|
--- |
|
license: bigscience-openrail-m |
|
widget: |
|
- text: O=C([C@@H](c1ccc(cc1)O)N)[MASK][C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C |
|
datasets: |
|
- ChEMBL |
|
pipeline_tag: fill-mask |
|
tags: |
|
- biology |
|
- medical |
|
--- |
|
|
|
# BERT base for SMILES |
|
This is bidirectional transformer pretrained on SMILES (simplified molecular-input line-entry system) strings. |
|
|
|
Example: Amoxicillin |
|
``` |
|
O=C([C@@H](c1ccc(cc1)O)N)N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C |
|
``` |
|
|
|
Two training objectives were used: |
|
1. masked language modeling |
|
2. molecular-formula validity prediction |
|
|
|
## Intended uses |
|
This model is primarily aimed at being fine-tuned on the following tasks: |
|
- molecule classification |
|
- molecule-to-gene-expression mapping |
|
- cell targeting |
|
|
|
## How to use in your code |
|
```python |
|
from transformers import BertTokenizerFast, BertModel |
|
checkpoint = 'unikei/bert-base-smiles' |
|
tokenizer = BertTokenizerFast.from_pretrained(checkpoint) |
|
model = BertModel.from_pretrained(checkpoint) |
|
|
|
example = 'O=C([C@@H](c1ccc(cc1)O)N)N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C' |
|
tokens = tokenizer(example, return_tensors='pt') |
|
predictions = model(**tokens) |
|
``` |