/5 = 0? -1, 2/3, 1, 2, 3 Determine o, given that 3o2 - 5o/3 = 0. 0, 5/9 Determine h so that -2h2 + 16h - 32 = 0. 4 Factor 3g3 - 7050g*2 + 28164g - 28152. 3(g - 2346)(g - 2)*2 Let -3u*3/5 - 1068u*2/5 - 19635u - 110250 = 0. What is u? -175, -6 Let -t*2/7 - 314t/7 + 951/7 = 0. What is t? -317, 3 Factor 196d4/5 - 56d*3 - 12d*2/5 + 16d + 16/5. 4(d - 1)2(7d + 2)2/5 Find l such that l3/5 - 9l*2/5 - 76l/5 + 84/5 = 0. -6, 1, 14 Determine k so that k*5 - 13k*4 + 55k*3 - 103k*2 + 88k - 28 = 0. 1, 2, 7 Factor 44f3 + 520f*2 + 1488f - 288. 4(f + 6)2(11f - 2) Find w such that 3w*2/4 - 33w/4 - 39/2 = 0. -2, 13 Suppose -2c4/7 + 6c*2/7 - 4c/7 = 0. What is c? -2, 0, 1 Let 3b3/7 - 201b*2/7 - 624b/7 - 60 = 0. Calculate b. -2, -1, 70 Let -3v5/2 + 55v*4/2 + 47v*3/2 - 159v*2/2 - 112v - 38 = 0. Calculate v. -1, -2/3, 2, 19 Let 16s2 + 12s = 0. Calculate s. -3/4, 0 Determine f, given that -4f2 + 544f - 1596 = 0. 3, 133 Factor 2i5 - 2i*4 - 34i*3 + 42i*2 + 72i. 2i(i - 3)*2(i + 1)(i + 4) Factor -2q*5/9 + 1342q*4/9 - 225790q*3/9 + 224450q*2/9. -2q*2(q - 335)*2(q - 1)/9 Let u*3/2 + 109u*2/2 = 0. What is u? -109, 0 Determine n, given that -12n*4/5 + 2356n*3/5 + 316n*2 - 788n/5 = 0. -1, 0, 1/3, 197 Determine p so that p*5 + 16p*4 + 35p*3 - 64p*2 - 156p = 0. -13, -3, -2, 0, 2 Factor 4p2 - 10472p/3 - 13984/3. 4(p - 874)(3p + 4)/3 What is b in 2b*3/9 + 22b*2 + 388b/9 = 0? -97, -2, 0 What is u in -4u5 + 12u*4 + 24u*3 - 32u*2 = 0? -2, 0, 1, 4 Find n, given that -14n*5 + 220n*4 - 1028n*3 + 1256n*2 - 238n - 196 = 0. -2/7, 1, 7 Factor 2r3/7 - 64r*2/7 + 122r/7 - 60/7. 2(r - 30)(r - 1)2/7 Factor -w3 + 15w2 + 16w. -w(w - 16)(w + 1) Factor -3j3/5 + 29808j*2/5 - 98724096j/5 + 108991401984/5. -3(j - 3312)3/5 Suppose -867c*5/4 + 53091c*4/4 - 791889c*3/4 - 649059c*2/4 + 46314c - 2883 = 0. What is c? -1, 2/17, 31 Solve 2c4/21 + 38c*3/21 + 184c*2/21 + 160c/21 - 128/7 = 0. -12, -4, 1 Suppose -2v4/5 + 101v*3/5 + 31v*2 + 52v/5 = 0. Calculate v. -1, -1/2, 0, 52 Find p such that 3p4/4 + 669p*3/4 + 19143p*2/2 + 27555p + 18150 = 0. -110, -2, -1 Suppose 2c4 - 92c*3 + 90c2 = 0. What is c? 0, 1, 45 Find p such that -p3/4 + 15p2/4 - 17p + 21 = 0. 2, 6, 7 What is b in 5b4/3 + 11b3/3 + b2 - 7b/3 - 4/3 = 0? -1, 4/5 Determine r, given that -3r*2 - 3492r - 1016172 = 0. -582 Factor -36j3 - 1968j*2 - 17920j - 45056. -4(j + 44)(3j + 16)2 Factor 2i*2/11 + 652i/11. 2i(i + 326)/11 Let -118u2/5 + 124u/5 - 6/5 = 0. Calculate u. 3/59, 1 Factor 4t2 + 3680t + 846400. 4(t + 460)2 Suppose m3/7 + 37m*2/7 + 166m/7 + 192/7 = 0. Calculate m. -32, -3, -2 Factor 3k2 - 180k - 768. 3(k - 64)(k + 4) Let g*4/4 - 23g*3/4 - 87g*2/4 + 239g/4 - 65/2 = 0. Calculate g. -5, 1, 26 Solve 5h5/6 + 20h*4 + 415h*3/3 + 220h*2 + 605h/6 = 0. -11, -1, 0 Suppose -4l5 + 56l*4 - 168l*3 - 416l*2 + 1708l - 1176 = 0. Calculate l. -3, 1, 2, 7 Factor -r*3/2 - 349r*2 - 2779r/2 - 1041. -(r + 1)(r + 3)(r + 694)/2 Let -2h3/5 + 4h*2/5 + 6h/5 = 0. Calculate h. -1, 0, 3 Factor -h*3 - 85h*2 - 394h + 480. -(h - 1)(h + 6)(h + 80) Factor 3x2/2 + 153x/8 + 27/2. 3(x + 12)(4x + 3)/8 Factor -5i*4 + 300i*3 - 2430i*2 + 7020i - 6885. -5(i - 51)(i - 3)*3 Solve -2w*4/7 + 138w*3/7 - 262w*2/7 - 402w/7 = 0. -1, 0, 3, 67 Suppose 25f3/2 - 23f*2/2 - 26f - 2 = 0. What is f? -1, -2/25, 2 Factor 2q3 - 354q*2 + 5886q - 25758. 2(q - 159)(q - 9)2 Factor a4/5 + a3/5. a3(a + 1)/5 Factor 14v*4/9 - 4840v*3/9 - 1384v*2/9. 2v*2(v - 346)(7v + 2)/9 Let 8j3 + 49j*2 + 70j + 8 = 0. What is j? -4, -2, -1/8 Find w such that -50w4 + 30w*3 + 56w*2 - 24w = 0. -1, 0, 2/5, 6/5 Factor -5c3 + 85c*2 - 260c. -5c(c - 13)(c - 4) Factor -l5 + 2l*4 + 11l*3 - 12l*2 - 36l. -l(l - 3)2(l + 2)2 Factor -q3/4 - 33q2/4 - 123q/2 - 92. -(q + 2)(q + 8)(q + 23)/4 Factor -2w2/19 - 244w/19 - 7442/19. -2(w + 61)2/19 Find w, given that -3w*4/4 + 513w*3/8 + 273w*2/8 - 162w + 129/2 = 0. -2, 1/2, 1, 86 Let -10v2/7 - 46v/7 + 20/7 = 0. What is v? -5, 2/5 What is b in -2b3 + 44b*2/5 + 434b/5 - 36 = 0? -5, 2/5, 9 Factor b*4/5 + 21b*3/5 + 25b*2 + 291b/5 + 234/5. (b + 2)(b + 3)2(b + 13)/5 Suppose -18s3 - 129s*2 + 1059s + 180 = 0. What is s? -12, -1/6, 5 Determine j, given that -4j3 + 128j*2 - 916j + 792 = 0. 1, 9, 22 Suppose h*2/5 - 249h/5 - 1012/5 = 0. Calculate h. -4, 253 Factor -4s2/3 + 1528s/3 - 3040/3. -4(s - 380)(s - 2)/3 Solve -c*2 - 19c + 66 = 0 for c. -22, 3 Factor -2l5/3 - 20l*4/9 - 20l*3/9 + 10l/9 + 4/9. -2(l + 1)4(3l - 2)/9 Factor 5x*2 + 390x. 5x(x + 78) Factor s*5/7 - 8s*4/7 + 6s*3/7 + 8s*2/7 - s. s(s - 7)(s - 1)2(s + 1)/7 Determine f so that 64f4 - 32f*3 - 156f*2 - 68f - 8 = 0. -1, -1/4, 2 Factor 4x2/5 - 64x/5 - 144/5. 4(x - 18)(x + 2)/5 Determine p, given that 2p3 - 400p*2/11 - 808p/11 + 160/11 = 0. -2, 2/11, 20 Let -3h4 + 6h*3 - 3h*2 = 0. What is h? 0, 1 Find a such that -4a*5 - 8a*4 + 8a*2 + 4a = 0. -1, 0, 1 Factor j*2/6 - 5j/6. j(j - 5)/6 Find t, given that 5t*2/3 + 2315t/3 - 1550 = 0. -465, 2 Factor -2p3 - 528p*2 - 36864p - 262144. -2(p + 8)(p + 128)2 Factor -h4/12 + 7h3/6 - 3h*2 + 17h/6 - 11/12. -(h - 11)(h - 1)3/12 Factor 3i*5/4 - 315i*4/4 + 78i*3. 3i*3(i - 104)(i - 1)/4 Determine u so that 20u*4/11 - 186u*3/11 - 146u*2/11 + 60u/11 = 0. -1, 0, 3/10, 10 Solve 68u3 - 72u*2 + 21u - 1 = 0. 1/17, 1/2 Factor x*2/5 - 11x + 156/5. (x - 52)(x - 3)/5 Determine l so that -206045l*2/4 + 19285l/2 - 1805/4 = 0. 19/203 Factor -5i3/9 + 7i*2/3 - 10i/9 - 8/3. -(i - 3)(i - 2)(5i + 4)/9 Factor -2s*2/5 - 132s - 10890. -2(s + 165)2/5 Factor -2n*3/5 + 42n*2/5 - 196n/5. -2n(n - 14)(n - 7)/5 Solve -122h*3/9 + 484h*2/9 - 472h/9 - 16/9 = 0 for h. -2/61, 2 Determine f, given that -4f3 + 12f + 8 = 0. -1, 2 Factor -73m3/2 - 3m*2 + 146m + 12. -(m - 2)(m + 2)(73m + 6)/2 Solve 722j*2 + 2128j + 1568 = 0 for j. -28/19 Let -6k3/5 + 18k*2 - 288k/5 - 384/5 = 0. Calculate k. -1, 8 Suppose u3/8 - u2/2 = 0. What is u? 0, 4 Factor -3a3 - 159a*2 + 327a - 165. -3(a - 1)2(a + 55) Factor y*4 + 14y*3 + 37y*2 - 48y - 180. (y - 2)(y + 3)2(y + 10) Suppose 7b5/3 + 289b*4/3 + 207b*3 - 133b*2/3 - 628b/3 - 52 = 0. Calculate b. -39, -2, -1, -2/7, 1 Let 4d3 + 856d*2 + 45796d = 0. What is d? -107, 0 Find h, given that 5h5 + 10h*4 - 35h*3 - 40h*2 + 60h = 0. -3, -2, 0, 1, 2 Factor 3v4 - 126v*3 + 1320v*2 + 126v - 1323. 3(v - 21)2(v - 1)(v + 1) Factor z3/3 + 1463z*2/3 + 178120z - 178608. (z - 1)(z + 732)2/3 Solve -4b*3 - 588b*2 + 3016b - 3648 = 0 for b. -152, 2, 3 Solve 66o2 - 62o - 4 = 0 for o. -2/33, 1 Factor -2a2/5 + 72a + 362/5. -2(a - 181)(a + 1)/5 Solve 4s3 - 44s*2 + 136s - 96 = 0. 1, 4, 6 Factor 6k3/5 - 6k*2/5 - 24k. 6k(k - 5)(k + 4)/5 Solve -n4/2 + 3n*3 + 78n*2 + 253n + 357/2 = 0. -7, -3, -1, 17 Factor 3c3/7 + 1686c*2/7 - 5097c/7 - 6780/7. 3(c - 4)(c + 1)(c + 565)/7 Solve 2l*5/7 - 1268l*4/7 + 198426l*3/7 + 808984l*2/7 + 814088l/7 = 0 for l. -2, 0, 319 Let -3c2 - 39c - 108 = 0. What is c? -9, -4 Let -3w2/4 + 309w - 31827 = 0. What is w? 206 Factor -a*4/4 + 15a*3/2 + 167a*2/4 + 69a + 35. -(a - 35)(a + 1)(a + 2)*2/4 Let -3a*3 + 2247a*2 = 0. What is a? 0, 749 Factor 4a*4 - 240a*3 + 1132a*2 - 1776a + 880. 4(a - 55)(a - 2)*2(a - 1) Factor -4r2/9 + 164r/9. -4r(r - 41)/9 Factor -4l4 - 16l*3 + 12l*2 + 40l - 32. -4(l - 1)2(l + 2)(l + 4) Suppose p5/4 - 16p*4 - 171p*3/2 - 54p*2 + 621p/4 = 0. What is p? -3, 0, 1, 69 What is z in 5z3 + 45z*2 - 485z - 525 = 0? -15, -1, 7 Factor 2y4/7 - 136y*3/7 - 60y*2 - 424y/7 - 142/7. 2(y - 71)(y + 1)*3/7 Determine i so that -5i	{ "pile_set_name": "DM Mathematics" }