repo_name
stringlengths 6
100
| path
stringlengths 4
294
| copies
stringclasses 981
values | size
stringlengths 4
6
| content
stringlengths 606
896k
| license
stringclasses 15
values |
|---|---|---|---|---|---|
synergeticsedx/deployment-wipro | common/lib/xmodule/xmodule/modulestore/split_mongo/caching_descriptor_system.py | 32 | 16966 | import sys
import logging
from contracts import contract, new_contract
from fs.osfs import OSFS
from lazy import lazy
from xblock.runtime import KvsFieldData, KeyValueStore
from xblock.fields import ScopeIds
from xblock.core import XBlock
from opaque_keys.edx.locator import BlockUsageLocator, LocalId, CourseLocator, LibraryLocator, DefinitionLocator
from xmodule.library_tools import LibraryToolsService
from xmodule.mako_module import MakoDescriptorSystem
from xmodule.error_module import ErrorDescriptor
from xmodule.errortracker import exc_info_to_str
from xmodule.modulestore import BlockData
from xmodule.modulestore.edit_info import EditInfoRuntimeMixin
from xmodule.modulestore.exceptions import ItemNotFoundError
from xmodule.modulestore.inheritance import inheriting_field_data, InheritanceMixin
from xmodule.modulestore.split_mongo import BlockKey, CourseEnvelope
from xmodule.modulestore.split_mongo.id_manager import SplitMongoIdManager
from xmodule.modulestore.split_mongo.definition_lazy_loader import DefinitionLazyLoader
from xmodule.modulestore.split_mongo.split_mongo_kvs import SplitMongoKVS
from xmodule.x_module import XModuleMixin
log = logging.getLogger(__name__)
new_contract('BlockUsageLocator', BlockUsageLocator)
new_contract('CourseLocator', CourseLocator)
new_contract('LibraryLocator', LibraryLocator)
new_contract('BlockKey', BlockKey)
new_contract('BlockData', BlockData)
new_contract('CourseEnvelope', CourseEnvelope)
new_contract('XBlock', XBlock)
class CachingDescriptorSystem(MakoDescriptorSystem, EditInfoRuntimeMixin):
"""
A system that has a cache of a course version's json that it will use to load modules
from, with a backup of calling to the underlying modulestore for more data.
Computes the settings (nee 'metadata') inheritance upon creation.
"""
@contract(course_entry=CourseEnvelope)
def __init__(self, modulestore, course_entry, default_class, module_data, lazy, **kwargs):
"""
Computes the settings inheritance and sets up the cache.
modulestore: the module store that can be used to retrieve additional
modules
course_entry: the originally fetched enveloped course_structure w/ branch and course id info.
Callers to _load_item provide an override but that function ignores the provided structure and
only looks at the branch and course id
module_data: a dict mapping Location -> json that was cached from the
underlying modulestore
"""
# needed by capa_problem (as runtime.filestore via this.resources_fs)
if course_entry.course_key.course:
root = modulestore.fs_root / course_entry.course_key.org / course_entry.course_key.course / course_entry.course_key.run
else:
root = modulestore.fs_root / str(course_entry.structure['_id'])
root.makedirs_p() # create directory if it doesn't exist
id_manager = SplitMongoIdManager(self)
kwargs.setdefault('id_reader', id_manager)
kwargs.setdefault('id_generator', id_manager)
super(CachingDescriptorSystem, self).__init__(
field_data=None,
load_item=self._load_item,
resources_fs=OSFS(root),
**kwargs
)
self.modulestore = modulestore
self.course_entry = course_entry
# set course_id attribute to avoid problems with subsystems that expect
# it here. (grading, for example)
self.course_id = course_entry.course_key
self.lazy = lazy
self.module_data = module_data
self.default_class = default_class
self.local_modules = {}
self._services['library_tools'] = LibraryToolsService(modulestore)
@lazy
@contract(returns="dict(BlockKey: BlockKey)")
def _parent_map(self):
parent_map = {}
for block_key, block in self.course_entry.structure['blocks'].iteritems():
for child in block.fields.get('children', []):
parent_map[child] = block_key
return parent_map
@contract(usage_key="BlockUsageLocator | BlockKey", course_entry_override="CourseEnvelope | None")
def _load_item(self, usage_key, course_entry_override=None, **kwargs):
"""
Instantiate the xblock fetching it either from the cache or from the structure
:param course_entry_override: the course_info with the course_key to use (defaults to cached)
"""
# usage_key is either a UsageKey or just the block_key. if a usage_key,
if isinstance(usage_key, BlockUsageLocator):
# trust the passed in key to know the caller's expectations of which fields are filled in.
# particularly useful for strip_keys so may go away when we're version aware
course_key = usage_key.course_key
if isinstance(usage_key.block_id, LocalId):
try:
return self.local_modules[usage_key]
except KeyError:
raise ItemNotFoundError
else:
block_key = BlockKey.from_usage_key(usage_key)
version_guid = self.course_entry.course_key.version_guid
else:
block_key = usage_key
course_info = course_entry_override or self.course_entry
course_key = course_info.course_key
version_guid = course_key.version_guid
# look in cache
cached_module = self.modulestore.get_cached_block(course_key, version_guid, block_key)
if cached_module:
return cached_module
block_data = self.get_module_data(block_key, course_key)
class_ = self.load_block_type(block_data.block_type)
block = self.xblock_from_json(class_, course_key, block_key, block_data, course_entry_override, **kwargs)
# TODO Once TNL-5092 is implemented, we can expose the course version
# information within the key identifier of the block. Until then, set
# the course_version as a field on the returned block so higher layers
# can use it when needed.
block.course_version = version_guid
self.modulestore.cache_block(course_key, version_guid, block_key, block)
return block
@contract(block_key=BlockKey, course_key="CourseLocator | LibraryLocator")
def get_module_data(self, block_key, course_key):
"""
Get block from module_data adding it to module_data if it's not already there but is in the structure
Raises:
ItemNotFoundError if block is not in the structure
"""
json_data = self.module_data.get(block_key)
if json_data is None:
# deeper than initial descendant fetch or doesn't exist
self.modulestore.cache_items(self, [block_key], course_key, lazy=self.lazy)
json_data = self.module_data.get(block_key)
if json_data is None:
raise ItemNotFoundError(block_key)
return json_data
# xblock's runtime does not always pass enough contextual information to figure out
# which named container (course x branch) or which parent is requesting an item. Because split allows
# a many:1 mapping from named containers to structures and because item's identities encode
# context as well as unique identity, this function must sometimes infer whether the access is
# within an unspecified named container. In most cases, course_entry_override will give the
# explicit context; however, runtime.get_block(), e.g., does not. HOWEVER, there are simple heuristics
# which will work 99.999% of the time: a runtime is thread & even context specific. The likelihood that
# the thread is working with more than one named container pointing to the same specific structure is
# low; thus, the course_entry is most likely correct. If the thread is looking at > 1 named container
# pointing to the same structure, the access is likely to be chunky enough that the last known container
# is the intended one when not given a course_entry_override; thus, the caching of the last branch/course id.
@contract(block_key="BlockKey | None")
def xblock_from_json(self, class_, course_key, block_key, block_data, course_entry_override=None, **kwargs):
"""
Load and return block info.
"""
if course_entry_override is None:
course_entry_override = self.course_entry
else:
# most recent retrieval is most likely the right one for next caller (see comment above fn)
self.course_entry = CourseEnvelope(course_entry_override.course_key, self.course_entry.structure)
definition_id = block_data.definition
# If no usage id is provided, generate an in-memory id
if block_key is None:
block_key = BlockKey(block_data.block_type, LocalId())
convert_fields = lambda field: self.modulestore.convert_references_to_keys(
course_key, class_, field, self.course_entry.structure['blocks'],
)
if definition_id is not None and not block_data.definition_loaded:
definition_loader = DefinitionLazyLoader(
self.modulestore,
course_key,
block_key.type,
definition_id,
convert_fields,
)
else:
definition_loader = None
# If no definition id is provide, generate an in-memory id
if definition_id is None:
definition_id = LocalId()
# Construct the Block Usage Locator:
block_locator = course_key.make_usage_key(
block_type=block_key.type,
block_id=block_key.id,
)
converted_fields = convert_fields(block_data.fields)
converted_defaults = convert_fields(block_data.defaults)
if block_key in self._parent_map:
parent_key = self._parent_map[block_key]
parent = course_key.make_usage_key(parent_key.type, parent_key.id)
else:
parent = None
aside_fields = None
# for the situation if block_data has no asides attribute
# (in case it was taken from memcache)
try:
if block_data.asides:
aside_fields = {block_key.type: {}}
for aside in block_data.asides:
aside_fields[block_key.type].update(aside['fields'])
except AttributeError:
pass
try:
kvs = SplitMongoKVS(
definition_loader,
converted_fields,
converted_defaults,
parent=parent,
aside_fields=aside_fields,
field_decorator=kwargs.get('field_decorator')
)
if InheritanceMixin in self.modulestore.xblock_mixins:
field_data = inheriting_field_data(kvs)
else:
field_data = KvsFieldData(kvs)
module = self.construct_xblock_from_class(
class_,
ScopeIds(None, block_key.type, definition_id, block_locator),
field_data,
for_parent=kwargs.get('for_parent')
)
except Exception: # pylint: disable=broad-except
log.warning("Failed to load descriptor", exc_info=True)
return ErrorDescriptor.from_json(
block_data,
self,
course_entry_override.course_key.make_usage_key(
block_type='error',
block_id=block_key.id
),
error_msg=exc_info_to_str(sys.exc_info())
)
edit_info = block_data.edit_info
module._edited_by = edit_info.edited_by # pylint: disable=protected-access
module._edited_on = edit_info.edited_on # pylint: disable=protected-access
module.previous_version = edit_info.previous_version
module.update_version = edit_info.update_version
module.source_version = edit_info.source_version
module.definition_locator = DefinitionLocator(block_key.type, definition_id)
for wrapper in self.modulestore.xblock_field_data_wrappers:
module._field_data = wrapper(module, module._field_data) # pylint: disable=protected-access
# decache any pending field settings
module.save()
# If this is an in-memory block, store it in this system
if isinstance(block_locator.block_id, LocalId):
self.local_modules[block_locator] = module
return module
def get_edited_by(self, xblock):
"""
See :meth: cms.lib.xblock.runtime.EditInfoRuntimeMixin.get_edited_by
"""
return xblock._edited_by
def get_edited_on(self, xblock):
"""
See :class: cms.lib.xblock.runtime.EditInfoRuntimeMixin
"""
return xblock._edited_on
@contract(xblock='XBlock')
def get_subtree_edited_by(self, xblock):
"""
See :class: cms.lib.xblock.runtime.EditInfoRuntimeMixin
"""
# pylint: disable=protected-access
if not hasattr(xblock, '_subtree_edited_by'):
block_data = self.module_data[BlockKey.from_usage_key(xblock.location)]
if block_data.edit_info._subtree_edited_by is None:
self._compute_subtree_edited_internal(
block_data, xblock.location.course_key
)
xblock._subtree_edited_by = block_data.edit_info._subtree_edited_by
return xblock._subtree_edited_by
@contract(xblock='XBlock')
def get_subtree_edited_on(self, xblock):
"""
See :class: cms.lib.xblock.runtime.EditInfoRuntimeMixin
"""
# pylint: disable=protected-access
if not hasattr(xblock, '_subtree_edited_on'):
block_data = self.module_data[BlockKey.from_usage_key(xblock.location)]
if block_data.edit_info._subtree_edited_on is None:
self._compute_subtree_edited_internal(
block_data, xblock.location.course_key
)
xblock._subtree_edited_on = block_data.edit_info._subtree_edited_on
return xblock._subtree_edited_on
def get_published_by(self, xblock):
"""
See :class: cms.lib.xblock.runtime.EditInfoRuntimeMixin
"""
if not hasattr(xblock, '_published_by'):
self.modulestore.compute_published_info_internal(xblock)
return getattr(xblock, '_published_by', None)
def get_published_on(self, xblock):
"""
See :class: cms.lib.xblock.runtime.EditInfoRuntimeMixin
"""
if not hasattr(xblock, '_published_on'):
self.modulestore.compute_published_info_internal(xblock)
return getattr(xblock, '_published_on', None)
@contract(block_data='BlockData')
def _compute_subtree_edited_internal(self, block_data, course_key):
"""
Recurse the subtree finding the max edited_on date and its corresponding edited_by. Cache it.
"""
# pylint: disable=protected-access
max_date = block_data.edit_info.edited_on
max_date_by = block_data.edit_info.edited_by
for child in block_data.fields.get('children', []):
child_data = self.get_module_data(BlockKey(*child), course_key)
if block_data.edit_info._subtree_edited_on is None:
self._compute_subtree_edited_internal(child_data, course_key)
if child_data.edit_info._subtree_edited_on > max_date:
max_date = child_data.edit_info._subtree_edited_on
max_date_by = child_data.edit_info._subtree_edited_by
block_data.edit_info._subtree_edited_on = max_date
block_data.edit_info._subtree_edited_by = max_date_by
def get_aside_of_type(self, block, aside_type):
"""
See `runtime.Runtime.get_aside_of_type`
This override adds the field data from the block to the aside
"""
asides_cached = block.get_asides() if isinstance(block, XModuleMixin) else None
if asides_cached:
for aside in asides_cached:
if aside.scope_ids.block_type == aside_type:
return aside
new_aside = super(CachingDescriptorSystem, self).get_aside_of_type(block, aside_type)
new_aside._field_data = block._field_data # pylint: disable=protected-access
for key, _ in new_aside.fields.iteritems():
if isinstance(key, KeyValueStore.Key) and block._field_data.has(new_aside, key): # pylint: disable=protected-access
try:
value = block._field_data.get(new_aside, key) # pylint: disable=protected-access
except KeyError:
pass
else:
setattr(new_aside, key, value)
block.add_aside(new_aside)
return new_aside
| agpl-3.0 |
altsen/diandiyun-platform | lms/djangoapps/wechat/tests/test_views.py | 12 | 17913 | """
Tests courseware views.py
"""
import unittest
from datetime import datetime
from mock import MagicMock, patch
from pytz import UTC
from django.test import TestCase
from django.http import Http404
from django.test.utils import override_settings
from django.contrib.auth.models import User, AnonymousUser
from django.test.client import RequestFactory
from django.conf import settings
from django.core.urlresolvers import reverse
from student.models import CourseEnrollment
from student.tests.factories import AdminFactory
from edxmako.middleware import MakoMiddleware
from xmodule.modulestore import Location
from xmodule.modulestore.django import modulestore
from xmodule.modulestore.tests.factories import CourseFactory, ItemFactory
from xmodule.modulestore.tests.django_utils import ModuleStoreTestCase
from student.tests.factories import UserFactory
import courseware.views as views
from courseware.tests.modulestore_config import TEST_DATA_MIXED_MODULESTORE
from course_modes.models import CourseMode
import shoppingcart
from util.tests.test_date_utils import fake_ugettext, fake_pgettext
@override_settings(MODULESTORE=TEST_DATA_MIXED_MODULESTORE)
class TestJumpTo(TestCase):
"""
Check the jumpto link for a course.
"""
def setUp(self):
# Use toy course from XML
self.course_name = 'edX/toy/2012_Fall'
def test_jumpto_invalid_location(self):
location = Location('i4x', 'edX', 'toy', 'NoSuchPlace', None)
jumpto_url = '{0}/{1}/jump_to/{2}'.format('/courses', self.course_name, location)
response = self.client.get(jumpto_url)
self.assertEqual(response.status_code, 404)
def test_jumpto_from_chapter(self):
location = Location('i4x', 'edX', 'toy', 'chapter', 'Overview')
jumpto_url = '{0}/{1}/jump_to/{2}'.format('/courses', self.course_name, location)
expected = 'courses/edX/toy/2012_Fall/courseware/Overview/'
response = self.client.get(jumpto_url)
self.assertRedirects(response, expected, status_code=302, target_status_code=302)
def test_jumpto_id(self):
location = Location('i4x', 'edX', 'toy', 'chapter', 'Overview')
jumpto_url = '{0}/{1}/jump_to_id/{2}'.format('/courses', self.course_name, location.name)
expected = 'courses/edX/toy/2012_Fall/courseware/Overview/'
response = self.client.get(jumpto_url)
self.assertRedirects(response, expected, status_code=302, target_status_code=302)
def test_jumpto_id_invalid_location(self):
location = Location('i4x', 'edX', 'toy', 'NoSuchPlace', None)
jumpto_url = '{0}/{1}/jump_to_id/{2}'.format('/courses', self.course_name, location.name)
response = self.client.get(jumpto_url)
self.assertEqual(response.status_code, 404)
@override_settings(MODULESTORE=TEST_DATA_MIXED_MODULESTORE)
class ViewsTestCase(TestCase):
"""
Tests for views.py methods.
"""
def setUp(self):
self.user = User.objects.create(username='dummy', password='123456',
email='[email protected]')
self.date = datetime(2013, 1, 22, tzinfo=UTC)
self.course_id = 'edX/toy/2012_Fall'
self.enrollment = CourseEnrollment.enroll(self.user, self.course_id)
self.enrollment.created = self.date
self.enrollment.save()
self.location = ['tag', 'org', 'course', 'category', 'name']
self.request_factory = RequestFactory()
chapter = 'Overview'
self.chapter_url = '%s/%s/%s' % ('/courses', self.course_id, chapter)
@unittest.skipUnless(settings.FEATURES.get('ENABLE_SHOPPING_CART'), "Shopping Cart not enabled in settings")
@patch.dict(settings.FEATURES, {'ENABLE_PAID_COURSE_REGISTRATION': True})
def test_course_about_in_cart(self):
in_cart_span = '<span class="add-to-cart">'
# don't mock this course due to shopping cart existence checking
course = CourseFactory.create(org="new", number="unenrolled", display_name="course")
request = self.request_factory.get(reverse('about_course', args=[course.id]))
request.user = AnonymousUser()
response = views.course_about(request, course.id)
self.assertEqual(response.status_code, 200)
self.assertNotIn(in_cart_span, response.content)
# authenticated user with nothing in cart
request.user = self.user
response = views.course_about(request, course.id)
self.assertEqual(response.status_code, 200)
self.assertNotIn(in_cart_span, response.content)
# now add the course to the cart
cart = shoppingcart.models.Order.get_cart_for_user(self.user)
shoppingcart.models.PaidCourseRegistration.add_to_order(cart, course.id)
response = views.course_about(request, course.id)
self.assertEqual(response.status_code, 200)
self.assertIn(in_cart_span, response.content)
def test_user_groups(self):
# depreciated function
mock_user = MagicMock()
mock_user.is_authenticated.return_value = False
self.assertEquals(views.user_groups(mock_user), [])
def test_get_current_child(self):
self.assertIsNone(views.get_current_child(MagicMock()))
mock_xmodule = MagicMock()
mock_xmodule.position = -1
mock_xmodule.get_display_items.return_value = ['one', 'two']
self.assertEquals(views.get_current_child(mock_xmodule), 'one')
mock_xmodule_2 = MagicMock()
mock_xmodule_2.position = 3
mock_xmodule_2.get_display_items.return_value = []
self.assertIsNone(views.get_current_child(mock_xmodule_2))
def test_redirect_to_course_position(self):
mock_module = MagicMock()
mock_module.descriptor.id = 'Underwater Basketweaving'
mock_module.position = 3
mock_module.get_display_items.return_value = []
self.assertRaises(Http404, views.redirect_to_course_position,
mock_module)
def test_registered_for_course(self):
self.assertFalse(views.registered_for_course('Basketweaving', None))
mock_user = MagicMock()
mock_user.is_authenticated.return_value = False
self.assertFalse(views.registered_for_course('dummy', mock_user))
mock_course = MagicMock()
mock_course.id = self.course_id
self.assertTrue(views.registered_for_course(mock_course, self.user))
def test_jump_to_invalid(self):
request = self.request_factory.get(self.chapter_url)
self.assertRaisesRegexp(Http404, 'Invalid location', views.jump_to,
request, 'bar', ())
self.assertRaisesRegexp(Http404, 'No data*', views.jump_to, request,
'dummy', self.location)
def test_no_end_on_about_page(self):
# Toy course has no course end date or about/end_date blob
self.verify_end_date('edX/toy/TT_2012_Fall')
def test_no_end_about_blob(self):
# test_end has a course end date, no end_date HTML blob
self.verify_end_date("edX/test_end/2012_Fall", "Sep 17, 2015")
def test_about_blob_end_date(self):
# test_about_blob_end_date has both a course end date and an end_date HTML blob.
# HTML blob wins
self.verify_end_date("edX/test_about_blob_end_date/2012_Fall", "Learning never ends")
def verify_end_date(self, course_id, expected_end_text=None):
request = self.request_factory.get("foo")
request.user = self.user
# TODO: Remove the dependency on MakoMiddleware (by making the views explicitly supply a RequestContext)
MakoMiddleware().process_request(request)
result = views.course_about(request, course_id)
if expected_end_text is not None:
self.assertContains(result, "Classes End")
self.assertContains(result, expected_end_text)
else:
self.assertNotContains(result, "Classes End")
def test_chat_settings(self):
mock_user = MagicMock()
mock_user.username = "johndoe"
mock_course = MagicMock()
mock_course.id = "a/b/c"
# Stub this out in the case that it's not in the settings
domain = "jabber.edx.org"
settings.JABBER_DOMAIN = domain
chat_settings = views.chat_settings(mock_course, mock_user)
# Test the proper format of all chat settings
self.assertEquals(chat_settings['domain'], domain)
self.assertEquals(chat_settings['room'], "a-b-c_class")
self.assertEquals(chat_settings['username'], "johndoe@%s" % domain)
# TODO: this needs to be changed once we figure out how to
# generate/store a real password.
self.assertEquals(chat_settings['password'], "johndoe@%s" % domain)
def test_course_mktg_about_coming_soon(self):
# we should not be able to find this course
url = reverse('mktg_about_course', kwargs={'course_id': 'no/course/here'})
response = self.client.get(url)
self.assertIn('Coming Soon', response.content)
def test_course_mktg_register(self):
admin = AdminFactory()
self.client.login(username=admin.username, password='test')
url = reverse('mktg_about_course', kwargs={'course_id': self.course_id})
response = self.client.get(url)
self.assertIn('Register for', response.content)
self.assertNotIn('and choose your student track', response.content)
def test_course_mktg_register_multiple_modes(self):
admin = AdminFactory()
CourseMode.objects.get_or_create(mode_slug='honor',
mode_display_name='Honor Code Certificate',
course_id=self.course_id)
CourseMode.objects.get_or_create(mode_slug='verified',
mode_display_name='Verified Certificate',
course_id=self.course_id)
self.client.login(username=admin.username, password='test')
url = reverse('mktg_about_course', kwargs={'course_id': self.course_id})
response = self.client.get(url)
self.assertIn('Register for', response.content)
self.assertIn('and choose your student track', response.content)
# clean up course modes
CourseMode.objects.all().delete()
def test_submission_history_xss(self):
# log into a staff account
admin = AdminFactory()
self.client.login(username=admin.username, password='test')
# try it with an existing user and a malicious location
url = reverse('submission_history', kwargs={
'course_id': self.course_id,
'student_username': 'dummy',
'location': '<script>alert("hello");</script>'
})
response = self.client.get(url)
self.assertFalse('<script>' in response.content)
# try it with a malicious user and a non-existent location
url = reverse('submission_history', kwargs={
'course_id': self.course_id,
'student_username': '<script>alert("hello");</script>',
'location': 'dummy'
})
response = self.client.get(url)
self.assertFalse('<script>' in response.content)
# setting TIME_ZONE_DISPLAYED_FOR_DEADLINES explicitly
@override_settings(MODULESTORE=TEST_DATA_MIXED_MODULESTORE, TIME_ZONE_DISPLAYED_FOR_DEADLINES="UTC")
class BaseDueDateTests(ModuleStoreTestCase):
"""
Base class that verifies that due dates are rendered correctly on a page
"""
__test__ = False
def get_text(self, course): # pylint: disable=unused-argument
"""Return the rendered text for the page to be verified"""
raise NotImplementedError
def set_up_course(self, **course_kwargs):
"""
Create a stock course with a specific due date.
:param course_kwargs: All kwargs are passed to through to the :class:`CourseFactory`
"""
course = CourseFactory(**course_kwargs)
chapter = ItemFactory(category='chapter', parent_location=course.location) # pylint: disable=no-member
section = ItemFactory(category='sequential', parent_location=chapter.location, due=datetime(2013, 9, 18, 11, 30, 00))
vertical = ItemFactory(category='vertical', parent_location=section.location)
ItemFactory(category='problem', parent_location=vertical.location)
course = modulestore().get_instance(course.id, course.location) # pylint: disable=no-member
self.assertIsNotNone(course.get_children()[0].get_children()[0].due)
return course
def setUp(self):
self.request_factory = RequestFactory()
self.user = UserFactory.create()
self.request = self.request_factory.get("foo")
self.request.user = self.user
self.time_with_tz = "due Sep 18, 2013 at 11:30 UTC"
self.time_without_tz = "due Sep 18, 2013 at 11:30"
def test_backwards_compatability(self):
# The test course being used has show_timezone = False in the policy file
# (and no due_date_display_format set). This is to test our backwards compatibility--
# in course_module's init method, the date_display_format will be set accordingly to
# remove the timezone.
course = self.set_up_course(due_date_display_format=None, show_timezone=False)
text = self.get_text(course)
self.assertIn(self.time_without_tz, text)
self.assertNotIn(self.time_with_tz, text)
# Test that show_timezone has been cleared (which means you get the default value of True).
self.assertTrue(course.show_timezone)
def test_defaults(self):
course = self.set_up_course()
text = self.get_text(course)
self.assertIn(self.time_with_tz, text)
def test_format_none(self):
# Same for setting the due date to None
course = self.set_up_course(due_date_display_format=None)
text = self.get_text(course)
self.assertIn(self.time_with_tz, text)
def test_format_plain_text(self):
# plain text due date
course = self.set_up_course(due_date_display_format="foobar")
text = self.get_text(course)
self.assertNotIn(self.time_with_tz, text)
self.assertIn("due foobar", text)
def test_format_date(self):
# due date with no time
course = self.set_up_course(due_date_display_format=u"%b %d %y")
text = self.get_text(course)
self.assertNotIn(self.time_with_tz, text)
self.assertIn("due Sep 18 13", text)
def test_format_hidden(self):
# hide due date completely
course = self.set_up_course(due_date_display_format=u"")
text = self.get_text(course)
self.assertNotIn("due ", text)
def test_format_invalid(self):
# improperly formatted due_date_display_format falls through to default
# (value of show_timezone does not matter-- setting to False to make that clear).
course = self.set_up_course(due_date_display_format=u"%%%", show_timezone=False)
text = self.get_text(course)
self.assertNotIn("%%%", text)
self.assertIn(self.time_with_tz, text)
class TestProgressDueDate(BaseDueDateTests):
"""
Test that the progress page displays due dates correctly
"""
__test__ = True
def get_text(self, course):
""" Returns the HTML for the progress page """
return views.progress(self.request, course.id, self.user.id).content
class TestAccordionDueDate(BaseDueDateTests):
"""
Test that the accordion page displays due dates correctly
"""
__test__ = True
def get_text(self, course):
""" Returns the HTML for the accordion """
return views.render_accordion(
self.request, course, course.get_children()[0].id, None, None
)
@override_settings(MODULESTORE=TEST_DATA_MIXED_MODULESTORE)
class StartDateTests(ModuleStoreTestCase):
"""
Test that start dates are properly localized and displayed on the student
dashboard.
"""
def setUp(self):
self.request_factory = RequestFactory()
self.user = UserFactory.create()
self.request = self.request_factory.get("foo")
self.request.user = self.user
def set_up_course(self):
"""
Create a stock course with a specific due date.
:param course_kwargs: All kwargs are passed to through to the :class:`CourseFactory`
"""
course = CourseFactory(start=datetime(2013, 9, 16, 7, 17, 28))
course = modulestore().get_instance(course.id, course.location) # pylint: disable=no-member
return course
def get_about_text(self, course_id):
"""
Get the text of the /about page for the course.
"""
text = views.course_about(self.request, course_id).content
return text
@patch('util.date_utils.pgettext', fake_pgettext(translations={
("abbreviated month name", "Sep"): "SEPTEMBER",
}))
@patch('util.date_utils.ugettext', fake_ugettext(translations={
"SHORT_DATE_FORMAT": "%Y-%b-%d",
}))
def test_format_localized_in_studio_course(self):
course = self.set_up_course()
text = self.get_about_text(course.id)
# The start date is set in the set_up_course function above.
self.assertIn("2013-SEPTEMBER-16", text)
@patch('util.date_utils.pgettext', fake_pgettext(translations={
("abbreviated month name", "Jul"): "JULY",
}))
@patch('util.date_utils.ugettext', fake_ugettext(translations={
"SHORT_DATE_FORMAT": "%Y-%b-%d",
}))
def test_format_localized_in_xml_course(self):
text = self.get_about_text('edX/toy/TT_2012_Fall')
# The start date is set in common/test/data/two_toys/policies/TT_2012_Fall/policy.json
self.assertIn("2015-JULY-17", text)
| agpl-3.0 |
esteve/txamqp | src/txamqp/test/test_heartbeat.py | 6 | 1136 | from txamqp.testlib import TestBase
from txamqp.protocol import AMQClient
from twisted.internet import reactor
from twisted.internet.defer import Deferred
class SpyAMQClient(AMQClient):
called_reschedule_check = 0
called_send_hb = 0
def reschedule_checkHB(self, dummy=None):
AMQClient.reschedule_checkHB(self)
self.called_reschedule_check += 1
def sendHeartbeat(self):
AMQClient.sendHeartbeat(self)
self.called_send_hb += 1
class HeartbeatTests(TestBase):
heartbeat = 1
clientClass = SpyAMQClient
"""
Tests handling of heartbeat frames
"""
def test_heartbeat(self):
"""
Test that heartbeat frames are sent and received
"""
d = Deferred()
def checkPulse(dummy):
self.assertTrue(self.client.called_send_hb,
"A heartbeat frame was recently sent")
self.assertTrue(self.client.called_reschedule_check,
"A heartbeat frame was recently received")
d.addCallback(checkPulse)
reactor.callLater(3, d.callback, None)
return d
| apache-2.0 |
OptimalPayments/Python_SDK | src/sample_application/DirectDebitACHpurchase.py | 1 | 1780 | #!/usr/bin/env python3
'''
Created on 1-June-2016
@author: Asawari.Vaidya
'''
from PythonNetBanxSDK.CardPayments.BillingDetails import BillingDetails
from PythonNetBanxSDK.CustomerVault.ACHBankAccount import ACHBankAccount
from PythonNetBanxSDK.CustomerVault.Profile import Profile
from PythonNetBanxSDK.DirectDebit.Purchase import Purchase
from PythonNetBanxSDK.OptimalApiClient import OptimalApiClient
from utils.Utils import Utils
from Config import Config
from RandomTokenGenerator import RandomTokenGenerator
optimal_obj = OptimalApiClient(Config.api_key, Config.api_password, Config.environment, Config.account_number_ACH)
purchase_obj = Purchase(None)
purchase_obj.merchantRefNum(RandomTokenGenerator().generateToken())
purchase_obj.amount("10098")
purchase_obj.customerIp("192.0.126.111")
achbank_obj = ACHBankAccount (None)
achbank_obj.accountHolderName("XYZ Company")
achbank_obj.accountType("CHECKING")
#achbank_obj.accountNumber(RandomTokenGenerator().generateNumber())
achbank_obj.accountNumber("988948193")
achbank_obj.routingNumber("211589828")
achbank_obj.payMethod("WEB")
profile_obj = Profile(None)
profile_obj.firstName("Joe")
profile_obj.lastName("Smith")
profile_obj.email("[email protected]")
billingdetails_obj = BillingDetails(None)
billingdetails_obj.street("100 Queen Street West")
billingdetails_obj.city("Los Angeles")
billingdetails_obj.state("CA")
billingdetails_obj.country("US")
billingdetails_obj.zip("90210")
billingdetails_obj.phone("3102649010")
purchase_obj.profile(profile_obj)
purchase_obj.billingDetails(billingdetails_obj)
purchase_obj.ach(achbank_obj)
response_object = optimal_obj.direct_debit_service_handler().submit_purchase(purchase_obj)
print ("\nResponse Values ==========> ")
Utils.print_response(response_object)
| mit |
geekboxzone/lollipop_external_chromium_org_third_party_WebKit | Tools/Scripts/webkitpy/layout_tests/servers/apache_http.py | 15 | 8419 | # Copyright (C) 2011 Google Inc. All rights reserved.
#
# Redistribution and use in source and binary forms, with or without
# modification, are permitted provided that the following conditions are
# met:
#
# * Redistributions of source code must retain the above copyright
# notice, this list of conditions and the following disclaimer.
# * Redistributions in binary form must reproduce the above
# copyright notice, this list of conditions and the following disclaimer
# in the documentation and/or other materials provided with the
# distribution.
# * Neither the name of Google Inc. nor the names of its
# contributors may be used to endorse or promote products derived from
# this software without specific prior written permission.
#
# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
# A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
# OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
# SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
# LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
# DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
# THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
# OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
"""Start and stop the Apache HTTP server as it is used by the layout tests."""
import logging
import os
import socket
from webkitpy.layout_tests.servers import server_base
_log = logging.getLogger(__name__)
class ApacheHTTP(server_base.ServerBase):
def __init__(self, port_obj, output_dir, additional_dirs, number_of_servers):
super(ApacheHTTP, self).__init__(port_obj, output_dir)
# We use the name "httpd" instead of "apache" to make our paths (e.g. the pid file: /tmp/WebKit/httpd.pid)
# match old-run-webkit-tests: https://bugs.webkit.org/show_bug.cgi?id=63956
self._name = 'httpd'
self._log_prefixes = ('access_log', 'error_log')
self._mappings = [{'port': 8000},
{'port': 8080},
{'port': 8443, 'sslcert': True}]
self._number_of_servers = number_of_servers
self._pid_file = self._filesystem.join(self._runtime_path, '%s.pid' % self._name)
executable = self._port_obj.path_to_apache()
server_root = self._filesystem.dirname(self._filesystem.dirname(executable))
test_dir = self._port_obj.layout_tests_dir()
document_root = self._filesystem.join(test_dir, "http", "tests")
js_test_resources_dir = self._filesystem.join(test_dir, "resources")
media_resources_dir = self._filesystem.join(test_dir, "media")
mime_types_path = self._filesystem.join(test_dir, "http", "conf", "mime.types")
cert_file = self._filesystem.join(test_dir, "http", "conf", "webkit-httpd.pem")
self._access_log_path = self._filesystem.join(output_dir, "access_log.txt")
self._error_log_path = self._filesystem.join(output_dir, "error_log.txt")
self._is_win = self._port_obj.host.platform.is_win()
start_cmd = [executable,
'-f', '%s' % self._port_obj.path_to_apache_config_file(),
'-C', 'ServerRoot "%s"' % server_root,
'-C', 'DocumentRoot "%s"' % document_root,
'-c', 'Alias /js-test-resources "%s"' % js_test_resources_dir,
'-c', 'Alias /media-resources "%s"' % media_resources_dir,
'-c', 'TypesConfig "%s"' % mime_types_path,
'-c', 'CustomLog "%s" common' % self._access_log_path,
'-c', 'ErrorLog "%s"' % self._error_log_path,
'-c', 'PidFile %s' % self._pid_file,
'-c', 'SSLCertificateFile "%s"' % cert_file,
]
if self._is_win:
start_cmd += ['-c', "ThreadsPerChild %d" % (self._number_of_servers * 2)]
else:
start_cmd += ['-c', "StartServers %d" % self._number_of_servers,
'-c', "MinSpareServers %d" % self._number_of_servers,
'-c', "MaxSpareServers %d" % self._number_of_servers,
'-C', 'User "%s"' % os.environ.get('USERNAME', os.environ.get('USER', '')),
'-k', 'start']
enable_ipv6 = self._port_obj.http_server_supports_ipv6()
# Perform part of the checks Apache's APR does when trying to listen to
# a specific host/port. This allows us to avoid trying to listen to
# IPV6 addresses when it fails on Apache. APR itself tries to call
# getaddrinfo() again without AI_ADDRCONFIG if the first call fails
# with EBADFLAGS, but that is not how it normally fails in our use
# cases, so ignore that for now.
# See https://bugs.webkit.org/show_bug.cgi?id=98602#c7
try:
socket.getaddrinfo('::1', 0, 0, 0, 0, socket.AI_ADDRCONFIG)
except:
enable_ipv6 = False
for mapping in self._mappings:
port = mapping['port']
start_cmd += ['-C', "Listen 127.0.0.1:%d" % port]
# We listen to both IPv4 and IPv6 loop-back addresses, but ignore
# requests to 8000 from random users on network.
# See https://bugs.webkit.org/show_bug.cgi?id=37104
if enable_ipv6:
start_cmd += ['-C', "Listen [::1]:%d" % port]
if additional_dirs:
self._start_cmd = start_cmd
for alias, path in additional_dirs.iteritems():
start_cmd += ['-c', 'Alias %s "%s"' % (alias, path),
# Disable CGI handler for additional dirs.
'-c', '<Location %s>' % alias,
'-c', 'RemoveHandler .cgi .pl',
'-c', '</Location>']
self._start_cmd = start_cmd
def _spawn_process(self):
_log.debug('Starting %s server, cmd="%s"' % (self._name, str(self._start_cmd)))
self._process = self._executive.popen(self._start_cmd, stderr=self._executive.PIPE)
if self._process.returncode is not None:
retval = self._process.returncode
err = self._process.stderr.read()
if retval or len(err):
raise server_base.ServerError('Failed to start %s: %s' % (self._name, err))
# For some reason apache isn't guaranteed to have created the pid file before
# the process exits, so we wait a little while longer.
if not self._wait_for_action(lambda: self._filesystem.exists(self._pid_file)):
self._log_errors_from_subprocess()
raise server_base.ServerError('Failed to start %s: no pid file found' % self._name)
return int(self._filesystem.read_text_file(self._pid_file))
def stop(self):
self._stop_running_server()
def _stop_running_server(self):
# If apache was forcefully killed, the pid file will not have been deleted, so check
# that the process specified by the pid_file no longer exists before deleting the file.
if self._pid and not self._executive.check_running_pid(self._pid):
self._filesystem.remove(self._pid_file)
return
if self._is_win:
self._executive.kill_process(self._pid)
return
proc = self._executive.popen([self._port_obj.path_to_apache(),
'-f', self._port_obj.path_to_apache_config_file(),
'-c', 'PidFile "%s"' % self._pid_file,
'-k', 'stop'], stderr=self._executive.PIPE)
proc.wait()
retval = proc.returncode
err = proc.stderr.read()
if retval or len(err):
raise server_base.ServerError('Failed to stop %s: %s' % (self._name, err))
# For some reason apache isn't guaranteed to have actually stopped after
# the stop command returns, so we wait a little while longer for the
# pid file to be removed.
if not self._wait_for_action(lambda: not self._filesystem.exists(self._pid_file)):
raise server_base.ServerError('Failed to stop %s: pid file still exists' % self._name)
| bsd-3-clause |
ssadedin/seqr | seqr/migrations/0004_auto_20200124_1912.py | 2 | 2811 | # -*- coding: utf-8 -*-
# Generated by Django 1.11.27 on 2020-01-24 19:12
from django.db import migrations, models
class Migration(migrations.Migration):
dependencies = [
('seqr', '0003_auto_20191203_1130'),
]
operations = [
migrations.RemoveField(
model_name='projectlastaccesseddate',
name='project',
),
migrations.RemoveField(
model_name='projectlastaccesseddate',
name='user',
),
migrations.RemoveField(
model_name='uploadedfileforfamily',
name='family',
),
migrations.RemoveField(
model_name='uploadedfileforfamily',
name='uploaded_by',
),
migrations.RemoveField(
model_name='uploadedfileforindividual',
name='individual',
),
migrations.RemoveField(
model_name='uploadedfileforindividual',
name='uploaded_by',
),
migrations.RemoveField(
model_name='family',
name='causal_inheritance_mode',
),
migrations.RemoveField(
model_name='locuslistgene',
name='description',
),
migrations.RemoveField(
model_name='locuslistinterval',
name='description',
),
migrations.RemoveField(
model_name='project',
name='deprecated_project_id',
),
migrations.RemoveField(
model_name='project',
name='disease_area',
),
migrations.RemoveField(
model_name='project',
name='has_new_search',
),
migrations.RemoveField(
model_name='project',
name='is_functional_data_enabled',
),
migrations.RemoveField(
model_name='project',
name='is_phenotips_enabled',
),
migrations.RemoveField(
model_name='variantfunctionaldata',
name='search_parameters',
),
migrations.RemoveField(
model_name='variantnote',
name='search_parameters',
),
migrations.RemoveField(
model_name='varianttag',
name='search_parameters',
),
migrations.RemoveField(
model_name='varianttagtype',
name='is_built_in',
),
migrations.AlterField(
model_name='variantnote',
name='note',
field=models.TextField(),
),
migrations.DeleteModel(
name='ProjectLastAccessedDate',
),
migrations.DeleteModel(
name='UploadedFileForFamily',
),
migrations.DeleteModel(
name='UploadedFileForIndividual',
),
]
| agpl-3.0 |
darshanthaker/nupic | external/linux32/lib/python2.6/site-packages/matplotlib/_cm.py | 70 | 375423 | """
Color data and pre-defined cmap objects.
This is a helper for cm.py, originally part of that file.
Separating the data (this file) from cm.py makes both easier
to deal with.
Objects visible in cm.py are the individual cmap objects ('autumn',
etc.) and a dictionary, 'datad', including all of these objects.
"""
import matplotlib as mpl
import matplotlib.colors as colors
LUTSIZE = mpl.rcParams['image.lut']
_binary_data = {
'red' : ((0., 1., 1.), (1., 0., 0.)),
'green': ((0., 1., 1.), (1., 0., 0.)),
'blue' : ((0., 1., 1.), (1., 0., 0.))
}
_bone_data = {'red': ((0., 0., 0.),(1.0, 1.0, 1.0)),
'green': ((0., 0., 0.),(1.0, 1.0, 1.0)),
'blue': ((0., 0., 0.),(1.0, 1.0, 1.0))}
_autumn_data = {'red': ((0., 1.0, 1.0),(1.0, 1.0, 1.0)),
'green': ((0., 0., 0.),(1.0, 1.0, 1.0)),
'blue': ((0., 0., 0.),(1.0, 0., 0.))}
_bone_data = {'red': ((0., 0., 0.),(0.746032, 0.652778, 0.652778),(1.0, 1.0, 1.0)),
'green': ((0., 0., 0.),(0.365079, 0.319444, 0.319444),
(0.746032, 0.777778, 0.777778),(1.0, 1.0, 1.0)),
'blue': ((0., 0., 0.),(0.365079, 0.444444, 0.444444),(1.0, 1.0, 1.0))}
_cool_data = {'red': ((0., 0., 0.), (1.0, 1.0, 1.0)),
'green': ((0., 1., 1.), (1.0, 0., 0.)),
'blue': ((0., 1., 1.), (1.0, 1., 1.))}
_copper_data = {'red': ((0., 0., 0.),(0.809524, 1.000000, 1.000000),(1.0, 1.0, 1.0)),
'green': ((0., 0., 0.),(1.0, 0.7812, 0.7812)),
'blue': ((0., 0., 0.),(1.0, 0.4975, 0.4975))}
_flag_data = {'red': ((0., 1., 1.),(0.015873, 1.000000, 1.000000),
(0.031746, 0.000000, 0.000000),(0.047619, 0.000000, 0.000000),
(0.063492, 1.000000, 1.000000),(0.079365, 1.000000, 1.000000),
(0.095238, 0.000000, 0.000000),(0.111111, 0.000000, 0.000000),
(0.126984, 1.000000, 1.000000),(0.142857, 1.000000, 1.000000),
(0.158730, 0.000000, 0.000000),(0.174603, 0.000000, 0.000000),
(0.190476, 1.000000, 1.000000),(0.206349, 1.000000, 1.000000),
(0.222222, 0.000000, 0.000000),(0.238095, 0.000000, 0.000000),
(0.253968, 1.000000, 1.000000),(0.269841, 1.000000, 1.000000),
(0.285714, 0.000000, 0.000000),(0.301587, 0.000000, 0.000000),
(0.317460, 1.000000, 1.000000),(0.333333, 1.000000, 1.000000),
(0.349206, 0.000000, 0.000000),(0.365079, 0.000000, 0.000000),
(0.380952, 1.000000, 1.000000),(0.396825, 1.000000, 1.000000),
(0.412698, 0.000000, 0.000000),(0.428571, 0.000000, 0.000000),
(0.444444, 1.000000, 1.000000),(0.460317, 1.000000, 1.000000),
(0.476190, 0.000000, 0.000000),(0.492063, 0.000000, 0.000000),
(0.507937, 1.000000, 1.000000),(0.523810, 1.000000, 1.000000),
(0.539683, 0.000000, 0.000000),(0.555556, 0.000000, 0.000000),
(0.571429, 1.000000, 1.000000),(0.587302, 1.000000, 1.000000),
(0.603175, 0.000000, 0.000000),(0.619048, 0.000000, 0.000000),
(0.634921, 1.000000, 1.000000),(0.650794, 1.000000, 1.000000),
(0.666667, 0.000000, 0.000000),(0.682540, 0.000000, 0.000000),
(0.698413, 1.000000, 1.000000),(0.714286, 1.000000, 1.000000),
(0.730159, 0.000000, 0.000000),(0.746032, 0.000000, 0.000000),
(0.761905, 1.000000, 1.000000),(0.777778, 1.000000, 1.000000),
(0.793651, 0.000000, 0.000000),(0.809524, 0.000000, 0.000000),
(0.825397, 1.000000, 1.000000),(0.841270, 1.000000, 1.000000),
(0.857143, 0.000000, 0.000000),(0.873016, 0.000000, 0.000000),
(0.888889, 1.000000, 1.000000),(0.904762, 1.000000, 1.000000),
(0.920635, 0.000000, 0.000000),(0.936508, 0.000000, 0.000000),
(0.952381, 1.000000, 1.000000),(0.968254, 1.000000, 1.000000),
(0.984127, 0.000000, 0.000000),(1.0, 0., 0.)),
'green': ((0., 0., 0.),(0.015873, 1.000000, 1.000000),
(0.031746, 0.000000, 0.000000),(0.063492, 0.000000, 0.000000),
(0.079365, 1.000000, 1.000000),(0.095238, 0.000000, 0.000000),
(0.126984, 0.000000, 0.000000),(0.142857, 1.000000, 1.000000),
(0.158730, 0.000000, 0.000000),(0.190476, 0.000000, 0.000000),
(0.206349, 1.000000, 1.000000),(0.222222, 0.000000, 0.000000),
(0.253968, 0.000000, 0.000000),(0.269841, 1.000000, 1.000000),
(0.285714, 0.000000, 0.000000),(0.317460, 0.000000, 0.000000),
(0.333333, 1.000000, 1.000000),(0.349206, 0.000000, 0.000000),
(0.380952, 0.000000, 0.000000),(0.396825, 1.000000, 1.000000),
(0.412698, 0.000000, 0.000000),(0.444444, 0.000000, 0.000000),
(0.460317, 1.000000, 1.000000),(0.476190, 0.000000, 0.000000),
(0.507937, 0.000000, 0.000000),(0.523810, 1.000000, 1.000000),
(0.539683, 0.000000, 0.000000),(0.571429, 0.000000, 0.000000),
(0.587302, 1.000000, 1.000000),(0.603175, 0.000000, 0.000000),
(0.634921, 0.000000, 0.000000),(0.650794, 1.000000, 1.000000),
(0.666667, 0.000000, 0.000000),(0.698413, 0.000000, 0.000000),
(0.714286, 1.000000, 1.000000),(0.730159, 0.000000, 0.000000),
(0.761905, 0.000000, 0.000000),(0.777778, 1.000000, 1.000000),
(0.793651, 0.000000, 0.000000),(0.825397, 0.000000, 0.000000),
(0.841270, 1.000000, 1.000000),(0.857143, 0.000000, 0.000000),
(0.888889, 0.000000, 0.000000),(0.904762, 1.000000, 1.000000),
(0.920635, 0.000000, 0.000000),(0.952381, 0.000000, 0.000000),
(0.968254, 1.000000, 1.000000),(0.984127, 0.000000, 0.000000),
(1.0, 0., 0.)),
'blue': ((0., 0., 0.),(0.015873, 1.000000, 1.000000),
(0.031746, 1.000000, 1.000000),(0.047619, 0.000000, 0.000000),
(0.063492, 0.000000, 0.000000),(0.079365, 1.000000, 1.000000),
(0.095238, 1.000000, 1.000000),(0.111111, 0.000000, 0.000000),
(0.126984, 0.000000, 0.000000),(0.142857, 1.000000, 1.000000),
(0.158730, 1.000000, 1.000000),(0.174603, 0.000000, 0.000000),
(0.190476, 0.000000, 0.000000),(0.206349, 1.000000, 1.000000),
(0.222222, 1.000000, 1.000000),(0.238095, 0.000000, 0.000000),
(0.253968, 0.000000, 0.000000),(0.269841, 1.000000, 1.000000),
(0.285714, 1.000000, 1.000000),(0.301587, 0.000000, 0.000000),
(0.317460, 0.000000, 0.000000),(0.333333, 1.000000, 1.000000),
(0.349206, 1.000000, 1.000000),(0.365079, 0.000000, 0.000000),
(0.380952, 0.000000, 0.000000),(0.396825, 1.000000, 1.000000),
(0.412698, 1.000000, 1.000000),(0.428571, 0.000000, 0.000000),
(0.444444, 0.000000, 0.000000),(0.460317, 1.000000, 1.000000),
(0.476190, 1.000000, 1.000000),(0.492063, 0.000000, 0.000000),
(0.507937, 0.000000, 0.000000),(0.523810, 1.000000, 1.000000),
(0.539683, 1.000000, 1.000000),(0.555556, 0.000000, 0.000000),
(0.571429, 0.000000, 0.000000),(0.587302, 1.000000, 1.000000),
(0.603175, 1.000000, 1.000000),(0.619048, 0.000000, 0.000000),
(0.634921, 0.000000, 0.000000),(0.650794, 1.000000, 1.000000),
(0.666667, 1.000000, 1.000000),(0.682540, 0.000000, 0.000000),
(0.698413, 0.000000, 0.000000),(0.714286, 1.000000, 1.000000),
(0.730159, 1.000000, 1.000000),(0.746032, 0.000000, 0.000000),
(0.761905, 0.000000, 0.000000),(0.777778, 1.000000, 1.000000),
(0.793651, 1.000000, 1.000000),(0.809524, 0.000000, 0.000000),
(0.825397, 0.000000, 0.000000),(0.841270, 1.000000, 1.000000),
(0.857143, 1.000000, 1.000000),(0.873016, 0.000000, 0.000000),
(0.888889, 0.000000, 0.000000),(0.904762, 1.000000, 1.000000),
(0.920635, 1.000000, 1.000000),(0.936508, 0.000000, 0.000000),
(0.952381, 0.000000, 0.000000),(0.968254, 1.000000, 1.000000),
(0.984127, 1.000000, 1.000000),(1.0, 0., 0.))}
_gray_data = {'red': ((0., 0, 0), (1., 1, 1)),
'green': ((0., 0, 0), (1., 1, 1)),
'blue': ((0., 0, 0), (1., 1, 1))}
_hot_data = {'red': ((0., 0.0416, 0.0416),(0.365079, 1.000000, 1.000000),(1.0, 1.0, 1.0)),
'green': ((0., 0., 0.),(0.365079, 0.000000, 0.000000),
(0.746032, 1.000000, 1.000000),(1.0, 1.0, 1.0)),
'blue': ((0., 0., 0.),(0.746032, 0.000000, 0.000000),(1.0, 1.0, 1.0))}
_hsv_data = {'red': ((0., 1., 1.),(0.158730, 1.000000, 1.000000),
(0.174603, 0.968750, 0.968750),(0.333333, 0.031250, 0.031250),
(0.349206, 0.000000, 0.000000),(0.666667, 0.000000, 0.000000),
(0.682540, 0.031250, 0.031250),(0.841270, 0.968750, 0.968750),
(0.857143, 1.000000, 1.000000),(1.0, 1.0, 1.0)),
'green': ((0., 0., 0.),(0.158730, 0.937500, 0.937500),
(0.174603, 1.000000, 1.000000),(0.507937, 1.000000, 1.000000),
(0.666667, 0.062500, 0.062500),(0.682540, 0.000000, 0.000000),
(1.0, 0., 0.)),
'blue': ((0., 0., 0.),(0.333333, 0.000000, 0.000000),
(0.349206, 0.062500, 0.062500),(0.507937, 1.000000, 1.000000),
(0.841270, 1.000000, 1.000000),(0.857143, 0.937500, 0.937500),
(1.0, 0.09375, 0.09375))}
_jet_data = {'red': ((0., 0, 0), (0.35, 0, 0), (0.66, 1, 1), (0.89,1, 1),
(1, 0.5, 0.5)),
'green': ((0., 0, 0), (0.125,0, 0), (0.375,1, 1), (0.64,1, 1),
(0.91,0,0), (1, 0, 0)),
'blue': ((0., 0.5, 0.5), (0.11, 1, 1), (0.34, 1, 1), (0.65,0, 0),
(1, 0, 0))}
_pink_data = {'red': ((0., 0.1178, 0.1178),(0.015873, 0.195857, 0.195857),
(0.031746, 0.250661, 0.250661),(0.047619, 0.295468, 0.295468),
(0.063492, 0.334324, 0.334324),(0.079365, 0.369112, 0.369112),
(0.095238, 0.400892, 0.400892),(0.111111, 0.430331, 0.430331),
(0.126984, 0.457882, 0.457882),(0.142857, 0.483867, 0.483867),
(0.158730, 0.508525, 0.508525),(0.174603, 0.532042, 0.532042),
(0.190476, 0.554563, 0.554563),(0.206349, 0.576204, 0.576204),
(0.222222, 0.597061, 0.597061),(0.238095, 0.617213, 0.617213),
(0.253968, 0.636729, 0.636729),(0.269841, 0.655663, 0.655663),
(0.285714, 0.674066, 0.674066),(0.301587, 0.691980, 0.691980),
(0.317460, 0.709441, 0.709441),(0.333333, 0.726483, 0.726483),
(0.349206, 0.743134, 0.743134),(0.365079, 0.759421, 0.759421),
(0.380952, 0.766356, 0.766356),(0.396825, 0.773229, 0.773229),
(0.412698, 0.780042, 0.780042),(0.428571, 0.786796, 0.786796),
(0.444444, 0.793492, 0.793492),(0.460317, 0.800132, 0.800132),
(0.476190, 0.806718, 0.806718),(0.492063, 0.813250, 0.813250),
(0.507937, 0.819730, 0.819730),(0.523810, 0.826160, 0.826160),
(0.539683, 0.832539, 0.832539),(0.555556, 0.838870, 0.838870),
(0.571429, 0.845154, 0.845154),(0.587302, 0.851392, 0.851392),
(0.603175, 0.857584, 0.857584),(0.619048, 0.863731, 0.863731),
(0.634921, 0.869835, 0.869835),(0.650794, 0.875897, 0.875897),
(0.666667, 0.881917, 0.881917),(0.682540, 0.887896, 0.887896),
(0.698413, 0.893835, 0.893835),(0.714286, 0.899735, 0.899735),
(0.730159, 0.905597, 0.905597),(0.746032, 0.911421, 0.911421),
(0.761905, 0.917208, 0.917208),(0.777778, 0.922958, 0.922958),
(0.793651, 0.928673, 0.928673),(0.809524, 0.934353, 0.934353),
(0.825397, 0.939999, 0.939999),(0.841270, 0.945611, 0.945611),
(0.857143, 0.951190, 0.951190),(0.873016, 0.956736, 0.956736),
(0.888889, 0.962250, 0.962250),(0.904762, 0.967733, 0.967733),
(0.920635, 0.973185, 0.973185),(0.936508, 0.978607, 0.978607),
(0.952381, 0.983999, 0.983999),(0.968254, 0.989361, 0.989361),
(0.984127, 0.994695, 0.994695),(1.0, 1.0, 1.0)),
'green': ((0., 0., 0.),(0.015873, 0.102869, 0.102869),
(0.031746, 0.145479, 0.145479),(0.047619, 0.178174, 0.178174),
(0.063492, 0.205738, 0.205738),(0.079365, 0.230022, 0.230022),
(0.095238, 0.251976, 0.251976),(0.111111, 0.272166, 0.272166),
(0.126984, 0.290957, 0.290957),(0.142857, 0.308607, 0.308607),
(0.158730, 0.325300, 0.325300),(0.174603, 0.341178, 0.341178),
(0.190476, 0.356348, 0.356348),(0.206349, 0.370899, 0.370899),
(0.222222, 0.384900, 0.384900),(0.238095, 0.398410, 0.398410),
(0.253968, 0.411476, 0.411476),(0.269841, 0.424139, 0.424139),
(0.285714, 0.436436, 0.436436),(0.301587, 0.448395, 0.448395),
(0.317460, 0.460044, 0.460044),(0.333333, 0.471405, 0.471405),
(0.349206, 0.482498, 0.482498),(0.365079, 0.493342, 0.493342),
(0.380952, 0.517549, 0.517549),(0.396825, 0.540674, 0.540674),
(0.412698, 0.562849, 0.562849),(0.428571, 0.584183, 0.584183),
(0.444444, 0.604765, 0.604765),(0.460317, 0.624669, 0.624669),
(0.476190, 0.643958, 0.643958),(0.492063, 0.662687, 0.662687),
(0.507937, 0.680900, 0.680900),(0.523810, 0.698638, 0.698638),
(0.539683, 0.715937, 0.715937),(0.555556, 0.732828, 0.732828),
(0.571429, 0.749338, 0.749338),(0.587302, 0.765493, 0.765493),
(0.603175, 0.781313, 0.781313),(0.619048, 0.796819, 0.796819),
(0.634921, 0.812029, 0.812029),(0.650794, 0.826960, 0.826960),
(0.666667, 0.841625, 0.841625),(0.682540, 0.856040, 0.856040),
(0.698413, 0.870216, 0.870216),(0.714286, 0.884164, 0.884164),
(0.730159, 0.897896, 0.897896),(0.746032, 0.911421, 0.911421),
(0.761905, 0.917208, 0.917208),(0.777778, 0.922958, 0.922958),
(0.793651, 0.928673, 0.928673),(0.809524, 0.934353, 0.934353),
(0.825397, 0.939999, 0.939999),(0.841270, 0.945611, 0.945611),
(0.857143, 0.951190, 0.951190),(0.873016, 0.956736, 0.956736),
(0.888889, 0.962250, 0.962250),(0.904762, 0.967733, 0.967733),
(0.920635, 0.973185, 0.973185),(0.936508, 0.978607, 0.978607),
(0.952381, 0.983999, 0.983999),(0.968254, 0.989361, 0.989361),
(0.984127, 0.994695, 0.994695),(1.0, 1.0, 1.0)),
'blue': ((0., 0., 0.),(0.015873, 0.102869, 0.102869),
(0.031746, 0.145479, 0.145479),(0.047619, 0.178174, 0.178174),
(0.063492, 0.205738, 0.205738),(0.079365, 0.230022, 0.230022),
(0.095238, 0.251976, 0.251976),(0.111111, 0.272166, 0.272166),
(0.126984, 0.290957, 0.290957),(0.142857, 0.308607, 0.308607),
(0.158730, 0.325300, 0.325300),(0.174603, 0.341178, 0.341178),
(0.190476, 0.356348, 0.356348),(0.206349, 0.370899, 0.370899),
(0.222222, 0.384900, 0.384900),(0.238095, 0.398410, 0.398410),
(0.253968, 0.411476, 0.411476),(0.269841, 0.424139, 0.424139),
(0.285714, 0.436436, 0.436436),(0.301587, 0.448395, 0.448395),
(0.317460, 0.460044, 0.460044),(0.333333, 0.471405, 0.471405),
(0.349206, 0.482498, 0.482498),(0.365079, 0.493342, 0.493342),
(0.380952, 0.503953, 0.503953),(0.396825, 0.514344, 0.514344),
(0.412698, 0.524531, 0.524531),(0.428571, 0.534522, 0.534522),
(0.444444, 0.544331, 0.544331),(0.460317, 0.553966, 0.553966),
(0.476190, 0.563436, 0.563436),(0.492063, 0.572750, 0.572750),
(0.507937, 0.581914, 0.581914),(0.523810, 0.590937, 0.590937),
(0.539683, 0.599824, 0.599824),(0.555556, 0.608581, 0.608581),
(0.571429, 0.617213, 0.617213),(0.587302, 0.625727, 0.625727),
(0.603175, 0.634126, 0.634126),(0.619048, 0.642416, 0.642416),
(0.634921, 0.650600, 0.650600),(0.650794, 0.658682, 0.658682),
(0.666667, 0.666667, 0.666667),(0.682540, 0.674556, 0.674556),
(0.698413, 0.682355, 0.682355),(0.714286, 0.690066, 0.690066),
(0.730159, 0.697691, 0.697691),(0.746032, 0.705234, 0.705234),
(0.761905, 0.727166, 0.727166),(0.777778, 0.748455, 0.748455),
(0.793651, 0.769156, 0.769156),(0.809524, 0.789314, 0.789314),
(0.825397, 0.808969, 0.808969),(0.841270, 0.828159, 0.828159),
(0.857143, 0.846913, 0.846913),(0.873016, 0.865261, 0.865261),
(0.888889, 0.883229, 0.883229),(0.904762, 0.900837, 0.900837),
(0.920635, 0.918109, 0.918109),(0.936508, 0.935061, 0.935061),
(0.952381, 0.951711, 0.951711),(0.968254, 0.968075, 0.968075),
(0.984127, 0.984167, 0.984167),(1.0, 1.0, 1.0))}
_prism_data = {'red': ((0., 1., 1.),(0.031746, 1.000000, 1.000000),
(0.047619, 0.000000, 0.000000),(0.063492, 0.000000, 0.000000),
(0.079365, 0.666667, 0.666667),(0.095238, 1.000000, 1.000000),
(0.126984, 1.000000, 1.000000),(0.142857, 0.000000, 0.000000),
(0.158730, 0.000000, 0.000000),(0.174603, 0.666667, 0.666667),
(0.190476, 1.000000, 1.000000),(0.222222, 1.000000, 1.000000),
(0.238095, 0.000000, 0.000000),(0.253968, 0.000000, 0.000000),
(0.269841, 0.666667, 0.666667),(0.285714, 1.000000, 1.000000),
(0.317460, 1.000000, 1.000000),(0.333333, 0.000000, 0.000000),
(0.349206, 0.000000, 0.000000),(0.365079, 0.666667, 0.666667),
(0.380952, 1.000000, 1.000000),(0.412698, 1.000000, 1.000000),
(0.428571, 0.000000, 0.000000),(0.444444, 0.000000, 0.000000),
(0.460317, 0.666667, 0.666667),(0.476190, 1.000000, 1.000000),
(0.507937, 1.000000, 1.000000),(0.523810, 0.000000, 0.000000),
(0.539683, 0.000000, 0.000000),(0.555556, 0.666667, 0.666667),
(0.571429, 1.000000, 1.000000),(0.603175, 1.000000, 1.000000),
(0.619048, 0.000000, 0.000000),(0.634921, 0.000000, 0.000000),
(0.650794, 0.666667, 0.666667),(0.666667, 1.000000, 1.000000),
(0.698413, 1.000000, 1.000000),(0.714286, 0.000000, 0.000000),
(0.730159, 0.000000, 0.000000),(0.746032, 0.666667, 0.666667),
(0.761905, 1.000000, 1.000000),(0.793651, 1.000000, 1.000000),
(0.809524, 0.000000, 0.000000),(0.825397, 0.000000, 0.000000),
(0.841270, 0.666667, 0.666667),(0.857143, 1.000000, 1.000000),
(0.888889, 1.000000, 1.000000),(0.904762, 0.000000, 0.000000),
(0.920635, 0.000000, 0.000000),(0.936508, 0.666667, 0.666667),
(0.952381, 1.000000, 1.000000),(0.984127, 1.000000, 1.000000),
(1.0, 0.0, 0.0)),
'green': ((0., 0., 0.),(0.031746, 1.000000, 1.000000),
(0.047619, 1.000000, 1.000000),(0.063492, 0.000000, 0.000000),
(0.095238, 0.000000, 0.000000),(0.126984, 1.000000, 1.000000),
(0.142857, 1.000000, 1.000000),(0.158730, 0.000000, 0.000000),
(0.190476, 0.000000, 0.000000),(0.222222, 1.000000, 1.000000),
(0.238095, 1.000000, 1.000000),(0.253968, 0.000000, 0.000000),
(0.285714, 0.000000, 0.000000),(0.317460, 1.000000, 1.000000),
(0.333333, 1.000000, 1.000000),(0.349206, 0.000000, 0.000000),
(0.380952, 0.000000, 0.000000),(0.412698, 1.000000, 1.000000),
(0.428571, 1.000000, 1.000000),(0.444444, 0.000000, 0.000000),
(0.476190, 0.000000, 0.000000),(0.507937, 1.000000, 1.000000),
(0.523810, 1.000000, 1.000000),(0.539683, 0.000000, 0.000000),
(0.571429, 0.000000, 0.000000),(0.603175, 1.000000, 1.000000),
(0.619048, 1.000000, 1.000000),(0.634921, 0.000000, 0.000000),
(0.666667, 0.000000, 0.000000),(0.698413, 1.000000, 1.000000),
(0.714286, 1.000000, 1.000000),(0.730159, 0.000000, 0.000000),
(0.761905, 0.000000, 0.000000),(0.793651, 1.000000, 1.000000),
(0.809524, 1.000000, 1.000000),(0.825397, 0.000000, 0.000000),
(0.857143, 0.000000, 0.000000),(0.888889, 1.000000, 1.000000),
(0.904762, 1.000000, 1.000000),(0.920635, 0.000000, 0.000000),
(0.952381, 0.000000, 0.000000),(0.984127, 1.000000, 1.000000),
(1.0, 1.0, 1.0)),
'blue': ((0., 0., 0.),(0.047619, 0.000000, 0.000000),
(0.063492, 1.000000, 1.000000),(0.079365, 1.000000, 1.000000),
(0.095238, 0.000000, 0.000000),(0.142857, 0.000000, 0.000000),
(0.158730, 1.000000, 1.000000),(0.174603, 1.000000, 1.000000),
(0.190476, 0.000000, 0.000000),(0.238095, 0.000000, 0.000000),
(0.253968, 1.000000, 1.000000),(0.269841, 1.000000, 1.000000),
(0.285714, 0.000000, 0.000000),(0.333333, 0.000000, 0.000000),
(0.349206, 1.000000, 1.000000),(0.365079, 1.000000, 1.000000),
(0.380952, 0.000000, 0.000000),(0.428571, 0.000000, 0.000000),
(0.444444, 1.000000, 1.000000),(0.460317, 1.000000, 1.000000),
(0.476190, 0.000000, 0.000000),(0.523810, 0.000000, 0.000000),
(0.539683, 1.000000, 1.000000),(0.555556, 1.000000, 1.000000),
(0.571429, 0.000000, 0.000000),(0.619048, 0.000000, 0.000000),
(0.634921, 1.000000, 1.000000),(0.650794, 1.000000, 1.000000),
(0.666667, 0.000000, 0.000000),(0.714286, 0.000000, 0.000000),
(0.730159, 1.000000, 1.000000),(0.746032, 1.000000, 1.000000),
(0.761905, 0.000000, 0.000000),(0.809524, 0.000000, 0.000000),
(0.825397, 1.000000, 1.000000),(0.841270, 1.000000, 1.000000),
(0.857143, 0.000000, 0.000000),(0.904762, 0.000000, 0.000000),
(0.920635, 1.000000, 1.000000),(0.936508, 1.000000, 1.000000),
(0.952381, 0.000000, 0.000000),(1.0, 0.0, 0.0))}
_spring_data = {'red': ((0., 1., 1.),(1.0, 1.0, 1.0)),
'green': ((0., 0., 0.),(1.0, 1.0, 1.0)),
'blue': ((0., 1., 1.),(1.0, 0.0, 0.0))}
_summer_data = {'red': ((0., 0., 0.),(1.0, 1.0, 1.0)),
'green': ((0., 0.5, 0.5),(1.0, 1.0, 1.0)),
'blue': ((0., 0.4, 0.4),(1.0, 0.4, 0.4))}
_winter_data = {'red': ((0., 0., 0.),(1.0, 0.0, 0.0)),
'green': ((0., 0., 0.),(1.0, 1.0, 1.0)),
'blue': ((0., 1., 1.),(1.0, 0.5, 0.5))}
_spectral_data = {'red': [(0.0, 0.0, 0.0), (0.05, 0.4667, 0.4667),
(0.10, 0.5333, 0.5333), (0.15, 0.0, 0.0),
(0.20, 0.0, 0.0), (0.25, 0.0, 0.0),
(0.30, 0.0, 0.0), (0.35, 0.0, 0.0),
(0.40, 0.0, 0.0), (0.45, 0.0, 0.0),
(0.50, 0.0, 0.0), (0.55, 0.0, 0.0),
(0.60, 0.0, 0.0), (0.65, 0.7333, 0.7333),
(0.70, 0.9333, 0.9333), (0.75, 1.0, 1.0),
(0.80, 1.0, 1.0), (0.85, 1.0, 1.0),
(0.90, 0.8667, 0.8667), (0.95, 0.80, 0.80),
(1.0, 0.80, 0.80)],
'green': [(0.0, 0.0, 0.0), (0.05, 0.0, 0.0),
(0.10, 0.0, 0.0), (0.15, 0.0, 0.0),
(0.20, 0.0, 0.0), (0.25, 0.4667, 0.4667),
(0.30, 0.6000, 0.6000), (0.35, 0.6667, 0.6667),
(0.40, 0.6667, 0.6667), (0.45, 0.6000, 0.6000),
(0.50, 0.7333, 0.7333), (0.55, 0.8667, 0.8667),
(0.60, 1.0, 1.0), (0.65, 1.0, 1.0),
(0.70, 0.9333, 0.9333), (0.75, 0.8000, 0.8000),
(0.80, 0.6000, 0.6000), (0.85, 0.0, 0.0),
(0.90, 0.0, 0.0), (0.95, 0.0, 0.0),
(1.0, 0.80, 0.80)],
'blue': [(0.0, 0.0, 0.0), (0.05, 0.5333, 0.5333),
(0.10, 0.6000, 0.6000), (0.15, 0.6667, 0.6667),
(0.20, 0.8667, 0.8667), (0.25, 0.8667, 0.8667),
(0.30, 0.8667, 0.8667), (0.35, 0.6667, 0.6667),
(0.40, 0.5333, 0.5333), (0.45, 0.0, 0.0),
(0.5, 0.0, 0.0), (0.55, 0.0, 0.0),
(0.60, 0.0, 0.0), (0.65, 0.0, 0.0),
(0.70, 0.0, 0.0), (0.75, 0.0, 0.0),
(0.80, 0.0, 0.0), (0.85, 0.0, 0.0),
(0.90, 0.0, 0.0), (0.95, 0.0, 0.0),
(1.0, 0.80, 0.80)]}
autumn = colors.LinearSegmentedColormap('autumn', _autumn_data, LUTSIZE)
bone = colors.LinearSegmentedColormap('bone ', _bone_data, LUTSIZE)
binary = colors.LinearSegmentedColormap('binary ', _binary_data, LUTSIZE)
cool = colors.LinearSegmentedColormap('cool', _cool_data, LUTSIZE)
copper = colors.LinearSegmentedColormap('copper', _copper_data, LUTSIZE)
flag = colors.LinearSegmentedColormap('flag', _flag_data, LUTSIZE)
gray = colors.LinearSegmentedColormap('gray', _gray_data, LUTSIZE)
hot = colors.LinearSegmentedColormap('hot', _hot_data, LUTSIZE)
hsv = colors.LinearSegmentedColormap('hsv', _hsv_data, LUTSIZE)
jet = colors.LinearSegmentedColormap('jet', _jet_data, LUTSIZE)
pink = colors.LinearSegmentedColormap('pink', _pink_data, LUTSIZE)
prism = colors.LinearSegmentedColormap('prism', _prism_data, LUTSIZE)
spring = colors.LinearSegmentedColormap('spring', _spring_data, LUTSIZE)
summer = colors.LinearSegmentedColormap('summer', _summer_data, LUTSIZE)
winter = colors.LinearSegmentedColormap('winter', _winter_data, LUTSIZE)
spectral = colors.LinearSegmentedColormap('spectral', _spectral_data, LUTSIZE)
datad = {
'autumn': _autumn_data,
'bone': _bone_data,
'binary': _binary_data,
'cool': _cool_data,
'copper': _copper_data,
'flag': _flag_data,
'gray' : _gray_data,
'hot': _hot_data,
'hsv': _hsv_data,
'jet' : _jet_data,
'pink': _pink_data,
'prism': _prism_data,
'spring': _spring_data,
'summer': _summer_data,
'winter': _winter_data,
'spectral': _spectral_data
}
# 34 colormaps based on color specifications and designs
# developed by Cynthia Brewer (http://colorbrewer.org).
# The ColorBrewer palettes have been included under the terms
# of an Apache-stype license (for details, see the file
# LICENSE_COLORBREWER in the license directory of the matplotlib
# source distribution).
_Accent_data = {'blue': [(0.0, 0.49803921580314636,
0.49803921580314636), (0.14285714285714285, 0.83137255907058716,
0.83137255907058716), (0.2857142857142857, 0.52549022436141968,
0.52549022436141968), (0.42857142857142855, 0.60000002384185791,
0.60000002384185791), (0.5714285714285714, 0.69019609689712524,
0.69019609689712524), (0.7142857142857143, 0.49803921580314636,
0.49803921580314636), (0.8571428571428571, 0.090196080505847931,
0.090196080505847931), (1.0, 0.40000000596046448,
0.40000000596046448)],
'green': [(0.0, 0.78823530673980713, 0.78823530673980713),
(0.14285714285714285, 0.68235296010971069, 0.68235296010971069),
(0.2857142857142857, 0.75294119119644165, 0.75294119119644165),
(0.42857142857142855, 1.0, 1.0), (0.5714285714285714,
0.42352941632270813, 0.42352941632270813), (0.7142857142857143,
0.0078431377187371254, 0.0078431377187371254),
(0.8571428571428571, 0.35686275362968445, 0.35686275362968445),
(1.0, 0.40000000596046448, 0.40000000596046448)],
'red': [(0.0, 0.49803921580314636, 0.49803921580314636),
(0.14285714285714285, 0.7450980544090271, 0.7450980544090271),
(0.2857142857142857, 0.99215686321258545, 0.99215686321258545),
(0.42857142857142855, 1.0, 1.0), (0.5714285714285714,
0.21960784494876862, 0.21960784494876862), (0.7142857142857143,
0.94117647409439087, 0.94117647409439087), (0.8571428571428571,
0.74901962280273438, 0.74901962280273438), (1.0,
0.40000000596046448, 0.40000000596046448)]}
_Blues_data = {'blue': [(0.0, 1.0, 1.0), (0.125, 0.9686274528503418,
0.9686274528503418), (0.25, 0.93725490570068359, 0.93725490570068359),
(0.375, 0.88235294818878174, 0.88235294818878174), (0.5,
0.83921569585800171, 0.83921569585800171), (0.625, 0.7764706015586853,
0.7764706015586853), (0.75, 0.70980393886566162, 0.70980393886566162),
(0.875, 0.61176472902297974, 0.61176472902297974), (1.0,
0.41960784792900085, 0.41960784792900085)],
'green': [(0.0, 0.9843137264251709, 0.9843137264251709), (0.125,
0.92156863212585449, 0.92156863212585449), (0.25,
0.85882353782653809, 0.85882353782653809), (0.375,
0.7921568751335144, 0.7921568751335144), (0.5,
0.68235296010971069, 0.68235296010971069), (0.625,
0.57254904508590698, 0.57254904508590698), (0.75,
0.44313725829124451, 0.44313725829124451), (0.875,
0.31764706969261169, 0.31764706969261169), (1.0,
0.18823529779911041, 0.18823529779911041)],
'red': [(0.0, 0.9686274528503418, 0.9686274528503418), (0.125,
0.87058824300765991, 0.87058824300765991), (0.25,
0.7764706015586853, 0.7764706015586853), (0.375,
0.61960786581039429, 0.61960786581039429), (0.5,
0.41960784792900085, 0.41960784792900085), (0.625,
0.25882354378700256, 0.25882354378700256), (0.75,
0.12941177189350128, 0.12941177189350128), (0.875,
0.031372550874948502, 0.031372550874948502), (1.0,
0.031372550874948502, 0.031372550874948502)]}
_BrBG_data = {'blue': [(0.0, 0.019607843831181526,
0.019607843831181526), (0.10000000000000001, 0.039215687662363052,
0.039215687662363052), (0.20000000000000001, 0.17647059261798859,
0.17647059261798859), (0.29999999999999999, 0.49019607901573181,
0.49019607901573181), (0.40000000000000002, 0.76470589637756348,
0.76470589637756348), (0.5, 0.96078431606292725, 0.96078431606292725),
(0.59999999999999998, 0.89803922176361084, 0.89803922176361084),
(0.69999999999999996, 0.75686275959014893, 0.75686275959014893),
(0.80000000000000004, 0.56078433990478516, 0.56078433990478516),
(0.90000000000000002, 0.36862745881080627, 0.36862745881080627), (1.0,
0.18823529779911041, 0.18823529779911041)],
'green': [(0.0, 0.18823529779911041, 0.18823529779911041),
(0.10000000000000001, 0.31764706969261169, 0.31764706969261169),
(0.20000000000000001, 0.5058823823928833, 0.5058823823928833),
(0.29999999999999999, 0.7607843279838562, 0.7607843279838562),
(0.40000000000000002, 0.90980392694473267, 0.90980392694473267),
(0.5, 0.96078431606292725, 0.96078431606292725),
(0.59999999999999998, 0.91764706373214722, 0.91764706373214722),
(0.69999999999999996, 0.80392158031463623, 0.80392158031463623),
(0.80000000000000004, 0.59215688705444336, 0.59215688705444336),
(0.90000000000000002, 0.40000000596046448, 0.40000000596046448),
(1.0, 0.23529411852359772, 0.23529411852359772)],
'red': [(0.0, 0.32941177487373352, 0.32941177487373352),
(0.10000000000000001, 0.54901963472366333, 0.54901963472366333),
(0.20000000000000001, 0.74901962280273438, 0.74901962280273438),
(0.29999999999999999, 0.87450981140136719, 0.87450981140136719),
(0.40000000000000002, 0.96470588445663452, 0.96470588445663452),
(0.5, 0.96078431606292725, 0.96078431606292725),
(0.59999999999999998, 0.78039216995239258, 0.78039216995239258),
(0.69999999999999996, 0.50196081399917603, 0.50196081399917603),
(0.80000000000000004, 0.20784313976764679, 0.20784313976764679),
(0.90000000000000002, 0.0039215688593685627,
0.0039215688593685627), (1.0, 0.0, 0.0)]}
_BuGn_data = {'blue': [(0.0, 0.99215686321258545,
0.99215686321258545), (0.125, 0.97647058963775635,
0.97647058963775635), (0.25, 0.90196079015731812,
0.90196079015731812), (0.375, 0.78823530673980713,
0.78823530673980713), (0.5, 0.64313727617263794, 0.64313727617263794),
(0.625, 0.46274510025978088, 0.46274510025978088), (0.75,
0.27058824896812439, 0.27058824896812439), (0.875,
0.17254902422428131, 0.17254902422428131), (1.0, 0.10588235408067703,
0.10588235408067703)],
'green': [(0.0, 0.98823529481887817, 0.98823529481887817), (0.125,
0.96078431606292725, 0.96078431606292725), (0.25,
0.92549020051956177, 0.92549020051956177), (0.375,
0.84705883264541626, 0.84705883264541626), (0.5,
0.7607843279838562, 0.7607843279838562), (0.625,
0.68235296010971069, 0.68235296010971069), (0.75,
0.54509806632995605, 0.54509806632995605), (0.875,
0.42745098471641541, 0.42745098471641541), (1.0,
0.26666668057441711, 0.26666668057441711)], 'red': [(0.0,
0.9686274528503418, 0.9686274528503418), (0.125,
0.89803922176361084, 0.89803922176361084), (0.25,
0.80000001192092896, 0.80000001192092896), (0.375,
0.60000002384185791, 0.60000002384185791), (0.5,
0.40000000596046448, 0.40000000596046448), (0.625,
0.25490197539329529, 0.25490197539329529), (0.75,
0.13725490868091583, 0.13725490868091583), (0.875, 0.0, 0.0),
(1.0, 0.0, 0.0)]}
_BuPu_data = {'blue': [(0.0, 0.99215686321258545,
0.99215686321258545), (0.125, 0.95686274766921997,
0.95686274766921997), (0.25, 0.90196079015731812,
0.90196079015731812), (0.375, 0.85490196943283081,
0.85490196943283081), (0.5, 0.7764706015586853, 0.7764706015586853),
(0.625, 0.69411766529083252, 0.69411766529083252), (0.75,
0.61568629741668701, 0.61568629741668701), (0.875,
0.48627451062202454, 0.48627451062202454), (1.0, 0.29411765933036804,
0.29411765933036804)],
'green': [(0.0, 0.98823529481887817, 0.98823529481887817), (0.125,
0.92549020051956177, 0.92549020051956177), (0.25,
0.82745099067687988, 0.82745099067687988), (0.375,
0.73725491762161255, 0.73725491762161255), (0.5,
0.58823531866073608, 0.58823531866073608), (0.625,
0.41960784792900085, 0.41960784792900085), (0.75,
0.25490197539329529, 0.25490197539329529), (0.875,
0.058823529630899429, 0.058823529630899429), (1.0, 0.0, 0.0)],
'red': [(0.0, 0.9686274528503418, 0.9686274528503418), (0.125,
0.87843137979507446, 0.87843137979507446), (0.25,
0.74901962280273438, 0.74901962280273438), (0.375,
0.61960786581039429, 0.61960786581039429), (0.5,
0.54901963472366333, 0.54901963472366333), (0.625,
0.54901963472366333, 0.54901963472366333), (0.75,
0.53333336114883423, 0.53333336114883423), (0.875,
0.5058823823928833, 0.5058823823928833), (1.0,
0.30196079611778259, 0.30196079611778259)]}
_Dark2_data = {'blue': [(0.0, 0.46666666865348816,
0.46666666865348816), (0.14285714285714285, 0.0078431377187371254,
0.0078431377187371254), (0.2857142857142857, 0.70196080207824707,
0.70196080207824707), (0.42857142857142855, 0.54117649793624878,
0.54117649793624878), (0.5714285714285714, 0.11764705926179886,
0.11764705926179886), (0.7142857142857143, 0.0078431377187371254,
0.0078431377187371254), (0.8571428571428571, 0.11372549086809158,
0.11372549086809158), (1.0, 0.40000000596046448,
0.40000000596046448)],
'green': [(0.0, 0.61960786581039429, 0.61960786581039429),
(0.14285714285714285, 0.37254902720451355, 0.37254902720451355),
(0.2857142857142857, 0.43921568989753723, 0.43921568989753723),
(0.42857142857142855, 0.16078431904315948, 0.16078431904315948),
(0.5714285714285714, 0.65098041296005249, 0.65098041296005249),
(0.7142857142857143, 0.67058825492858887, 0.67058825492858887),
(0.8571428571428571, 0.46274510025978088, 0.46274510025978088),
(1.0, 0.40000000596046448, 0.40000000596046448)],
'red': [(0.0, 0.10588235408067703, 0.10588235408067703),
(0.14285714285714285, 0.85098040103912354, 0.85098040103912354),
(0.2857142857142857, 0.45882353186607361, 0.45882353186607361),
(0.42857142857142855, 0.90588235855102539, 0.90588235855102539),
(0.5714285714285714, 0.40000000596046448, 0.40000000596046448),
(0.7142857142857143, 0.90196079015731812, 0.90196079015731812),
(0.8571428571428571, 0.65098041296005249, 0.65098041296005249),
(1.0, 0.40000000596046448, 0.40000000596046448)]}
_GnBu_data = {'blue': [(0.0, 0.94117647409439087,
0.94117647409439087), (0.125, 0.85882353782653809,
0.85882353782653809), (0.25, 0.77254903316497803,
0.77254903316497803), (0.375, 0.70980393886566162,
0.70980393886566162), (0.5, 0.76862746477127075, 0.76862746477127075),
(0.625, 0.82745099067687988, 0.82745099067687988), (0.75,
0.7450980544090271, 0.7450980544090271), (0.875, 0.67450982332229614,
0.67450982332229614), (1.0, 0.5058823823928833, 0.5058823823928833)],
'green': [(0.0, 0.98823529481887817, 0.98823529481887817), (0.125,
0.9529411792755127, 0.9529411792755127), (0.25,
0.92156863212585449, 0.92156863212585449), (0.375,
0.86666667461395264, 0.86666667461395264), (0.5,
0.80000001192092896, 0.80000001192092896), (0.625,
0.70196080207824707, 0.70196080207824707), (0.75,
0.54901963472366333, 0.54901963472366333), (0.875,
0.40784314274787903, 0.40784314274787903), (1.0,
0.25098040699958801, 0.25098040699958801)],
'red': [(0.0, 0.9686274528503418, 0.9686274528503418), (0.125,
0.87843137979507446, 0.87843137979507446), (0.25,
0.80000001192092896, 0.80000001192092896), (0.375,
0.65882354974746704, 0.65882354974746704), (0.5,
0.48235294222831726, 0.48235294222831726), (0.625,
0.30588236451148987, 0.30588236451148987), (0.75,
0.16862745583057404, 0.16862745583057404), (0.875,
0.031372550874948502, 0.031372550874948502), (1.0,
0.031372550874948502, 0.031372550874948502)]}
_Greens_data = {'blue': [(0.0, 0.96078431606292725,
0.96078431606292725), (0.125, 0.87843137979507446,
0.87843137979507446), (0.25, 0.75294119119644165,
0.75294119119644165), (0.375, 0.60784316062927246,
0.60784316062927246), (0.5, 0.46274510025978088, 0.46274510025978088),
(0.625, 0.364705890417099, 0.364705890417099), (0.75,
0.27058824896812439, 0.27058824896812439), (0.875,
0.17254902422428131, 0.17254902422428131), (1.0, 0.10588235408067703,
0.10588235408067703)],
'green': [(0.0, 0.98823529481887817, 0.98823529481887817), (0.125,
0.96078431606292725, 0.96078431606292725), (0.25,
0.91372549533843994, 0.91372549533843994), (0.375,
0.85098040103912354, 0.85098040103912354), (0.5,
0.76862746477127075, 0.76862746477127075), (0.625,
0.67058825492858887, 0.67058825492858887), (0.75,
0.54509806632995605, 0.54509806632995605), (0.875,
0.42745098471641541, 0.42745098471641541), (1.0,
0.26666668057441711, 0.26666668057441711)],
'red': [(0.0, 0.9686274528503418, 0.9686274528503418), (0.125,
0.89803922176361084, 0.89803922176361084), (0.25,
0.78039216995239258, 0.78039216995239258), (0.375,
0.63137257099151611, 0.63137257099151611), (0.5,
0.45490196347236633, 0.45490196347236633), (0.625,
0.25490197539329529, 0.25490197539329529), (0.75,
0.13725490868091583, 0.13725490868091583), (0.875, 0.0, 0.0),
(1.0, 0.0, 0.0)]}
_Greys_data = {'blue': [(0.0, 1.0, 1.0), (0.125, 0.94117647409439087,
0.94117647409439087), (0.25, 0.85098040103912354,
0.85098040103912354), (0.375, 0.74117648601531982,
0.74117648601531982), (0.5, 0.58823531866073608, 0.58823531866073608),
(0.625, 0.45098039507865906, 0.45098039507865906), (0.75,
0.32156863808631897, 0.32156863808631897), (0.875,
0.14509804546833038, 0.14509804546833038), (1.0, 0.0, 0.0)],
'green': [(0.0, 1.0, 1.0), (0.125, 0.94117647409439087,
0.94117647409439087), (0.25, 0.85098040103912354,
0.85098040103912354), (0.375, 0.74117648601531982,
0.74117648601531982), (0.5, 0.58823531866073608,
0.58823531866073608), (0.625, 0.45098039507865906,
0.45098039507865906), (0.75, 0.32156863808631897,
0.32156863808631897), (0.875, 0.14509804546833038,
0.14509804546833038), (1.0, 0.0, 0.0)],
'red': [(0.0, 1.0, 1.0), (0.125, 0.94117647409439087,
0.94117647409439087), (0.25, 0.85098040103912354,
0.85098040103912354), (0.375, 0.74117648601531982,
0.74117648601531982), (0.5, 0.58823531866073608,
0.58823531866073608), (0.625, 0.45098039507865906,
0.45098039507865906), (0.75, 0.32156863808631897,
0.32156863808631897), (0.875, 0.14509804546833038,
0.14509804546833038), (1.0, 0.0, 0.0)]}
_Oranges_data = {'blue': [(0.0, 0.92156863212585449,
0.92156863212585449), (0.125, 0.80784314870834351,
0.80784314870834351), (0.25, 0.63529413938522339,
0.63529413938522339), (0.375, 0.41960784792900085,
0.41960784792900085), (0.5, 0.23529411852359772, 0.23529411852359772),
(0.625, 0.074509806931018829, 0.074509806931018829), (0.75,
0.0039215688593685627, 0.0039215688593685627), (0.875,
0.011764706112444401, 0.011764706112444401), (1.0,
0.015686275437474251, 0.015686275437474251)],
'green': [(0.0, 0.96078431606292725, 0.96078431606292725), (0.125,
0.90196079015731812, 0.90196079015731812), (0.25,
0.81568628549575806, 0.81568628549575806), (0.375,
0.68235296010971069, 0.68235296010971069), (0.5,
0.55294120311737061, 0.55294120311737061), (0.625,
0.4117647111415863, 0.4117647111415863), (0.75,
0.28235295414924622, 0.28235295414924622), (0.875,
0.21176470816135406, 0.21176470816135406), (1.0,
0.15294118225574493, 0.15294118225574493)],
'red': [(0.0, 1.0, 1.0), (0.125, 0.99607843160629272,
0.99607843160629272), (0.25, 0.99215686321258545,
0.99215686321258545), (0.375, 0.99215686321258545,
0.99215686321258545), (0.5, 0.99215686321258545,
0.99215686321258545), (0.625, 0.94509804248809814,
0.94509804248809814), (0.75, 0.85098040103912354,
0.85098040103912354), (0.875, 0.65098041296005249,
0.65098041296005249), (1.0, 0.49803921580314636,
0.49803921580314636)]}
_OrRd_data = {'blue': [(0.0, 0.92549020051956177,
0.92549020051956177), (0.125, 0.78431373834609985,
0.78431373834609985), (0.25, 0.61960786581039429,
0.61960786581039429), (0.375, 0.51764708757400513,
0.51764708757400513), (0.5, 0.3490196168422699, 0.3490196168422699),
(0.625, 0.28235295414924622, 0.28235295414924622), (0.75,
0.12156862765550613, 0.12156862765550613), (0.875, 0.0, 0.0), (1.0,
0.0, 0.0)],
'green': [(0.0, 0.9686274528503418, 0.9686274528503418), (0.125,
0.90980392694473267, 0.90980392694473267), (0.25,
0.83137255907058716, 0.83137255907058716), (0.375,
0.73333334922790527, 0.73333334922790527), (0.5,
0.55294120311737061, 0.55294120311737061), (0.625,
0.3960784375667572, 0.3960784375667572), (0.75,
0.18823529779911041, 0.18823529779911041), (0.875, 0.0, 0.0),
(1.0, 0.0, 0.0)],
'red': [(0.0, 1.0, 1.0), (0.125, 0.99607843160629272,
0.99607843160629272), (0.25, 0.99215686321258545,
0.99215686321258545), (0.375, 0.99215686321258545,
0.99215686321258545), (0.5, 0.98823529481887817,
0.98823529481887817), (0.625, 0.93725490570068359,
0.93725490570068359), (0.75, 0.84313726425170898,
0.84313726425170898), (0.875, 0.70196080207824707,
0.70196080207824707), (1.0, 0.49803921580314636,
0.49803921580314636)]}
_Paired_data = {'blue': [(0.0, 0.89019608497619629,
0.89019608497619629), (0.090909090909090912, 0.70588237047195435,
0.70588237047195435), (0.18181818181818182, 0.54117649793624878,
0.54117649793624878), (0.27272727272727271, 0.17254902422428131,
0.17254902422428131), (0.36363636363636365, 0.60000002384185791,
0.60000002384185791), (0.45454545454545453, 0.10980392247438431,
0.10980392247438431), (0.54545454545454541, 0.43529412150382996,
0.43529412150382996), (0.63636363636363635, 0.0, 0.0),
(0.72727272727272729, 0.83921569585800171, 0.83921569585800171),
(0.81818181818181823, 0.60392159223556519, 0.60392159223556519),
(0.90909090909090906, 0.60000002384185791, 0.60000002384185791), (1.0,
0.15686275064945221, 0.15686275064945221)],
'green': [(0.0, 0.80784314870834351, 0.80784314870834351),
(0.090909090909090912, 0.47058823704719543, 0.47058823704719543),
(0.18181818181818182, 0.87450981140136719, 0.87450981140136719),
(0.27272727272727271, 0.62745100259780884, 0.62745100259780884),
(0.36363636363636365, 0.60392159223556519, 0.60392159223556519),
(0.45454545454545453, 0.10196078568696976, 0.10196078568696976),
(0.54545454545454541, 0.74901962280273438, 0.74901962280273438),
(0.63636363636363635, 0.49803921580314636, 0.49803921580314636),
(0.72727272727272729, 0.69803923368453979, 0.69803923368453979),
(0.81818181818181823, 0.23921568691730499, 0.23921568691730499),
(0.90909090909090906, 1.0, 1.0), (1.0, 0.3490196168422699,
0.3490196168422699)],
'red': [(0.0, 0.65098041296005249, 0.65098041296005249),
(0.090909090909090912, 0.12156862765550613, 0.12156862765550613),
(0.18181818181818182, 0.69803923368453979, 0.69803923368453979),
(0.27272727272727271, 0.20000000298023224, 0.20000000298023224),
(0.36363636363636365, 0.9843137264251709, 0.9843137264251709),
(0.45454545454545453, 0.89019608497619629, 0.89019608497619629),
(0.54545454545454541, 0.99215686321258545, 0.99215686321258545),
(0.63636363636363635, 1.0, 1.0), (0.72727272727272729,
0.7921568751335144, 0.7921568751335144), (0.81818181818181823,
0.41568627953529358, 0.41568627953529358), (0.90909090909090906,
1.0, 1.0), (1.0, 0.69411766529083252, 0.69411766529083252)]}
_Pastel1_data = {'blue': [(0.0, 0.68235296010971069,
0.68235296010971069), (0.125, 0.89019608497619629,
0.89019608497619629), (0.25, 0.77254903316497803,
0.77254903316497803), (0.375, 0.89411765336990356,
0.89411765336990356), (0.5, 0.65098041296005249, 0.65098041296005249),
(0.625, 0.80000001192092896, 0.80000001192092896), (0.75,
0.74117648601531982, 0.74117648601531982), (0.875,
0.92549020051956177, 0.92549020051956177), (1.0, 0.94901961088180542,
0.94901961088180542)],
'green': [(0.0, 0.70588237047195435, 0.70588237047195435), (0.125,
0.80392158031463623, 0.80392158031463623), (0.25,
0.92156863212585449, 0.92156863212585449), (0.375,
0.79607844352722168, 0.79607844352722168), (0.5,
0.85098040103912354, 0.85098040103912354), (0.625, 1.0, 1.0),
(0.75, 0.84705883264541626, 0.84705883264541626), (0.875,
0.85490196943283081, 0.85490196943283081), (1.0,
0.94901961088180542, 0.94901961088180542)],
'red': [(0.0, 0.9843137264251709, 0.9843137264251709), (0.125,
0.70196080207824707, 0.70196080207824707), (0.25,
0.80000001192092896, 0.80000001192092896), (0.375,
0.87058824300765991, 0.87058824300765991), (0.5,
0.99607843160629272, 0.99607843160629272), (0.625, 1.0, 1.0),
(0.75, 0.89803922176361084, 0.89803922176361084), (0.875,
0.99215686321258545, 0.99215686321258545), (1.0,
0.94901961088180542, 0.94901961088180542)]}
_Pastel2_data = {'blue': [(0.0, 0.80392158031463623,
0.80392158031463623), (0.14285714285714285, 0.67450982332229614,
0.67450982332229614), (0.2857142857142857, 0.90980392694473267,
0.90980392694473267), (0.42857142857142855, 0.89411765336990356,
0.89411765336990356), (0.5714285714285714, 0.78823530673980713,
0.78823530673980713), (0.7142857142857143, 0.68235296010971069,
0.68235296010971069), (0.8571428571428571, 0.80000001192092896,
0.80000001192092896), (1.0, 0.80000001192092896,
0.80000001192092896)],
'green': [(0.0, 0.88627451658248901, 0.88627451658248901),
(0.14285714285714285, 0.80392158031463623, 0.80392158031463623),
(0.2857142857142857, 0.83529412746429443, 0.83529412746429443),
(0.42857142857142855, 0.7921568751335144, 0.7921568751335144),
(0.5714285714285714, 0.96078431606292725, 0.96078431606292725),
(0.7142857142857143, 0.94901961088180542, 0.94901961088180542),
(0.8571428571428571, 0.88627451658248901, 0.88627451658248901),
(1.0, 0.80000001192092896, 0.80000001192092896)],
'red': [(0.0, 0.70196080207824707, 0.70196080207824707),
(0.14285714285714285, 0.99215686321258545, 0.99215686321258545),
(0.2857142857142857, 0.79607844352722168, 0.79607844352722168),
(0.42857142857142855, 0.95686274766921997, 0.95686274766921997),
(0.5714285714285714, 0.90196079015731812, 0.90196079015731812),
(0.7142857142857143, 1.0, 1.0), (0.8571428571428571,
0.94509804248809814, 0.94509804248809814), (1.0,
0.80000001192092896, 0.80000001192092896)]}
_PiYG_data = {'blue': [(0.0, 0.32156863808631897,
0.32156863808631897), (0.10000000000000001, 0.49019607901573181,
0.49019607901573181), (0.20000000000000001, 0.68235296010971069,
0.68235296010971069), (0.29999999999999999, 0.85490196943283081,
0.85490196943283081), (0.40000000000000002, 0.93725490570068359,
0.93725490570068359), (0.5, 0.9686274528503418, 0.9686274528503418),
(0.59999999999999998, 0.81568628549575806, 0.81568628549575806),
(0.69999999999999996, 0.52549022436141968, 0.52549022436141968),
(0.80000000000000004, 0.25490197539329529, 0.25490197539329529),
(0.90000000000000002, 0.12941177189350128, 0.12941177189350128), (1.0,
0.098039217293262482, 0.098039217293262482)],
'green': [(0.0, 0.0039215688593685627, 0.0039215688593685627),
(0.10000000000000001, 0.10588235408067703, 0.10588235408067703),
(0.20000000000000001, 0.46666666865348816, 0.46666666865348816),
(0.29999999999999999, 0.7137255072593689, 0.7137255072593689),
(0.40000000000000002, 0.87843137979507446, 0.87843137979507446),
(0.5, 0.9686274528503418, 0.9686274528503418),
(0.59999999999999998, 0.96078431606292725, 0.96078431606292725),
(0.69999999999999996, 0.88235294818878174, 0.88235294818878174),
(0.80000000000000004, 0.73725491762161255, 0.73725491762161255),
(0.90000000000000002, 0.57254904508590698, 0.57254904508590698),
(1.0, 0.39215686917304993, 0.39215686917304993)],
'red': [(0.0, 0.55686277151107788, 0.55686277151107788),
(0.10000000000000001, 0.77254903316497803, 0.77254903316497803),
(0.20000000000000001, 0.87058824300765991, 0.87058824300765991),
(0.29999999999999999, 0.94509804248809814, 0.94509804248809814),
(0.40000000000000002, 0.99215686321258545, 0.99215686321258545),
(0.5, 0.9686274528503418, 0.9686274528503418),
(0.59999999999999998, 0.90196079015731812, 0.90196079015731812),
(0.69999999999999996, 0.72156864404678345, 0.72156864404678345),
(0.80000000000000004, 0.49803921580314636, 0.49803921580314636),
(0.90000000000000002, 0.30196079611778259, 0.30196079611778259),
(1.0, 0.15294118225574493, 0.15294118225574493)]}
_PRGn_data = {'blue': [(0.0, 0.29411765933036804,
0.29411765933036804), (0.10000000000000001, 0.51372551918029785,
0.51372551918029785), (0.20000000000000001, 0.67058825492858887,
0.67058825492858887), (0.29999999999999999, 0.81176471710205078,
0.81176471710205078), (0.40000000000000002, 0.90980392694473267,
0.90980392694473267), (0.5, 0.9686274528503418, 0.9686274528503418),
(0.59999999999999998, 0.82745099067687988, 0.82745099067687988),
(0.69999999999999996, 0.62745100259780884, 0.62745100259780884),
(0.80000000000000004, 0.3803921639919281, 0.3803921639919281),
(0.90000000000000002, 0.21568627655506134, 0.21568627655506134), (1.0,
0.10588235408067703, 0.10588235408067703)],
'green': [(0.0, 0.0, 0.0), (0.10000000000000001,
0.16470588743686676, 0.16470588743686676), (0.20000000000000001,
0.43921568989753723, 0.43921568989753723), (0.29999999999999999,
0.64705884456634521, 0.64705884456634521), (0.40000000000000002,
0.83137255907058716, 0.83137255907058716), (0.5,
0.9686274528503418, 0.9686274528503418), (0.59999999999999998,
0.94117647409439087, 0.94117647409439087), (0.69999999999999996,
0.85882353782653809, 0.85882353782653809), (0.80000000000000004,
0.68235296010971069, 0.68235296010971069), (0.90000000000000002,
0.47058823704719543, 0.47058823704719543), (1.0,
0.26666668057441711, 0.26666668057441711)],
'red': [(0.0, 0.25098040699958801, 0.25098040699958801),
(0.10000000000000001, 0.46274510025978088, 0.46274510025978088),
(0.20000000000000001, 0.60000002384185791, 0.60000002384185791),
(0.29999999999999999, 0.7607843279838562, 0.7607843279838562),
(0.40000000000000002, 0.90588235855102539, 0.90588235855102539),
(0.5, 0.9686274528503418, 0.9686274528503418),
(0.59999999999999998, 0.85098040103912354, 0.85098040103912354),
(0.69999999999999996, 0.65098041296005249, 0.65098041296005249),
(0.80000000000000004, 0.35294118523597717, 0.35294118523597717),
(0.90000000000000002, 0.10588235408067703, 0.10588235408067703),
(1.0, 0.0, 0.0)]}
_PuBu_data = {'blue': [(0.0, 0.9843137264251709, 0.9843137264251709),
(0.125, 0.94901961088180542, 0.94901961088180542), (0.25,
0.90196079015731812, 0.90196079015731812), (0.375,
0.85882353782653809, 0.85882353782653809), (0.5, 0.81176471710205078,
0.81176471710205078), (0.625, 0.75294119119644165,
0.75294119119644165), (0.75, 0.69019609689712524,
0.69019609689712524), (0.875, 0.55294120311737061,
0.55294120311737061), (1.0, 0.34509804844856262,
0.34509804844856262)],
'green': [(0.0, 0.9686274528503418, 0.9686274528503418), (0.125,
0.90588235855102539, 0.90588235855102539), (0.25,
0.81960785388946533, 0.81960785388946533), (0.375,
0.74117648601531982, 0.74117648601531982), (0.5,
0.66274511814117432, 0.66274511814117432), (0.625,
0.56470590829849243, 0.56470590829849243), (0.75,
0.43921568989753723, 0.43921568989753723), (0.875,
0.35294118523597717, 0.35294118523597717), (1.0,
0.21960784494876862, 0.21960784494876862)],
'red': [(0.0, 1.0, 1.0), (0.125, 0.92549020051956177,
0.92549020051956177), (0.25, 0.81568628549575806,
0.81568628549575806), (0.375, 0.65098041296005249,
0.65098041296005249), (0.5, 0.45490196347236633,
0.45490196347236633), (0.625, 0.21176470816135406,
0.21176470816135406), (0.75, 0.019607843831181526,
0.019607843831181526), (0.875, 0.015686275437474251,
0.015686275437474251), (1.0, 0.0078431377187371254,
0.0078431377187371254)]}
_PuBuGn_data = {'blue': [(0.0, 0.9843137264251709,
0.9843137264251709), (0.125, 0.94117647409439087,
0.94117647409439087), (0.25, 0.90196079015731812,
0.90196079015731812), (0.375, 0.85882353782653809,
0.85882353782653809), (0.5, 0.81176471710205078, 0.81176471710205078),
(0.625, 0.75294119119644165, 0.75294119119644165), (0.75,
0.54117649793624878, 0.54117649793624878), (0.875, 0.3490196168422699,
0.3490196168422699), (1.0, 0.21176470816135406, 0.21176470816135406)],
'green': [(0.0, 0.9686274528503418, 0.9686274528503418), (0.125,
0.88627451658248901, 0.88627451658248901), (0.25,
0.81960785388946533, 0.81960785388946533), (0.375,
0.74117648601531982, 0.74117648601531982), (0.5,
0.66274511814117432, 0.66274511814117432), (0.625,
0.56470590829849243, 0.56470590829849243), (0.75,
0.5058823823928833, 0.5058823823928833), (0.875,
0.42352941632270813, 0.42352941632270813), (1.0,
0.27450981736183167, 0.27450981736183167)],
'red': [(0.0, 1.0, 1.0), (0.125, 0.92549020051956177,
0.92549020051956177), (0.25, 0.81568628549575806,
0.81568628549575806), (0.375, 0.65098041296005249,
0.65098041296005249), (0.5, 0.40392157435417175,
0.40392157435417175), (0.625, 0.21176470816135406,
0.21176470816135406), (0.75, 0.0078431377187371254,
0.0078431377187371254), (0.875, 0.0039215688593685627,
0.0039215688593685627), (1.0, 0.0039215688593685627,
0.0039215688593685627)]}
_PuOr_data = {'blue': [(0.0, 0.031372550874948502,
0.031372550874948502), (0.10000000000000001, 0.023529412224888802,
0.023529412224888802), (0.20000000000000001, 0.078431375324726105,
0.078431375324726105), (0.29999999999999999, 0.38823530077934265,
0.38823530077934265), (0.40000000000000002, 0.7137255072593689,
0.7137255072593689), (0.5, 0.9686274528503418, 0.9686274528503418),
(0.59999999999999998, 0.92156863212585449, 0.92156863212585449),
(0.69999999999999996, 0.82352942228317261, 0.82352942228317261),
(0.80000000000000004, 0.67450982332229614, 0.67450982332229614),
(0.90000000000000002, 0.53333336114883423, 0.53333336114883423), (1.0,
0.29411765933036804, 0.29411765933036804)],
'green': [(0.0, 0.23137255012989044, 0.23137255012989044),
(0.10000000000000001, 0.34509804844856262, 0.34509804844856262),
(0.20000000000000001, 0.50980395078659058, 0.50980395078659058),
(0.29999999999999999, 0.72156864404678345, 0.72156864404678345),
(0.40000000000000002, 0.87843137979507446, 0.87843137979507446),
(0.5, 0.9686274528503418, 0.9686274528503418),
(0.59999999999999998, 0.85490196943283081, 0.85490196943283081),
(0.69999999999999996, 0.67058825492858887, 0.67058825492858887),
(0.80000000000000004, 0.45098039507865906, 0.45098039507865906),
(0.90000000000000002, 0.15294118225574493, 0.15294118225574493),
(1.0, 0.0, 0.0)],
'red': [(0.0, 0.49803921580314636, 0.49803921580314636),
(0.10000000000000001, 0.70196080207824707, 0.70196080207824707),
(0.20000000000000001, 0.87843137979507446, 0.87843137979507446),
(0.29999999999999999, 0.99215686321258545, 0.99215686321258545),
(0.40000000000000002, 0.99607843160629272, 0.99607843160629272),
(0.5, 0.9686274528503418, 0.9686274528503418),
(0.59999999999999998, 0.84705883264541626, 0.84705883264541626),
(0.69999999999999996, 0.69803923368453979, 0.69803923368453979),
(0.80000000000000004, 0.50196081399917603, 0.50196081399917603),
(0.90000000000000002, 0.32941177487373352, 0.32941177487373352),
(1.0, 0.17647059261798859, 0.17647059261798859)]}
_PuRd_data = {'blue': [(0.0, 0.97647058963775635,
0.97647058963775635), (0.125, 0.93725490570068359,
0.93725490570068359), (0.25, 0.85490196943283081,
0.85490196943283081), (0.375, 0.78039216995239258,
0.78039216995239258), (0.5, 0.69019609689712524, 0.69019609689712524),
(0.625, 0.54117649793624878, 0.54117649793624878), (0.75,
0.33725491166114807, 0.33725491166114807), (0.875,
0.26274511218070984, 0.26274511218070984), (1.0, 0.12156862765550613,
0.12156862765550613)],
'green': [(0.0, 0.95686274766921997, 0.95686274766921997), (0.125,
0.88235294818878174, 0.88235294818878174), (0.25,
0.72549021244049072, 0.72549021244049072), (0.375,
0.58039218187332153, 0.58039218187332153), (0.5,
0.3960784375667572, 0.3960784375667572), (0.625,
0.16078431904315948, 0.16078431904315948), (0.75,
0.070588238537311554, 0.070588238537311554), (0.875, 0.0, 0.0),
(1.0, 0.0, 0.0)],
'red': [(0.0, 0.9686274528503418, 0.9686274528503418), (0.125,
0.90588235855102539, 0.90588235855102539), (0.25,
0.83137255907058716, 0.83137255907058716), (0.375,
0.78823530673980713, 0.78823530673980713), (0.5,
0.87450981140136719, 0.87450981140136719), (0.625,
0.90588235855102539, 0.90588235855102539), (0.75,
0.80784314870834351, 0.80784314870834351), (0.875,
0.59607845544815063, 0.59607845544815063), (1.0,
0.40392157435417175, 0.40392157435417175)]}
_Purples_data = {'blue': [(0.0, 0.99215686321258545,
0.99215686321258545), (0.125, 0.96078431606292725,
0.96078431606292725), (0.25, 0.92156863212585449,
0.92156863212585449), (0.375, 0.86274510622024536,
0.86274510622024536), (0.5, 0.78431373834609985, 0.78431373834609985),
(0.625, 0.729411780834198, 0.729411780834198), (0.75,
0.63921570777893066, 0.63921570777893066), (0.875,
0.56078433990478516, 0.56078433990478516), (1.0, 0.49019607901573181,
0.49019607901573181)],
'green': [(0.0, 0.9843137264251709, 0.9843137264251709), (0.125,
0.92941176891326904, 0.92941176891326904), (0.25,
0.85490196943283081, 0.85490196943283081), (0.375,
0.74117648601531982, 0.74117648601531982), (0.5,
0.60392159223556519, 0.60392159223556519), (0.625,
0.49019607901573181, 0.49019607901573181), (0.75,
0.31764706969261169, 0.31764706969261169), (0.875,
0.15294118225574493, 0.15294118225574493), (1.0, 0.0, 0.0)],
'red': [(0.0, 0.98823529481887817, 0.98823529481887817), (0.125,
0.93725490570068359, 0.93725490570068359), (0.25,
0.85490196943283081, 0.85490196943283081), (0.375,
0.73725491762161255, 0.73725491762161255), (0.5,
0.61960786581039429, 0.61960786581039429), (0.625,
0.50196081399917603, 0.50196081399917603), (0.75,
0.41568627953529358, 0.41568627953529358), (0.875,
0.32941177487373352, 0.32941177487373352), (1.0,
0.24705882370471954, 0.24705882370471954)]}
_RdBu_data = {'blue': [(0.0, 0.12156862765550613,
0.12156862765550613), (0.10000000000000001, 0.16862745583057404,
0.16862745583057404), (0.20000000000000001, 0.30196079611778259,
0.30196079611778259), (0.29999999999999999, 0.50980395078659058,
0.50980395078659058), (0.40000000000000002, 0.78039216995239258,
0.78039216995239258), (0.5, 0.9686274528503418, 0.9686274528503418),
(0.59999999999999998, 0.94117647409439087, 0.94117647409439087),
(0.69999999999999996, 0.87058824300765991, 0.87058824300765991),
(0.80000000000000004, 0.76470589637756348, 0.76470589637756348),
(0.90000000000000002, 0.67450982332229614, 0.67450982332229614), (1.0,
0.3803921639919281, 0.3803921639919281)],
'green': [(0.0, 0.0, 0.0), (0.10000000000000001,
0.094117648899555206, 0.094117648899555206), (0.20000000000000001,
0.37647059559822083, 0.37647059559822083), (0.29999999999999999,
0.64705884456634521, 0.64705884456634521), (0.40000000000000002,
0.85882353782653809, 0.85882353782653809), (0.5,
0.9686274528503418, 0.9686274528503418), (0.59999999999999998,
0.89803922176361084, 0.89803922176361084), (0.69999999999999996,
0.77254903316497803, 0.77254903316497803), (0.80000000000000004,
0.57647061347961426, 0.57647061347961426), (0.90000000000000002,
0.40000000596046448, 0.40000000596046448), (1.0,
0.18823529779911041, 0.18823529779911041)],
'red': [(0.0, 0.40392157435417175, 0.40392157435417175),
(0.10000000000000001, 0.69803923368453979, 0.69803923368453979),
(0.20000000000000001, 0.83921569585800171, 0.83921569585800171),
(0.29999999999999999, 0.95686274766921997, 0.95686274766921997),
(0.40000000000000002, 0.99215686321258545, 0.99215686321258545),
(0.5, 0.9686274528503418, 0.9686274528503418),
(0.59999999999999998, 0.81960785388946533, 0.81960785388946533),
(0.69999999999999996, 0.57254904508590698, 0.57254904508590698),
(0.80000000000000004, 0.26274511218070984, 0.26274511218070984),
(0.90000000000000002, 0.12941177189350128, 0.12941177189350128),
(1.0, 0.019607843831181526, 0.019607843831181526)]}
_RdGy_data = {'blue': [(0.0, 0.12156862765550613,
0.12156862765550613), (0.10000000000000001, 0.16862745583057404,
0.16862745583057404), (0.20000000000000001, 0.30196079611778259,
0.30196079611778259), (0.29999999999999999, 0.50980395078659058,
0.50980395078659058), (0.40000000000000002, 0.78039216995239258,
0.78039216995239258), (0.5, 1.0, 1.0), (0.59999999999999998,
0.87843137979507446, 0.87843137979507446), (0.69999999999999996,
0.729411780834198, 0.729411780834198), (0.80000000000000004,
0.52941179275512695, 0.52941179275512695), (0.90000000000000002,
0.30196079611778259, 0.30196079611778259), (1.0, 0.10196078568696976,
0.10196078568696976)],
'green': [(0.0, 0.0, 0.0), (0.10000000000000001,
0.094117648899555206, 0.094117648899555206), (0.20000000000000001,
0.37647059559822083, 0.37647059559822083), (0.29999999999999999,
0.64705884456634521, 0.64705884456634521), (0.40000000000000002,
0.85882353782653809, 0.85882353782653809), (0.5, 1.0, 1.0),
(0.59999999999999998, 0.87843137979507446, 0.87843137979507446),
(0.69999999999999996, 0.729411780834198, 0.729411780834198),
(0.80000000000000004, 0.52941179275512695, 0.52941179275512695),
(0.90000000000000002, 0.30196079611778259, 0.30196079611778259),
(1.0, 0.10196078568696976, 0.10196078568696976)],
'red': [(0.0, 0.40392157435417175, 0.40392157435417175),
(0.10000000000000001, 0.69803923368453979, 0.69803923368453979),
(0.20000000000000001, 0.83921569585800171, 0.83921569585800171),
(0.29999999999999999, 0.95686274766921997, 0.95686274766921997),
(0.40000000000000002, 0.99215686321258545, 0.99215686321258545),
(0.5, 1.0, 1.0), (0.59999999999999998, 0.87843137979507446,
0.87843137979507446), (0.69999999999999996, 0.729411780834198,
0.729411780834198), (0.80000000000000004, 0.52941179275512695,
0.52941179275512695), (0.90000000000000002, 0.30196079611778259,
0.30196079611778259), (1.0, 0.10196078568696976,
0.10196078568696976)]}
_RdPu_data = {'blue': [(0.0, 0.9529411792755127, 0.9529411792755127),
(0.125, 0.86666667461395264, 0.86666667461395264), (0.25,
0.75294119119644165, 0.75294119119644165), (0.375,
0.70980393886566162, 0.70980393886566162), (0.5, 0.63137257099151611,
0.63137257099151611), (0.625, 0.59215688705444336,
0.59215688705444336), (0.75, 0.49411764740943909,
0.49411764740943909), (0.875, 0.46666666865348816,
0.46666666865348816), (1.0, 0.41568627953529358,
0.41568627953529358)],
'green': [(0.0, 0.9686274528503418, 0.9686274528503418), (0.125,
0.87843137979507446, 0.87843137979507446), (0.25,
0.77254903316497803, 0.77254903316497803), (0.375,
0.62352943420410156, 0.62352943420410156), (0.5,
0.40784314274787903, 0.40784314274787903), (0.625,
0.20392157137393951, 0.20392157137393951), (0.75,
0.0039215688593685627, 0.0039215688593685627), (0.875,
0.0039215688593685627, 0.0039215688593685627), (1.0, 0.0, 0.0)],
'red': [(0.0, 1.0, 1.0), (0.125, 0.99215686321258545,
0.99215686321258545), (0.25, 0.98823529481887817,
0.98823529481887817), (0.375, 0.98039215803146362,
0.98039215803146362), (0.5, 0.9686274528503418,
0.9686274528503418), (0.625, 0.86666667461395264,
0.86666667461395264), (0.75, 0.68235296010971069,
0.68235296010971069), (0.875, 0.47843137383460999,
0.47843137383460999), (1.0, 0.28627452254295349,
0.28627452254295349)]}
_RdYlBu_data = {'blue': [(0.0, 0.14901961386203766,
0.14901961386203766), (0.10000000149011612,
0.15294118225574493, 0.15294118225574493),
(0.20000000298023224, 0.26274511218070984,
0.26274511218070984), (0.30000001192092896,
0.3803921639919281, 0.3803921639919281),
(0.40000000596046448, 0.56470590829849243,
0.56470590829849243), (0.5, 0.74901962280273438,
0.74901962280273438), (0.60000002384185791,
0.97254902124404907, 0.97254902124404907),
(0.69999998807907104, 0.91372549533843994,
0.91372549533843994), (0.80000001192092896,
0.81960785388946533, 0.81960785388946533),
(0.89999997615814209, 0.70588237047195435,
0.70588237047195435), (1.0, 0.58431375026702881,
0.58431375026702881)], 'green': [(0.0, 0.0, 0.0),
(0.10000000149011612, 0.18823529779911041,
0.18823529779911041), (0.20000000298023224,
0.42745098471641541, 0.42745098471641541),
(0.30000001192092896, 0.68235296010971069,
0.68235296010971069), (0.40000000596046448,
0.87843137979507446, 0.87843137979507446), (0.5, 1.0,
1.0), (0.60000002384185791, 0.9529411792755127,
0.9529411792755127), (0.69999998807907104,
0.85098040103912354, 0.85098040103912354),
(0.80000001192092896, 0.67843139171600342,
0.67843139171600342), (0.89999997615814209,
0.45882353186607361, 0.45882353186607361), (1.0,
0.21176470816135406, 0.21176470816135406)], 'red':
[(0.0, 0.64705884456634521, 0.64705884456634521),
(0.10000000149011612, 0.84313726425170898,
0.84313726425170898), (0.20000000298023224,
0.95686274766921997, 0.95686274766921997),
(0.30000001192092896, 0.99215686321258545,
0.99215686321258545), (0.40000000596046448,
0.99607843160629272, 0.99607843160629272), (0.5, 1.0,
1.0), (0.60000002384185791, 0.87843137979507446,
0.87843137979507446), (0.69999998807907104,
0.67058825492858887, 0.67058825492858887),
(0.80000001192092896, 0.45490196347236633,
0.45490196347236633), (0.89999997615814209,
0.27058824896812439, 0.27058824896812439), (1.0,
0.19215686619281769, 0.19215686619281769)]}
_RdYlGn_data = {'blue': [(0.0, 0.14901961386203766,
0.14901961386203766), (0.10000000000000001, 0.15294118225574493,
0.15294118225574493), (0.20000000000000001, 0.26274511218070984,
0.26274511218070984), (0.29999999999999999, 0.3803921639919281,
0.3803921639919281), (0.40000000000000002, 0.54509806632995605,
0.54509806632995605), (0.5, 0.74901962280273438, 0.74901962280273438),
(0.59999999999999998, 0.54509806632995605, 0.54509806632995605),
(0.69999999999999996, 0.41568627953529358, 0.41568627953529358),
(0.80000000000000004, 0.38823530077934265, 0.38823530077934265),
(0.90000000000000002, 0.31372550129890442, 0.31372550129890442), (1.0,
0.21568627655506134, 0.21568627655506134)],
'green': [(0.0, 0.0, 0.0), (0.10000000000000001,
0.18823529779911041, 0.18823529779911041), (0.20000000000000001,
0.42745098471641541, 0.42745098471641541), (0.29999999999999999,
0.68235296010971069, 0.68235296010971069), (0.40000000000000002,
0.87843137979507446, 0.87843137979507446), (0.5, 1.0, 1.0),
(0.59999999999999998, 0.93725490570068359, 0.93725490570068359),
(0.69999999999999996, 0.85098040103912354, 0.85098040103912354),
(0.80000000000000004, 0.74117648601531982, 0.74117648601531982),
(0.90000000000000002, 0.59607845544815063, 0.59607845544815063),
(1.0, 0.40784314274787903, 0.40784314274787903)],
'red': [(0.0, 0.64705884456634521, 0.64705884456634521),
(0.10000000000000001, 0.84313726425170898, 0.84313726425170898),
(0.20000000000000001, 0.95686274766921997, 0.95686274766921997),
(0.29999999999999999, 0.99215686321258545, 0.99215686321258545),
(0.40000000000000002, 0.99607843160629272, 0.99607843160629272),
(0.5, 1.0, 1.0), (0.59999999999999998, 0.85098040103912354,
0.85098040103912354), (0.69999999999999996, 0.65098041296005249,
0.65098041296005249), (0.80000000000000004, 0.40000000596046448,
0.40000000596046448), (0.90000000000000002, 0.10196078568696976,
0.10196078568696976), (1.0, 0.0, 0.0)]}
_Reds_data = {'blue': [(0.0, 0.94117647409439087,
0.94117647409439087), (0.125, 0.82352942228317261,
0.82352942228317261), (0.25, 0.63137257099151611,
0.63137257099151611), (0.375, 0.44705882668495178,
0.44705882668495178), (0.5, 0.29019609093666077, 0.29019609093666077),
(0.625, 0.17254902422428131, 0.17254902422428131), (0.75,
0.11372549086809158, 0.11372549086809158), (0.875,
0.08235294371843338, 0.08235294371843338), (1.0, 0.050980392843484879,
0.050980392843484879)],
'green': [(0.0, 0.96078431606292725, 0.96078431606292725), (0.125,
0.87843137979507446, 0.87843137979507446), (0.25,
0.73333334922790527, 0.73333334922790527), (0.375,
0.57254904508590698, 0.57254904508590698), (0.5,
0.41568627953529358, 0.41568627953529358), (0.625,
0.23137255012989044, 0.23137255012989044), (0.75,
0.094117648899555206, 0.094117648899555206), (0.875,
0.058823529630899429, 0.058823529630899429), (1.0, 0.0, 0.0)],
'red': [(0.0, 1.0, 1.0), (0.125, 0.99607843160629272,
0.99607843160629272), (0.25, 0.98823529481887817,
0.98823529481887817), (0.375, 0.98823529481887817,
0.98823529481887817), (0.5, 0.9843137264251709,
0.9843137264251709), (0.625, 0.93725490570068359,
0.93725490570068359), (0.75, 0.79607844352722168,
0.79607844352722168), (0.875, 0.64705884456634521,
0.64705884456634521), (1.0, 0.40392157435417175,
0.40392157435417175)]}
_Set1_data = {'blue': [(0.0, 0.10980392247438431,
0.10980392247438431), (0.125, 0.72156864404678345,
0.72156864404678345), (0.25, 0.29019609093666077,
0.29019609093666077), (0.375, 0.63921570777893066,
0.63921570777893066), (0.5, 0.0, 0.0), (0.625, 0.20000000298023224,
0.20000000298023224), (0.75, 0.15686275064945221,
0.15686275064945221), (0.875, 0.74901962280273438,
0.74901962280273438), (1.0, 0.60000002384185791,
0.60000002384185791)],
'green': [(0.0, 0.10196078568696976, 0.10196078568696976), (0.125,
0.49411764740943909, 0.49411764740943909), (0.25,
0.68627452850341797, 0.68627452850341797), (0.375,
0.30588236451148987, 0.30588236451148987), (0.5,
0.49803921580314636, 0.49803921580314636), (0.625, 1.0, 1.0),
(0.75, 0.33725491166114807, 0.33725491166114807), (0.875,
0.5058823823928833, 0.5058823823928833), (1.0,
0.60000002384185791, 0.60000002384185791)],
'red': [(0.0, 0.89411765336990356, 0.89411765336990356), (0.125,
0.21568627655506134, 0.21568627655506134), (0.25,
0.30196079611778259, 0.30196079611778259), (0.375,
0.59607845544815063, 0.59607845544815063), (0.5, 1.0, 1.0),
(0.625, 1.0, 1.0), (0.75, 0.65098041296005249,
0.65098041296005249), (0.875, 0.9686274528503418,
0.9686274528503418), (1.0, 0.60000002384185791,
0.60000002384185791)]}
_Set2_data = {'blue': [(0.0, 0.64705884456634521,
0.64705884456634521), (0.14285714285714285, 0.38431373238563538,
0.38431373238563538), (0.2857142857142857, 0.79607844352722168,
0.79607844352722168), (0.42857142857142855, 0.76470589637756348,
0.76470589637756348), (0.5714285714285714, 0.32941177487373352,
0.32941177487373352), (0.7142857142857143, 0.18431372940540314,
0.18431372940540314), (0.8571428571428571, 0.58039218187332153,
0.58039218187332153), (1.0, 0.70196080207824707,
0.70196080207824707)],
'green': [(0.0, 0.7607843279838562, 0.7607843279838562),
(0.14285714285714285, 0.55294120311737061, 0.55294120311737061),
(0.2857142857142857, 0.62745100259780884, 0.62745100259780884),
(0.42857142857142855, 0.54117649793624878, 0.54117649793624878),
(0.5714285714285714, 0.84705883264541626, 0.84705883264541626),
(0.7142857142857143, 0.85098040103912354, 0.85098040103912354),
(0.8571428571428571, 0.76862746477127075, 0.76862746477127075),
(1.0, 0.70196080207824707, 0.70196080207824707)],
'red': [(0.0, 0.40000000596046448, 0.40000000596046448),
(0.14285714285714285, 0.98823529481887817, 0.98823529481887817),
(0.2857142857142857, 0.55294120311737061, 0.55294120311737061),
(0.42857142857142855, 0.90588235855102539, 0.90588235855102539),
(0.5714285714285714, 0.65098041296005249, 0.65098041296005249),
(0.7142857142857143, 1.0, 1.0), (0.8571428571428571,
0.89803922176361084, 0.89803922176361084), (1.0,
0.70196080207824707, 0.70196080207824707)]}
_Set3_data = {'blue': [(0.0, 0.78039216995239258,
0.78039216995239258), (0.090909090909090912, 0.70196080207824707,
0.70196080207824707), (0.18181818181818182, 0.85490196943283081,
0.85490196943283081), (0.27272727272727271, 0.44705882668495178,
0.44705882668495178), (0.36363636363636365, 0.82745099067687988,
0.82745099067687988), (0.45454545454545453, 0.38431373238563538,
0.38431373238563538), (0.54545454545454541, 0.4117647111415863,
0.4117647111415863), (0.63636363636363635, 0.89803922176361084,
0.89803922176361084), (0.72727272727272729, 0.85098040103912354,
0.85098040103912354), (0.81818181818181823, 0.74117648601531982,
0.74117648601531982), (0.90909090909090906, 0.77254903316497803,
0.77254903316497803), (1.0, 0.43529412150382996,
0.43529412150382996)],
'green': [(0.0, 0.82745099067687988, 0.82745099067687988),
(0.090909090909090912, 1.0, 1.0), (0.18181818181818182,
0.729411780834198, 0.729411780834198), (0.27272727272727271,
0.50196081399917603, 0.50196081399917603), (0.36363636363636365,
0.69411766529083252, 0.69411766529083252), (0.45454545454545453,
0.70588237047195435, 0.70588237047195435), (0.54545454545454541,
0.87058824300765991, 0.87058824300765991), (0.63636363636363635,
0.80392158031463623, 0.80392158031463623), (0.72727272727272729,
0.85098040103912354, 0.85098040103912354), (0.81818181818181823,
0.50196081399917603, 0.50196081399917603), (0.90909090909090906,
0.92156863212585449, 0.92156863212585449), (1.0,
0.92941176891326904, 0.92941176891326904)],
'red': [(0.0, 0.55294120311737061, 0.55294120311737061),
(0.090909090909090912, 1.0, 1.0), (0.18181818181818182,
0.7450980544090271, 0.7450980544090271), (0.27272727272727271,
0.9843137264251709, 0.9843137264251709), (0.36363636363636365,
0.50196081399917603, 0.50196081399917603), (0.45454545454545453,
0.99215686321258545, 0.99215686321258545), (0.54545454545454541,
0.70196080207824707, 0.70196080207824707), (0.63636363636363635,
0.98823529481887817, 0.98823529481887817), (0.72727272727272729,
0.85098040103912354, 0.85098040103912354), (0.81818181818181823,
0.73725491762161255, 0.73725491762161255), (0.90909090909090906,
0.80000001192092896, 0.80000001192092896), (1.0, 1.0, 1.0)]}
_Spectral_data = {'blue': [(0.0, 0.25882354378700256,
0.25882354378700256), (0.10000000000000001, 0.30980393290519714,
0.30980393290519714), (0.20000000000000001, 0.26274511218070984,
0.26274511218070984), (0.29999999999999999, 0.3803921639919281,
0.3803921639919281), (0.40000000000000002, 0.54509806632995605,
0.54509806632995605), (0.5, 0.74901962280273438, 0.74901962280273438),
(0.59999999999999998, 0.59607845544815063, 0.59607845544815063),
(0.69999999999999996, 0.64313727617263794, 0.64313727617263794),
(0.80000000000000004, 0.64705884456634521, 0.64705884456634521),
(0.90000000000000002, 0.74117648601531982, 0.74117648601531982), (1.0,
0.63529413938522339, 0.63529413938522339)],
'green': [(0.0, 0.0039215688593685627, 0.0039215688593685627),
(0.10000000000000001, 0.24313725531101227, 0.24313725531101227),
(0.20000000000000001, 0.42745098471641541, 0.42745098471641541),
(0.29999999999999999, 0.68235296010971069, 0.68235296010971069),
(0.40000000000000002, 0.87843137979507446, 0.87843137979507446),
(0.5, 1.0, 1.0), (0.59999999999999998, 0.96078431606292725,
0.96078431606292725), (0.69999999999999996, 0.86666667461395264,
0.86666667461395264), (0.80000000000000004, 0.7607843279838562,
0.7607843279838562), (0.90000000000000002, 0.53333336114883423,
0.53333336114883423), (1.0, 0.30980393290519714,
0.30980393290519714)],
'red': [(0.0, 0.61960786581039429, 0.61960786581039429),
(0.10000000000000001, 0.83529412746429443, 0.83529412746429443),
(0.20000000000000001, 0.95686274766921997, 0.95686274766921997),
(0.29999999999999999, 0.99215686321258545, 0.99215686321258545),
(0.40000000000000002, 0.99607843160629272, 0.99607843160629272),
(0.5, 1.0, 1.0), (0.59999999999999998, 0.90196079015731812,
0.90196079015731812), (0.69999999999999996, 0.67058825492858887,
0.67058825492858887), (0.80000000000000004, 0.40000000596046448,
0.40000000596046448), (0.90000000000000002, 0.19607843458652496,
0.19607843458652496), (1.0, 0.36862745881080627,
0.36862745881080627)]}
_YlGn_data = {'blue': [(0.0, 0.89803922176361084,
0.89803922176361084), (0.125, 0.72549021244049072,
0.72549021244049072), (0.25, 0.63921570777893066,
0.63921570777893066), (0.375, 0.55686277151107788,
0.55686277151107788), (0.5, 0.47450980544090271, 0.47450980544090271),
(0.625, 0.364705890417099, 0.364705890417099), (0.75,
0.26274511218070984, 0.26274511218070984), (0.875,
0.21568627655506134, 0.21568627655506134), (1.0, 0.16078431904315948,
0.16078431904315948)],
'green': [(0.0, 1.0, 1.0), (0.125, 0.98823529481887817,
0.98823529481887817), (0.25, 0.94117647409439087,
0.94117647409439087), (0.375, 0.86666667461395264,
0.86666667461395264), (0.5, 0.7764706015586853,
0.7764706015586853), (0.625, 0.67058825492858887,
0.67058825492858887), (0.75, 0.51764708757400513,
0.51764708757400513), (0.875, 0.40784314274787903,
0.40784314274787903), (1.0, 0.27058824896812439,
0.27058824896812439)],
'red': [(0.0, 1.0, 1.0), (0.125, 0.9686274528503418,
0.9686274528503418), (0.25, 0.85098040103912354,
0.85098040103912354), (0.375, 0.67843139171600342,
0.67843139171600342), (0.5, 0.47058823704719543,
0.47058823704719543), (0.625, 0.25490197539329529,
0.25490197539329529), (0.75, 0.13725490868091583,
0.13725490868091583), (0.875, 0.0, 0.0), (1.0, 0.0, 0.0)]}
_YlGnBu_data = {'blue': [(0.0, 0.85098040103912354,
0.85098040103912354), (0.125, 0.69411766529083252,
0.69411766529083252), (0.25, 0.70588237047195435,
0.70588237047195435), (0.375, 0.73333334922790527,
0.73333334922790527), (0.5, 0.76862746477127075, 0.76862746477127075),
(0.625, 0.75294119119644165, 0.75294119119644165), (0.75,
0.65882354974746704, 0.65882354974746704), (0.875,
0.58039218187332153, 0.58039218187332153), (1.0, 0.34509804844856262,
0.34509804844856262)],
'green': [(0.0, 1.0, 1.0), (0.125, 0.97254902124404907,
0.97254902124404907), (0.25, 0.91372549533843994,
0.91372549533843994), (0.375, 0.80392158031463623,
0.80392158031463623), (0.5, 0.7137255072593689,
0.7137255072593689), (0.625, 0.56862747669219971,
0.56862747669219971), (0.75, 0.36862745881080627,
0.36862745881080627), (0.875, 0.20392157137393951,
0.20392157137393951), (1.0, 0.11372549086809158,
0.11372549086809158)],
'red': [(0.0, 1.0, 1.0), (0.125, 0.92941176891326904,
0.92941176891326904), (0.25, 0.78039216995239258,
0.78039216995239258), (0.375, 0.49803921580314636,
0.49803921580314636), (0.5, 0.25490197539329529,
0.25490197539329529), (0.625, 0.11372549086809158,
0.11372549086809158), (0.75, 0.13333334028720856,
0.13333334028720856), (0.875, 0.14509804546833038,
0.14509804546833038), (1.0, 0.031372550874948502,
0.031372550874948502)]}
_YlOrBr_data = {'blue': [(0.0, 0.89803922176361084,
0.89803922176361084), (0.125, 0.73725491762161255,
0.73725491762161255), (0.25, 0.56862747669219971,
0.56862747669219971), (0.375, 0.30980393290519714,
0.30980393290519714), (0.5, 0.16078431904315948, 0.16078431904315948),
(0.625, 0.078431375324726105, 0.078431375324726105), (0.75,
0.0078431377187371254, 0.0078431377187371254), (0.875,
0.015686275437474251, 0.015686275437474251), (1.0,
0.023529412224888802, 0.023529412224888802)],
'green': [(0.0, 1.0, 1.0), (0.125, 0.9686274528503418,
0.9686274528503418), (0.25, 0.89019608497619629,
0.89019608497619629), (0.375, 0.76862746477127075,
0.76862746477127075), (0.5, 0.60000002384185791,
0.60000002384185791), (0.625, 0.43921568989753723,
0.43921568989753723), (0.75, 0.29803922772407532,
0.29803922772407532), (0.875, 0.20392157137393951,
0.20392157137393951), (1.0, 0.14509804546833038,
0.14509804546833038)],
'red': [(0.0, 1.0, 1.0), (0.125, 1.0, 1.0), (0.25,
0.99607843160629272, 0.99607843160629272), (0.375,
0.99607843160629272, 0.99607843160629272), (0.5,
0.99607843160629272, 0.99607843160629272), (0.625,
0.92549020051956177, 0.92549020051956177), (0.75,
0.80000001192092896, 0.80000001192092896), (0.875,
0.60000002384185791, 0.60000002384185791), (1.0,
0.40000000596046448, 0.40000000596046448)]}
_YlOrRd_data = {'blue': [(0.0, 0.80000001192092896,
0.80000001192092896), (0.125, 0.62745100259780884,
0.62745100259780884), (0.25, 0.46274510025978088,
0.46274510025978088), (0.375, 0.29803922772407532,
0.29803922772407532), (0.5, 0.23529411852359772, 0.23529411852359772),
(0.625, 0.16470588743686676, 0.16470588743686676), (0.75,
0.10980392247438431, 0.10980392247438431), (0.875,
0.14901961386203766, 0.14901961386203766), (1.0, 0.14901961386203766,
0.14901961386203766)],
'green': [(0.0, 1.0, 1.0), (0.125, 0.92941176891326904,
0.92941176891326904), (0.25, 0.85098040103912354,
0.85098040103912354), (0.375, 0.69803923368453979,
0.69803923368453979), (0.5, 0.55294120311737061,
0.55294120311737061), (0.625, 0.30588236451148987,
0.30588236451148987), (0.75, 0.10196078568696976,
0.10196078568696976), (0.875, 0.0, 0.0), (1.0, 0.0, 0.0)],
'red': [(0.0, 1.0, 1.0), (0.125, 1.0, 1.0), (0.25,
0.99607843160629272, 0.99607843160629272), (0.375,
0.99607843160629272, 0.99607843160629272), (0.5,
0.99215686321258545, 0.99215686321258545), (0.625,
0.98823529481887817, 0.98823529481887817), (0.75,
0.89019608497619629, 0.89019608497619629), (0.875,
0.74117648601531982, 0.74117648601531982), (1.0,
0.50196081399917603, 0.50196081399917603)]}
# The next 7 palettes are from the Yorick scientific visalisation package,
# an evolution of the GIST package, both by David H. Munro.
# They are released under a BSD-like license (see LICENSE_YORICK in
# the license directory of the matplotlib source distribution).
_gist_earth_data = {'blue': [(0.0, 0.0, 0.0), (0.0042016808874905109,
0.18039216101169586, 0.18039216101169586), (0.0084033617749810219,
0.22745098173618317, 0.22745098173618317), (0.012605042196810246,
0.27058824896812439, 0.27058824896812439), (0.016806723549962044,
0.31764706969261169, 0.31764706969261169), (0.021008403971791267,
0.36078432202339172, 0.36078432202339172), (0.025210084393620491,
0.40784314274787903, 0.40784314274787903), (0.029411764815449715,
0.45490196347236633, 0.45490196347236633), (0.033613447099924088,
0.45490196347236633, 0.45490196347236633), (0.037815127521753311,
0.45490196347236633, 0.45490196347236633), (0.042016807943582535,
0.45490196347236633, 0.45490196347236633), (0.046218488365411758,
0.45490196347236633, 0.45490196347236633), (0.050420168787240982,
0.45882353186607361, 0.45882353186607361), (0.054621849209070206,
0.45882353186607361, 0.45882353186607361), (0.058823529630899429,
0.45882353186607361, 0.45882353186607361), (0.063025213778018951,
0.45882353186607361, 0.45882353186607361), (0.067226894199848175,
0.45882353186607361, 0.45882353186607361), (0.071428574621677399,
0.46274510025978088, 0.46274510025978088), (0.075630255043506622,
0.46274510025978088, 0.46274510025978088), (0.079831935465335846,
0.46274510025978088, 0.46274510025978088), (0.08403361588716507,
0.46274510025978088, 0.46274510025978088), (0.088235296308994293,
0.46274510025978088, 0.46274510025978088), (0.092436976730823517,
0.46666666865348816, 0.46666666865348816), (0.09663865715265274,
0.46666666865348816, 0.46666666865348816), (0.10084033757448196,
0.46666666865348816, 0.46666666865348816), (0.10504201799631119,
0.46666666865348816, 0.46666666865348816), (0.10924369841814041,
0.46666666865348816, 0.46666666865348816), (0.11344537883996964,
0.47058823704719543, 0.47058823704719543), (0.11764705926179886,
0.47058823704719543, 0.47058823704719543), (0.12184873968362808,
0.47058823704719543, 0.47058823704719543), (0.1260504275560379,
0.47058823704719543, 0.47058823704719543), (0.13025210797786713,
0.47058823704719543, 0.47058823704719543), (0.13445378839969635,
0.47450980544090271, 0.47450980544090271), (0.13865546882152557,
0.47450980544090271, 0.47450980544090271), (0.1428571492433548,
0.47450980544090271, 0.47450980544090271), (0.14705882966518402,
0.47450980544090271, 0.47450980544090271), (0.15126051008701324,
0.47450980544090271, 0.47450980544090271), (0.15546219050884247,
0.47843137383460999, 0.47843137383460999), (0.15966387093067169,
0.47843137383460999, 0.47843137383460999), (0.16386555135250092,
0.47843137383460999, 0.47843137383460999), (0.16806723177433014,
0.47843137383460999, 0.47843137383460999), (0.17226891219615936,
0.47843137383460999, 0.47843137383460999), (0.17647059261798859,
0.48235294222831726, 0.48235294222831726), (0.18067227303981781,
0.48235294222831726, 0.48235294222831726), (0.18487395346164703,
0.48235294222831726, 0.48235294222831726), (0.18907563388347626,
0.48235294222831726, 0.48235294222831726), (0.19327731430530548,
0.48235294222831726, 0.48235294222831726), (0.1974789947271347,
0.48627451062202454, 0.48627451062202454), (0.20168067514896393,
0.48627451062202454, 0.48627451062202454), (0.20588235557079315,
0.48627451062202454, 0.48627451062202454), (0.21008403599262238,
0.48627451062202454, 0.48627451062202454), (0.2142857164144516,
0.48627451062202454, 0.48627451062202454), (0.21848739683628082,
0.49019607901573181, 0.49019607901573181), (0.22268907725811005,
0.49019607901573181, 0.49019607901573181), (0.22689075767993927,
0.49019607901573181, 0.49019607901573181), (0.23109243810176849,
0.49019607901573181, 0.49019607901573181), (0.23529411852359772,
0.49019607901573181, 0.49019607901573181), (0.23949579894542694,
0.49411764740943909, 0.49411764740943909), (0.24369747936725616,
0.49411764740943909, 0.49411764740943909), (0.24789915978908539,
0.49411764740943909, 0.49411764740943909), (0.25210085511207581,
0.49411764740943909, 0.49411764740943909), (0.25630253553390503,
0.49411764740943909, 0.49411764740943909), (0.26050421595573425,
0.49803921580314636, 0.49803921580314636), (0.26470589637756348,
0.49803921580314636, 0.49803921580314636), (0.2689075767993927,
0.49803921580314636, 0.49803921580314636), (0.27310925722122192,
0.49803921580314636, 0.49803921580314636), (0.27731093764305115,
0.49803921580314636, 0.49803921580314636), (0.28151261806488037,
0.50196081399917603, 0.50196081399917603), (0.28571429848670959,
0.49411764740943909, 0.49411764740943909), (0.28991597890853882,
0.49019607901573181, 0.49019607901573181), (0.29411765933036804,
0.48627451062202454, 0.48627451062202454), (0.29831933975219727,
0.48235294222831726, 0.48235294222831726), (0.30252102017402649,
0.47843137383460999, 0.47843137383460999), (0.30672270059585571,
0.47058823704719543, 0.47058823704719543), (0.31092438101768494,
0.46666666865348816, 0.46666666865348816), (0.31512606143951416,
0.46274510025978088, 0.46274510025978088), (0.31932774186134338,
0.45882353186607361, 0.45882353186607361), (0.32352942228317261,
0.45098039507865906, 0.45098039507865906), (0.32773110270500183,
0.44705882668495178, 0.44705882668495178), (0.33193278312683105,
0.44313725829124451, 0.44313725829124451), (0.33613446354866028,
0.43529412150382996, 0.43529412150382996), (0.3403361439704895,
0.43137255311012268, 0.43137255311012268), (0.34453782439231873,
0.42745098471641541, 0.42745098471641541), (0.34873950481414795,
0.42352941632270813, 0.42352941632270813), (0.35294118523597717,
0.41568627953529358, 0.41568627953529358), (0.3571428656578064,
0.4117647111415863, 0.4117647111415863), (0.36134454607963562,
0.40784314274787903, 0.40784314274787903), (0.36554622650146484,
0.40000000596046448, 0.40000000596046448), (0.36974790692329407,
0.3960784375667572, 0.3960784375667572), (0.37394958734512329,
0.39215686917304993, 0.39215686917304993), (0.37815126776695251,
0.38431373238563538, 0.38431373238563538), (0.38235294818878174,
0.3803921639919281, 0.3803921639919281), (0.38655462861061096,
0.37647059559822083, 0.37647059559822083), (0.39075630903244019,
0.36862745881080627, 0.36862745881080627), (0.39495798945426941,
0.364705890417099, 0.364705890417099), (0.39915966987609863,
0.36078432202339172, 0.36078432202339172), (0.40336135029792786,
0.35294118523597717, 0.35294118523597717), (0.40756303071975708,
0.3490196168422699, 0.3490196168422699), (0.4117647111415863,
0.34509804844856262, 0.34509804844856262), (0.41596639156341553,
0.33725491166114807, 0.33725491166114807), (0.42016807198524475,
0.3333333432674408, 0.3333333432674408), (0.42436975240707397,
0.32941177487373352, 0.32941177487373352), (0.4285714328289032,
0.32156863808631897, 0.32156863808631897), (0.43277311325073242,
0.31764706969261169, 0.31764706969261169), (0.43697479367256165,
0.31372550129890442, 0.31372550129890442), (0.44117647409439087,
0.30588236451148987, 0.30588236451148987), (0.44537815451622009,
0.30196079611778259, 0.30196079611778259), (0.44957983493804932,
0.29803922772407532, 0.29803922772407532), (0.45378151535987854,
0.29019609093666077, 0.29019609093666077), (0.45798319578170776,
0.28627452254295349, 0.28627452254295349), (0.46218487620353699,
0.27843138575553894, 0.27843138575553894), (0.46638655662536621,
0.27450981736183167, 0.27450981736183167), (0.47058823704719543,
0.27843138575553894, 0.27843138575553894), (0.47478991746902466,
0.28235295414924622, 0.28235295414924622), (0.47899159789085388,
0.28235295414924622, 0.28235295414924622), (0.48319327831268311,
0.28627452254295349, 0.28627452254295349), (0.48739495873451233,
0.28627452254295349, 0.28627452254295349), (0.49159663915634155,
0.29019609093666077, 0.29019609093666077), (0.49579831957817078,
0.29411765933036804, 0.29411765933036804), (0.5, 0.29411765933036804,
0.29411765933036804), (0.50420171022415161, 0.29803922772407532,
0.29803922772407532), (0.50840336084365845, 0.29803922772407532,
0.29803922772407532), (0.51260507106781006, 0.30196079611778259,
0.30196079611778259), (0.51680672168731689, 0.30196079611778259,
0.30196079611778259), (0.52100843191146851, 0.30588236451148987,
0.30588236451148987), (0.52521008253097534, 0.30980393290519714,
0.30980393290519714), (0.52941179275512695, 0.30980393290519714,
0.30980393290519714), (0.53361344337463379, 0.31372550129890442,
0.31372550129890442), (0.5378151535987854, 0.31372550129890442,
0.31372550129890442), (0.54201680421829224, 0.31764706969261169,
0.31764706969261169), (0.54621851444244385, 0.32156863808631897,
0.32156863808631897), (0.55042016506195068, 0.32156863808631897,
0.32156863808631897), (0.55462187528610229, 0.32156863808631897,
0.32156863808631897), (0.55882352590560913, 0.32549020648002625,
0.32549020648002625), (0.56302523612976074, 0.32549020648002625,
0.32549020648002625), (0.56722688674926758, 0.32549020648002625,
0.32549020648002625), (0.57142859697341919, 0.32941177487373352,
0.32941177487373352), (0.57563024759292603, 0.32941177487373352,
0.32941177487373352), (0.57983195781707764, 0.32941177487373352,
0.32941177487373352), (0.58403360843658447, 0.3333333432674408,
0.3333333432674408), (0.58823531866073608, 0.3333333432674408,
0.3333333432674408), (0.59243696928024292, 0.3333333432674408,
0.3333333432674408), (0.59663867950439453, 0.33725491166114807,
0.33725491166114807), (0.60084033012390137, 0.33725491166114807,
0.33725491166114807), (0.60504204034805298, 0.33725491166114807,
0.33725491166114807), (0.60924369096755981, 0.34117648005485535,
0.34117648005485535), (0.61344540119171143, 0.34117648005485535,
0.34117648005485535), (0.61764705181121826, 0.34117648005485535,
0.34117648005485535), (0.62184876203536987, 0.34509804844856262,
0.34509804844856262), (0.62605041265487671, 0.34509804844856262,
0.34509804844856262), (0.63025212287902832, 0.34509804844856262,
0.34509804844856262), (0.63445377349853516, 0.3490196168422699,
0.3490196168422699), (0.63865548372268677, 0.3490196168422699,
0.3490196168422699), (0.6428571343421936, 0.3490196168422699,
0.3490196168422699), (0.64705884456634521, 0.35294118523597717,
0.35294118523597717), (0.65126049518585205, 0.35294118523597717,
0.35294118523597717), (0.65546220541000366, 0.35294118523597717,
0.35294118523597717), (0.6596638560295105, 0.35686275362968445,
0.35686275362968445), (0.66386556625366211, 0.35686275362968445,
0.35686275362968445), (0.66806721687316895, 0.35686275362968445,
0.35686275362968445), (0.67226892709732056, 0.36078432202339172,
0.36078432202339172), (0.67647057771682739, 0.36078432202339172,
0.36078432202339172), (0.680672287940979, 0.36078432202339172,
0.36078432202339172), (0.68487393856048584, 0.364705890417099,
0.364705890417099), (0.68907564878463745, 0.364705890417099,
0.364705890417099), (0.69327729940414429, 0.364705890417099,
0.364705890417099), (0.6974790096282959, 0.36862745881080627,
0.36862745881080627), (0.70168066024780273, 0.36862745881080627,
0.36862745881080627), (0.70588237047195435, 0.36862745881080627,
0.36862745881080627), (0.71008402109146118, 0.37254902720451355,
0.37254902720451355), (0.71428573131561279, 0.37254902720451355,
0.37254902720451355), (0.71848738193511963, 0.37254902720451355,
0.37254902720451355), (0.72268909215927124, 0.37647059559822083,
0.37647059559822083), (0.72689074277877808, 0.37647059559822083,
0.37647059559822083), (0.73109245300292969, 0.3803921639919281,
0.3803921639919281), (0.73529410362243652, 0.3803921639919281,
0.3803921639919281), (0.73949581384658813, 0.3803921639919281,
0.3803921639919281), (0.74369746446609497, 0.38431373238563538,
0.38431373238563538), (0.74789917469024658, 0.38431373238563538,
0.38431373238563538), (0.75210082530975342, 0.38431373238563538,
0.38431373238563538), (0.75630253553390503, 0.38823530077934265,
0.38823530077934265), (0.76050418615341187, 0.38823530077934265,
0.38823530077934265), (0.76470589637756348, 0.38823530077934265,
0.38823530077934265), (0.76890754699707031, 0.39215686917304993,
0.39215686917304993), (0.77310925722122192, 0.39215686917304993,
0.39215686917304993), (0.77731090784072876, 0.39215686917304993,
0.39215686917304993), (0.78151261806488037, 0.3960784375667572,
0.3960784375667572), (0.78571426868438721, 0.3960784375667572,
0.3960784375667572), (0.78991597890853882, 0.40784314274787903,
0.40784314274787903), (0.79411762952804565, 0.41568627953529358,
0.41568627953529358), (0.79831933975219727, 0.42352941632270813,
0.42352941632270813), (0.8025209903717041, 0.43529412150382996,
0.43529412150382996), (0.80672270059585571, 0.44313725829124451,
0.44313725829124451), (0.81092435121536255, 0.45490196347236633,
0.45490196347236633), (0.81512606143951416, 0.46274510025978088,
0.46274510025978088), (0.819327712059021, 0.47450980544090271,
0.47450980544090271), (0.82352942228317261, 0.48235294222831726,
0.48235294222831726), (0.82773107290267944, 0.49411764740943909,
0.49411764740943909), (0.83193278312683105, 0.5058823823928833,
0.5058823823928833), (0.83613443374633789, 0.51372551918029785,
0.51372551918029785), (0.8403361439704895, 0.52549022436141968,
0.52549022436141968), (0.84453779458999634, 0.5372549295425415,
0.5372549295425415), (0.84873950481414795, 0.54509806632995605,
0.54509806632995605), (0.85294115543365479, 0.55686277151107788,
0.55686277151107788), (0.8571428656578064, 0.56862747669219971,
0.56862747669219971), (0.86134451627731323, 0.58039218187332153,
0.58039218187332153), (0.86554622650146484, 0.58823531866073608,
0.58823531866073608), (0.86974787712097168, 0.60000002384185791,
0.60000002384185791), (0.87394958734512329, 0.61176472902297974,
0.61176472902297974), (0.87815123796463013, 0.62352943420410156,
0.62352943420410156), (0.88235294818878174, 0.63529413938522339,
0.63529413938522339), (0.88655459880828857, 0.64705884456634521,
0.64705884456634521), (0.89075630903244019, 0.65882354974746704,
0.65882354974746704), (0.89495795965194702, 0.66666668653488159,
0.66666668653488159), (0.89915966987609863, 0.67843139171600342,
0.67843139171600342), (0.90336132049560547, 0.69019609689712524,
0.69019609689712524), (0.90756303071975708, 0.70196080207824707,
0.70196080207824707), (0.91176468133926392, 0.7137255072593689,
0.7137255072593689), (0.91596639156341553, 0.72549021244049072,
0.72549021244049072), (0.92016804218292236, 0.74117648601531982,
0.74117648601531982), (0.92436975240707397, 0.75294119119644165,
0.75294119119644165), (0.92857140302658081, 0.76470589637756348,
0.76470589637756348), (0.93277311325073242, 0.7764706015586853,
0.7764706015586853), (0.93697476387023926, 0.78823530673980713,
0.78823530673980713), (0.94117647409439087, 0.80000001192092896,
0.80000001192092896), (0.94537812471389771, 0.81176471710205078,
0.81176471710205078), (0.94957983493804932, 0.82745099067687988,
0.82745099067687988), (0.95378148555755615, 0.83921569585800171,
0.83921569585800171), (0.95798319578170776, 0.85098040103912354,
0.85098040103912354), (0.9621848464012146, 0.86274510622024536,
0.86274510622024536), (0.96638655662536621, 0.87843137979507446,
0.87843137979507446), (0.97058820724487305, 0.89019608497619629,
0.89019608497619629), (0.97478991746902466, 0.90196079015731812,
0.90196079015731812), (0.97899156808853149, 0.91764706373214722,
0.91764706373214722), (0.98319327831268311, 0.92941176891326904,
0.92941176891326904), (0.98739492893218994, 0.94509804248809814,
0.94509804248809814), (0.99159663915634155, 0.95686274766921997,
0.95686274766921997), (0.99579828977584839, 0.97254902124404907,
0.97254902124404907), (1.0, 0.9843137264251709, 0.9843137264251709)],
'green': [(0.0, 0.0, 0.0), (0.0042016808874905109, 0.0, 0.0),
(0.0084033617749810219, 0.0, 0.0), (0.012605042196810246, 0.0, 0.0),
(0.016806723549962044, 0.0, 0.0), (0.021008403971791267, 0.0, 0.0),
(0.025210084393620491, 0.0, 0.0), (0.029411764815449715, 0.0, 0.0),
(0.033613447099924088, 0.011764706112444401, 0.011764706112444401),
(0.037815127521753311, 0.023529412224888802, 0.023529412224888802),
(0.042016807943582535, 0.031372550874948502, 0.031372550874948502),
(0.046218488365411758, 0.043137256056070328, 0.043137256056070328),
(0.050420168787240982, 0.050980392843484879, 0.050980392843484879),
(0.054621849209070206, 0.062745101749897003, 0.062745101749897003),
(0.058823529630899429, 0.070588238537311554, 0.070588238537311554),
(0.063025213778018951, 0.08235294371843338, 0.08235294371843338),
(0.067226894199848175, 0.090196080505847931, 0.090196080505847931),
(0.071428574621677399, 0.10196078568696976, 0.10196078568696976),
(0.075630255043506622, 0.10980392247438431, 0.10980392247438431),
(0.079831935465335846, 0.12156862765550613, 0.12156862765550613),
(0.08403361588716507, 0.12941177189350128, 0.12941177189350128),
(0.088235296308994293, 0.14117647707462311, 0.14117647707462311),
(0.092436976730823517, 0.14901961386203766, 0.14901961386203766),
(0.09663865715265274, 0.16078431904315948, 0.16078431904315948),
(0.10084033757448196, 0.16862745583057404, 0.16862745583057404),
(0.10504201799631119, 0.17647059261798859, 0.17647059261798859),
(0.10924369841814041, 0.18823529779911041, 0.18823529779911041),
(0.11344537883996964, 0.19607843458652496, 0.19607843458652496),
(0.11764705926179886, 0.20392157137393951, 0.20392157137393951),
(0.12184873968362808, 0.21568627655506134, 0.21568627655506134),
(0.1260504275560379, 0.22352941334247589, 0.22352941334247589),
(0.13025210797786713, 0.23137255012989044, 0.23137255012989044),
(0.13445378839969635, 0.23921568691730499, 0.23921568691730499),
(0.13865546882152557, 0.25098040699958801, 0.25098040699958801),
(0.1428571492433548, 0.25882354378700256, 0.25882354378700256),
(0.14705882966518402, 0.26666668057441711, 0.26666668057441711),
(0.15126051008701324, 0.27450981736183167, 0.27450981736183167),
(0.15546219050884247, 0.28235295414924622, 0.28235295414924622),
(0.15966387093067169, 0.29019609093666077, 0.29019609093666077),
(0.16386555135250092, 0.30196079611778259, 0.30196079611778259),
(0.16806723177433014, 0.30980393290519714, 0.30980393290519714),
(0.17226891219615936, 0.31764706969261169, 0.31764706969261169),
(0.17647059261798859, 0.32549020648002625, 0.32549020648002625),
(0.18067227303981781, 0.3333333432674408, 0.3333333432674408),
(0.18487395346164703, 0.34117648005485535, 0.34117648005485535),
(0.18907563388347626, 0.3490196168422699, 0.3490196168422699),
(0.19327731430530548, 0.35686275362968445, 0.35686275362968445),
(0.1974789947271347, 0.364705890417099, 0.364705890417099),
(0.20168067514896393, 0.37254902720451355, 0.37254902720451355),
(0.20588235557079315, 0.3803921639919281, 0.3803921639919281),
(0.21008403599262238, 0.38823530077934265, 0.38823530077934265),
(0.2142857164144516, 0.39215686917304993, 0.39215686917304993),
(0.21848739683628082, 0.40000000596046448, 0.40000000596046448),
(0.22268907725811005, 0.40784314274787903, 0.40784314274787903),
(0.22689075767993927, 0.41568627953529358, 0.41568627953529358),
(0.23109243810176849, 0.42352941632270813, 0.42352941632270813),
(0.23529411852359772, 0.42745098471641541, 0.42745098471641541),
(0.23949579894542694, 0.43529412150382996, 0.43529412150382996),
(0.24369747936725616, 0.44313725829124451, 0.44313725829124451),
(0.24789915978908539, 0.45098039507865906, 0.45098039507865906),
(0.25210085511207581, 0.45490196347236633, 0.45490196347236633),
(0.25630253553390503, 0.46274510025978088, 0.46274510025978088),
(0.26050421595573425, 0.47058823704719543, 0.47058823704719543),
(0.26470589637756348, 0.47450980544090271, 0.47450980544090271),
(0.2689075767993927, 0.48235294222831726, 0.48235294222831726),
(0.27310925722122192, 0.49019607901573181, 0.49019607901573181),
(0.27731093764305115, 0.49411764740943909, 0.49411764740943909),
(0.28151261806488037, 0.50196081399917603, 0.50196081399917603),
(0.28571429848670959, 0.50196081399917603, 0.50196081399917603),
(0.28991597890853882, 0.5058823823928833, 0.5058823823928833),
(0.29411765933036804, 0.5058823823928833, 0.5058823823928833),
(0.29831933975219727, 0.50980395078659058, 0.50980395078659058),
(0.30252102017402649, 0.51372551918029785, 0.51372551918029785),
(0.30672270059585571, 0.51372551918029785, 0.51372551918029785),
(0.31092438101768494, 0.51764708757400513, 0.51764708757400513),
(0.31512606143951416, 0.5215686559677124, 0.5215686559677124),
(0.31932774186134338, 0.5215686559677124, 0.5215686559677124),
(0.32352942228317261, 0.52549022436141968, 0.52549022436141968),
(0.32773110270500183, 0.52549022436141968, 0.52549022436141968),
(0.33193278312683105, 0.52941179275512695, 0.52941179275512695),
(0.33613446354866028, 0.53333336114883423, 0.53333336114883423),
(0.3403361439704895, 0.53333336114883423, 0.53333336114883423),
(0.34453782439231873, 0.5372549295425415, 0.5372549295425415),
(0.34873950481414795, 0.54117649793624878, 0.54117649793624878),
(0.35294118523597717, 0.54117649793624878, 0.54117649793624878),
(0.3571428656578064, 0.54509806632995605, 0.54509806632995605),
(0.36134454607963562, 0.54901963472366333, 0.54901963472366333),
(0.36554622650146484, 0.54901963472366333, 0.54901963472366333),
(0.36974790692329407, 0.55294120311737061, 0.55294120311737061),
(0.37394958734512329, 0.55294120311737061, 0.55294120311737061),
(0.37815126776695251, 0.55686277151107788, 0.55686277151107788),
(0.38235294818878174, 0.56078433990478516, 0.56078433990478516),
(0.38655462861061096, 0.56078433990478516, 0.56078433990478516),
(0.39075630903244019, 0.56470590829849243, 0.56470590829849243),
(0.39495798945426941, 0.56862747669219971, 0.56862747669219971),
(0.39915966987609863, 0.56862747669219971, 0.56862747669219971),
(0.40336135029792786, 0.57254904508590698, 0.57254904508590698),
(0.40756303071975708, 0.57254904508590698, 0.57254904508590698),
(0.4117647111415863, 0.57647061347961426, 0.57647061347961426),
(0.41596639156341553, 0.58039218187332153, 0.58039218187332153),
(0.42016807198524475, 0.58039218187332153, 0.58039218187332153),
(0.42436975240707397, 0.58431375026702881, 0.58431375026702881),
(0.4285714328289032, 0.58823531866073608, 0.58823531866073608),
(0.43277311325073242, 0.58823531866073608, 0.58823531866073608),
(0.43697479367256165, 0.59215688705444336, 0.59215688705444336),
(0.44117647409439087, 0.59215688705444336, 0.59215688705444336),
(0.44537815451622009, 0.59607845544815063, 0.59607845544815063),
(0.44957983493804932, 0.60000002384185791, 0.60000002384185791),
(0.45378151535987854, 0.60000002384185791, 0.60000002384185791),
(0.45798319578170776, 0.60392159223556519, 0.60392159223556519),
(0.46218487620353699, 0.60784316062927246, 0.60784316062927246),
(0.46638655662536621, 0.60784316062927246, 0.60784316062927246),
(0.47058823704719543, 0.61176472902297974, 0.61176472902297974),
(0.47478991746902466, 0.61176472902297974, 0.61176472902297974),
(0.47899159789085388, 0.61568629741668701, 0.61568629741668701),
(0.48319327831268311, 0.61960786581039429, 0.61960786581039429),
(0.48739495873451233, 0.61960786581039429, 0.61960786581039429),
(0.49159663915634155, 0.62352943420410156, 0.62352943420410156),
(0.49579831957817078, 0.62745100259780884, 0.62745100259780884), (0.5,
0.62745100259780884, 0.62745100259780884), (0.50420171022415161,
0.63137257099151611, 0.63137257099151611), (0.50840336084365845,
0.63137257099151611, 0.63137257099151611), (0.51260507106781006,
0.63529413938522339, 0.63529413938522339), (0.51680672168731689,
0.63921570777893066, 0.63921570777893066), (0.52100843191146851,
0.63921570777893066, 0.63921570777893066), (0.52521008253097534,
0.64313727617263794, 0.64313727617263794), (0.52941179275512695,
0.64705884456634521, 0.64705884456634521), (0.53361344337463379,
0.64705884456634521, 0.64705884456634521), (0.5378151535987854,
0.65098041296005249, 0.65098041296005249), (0.54201680421829224,
0.65098041296005249, 0.65098041296005249), (0.54621851444244385,
0.65490198135375977, 0.65490198135375977), (0.55042016506195068,
0.65882354974746704, 0.65882354974746704), (0.55462187528610229,
0.65882354974746704, 0.65882354974746704), (0.55882352590560913,
0.65882354974746704, 0.65882354974746704), (0.56302523612976074,
0.66274511814117432, 0.66274511814117432), (0.56722688674926758,
0.66274511814117432, 0.66274511814117432), (0.57142859697341919,
0.66666668653488159, 0.66666668653488159), (0.57563024759292603,
0.66666668653488159, 0.66666668653488159), (0.57983195781707764,
0.67058825492858887, 0.67058825492858887), (0.58403360843658447,
0.67058825492858887, 0.67058825492858887), (0.58823531866073608,
0.67450982332229614, 0.67450982332229614), (0.59243696928024292,
0.67450982332229614, 0.67450982332229614), (0.59663867950439453,
0.67450982332229614, 0.67450982332229614), (0.60084033012390137,
0.67843139171600342, 0.67843139171600342), (0.60504204034805298,
0.67843139171600342, 0.67843139171600342), (0.60924369096755981,
0.68235296010971069, 0.68235296010971069), (0.61344540119171143,
0.68235296010971069, 0.68235296010971069), (0.61764705181121826,
0.68627452850341797, 0.68627452850341797), (0.62184876203536987,
0.68627452850341797, 0.68627452850341797), (0.62605041265487671,
0.68627452850341797, 0.68627452850341797), (0.63025212287902832,
0.69019609689712524, 0.69019609689712524), (0.63445377349853516,
0.69019609689712524, 0.69019609689712524), (0.63865548372268677,
0.69411766529083252, 0.69411766529083252), (0.6428571343421936,
0.69411766529083252, 0.69411766529083252), (0.64705884456634521,
0.69803923368453979, 0.69803923368453979), (0.65126049518585205,
0.69803923368453979, 0.69803923368453979), (0.65546220541000366,
0.70196080207824707, 0.70196080207824707), (0.6596638560295105,
0.70196080207824707, 0.70196080207824707), (0.66386556625366211,
0.70196080207824707, 0.70196080207824707), (0.66806721687316895,
0.70588237047195435, 0.70588237047195435), (0.67226892709732056,
0.70588237047195435, 0.70588237047195435), (0.67647057771682739,
0.70980393886566162, 0.70980393886566162), (0.680672287940979,
0.70980393886566162, 0.70980393886566162), (0.68487393856048584,
0.7137255072593689, 0.7137255072593689), (0.68907564878463745,
0.7137255072593689, 0.7137255072593689), (0.69327729940414429,
0.71764707565307617, 0.71764707565307617), (0.6974790096282959,
0.71764707565307617, 0.71764707565307617), (0.70168066024780273,
0.7137255072593689, 0.7137255072593689), (0.70588237047195435,
0.70980393886566162, 0.70980393886566162), (0.71008402109146118,
0.70980393886566162, 0.70980393886566162), (0.71428573131561279,
0.70588237047195435, 0.70588237047195435), (0.71848738193511963,
0.70196080207824707, 0.70196080207824707), (0.72268909215927124,
0.69803923368453979, 0.69803923368453979), (0.72689074277877808,
0.69411766529083252, 0.69411766529083252), (0.73109245300292969,
0.69019609689712524, 0.69019609689712524), (0.73529410362243652,
0.68627452850341797, 0.68627452850341797), (0.73949581384658813,
0.68235296010971069, 0.68235296010971069), (0.74369746446609497,
0.67843139171600342, 0.67843139171600342), (0.74789917469024658,
0.67450982332229614, 0.67450982332229614), (0.75210082530975342,
0.67058825492858887, 0.67058825492858887), (0.75630253553390503,
0.66666668653488159, 0.66666668653488159), (0.76050418615341187,
0.66274511814117432, 0.66274511814117432), (0.76470589637756348,
0.65882354974746704, 0.65882354974746704), (0.76890754699707031,
0.65490198135375977, 0.65490198135375977), (0.77310925722122192,
0.65098041296005249, 0.65098041296005249), (0.77731090784072876,
0.64705884456634521, 0.64705884456634521), (0.78151261806488037,
0.64313727617263794, 0.64313727617263794), (0.78571426868438721,
0.63921570777893066, 0.63921570777893066), (0.78991597890853882,
0.63921570777893066, 0.63921570777893066), (0.79411762952804565,
0.64313727617263794, 0.64313727617263794), (0.79831933975219727,
0.64313727617263794, 0.64313727617263794), (0.8025209903717041,
0.64705884456634521, 0.64705884456634521), (0.80672270059585571,
0.64705884456634521, 0.64705884456634521), (0.81092435121536255,
0.65098041296005249, 0.65098041296005249), (0.81512606143951416,
0.65490198135375977, 0.65490198135375977), (0.819327712059021,
0.65490198135375977, 0.65490198135375977), (0.82352942228317261,
0.65882354974746704, 0.65882354974746704), (0.82773107290267944,
0.66274511814117432, 0.66274511814117432), (0.83193278312683105,
0.66666668653488159, 0.66666668653488159), (0.83613443374633789,
0.67058825492858887, 0.67058825492858887), (0.8403361439704895,
0.67450982332229614, 0.67450982332229614), (0.84453779458999634,
0.67843139171600342, 0.67843139171600342), (0.84873950481414795,
0.68235296010971069, 0.68235296010971069), (0.85294115543365479,
0.68627452850341797, 0.68627452850341797), (0.8571428656578064,
0.69019609689712524, 0.69019609689712524), (0.86134451627731323,
0.69411766529083252, 0.69411766529083252), (0.86554622650146484,
0.69803923368453979, 0.69803923368453979), (0.86974787712097168,
0.70196080207824707, 0.70196080207824707), (0.87394958734512329,
0.70980393886566162, 0.70980393886566162), (0.87815123796463013,
0.7137255072593689, 0.7137255072593689), (0.88235294818878174,
0.72156864404678345, 0.72156864404678345), (0.88655459880828857,
0.72549021244049072, 0.72549021244049072), (0.89075630903244019,
0.73333334922790527, 0.73333334922790527), (0.89495795965194702,
0.73725491762161255, 0.73725491762161255), (0.89915966987609863,
0.7450980544090271, 0.7450980544090271), (0.90336132049560547,
0.75294119119644165, 0.75294119119644165), (0.90756303071975708,
0.7607843279838562, 0.7607843279838562), (0.91176468133926392,
0.76862746477127075, 0.76862746477127075), (0.91596639156341553,
0.7764706015586853, 0.7764706015586853), (0.92016804218292236,
0.78431373834609985, 0.78431373834609985), (0.92436975240707397,
0.7921568751335144, 0.7921568751335144), (0.92857140302658081,
0.80000001192092896, 0.80000001192092896), (0.93277311325073242,
0.80784314870834351, 0.80784314870834351), (0.93697476387023926,
0.81568628549575806, 0.81568628549575806), (0.94117647409439087,
0.82745099067687988, 0.82745099067687988), (0.94537812471389771,
0.83529412746429443, 0.83529412746429443), (0.94957983493804932,
0.84313726425170898, 0.84313726425170898), (0.95378148555755615,
0.85490196943283081, 0.85490196943283081), (0.95798319578170776,
0.86666667461395264, 0.86666667461395264), (0.9621848464012146,
0.87450981140136719, 0.87450981140136719), (0.96638655662536621,
0.88627451658248901, 0.88627451658248901), (0.97058820724487305,
0.89803922176361084, 0.89803922176361084), (0.97478991746902466,
0.90980392694473267, 0.90980392694473267), (0.97899156808853149,
0.92156863212585449, 0.92156863212585449), (0.98319327831268311,
0.93333333730697632, 0.93333333730697632), (0.98739492893218994,
0.94509804248809814, 0.94509804248809814), (0.99159663915634155,
0.95686274766921997, 0.95686274766921997), (0.99579828977584839,
0.97254902124404907, 0.97254902124404907), (1.0, 0.9843137264251709,
0.9843137264251709)], 'red': [(0.0, 0.0, 0.0), (0.0042016808874905109,
0.0, 0.0), (0.0084033617749810219, 0.0, 0.0), (0.012605042196810246, 0.0,
0.0), (0.016806723549962044, 0.0, 0.0), (0.021008403971791267, 0.0, 0.0),
(0.025210084393620491, 0.0, 0.0), (0.029411764815449715, 0.0, 0.0),
(0.033613447099924088, 0.0, 0.0), (0.037815127521753311,
0.0039215688593685627, 0.0039215688593685627), (0.042016807943582535,
0.0078431377187371254, 0.0078431377187371254), (0.046218488365411758,
0.0078431377187371254, 0.0078431377187371254), (0.050420168787240982,
0.011764706112444401, 0.011764706112444401), (0.054621849209070206,
0.015686275437474251, 0.015686275437474251), (0.058823529630899429,
0.019607843831181526, 0.019607843831181526), (0.063025213778018951,
0.019607843831181526, 0.019607843831181526), (0.067226894199848175,
0.023529412224888802, 0.023529412224888802), (0.071428574621677399,
0.027450980618596077, 0.027450980618596077), (0.075630255043506622,
0.031372550874948502, 0.031372550874948502), (0.079831935465335846,
0.031372550874948502, 0.031372550874948502), (0.08403361588716507,
0.035294119268655777, 0.035294119268655777), (0.088235296308994293,
0.039215687662363052, 0.039215687662363052), (0.092436976730823517,
0.043137256056070328, 0.043137256056070328), (0.09663865715265274,
0.043137256056070328, 0.043137256056070328), (0.10084033757448196,
0.047058824449777603, 0.047058824449777603), (0.10504201799631119,
0.050980392843484879, 0.050980392843484879), (0.10924369841814041,
0.054901961237192154, 0.054901961237192154), (0.11344537883996964,
0.058823529630899429, 0.058823529630899429), (0.11764705926179886,
0.058823529630899429, 0.058823529630899429), (0.12184873968362808,
0.062745101749897003, 0.062745101749897003), (0.1260504275560379,
0.066666670143604279, 0.066666670143604279), (0.13025210797786713,
0.070588238537311554, 0.070588238537311554), (0.13445378839969635,
0.070588238537311554, 0.070588238537311554), (0.13865546882152557,
0.074509806931018829, 0.074509806931018829), (0.1428571492433548,
0.078431375324726105, 0.078431375324726105), (0.14705882966518402,
0.08235294371843338, 0.08235294371843338), (0.15126051008701324,
0.086274512112140656, 0.086274512112140656), (0.15546219050884247,
0.086274512112140656, 0.086274512112140656), (0.15966387093067169,
0.090196080505847931, 0.090196080505847931), (0.16386555135250092,
0.094117648899555206, 0.094117648899555206), (0.16806723177433014,
0.098039217293262482, 0.098039217293262482), (0.17226891219615936,
0.10196078568696976, 0.10196078568696976), (0.17647059261798859,
0.10196078568696976, 0.10196078568696976), (0.18067227303981781,
0.10588235408067703, 0.10588235408067703), (0.18487395346164703,
0.10980392247438431, 0.10980392247438431), (0.18907563388347626,
0.11372549086809158, 0.11372549086809158), (0.19327731430530548,
0.11764705926179886, 0.11764705926179886), (0.1974789947271347,
0.12156862765550613, 0.12156862765550613), (0.20168067514896393,
0.12156862765550613, 0.12156862765550613), (0.20588235557079315,
0.12549020349979401, 0.12549020349979401), (0.21008403599262238,
0.12941177189350128, 0.12941177189350128), (0.2142857164144516,
0.13333334028720856, 0.13333334028720856), (0.21848739683628082,
0.13725490868091583, 0.13725490868091583), (0.22268907725811005,
0.14117647707462311, 0.14117647707462311), (0.22689075767993927,
0.14117647707462311, 0.14117647707462311), (0.23109243810176849,
0.14509804546833038, 0.14509804546833038), (0.23529411852359772,
0.14901961386203766, 0.14901961386203766), (0.23949579894542694,
0.15294118225574493, 0.15294118225574493), (0.24369747936725616,
0.15686275064945221, 0.15686275064945221), (0.24789915978908539,
0.16078431904315948, 0.16078431904315948), (0.25210085511207581,
0.16078431904315948, 0.16078431904315948), (0.25630253553390503,
0.16470588743686676, 0.16470588743686676), (0.26050421595573425,
0.16862745583057404, 0.16862745583057404), (0.26470589637756348,
0.17254902422428131, 0.17254902422428131), (0.2689075767993927,
0.17647059261798859, 0.17647059261798859), (0.27310925722122192,
0.18039216101169586, 0.18039216101169586), (0.27731093764305115,
0.18431372940540314, 0.18431372940540314), (0.28151261806488037,
0.18823529779911041, 0.18823529779911041), (0.28571429848670959,
0.18823529779911041, 0.18823529779911041), (0.28991597890853882,
0.18823529779911041, 0.18823529779911041), (0.29411765933036804,
0.19215686619281769, 0.19215686619281769), (0.29831933975219727,
0.19215686619281769, 0.19215686619281769), (0.30252102017402649,
0.19607843458652496, 0.19607843458652496), (0.30672270059585571,
0.19607843458652496, 0.19607843458652496), (0.31092438101768494,
0.20000000298023224, 0.20000000298023224), (0.31512606143951416,
0.20000000298023224, 0.20000000298023224), (0.31932774186134338,
0.20392157137393951, 0.20392157137393951), (0.32352942228317261,
0.20392157137393951, 0.20392157137393951), (0.32773110270500183,
0.20784313976764679, 0.20784313976764679), (0.33193278312683105,
0.20784313976764679, 0.20784313976764679), (0.33613446354866028,
0.21176470816135406, 0.21176470816135406), (0.3403361439704895,
0.21176470816135406, 0.21176470816135406), (0.34453782439231873,
0.21568627655506134, 0.21568627655506134), (0.34873950481414795,
0.21568627655506134, 0.21568627655506134), (0.35294118523597717,
0.21960784494876862, 0.21960784494876862), (0.3571428656578064,
0.21960784494876862, 0.21960784494876862), (0.36134454607963562,
0.22352941334247589, 0.22352941334247589), (0.36554622650146484,
0.22352941334247589, 0.22352941334247589), (0.36974790692329407,
0.22745098173618317, 0.22745098173618317), (0.37394958734512329,
0.22745098173618317, 0.22745098173618317), (0.37815126776695251,
0.23137255012989044, 0.23137255012989044), (0.38235294818878174,
0.23137255012989044, 0.23137255012989044), (0.38655462861061096,
0.23529411852359772, 0.23529411852359772), (0.39075630903244019,
0.23921568691730499, 0.23921568691730499), (0.39495798945426941,
0.23921568691730499, 0.23921568691730499), (0.39915966987609863,
0.24313725531101227, 0.24313725531101227), (0.40336135029792786,
0.24313725531101227, 0.24313725531101227), (0.40756303071975708,
0.24705882370471954, 0.24705882370471954), (0.4117647111415863,
0.24705882370471954, 0.24705882370471954), (0.41596639156341553,
0.25098040699958801, 0.25098040699958801), (0.42016807198524475,
0.25098040699958801, 0.25098040699958801), (0.42436975240707397,
0.25490197539329529, 0.25490197539329529), (0.4285714328289032,
0.25490197539329529, 0.25490197539329529), (0.43277311325073242,
0.25882354378700256, 0.25882354378700256), (0.43697479367256165,
0.26274511218070984, 0.26274511218070984), (0.44117647409439087,
0.26274511218070984, 0.26274511218070984), (0.44537815451622009,
0.26666668057441711, 0.26666668057441711), (0.44957983493804932,
0.26666668057441711, 0.26666668057441711), (0.45378151535987854,
0.27058824896812439, 0.27058824896812439), (0.45798319578170776,
0.27058824896812439, 0.27058824896812439), (0.46218487620353699,
0.27450981736183167, 0.27450981736183167), (0.46638655662536621,
0.27843138575553894, 0.27843138575553894), (0.47058823704719543,
0.28627452254295349, 0.28627452254295349), (0.47478991746902466,
0.29803922772407532, 0.29803922772407532), (0.47899159789085388,
0.30588236451148987, 0.30588236451148987), (0.48319327831268311,
0.31764706969261169, 0.31764706969261169), (0.48739495873451233,
0.32549020648002625, 0.32549020648002625), (0.49159663915634155,
0.33725491166114807, 0.33725491166114807), (0.49579831957817078,
0.34509804844856262, 0.34509804844856262), (0.5, 0.35686275362968445,
0.35686275362968445), (0.50420171022415161, 0.36862745881080627,
0.36862745881080627), (0.50840336084365845, 0.37647059559822083,
0.37647059559822083), (0.51260507106781006, 0.38823530077934265,
0.38823530077934265), (0.51680672168731689, 0.3960784375667572,
0.3960784375667572), (0.52100843191146851, 0.40784314274787903,
0.40784314274787903), (0.52521008253097534, 0.41568627953529358,
0.41568627953529358), (0.52941179275512695, 0.42745098471641541,
0.42745098471641541), (0.53361344337463379, 0.43529412150382996,
0.43529412150382996), (0.5378151535987854, 0.44705882668495178,
0.44705882668495178), (0.54201680421829224, 0.45882353186607361,
0.45882353186607361), (0.54621851444244385, 0.46666666865348816,
0.46666666865348816), (0.55042016506195068, 0.47450980544090271,
0.47450980544090271), (0.55462187528610229, 0.47843137383460999,
0.47843137383460999), (0.55882352590560913, 0.48627451062202454,
0.48627451062202454), (0.56302523612976074, 0.49411764740943909,
0.49411764740943909), (0.56722688674926758, 0.50196081399917603,
0.50196081399917603), (0.57142859697341919, 0.5058823823928833,
0.5058823823928833), (0.57563024759292603, 0.51372551918029785,
0.51372551918029785), (0.57983195781707764, 0.5215686559677124,
0.5215686559677124), (0.58403360843658447, 0.52941179275512695,
0.52941179275512695), (0.58823531866073608, 0.53333336114883423,
0.53333336114883423), (0.59243696928024292, 0.54117649793624878,
0.54117649793624878), (0.59663867950439453, 0.54901963472366333,
0.54901963472366333), (0.60084033012390137, 0.55294120311737061,
0.55294120311737061), (0.60504204034805298, 0.56078433990478516,
0.56078433990478516), (0.60924369096755981, 0.56862747669219971,
0.56862747669219971), (0.61344540119171143, 0.57647061347961426,
0.57647061347961426), (0.61764705181121826, 0.58431375026702881,
0.58431375026702881), (0.62184876203536987, 0.58823531866073608,
0.58823531866073608), (0.62605041265487671, 0.59607845544815063,
0.59607845544815063), (0.63025212287902832, 0.60392159223556519,
0.60392159223556519), (0.63445377349853516, 0.61176472902297974,
0.61176472902297974), (0.63865548372268677, 0.61568629741668701,
0.61568629741668701), (0.6428571343421936, 0.62352943420410156,
0.62352943420410156), (0.64705884456634521, 0.63137257099151611,
0.63137257099151611), (0.65126049518585205, 0.63921570777893066,
0.63921570777893066), (0.65546220541000366, 0.64705884456634521,
0.64705884456634521), (0.6596638560295105, 0.65098041296005249,
0.65098041296005249), (0.66386556625366211, 0.65882354974746704,
0.65882354974746704), (0.66806721687316895, 0.66666668653488159,
0.66666668653488159), (0.67226892709732056, 0.67450982332229614,
0.67450982332229614), (0.67647057771682739, 0.68235296010971069,
0.68235296010971069), (0.680672287940979, 0.68627452850341797,
0.68627452850341797), (0.68487393856048584, 0.69411766529083252,
0.69411766529083252), (0.68907564878463745, 0.70196080207824707,
0.70196080207824707), (0.69327729940414429, 0.70980393886566162,
0.70980393886566162), (0.6974790096282959, 0.71764707565307617,
0.71764707565307617), (0.70168066024780273, 0.71764707565307617,
0.71764707565307617), (0.70588237047195435, 0.72156864404678345,
0.72156864404678345), (0.71008402109146118, 0.72156864404678345,
0.72156864404678345), (0.71428573131561279, 0.72549021244049072,
0.72549021244049072), (0.71848738193511963, 0.72549021244049072,
0.72549021244049072), (0.72268909215927124, 0.729411780834198,
0.729411780834198), (0.72689074277877808, 0.729411780834198,
0.729411780834198), (0.73109245300292969, 0.73333334922790527,
0.73333334922790527), (0.73529410362243652, 0.73333334922790527,
0.73333334922790527), (0.73949581384658813, 0.73333334922790527,
0.73333334922790527), (0.74369746446609497, 0.73725491762161255,
0.73725491762161255), (0.74789917469024658, 0.73725491762161255,
0.73725491762161255), (0.75210082530975342, 0.74117648601531982,
0.74117648601531982), (0.75630253553390503, 0.74117648601531982,
0.74117648601531982), (0.76050418615341187, 0.7450980544090271,
0.7450980544090271), (0.76470589637756348, 0.7450980544090271,
0.7450980544090271), (0.76890754699707031, 0.7450980544090271,
0.7450980544090271), (0.77310925722122192, 0.74901962280273438,
0.74901962280273438), (0.77731090784072876, 0.74901962280273438,
0.74901962280273438), (0.78151261806488037, 0.75294119119644165,
0.75294119119644165), (0.78571426868438721, 0.75294119119644165,
0.75294119119644165), (0.78991597890853882, 0.75686275959014893,
0.75686275959014893), (0.79411762952804565, 0.76470589637756348,
0.76470589637756348), (0.79831933975219727, 0.76862746477127075,
0.76862746477127075), (0.8025209903717041, 0.77254903316497803,
0.77254903316497803), (0.80672270059585571, 0.7764706015586853,
0.7764706015586853), (0.81092435121536255, 0.78039216995239258,
0.78039216995239258), (0.81512606143951416, 0.78823530673980713,
0.78823530673980713), (0.819327712059021, 0.7921568751335144,
0.7921568751335144), (0.82352942228317261, 0.79607844352722168,
0.79607844352722168), (0.82773107290267944, 0.80000001192092896,
0.80000001192092896), (0.83193278312683105, 0.80392158031463623,
0.80392158031463623), (0.83613443374633789, 0.81176471710205078,
0.81176471710205078), (0.8403361439704895, 0.81568628549575806,
0.81568628549575806), (0.84453779458999634, 0.81960785388946533,
0.81960785388946533), (0.84873950481414795, 0.82352942228317261,
0.82352942228317261), (0.85294115543365479, 0.82745099067687988,
0.82745099067687988), (0.8571428656578064, 0.83529412746429443,
0.83529412746429443), (0.86134451627731323, 0.83921569585800171,
0.83921569585800171), (0.86554622650146484, 0.84313726425170898,
0.84313726425170898), (0.86974787712097168, 0.84705883264541626,
0.84705883264541626), (0.87394958734512329, 0.85098040103912354,
0.85098040103912354), (0.87815123796463013, 0.85882353782653809,
0.85882353782653809), (0.88235294818878174, 0.86274510622024536,
0.86274510622024536), (0.88655459880828857, 0.86666667461395264,
0.86666667461395264), (0.89075630903244019, 0.87058824300765991,
0.87058824300765991), (0.89495795965194702, 0.87450981140136719,
0.87450981140136719), (0.89915966987609863, 0.88235294818878174,
0.88235294818878174), (0.90336132049560547, 0.88627451658248901,
0.88627451658248901), (0.90756303071975708, 0.89019608497619629,
0.89019608497619629), (0.91176468133926392, 0.89411765336990356,
0.89411765336990356), (0.91596639156341553, 0.89803922176361084,
0.89803922176361084), (0.92016804218292236, 0.90588235855102539,
0.90588235855102539), (0.92436975240707397, 0.90980392694473267,
0.90980392694473267), (0.92857140302658081, 0.91372549533843994,
0.91372549533843994), (0.93277311325073242, 0.91764706373214722,
0.91764706373214722), (0.93697476387023926, 0.92156863212585449,
0.92156863212585449), (0.94117647409439087, 0.92941176891326904,
0.92941176891326904), (0.94537812471389771, 0.93333333730697632,
0.93333333730697632), (0.94957983493804932, 0.93725490570068359,
0.93725490570068359), (0.95378148555755615, 0.94117647409439087,
0.94117647409439087), (0.95798319578170776, 0.94509804248809814,
0.94509804248809814), (0.9621848464012146, 0.9529411792755127,
0.9529411792755127), (0.96638655662536621, 0.95686274766921997,
0.95686274766921997), (0.97058820724487305, 0.96078431606292725,
0.96078431606292725), (0.97478991746902466, 0.96470588445663452,
0.96470588445663452), (0.97899156808853149, 0.9686274528503418,
0.9686274528503418), (0.98319327831268311, 0.97647058963775635,
0.97647058963775635), (0.98739492893218994, 0.98039215803146362,
0.98039215803146362), (0.99159663915634155, 0.9843137264251709,
0.9843137264251709), (0.99579828977584839, 0.98823529481887817,
0.98823529481887817), (1.0, 0.99215686321258545, 0.99215686321258545)]}
_gist_gray_data = {'blue': [(0.0, 0.0, 0.0), (0.0042016808874905109,
0.0039215688593685627, 0.0039215688593685627), (0.0084033617749810219,
0.0078431377187371254, 0.0078431377187371254), (0.012605042196810246,
0.011764706112444401, 0.011764706112444401), (0.016806723549962044,
0.015686275437474251, 0.015686275437474251), (0.021008403971791267,
0.019607843831181526, 0.019607843831181526), (0.025210084393620491,
0.023529412224888802, 0.023529412224888802), (0.029411764815449715,
0.027450980618596077, 0.027450980618596077), (0.033613447099924088,
0.035294119268655777, 0.035294119268655777), (0.037815127521753311,
0.039215687662363052, 0.039215687662363052), (0.042016807943582535,
0.043137256056070328, 0.043137256056070328), (0.046218488365411758,
0.047058824449777603, 0.047058824449777603), (0.050420168787240982,
0.050980392843484879, 0.050980392843484879), (0.054621849209070206,
0.054901961237192154, 0.054901961237192154), (0.058823529630899429,
0.058823529630899429, 0.058823529630899429), (0.063025213778018951,
0.062745101749897003, 0.062745101749897003), (0.067226894199848175,
0.066666670143604279, 0.066666670143604279), (0.071428574621677399,
0.070588238537311554, 0.070588238537311554), (0.075630255043506622,
0.074509806931018829, 0.074509806931018829), (0.079831935465335846,
0.078431375324726105, 0.078431375324726105), (0.08403361588716507,
0.08235294371843338, 0.08235294371843338), (0.088235296308994293,
0.086274512112140656, 0.086274512112140656), (0.092436976730823517,
0.090196080505847931, 0.090196080505847931), (0.09663865715265274,
0.098039217293262482, 0.098039217293262482), (0.10084033757448196,
0.10196078568696976, 0.10196078568696976), (0.10504201799631119,
0.10588235408067703, 0.10588235408067703), (0.10924369841814041,
0.10980392247438431, 0.10980392247438431), (0.11344537883996964,
0.11372549086809158, 0.11372549086809158), (0.11764705926179886,
0.11764705926179886, 0.11764705926179886), (0.12184873968362808,
0.12156862765550613, 0.12156862765550613), (0.1260504275560379,
0.12549020349979401, 0.12549020349979401), (0.13025210797786713,
0.12941177189350128, 0.12941177189350128), (0.13445378839969635,
0.13333334028720856, 0.13333334028720856), (0.13865546882152557,
0.13725490868091583, 0.13725490868091583), (0.1428571492433548,
0.14117647707462311, 0.14117647707462311), (0.14705882966518402,
0.14509804546833038, 0.14509804546833038), (0.15126051008701324,
0.14901961386203766, 0.14901961386203766), (0.15546219050884247,
0.15294118225574493, 0.15294118225574493), (0.15966387093067169,
0.16078431904315948, 0.16078431904315948), (0.16386555135250092,
0.16470588743686676, 0.16470588743686676), (0.16806723177433014,
0.16862745583057404, 0.16862745583057404), (0.17226891219615936,
0.17254902422428131, 0.17254902422428131), (0.17647059261798859,
0.17647059261798859, 0.17647059261798859), (0.18067227303981781,
0.18039216101169586, 0.18039216101169586), (0.18487395346164703,
0.18431372940540314, 0.18431372940540314), (0.18907563388347626,
0.18823529779911041, 0.18823529779911041), (0.19327731430530548,
0.19215686619281769, 0.19215686619281769), (0.1974789947271347,
0.19607843458652496, 0.19607843458652496), (0.20168067514896393,
0.20000000298023224, 0.20000000298023224), (0.20588235557079315,
0.20392157137393951, 0.20392157137393951), (0.21008403599262238,
0.20784313976764679, 0.20784313976764679), (0.2142857164144516,
0.21176470816135406, 0.21176470816135406), (0.21848739683628082,
0.21568627655506134, 0.21568627655506134), (0.22268907725811005,
0.22352941334247589, 0.22352941334247589), (0.22689075767993927,
0.22745098173618317, 0.22745098173618317), (0.23109243810176849,
0.23137255012989044, 0.23137255012989044), (0.23529411852359772,
0.23529411852359772, 0.23529411852359772), (0.23949579894542694,
0.23921568691730499, 0.23921568691730499), (0.24369747936725616,
0.24313725531101227, 0.24313725531101227), (0.24789915978908539,
0.24705882370471954, 0.24705882370471954), (0.25210085511207581,
0.25098040699958801, 0.25098040699958801), (0.25630253553390503,
0.25490197539329529, 0.25490197539329529), (0.26050421595573425,
0.25882354378700256, 0.25882354378700256), (0.26470589637756348,
0.26274511218070984, 0.26274511218070984), (0.2689075767993927,
0.26666668057441711, 0.26666668057441711), (0.27310925722122192,
0.27058824896812439, 0.27058824896812439), (0.27731093764305115,
0.27450981736183167, 0.27450981736183167), (0.28151261806488037,
0.27843138575553894, 0.27843138575553894), (0.28571429848670959,
0.28627452254295349, 0.28627452254295349), (0.28991597890853882,
0.29019609093666077, 0.29019609093666077), (0.29411765933036804,
0.29411765933036804, 0.29411765933036804), (0.29831933975219727,
0.29803922772407532, 0.29803922772407532), (0.30252102017402649,
0.30196079611778259, 0.30196079611778259), (0.30672270059585571,
0.30588236451148987, 0.30588236451148987), (0.31092438101768494,
0.30980393290519714, 0.30980393290519714), (0.31512606143951416,
0.31372550129890442, 0.31372550129890442), (0.31932774186134338,
0.31764706969261169, 0.31764706969261169), (0.32352942228317261,
0.32156863808631897, 0.32156863808631897), (0.32773110270500183,
0.32549020648002625, 0.32549020648002625), (0.33193278312683105,
0.32941177487373352, 0.32941177487373352), (0.33613446354866028,
0.3333333432674408, 0.3333333432674408), (0.3403361439704895,
0.33725491166114807, 0.33725491166114807), (0.34453782439231873,
0.34117648005485535, 0.34117648005485535), (0.34873950481414795,
0.3490196168422699, 0.3490196168422699), (0.35294118523597717,
0.35294118523597717, 0.35294118523597717), (0.3571428656578064,
0.35686275362968445, 0.35686275362968445), (0.36134454607963562,
0.36078432202339172, 0.36078432202339172), (0.36554622650146484,
0.364705890417099, 0.364705890417099), (0.36974790692329407,
0.36862745881080627, 0.36862745881080627), (0.37394958734512329,
0.37254902720451355, 0.37254902720451355), (0.37815126776695251,
0.37647059559822083, 0.37647059559822083), (0.38235294818878174,
0.3803921639919281, 0.3803921639919281), (0.38655462861061096,
0.38431373238563538, 0.38431373238563538), (0.39075630903244019,
0.38823530077934265, 0.38823530077934265), (0.39495798945426941,
0.39215686917304993, 0.39215686917304993), (0.39915966987609863,
0.3960784375667572, 0.3960784375667572), (0.40336135029792786,
0.40000000596046448, 0.40000000596046448), (0.40756303071975708,
0.40392157435417175, 0.40392157435417175), (0.4117647111415863,
0.4117647111415863, 0.4117647111415863), (0.41596639156341553,
0.41568627953529358, 0.41568627953529358), (0.42016807198524475,
0.41960784792900085, 0.41960784792900085), (0.42436975240707397,
0.42352941632270813, 0.42352941632270813), (0.4285714328289032,
0.42745098471641541, 0.42745098471641541), (0.43277311325073242,
0.43137255311012268, 0.43137255311012268), (0.43697479367256165,
0.43529412150382996, 0.43529412150382996), (0.44117647409439087,
0.43921568989753723, 0.43921568989753723), (0.44537815451622009,
0.44313725829124451, 0.44313725829124451), (0.44957983493804932,
0.44705882668495178, 0.44705882668495178), (0.45378151535987854,
0.45098039507865906, 0.45098039507865906), (0.45798319578170776,
0.45490196347236633, 0.45490196347236633), (0.46218487620353699,
0.45882353186607361, 0.45882353186607361), (0.46638655662536621,
0.46274510025978088, 0.46274510025978088), (0.47058823704719543,
0.46666666865348816, 0.46666666865348816), (0.47478991746902466,
0.47450980544090271, 0.47450980544090271), (0.47899159789085388,
0.47843137383460999, 0.47843137383460999), (0.48319327831268311,
0.48235294222831726, 0.48235294222831726), (0.48739495873451233,
0.48627451062202454, 0.48627451062202454), (0.49159663915634155,
0.49019607901573181, 0.49019607901573181), (0.49579831957817078,
0.49411764740943909, 0.49411764740943909), (0.5, 0.49803921580314636,
0.49803921580314636), (0.50420171022415161, 0.50196081399917603,
0.50196081399917603), (0.50840336084365845, 0.5058823823928833,
0.5058823823928833), (0.51260507106781006, 0.50980395078659058,
0.50980395078659058), (0.51680672168731689, 0.51372551918029785,
0.51372551918029785), (0.52100843191146851, 0.51764708757400513,
0.51764708757400513), (0.52521008253097534, 0.5215686559677124,
0.5215686559677124), (0.52941179275512695, 0.52549022436141968,
0.52549022436141968), (0.53361344337463379, 0.52941179275512695,
0.52941179275512695), (0.5378151535987854, 0.5372549295425415,
0.5372549295425415), (0.54201680421829224, 0.54117649793624878,
0.54117649793624878), (0.54621851444244385, 0.54509806632995605,
0.54509806632995605), (0.55042016506195068, 0.54901963472366333,
0.54901963472366333), (0.55462187528610229, 0.55294120311737061,
0.55294120311737061), (0.55882352590560913, 0.55686277151107788,
0.55686277151107788), (0.56302523612976074, 0.56078433990478516,
0.56078433990478516), (0.56722688674926758, 0.56470590829849243,
0.56470590829849243), (0.57142859697341919, 0.56862747669219971,
0.56862747669219971), (0.57563024759292603, 0.57254904508590698,
0.57254904508590698), (0.57983195781707764, 0.57647061347961426,
0.57647061347961426), (0.58403360843658447, 0.58039218187332153,
0.58039218187332153), (0.58823531866073608, 0.58431375026702881,
0.58431375026702881), (0.59243696928024292, 0.58823531866073608,
0.58823531866073608), (0.59663867950439453, 0.59215688705444336,
0.59215688705444336), (0.60084033012390137, 0.60000002384185791,
0.60000002384185791), (0.60504204034805298, 0.60392159223556519,
0.60392159223556519), (0.60924369096755981, 0.60784316062927246,
0.60784316062927246), (0.61344540119171143, 0.61176472902297974,
0.61176472902297974), (0.61764705181121826, 0.61568629741668701,
0.61568629741668701), (0.62184876203536987, 0.61960786581039429,
0.61960786581039429), (0.62605041265487671, 0.62352943420410156,
0.62352943420410156), (0.63025212287902832, 0.62745100259780884,
0.62745100259780884), (0.63445377349853516, 0.63137257099151611,
0.63137257099151611), (0.63865548372268677, 0.63529413938522339,
0.63529413938522339), (0.6428571343421936, 0.63921570777893066,
0.63921570777893066), (0.64705884456634521, 0.64313727617263794,
0.64313727617263794), (0.65126049518585205, 0.64705884456634521,
0.64705884456634521), (0.65546220541000366, 0.65098041296005249,
0.65098041296005249), (0.6596638560295105, 0.65490198135375977,
0.65490198135375977), (0.66386556625366211, 0.66274511814117432,
0.66274511814117432), (0.66806721687316895, 0.66666668653488159,
0.66666668653488159), (0.67226892709732056, 0.67058825492858887,
0.67058825492858887), (0.67647057771682739, 0.67450982332229614,
0.67450982332229614), (0.680672287940979, 0.67843139171600342,
0.67843139171600342), (0.68487393856048584, 0.68235296010971069,
0.68235296010971069), (0.68907564878463745, 0.68627452850341797,
0.68627452850341797), (0.69327729940414429, 0.69019609689712524,
0.69019609689712524), (0.6974790096282959, 0.69411766529083252,
0.69411766529083252), (0.70168066024780273, 0.69803923368453979,
0.69803923368453979), (0.70588237047195435, 0.70196080207824707,
0.70196080207824707), (0.71008402109146118, 0.70588237047195435,
0.70588237047195435), (0.71428573131561279, 0.70980393886566162,
0.70980393886566162), (0.71848738193511963, 0.7137255072593689,
0.7137255072593689), (0.72268909215927124, 0.71764707565307617,
0.71764707565307617), (0.72689074277877808, 0.72549021244049072,
0.72549021244049072), (0.73109245300292969, 0.729411780834198,
0.729411780834198), (0.73529410362243652, 0.73333334922790527,
0.73333334922790527), (0.73949581384658813, 0.73725491762161255,
0.73725491762161255), (0.74369746446609497, 0.74117648601531982,
0.74117648601531982), (0.74789917469024658, 0.7450980544090271,
0.7450980544090271), (0.75210082530975342, 0.74901962280273438,
0.74901962280273438), (0.75630253553390503, 0.75294119119644165,
0.75294119119644165), (0.76050418615341187, 0.75686275959014893,
0.75686275959014893), (0.76470589637756348, 0.7607843279838562,
0.7607843279838562), (0.76890754699707031, 0.76470589637756348,
0.76470589637756348), (0.77310925722122192, 0.76862746477127075,
0.76862746477127075), (0.77731090784072876, 0.77254903316497803,
0.77254903316497803), (0.78151261806488037, 0.7764706015586853,
0.7764706015586853), (0.78571426868438721, 0.78039216995239258,
0.78039216995239258), (0.78991597890853882, 0.78823530673980713,
0.78823530673980713), (0.79411762952804565, 0.7921568751335144,
0.7921568751335144), (0.79831933975219727, 0.79607844352722168,
0.79607844352722168), (0.8025209903717041, 0.80000001192092896,
0.80000001192092896), (0.80672270059585571, 0.80392158031463623,
0.80392158031463623), (0.81092435121536255, 0.80784314870834351,
0.80784314870834351), (0.81512606143951416, 0.81176471710205078,
0.81176471710205078), (0.819327712059021, 0.81568628549575806,
0.81568628549575806), (0.82352942228317261, 0.81960785388946533,
0.81960785388946533), (0.82773107290267944, 0.82352942228317261,
0.82352942228317261), (0.83193278312683105, 0.82745099067687988,
0.82745099067687988), (0.83613443374633789, 0.83137255907058716,
0.83137255907058716), (0.8403361439704895, 0.83529412746429443,
0.83529412746429443), (0.84453779458999634, 0.83921569585800171,
0.83921569585800171), (0.84873950481414795, 0.84313726425170898,
0.84313726425170898), (0.85294115543365479, 0.85098040103912354,
0.85098040103912354), (0.8571428656578064, 0.85490196943283081,
0.85490196943283081), (0.86134451627731323, 0.85882353782653809,
0.85882353782653809), (0.86554622650146484, 0.86274510622024536,
0.86274510622024536), (0.86974787712097168, 0.86666667461395264,
0.86666667461395264), (0.87394958734512329, 0.87058824300765991,
0.87058824300765991), (0.87815123796463013, 0.87450981140136719,
0.87450981140136719), (0.88235294818878174, 0.87843137979507446,
0.87843137979507446), (0.88655459880828857, 0.88235294818878174,
0.88235294818878174), (0.89075630903244019, 0.88627451658248901,
0.88627451658248901), (0.89495795965194702, 0.89019608497619629,
0.89019608497619629), (0.89915966987609863, 0.89411765336990356,
0.89411765336990356), (0.90336132049560547, 0.89803922176361084,
0.89803922176361084), (0.90756303071975708, 0.90196079015731812,
0.90196079015731812), (0.91176468133926392, 0.90588235855102539,
0.90588235855102539), (0.91596639156341553, 0.91372549533843994,
0.91372549533843994), (0.92016804218292236, 0.91764706373214722,
0.91764706373214722), (0.92436975240707397, 0.92156863212585449,
0.92156863212585449), (0.92857140302658081, 0.92549020051956177,
0.92549020051956177), (0.93277311325073242, 0.92941176891326904,
0.92941176891326904), (0.93697476387023926, 0.93333333730697632,
0.93333333730697632), (0.94117647409439087, 0.93725490570068359,
0.93725490570068359), (0.94537812471389771, 0.94117647409439087,
0.94117647409439087), (0.94957983493804932, 0.94509804248809814,
0.94509804248809814), (0.95378148555755615, 0.94901961088180542,
0.94901961088180542), (0.95798319578170776, 0.9529411792755127,
0.9529411792755127), (0.9621848464012146, 0.95686274766921997,
0.95686274766921997), (0.96638655662536621, 0.96078431606292725,
0.96078431606292725), (0.97058820724487305, 0.96470588445663452,
0.96470588445663452), (0.97478991746902466, 0.9686274528503418,
0.9686274528503418), (0.97899156808853149, 0.97647058963775635,
0.97647058963775635), (0.98319327831268311, 0.98039215803146362,
0.98039215803146362), (0.98739492893218994, 0.9843137264251709,
0.9843137264251709), (0.99159663915634155, 0.98823529481887817,
0.98823529481887817), (0.99579828977584839, 0.99215686321258545,
0.99215686321258545), (1.0, 0.99607843160629272, 0.99607843160629272)],
'green': [(0.0, 0.0, 0.0), (0.0042016808874905109, 0.0039215688593685627,
0.0039215688593685627), (0.0084033617749810219, 0.0078431377187371254,
0.0078431377187371254), (0.012605042196810246, 0.011764706112444401,
0.011764706112444401), (0.016806723549962044, 0.015686275437474251,
0.015686275437474251), (0.021008403971791267, 0.019607843831181526,
0.019607843831181526), (0.025210084393620491, 0.023529412224888802,
0.023529412224888802), (0.029411764815449715, 0.027450980618596077,
0.027450980618596077), (0.033613447099924088, 0.035294119268655777,
0.035294119268655777), (0.037815127521753311, 0.039215687662363052,
0.039215687662363052), (0.042016807943582535, 0.043137256056070328,
0.043137256056070328), (0.046218488365411758, 0.047058824449777603,
0.047058824449777603), (0.050420168787240982, 0.050980392843484879,
0.050980392843484879), (0.054621849209070206, 0.054901961237192154,
0.054901961237192154), (0.058823529630899429, 0.058823529630899429,
0.058823529630899429), (0.063025213778018951, 0.062745101749897003,
0.062745101749897003), (0.067226894199848175, 0.066666670143604279,
0.066666670143604279), (0.071428574621677399, 0.070588238537311554,
0.070588238537311554), (0.075630255043506622, 0.074509806931018829,
0.074509806931018829), (0.079831935465335846, 0.078431375324726105,
0.078431375324726105), (0.08403361588716507, 0.08235294371843338,
0.08235294371843338), (0.088235296308994293, 0.086274512112140656,
0.086274512112140656), (0.092436976730823517, 0.090196080505847931,
0.090196080505847931), (0.09663865715265274, 0.098039217293262482,
0.098039217293262482), (0.10084033757448196, 0.10196078568696976,
0.10196078568696976), (0.10504201799631119, 0.10588235408067703,
0.10588235408067703), (0.10924369841814041, 0.10980392247438431,
0.10980392247438431), (0.11344537883996964, 0.11372549086809158,
0.11372549086809158), (0.11764705926179886, 0.11764705926179886,
0.11764705926179886), (0.12184873968362808, 0.12156862765550613,
0.12156862765550613), (0.1260504275560379, 0.12549020349979401,
0.12549020349979401), (0.13025210797786713, 0.12941177189350128,
0.12941177189350128), (0.13445378839969635, 0.13333334028720856,
0.13333334028720856), (0.13865546882152557, 0.13725490868091583,
0.13725490868091583), (0.1428571492433548, 0.14117647707462311,
0.14117647707462311), (0.14705882966518402, 0.14509804546833038,
0.14509804546833038), (0.15126051008701324, 0.14901961386203766,
0.14901961386203766), (0.15546219050884247, 0.15294118225574493,
0.15294118225574493), (0.15966387093067169, 0.16078431904315948,
0.16078431904315948), (0.16386555135250092, 0.16470588743686676,
0.16470588743686676), (0.16806723177433014, 0.16862745583057404,
0.16862745583057404), (0.17226891219615936, 0.17254902422428131,
0.17254902422428131), (0.17647059261798859, 0.17647059261798859,
0.17647059261798859), (0.18067227303981781, 0.18039216101169586,
0.18039216101169586), (0.18487395346164703, 0.18431372940540314,
0.18431372940540314), (0.18907563388347626, 0.18823529779911041,
0.18823529779911041), (0.19327731430530548, 0.19215686619281769,
0.19215686619281769), (0.1974789947271347, 0.19607843458652496,
0.19607843458652496), (0.20168067514896393, 0.20000000298023224,
0.20000000298023224), (0.20588235557079315, 0.20392157137393951,
0.20392157137393951), (0.21008403599262238, 0.20784313976764679,
0.20784313976764679), (0.2142857164144516, 0.21176470816135406,
0.21176470816135406), (0.21848739683628082, 0.21568627655506134,
0.21568627655506134), (0.22268907725811005, 0.22352941334247589,
0.22352941334247589), (0.22689075767993927, 0.22745098173618317,
0.22745098173618317), (0.23109243810176849, 0.23137255012989044,
0.23137255012989044), (0.23529411852359772, 0.23529411852359772,
0.23529411852359772), (0.23949579894542694, 0.23921568691730499,
0.23921568691730499), (0.24369747936725616, 0.24313725531101227,
0.24313725531101227), (0.24789915978908539, 0.24705882370471954,
0.24705882370471954), (0.25210085511207581, 0.25098040699958801,
0.25098040699958801), (0.25630253553390503, 0.25490197539329529,
0.25490197539329529), (0.26050421595573425, 0.25882354378700256,
0.25882354378700256), (0.26470589637756348, 0.26274511218070984,
0.26274511218070984), (0.2689075767993927, 0.26666668057441711,
0.26666668057441711), (0.27310925722122192, 0.27058824896812439,
0.27058824896812439), (0.27731093764305115, 0.27450981736183167,
0.27450981736183167), (0.28151261806488037, 0.27843138575553894,
0.27843138575553894), (0.28571429848670959, 0.28627452254295349,
0.28627452254295349), (0.28991597890853882, 0.29019609093666077,
0.29019609093666077), (0.29411765933036804, 0.29411765933036804,
0.29411765933036804), (0.29831933975219727, 0.29803922772407532,
0.29803922772407532), (0.30252102017402649, 0.30196079611778259,
0.30196079611778259), (0.30672270059585571, 0.30588236451148987,
0.30588236451148987), (0.31092438101768494, 0.30980393290519714,
0.30980393290519714), (0.31512606143951416, 0.31372550129890442,
0.31372550129890442), (0.31932774186134338, 0.31764706969261169,
0.31764706969261169), (0.32352942228317261, 0.32156863808631897,
0.32156863808631897), (0.32773110270500183, 0.32549020648002625,
0.32549020648002625), (0.33193278312683105, 0.32941177487373352,
0.32941177487373352), (0.33613446354866028, 0.3333333432674408,
0.3333333432674408), (0.3403361439704895, 0.33725491166114807,
0.33725491166114807), (0.34453782439231873, 0.34117648005485535,
0.34117648005485535), (0.34873950481414795, 0.3490196168422699,
0.3490196168422699), (0.35294118523597717, 0.35294118523597717,
0.35294118523597717), (0.3571428656578064, 0.35686275362968445,
0.35686275362968445), (0.36134454607963562, 0.36078432202339172,
0.36078432202339172), (0.36554622650146484, 0.364705890417099,
0.364705890417099), (0.36974790692329407, 0.36862745881080627,
0.36862745881080627), (0.37394958734512329, 0.37254902720451355,
0.37254902720451355), (0.37815126776695251, 0.37647059559822083,
0.37647059559822083), (0.38235294818878174, 0.3803921639919281,
0.3803921639919281), (0.38655462861061096, 0.38431373238563538,
0.38431373238563538), (0.39075630903244019, 0.38823530077934265,
0.38823530077934265), (0.39495798945426941, 0.39215686917304993,
0.39215686917304993), (0.39915966987609863, 0.3960784375667572,
0.3960784375667572), (0.40336135029792786, 0.40000000596046448,
0.40000000596046448), (0.40756303071975708, 0.40392157435417175,
0.40392157435417175), (0.4117647111415863, 0.4117647111415863,
0.4117647111415863), (0.41596639156341553, 0.41568627953529358,
0.41568627953529358), (0.42016807198524475, 0.41960784792900085,
0.41960784792900085), (0.42436975240707397, 0.42352941632270813,
0.42352941632270813), (0.4285714328289032, 0.42745098471641541,
0.42745098471641541), (0.43277311325073242, 0.43137255311012268,
0.43137255311012268), (0.43697479367256165, 0.43529412150382996,
0.43529412150382996), (0.44117647409439087, 0.43921568989753723,
0.43921568989753723), (0.44537815451622009, 0.44313725829124451,
0.44313725829124451), (0.44957983493804932, 0.44705882668495178,
0.44705882668495178), (0.45378151535987854, 0.45098039507865906,
0.45098039507865906), (0.45798319578170776, 0.45490196347236633,
0.45490196347236633), (0.46218487620353699, 0.45882353186607361,
0.45882353186607361), (0.46638655662536621, 0.46274510025978088,
0.46274510025978088), (0.47058823704719543, 0.46666666865348816,
0.46666666865348816), (0.47478991746902466, 0.47450980544090271,
0.47450980544090271), (0.47899159789085388, 0.47843137383460999,
0.47843137383460999), (0.48319327831268311, 0.48235294222831726,
0.48235294222831726), (0.48739495873451233, 0.48627451062202454,
0.48627451062202454), (0.49159663915634155, 0.49019607901573181,
0.49019607901573181), (0.49579831957817078, 0.49411764740943909,
0.49411764740943909), (0.5, 0.49803921580314636, 0.49803921580314636),
(0.50420171022415161, 0.50196081399917603, 0.50196081399917603),
(0.50840336084365845, 0.5058823823928833, 0.5058823823928833),
(0.51260507106781006, 0.50980395078659058, 0.50980395078659058),
(0.51680672168731689, 0.51372551918029785, 0.51372551918029785),
(0.52100843191146851, 0.51764708757400513, 0.51764708757400513),
(0.52521008253097534, 0.5215686559677124, 0.5215686559677124),
(0.52941179275512695, 0.52549022436141968, 0.52549022436141968),
(0.53361344337463379, 0.52941179275512695, 0.52941179275512695),
(0.5378151535987854, 0.5372549295425415, 0.5372549295425415),
(0.54201680421829224, 0.54117649793624878, 0.54117649793624878),
(0.54621851444244385, 0.54509806632995605, 0.54509806632995605),
(0.55042016506195068, 0.54901963472366333, 0.54901963472366333),
(0.55462187528610229, 0.55294120311737061, 0.55294120311737061),
(0.55882352590560913, 0.55686277151107788, 0.55686277151107788),
(0.56302523612976074, 0.56078433990478516, 0.56078433990478516),
(0.56722688674926758, 0.56470590829849243, 0.56470590829849243),
(0.57142859697341919, 0.56862747669219971, 0.56862747669219971),
(0.57563024759292603, 0.57254904508590698, 0.57254904508590698),
(0.57983195781707764, 0.57647061347961426, 0.57647061347961426),
(0.58403360843658447, 0.58039218187332153, 0.58039218187332153),
(0.58823531866073608, 0.58431375026702881, 0.58431375026702881),
(0.59243696928024292, 0.58823531866073608, 0.58823531866073608),
(0.59663867950439453, 0.59215688705444336, 0.59215688705444336),
(0.60084033012390137, 0.60000002384185791, 0.60000002384185791),
(0.60504204034805298, 0.60392159223556519, 0.60392159223556519),
(0.60924369096755981, 0.60784316062927246, 0.60784316062927246),
(0.61344540119171143, 0.61176472902297974, 0.61176472902297974),
(0.61764705181121826, 0.61568629741668701, 0.61568629741668701),
(0.62184876203536987, 0.61960786581039429, 0.61960786581039429),
(0.62605041265487671, 0.62352943420410156, 0.62352943420410156),
(0.63025212287902832, 0.62745100259780884, 0.62745100259780884),
(0.63445377349853516, 0.63137257099151611, 0.63137257099151611),
(0.63865548372268677, 0.63529413938522339, 0.63529413938522339),
(0.6428571343421936, 0.63921570777893066, 0.63921570777893066),
(0.64705884456634521, 0.64313727617263794, 0.64313727617263794),
(0.65126049518585205, 0.64705884456634521, 0.64705884456634521),
(0.65546220541000366, 0.65098041296005249, 0.65098041296005249),
(0.6596638560295105, 0.65490198135375977, 0.65490198135375977),
(0.66386556625366211, 0.66274511814117432, 0.66274511814117432),
(0.66806721687316895, 0.66666668653488159, 0.66666668653488159),
(0.67226892709732056, 0.67058825492858887, 0.67058825492858887),
(0.67647057771682739, 0.67450982332229614, 0.67450982332229614),
(0.680672287940979, 0.67843139171600342, 0.67843139171600342),
(0.68487393856048584, 0.68235296010971069, 0.68235296010971069),
(0.68907564878463745, 0.68627452850341797, 0.68627452850341797),
(0.69327729940414429, 0.69019609689712524, 0.69019609689712524),
(0.6974790096282959, 0.69411766529083252, 0.69411766529083252),
(0.70168066024780273, 0.69803923368453979, 0.69803923368453979),
(0.70588237047195435, 0.70196080207824707, 0.70196080207824707),
(0.71008402109146118, 0.70588237047195435, 0.70588237047195435),
(0.71428573131561279, 0.70980393886566162, 0.70980393886566162),
(0.71848738193511963, 0.7137255072593689, 0.7137255072593689),
(0.72268909215927124, 0.71764707565307617, 0.71764707565307617),
(0.72689074277877808, 0.72549021244049072, 0.72549021244049072),
(0.73109245300292969, 0.729411780834198, 0.729411780834198),
(0.73529410362243652, 0.73333334922790527, 0.73333334922790527),
(0.73949581384658813, 0.73725491762161255, 0.73725491762161255),
(0.74369746446609497, 0.74117648601531982, 0.74117648601531982),
(0.74789917469024658, 0.7450980544090271, 0.7450980544090271),
(0.75210082530975342, 0.74901962280273438, 0.74901962280273438),
(0.75630253553390503, 0.75294119119644165, 0.75294119119644165),
(0.76050418615341187, 0.75686275959014893, 0.75686275959014893),
(0.76470589637756348, 0.7607843279838562, 0.7607843279838562),
(0.76890754699707031, 0.76470589637756348, 0.76470589637756348),
(0.77310925722122192, 0.76862746477127075, 0.76862746477127075),
(0.77731090784072876, 0.77254903316497803, 0.77254903316497803),
(0.78151261806488037, 0.7764706015586853, 0.7764706015586853),
(0.78571426868438721, 0.78039216995239258, 0.78039216995239258),
(0.78991597890853882, 0.78823530673980713, 0.78823530673980713),
(0.79411762952804565, 0.7921568751335144, 0.7921568751335144),
(0.79831933975219727, 0.79607844352722168, 0.79607844352722168),
(0.8025209903717041, 0.80000001192092896, 0.80000001192092896),
(0.80672270059585571, 0.80392158031463623, 0.80392158031463623),
(0.81092435121536255, 0.80784314870834351, 0.80784314870834351),
(0.81512606143951416, 0.81176471710205078, 0.81176471710205078),
(0.819327712059021, 0.81568628549575806, 0.81568628549575806),
(0.82352942228317261, 0.81960785388946533, 0.81960785388946533),
(0.82773107290267944, 0.82352942228317261, 0.82352942228317261),
(0.83193278312683105, 0.82745099067687988, 0.82745099067687988),
(0.83613443374633789, 0.83137255907058716, 0.83137255907058716),
(0.8403361439704895, 0.83529412746429443, 0.83529412746429443),
(0.84453779458999634, 0.83921569585800171, 0.83921569585800171),
(0.84873950481414795, 0.84313726425170898, 0.84313726425170898),
(0.85294115543365479, 0.85098040103912354, 0.85098040103912354),
(0.8571428656578064, 0.85490196943283081, 0.85490196943283081),
(0.86134451627731323, 0.85882353782653809, 0.85882353782653809),
(0.86554622650146484, 0.86274510622024536, 0.86274510622024536),
(0.86974787712097168, 0.86666667461395264, 0.86666667461395264),
(0.87394958734512329, 0.87058824300765991, 0.87058824300765991),
(0.87815123796463013, 0.87450981140136719, 0.87450981140136719),
(0.88235294818878174, 0.87843137979507446, 0.87843137979507446),
(0.88655459880828857, 0.88235294818878174, 0.88235294818878174),
(0.89075630903244019, 0.88627451658248901, 0.88627451658248901),
(0.89495795965194702, 0.89019608497619629, 0.89019608497619629),
(0.89915966987609863, 0.89411765336990356, 0.89411765336990356),
(0.90336132049560547, 0.89803922176361084, 0.89803922176361084),
(0.90756303071975708, 0.90196079015731812, 0.90196079015731812),
(0.91176468133926392, 0.90588235855102539, 0.90588235855102539),
(0.91596639156341553, 0.91372549533843994, 0.91372549533843994),
(0.92016804218292236, 0.91764706373214722, 0.91764706373214722),
(0.92436975240707397, 0.92156863212585449, 0.92156863212585449),
(0.92857140302658081, 0.92549020051956177, 0.92549020051956177),
(0.93277311325073242, 0.92941176891326904, 0.92941176891326904),
(0.93697476387023926, 0.93333333730697632, 0.93333333730697632),
(0.94117647409439087, 0.93725490570068359, 0.93725490570068359),
(0.94537812471389771, 0.94117647409439087, 0.94117647409439087),
(0.94957983493804932, 0.94509804248809814, 0.94509804248809814),
(0.95378148555755615, 0.94901961088180542, 0.94901961088180542),
(0.95798319578170776, 0.9529411792755127, 0.9529411792755127),
(0.9621848464012146, 0.95686274766921997, 0.95686274766921997),
(0.96638655662536621, 0.96078431606292725, 0.96078431606292725),
(0.97058820724487305, 0.96470588445663452, 0.96470588445663452),
(0.97478991746902466, 0.9686274528503418, 0.9686274528503418),
(0.97899156808853149, 0.97647058963775635, 0.97647058963775635),
(0.98319327831268311, 0.98039215803146362, 0.98039215803146362),
(0.98739492893218994, 0.9843137264251709, 0.9843137264251709),
(0.99159663915634155, 0.98823529481887817, 0.98823529481887817),
(0.99579828977584839, 0.99215686321258545, 0.99215686321258545), (1.0,
0.99607843160629272, 0.99607843160629272)], 'red': [(0.0, 0.0, 0.0),
(0.0042016808874905109, 0.0039215688593685627, 0.0039215688593685627),
(0.0084033617749810219, 0.0078431377187371254, 0.0078431377187371254),
(0.012605042196810246, 0.011764706112444401, 0.011764706112444401),
(0.016806723549962044, 0.015686275437474251, 0.015686275437474251),
(0.021008403971791267, 0.019607843831181526, 0.019607843831181526),
(0.025210084393620491, 0.023529412224888802, 0.023529412224888802),
(0.029411764815449715, 0.027450980618596077, 0.027450980618596077),
(0.033613447099924088, 0.035294119268655777, 0.035294119268655777),
(0.037815127521753311, 0.039215687662363052, 0.039215687662363052),
(0.042016807943582535, 0.043137256056070328, 0.043137256056070328),
(0.046218488365411758, 0.047058824449777603, 0.047058824449777603),
(0.050420168787240982, 0.050980392843484879, 0.050980392843484879),
(0.054621849209070206, 0.054901961237192154, 0.054901961237192154),
(0.058823529630899429, 0.058823529630899429, 0.058823529630899429),
(0.063025213778018951, 0.062745101749897003, 0.062745101749897003),
(0.067226894199848175, 0.066666670143604279, 0.066666670143604279),
(0.071428574621677399, 0.070588238537311554, 0.070588238537311554),
(0.075630255043506622, 0.074509806931018829, 0.074509806931018829),
(0.079831935465335846, 0.078431375324726105, 0.078431375324726105),
(0.08403361588716507, 0.08235294371843338, 0.08235294371843338),
(0.088235296308994293, 0.086274512112140656, 0.086274512112140656),
(0.092436976730823517, 0.090196080505847931, 0.090196080505847931),
(0.09663865715265274, 0.098039217293262482, 0.098039217293262482),
(0.10084033757448196, 0.10196078568696976, 0.10196078568696976),
(0.10504201799631119, 0.10588235408067703, 0.10588235408067703),
(0.10924369841814041, 0.10980392247438431, 0.10980392247438431),
(0.11344537883996964, 0.11372549086809158, 0.11372549086809158),
(0.11764705926179886, 0.11764705926179886, 0.11764705926179886),
(0.12184873968362808, 0.12156862765550613, 0.12156862765550613),
(0.1260504275560379, 0.12549020349979401, 0.12549020349979401),
(0.13025210797786713, 0.12941177189350128, 0.12941177189350128),
(0.13445378839969635, 0.13333334028720856, 0.13333334028720856),
(0.13865546882152557, 0.13725490868091583, 0.13725490868091583),
(0.1428571492433548, 0.14117647707462311, 0.14117647707462311),
(0.14705882966518402, 0.14509804546833038, 0.14509804546833038),
(0.15126051008701324, 0.14901961386203766, 0.14901961386203766),
(0.15546219050884247, 0.15294118225574493, 0.15294118225574493),
(0.15966387093067169, 0.16078431904315948, 0.16078431904315948),
(0.16386555135250092, 0.16470588743686676, 0.16470588743686676),
(0.16806723177433014, 0.16862745583057404, 0.16862745583057404),
(0.17226891219615936, 0.17254902422428131, 0.17254902422428131),
(0.17647059261798859, 0.17647059261798859, 0.17647059261798859),
(0.18067227303981781, 0.18039216101169586, 0.18039216101169586),
(0.18487395346164703, 0.18431372940540314, 0.18431372940540314),
(0.18907563388347626, 0.18823529779911041, 0.18823529779911041),
(0.19327731430530548, 0.19215686619281769, 0.19215686619281769),
(0.1974789947271347, 0.19607843458652496, 0.19607843458652496),
(0.20168067514896393, 0.20000000298023224, 0.20000000298023224),
(0.20588235557079315, 0.20392157137393951, 0.20392157137393951),
(0.21008403599262238, 0.20784313976764679, 0.20784313976764679),
(0.2142857164144516, 0.21176470816135406, 0.21176470816135406),
(0.21848739683628082, 0.21568627655506134, 0.21568627655506134),
(0.22268907725811005, 0.22352941334247589, 0.22352941334247589),
(0.22689075767993927, 0.22745098173618317, 0.22745098173618317),
(0.23109243810176849, 0.23137255012989044, 0.23137255012989044),
(0.23529411852359772, 0.23529411852359772, 0.23529411852359772),
(0.23949579894542694, 0.23921568691730499, 0.23921568691730499),
(0.24369747936725616, 0.24313725531101227, 0.24313725531101227),
(0.24789915978908539, 0.24705882370471954, 0.24705882370471954),
(0.25210085511207581, 0.25098040699958801, 0.25098040699958801),
(0.25630253553390503, 0.25490197539329529, 0.25490197539329529),
(0.26050421595573425, 0.25882354378700256, 0.25882354378700256),
(0.26470589637756348, 0.26274511218070984, 0.26274511218070984),
(0.2689075767993927, 0.26666668057441711, 0.26666668057441711),
(0.27310925722122192, 0.27058824896812439, 0.27058824896812439),
(0.27731093764305115, 0.27450981736183167, 0.27450981736183167),
(0.28151261806488037, 0.27843138575553894, 0.27843138575553894),
(0.28571429848670959, 0.28627452254295349, 0.28627452254295349),
(0.28991597890853882, 0.29019609093666077, 0.29019609093666077),
(0.29411765933036804, 0.29411765933036804, 0.29411765933036804),
(0.29831933975219727, 0.29803922772407532, 0.29803922772407532),
(0.30252102017402649, 0.30196079611778259, 0.30196079611778259),
(0.30672270059585571, 0.30588236451148987, 0.30588236451148987),
(0.31092438101768494, 0.30980393290519714, 0.30980393290519714),
(0.31512606143951416, 0.31372550129890442, 0.31372550129890442),
(0.31932774186134338, 0.31764706969261169, 0.31764706969261169),
(0.32352942228317261, 0.32156863808631897, 0.32156863808631897),
(0.32773110270500183, 0.32549020648002625, 0.32549020648002625),
(0.33193278312683105, 0.32941177487373352, 0.32941177487373352),
(0.33613446354866028, 0.3333333432674408, 0.3333333432674408),
(0.3403361439704895, 0.33725491166114807, 0.33725491166114807),
(0.34453782439231873, 0.34117648005485535, 0.34117648005485535),
(0.34873950481414795, 0.3490196168422699, 0.3490196168422699),
(0.35294118523597717, 0.35294118523597717, 0.35294118523597717),
(0.3571428656578064, 0.35686275362968445, 0.35686275362968445),
(0.36134454607963562, 0.36078432202339172, 0.36078432202339172),
(0.36554622650146484, 0.364705890417099, 0.364705890417099),
(0.36974790692329407, 0.36862745881080627, 0.36862745881080627),
(0.37394958734512329, 0.37254902720451355, 0.37254902720451355),
(0.37815126776695251, 0.37647059559822083, 0.37647059559822083),
(0.38235294818878174, 0.3803921639919281, 0.3803921639919281),
(0.38655462861061096, 0.38431373238563538, 0.38431373238563538),
(0.39075630903244019, 0.38823530077934265, 0.38823530077934265),
(0.39495798945426941, 0.39215686917304993, 0.39215686917304993),
(0.39915966987609863, 0.3960784375667572, 0.3960784375667572),
(0.40336135029792786, 0.40000000596046448, 0.40000000596046448),
(0.40756303071975708, 0.40392157435417175, 0.40392157435417175),
(0.4117647111415863, 0.4117647111415863, 0.4117647111415863),
(0.41596639156341553, 0.41568627953529358, 0.41568627953529358),
(0.42016807198524475, 0.41960784792900085, 0.41960784792900085),
(0.42436975240707397, 0.42352941632270813, 0.42352941632270813),
(0.4285714328289032, 0.42745098471641541, 0.42745098471641541),
(0.43277311325073242, 0.43137255311012268, 0.43137255311012268),
(0.43697479367256165, 0.43529412150382996, 0.43529412150382996),
(0.44117647409439087, 0.43921568989753723, 0.43921568989753723),
(0.44537815451622009, 0.44313725829124451, 0.44313725829124451),
(0.44957983493804932, 0.44705882668495178, 0.44705882668495178),
(0.45378151535987854, 0.45098039507865906, 0.45098039507865906),
(0.45798319578170776, 0.45490196347236633, 0.45490196347236633),
(0.46218487620353699, 0.45882353186607361, 0.45882353186607361),
(0.46638655662536621, 0.46274510025978088, 0.46274510025978088),
(0.47058823704719543, 0.46666666865348816, 0.46666666865348816),
(0.47478991746902466, 0.47450980544090271, 0.47450980544090271),
(0.47899159789085388, 0.47843137383460999, 0.47843137383460999),
(0.48319327831268311, 0.48235294222831726, 0.48235294222831726),
(0.48739495873451233, 0.48627451062202454, 0.48627451062202454),
(0.49159663915634155, 0.49019607901573181, 0.49019607901573181),
(0.49579831957817078, 0.49411764740943909, 0.49411764740943909), (0.5,
0.49803921580314636, 0.49803921580314636), (0.50420171022415161,
0.50196081399917603, 0.50196081399917603), (0.50840336084365845,
0.5058823823928833, 0.5058823823928833), (0.51260507106781006,
0.50980395078659058, 0.50980395078659058), (0.51680672168731689,
0.51372551918029785, 0.51372551918029785), (0.52100843191146851,
0.51764708757400513, 0.51764708757400513), (0.52521008253097534,
0.5215686559677124, 0.5215686559677124), (0.52941179275512695,
0.52549022436141968, 0.52549022436141968), (0.53361344337463379,
0.52941179275512695, 0.52941179275512695), (0.5378151535987854,
0.5372549295425415, 0.5372549295425415), (0.54201680421829224,
0.54117649793624878, 0.54117649793624878), (0.54621851444244385,
0.54509806632995605, 0.54509806632995605), (0.55042016506195068,
0.54901963472366333, 0.54901963472366333), (0.55462187528610229,
0.55294120311737061, 0.55294120311737061), (0.55882352590560913,
0.55686277151107788, 0.55686277151107788), (0.56302523612976074,
0.56078433990478516, 0.56078433990478516), (0.56722688674926758,
0.56470590829849243, 0.56470590829849243), (0.57142859697341919,
0.56862747669219971, 0.56862747669219971), (0.57563024759292603,
0.57254904508590698, 0.57254904508590698), (0.57983195781707764,
0.57647061347961426, 0.57647061347961426), (0.58403360843658447,
0.58039218187332153, 0.58039218187332153), (0.58823531866073608,
0.58431375026702881, 0.58431375026702881), (0.59243696928024292,
0.58823531866073608, 0.58823531866073608), (0.59663867950439453,
0.59215688705444336, 0.59215688705444336), (0.60084033012390137,
0.60000002384185791, 0.60000002384185791), (0.60504204034805298,
0.60392159223556519, 0.60392159223556519), (0.60924369096755981,
0.60784316062927246, 0.60784316062927246), (0.61344540119171143,
0.61176472902297974, 0.61176472902297974), (0.61764705181121826,
0.61568629741668701, 0.61568629741668701), (0.62184876203536987,
0.61960786581039429, 0.61960786581039429), (0.62605041265487671,
0.62352943420410156, 0.62352943420410156), (0.63025212287902832,
0.62745100259780884, 0.62745100259780884), (0.63445377349853516,
0.63137257099151611, 0.63137257099151611), (0.63865548372268677,
0.63529413938522339, 0.63529413938522339), (0.6428571343421936,
0.63921570777893066, 0.63921570777893066), (0.64705884456634521,
0.64313727617263794, 0.64313727617263794), (0.65126049518585205,
0.64705884456634521, 0.64705884456634521), (0.65546220541000366,
0.65098041296005249, 0.65098041296005249), (0.6596638560295105,
0.65490198135375977, 0.65490198135375977), (0.66386556625366211,
0.66274511814117432, 0.66274511814117432), (0.66806721687316895,
0.66666668653488159, 0.66666668653488159), (0.67226892709732056,
0.67058825492858887, 0.67058825492858887), (0.67647057771682739,
0.67450982332229614, 0.67450982332229614), (0.680672287940979,
0.67843139171600342, 0.67843139171600342), (0.68487393856048584,
0.68235296010971069, 0.68235296010971069), (0.68907564878463745,
0.68627452850341797, 0.68627452850341797), (0.69327729940414429,
0.69019609689712524, 0.69019609689712524), (0.6974790096282959,
0.69411766529083252, 0.69411766529083252), (0.70168066024780273,
0.69803923368453979, 0.69803923368453979), (0.70588237047195435,
0.70196080207824707, 0.70196080207824707), (0.71008402109146118,
0.70588237047195435, 0.70588237047195435), (0.71428573131561279,
0.70980393886566162, 0.70980393886566162), (0.71848738193511963,
0.7137255072593689, 0.7137255072593689), (0.72268909215927124,
0.71764707565307617, 0.71764707565307617), (0.72689074277877808,
0.72549021244049072, 0.72549021244049072), (0.73109245300292969,
0.729411780834198, 0.729411780834198), (0.73529410362243652,
0.73333334922790527, 0.73333334922790527), (0.73949581384658813,
0.73725491762161255, 0.73725491762161255), (0.74369746446609497,
0.74117648601531982, 0.74117648601531982), (0.74789917469024658,
0.7450980544090271, 0.7450980544090271), (0.75210082530975342,
0.74901962280273438, 0.74901962280273438), (0.75630253553390503,
0.75294119119644165, 0.75294119119644165), (0.76050418615341187,
0.75686275959014893, 0.75686275959014893), (0.76470589637756348,
0.7607843279838562, 0.7607843279838562), (0.76890754699707031,
0.76470589637756348, 0.76470589637756348), (0.77310925722122192,
0.76862746477127075, 0.76862746477127075), (0.77731090784072876,
0.77254903316497803, 0.77254903316497803), (0.78151261806488037,
0.7764706015586853, 0.7764706015586853), (0.78571426868438721,
0.78039216995239258, 0.78039216995239258), (0.78991597890853882,
0.78823530673980713, 0.78823530673980713), (0.79411762952804565,
0.7921568751335144, 0.7921568751335144), (0.79831933975219727,
0.79607844352722168, 0.79607844352722168), (0.8025209903717041,
0.80000001192092896, 0.80000001192092896), (0.80672270059585571,
0.80392158031463623, 0.80392158031463623), (0.81092435121536255,
0.80784314870834351, 0.80784314870834351), (0.81512606143951416,
0.81176471710205078, 0.81176471710205078), (0.819327712059021,
0.81568628549575806, 0.81568628549575806), (0.82352942228317261,
0.81960785388946533, 0.81960785388946533), (0.82773107290267944,
0.82352942228317261, 0.82352942228317261), (0.83193278312683105,
0.82745099067687988, 0.82745099067687988), (0.83613443374633789,
0.83137255907058716, 0.83137255907058716), (0.8403361439704895,
0.83529412746429443, 0.83529412746429443), (0.84453779458999634,
0.83921569585800171, 0.83921569585800171), (0.84873950481414795,
0.84313726425170898, 0.84313726425170898), (0.85294115543365479,
0.85098040103912354, 0.85098040103912354), (0.8571428656578064,
0.85490196943283081, 0.85490196943283081), (0.86134451627731323,
0.85882353782653809, 0.85882353782653809), (0.86554622650146484,
0.86274510622024536, 0.86274510622024536), (0.86974787712097168,
0.86666667461395264, 0.86666667461395264), (0.87394958734512329,
0.87058824300765991, 0.87058824300765991), (0.87815123796463013,
0.87450981140136719, 0.87450981140136719), (0.88235294818878174,
0.87843137979507446, 0.87843137979507446), (0.88655459880828857,
0.88235294818878174, 0.88235294818878174), (0.89075630903244019,
0.88627451658248901, 0.88627451658248901), (0.89495795965194702,
0.89019608497619629, 0.89019608497619629), (0.89915966987609863,
0.89411765336990356, 0.89411765336990356), (0.90336132049560547,
0.89803922176361084, 0.89803922176361084), (0.90756303071975708,
0.90196079015731812, 0.90196079015731812), (0.91176468133926392,
0.90588235855102539, 0.90588235855102539), (0.91596639156341553,
0.91372549533843994, 0.91372549533843994), (0.92016804218292236,
0.91764706373214722, 0.91764706373214722), (0.92436975240707397,
0.92156863212585449, 0.92156863212585449), (0.92857140302658081,
0.92549020051956177, 0.92549020051956177), (0.93277311325073242,
0.92941176891326904, 0.92941176891326904), (0.93697476387023926,
0.93333333730697632, 0.93333333730697632), (0.94117647409439087,
0.93725490570068359, 0.93725490570068359), (0.94537812471389771,
0.94117647409439087, 0.94117647409439087), (0.94957983493804932,
0.94509804248809814, 0.94509804248809814), (0.95378148555755615,
0.94901961088180542, 0.94901961088180542), (0.95798319578170776,
0.9529411792755127, 0.9529411792755127), (0.9621848464012146,
0.95686274766921997, 0.95686274766921997), (0.96638655662536621,
0.96078431606292725, 0.96078431606292725), (0.97058820724487305,
0.96470588445663452, 0.96470588445663452), (0.97478991746902466,
0.9686274528503418, 0.9686274528503418), (0.97899156808853149,
0.97647058963775635, 0.97647058963775635), (0.98319327831268311,
0.98039215803146362, 0.98039215803146362), (0.98739492893218994,
0.9843137264251709, 0.9843137264251709), (0.99159663915634155,
0.98823529481887817, 0.98823529481887817), (0.99579828977584839,
0.99215686321258545, 0.99215686321258545), (1.0, 0.99607843160629272,
0.99607843160629272)]}
_gist_heat_data = {'blue': [(0.0, 0.0, 0.0),
(0.0042016808874905109, 0.0, 0.0), (0.0084033617749810219, 0.0, 0.0),
(0.012605042196810246, 0.0, 0.0), (0.016806723549962044, 0.0, 0.0),
(0.021008403971791267, 0.0, 0.0), (0.025210084393620491, 0.0, 0.0),
(0.029411764815449715, 0.0, 0.0), (0.033613447099924088, 0.0, 0.0),
(0.037815127521753311, 0.0, 0.0), (0.042016807943582535, 0.0, 0.0),
(0.046218488365411758, 0.0, 0.0), (0.050420168787240982, 0.0, 0.0),
(0.054621849209070206, 0.0, 0.0), (0.058823529630899429, 0.0, 0.0),
(0.063025213778018951, 0.0, 0.0), (0.067226894199848175, 0.0, 0.0),
(0.071428574621677399, 0.0, 0.0), (0.075630255043506622, 0.0, 0.0),
(0.079831935465335846, 0.0, 0.0), (0.08403361588716507, 0.0, 0.0),
(0.088235296308994293, 0.0, 0.0), (0.092436976730823517, 0.0, 0.0),
(0.09663865715265274, 0.0, 0.0), (0.10084033757448196, 0.0, 0.0),
(0.10504201799631119, 0.0, 0.0), (0.10924369841814041, 0.0, 0.0),
(0.11344537883996964, 0.0, 0.0), (0.11764705926179886, 0.0, 0.0),
(0.12184873968362808, 0.0, 0.0), (0.1260504275560379, 0.0, 0.0),
(0.13025210797786713, 0.0, 0.0), (0.13445378839969635, 0.0, 0.0),
(0.13865546882152557, 0.0, 0.0), (0.1428571492433548, 0.0, 0.0),
(0.14705882966518402, 0.0, 0.0), (0.15126051008701324, 0.0, 0.0),
(0.15546219050884247, 0.0, 0.0), (0.15966387093067169, 0.0, 0.0),
(0.16386555135250092, 0.0, 0.0), (0.16806723177433014, 0.0, 0.0),
(0.17226891219615936, 0.0, 0.0), (0.17647059261798859, 0.0, 0.0),
(0.18067227303981781, 0.0, 0.0), (0.18487395346164703, 0.0, 0.0),
(0.18907563388347626, 0.0, 0.0), (0.19327731430530548, 0.0, 0.0),
(0.1974789947271347, 0.0, 0.0), (0.20168067514896393, 0.0, 0.0),
(0.20588235557079315, 0.0, 0.0), (0.21008403599262238, 0.0, 0.0),
(0.2142857164144516, 0.0, 0.0), (0.21848739683628082, 0.0, 0.0),
(0.22268907725811005, 0.0, 0.0), (0.22689075767993927, 0.0, 0.0),
(0.23109243810176849, 0.0, 0.0), (0.23529411852359772, 0.0, 0.0),
(0.23949579894542694, 0.0, 0.0), (0.24369747936725616, 0.0, 0.0),
(0.24789915978908539, 0.0, 0.0), (0.25210085511207581, 0.0, 0.0),
(0.25630253553390503, 0.0, 0.0), (0.26050421595573425, 0.0, 0.0),
(0.26470589637756348, 0.0, 0.0), (0.2689075767993927, 0.0, 0.0),
(0.27310925722122192, 0.0, 0.0), (0.27731093764305115, 0.0, 0.0),
(0.28151261806488037, 0.0, 0.0), (0.28571429848670959, 0.0, 0.0),
(0.28991597890853882, 0.0, 0.0), (0.29411765933036804, 0.0, 0.0),
(0.29831933975219727, 0.0, 0.0), (0.30252102017402649, 0.0, 0.0),
(0.30672270059585571, 0.0, 0.0), (0.31092438101768494, 0.0, 0.0),
(0.31512606143951416, 0.0, 0.0), (0.31932774186134338, 0.0, 0.0),
(0.32352942228317261, 0.0, 0.0), (0.32773110270500183, 0.0, 0.0),
(0.33193278312683105, 0.0, 0.0), (0.33613446354866028, 0.0, 0.0),
(0.3403361439704895, 0.0, 0.0), (0.34453782439231873, 0.0, 0.0),
(0.34873950481414795, 0.0, 0.0), (0.35294118523597717, 0.0, 0.0),
(0.3571428656578064, 0.0, 0.0), (0.36134454607963562, 0.0, 0.0),
(0.36554622650146484, 0.0, 0.0), (0.36974790692329407, 0.0, 0.0),
(0.37394958734512329, 0.0, 0.0), (0.37815126776695251, 0.0, 0.0),
(0.38235294818878174, 0.0, 0.0), (0.38655462861061096, 0.0, 0.0),
(0.39075630903244019, 0.0, 0.0), (0.39495798945426941, 0.0, 0.0),
(0.39915966987609863, 0.0, 0.0), (0.40336135029792786, 0.0, 0.0),
(0.40756303071975708, 0.0, 0.0), (0.4117647111415863, 0.0, 0.0),
(0.41596639156341553, 0.0, 0.0), (0.42016807198524475, 0.0, 0.0),
(0.42436975240707397, 0.0, 0.0), (0.4285714328289032, 0.0, 0.0),
(0.43277311325073242, 0.0, 0.0), (0.43697479367256165, 0.0, 0.0),
(0.44117647409439087, 0.0, 0.0), (0.44537815451622009, 0.0, 0.0),
(0.44957983493804932, 0.0, 0.0), (0.45378151535987854, 0.0, 0.0),
(0.45798319578170776, 0.0, 0.0), (0.46218487620353699, 0.0, 0.0),
(0.46638655662536621, 0.0, 0.0), (0.47058823704719543, 0.0, 0.0),
(0.47478991746902466, 0.0, 0.0), (0.47899159789085388, 0.0, 0.0),
(0.48319327831268311, 0.0, 0.0), (0.48739495873451233, 0.0, 0.0),
(0.49159663915634155, 0.0, 0.0), (0.49579831957817078, 0.0, 0.0), (0.5,
0.0, 0.0), (0.50420171022415161, 0.0, 0.0), (0.50840336084365845, 0.0,
0.0), (0.51260507106781006, 0.0, 0.0), (0.51680672168731689, 0.0, 0.0),
(0.52100843191146851, 0.0, 0.0), (0.52521008253097534, 0.0, 0.0),
(0.52941179275512695, 0.0, 0.0), (0.53361344337463379, 0.0, 0.0),
(0.5378151535987854, 0.0, 0.0), (0.54201680421829224, 0.0, 0.0),
(0.54621851444244385, 0.0, 0.0), (0.55042016506195068, 0.0, 0.0),
(0.55462187528610229, 0.0, 0.0), (0.55882352590560913, 0.0, 0.0),
(0.56302523612976074, 0.0, 0.0), (0.56722688674926758, 0.0, 0.0),
(0.57142859697341919, 0.0, 0.0), (0.57563024759292603, 0.0, 0.0),
(0.57983195781707764, 0.0, 0.0), (0.58403360843658447, 0.0, 0.0),
(0.58823531866073608, 0.0, 0.0), (0.59243696928024292, 0.0, 0.0),
(0.59663867950439453, 0.0, 0.0), (0.60084033012390137, 0.0, 0.0),
(0.60504204034805298, 0.0, 0.0), (0.60924369096755981, 0.0, 0.0),
(0.61344540119171143, 0.0, 0.0), (0.61764705181121826, 0.0, 0.0),
(0.62184876203536987, 0.0, 0.0), (0.62605041265487671, 0.0, 0.0),
(0.63025212287902832, 0.0, 0.0), (0.63445377349853516, 0.0, 0.0),
(0.63865548372268677, 0.0, 0.0), (0.6428571343421936, 0.0, 0.0),
(0.64705884456634521, 0.0, 0.0), (0.65126049518585205, 0.0, 0.0),
(0.65546220541000366, 0.0, 0.0), (0.6596638560295105, 0.0, 0.0),
(0.66386556625366211, 0.0, 0.0), (0.66806721687316895, 0.0, 0.0),
(0.67226892709732056, 0.0, 0.0), (0.67647057771682739, 0.0, 0.0),
(0.680672287940979, 0.0, 0.0), (0.68487393856048584, 0.0, 0.0),
(0.68907564878463745, 0.0, 0.0), (0.69327729940414429, 0.0, 0.0),
(0.6974790096282959, 0.0, 0.0), (0.70168066024780273, 0.0, 0.0),
(0.70588237047195435, 0.0, 0.0), (0.71008402109146118, 0.0, 0.0),
(0.71428573131561279, 0.0, 0.0), (0.71848738193511963, 0.0, 0.0),
(0.72268909215927124, 0.0, 0.0), (0.72689074277877808, 0.0, 0.0),
(0.73109245300292969, 0.0, 0.0), (0.73529410362243652, 0.0, 0.0),
(0.73949581384658813, 0.0, 0.0), (0.74369746446609497, 0.0, 0.0),
(0.74789917469024658, 0.0, 0.0), (0.75210082530975342, 0.0, 0.0),
(0.75630253553390503, 0.027450980618596077, 0.027450980618596077),
(0.76050418615341187, 0.043137256056070328, 0.043137256056070328),
(0.76470589637756348, 0.058823529630899429, 0.058823529630899429),
(0.76890754699707031, 0.074509806931018829, 0.074509806931018829),
(0.77310925722122192, 0.090196080505847931, 0.090196080505847931),
(0.77731090784072876, 0.10588235408067703, 0.10588235408067703),
(0.78151261806488037, 0.12156862765550613, 0.12156862765550613),
(0.78571426868438721, 0.13725490868091583, 0.13725490868091583),
(0.78991597890853882, 0.15294118225574493, 0.15294118225574493),
(0.79411762952804565, 0.16862745583057404, 0.16862745583057404),
(0.79831933975219727, 0.20000000298023224, 0.20000000298023224),
(0.8025209903717041, 0.21176470816135406, 0.21176470816135406),
(0.80672270059585571, 0.22745098173618317, 0.22745098173618317),
(0.81092435121536255, 0.24313725531101227, 0.24313725531101227),
(0.81512606143951416, 0.25882354378700256, 0.25882354378700256),
(0.819327712059021, 0.27450981736183167, 0.27450981736183167),
(0.82352942228317261, 0.29019609093666077, 0.29019609093666077),
(0.82773107290267944, 0.30588236451148987, 0.30588236451148987),
(0.83193278312683105, 0.32156863808631897, 0.32156863808631897),
(0.83613443374633789, 0.33725491166114807, 0.33725491166114807),
(0.8403361439704895, 0.35294118523597717, 0.35294118523597717),
(0.84453779458999634, 0.36862745881080627, 0.36862745881080627),
(0.84873950481414795, 0.38431373238563538, 0.38431373238563538),
(0.85294115543365479, 0.40000000596046448, 0.40000000596046448),
(0.8571428656578064, 0.4117647111415863, 0.4117647111415863),
(0.86134451627731323, 0.42745098471641541, 0.42745098471641541),
(0.86554622650146484, 0.44313725829124451, 0.44313725829124451),
(0.86974787712097168, 0.45882353186607361, 0.45882353186607361),
(0.87394958734512329, 0.47450980544090271, 0.47450980544090271),
(0.87815123796463013, 0.49019607901573181, 0.49019607901573181),
(0.88235294818878174, 0.5215686559677124, 0.5215686559677124),
(0.88655459880828857, 0.5372549295425415, 0.5372549295425415),
(0.89075630903244019, 0.55294120311737061, 0.55294120311737061),
(0.89495795965194702, 0.56862747669219971, 0.56862747669219971),
(0.89915966987609863, 0.58431375026702881, 0.58431375026702881),
(0.90336132049560547, 0.60000002384185791, 0.60000002384185791),
(0.90756303071975708, 0.61176472902297974, 0.61176472902297974),
(0.91176468133926392, 0.62745100259780884, 0.62745100259780884),
(0.91596639156341553, 0.64313727617263794, 0.64313727617263794),
(0.92016804218292236, 0.65882354974746704, 0.65882354974746704),
(0.92436975240707397, 0.67450982332229614, 0.67450982332229614),
(0.92857140302658081, 0.69019609689712524, 0.69019609689712524),
(0.93277311325073242, 0.70588237047195435, 0.70588237047195435),
(0.93697476387023926, 0.72156864404678345, 0.72156864404678345),
(0.94117647409439087, 0.73725491762161255, 0.73725491762161255),
(0.94537812471389771, 0.75294119119644165, 0.75294119119644165),
(0.94957983493804932, 0.76862746477127075, 0.76862746477127075),
(0.95378148555755615, 0.78431373834609985, 0.78431373834609985),
(0.95798319578170776, 0.80000001192092896, 0.80000001192092896),
(0.9621848464012146, 0.81176471710205078, 0.81176471710205078),
(0.96638655662536621, 0.84313726425170898, 0.84313726425170898),
(0.97058820724487305, 0.85882353782653809, 0.85882353782653809),
(0.97478991746902466, 0.87450981140136719, 0.87450981140136719),
(0.97899156808853149, 0.89019608497619629, 0.89019608497619629),
(0.98319327831268311, 0.90588235855102539, 0.90588235855102539),
(0.98739492893218994, 0.92156863212585449, 0.92156863212585449),
(0.99159663915634155, 0.93725490570068359, 0.93725490570068359),
(0.99579828977584839, 0.9529411792755127, 0.9529411792755127), (1.0,
0.9686274528503418, 0.9686274528503418)], 'green': [(0.0, 0.0, 0.0),
(0.0042016808874905109, 0.0, 0.0), (0.0084033617749810219, 0.0, 0.0),
(0.012605042196810246, 0.0, 0.0), (0.016806723549962044, 0.0, 0.0),
(0.021008403971791267, 0.0, 0.0), (0.025210084393620491, 0.0, 0.0),
(0.029411764815449715, 0.0, 0.0), (0.033613447099924088, 0.0, 0.0),
(0.037815127521753311, 0.0, 0.0), (0.042016807943582535, 0.0, 0.0),
(0.046218488365411758, 0.0, 0.0), (0.050420168787240982, 0.0, 0.0),
(0.054621849209070206, 0.0, 0.0), (0.058823529630899429, 0.0, 0.0),
(0.063025213778018951, 0.0, 0.0), (0.067226894199848175, 0.0, 0.0),
(0.071428574621677399, 0.0, 0.0), (0.075630255043506622, 0.0, 0.0),
(0.079831935465335846, 0.0, 0.0), (0.08403361588716507, 0.0, 0.0),
(0.088235296308994293, 0.0, 0.0), (0.092436976730823517, 0.0, 0.0),
(0.09663865715265274, 0.0, 0.0), (0.10084033757448196, 0.0, 0.0),
(0.10504201799631119, 0.0, 0.0), (0.10924369841814041, 0.0, 0.0),
(0.11344537883996964, 0.0, 0.0), (0.11764705926179886, 0.0, 0.0),
(0.12184873968362808, 0.0, 0.0), (0.1260504275560379, 0.0, 0.0),
(0.13025210797786713, 0.0, 0.0), (0.13445378839969635, 0.0, 0.0),
(0.13865546882152557, 0.0, 0.0), (0.1428571492433548, 0.0, 0.0),
(0.14705882966518402, 0.0, 0.0), (0.15126051008701324, 0.0, 0.0),
(0.15546219050884247, 0.0, 0.0), (0.15966387093067169, 0.0, 0.0),
(0.16386555135250092, 0.0, 0.0), (0.16806723177433014, 0.0, 0.0),
(0.17226891219615936, 0.0, 0.0), (0.17647059261798859, 0.0, 0.0),
(0.18067227303981781, 0.0, 0.0), (0.18487395346164703, 0.0, 0.0),
(0.18907563388347626, 0.0, 0.0), (0.19327731430530548, 0.0, 0.0),
(0.1974789947271347, 0.0, 0.0), (0.20168067514896393, 0.0, 0.0),
(0.20588235557079315, 0.0, 0.0), (0.21008403599262238, 0.0, 0.0),
(0.2142857164144516, 0.0, 0.0), (0.21848739683628082, 0.0, 0.0),
(0.22268907725811005, 0.0, 0.0), (0.22689075767993927, 0.0, 0.0),
(0.23109243810176849, 0.0, 0.0), (0.23529411852359772, 0.0, 0.0),
(0.23949579894542694, 0.0, 0.0), (0.24369747936725616, 0.0, 0.0),
(0.24789915978908539, 0.0, 0.0), (0.25210085511207581, 0.0, 0.0),
(0.25630253553390503, 0.0, 0.0), (0.26050421595573425, 0.0, 0.0),
(0.26470589637756348, 0.0, 0.0), (0.2689075767993927, 0.0, 0.0),
(0.27310925722122192, 0.0, 0.0), (0.27731093764305115, 0.0, 0.0),
(0.28151261806488037, 0.0, 0.0), (0.28571429848670959, 0.0, 0.0),
(0.28991597890853882, 0.0, 0.0), (0.29411765933036804, 0.0, 0.0),
(0.29831933975219727, 0.0, 0.0), (0.30252102017402649, 0.0, 0.0),
(0.30672270059585571, 0.0, 0.0), (0.31092438101768494, 0.0, 0.0),
(0.31512606143951416, 0.0, 0.0), (0.31932774186134338, 0.0, 0.0),
(0.32352942228317261, 0.0, 0.0), (0.32773110270500183, 0.0, 0.0),
(0.33193278312683105, 0.0, 0.0), (0.33613446354866028, 0.0, 0.0),
(0.3403361439704895, 0.0, 0.0), (0.34453782439231873, 0.0, 0.0),
(0.34873950481414795, 0.0, 0.0), (0.35294118523597717, 0.0, 0.0),
(0.3571428656578064, 0.0, 0.0), (0.36134454607963562, 0.0, 0.0),
(0.36554622650146484, 0.0, 0.0), (0.36974790692329407, 0.0, 0.0),
(0.37394958734512329, 0.0, 0.0), (0.37815126776695251, 0.0, 0.0),
(0.38235294818878174, 0.0, 0.0), (0.38655462861061096, 0.0, 0.0),
(0.39075630903244019, 0.0, 0.0), (0.39495798945426941, 0.0, 0.0),
(0.39915966987609863, 0.0, 0.0), (0.40336135029792786, 0.0, 0.0),
(0.40756303071975708, 0.0, 0.0), (0.4117647111415863, 0.0, 0.0),
(0.41596639156341553, 0.0, 0.0), (0.42016807198524475, 0.0, 0.0),
(0.42436975240707397, 0.0, 0.0), (0.4285714328289032, 0.0, 0.0),
(0.43277311325073242, 0.0, 0.0), (0.43697479367256165, 0.0, 0.0),
(0.44117647409439087, 0.0, 0.0), (0.44537815451622009, 0.0, 0.0),
(0.44957983493804932, 0.0, 0.0), (0.45378151535987854, 0.0, 0.0),
(0.45798319578170776, 0.0, 0.0), (0.46218487620353699, 0.0, 0.0),
(0.46638655662536621, 0.0, 0.0), (0.47058823704719543, 0.0, 0.0),
(0.47478991746902466, 0.0, 0.0), (0.47899159789085388,
0.0039215688593685627, 0.0039215688593685627), (0.48319327831268311,
0.011764706112444401, 0.011764706112444401), (0.48739495873451233,
0.019607843831181526, 0.019607843831181526), (0.49159663915634155,
0.027450980618596077, 0.027450980618596077), (0.49579831957817078,
0.035294119268655777, 0.035294119268655777), (0.5, 0.043137256056070328,
0.043137256056070328), (0.50420171022415161, 0.058823529630899429,
0.058823529630899429), (0.50840336084365845, 0.066666670143604279,
0.066666670143604279), (0.51260507106781006, 0.070588238537311554,
0.070588238537311554), (0.51680672168731689, 0.078431375324726105,
0.078431375324726105), (0.52100843191146851, 0.086274512112140656,
0.086274512112140656), (0.52521008253097534, 0.094117648899555206,
0.094117648899555206), (0.52941179275512695, 0.10196078568696976,
0.10196078568696976), (0.53361344337463379, 0.10980392247438431,
0.10980392247438431), (0.5378151535987854, 0.11764705926179886,
0.11764705926179886), (0.54201680421829224, 0.12549020349979401,
0.12549020349979401), (0.54621851444244385, 0.13725490868091583,
0.13725490868091583), (0.55042016506195068, 0.14509804546833038,
0.14509804546833038), (0.55462187528610229, 0.15294118225574493,
0.15294118225574493), (0.55882352590560913, 0.16078431904315948,
0.16078431904315948), (0.56302523612976074, 0.16862745583057404,
0.16862745583057404), (0.56722688674926758, 0.17647059261798859,
0.17647059261798859), (0.57142859697341919, 0.18431372940540314,
0.18431372940540314), (0.57563024759292603, 0.19215686619281769,
0.19215686619281769), (0.57983195781707764, 0.20000000298023224,
0.20000000298023224), (0.58403360843658447, 0.20392157137393951,
0.20392157137393951), (0.58823531866073608, 0.21176470816135406,
0.21176470816135406), (0.59243696928024292, 0.21960784494876862,
0.21960784494876862), (0.59663867950439453, 0.22745098173618317,
0.22745098173618317), (0.60084033012390137, 0.23529411852359772,
0.23529411852359772), (0.60504204034805298, 0.24313725531101227,
0.24313725531101227), (0.60924369096755981, 0.25098040699958801,
0.25098040699958801), (0.61344540119171143, 0.25882354378700256,
0.25882354378700256), (0.61764705181121826, 0.26666668057441711,
0.26666668057441711), (0.62184876203536987, 0.27058824896812439,
0.27058824896812439), (0.62605041265487671, 0.27843138575553894,
0.27843138575553894), (0.63025212287902832, 0.29411765933036804,
0.29411765933036804), (0.63445377349853516, 0.30196079611778259,
0.30196079611778259), (0.63865548372268677, 0.30980393290519714,
0.30980393290519714), (0.6428571343421936, 0.31764706969261169,
0.31764706969261169), (0.64705884456634521, 0.32549020648002625,
0.32549020648002625), (0.65126049518585205, 0.3333333432674408,
0.3333333432674408), (0.65546220541000366, 0.33725491166114807,
0.33725491166114807), (0.6596638560295105, 0.34509804844856262,
0.34509804844856262), (0.66386556625366211, 0.35294118523597717,
0.35294118523597717), (0.66806721687316895, 0.36078432202339172,
0.36078432202339172), (0.67226892709732056, 0.36862745881080627,
0.36862745881080627), (0.67647057771682739, 0.37647059559822083,
0.37647059559822083), (0.680672287940979, 0.38431373238563538,
0.38431373238563538), (0.68487393856048584, 0.39215686917304993,
0.39215686917304993), (0.68907564878463745, 0.40000000596046448,
0.40000000596046448), (0.69327729940414429, 0.40392157435417175,
0.40392157435417175), (0.6974790096282959, 0.4117647111415863,
0.4117647111415863), (0.70168066024780273, 0.41960784792900085,
0.41960784792900085), (0.70588237047195435, 0.42745098471641541,
0.42745098471641541), (0.71008402109146118, 0.43529412150382996,
0.43529412150382996), (0.71428573131561279, 0.45098039507865906,
0.45098039507865906), (0.71848738193511963, 0.45882353186607361,
0.45882353186607361), (0.72268909215927124, 0.46666666865348816,
0.46666666865348816), (0.72689074277877808, 0.47058823704719543,
0.47058823704719543), (0.73109245300292969, 0.47843137383460999,
0.47843137383460999), (0.73529410362243652, 0.48627451062202454,
0.48627451062202454), (0.73949581384658813, 0.49411764740943909,
0.49411764740943909), (0.74369746446609497, 0.50196081399917603,
0.50196081399917603), (0.74789917469024658, 0.50980395078659058,
0.50980395078659058), (0.75210082530975342, 0.51764708757400513,
0.51764708757400513), (0.75630253553390503, 0.53333336114883423,
0.53333336114883423), (0.76050418615341187, 0.5372549295425415,
0.5372549295425415), (0.76470589637756348, 0.54509806632995605,
0.54509806632995605), (0.76890754699707031, 0.55294120311737061,
0.55294120311737061), (0.77310925722122192, 0.56078433990478516,
0.56078433990478516), (0.77731090784072876, 0.56862747669219971,
0.56862747669219971), (0.78151261806488037, 0.57647061347961426,
0.57647061347961426), (0.78571426868438721, 0.58431375026702881,
0.58431375026702881), (0.78991597890853882, 0.59215688705444336,
0.59215688705444336), (0.79411762952804565, 0.60000002384185791,
0.60000002384185791), (0.79831933975219727, 0.61176472902297974,
0.61176472902297974), (0.8025209903717041, 0.61960786581039429,
0.61960786581039429), (0.80672270059585571, 0.62745100259780884,
0.62745100259780884), (0.81092435121536255, 0.63529413938522339,
0.63529413938522339), (0.81512606143951416, 0.64313727617263794,
0.64313727617263794), (0.819327712059021, 0.65098041296005249,
0.65098041296005249), (0.82352942228317261, 0.65882354974746704,
0.65882354974746704), (0.82773107290267944, 0.66666668653488159,
0.66666668653488159), (0.83193278312683105, 0.67058825492858887,
0.67058825492858887), (0.83613443374633789, 0.67843139171600342,
0.67843139171600342), (0.8403361439704895, 0.68627452850341797,
0.68627452850341797), (0.84453779458999634, 0.69411766529083252,
0.69411766529083252), (0.84873950481414795, 0.70196080207824707,
0.70196080207824707), (0.85294115543365479, 0.70980393886566162,
0.70980393886566162), (0.8571428656578064, 0.71764707565307617,
0.71764707565307617), (0.86134451627731323, 0.72549021244049072,
0.72549021244049072), (0.86554622650146484, 0.73333334922790527,
0.73333334922790527), (0.86974787712097168, 0.73725491762161255,
0.73725491762161255), (0.87394958734512329, 0.7450980544090271,
0.7450980544090271), (0.87815123796463013, 0.75294119119644165,
0.75294119119644165), (0.88235294818878174, 0.76862746477127075,
0.76862746477127075), (0.88655459880828857, 0.7764706015586853,
0.7764706015586853), (0.89075630903244019, 0.78431373834609985,
0.78431373834609985), (0.89495795965194702, 0.7921568751335144,
0.7921568751335144), (0.89915966987609863, 0.80000001192092896,
0.80000001192092896), (0.90336132049560547, 0.80392158031463623,
0.80392158031463623), (0.90756303071975708, 0.81176471710205078,
0.81176471710205078), (0.91176468133926392, 0.81960785388946533,
0.81960785388946533), (0.91596639156341553, 0.82745099067687988,
0.82745099067687988), (0.92016804218292236, 0.83529412746429443,
0.83529412746429443), (0.92436975240707397, 0.84313726425170898,
0.84313726425170898), (0.92857140302658081, 0.85098040103912354,
0.85098040103912354), (0.93277311325073242, 0.85882353782653809,
0.85882353782653809), (0.93697476387023926, 0.86666667461395264,
0.86666667461395264), (0.94117647409439087, 0.87058824300765991,
0.87058824300765991), (0.94537812471389771, 0.87843137979507446,
0.87843137979507446), (0.94957983493804932, 0.88627451658248901,
0.88627451658248901), (0.95378148555755615, 0.89411765336990356,
0.89411765336990356), (0.95798319578170776, 0.90196079015731812,
0.90196079015731812), (0.9621848464012146, 0.90980392694473267,
0.90980392694473267), (0.96638655662536621, 0.92549020051956177,
0.92549020051956177), (0.97058820724487305, 0.93333333730697632,
0.93333333730697632), (0.97478991746902466, 0.93725490570068359,
0.93725490570068359), (0.97899156808853149, 0.94509804248809814,
0.94509804248809814), (0.98319327831268311, 0.9529411792755127,
0.9529411792755127), (0.98739492893218994, 0.96078431606292725,
0.96078431606292725), (0.99159663915634155, 0.9686274528503418,
0.9686274528503418), (0.99579828977584839, 0.97647058963775635,
0.97647058963775635), (1.0, 0.9843137264251709, 0.9843137264251709)],
'red': [(0.0, 0.0, 0.0), (0.0042016808874905109, 0.0039215688593685627,
0.0039215688593685627), (0.0084033617749810219, 0.0078431377187371254,
0.0078431377187371254), (0.012605042196810246, 0.015686275437474251,
0.015686275437474251), (0.016806723549962044, 0.019607843831181526,
0.019607843831181526), (0.021008403971791267, 0.027450980618596077,
0.027450980618596077), (0.025210084393620491, 0.031372550874948502,
0.031372550874948502), (0.029411764815449715, 0.039215687662363052,
0.039215687662363052), (0.033613447099924088, 0.043137256056070328,
0.043137256056070328), (0.037815127521753311, 0.050980392843484879,
0.050980392843484879), (0.042016807943582535, 0.058823529630899429,
0.058823529630899429), (0.046218488365411758, 0.066666670143604279,
0.066666670143604279), (0.050420168787240982, 0.070588238537311554,
0.070588238537311554), (0.054621849209070206, 0.078431375324726105,
0.078431375324726105), (0.058823529630899429, 0.08235294371843338,
0.08235294371843338), (0.063025213778018951, 0.090196080505847931,
0.090196080505847931), (0.067226894199848175, 0.094117648899555206,
0.094117648899555206), (0.071428574621677399, 0.10196078568696976,
0.10196078568696976), (0.075630255043506622, 0.10588235408067703,
0.10588235408067703), (0.079831935465335846, 0.10980392247438431,
0.10980392247438431), (0.08403361588716507, 0.11764705926179886,
0.11764705926179886), (0.088235296308994293, 0.12156862765550613,
0.12156862765550613), (0.092436976730823517, 0.12941177189350128,
0.12941177189350128), (0.09663865715265274, 0.13333334028720856,
0.13333334028720856), (0.10084033757448196, 0.14117647707462311,
0.14117647707462311), (0.10504201799631119, 0.14509804546833038,
0.14509804546833038), (0.10924369841814041, 0.15294118225574493,
0.15294118225574493), (0.11344537883996964, 0.15686275064945221,
0.15686275064945221), (0.11764705926179886, 0.16470588743686676,
0.16470588743686676), (0.12184873968362808, 0.16862745583057404,
0.16862745583057404), (0.1260504275560379, 0.18039216101169586,
0.18039216101169586), (0.13025210797786713, 0.18431372940540314,
0.18431372940540314), (0.13445378839969635, 0.19215686619281769,
0.19215686619281769), (0.13865546882152557, 0.19607843458652496,
0.19607843458652496), (0.1428571492433548, 0.20392157137393951,
0.20392157137393951), (0.14705882966518402, 0.20784313976764679,
0.20784313976764679), (0.15126051008701324, 0.21568627655506134,
0.21568627655506134), (0.15546219050884247, 0.21960784494876862,
0.21960784494876862), (0.15966387093067169, 0.22352941334247589,
0.22352941334247589), (0.16386555135250092, 0.23137255012989044,
0.23137255012989044), (0.16806723177433014, 0.23529411852359772,
0.23529411852359772), (0.17226891219615936, 0.24313725531101227,
0.24313725531101227), (0.17647059261798859, 0.24705882370471954,
0.24705882370471954), (0.18067227303981781, 0.25490197539329529,
0.25490197539329529), (0.18487395346164703, 0.25882354378700256,
0.25882354378700256), (0.18907563388347626, 0.26666668057441711,
0.26666668057441711), (0.19327731430530548, 0.27058824896812439,
0.27058824896812439), (0.1974789947271347, 0.27450981736183167,
0.27450981736183167), (0.20168067514896393, 0.28235295414924622,
0.28235295414924622), (0.20588235557079315, 0.28627452254295349,
0.28627452254295349), (0.21008403599262238, 0.29803922772407532,
0.29803922772407532), (0.2142857164144516, 0.30588236451148987,
0.30588236451148987), (0.21848739683628082, 0.30980393290519714,
0.30980393290519714), (0.22268907725811005, 0.31764706969261169,
0.31764706969261169), (0.22689075767993927, 0.32156863808631897,
0.32156863808631897), (0.23109243810176849, 0.32941177487373352,
0.32941177487373352), (0.23529411852359772, 0.3333333432674408,
0.3333333432674408), (0.23949579894542694, 0.33725491166114807,
0.33725491166114807), (0.24369747936725616, 0.34509804844856262,
0.34509804844856262), (0.24789915978908539, 0.3490196168422699,
0.3490196168422699), (0.25210085511207581, 0.36078432202339172,
0.36078432202339172), (0.25630253553390503, 0.36862745881080627,
0.36862745881080627), (0.26050421595573425, 0.37254902720451355,
0.37254902720451355), (0.26470589637756348, 0.3803921639919281,
0.3803921639919281), (0.2689075767993927, 0.38431373238563538,
0.38431373238563538), (0.27310925722122192, 0.38823530077934265,
0.38823530077934265), (0.27731093764305115, 0.3960784375667572,
0.3960784375667572), (0.28151261806488037, 0.40000000596046448,
0.40000000596046448), (0.28571429848670959, 0.40784314274787903,
0.40784314274787903), (0.28991597890853882, 0.4117647111415863,
0.4117647111415863), (0.29411765933036804, 0.42352941632270813,
0.42352941632270813), (0.29831933975219727, 0.43137255311012268,
0.43137255311012268), (0.30252102017402649, 0.43529412150382996,
0.43529412150382996), (0.30672270059585571, 0.44313725829124451,
0.44313725829124451), (0.31092438101768494, 0.44705882668495178,
0.44705882668495178), (0.31512606143951416, 0.45098039507865906,
0.45098039507865906), (0.31932774186134338, 0.45882353186607361,
0.45882353186607361), (0.32352942228317261, 0.46274510025978088,
0.46274510025978088), (0.32773110270500183, 0.47058823704719543,
0.47058823704719543), (0.33193278312683105, 0.47450980544090271,
0.47450980544090271), (0.33613446354866028, 0.48235294222831726,
0.48235294222831726), (0.3403361439704895, 0.48627451062202454,
0.48627451062202454), (0.34453782439231873, 0.49411764740943909,
0.49411764740943909), (0.34873950481414795, 0.49803921580314636,
0.49803921580314636), (0.35294118523597717, 0.50196081399917603,
0.50196081399917603), (0.3571428656578064, 0.50980395078659058,
0.50980395078659058), (0.36134454607963562, 0.51372551918029785,
0.51372551918029785), (0.36554622650146484, 0.5215686559677124,
0.5215686559677124), (0.36974790692329407, 0.52549022436141968,
0.52549022436141968), (0.37394958734512329, 0.53333336114883423,
0.53333336114883423), (0.37815126776695251, 0.54509806632995605,
0.54509806632995605), (0.38235294818878174, 0.54901963472366333,
0.54901963472366333), (0.38655462861061096, 0.55294120311737061,
0.55294120311737061), (0.39075630903244019, 0.56078433990478516,
0.56078433990478516), (0.39495798945426941, 0.56470590829849243,
0.56470590829849243), (0.39915966987609863, 0.57254904508590698,
0.57254904508590698), (0.40336135029792786, 0.57647061347961426,
0.57647061347961426), (0.40756303071975708, 0.58431375026702881,
0.58431375026702881), (0.4117647111415863, 0.58823531866073608,
0.58823531866073608), (0.41596639156341553, 0.59607845544815063,
0.59607845544815063), (0.42016807198524475, 0.60000002384185791,
0.60000002384185791), (0.42436975240707397, 0.60784316062927246,
0.60784316062927246), (0.4285714328289032, 0.61176472902297974,
0.61176472902297974), (0.43277311325073242, 0.61568629741668701,
0.61568629741668701), (0.43697479367256165, 0.62352943420410156,
0.62352943420410156), (0.44117647409439087, 0.62745100259780884,
0.62745100259780884), (0.44537815451622009, 0.63529413938522339,
0.63529413938522339), (0.44957983493804932, 0.63921570777893066,
0.63921570777893066), (0.45378151535987854, 0.64705884456634521,
0.64705884456634521), (0.45798319578170776, 0.65098041296005249,
0.65098041296005249), (0.46218487620353699, 0.66274511814117432,
0.66274511814117432), (0.46638655662536621, 0.66666668653488159,
0.66666668653488159), (0.47058823704719543, 0.67450982332229614,
0.67450982332229614), (0.47478991746902466, 0.67843139171600342,
0.67843139171600342), (0.47899159789085388, 0.68627452850341797,
0.68627452850341797), (0.48319327831268311, 0.69019609689712524,
0.69019609689712524), (0.48739495873451233, 0.69803923368453979,
0.69803923368453979), (0.49159663915634155, 0.70196080207824707,
0.70196080207824707), (0.49579831957817078, 0.70980393886566162,
0.70980393886566162), (0.5, 0.7137255072593689, 0.7137255072593689),
(0.50420171022415161, 0.72549021244049072, 0.72549021244049072),
(0.50840336084365845, 0.729411780834198, 0.729411780834198),
(0.51260507106781006, 0.73725491762161255, 0.73725491762161255),
(0.51680672168731689, 0.74117648601531982, 0.74117648601531982),
(0.52100843191146851, 0.74901962280273438, 0.74901962280273438),
(0.52521008253097534, 0.75294119119644165, 0.75294119119644165),
(0.52941179275512695, 0.7607843279838562, 0.7607843279838562),
(0.53361344337463379, 0.76470589637756348, 0.76470589637756348),
(0.5378151535987854, 0.77254903316497803, 0.77254903316497803),
(0.54201680421829224, 0.7764706015586853, 0.7764706015586853),
(0.54621851444244385, 0.78823530673980713, 0.78823530673980713),
(0.55042016506195068, 0.7921568751335144, 0.7921568751335144),
(0.55462187528610229, 0.80000001192092896, 0.80000001192092896),
(0.55882352590560913, 0.80392158031463623, 0.80392158031463623),
(0.56302523612976074, 0.81176471710205078, 0.81176471710205078),
(0.56722688674926758, 0.81568628549575806, 0.81568628549575806),
(0.57142859697341919, 0.82352942228317261, 0.82352942228317261),
(0.57563024759292603, 0.82745099067687988, 0.82745099067687988),
(0.57983195781707764, 0.83137255907058716, 0.83137255907058716),
(0.58403360843658447, 0.83921569585800171, 0.83921569585800171),
(0.58823531866073608, 0.84313726425170898, 0.84313726425170898),
(0.59243696928024292, 0.85098040103912354, 0.85098040103912354),
(0.59663867950439453, 0.85490196943283081, 0.85490196943283081),
(0.60084033012390137, 0.86274510622024536, 0.86274510622024536),
(0.60504204034805298, 0.86666667461395264, 0.86666667461395264),
(0.60924369096755981, 0.87450981140136719, 0.87450981140136719),
(0.61344540119171143, 0.87843137979507446, 0.87843137979507446),
(0.61764705181121826, 0.88627451658248901, 0.88627451658248901),
(0.62184876203536987, 0.89019608497619629, 0.89019608497619629),
(0.62605041265487671, 0.89411765336990356, 0.89411765336990356),
(0.63025212287902832, 0.90588235855102539, 0.90588235855102539),
(0.63445377349853516, 0.91372549533843994, 0.91372549533843994),
(0.63865548372268677, 0.91764706373214722, 0.91764706373214722),
(0.6428571343421936, 0.92549020051956177, 0.92549020051956177),
(0.64705884456634521, 0.92941176891326904, 0.92941176891326904),
(0.65126049518585205, 0.93725490570068359, 0.93725490570068359),
(0.65546220541000366, 0.94117647409439087, 0.94117647409439087),
(0.6596638560295105, 0.94509804248809814, 0.94509804248809814),
(0.66386556625366211, 0.9529411792755127, 0.9529411792755127),
(0.66806721687316895, 0.95686274766921997, 0.95686274766921997),
(0.67226892709732056, 0.96470588445663452, 0.96470588445663452),
(0.67647057771682739, 0.9686274528503418, 0.9686274528503418),
(0.680672287940979, 0.97647058963775635, 0.97647058963775635),
(0.68487393856048584, 0.98039215803146362, 0.98039215803146362),
(0.68907564878463745, 0.98823529481887817, 0.98823529481887817),
(0.69327729940414429, 0.99215686321258545, 0.99215686321258545),
(0.6974790096282959, 1.0, 1.0), (0.70168066024780273, 1.0, 1.0),
(0.70588237047195435, 1.0, 1.0), (0.71008402109146118, 1.0, 1.0),
(0.71428573131561279, 1.0, 1.0), (0.71848738193511963, 1.0, 1.0),
(0.72268909215927124, 1.0, 1.0), (0.72689074277877808, 1.0, 1.0),
(0.73109245300292969, 1.0, 1.0), (0.73529410362243652, 1.0, 1.0),
(0.73949581384658813, 1.0, 1.0), (0.74369746446609497, 1.0, 1.0),
(0.74789917469024658, 1.0, 1.0), (0.75210082530975342, 1.0, 1.0),
(0.75630253553390503, 1.0, 1.0), (0.76050418615341187, 1.0, 1.0),
(0.76470589637756348, 1.0, 1.0), (0.76890754699707031, 1.0, 1.0),
(0.77310925722122192, 1.0, 1.0), (0.77731090784072876, 1.0, 1.0),
(0.78151261806488037, 1.0, 1.0), (0.78571426868438721, 1.0, 1.0),
(0.78991597890853882, 1.0, 1.0), (0.79411762952804565, 1.0, 1.0),
(0.79831933975219727, 1.0, 1.0), (0.8025209903717041, 1.0, 1.0),
(0.80672270059585571, 1.0, 1.0), (0.81092435121536255, 1.0, 1.0),
(0.81512606143951416, 1.0, 1.0), (0.819327712059021, 1.0, 1.0),
(0.82352942228317261, 1.0, 1.0), (0.82773107290267944, 1.0, 1.0),
(0.83193278312683105, 1.0, 1.0), (0.83613443374633789, 1.0, 1.0),
(0.8403361439704895, 1.0, 1.0), (0.84453779458999634, 1.0, 1.0),
(0.84873950481414795, 1.0, 1.0), (0.85294115543365479, 1.0, 1.0),
(0.8571428656578064, 1.0, 1.0), (0.86134451627731323, 1.0, 1.0),
(0.86554622650146484, 1.0, 1.0), (0.86974787712097168, 1.0, 1.0),
(0.87394958734512329, 1.0, 1.0), (0.87815123796463013, 1.0, 1.0),
(0.88235294818878174, 1.0, 1.0), (0.88655459880828857, 1.0, 1.0),
(0.89075630903244019, 1.0, 1.0), (0.89495795965194702, 1.0, 1.0),
(0.89915966987609863, 1.0, 1.0), (0.90336132049560547, 1.0, 1.0),
(0.90756303071975708, 1.0, 1.0), (0.91176468133926392, 1.0, 1.0),
(0.91596639156341553, 1.0, 1.0), (0.92016804218292236, 1.0, 1.0),
(0.92436975240707397, 1.0, 1.0), (0.92857140302658081, 1.0, 1.0),
(0.93277311325073242, 1.0, 1.0), (0.93697476387023926, 1.0, 1.0),
(0.94117647409439087, 1.0, 1.0), (0.94537812471389771, 1.0, 1.0),
(0.94957983493804932, 1.0, 1.0), (0.95378148555755615, 1.0, 1.0),
(0.95798319578170776, 1.0, 1.0), (0.9621848464012146, 1.0, 1.0),
(0.96638655662536621, 1.0, 1.0), (0.97058820724487305, 1.0, 1.0),
(0.97478991746902466, 1.0, 1.0), (0.97899156808853149, 1.0, 1.0),
(0.98319327831268311, 1.0, 1.0), (0.98739492893218994, 1.0, 1.0),
(0.99159663915634155, 1.0, 1.0), (0.99579828977584839, 1.0, 1.0), (1.0,
1.0, 1.0)]}
_gist_ncar_data = {'blue': [(0.0, 0.50196081399917603,
0.50196081399917603), (0.0050505050458014011, 0.45098039507865906,
0.45098039507865906), (0.010101010091602802, 0.40392157435417175,
0.40392157435417175), (0.015151515603065491, 0.35686275362968445,
0.35686275362968445), (0.020202020183205605, 0.30980393290519714,
0.30980393290519714), (0.025252524763345718, 0.25882354378700256,
0.25882354378700256), (0.030303031206130981, 0.21176470816135406,
0.21176470816135406), (0.035353533923625946, 0.16470588743686676,
0.16470588743686676), (0.040404040366411209, 0.11764705926179886,
0.11764705926179886), (0.045454546809196472, 0.070588238537311554,
0.070588238537311554), (0.050505049526691437, 0.019607843831181526,
0.019607843831181526), (0.0555555559694767, 0.047058824449777603,
0.047058824449777603), (0.060606062412261963, 0.14509804546833038,
0.14509804546833038), (0.065656565129756927, 0.23921568691730499,
0.23921568691730499), (0.070707067847251892, 0.3333333432674408,
0.3333333432674408), (0.075757578015327454, 0.43137255311012268,
0.43137255311012268), (0.080808080732822418, 0.52549022436141968,
0.52549022436141968), (0.085858583450317383, 0.61960786581039429,
0.61960786581039429), (0.090909093618392944, 0.71764707565307617,
0.71764707565307617), (0.095959596335887909, 0.81176471710205078,
0.81176471710205078), (0.10101009905338287, 0.90588235855102539,
0.90588235855102539), (0.10606060922145844, 1.0, 1.0),
(0.1111111119389534, 1.0, 1.0), (0.11616161465644836, 1.0, 1.0),
(0.12121212482452393, 1.0, 1.0), (0.12626262009143829, 1.0, 1.0),
(0.13131313025951385, 1.0, 1.0), (0.13636364042758942, 1.0, 1.0),
(0.14141413569450378, 1.0, 1.0), (0.14646464586257935, 1.0, 1.0),
(0.15151515603065491, 1.0, 1.0), (0.15656565129756927, 1.0, 1.0),
(0.16161616146564484, 1.0, 1.0), (0.1666666716337204, 1.0, 1.0),
(0.17171716690063477, 1.0, 1.0), (0.17676767706871033, 1.0, 1.0),
(0.18181818723678589, 1.0, 1.0), (0.18686868250370026, 1.0, 1.0),
(0.19191919267177582, 1.0, 1.0), (0.19696970283985138, 1.0, 1.0),
(0.20202019810676575, 1.0, 1.0), (0.20707070827484131, 1.0, 1.0),
(0.21212121844291687, 0.99215686321258545, 0.99215686321258545),
(0.21717171370983124, 0.95686274766921997, 0.95686274766921997),
(0.2222222238779068, 0.91764706373214722, 0.91764706373214722),
(0.22727273404598236, 0.88235294818878174, 0.88235294818878174),
(0.23232322931289673, 0.84313726425170898, 0.84313726425170898),
(0.23737373948097229, 0.80392158031463623, 0.80392158031463623),
(0.24242424964904785, 0.76862746477127075, 0.76862746477127075),
(0.24747474491596222, 0.729411780834198, 0.729411780834198),
(0.25252524018287659, 0.69019609689712524, 0.69019609689712524),
(0.25757575035095215, 0.65490198135375977, 0.65490198135375977),
(0.26262626051902771, 0.61568629741668701, 0.61568629741668701),
(0.26767677068710327, 0.56470590829849243, 0.56470590829849243),
(0.27272728085517883, 0.50980395078659058, 0.50980395078659058),
(0.27777779102325439, 0.45098039507865906, 0.45098039507865906),
(0.28282827138900757, 0.39215686917304993, 0.39215686917304993),
(0.28787878155708313, 0.3333333432674408, 0.3333333432674408),
(0.29292929172515869, 0.27843138575553894, 0.27843138575553894),
(0.29797980189323425, 0.21960784494876862, 0.21960784494876862),
(0.30303031206130981, 0.16078431904315948, 0.16078431904315948),
(0.30808082222938538, 0.10588235408067703, 0.10588235408067703),
(0.31313130259513855, 0.047058824449777603, 0.047058824449777603),
(0.31818181276321411, 0.0, 0.0), (0.32323232293128967, 0.0, 0.0),
(0.32828283309936523, 0.0, 0.0), (0.3333333432674408, 0.0, 0.0),
(0.33838382363319397, 0.0, 0.0), (0.34343433380126953, 0.0, 0.0),
(0.34848484396934509, 0.0, 0.0), (0.35353535413742065, 0.0, 0.0),
(0.35858586430549622, 0.0, 0.0), (0.36363637447357178, 0.0, 0.0),
(0.36868685483932495, 0.0, 0.0), (0.37373736500740051, 0.0, 0.0),
(0.37878787517547607, 0.0, 0.0), (0.38383838534355164, 0.0, 0.0),
(0.3888888955116272, 0.0, 0.0), (0.39393940567970276, 0.0, 0.0),
(0.39898988604545593, 0.0, 0.0), (0.40404039621353149, 0.0, 0.0),
(0.40909090638160706, 0.0, 0.0), (0.41414141654968262, 0.0, 0.0),
(0.41919192671775818, 0.0, 0.0), (0.42424243688583374,
0.0039215688593685627, 0.0039215688593685627), (0.42929291725158691,
0.027450980618596077, 0.027450980618596077), (0.43434342741966248,
0.050980392843484879, 0.050980392843484879), (0.43939393758773804,
0.074509806931018829, 0.074509806931018829), (0.4444444477558136,
0.094117648899555206, 0.094117648899555206), (0.44949495792388916,
0.11764705926179886, 0.11764705926179886), (0.45454546809196472,
0.14117647707462311, 0.14117647707462311), (0.4595959484577179,
0.16470588743686676, 0.16470588743686676), (0.46464645862579346,
0.18823529779911041, 0.18823529779911041), (0.46969696879386902,
0.21176470816135406, 0.21176470816135406), (0.47474747896194458,
0.23529411852359772, 0.23529411852359772), (0.47979798913002014,
0.22352941334247589, 0.22352941334247589), (0.4848484992980957,
0.20000000298023224, 0.20000000298023224), (0.48989897966384888,
0.17647059261798859, 0.17647059261798859), (0.49494948983192444,
0.15294118225574493, 0.15294118225574493), (0.5, 0.12941177189350128,
0.12941177189350128), (0.50505048036575317, 0.10980392247438431,
0.10980392247438431), (0.51010102033615112, 0.086274512112140656,
0.086274512112140656), (0.5151515007019043, 0.062745101749897003,
0.062745101749897003), (0.52020204067230225, 0.039215687662363052,
0.039215687662363052), (0.52525252103805542, 0.015686275437474251,
0.015686275437474251), (0.53030300140380859, 0.0, 0.0),
(0.53535354137420654, 0.0, 0.0), (0.54040402173995972, 0.0, 0.0),
(0.54545456171035767, 0.0, 0.0), (0.55050504207611084, 0.0, 0.0),
(0.55555558204650879, 0.0, 0.0), (0.56060606241226196, 0.0, 0.0),
(0.56565654277801514, 0.0, 0.0), (0.57070708274841309, 0.0, 0.0),
(0.57575756311416626, 0.0, 0.0), (0.58080810308456421, 0.0, 0.0),
(0.58585858345031738, 0.0039215688593685627, 0.0039215688593685627),
(0.59090906381607056, 0.0078431377187371254, 0.0078431377187371254),
(0.59595960378646851, 0.011764706112444401, 0.011764706112444401),
(0.60101008415222168, 0.019607843831181526, 0.019607843831181526),
(0.60606062412261963, 0.023529412224888802, 0.023529412224888802),
(0.6111111044883728, 0.031372550874948502, 0.031372550874948502),
(0.61616164445877075, 0.035294119268655777, 0.035294119268655777),
(0.62121212482452393, 0.043137256056070328, 0.043137256056070328),
(0.6262626051902771, 0.047058824449777603, 0.047058824449777603),
(0.63131314516067505, 0.054901961237192154, 0.054901961237192154),
(0.63636362552642822, 0.054901961237192154, 0.054901961237192154),
(0.64141416549682617, 0.050980392843484879, 0.050980392843484879),
(0.64646464586257935, 0.043137256056070328, 0.043137256056070328),
(0.65151512622833252, 0.039215687662363052, 0.039215687662363052),
(0.65656566619873047, 0.031372550874948502, 0.031372550874948502),
(0.66161614656448364, 0.027450980618596077, 0.027450980618596077),
(0.66666668653488159, 0.019607843831181526, 0.019607843831181526),
(0.67171716690063477, 0.015686275437474251, 0.015686275437474251),
(0.67676764726638794, 0.011764706112444401, 0.011764706112444401),
(0.68181818723678589, 0.0039215688593685627, 0.0039215688593685627),
(0.68686866760253906, 0.0, 0.0), (0.69191920757293701, 0.0, 0.0),
(0.69696968793869019, 0.0, 0.0), (0.70202022790908813, 0.0, 0.0),
(0.70707070827484131, 0.0, 0.0), (0.71212118864059448, 0.0, 0.0),
(0.71717172861099243, 0.0, 0.0), (0.72222220897674561, 0.0, 0.0),
(0.72727274894714355, 0.0, 0.0), (0.73232322931289673, 0.0, 0.0),
(0.7373737096786499, 0.0, 0.0), (0.74242424964904785,
0.031372550874948502, 0.031372550874948502), (0.74747473001480103,
0.12941177189350128, 0.12941177189350128), (0.75252526998519897,
0.22352941334247589, 0.22352941334247589), (0.75757575035095215,
0.32156863808631897, 0.32156863808631897), (0.7626262903213501,
0.41568627953529358, 0.41568627953529358), (0.76767677068710327,
0.50980395078659058, 0.50980395078659058), (0.77272725105285645,
0.60784316062927246, 0.60784316062927246), (0.77777779102325439,
0.70196080207824707, 0.70196080207824707), (0.78282827138900757,
0.79607844352722168, 0.79607844352722168), (0.78787881135940552,
0.89411765336990356, 0.89411765336990356), (0.79292929172515869,
0.98823529481887817, 0.98823529481887817), (0.79797977209091187, 1.0,
1.0), (0.80303031206130981, 1.0, 1.0), (0.80808079242706299, 1.0, 1.0),
(0.81313133239746094, 1.0, 1.0), (0.81818181276321411, 1.0, 1.0),
(0.82323235273361206, 1.0, 1.0), (0.82828283309936523, 1.0, 1.0),
(0.83333331346511841, 1.0, 1.0), (0.83838385343551636, 1.0, 1.0),
(0.84343433380126953, 1.0, 1.0), (0.84848487377166748,
0.99607843160629272, 0.99607843160629272), (0.85353535413742065,
0.98823529481887817, 0.98823529481887817), (0.85858583450317383,
0.9843137264251709, 0.9843137264251709), (0.86363637447357178,
0.97647058963775635, 0.97647058963775635), (0.86868685483932495,
0.9686274528503418, 0.9686274528503418), (0.8737373948097229,
0.96470588445663452, 0.96470588445663452), (0.87878787517547607,
0.95686274766921997, 0.95686274766921997), (0.88383835554122925,
0.94901961088180542, 0.94901961088180542), (0.8888888955116272,
0.94509804248809814, 0.94509804248809814), (0.89393937587738037,
0.93725490570068359, 0.93725490570068359), (0.89898991584777832,
0.93333333730697632, 0.93333333730697632), (0.90404039621353149,
0.93333333730697632, 0.93333333730697632), (0.90909093618392944,
0.93725490570068359, 0.93725490570068359), (0.91414141654968262,
0.93725490570068359, 0.93725490570068359), (0.91919189691543579,
0.94117647409439087, 0.94117647409439087), (0.92424243688583374,
0.94509804248809814, 0.94509804248809814), (0.92929291725158691,
0.94509804248809814, 0.94509804248809814), (0.93434345722198486,
0.94901961088180542, 0.94901961088180542), (0.93939393758773804,
0.9529411792755127, 0.9529411792755127), (0.94444441795349121,
0.9529411792755127, 0.9529411792755127), (0.94949495792388916,
0.95686274766921997, 0.95686274766921997), (0.95454543828964233,
0.96078431606292725, 0.96078431606292725), (0.95959597826004028,
0.96470588445663452, 0.96470588445663452), (0.96464645862579346,
0.9686274528503418, 0.9686274528503418), (0.96969699859619141,
0.97254902124404907, 0.97254902124404907), (0.97474747896194458,
0.97647058963775635, 0.97647058963775635), (0.97979795932769775,
0.98039215803146362, 0.98039215803146362), (0.9848484992980957,
0.9843137264251709, 0.9843137264251709), (0.98989897966384888,
0.98823529481887817, 0.98823529481887817), (0.99494951963424683,
0.99215686321258545, 0.99215686321258545), (1.0, 0.99607843160629272,
0.99607843160629272)], 'green': [(0.0, 0.0, 0.0), (0.0050505050458014011,
0.035294119268655777, 0.035294119268655777), (0.010101010091602802,
0.074509806931018829, 0.074509806931018829), (0.015151515603065491,
0.10980392247438431, 0.10980392247438431), (0.020202020183205605,
0.14901961386203766, 0.14901961386203766), (0.025252524763345718,
0.18431372940540314, 0.18431372940540314), (0.030303031206130981,
0.22352941334247589, 0.22352941334247589), (0.035353533923625946,
0.25882354378700256, 0.25882354378700256), (0.040404040366411209,
0.29803922772407532, 0.29803922772407532), (0.045454546809196472,
0.3333333432674408, 0.3333333432674408), (0.050505049526691437,
0.37254902720451355, 0.37254902720451355), (0.0555555559694767,
0.36862745881080627, 0.36862745881080627), (0.060606062412261963,
0.3333333432674408, 0.3333333432674408), (0.065656565129756927,
0.29411765933036804, 0.29411765933036804), (0.070707067847251892,
0.25882354378700256, 0.25882354378700256), (0.075757578015327454,
0.21960784494876862, 0.21960784494876862), (0.080808080732822418,
0.18431372940540314, 0.18431372940540314), (0.085858583450317383,
0.14509804546833038, 0.14509804546833038), (0.090909093618392944,
0.10980392247438431, 0.10980392247438431), (0.095959596335887909,
0.070588238537311554, 0.070588238537311554), (0.10101009905338287,
0.035294119268655777, 0.035294119268655777), (0.10606060922145844, 0.0,
0.0), (0.1111111119389534, 0.074509806931018829, 0.074509806931018829),
(0.11616161465644836, 0.14509804546833038, 0.14509804546833038),
(0.12121212482452393, 0.21568627655506134, 0.21568627655506134),
(0.12626262009143829, 0.28627452254295349, 0.28627452254295349),
(0.13131313025951385, 0.36078432202339172, 0.36078432202339172),
(0.13636364042758942, 0.43137255311012268, 0.43137255311012268),
(0.14141413569450378, 0.50196081399917603, 0.50196081399917603),
(0.14646464586257935, 0.57254904508590698, 0.57254904508590698),
(0.15151515603065491, 0.64705884456634521, 0.64705884456634521),
(0.15656565129756927, 0.71764707565307617, 0.71764707565307617),
(0.16161616146564484, 0.7607843279838562, 0.7607843279838562),
(0.1666666716337204, 0.78431373834609985, 0.78431373834609985),
(0.17171716690063477, 0.80784314870834351, 0.80784314870834351),
(0.17676767706871033, 0.83137255907058716, 0.83137255907058716),
(0.18181818723678589, 0.85490196943283081, 0.85490196943283081),
(0.18686868250370026, 0.88235294818878174, 0.88235294818878174),
(0.19191919267177582, 0.90588235855102539, 0.90588235855102539),
(0.19696970283985138, 0.92941176891326904, 0.92941176891326904),
(0.20202019810676575, 0.9529411792755127, 0.9529411792755127),
(0.20707070827484131, 0.97647058963775635, 0.97647058963775635),
(0.21212121844291687, 0.99607843160629272, 0.99607843160629272),
(0.21717171370983124, 0.99607843160629272, 0.99607843160629272),
(0.2222222238779068, 0.99215686321258545, 0.99215686321258545),
(0.22727273404598236, 0.99215686321258545, 0.99215686321258545),
(0.23232322931289673, 0.99215686321258545, 0.99215686321258545),
(0.23737373948097229, 0.98823529481887817, 0.98823529481887817),
(0.24242424964904785, 0.98823529481887817, 0.98823529481887817),
(0.24747474491596222, 0.9843137264251709, 0.9843137264251709),
(0.25252524018287659, 0.9843137264251709, 0.9843137264251709),
(0.25757575035095215, 0.98039215803146362, 0.98039215803146362),
(0.26262626051902771, 0.98039215803146362, 0.98039215803146362),
(0.26767677068710327, 0.98039215803146362, 0.98039215803146362),
(0.27272728085517883, 0.98039215803146362, 0.98039215803146362),
(0.27777779102325439, 0.9843137264251709, 0.9843137264251709),
(0.28282827138900757, 0.9843137264251709, 0.9843137264251709),
(0.28787878155708313, 0.98823529481887817, 0.98823529481887817),
(0.29292929172515869, 0.98823529481887817, 0.98823529481887817),
(0.29797980189323425, 0.99215686321258545, 0.99215686321258545),
(0.30303031206130981, 0.99215686321258545, 0.99215686321258545),
(0.30808082222938538, 0.99607843160629272, 0.99607843160629272),
(0.31313130259513855, 0.99607843160629272, 0.99607843160629272),
(0.31818181276321411, 0.99607843160629272, 0.99607843160629272),
(0.32323232293128967, 0.97647058963775635, 0.97647058963775635),
(0.32828283309936523, 0.95686274766921997, 0.95686274766921997),
(0.3333333432674408, 0.93725490570068359, 0.93725490570068359),
(0.33838382363319397, 0.92156863212585449, 0.92156863212585449),
(0.34343433380126953, 0.90196079015731812, 0.90196079015731812),
(0.34848484396934509, 0.88235294818878174, 0.88235294818878174),
(0.35353535413742065, 0.86274510622024536, 0.86274510622024536),
(0.35858586430549622, 0.84705883264541626, 0.84705883264541626),
(0.36363637447357178, 0.82745099067687988, 0.82745099067687988),
(0.36868685483932495, 0.80784314870834351, 0.80784314870834351),
(0.37373736500740051, 0.81568628549575806, 0.81568628549575806),
(0.37878787517547607, 0.83529412746429443, 0.83529412746429443),
(0.38383838534355164, 0.85098040103912354, 0.85098040103912354),
(0.3888888955116272, 0.87058824300765991, 0.87058824300765991),
(0.39393940567970276, 0.89019608497619629, 0.89019608497619629),
(0.39898988604545593, 0.90980392694473267, 0.90980392694473267),
(0.40404039621353149, 0.92549020051956177, 0.92549020051956177),
(0.40909090638160706, 0.94509804248809814, 0.94509804248809814),
(0.41414141654968262, 0.96470588445663452, 0.96470588445663452),
(0.41919192671775818, 0.9843137264251709, 0.9843137264251709),
(0.42424243688583374, 1.0, 1.0), (0.42929291725158691, 1.0, 1.0),
(0.43434342741966248, 1.0, 1.0), (0.43939393758773804, 1.0, 1.0),
(0.4444444477558136, 1.0, 1.0), (0.44949495792388916, 1.0, 1.0),
(0.45454546809196472, 1.0, 1.0), (0.4595959484577179, 1.0, 1.0),
(0.46464645862579346, 1.0, 1.0), (0.46969696879386902, 1.0, 1.0),
(0.47474747896194458, 1.0, 1.0), (0.47979798913002014, 1.0, 1.0),
(0.4848484992980957, 1.0, 1.0), (0.48989897966384888, 1.0, 1.0),
(0.49494948983192444, 1.0, 1.0), (0.5, 1.0, 1.0), (0.50505048036575317,
1.0, 1.0), (0.51010102033615112, 1.0, 1.0), (0.5151515007019043, 1.0,
1.0), (0.52020204067230225, 1.0, 1.0), (0.52525252103805542, 1.0, 1.0),
(0.53030300140380859, 0.99215686321258545, 0.99215686321258545),
(0.53535354137420654, 0.98039215803146362, 0.98039215803146362),
(0.54040402173995972, 0.96470588445663452, 0.96470588445663452),
(0.54545456171035767, 0.94901961088180542, 0.94901961088180542),
(0.55050504207611084, 0.93333333730697632, 0.93333333730697632),
(0.55555558204650879, 0.91764706373214722, 0.91764706373214722),
(0.56060606241226196, 0.90588235855102539, 0.90588235855102539),
(0.56565654277801514, 0.89019608497619629, 0.89019608497619629),
(0.57070708274841309, 0.87450981140136719, 0.87450981140136719),
(0.57575756311416626, 0.85882353782653809, 0.85882353782653809),
(0.58080810308456421, 0.84313726425170898, 0.84313726425170898),
(0.58585858345031738, 0.83137255907058716, 0.83137255907058716),
(0.59090906381607056, 0.81960785388946533, 0.81960785388946533),
(0.59595960378646851, 0.81176471710205078, 0.81176471710205078),
(0.60101008415222168, 0.80000001192092896, 0.80000001192092896),
(0.60606062412261963, 0.78823530673980713, 0.78823530673980713),
(0.6111111044883728, 0.7764706015586853, 0.7764706015586853),
(0.61616164445877075, 0.76470589637756348, 0.76470589637756348),
(0.62121212482452393, 0.75294119119644165, 0.75294119119644165),
(0.6262626051902771, 0.74117648601531982, 0.74117648601531982),
(0.63131314516067505, 0.729411780834198, 0.729411780834198),
(0.63636362552642822, 0.70980393886566162, 0.70980393886566162),
(0.64141416549682617, 0.66666668653488159, 0.66666668653488159),
(0.64646464586257935, 0.62352943420410156, 0.62352943420410156),
(0.65151512622833252, 0.58039218187332153, 0.58039218187332153),
(0.65656566619873047, 0.5372549295425415, 0.5372549295425415),
(0.66161614656448364, 0.49411764740943909, 0.49411764740943909),
(0.66666668653488159, 0.45098039507865906, 0.45098039507865906),
(0.67171716690063477, 0.40392157435417175, 0.40392157435417175),
(0.67676764726638794, 0.36078432202339172, 0.36078432202339172),
(0.68181818723678589, 0.31764706969261169, 0.31764706969261169),
(0.68686866760253906, 0.27450981736183167, 0.27450981736183167),
(0.69191920757293701, 0.24705882370471954, 0.24705882370471954),
(0.69696968793869019, 0.21960784494876862, 0.21960784494876862),
(0.70202022790908813, 0.19607843458652496, 0.19607843458652496),
(0.70707070827484131, 0.16862745583057404, 0.16862745583057404),
(0.71212118864059448, 0.14509804546833038, 0.14509804546833038),
(0.71717172861099243, 0.11764705926179886, 0.11764705926179886),
(0.72222220897674561, 0.090196080505847931, 0.090196080505847931),
(0.72727274894714355, 0.066666670143604279, 0.066666670143604279),
(0.73232322931289673, 0.039215687662363052, 0.039215687662363052),
(0.7373737096786499, 0.015686275437474251, 0.015686275437474251),
(0.74242424964904785, 0.0, 0.0), (0.74747473001480103, 0.0, 0.0),
(0.75252526998519897, 0.0, 0.0), (0.75757575035095215, 0.0, 0.0),
(0.7626262903213501, 0.0, 0.0), (0.76767677068710327, 0.0, 0.0),
(0.77272725105285645, 0.0, 0.0), (0.77777779102325439, 0.0, 0.0),
(0.78282827138900757, 0.0, 0.0), (0.78787881135940552, 0.0, 0.0),
(0.79292929172515869, 0.0, 0.0), (0.79797977209091187,
0.015686275437474251, 0.015686275437474251), (0.80303031206130981,
0.031372550874948502, 0.031372550874948502), (0.80808079242706299,
0.050980392843484879, 0.050980392843484879), (0.81313133239746094,
0.066666670143604279, 0.066666670143604279), (0.81818181276321411,
0.086274512112140656, 0.086274512112140656), (0.82323235273361206,
0.10588235408067703, 0.10588235408067703), (0.82828283309936523,
0.12156862765550613, 0.12156862765550613), (0.83333331346511841,
0.14117647707462311, 0.14117647707462311), (0.83838385343551636,
0.15686275064945221, 0.15686275064945221), (0.84343433380126953,
0.17647059261798859, 0.17647059261798859), (0.84848487377166748,
0.20000000298023224, 0.20000000298023224), (0.85353535413742065,
0.23137255012989044, 0.23137255012989044), (0.85858583450317383,
0.25882354378700256, 0.25882354378700256), (0.86363637447357178,
0.29019609093666077, 0.29019609093666077), (0.86868685483932495,
0.32156863808631897, 0.32156863808631897), (0.8737373948097229,
0.35294118523597717, 0.35294118523597717), (0.87878787517547607,
0.38431373238563538, 0.38431373238563538), (0.88383835554122925,
0.41568627953529358, 0.41568627953529358), (0.8888888955116272,
0.44313725829124451, 0.44313725829124451), (0.89393937587738037,
0.47450980544090271, 0.47450980544090271), (0.89898991584777832,
0.5058823823928833, 0.5058823823928833), (0.90404039621353149,
0.52941179275512695, 0.52941179275512695), (0.90909093618392944,
0.55294120311737061, 0.55294120311737061), (0.91414141654968262,
0.57254904508590698, 0.57254904508590698), (0.91919189691543579,
0.59607845544815063, 0.59607845544815063), (0.92424243688583374,
0.61960786581039429, 0.61960786581039429), (0.92929291725158691,
0.64313727617263794, 0.64313727617263794), (0.93434345722198486,
0.66274511814117432, 0.66274511814117432), (0.93939393758773804,
0.68627452850341797, 0.68627452850341797), (0.94444441795349121,
0.70980393886566162, 0.70980393886566162), (0.94949495792388916,
0.729411780834198, 0.729411780834198), (0.95454543828964233,
0.75294119119644165, 0.75294119119644165), (0.95959597826004028,
0.78039216995239258, 0.78039216995239258), (0.96464645862579346,
0.80392158031463623, 0.80392158031463623), (0.96969699859619141,
0.82745099067687988, 0.82745099067687988), (0.97474747896194458,
0.85098040103912354, 0.85098040103912354), (0.97979795932769775,
0.87450981140136719, 0.87450981140136719), (0.9848484992980957,
0.90196079015731812, 0.90196079015731812), (0.98989897966384888,
0.92549020051956177, 0.92549020051956177), (0.99494951963424683,
0.94901961088180542, 0.94901961088180542), (1.0, 0.97254902124404907,
0.97254902124404907)], 'red': [(0.0, 0.0, 0.0), (0.0050505050458014011,
0.0, 0.0), (0.010101010091602802, 0.0, 0.0), (0.015151515603065491, 0.0,
0.0), (0.020202020183205605, 0.0, 0.0), (0.025252524763345718, 0.0, 0.0),
(0.030303031206130981, 0.0, 0.0), (0.035353533923625946, 0.0, 0.0),
(0.040404040366411209, 0.0, 0.0), (0.045454546809196472, 0.0, 0.0),
(0.050505049526691437, 0.0, 0.0), (0.0555555559694767, 0.0, 0.0),
(0.060606062412261963, 0.0, 0.0), (0.065656565129756927, 0.0, 0.0),
(0.070707067847251892, 0.0, 0.0), (0.075757578015327454, 0.0, 0.0),
(0.080808080732822418, 0.0, 0.0), (0.085858583450317383, 0.0, 0.0),
(0.090909093618392944, 0.0, 0.0), (0.095959596335887909, 0.0, 0.0),
(0.10101009905338287, 0.0, 0.0), (0.10606060922145844, 0.0, 0.0),
(0.1111111119389534, 0.0, 0.0), (0.11616161465644836, 0.0, 0.0),
(0.12121212482452393, 0.0, 0.0), (0.12626262009143829, 0.0, 0.0),
(0.13131313025951385, 0.0, 0.0), (0.13636364042758942, 0.0, 0.0),
(0.14141413569450378, 0.0, 0.0), (0.14646464586257935, 0.0, 0.0),
(0.15151515603065491, 0.0, 0.0), (0.15656565129756927, 0.0, 0.0),
(0.16161616146564484, 0.0, 0.0), (0.1666666716337204, 0.0, 0.0),
(0.17171716690063477, 0.0, 0.0), (0.17676767706871033, 0.0, 0.0),
(0.18181818723678589, 0.0, 0.0), (0.18686868250370026, 0.0, 0.0),
(0.19191919267177582, 0.0, 0.0), (0.19696970283985138, 0.0, 0.0),
(0.20202019810676575, 0.0, 0.0), (0.20707070827484131, 0.0, 0.0),
(0.21212121844291687, 0.0, 0.0), (0.21717171370983124, 0.0, 0.0),
(0.2222222238779068, 0.0, 0.0), (0.22727273404598236, 0.0, 0.0),
(0.23232322931289673, 0.0, 0.0), (0.23737373948097229, 0.0, 0.0),
(0.24242424964904785, 0.0, 0.0), (0.24747474491596222, 0.0, 0.0),
(0.25252524018287659, 0.0, 0.0), (0.25757575035095215, 0.0, 0.0),
(0.26262626051902771, 0.0, 0.0), (0.26767677068710327, 0.0, 0.0),
(0.27272728085517883, 0.0, 0.0), (0.27777779102325439, 0.0, 0.0),
(0.28282827138900757, 0.0, 0.0), (0.28787878155708313, 0.0, 0.0),
(0.29292929172515869, 0.0, 0.0), (0.29797980189323425, 0.0, 0.0),
(0.30303031206130981, 0.0, 0.0), (0.30808082222938538, 0.0, 0.0),
(0.31313130259513855, 0.0, 0.0), (0.31818181276321411,
0.0039215688593685627, 0.0039215688593685627), (0.32323232293128967,
0.043137256056070328, 0.043137256056070328), (0.32828283309936523,
0.08235294371843338, 0.08235294371843338), (0.3333333432674408,
0.11764705926179886, 0.11764705926179886), (0.33838382363319397,
0.15686275064945221, 0.15686275064945221), (0.34343433380126953,
0.19607843458652496, 0.19607843458652496), (0.34848484396934509,
0.23137255012989044, 0.23137255012989044), (0.35353535413742065,
0.27058824896812439, 0.27058824896812439), (0.35858586430549622,
0.30980393290519714, 0.30980393290519714), (0.36363637447357178,
0.3490196168422699, 0.3490196168422699), (0.36868685483932495,
0.38431373238563538, 0.38431373238563538), (0.37373736500740051,
0.40392157435417175, 0.40392157435417175), (0.37878787517547607,
0.41568627953529358, 0.41568627953529358), (0.38383838534355164,
0.42352941632270813, 0.42352941632270813), (0.3888888955116272,
0.43137255311012268, 0.43137255311012268), (0.39393940567970276,
0.44313725829124451, 0.44313725829124451), (0.39898988604545593,
0.45098039507865906, 0.45098039507865906), (0.40404039621353149,
0.45882353186607361, 0.45882353186607361), (0.40909090638160706,
0.47058823704719543, 0.47058823704719543), (0.41414141654968262,
0.47843137383460999, 0.47843137383460999), (0.41919192671775818,
0.49019607901573181, 0.49019607901573181), (0.42424243688583374,
0.50196081399917603, 0.50196081399917603), (0.42929291725158691,
0.52549022436141968, 0.52549022436141968), (0.43434342741966248,
0.54901963472366333, 0.54901963472366333), (0.43939393758773804,
0.57254904508590698, 0.57254904508590698), (0.4444444477558136,
0.60000002384185791, 0.60000002384185791), (0.44949495792388916,
0.62352943420410156, 0.62352943420410156), (0.45454546809196472,
0.64705884456634521, 0.64705884456634521), (0.4595959484577179,
0.67058825492858887, 0.67058825492858887), (0.46464645862579346,
0.69411766529083252, 0.69411766529083252), (0.46969696879386902,
0.72156864404678345, 0.72156864404678345), (0.47474747896194458,
0.7450980544090271, 0.7450980544090271), (0.47979798913002014,
0.76862746477127075, 0.76862746477127075), (0.4848484992980957,
0.7921568751335144, 0.7921568751335144), (0.48989897966384888,
0.81568628549575806, 0.81568628549575806), (0.49494948983192444,
0.83921569585800171, 0.83921569585800171), (0.5, 0.86274510622024536,
0.86274510622024536), (0.50505048036575317, 0.88627451658248901,
0.88627451658248901), (0.51010102033615112, 0.90980392694473267,
0.90980392694473267), (0.5151515007019043, 0.93333333730697632,
0.93333333730697632), (0.52020204067230225, 0.95686274766921997,
0.95686274766921997), (0.52525252103805542, 0.98039215803146362,
0.98039215803146362), (0.53030300140380859, 1.0, 1.0),
(0.53535354137420654, 1.0, 1.0), (0.54040402173995972, 1.0, 1.0),
(0.54545456171035767, 1.0, 1.0), (0.55050504207611084, 1.0, 1.0),
(0.55555558204650879, 1.0, 1.0), (0.56060606241226196, 1.0, 1.0),
(0.56565654277801514, 1.0, 1.0), (0.57070708274841309, 1.0, 1.0),
(0.57575756311416626, 1.0, 1.0), (0.58080810308456421, 1.0, 1.0),
(0.58585858345031738, 1.0, 1.0), (0.59090906381607056, 1.0, 1.0),
(0.59595960378646851, 1.0, 1.0), (0.60101008415222168, 1.0, 1.0),
(0.60606062412261963, 1.0, 1.0), (0.6111111044883728, 1.0, 1.0),
(0.61616164445877075, 1.0, 1.0), (0.62121212482452393, 1.0, 1.0),
(0.6262626051902771, 1.0, 1.0), (0.63131314516067505, 1.0, 1.0),
(0.63636362552642822, 1.0, 1.0), (0.64141416549682617, 1.0, 1.0),
(0.64646464586257935, 1.0, 1.0), (0.65151512622833252, 1.0, 1.0),
(0.65656566619873047, 1.0, 1.0), (0.66161614656448364, 1.0, 1.0),
(0.66666668653488159, 1.0, 1.0), (0.67171716690063477, 1.0, 1.0),
(0.67676764726638794, 1.0, 1.0), (0.68181818723678589, 1.0, 1.0),
(0.68686866760253906, 1.0, 1.0), (0.69191920757293701, 1.0, 1.0),
(0.69696968793869019, 1.0, 1.0), (0.70202022790908813, 1.0, 1.0),
(0.70707070827484131, 1.0, 1.0), (0.71212118864059448, 1.0, 1.0),
(0.71717172861099243, 1.0, 1.0), (0.72222220897674561, 1.0, 1.0),
(0.72727274894714355, 1.0, 1.0), (0.73232322931289673, 1.0, 1.0),
(0.7373737096786499, 1.0, 1.0), (0.74242424964904785, 1.0, 1.0),
(0.74747473001480103, 1.0, 1.0), (0.75252526998519897, 1.0, 1.0),
(0.75757575035095215, 1.0, 1.0), (0.7626262903213501, 1.0, 1.0),
(0.76767677068710327, 1.0, 1.0), (0.77272725105285645, 1.0, 1.0),
(0.77777779102325439, 1.0, 1.0), (0.78282827138900757, 1.0, 1.0),
(0.78787881135940552, 1.0, 1.0), (0.79292929172515869, 1.0, 1.0),
(0.79797977209091187, 0.96470588445663452, 0.96470588445663452),
(0.80303031206130981, 0.92549020051956177, 0.92549020051956177),
(0.80808079242706299, 0.89019608497619629, 0.89019608497619629),
(0.81313133239746094, 0.85098040103912354, 0.85098040103912354),
(0.81818181276321411, 0.81568628549575806, 0.81568628549575806),
(0.82323235273361206, 0.7764706015586853, 0.7764706015586853),
(0.82828283309936523, 0.74117648601531982, 0.74117648601531982),
(0.83333331346511841, 0.70196080207824707, 0.70196080207824707),
(0.83838385343551636, 0.66666668653488159, 0.66666668653488159),
(0.84343433380126953, 0.62745100259780884, 0.62745100259780884),
(0.84848487377166748, 0.61960786581039429, 0.61960786581039429),
(0.85353535413742065, 0.65098041296005249, 0.65098041296005249),
(0.85858583450317383, 0.68235296010971069, 0.68235296010971069),
(0.86363637447357178, 0.7137255072593689, 0.7137255072593689),
(0.86868685483932495, 0.7450980544090271, 0.7450980544090271),
(0.8737373948097229, 0.77254903316497803, 0.77254903316497803),
(0.87878787517547607, 0.80392158031463623, 0.80392158031463623),
(0.88383835554122925, 0.83529412746429443, 0.83529412746429443),
(0.8888888955116272, 0.86666667461395264, 0.86666667461395264),
(0.89393937587738037, 0.89803922176361084, 0.89803922176361084),
(0.89898991584777832, 0.92941176891326904, 0.92941176891326904),
(0.90404039621353149, 0.93333333730697632, 0.93333333730697632),
(0.90909093618392944, 0.93725490570068359, 0.93725490570068359),
(0.91414141654968262, 0.93725490570068359, 0.93725490570068359),
(0.91919189691543579, 0.94117647409439087, 0.94117647409439087),
(0.92424243688583374, 0.94509804248809814, 0.94509804248809814),
(0.92929291725158691, 0.94509804248809814, 0.94509804248809814),
(0.93434345722198486, 0.94901961088180542, 0.94901961088180542),
(0.93939393758773804, 0.9529411792755127, 0.9529411792755127),
(0.94444441795349121, 0.9529411792755127, 0.9529411792755127),
(0.94949495792388916, 0.95686274766921997, 0.95686274766921997),
(0.95454543828964233, 0.96078431606292725, 0.96078431606292725),
(0.95959597826004028, 0.96470588445663452, 0.96470588445663452),
(0.96464645862579346, 0.9686274528503418, 0.9686274528503418),
(0.96969699859619141, 0.97254902124404907, 0.97254902124404907),
(0.97474747896194458, 0.97647058963775635, 0.97647058963775635),
(0.97979795932769775, 0.98039215803146362, 0.98039215803146362),
(0.9848484992980957, 0.9843137264251709, 0.9843137264251709),
(0.98989897966384888, 0.98823529481887817, 0.98823529481887817),
(0.99494951963424683, 0.99215686321258545, 0.99215686321258545), (1.0,
0.99607843160629272, 0.99607843160629272)]}
_gist_rainbow_data = {'blue':
[(0.0, 0.16470588743686676, 0.16470588743686676), (0.0042016808874905109,
0.14117647707462311, 0.14117647707462311), (0.0084033617749810219,
0.12156862765550613, 0.12156862765550613), (0.012605042196810246,
0.10196078568696976, 0.10196078568696976), (0.016806723549962044,
0.078431375324726105, 0.078431375324726105), (0.021008403971791267,
0.058823529630899429, 0.058823529630899429), (0.025210084393620491,
0.039215687662363052, 0.039215687662363052), (0.029411764815449715,
0.015686275437474251, 0.015686275437474251), (0.033613447099924088, 0.0,
0.0), (0.037815127521753311, 0.0, 0.0), (0.042016807943582535, 0.0, 0.0),
(0.046218488365411758, 0.0, 0.0), (0.050420168787240982, 0.0, 0.0),
(0.054621849209070206, 0.0, 0.0), (0.058823529630899429, 0.0, 0.0),
(0.063025213778018951, 0.0, 0.0), (0.067226894199848175, 0.0, 0.0),
(0.071428574621677399, 0.0, 0.0), (0.075630255043506622, 0.0, 0.0),
(0.079831935465335846, 0.0, 0.0), (0.08403361588716507, 0.0, 0.0),
(0.088235296308994293, 0.0, 0.0), (0.092436976730823517, 0.0, 0.0),
(0.09663865715265274, 0.0, 0.0), (0.10084033757448196, 0.0, 0.0),
(0.10504201799631119, 0.0, 0.0), (0.10924369841814041, 0.0, 0.0),
(0.11344537883996964, 0.0, 0.0), (0.11764705926179886, 0.0, 0.0),
(0.12184873968362808, 0.0, 0.0), (0.1260504275560379, 0.0, 0.0),
(0.13025210797786713, 0.0, 0.0), (0.13445378839969635, 0.0, 0.0),
(0.13865546882152557, 0.0, 0.0), (0.1428571492433548, 0.0, 0.0),
(0.14705882966518402, 0.0, 0.0), (0.15126051008701324, 0.0, 0.0),
(0.15546219050884247, 0.0, 0.0), (0.15966387093067169, 0.0, 0.0),
(0.16386555135250092, 0.0, 0.0), (0.16806723177433014, 0.0, 0.0),
(0.17226891219615936, 0.0, 0.0), (0.17647059261798859, 0.0, 0.0),
(0.18067227303981781, 0.0, 0.0), (0.18487395346164703, 0.0, 0.0),
(0.18907563388347626, 0.0, 0.0), (0.19327731430530548, 0.0, 0.0),
(0.1974789947271347, 0.0, 0.0), (0.20168067514896393, 0.0, 0.0),
(0.20588235557079315, 0.0, 0.0), (0.21008403599262238, 0.0, 0.0),
(0.2142857164144516, 0.0, 0.0), (0.21848739683628082, 0.0, 0.0),
(0.22268907725811005, 0.0, 0.0), (0.22689075767993927, 0.0, 0.0),
(0.23109243810176849, 0.0, 0.0), (0.23529411852359772, 0.0, 0.0),
(0.23949579894542694, 0.0, 0.0), (0.24369747936725616, 0.0, 0.0),
(0.24789915978908539, 0.0, 0.0), (0.25210085511207581, 0.0, 0.0),
(0.25630253553390503, 0.0, 0.0), (0.26050421595573425, 0.0, 0.0),
(0.26470589637756348, 0.0, 0.0), (0.2689075767993927, 0.0, 0.0),
(0.27310925722122192, 0.0, 0.0), (0.27731093764305115, 0.0, 0.0),
(0.28151261806488037, 0.0, 0.0), (0.28571429848670959, 0.0, 0.0),
(0.28991597890853882, 0.0, 0.0), (0.29411765933036804, 0.0, 0.0),
(0.29831933975219727, 0.0, 0.0), (0.30252102017402649, 0.0, 0.0),
(0.30672270059585571, 0.0, 0.0), (0.31092438101768494, 0.0, 0.0),
(0.31512606143951416, 0.0, 0.0), (0.31932774186134338, 0.0, 0.0),
(0.32352942228317261, 0.0, 0.0), (0.32773110270500183, 0.0, 0.0),
(0.33193278312683105, 0.0, 0.0), (0.33613446354866028, 0.0, 0.0),
(0.3403361439704895, 0.0, 0.0), (0.34453782439231873, 0.0, 0.0),
(0.34873950481414795, 0.0, 0.0), (0.35294118523597717, 0.0, 0.0),
(0.3571428656578064, 0.0, 0.0), (0.36134454607963562, 0.0, 0.0),
(0.36554622650146484, 0.0, 0.0), (0.36974790692329407, 0.0, 0.0),
(0.37394958734512329, 0.0, 0.0), (0.37815126776695251, 0.0, 0.0),
(0.38235294818878174, 0.0, 0.0), (0.38655462861061096, 0.0, 0.0),
(0.39075630903244019, 0.0, 0.0), (0.39495798945426941, 0.0, 0.0),
(0.39915966987609863, 0.0, 0.0), (0.40336135029792786, 0.0, 0.0),
(0.40756303071975708, 0.0039215688593685627, 0.0039215688593685627),
(0.4117647111415863, 0.047058824449777603, 0.047058824449777603),
(0.41596639156341553, 0.066666670143604279, 0.066666670143604279),
(0.42016807198524475, 0.090196080505847931, 0.090196080505847931),
(0.42436975240707397, 0.10980392247438431, 0.10980392247438431),
(0.4285714328289032, 0.12941177189350128, 0.12941177189350128),
(0.43277311325073242, 0.15294118225574493, 0.15294118225574493),
(0.43697479367256165, 0.17254902422428131, 0.17254902422428131),
(0.44117647409439087, 0.19215686619281769, 0.19215686619281769),
(0.44537815451622009, 0.21568627655506134, 0.21568627655506134),
(0.44957983493804932, 0.23529411852359772, 0.23529411852359772),
(0.45378151535987854, 0.25882354378700256, 0.25882354378700256),
(0.45798319578170776, 0.27843138575553894, 0.27843138575553894),
(0.46218487620353699, 0.29803922772407532, 0.29803922772407532),
(0.46638655662536621, 0.32156863808631897, 0.32156863808631897),
(0.47058823704719543, 0.34117648005485535, 0.34117648005485535),
(0.47478991746902466, 0.38431373238563538, 0.38431373238563538),
(0.47899159789085388, 0.40392157435417175, 0.40392157435417175),
(0.48319327831268311, 0.42745098471641541, 0.42745098471641541),
(0.48739495873451233, 0.44705882668495178, 0.44705882668495178),
(0.49159663915634155, 0.46666666865348816, 0.46666666865348816),
(0.49579831957817078, 0.49019607901573181, 0.49019607901573181), (0.5,
0.50980395078659058, 0.50980395078659058), (0.50420171022415161,
0.52941179275512695, 0.52941179275512695), (0.50840336084365845,
0.55294120311737061, 0.55294120311737061), (0.51260507106781006,
0.57254904508590698, 0.57254904508590698), (0.51680672168731689,
0.59607845544815063, 0.59607845544815063), (0.52100843191146851,
0.61568629741668701, 0.61568629741668701), (0.52521008253097534,
0.63529413938522339, 0.63529413938522339), (0.52941179275512695,
0.65882354974746704, 0.65882354974746704), (0.53361344337463379,
0.67843139171600342, 0.67843139171600342), (0.5378151535987854,
0.72156864404678345, 0.72156864404678345), (0.54201680421829224,
0.74117648601531982, 0.74117648601531982), (0.54621851444244385,
0.76470589637756348, 0.76470589637756348), (0.55042016506195068,
0.78431373834609985, 0.78431373834609985), (0.55462187528610229,
0.80392158031463623, 0.80392158031463623), (0.55882352590560913,
0.82745099067687988, 0.82745099067687988), (0.56302523612976074,
0.84705883264541626, 0.84705883264541626), (0.56722688674926758,
0.87058824300765991, 0.87058824300765991), (0.57142859697341919,
0.89019608497619629, 0.89019608497619629), (0.57563024759292603,
0.90980392694473267, 0.90980392694473267), (0.57983195781707764,
0.93333333730697632, 0.93333333730697632), (0.58403360843658447,
0.9529411792755127, 0.9529411792755127), (0.58823531866073608,
0.97254902124404907, 0.97254902124404907), (0.59243696928024292,
0.99607843160629272, 0.99607843160629272), (0.59663867950439453, 1.0,
1.0), (0.60084033012390137, 1.0, 1.0), (0.60504204034805298, 1.0, 1.0),
(0.60924369096755981, 1.0, 1.0), (0.61344540119171143, 1.0, 1.0),
(0.61764705181121826, 1.0, 1.0), (0.62184876203536987, 1.0, 1.0),
(0.62605041265487671, 1.0, 1.0), (0.63025212287902832, 1.0, 1.0),
(0.63445377349853516, 1.0, 1.0), (0.63865548372268677, 1.0, 1.0),
(0.6428571343421936, 1.0, 1.0), (0.64705884456634521, 1.0, 1.0),
(0.65126049518585205, 1.0, 1.0), (0.65546220541000366, 1.0, 1.0),
(0.6596638560295105, 1.0, 1.0), (0.66386556625366211, 1.0, 1.0),
(0.66806721687316895, 1.0, 1.0), (0.67226892709732056, 1.0, 1.0),
(0.67647057771682739, 1.0, 1.0), (0.680672287940979, 1.0, 1.0),
(0.68487393856048584, 1.0, 1.0), (0.68907564878463745, 1.0, 1.0),
(0.69327729940414429, 1.0, 1.0), (0.6974790096282959, 1.0, 1.0),
(0.70168066024780273, 1.0, 1.0), (0.70588237047195435, 1.0, 1.0),
(0.71008402109146118, 1.0, 1.0), (0.71428573131561279, 1.0, 1.0),
(0.71848738193511963, 1.0, 1.0), (0.72268909215927124, 1.0, 1.0),
(0.72689074277877808, 1.0, 1.0), (0.73109245300292969, 1.0, 1.0),
(0.73529410362243652, 1.0, 1.0), (0.73949581384658813, 1.0, 1.0),
(0.74369746446609497, 1.0, 1.0), (0.74789917469024658, 1.0, 1.0),
(0.75210082530975342, 1.0, 1.0), (0.75630253553390503, 1.0, 1.0),
(0.76050418615341187, 1.0, 1.0), (0.76470589637756348, 1.0, 1.0),
(0.76890754699707031, 1.0, 1.0), (0.77310925722122192, 1.0, 1.0),
(0.77731090784072876, 1.0, 1.0), (0.78151261806488037, 1.0, 1.0),
(0.78571426868438721, 1.0, 1.0), (0.78991597890853882, 1.0, 1.0),
(0.79411762952804565, 1.0, 1.0), (0.79831933975219727, 1.0, 1.0),
(0.8025209903717041, 1.0, 1.0), (0.80672270059585571, 1.0, 1.0),
(0.81092435121536255, 1.0, 1.0), (0.81512606143951416, 1.0, 1.0),
(0.819327712059021, 1.0, 1.0), (0.82352942228317261, 1.0, 1.0),
(0.82773107290267944, 1.0, 1.0), (0.83193278312683105, 1.0, 1.0),
(0.83613443374633789, 1.0, 1.0), (0.8403361439704895, 1.0, 1.0),
(0.84453779458999634, 1.0, 1.0), (0.84873950481414795, 1.0, 1.0),
(0.85294115543365479, 1.0, 1.0), (0.8571428656578064, 1.0, 1.0),
(0.86134451627731323, 1.0, 1.0), (0.86554622650146484, 1.0, 1.0),
(0.86974787712097168, 1.0, 1.0), (0.87394958734512329, 1.0, 1.0),
(0.87815123796463013, 1.0, 1.0), (0.88235294818878174, 1.0, 1.0),
(0.88655459880828857, 1.0, 1.0), (0.89075630903244019, 1.0, 1.0),
(0.89495795965194702, 1.0, 1.0), (0.89915966987609863, 1.0, 1.0),
(0.90336132049560547, 1.0, 1.0), (0.90756303071975708, 1.0, 1.0),
(0.91176468133926392, 1.0, 1.0), (0.91596639156341553, 1.0, 1.0),
(0.92016804218292236, 1.0, 1.0), (0.92436975240707397, 1.0, 1.0),
(0.92857140302658081, 1.0, 1.0), (0.93277311325073242, 1.0, 1.0),
(0.93697476387023926, 1.0, 1.0), (0.94117647409439087, 1.0, 1.0),
(0.94537812471389771, 1.0, 1.0), (0.94957983493804932, 1.0, 1.0),
(0.95378148555755615, 1.0, 1.0), (0.95798319578170776, 1.0, 1.0),
(0.9621848464012146, 1.0, 1.0), (0.96638655662536621, 0.99607843160629272,
0.99607843160629272), (0.97058820724487305, 0.97647058963775635,
0.97647058963775635), (0.97478991746902466, 0.9529411792755127,
0.9529411792755127), (0.97899156808853149, 0.91372549533843994,
0.91372549533843994), (0.98319327831268311, 0.89019608497619629,
0.89019608497619629), (0.98739492893218994, 0.87058824300765991,
0.87058824300765991), (0.99159663915634155, 0.85098040103912354,
0.85098040103912354), (0.99579828977584839, 0.82745099067687988,
0.82745099067687988), (1.0, 0.80784314870834351, 0.80784314870834351)],
'green': [(0.0, 0.0, 0.0), (0.0042016808874905109, 0.0, 0.0),
(0.0084033617749810219, 0.0, 0.0), (0.012605042196810246, 0.0, 0.0),
(0.016806723549962044, 0.0, 0.0), (0.021008403971791267, 0.0, 0.0),
(0.025210084393620491, 0.0, 0.0), (0.029411764815449715, 0.0, 0.0),
(0.033613447099924088, 0.019607843831181526, 0.019607843831181526),
(0.037815127521753311, 0.043137256056070328, 0.043137256056070328),
(0.042016807943582535, 0.062745101749897003, 0.062745101749897003),
(0.046218488365411758, 0.086274512112140656, 0.086274512112140656),
(0.050420168787240982, 0.10588235408067703, 0.10588235408067703),
(0.054621849209070206, 0.12549020349979401, 0.12549020349979401),
(0.058823529630899429, 0.14901961386203766, 0.14901961386203766),
(0.063025213778018951, 0.16862745583057404, 0.16862745583057404),
(0.067226894199848175, 0.18823529779911041, 0.18823529779911041),
(0.071428574621677399, 0.21176470816135406, 0.21176470816135406),
(0.075630255043506622, 0.23137255012989044, 0.23137255012989044),
(0.079831935465335846, 0.25490197539329529, 0.25490197539329529),
(0.08403361588716507, 0.27450981736183167, 0.27450981736183167),
(0.088235296308994293, 0.29411765933036804, 0.29411765933036804),
(0.092436976730823517, 0.31764706969261169, 0.31764706969261169),
(0.09663865715265274, 0.35686275362968445, 0.35686275362968445),
(0.10084033757448196, 0.3803921639919281, 0.3803921639919281),
(0.10504201799631119, 0.40000000596046448, 0.40000000596046448),
(0.10924369841814041, 0.42352941632270813, 0.42352941632270813),
(0.11344537883996964, 0.44313725829124451, 0.44313725829124451),
(0.11764705926179886, 0.46274510025978088, 0.46274510025978088),
(0.12184873968362808, 0.48627451062202454, 0.48627451062202454),
(0.1260504275560379, 0.5058823823928833, 0.5058823823928833),
(0.13025210797786713, 0.52941179275512695, 0.52941179275512695),
(0.13445378839969635, 0.54901963472366333, 0.54901963472366333),
(0.13865546882152557, 0.56862747669219971, 0.56862747669219971),
(0.1428571492433548, 0.59215688705444336, 0.59215688705444336),
(0.14705882966518402, 0.61176472902297974, 0.61176472902297974),
(0.15126051008701324, 0.63137257099151611, 0.63137257099151611),
(0.15546219050884247, 0.65490198135375977, 0.65490198135375977),
(0.15966387093067169, 0.69803923368453979, 0.69803923368453979),
(0.16386555135250092, 0.71764707565307617, 0.71764707565307617),
(0.16806723177433014, 0.73725491762161255, 0.73725491762161255),
(0.17226891219615936, 0.7607843279838562, 0.7607843279838562),
(0.17647059261798859, 0.78039216995239258, 0.78039216995239258),
(0.18067227303981781, 0.80000001192092896, 0.80000001192092896),
(0.18487395346164703, 0.82352942228317261, 0.82352942228317261),
(0.18907563388347626, 0.84313726425170898, 0.84313726425170898),
(0.19327731430530548, 0.86666667461395264, 0.86666667461395264),
(0.1974789947271347, 0.88627451658248901, 0.88627451658248901),
(0.20168067514896393, 0.90588235855102539, 0.90588235855102539),
(0.20588235557079315, 0.92941176891326904, 0.92941176891326904),
(0.21008403599262238, 0.94901961088180542, 0.94901961088180542),
(0.2142857164144516, 0.9686274528503418, 0.9686274528503418),
(0.21848739683628082, 0.99215686321258545, 0.99215686321258545),
(0.22268907725811005, 1.0, 1.0), (0.22689075767993927, 1.0, 1.0),
(0.23109243810176849, 1.0, 1.0), (0.23529411852359772, 1.0, 1.0),
(0.23949579894542694, 1.0, 1.0), (0.24369747936725616, 1.0, 1.0),
(0.24789915978908539, 1.0, 1.0), (0.25210085511207581, 1.0, 1.0),
(0.25630253553390503, 1.0, 1.0), (0.26050421595573425, 1.0, 1.0),
(0.26470589637756348, 1.0, 1.0), (0.2689075767993927, 1.0, 1.0),
(0.27310925722122192, 1.0, 1.0), (0.27731093764305115, 1.0, 1.0),
(0.28151261806488037, 1.0, 1.0), (0.28571429848670959, 1.0, 1.0),
(0.28991597890853882, 1.0, 1.0), (0.29411765933036804, 1.0, 1.0),
(0.29831933975219727, 1.0, 1.0), (0.30252102017402649, 1.0, 1.0),
(0.30672270059585571, 1.0, 1.0), (0.31092438101768494, 1.0, 1.0),
(0.31512606143951416, 1.0, 1.0), (0.31932774186134338, 1.0, 1.0),
(0.32352942228317261, 1.0, 1.0), (0.32773110270500183, 1.0, 1.0),
(0.33193278312683105, 1.0, 1.0), (0.33613446354866028, 1.0, 1.0),
(0.3403361439704895, 1.0, 1.0), (0.34453782439231873, 1.0, 1.0),
(0.34873950481414795, 1.0, 1.0), (0.35294118523597717, 1.0, 1.0),
(0.3571428656578064, 1.0, 1.0), (0.36134454607963562, 1.0, 1.0),
(0.36554622650146484, 1.0, 1.0), (0.36974790692329407, 1.0, 1.0),
(0.37394958734512329, 1.0, 1.0), (0.37815126776695251, 1.0, 1.0),
(0.38235294818878174, 1.0, 1.0), (0.38655462861061096, 1.0, 1.0),
(0.39075630903244019, 1.0, 1.0), (0.39495798945426941, 1.0, 1.0),
(0.39915966987609863, 1.0, 1.0), (0.40336135029792786, 1.0, 1.0),
(0.40756303071975708, 1.0, 1.0), (0.4117647111415863, 1.0, 1.0),
(0.41596639156341553, 1.0, 1.0), (0.42016807198524475, 1.0, 1.0),
(0.42436975240707397, 1.0, 1.0), (0.4285714328289032, 1.0, 1.0),
(0.43277311325073242, 1.0, 1.0), (0.43697479367256165, 1.0, 1.0),
(0.44117647409439087, 1.0, 1.0), (0.44537815451622009, 1.0, 1.0),
(0.44957983493804932, 1.0, 1.0), (0.45378151535987854, 1.0, 1.0),
(0.45798319578170776, 1.0, 1.0), (0.46218487620353699, 1.0, 1.0),
(0.46638655662536621, 1.0, 1.0), (0.47058823704719543, 1.0, 1.0),
(0.47478991746902466, 1.0, 1.0), (0.47899159789085388, 1.0, 1.0),
(0.48319327831268311, 1.0, 1.0), (0.48739495873451233, 1.0, 1.0),
(0.49159663915634155, 1.0, 1.0), (0.49579831957817078, 1.0, 1.0), (0.5,
1.0, 1.0), (0.50420171022415161, 1.0, 1.0), (0.50840336084365845, 1.0,
1.0), (0.51260507106781006, 1.0, 1.0), (0.51680672168731689, 1.0, 1.0),
(0.52100843191146851, 1.0, 1.0), (0.52521008253097534, 1.0, 1.0),
(0.52941179275512695, 1.0, 1.0), (0.53361344337463379, 1.0, 1.0),
(0.5378151535987854, 1.0, 1.0), (0.54201680421829224, 1.0, 1.0),
(0.54621851444244385, 1.0, 1.0), (0.55042016506195068, 1.0, 1.0),
(0.55462187528610229, 1.0, 1.0), (0.55882352590560913, 1.0, 1.0),
(0.56302523612976074, 1.0, 1.0), (0.56722688674926758, 1.0, 1.0),
(0.57142859697341919, 1.0, 1.0), (0.57563024759292603, 1.0, 1.0),
(0.57983195781707764, 1.0, 1.0), (0.58403360843658447, 1.0, 1.0),
(0.58823531866073608, 1.0, 1.0), (0.59243696928024292, 1.0, 1.0),
(0.59663867950439453, 0.98039215803146362, 0.98039215803146362),
(0.60084033012390137, 0.93725490570068359, 0.93725490570068359),
(0.60504204034805298, 0.91764706373214722, 0.91764706373214722),
(0.60924369096755981, 0.89411765336990356, 0.89411765336990356),
(0.61344540119171143, 0.87450981140136719, 0.87450981140136719),
(0.61764705181121826, 0.85490196943283081, 0.85490196943283081),
(0.62184876203536987, 0.83137255907058716, 0.83137255907058716),
(0.62605041265487671, 0.81176471710205078, 0.81176471710205078),
(0.63025212287902832, 0.78823530673980713, 0.78823530673980713),
(0.63445377349853516, 0.76862746477127075, 0.76862746477127075),
(0.63865548372268677, 0.74901962280273438, 0.74901962280273438),
(0.6428571343421936, 0.72549021244049072, 0.72549021244049072),
(0.64705884456634521, 0.70588237047195435, 0.70588237047195435),
(0.65126049518585205, 0.68235296010971069, 0.68235296010971069),
(0.65546220541000366, 0.66274511814117432, 0.66274511814117432),
(0.6596638560295105, 0.64313727617263794, 0.64313727617263794),
(0.66386556625366211, 0.60000002384185791, 0.60000002384185791),
(0.66806721687316895, 0.58039218187332153, 0.58039218187332153),
(0.67226892709732056, 0.55686277151107788, 0.55686277151107788),
(0.67647057771682739, 0.5372549295425415, 0.5372549295425415),
(0.680672287940979, 0.51372551918029785, 0.51372551918029785),
(0.68487393856048584, 0.49411764740943909, 0.49411764740943909),
(0.68907564878463745, 0.47450980544090271, 0.47450980544090271),
(0.69327729940414429, 0.45098039507865906, 0.45098039507865906),
(0.6974790096282959, 0.43137255311012268, 0.43137255311012268),
(0.70168066024780273, 0.4117647111415863, 0.4117647111415863),
(0.70588237047195435, 0.38823530077934265, 0.38823530077934265),
(0.71008402109146118, 0.36862745881080627, 0.36862745881080627),
(0.71428573131561279, 0.34509804844856262, 0.34509804844856262),
(0.71848738193511963, 0.32549020648002625, 0.32549020648002625),
(0.72268909215927124, 0.30588236451148987, 0.30588236451148987),
(0.72689074277877808, 0.26274511218070984, 0.26274511218070984),
(0.73109245300292969, 0.24313725531101227, 0.24313725531101227),
(0.73529410362243652, 0.21960784494876862, 0.21960784494876862),
(0.73949581384658813, 0.20000000298023224, 0.20000000298023224),
(0.74369746446609497, 0.17647059261798859, 0.17647059261798859),
(0.74789917469024658, 0.15686275064945221, 0.15686275064945221),
(0.75210082530975342, 0.13725490868091583, 0.13725490868091583),
(0.75630253553390503, 0.11372549086809158, 0.11372549086809158),
(0.76050418615341187, 0.094117648899555206, 0.094117648899555206),
(0.76470589637756348, 0.070588238537311554, 0.070588238537311554),
(0.76890754699707031, 0.050980392843484879, 0.050980392843484879),
(0.77310925722122192, 0.031372550874948502, 0.031372550874948502),
(0.77731090784072876, 0.0078431377187371254, 0.0078431377187371254),
(0.78151261806488037, 0.0, 0.0), (0.78571426868438721, 0.0, 0.0),
(0.78991597890853882, 0.0, 0.0), (0.79411762952804565, 0.0, 0.0),
(0.79831933975219727, 0.0, 0.0), (0.8025209903717041, 0.0, 0.0),
(0.80672270059585571, 0.0, 0.0), (0.81092435121536255, 0.0, 0.0),
(0.81512606143951416, 0.0, 0.0), (0.819327712059021, 0.0, 0.0),
(0.82352942228317261, 0.0, 0.0), (0.82773107290267944, 0.0, 0.0),
(0.83193278312683105, 0.0, 0.0), (0.83613443374633789, 0.0, 0.0),
(0.8403361439704895, 0.0, 0.0), (0.84453779458999634, 0.0, 0.0),
(0.84873950481414795, 0.0, 0.0), (0.85294115543365479, 0.0, 0.0),
(0.8571428656578064, 0.0, 0.0), (0.86134451627731323, 0.0, 0.0),
(0.86554622650146484, 0.0, 0.0), (0.86974787712097168, 0.0, 0.0),
(0.87394958734512329, 0.0, 0.0), (0.87815123796463013, 0.0, 0.0),
(0.88235294818878174, 0.0, 0.0), (0.88655459880828857, 0.0, 0.0),
(0.89075630903244019, 0.0, 0.0), (0.89495795965194702, 0.0, 0.0),
(0.89915966987609863, 0.0, 0.0), (0.90336132049560547, 0.0, 0.0),
(0.90756303071975708, 0.0, 0.0), (0.91176468133926392, 0.0, 0.0),
(0.91596639156341553, 0.0, 0.0), (0.92016804218292236, 0.0, 0.0),
(0.92436975240707397, 0.0, 0.0), (0.92857140302658081, 0.0, 0.0),
(0.93277311325073242, 0.0, 0.0), (0.93697476387023926, 0.0, 0.0),
(0.94117647409439087, 0.0, 0.0), (0.94537812471389771, 0.0, 0.0),
(0.94957983493804932, 0.0, 0.0), (0.95378148555755615, 0.0, 0.0),
(0.95798319578170776, 0.0, 0.0), (0.9621848464012146, 0.0, 0.0),
(0.96638655662536621, 0.0, 0.0), (0.97058820724487305, 0.0, 0.0),
(0.97478991746902466, 0.0, 0.0), (0.97899156808853149, 0.0, 0.0),
(0.98319327831268311, 0.0, 0.0), (0.98739492893218994, 0.0, 0.0),
(0.99159663915634155, 0.0, 0.0), (0.99579828977584839, 0.0, 0.0), (1.0,
0.0, 0.0)], 'red': [(0.0, 1.0, 1.0), (0.0042016808874905109, 1.0, 1.0),
(0.0084033617749810219, 1.0, 1.0), (0.012605042196810246, 1.0, 1.0),
(0.016806723549962044, 1.0, 1.0), (0.021008403971791267, 1.0, 1.0),
(0.025210084393620491, 1.0, 1.0), (0.029411764815449715, 1.0, 1.0),
(0.033613447099924088, 1.0, 1.0), (0.037815127521753311, 1.0, 1.0),
(0.042016807943582535, 1.0, 1.0), (0.046218488365411758, 1.0, 1.0),
(0.050420168787240982, 1.0, 1.0), (0.054621849209070206, 1.0, 1.0),
(0.058823529630899429, 1.0, 1.0), (0.063025213778018951, 1.0, 1.0),
(0.067226894199848175, 1.0, 1.0), (0.071428574621677399, 1.0, 1.0),
(0.075630255043506622, 1.0, 1.0), (0.079831935465335846, 1.0, 1.0),
(0.08403361588716507, 1.0, 1.0), (0.088235296308994293, 1.0, 1.0),
(0.092436976730823517, 1.0, 1.0), (0.09663865715265274, 1.0, 1.0),
(0.10084033757448196, 1.0, 1.0), (0.10504201799631119, 1.0, 1.0),
(0.10924369841814041, 1.0, 1.0), (0.11344537883996964, 1.0, 1.0),
(0.11764705926179886, 1.0, 1.0), (0.12184873968362808, 1.0, 1.0),
(0.1260504275560379, 1.0, 1.0), (0.13025210797786713, 1.0, 1.0),
(0.13445378839969635, 1.0, 1.0), (0.13865546882152557, 1.0, 1.0),
(0.1428571492433548, 1.0, 1.0), (0.14705882966518402, 1.0, 1.0),
(0.15126051008701324, 1.0, 1.0), (0.15546219050884247, 1.0, 1.0),
(0.15966387093067169, 1.0, 1.0), (0.16386555135250092, 1.0, 1.0),
(0.16806723177433014, 1.0, 1.0), (0.17226891219615936, 1.0, 1.0),
(0.17647059261798859, 1.0, 1.0), (0.18067227303981781, 1.0, 1.0),
(0.18487395346164703, 1.0, 1.0), (0.18907563388347626, 1.0, 1.0),
(0.19327731430530548, 1.0, 1.0), (0.1974789947271347, 1.0, 1.0),
(0.20168067514896393, 1.0, 1.0), (0.20588235557079315, 1.0, 1.0),
(0.21008403599262238, 1.0, 1.0), (0.2142857164144516, 1.0, 1.0),
(0.21848739683628082, 1.0, 1.0), (0.22268907725811005,
0.96078431606292725, 0.96078431606292725), (0.22689075767993927,
0.94117647409439087, 0.94117647409439087), (0.23109243810176849,
0.92156863212585449, 0.92156863212585449), (0.23529411852359772,
0.89803922176361084, 0.89803922176361084), (0.23949579894542694,
0.87843137979507446, 0.87843137979507446), (0.24369747936725616,
0.85882353782653809, 0.85882353782653809), (0.24789915978908539,
0.83529412746429443, 0.83529412746429443), (0.25210085511207581,
0.81568628549575806, 0.81568628549575806), (0.25630253553390503,
0.7921568751335144, 0.7921568751335144), (0.26050421595573425,
0.77254903316497803, 0.77254903316497803), (0.26470589637756348,
0.75294119119644165, 0.75294119119644165), (0.2689075767993927,
0.729411780834198, 0.729411780834198), (0.27310925722122192,
0.70980393886566162, 0.70980393886566162), (0.27731093764305115,
0.68627452850341797, 0.68627452850341797), (0.28151261806488037,
0.66666668653488159, 0.66666668653488159), (0.28571429848670959,
0.62352943420410156, 0.62352943420410156), (0.28991597890853882,
0.60392159223556519, 0.60392159223556519), (0.29411765933036804,
0.58431375026702881, 0.58431375026702881), (0.29831933975219727,
0.56078433990478516, 0.56078433990478516), (0.30252102017402649,
0.54117649793624878, 0.54117649793624878), (0.30672270059585571,
0.51764708757400513, 0.51764708757400513), (0.31092438101768494,
0.49803921580314636, 0.49803921580314636), (0.31512606143951416,
0.47843137383460999, 0.47843137383460999), (0.31932774186134338,
0.45490196347236633, 0.45490196347236633), (0.32352942228317261,
0.43529412150382996, 0.43529412150382996), (0.32773110270500183,
0.41568627953529358, 0.41568627953529358), (0.33193278312683105,
0.39215686917304993, 0.39215686917304993), (0.33613446354866028,
0.37254902720451355, 0.37254902720451355), (0.3403361439704895,
0.3490196168422699, 0.3490196168422699), (0.34453782439231873,
0.32941177487373352, 0.32941177487373352), (0.34873950481414795,
0.28627452254295349, 0.28627452254295349), (0.35294118523597717,
0.26666668057441711, 0.26666668057441711), (0.3571428656578064,
0.24705882370471954, 0.24705882370471954), (0.36134454607963562,
0.22352941334247589, 0.22352941334247589), (0.36554622650146484,
0.20392157137393951, 0.20392157137393951), (0.36974790692329407,
0.18039216101169586, 0.18039216101169586), (0.37394958734512329,
0.16078431904315948, 0.16078431904315948), (0.37815126776695251,
0.14117647707462311, 0.14117647707462311), (0.38235294818878174,
0.11764705926179886, 0.11764705926179886), (0.38655462861061096,
0.098039217293262482, 0.098039217293262482), (0.39075630903244019,
0.074509806931018829, 0.074509806931018829), (0.39495798945426941,
0.054901961237192154, 0.054901961237192154), (0.39915966987609863,
0.035294119268655777, 0.035294119268655777), (0.40336135029792786,
0.011764706112444401, 0.011764706112444401), (0.40756303071975708, 0.0,
0.0), (0.4117647111415863, 0.0, 0.0), (0.41596639156341553, 0.0, 0.0),
(0.42016807198524475, 0.0, 0.0), (0.42436975240707397, 0.0, 0.0),
(0.4285714328289032, 0.0, 0.0), (0.43277311325073242, 0.0, 0.0),
(0.43697479367256165, 0.0, 0.0), (0.44117647409439087, 0.0, 0.0),
(0.44537815451622009, 0.0, 0.0), (0.44957983493804932, 0.0, 0.0),
(0.45378151535987854, 0.0, 0.0), (0.45798319578170776, 0.0, 0.0),
(0.46218487620353699, 0.0, 0.0), (0.46638655662536621, 0.0, 0.0),
(0.47058823704719543, 0.0, 0.0), (0.47478991746902466, 0.0, 0.0),
(0.47899159789085388, 0.0, 0.0), (0.48319327831268311, 0.0, 0.0),
(0.48739495873451233, 0.0, 0.0), (0.49159663915634155, 0.0, 0.0),
(0.49579831957817078, 0.0, 0.0), (0.5, 0.0, 0.0), (0.50420171022415161,
0.0, 0.0), (0.50840336084365845, 0.0, 0.0), (0.51260507106781006, 0.0,
0.0), (0.51680672168731689, 0.0, 0.0), (0.52100843191146851, 0.0, 0.0),
(0.52521008253097534, 0.0, 0.0), (0.52941179275512695, 0.0, 0.0),
(0.53361344337463379, 0.0, 0.0), (0.5378151535987854, 0.0, 0.0),
(0.54201680421829224, 0.0, 0.0), (0.54621851444244385, 0.0, 0.0),
(0.55042016506195068, 0.0, 0.0), (0.55462187528610229, 0.0, 0.0),
(0.55882352590560913, 0.0, 0.0), (0.56302523612976074, 0.0, 0.0),
(0.56722688674926758, 0.0, 0.0), (0.57142859697341919, 0.0, 0.0),
(0.57563024759292603, 0.0, 0.0), (0.57983195781707764, 0.0, 0.0),
(0.58403360843658447, 0.0, 0.0), (0.58823531866073608, 0.0, 0.0),
(0.59243696928024292, 0.0, 0.0), (0.59663867950439453, 0.0, 0.0),
(0.60084033012390137, 0.0, 0.0), (0.60504204034805298, 0.0, 0.0),
(0.60924369096755981, 0.0, 0.0), (0.61344540119171143, 0.0, 0.0),
(0.61764705181121826, 0.0, 0.0), (0.62184876203536987, 0.0, 0.0),
(0.62605041265487671, 0.0, 0.0), (0.63025212287902832, 0.0, 0.0),
(0.63445377349853516, 0.0, 0.0), (0.63865548372268677, 0.0, 0.0),
(0.6428571343421936, 0.0, 0.0), (0.64705884456634521, 0.0, 0.0),
(0.65126049518585205, 0.0, 0.0), (0.65546220541000366, 0.0, 0.0),
(0.6596638560295105, 0.0, 0.0), (0.66386556625366211, 0.0, 0.0),
(0.66806721687316895, 0.0, 0.0), (0.67226892709732056, 0.0, 0.0),
(0.67647057771682739, 0.0, 0.0), (0.680672287940979, 0.0, 0.0),
(0.68487393856048584, 0.0, 0.0), (0.68907564878463745, 0.0, 0.0),
(0.69327729940414429, 0.0, 0.0), (0.6974790096282959, 0.0, 0.0),
(0.70168066024780273, 0.0, 0.0), (0.70588237047195435, 0.0, 0.0),
(0.71008402109146118, 0.0, 0.0), (0.71428573131561279, 0.0, 0.0),
(0.71848738193511963, 0.0, 0.0), (0.72268909215927124, 0.0, 0.0),
(0.72689074277877808, 0.0, 0.0), (0.73109245300292969, 0.0, 0.0),
(0.73529410362243652, 0.0, 0.0), (0.73949581384658813, 0.0, 0.0),
(0.74369746446609497, 0.0, 0.0), (0.74789917469024658, 0.0, 0.0),
(0.75210082530975342, 0.0, 0.0), (0.75630253553390503, 0.0, 0.0),
(0.76050418615341187, 0.0, 0.0), (0.76470589637756348, 0.0, 0.0),
(0.76890754699707031, 0.0, 0.0), (0.77310925722122192, 0.0, 0.0),
(0.77731090784072876, 0.0, 0.0), (0.78151261806488037,
0.0078431377187371254, 0.0078431377187371254), (0.78571426868438721,
0.027450980618596077, 0.027450980618596077), (0.78991597890853882,
0.070588238537311554, 0.070588238537311554), (0.79411762952804565,
0.094117648899555206, 0.094117648899555206), (0.79831933975219727,
0.11372549086809158, 0.11372549086809158), (0.8025209903717041,
0.13333334028720856, 0.13333334028720856), (0.80672270059585571,
0.15686275064945221, 0.15686275064945221), (0.81092435121536255,
0.17647059261798859, 0.17647059261798859), (0.81512606143951416,
0.19607843458652496, 0.19607843458652496), (0.819327712059021,
0.21960784494876862, 0.21960784494876862), (0.82352942228317261,
0.23921568691730499, 0.23921568691730499), (0.82773107290267944,
0.26274511218070984, 0.26274511218070984), (0.83193278312683105,
0.28235295414924622, 0.28235295414924622), (0.83613443374633789,
0.30196079611778259, 0.30196079611778259), (0.8403361439704895,
0.32549020648002625, 0.32549020648002625), (0.84453779458999634,
0.34509804844856262, 0.34509804844856262), (0.84873950481414795,
0.364705890417099, 0.364705890417099), (0.85294115543365479,
0.40784314274787903, 0.40784314274787903), (0.8571428656578064,
0.43137255311012268, 0.43137255311012268), (0.86134451627731323,
0.45098039507865906, 0.45098039507865906), (0.86554622650146484,
0.47058823704719543, 0.47058823704719543), (0.86974787712097168,
0.49411764740943909, 0.49411764740943909), (0.87394958734512329,
0.51372551918029785, 0.51372551918029785), (0.87815123796463013,
0.53333336114883423, 0.53333336114883423), (0.88235294818878174,
0.55686277151107788, 0.55686277151107788), (0.88655459880828857,
0.57647061347961426, 0.57647061347961426), (0.89075630903244019,
0.60000002384185791, 0.60000002384185791), (0.89495795965194702,
0.61960786581039429, 0.61960786581039429), (0.89915966987609863,
0.63921570777893066, 0.63921570777893066), (0.90336132049560547,
0.66274511814117432, 0.66274511814117432), (0.90756303071975708,
0.68235296010971069, 0.68235296010971069), (0.91176468133926392,
0.70588237047195435, 0.70588237047195435), (0.91596639156341553,
0.7450980544090271, 0.7450980544090271), (0.92016804218292236,
0.76862746477127075, 0.76862746477127075), (0.92436975240707397,
0.78823530673980713, 0.78823530673980713), (0.92857140302658081,
0.80784314870834351, 0.80784314870834351), (0.93277311325073242,
0.83137255907058716, 0.83137255907058716), (0.93697476387023926,
0.85098040103912354, 0.85098040103912354), (0.94117647409439087,
0.87450981140136719, 0.87450981140136719), (0.94537812471389771,
0.89411765336990356, 0.89411765336990356), (0.94957983493804932,
0.91372549533843994, 0.91372549533843994), (0.95378148555755615,
0.93725490570068359, 0.93725490570068359), (0.95798319578170776,
0.95686274766921997, 0.95686274766921997), (0.9621848464012146,
0.97647058963775635, 0.97647058963775635), (0.96638655662536621, 1.0,
1.0), (0.97058820724487305, 1.0, 1.0), (0.97478991746902466, 1.0, 1.0),
(0.97899156808853149, 1.0, 1.0), (0.98319327831268311, 1.0, 1.0),
(0.98739492893218994, 1.0, 1.0), (0.99159663915634155, 1.0, 1.0),
(0.99579828977584839, 1.0, 1.0), (1.0, 1.0, 1.0)]}
_gist_stern_data = {'blue': [(0.0, 0.0, 0.0),
(0.0042016808874905109, 0.0039215688593685627,
0.0039215688593685627), (0.0084033617749810219, 0.011764706112444401,
0.011764706112444401), (0.012605042196810246, 0.019607843831181526,
0.019607843831181526), (0.016806723549962044, 0.027450980618596077,
0.027450980618596077), (0.021008403971791267, 0.035294119268655777,
0.035294119268655777), (0.025210084393620491, 0.043137256056070328,
0.043137256056070328), (0.029411764815449715, 0.050980392843484879,
0.050980392843484879), (0.033613447099924088, 0.058823529630899429,
0.058823529630899429), (0.037815127521753311, 0.066666670143604279,
0.066666670143604279), (0.042016807943582535, 0.08235294371843338,
0.08235294371843338), (0.046218488365411758, 0.090196080505847931,
0.090196080505847931), (0.050420168787240982, 0.098039217293262482,
0.098039217293262482), (0.054621849209070206, 0.10588235408067703,
0.10588235408067703), (0.058823529630899429, 0.11372549086809158,
0.11372549086809158), (0.063025213778018951, 0.12156862765550613,
0.12156862765550613), (0.067226894199848175, 0.12941177189350128,
0.12941177189350128), (0.071428574621677399, 0.13725490868091583,
0.13725490868091583), (0.075630255043506622, 0.14509804546833038,
0.14509804546833038), (0.079831935465335846, 0.15294118225574493,
0.15294118225574493), (0.08403361588716507, 0.16078431904315948,
0.16078431904315948), (0.088235296308994293, 0.16862745583057404,
0.16862745583057404), (0.092436976730823517, 0.17647059261798859,
0.17647059261798859), (0.09663865715265274, 0.18431372940540314,
0.18431372940540314), (0.10084033757448196, 0.19215686619281769,
0.19215686619281769), (0.10504201799631119, 0.20000000298023224,
0.20000000298023224), (0.10924369841814041, 0.20784313976764679,
0.20784313976764679), (0.11344537883996964, 0.21568627655506134,
0.21568627655506134), (0.11764705926179886, 0.22352941334247589,
0.22352941334247589), (0.12184873968362808, 0.23137255012989044,
0.23137255012989044), (0.1260504275560379, 0.24705882370471954,
0.24705882370471954), (0.13025210797786713, 0.25490197539329529,
0.25490197539329529), (0.13445378839969635, 0.26274511218070984,
0.26274511218070984), (0.13865546882152557, 0.27058824896812439,
0.27058824896812439), (0.1428571492433548, 0.27843138575553894,
0.27843138575553894), (0.14705882966518402, 0.28627452254295349,
0.28627452254295349), (0.15126051008701324, 0.29411765933036804,
0.29411765933036804), (0.15546219050884247, 0.30196079611778259,
0.30196079611778259), (0.15966387093067169, 0.30980393290519714,
0.30980393290519714), (0.16386555135250092, 0.31764706969261169,
0.31764706969261169), (0.16806723177433014, 0.32549020648002625,
0.32549020648002625), (0.17226891219615936, 0.3333333432674408,
0.3333333432674408), (0.17647059261798859, 0.34117648005485535,
0.34117648005485535), (0.18067227303981781, 0.3490196168422699,
0.3490196168422699), (0.18487395346164703, 0.35686275362968445,
0.35686275362968445), (0.18907563388347626, 0.364705890417099,
0.364705890417099), (0.19327731430530548, 0.37254902720451355,
0.37254902720451355), (0.1974789947271347, 0.3803921639919281,
0.3803921639919281), (0.20168067514896393, 0.38823530077934265,
0.38823530077934265), (0.20588235557079315, 0.3960784375667572,
0.3960784375667572), (0.21008403599262238, 0.4117647111415863,
0.4117647111415863), (0.2142857164144516, 0.41960784792900085,
0.41960784792900085), (0.21848739683628082, 0.42745098471641541,
0.42745098471641541), (0.22268907725811005, 0.43529412150382996,
0.43529412150382996), (0.22689075767993927, 0.44313725829124451,
0.44313725829124451), (0.23109243810176849, 0.45098039507865906,
0.45098039507865906), (0.23529411852359772, 0.45882353186607361,
0.45882353186607361), (0.23949579894542694, 0.46666666865348816,
0.46666666865348816), (0.24369747936725616, 0.47450980544090271,
0.47450980544090271), (0.24789915978908539, 0.48235294222831726,
0.48235294222831726), (0.25210085511207581, 0.49803921580314636,
0.49803921580314636), (0.25630253553390503, 0.5058823823928833,
0.5058823823928833), (0.26050421595573425, 0.51372551918029785,
0.51372551918029785), (0.26470589637756348, 0.5215686559677124,
0.5215686559677124), (0.2689075767993927, 0.52941179275512695,
0.52941179275512695), (0.27310925722122192, 0.5372549295425415,
0.5372549295425415), (0.27731093764305115, 0.54509806632995605,
0.54509806632995605), (0.28151261806488037, 0.55294120311737061,
0.55294120311737061), (0.28571429848670959, 0.56078433990478516,
0.56078433990478516), (0.28991597890853882, 0.56862747669219971,
0.56862747669219971), (0.29411765933036804, 0.58431375026702881,
0.58431375026702881), (0.29831933975219727, 0.59215688705444336,
0.59215688705444336), (0.30252102017402649, 0.60000002384185791,
0.60000002384185791), (0.30672270059585571, 0.60784316062927246,
0.60784316062927246), (0.31092438101768494, 0.61568629741668701,
0.61568629741668701), (0.31512606143951416, 0.62352943420410156,
0.62352943420410156), (0.31932774186134338, 0.63137257099151611,
0.63137257099151611), (0.32352942228317261, 0.63921570777893066,
0.63921570777893066), (0.32773110270500183, 0.64705884456634521,
0.64705884456634521), (0.33193278312683105, 0.65490198135375977,
0.65490198135375977), (0.33613446354866028, 0.66274511814117432,
0.66274511814117432), (0.3403361439704895, 0.67058825492858887,
0.67058825492858887), (0.34453782439231873, 0.67843139171600342,
0.67843139171600342), (0.34873950481414795, 0.68627452850341797,
0.68627452850341797), (0.35294118523597717, 0.69411766529083252,
0.69411766529083252), (0.3571428656578064, 0.70196080207824707,
0.70196080207824707), (0.36134454607963562, 0.70980393886566162,
0.70980393886566162), (0.36554622650146484, 0.71764707565307617,
0.71764707565307617), (0.36974790692329407, 0.72549021244049072,
0.72549021244049072), (0.37394958734512329, 0.73333334922790527,
0.73333334922790527), (0.37815126776695251, 0.74901962280273438,
0.74901962280273438), (0.38235294818878174, 0.75686275959014893,
0.75686275959014893), (0.38655462861061096, 0.76470589637756348,
0.76470589637756348), (0.39075630903244019, 0.77254903316497803,
0.77254903316497803), (0.39495798945426941, 0.78039216995239258,
0.78039216995239258), (0.39915966987609863, 0.78823530673980713,
0.78823530673980713), (0.40336135029792786, 0.79607844352722168,
0.79607844352722168), (0.40756303071975708, 0.80392158031463623,
0.80392158031463623), (0.4117647111415863, 0.81176471710205078,
0.81176471710205078), (0.41596639156341553, 0.81960785388946533,
0.81960785388946533), (0.42016807198524475, 0.82745099067687988,
0.82745099067687988), (0.42436975240707397, 0.83529412746429443,
0.83529412746429443), (0.4285714328289032, 0.84313726425170898,
0.84313726425170898), (0.43277311325073242, 0.85098040103912354,
0.85098040103912354), (0.43697479367256165, 0.85882353782653809,
0.85882353782653809), (0.44117647409439087, 0.86666667461395264,
0.86666667461395264), (0.44537815451622009, 0.87450981140136719,
0.87450981140136719), (0.44957983493804932, 0.88235294818878174,
0.88235294818878174), (0.45378151535987854, 0.89019608497619629,
0.89019608497619629), (0.45798319578170776, 0.89803922176361084,
0.89803922176361084), (0.46218487620353699, 0.91372549533843994,
0.91372549533843994), (0.46638655662536621, 0.92156863212585449,
0.92156863212585449), (0.47058823704719543, 0.92941176891326904,
0.92941176891326904), (0.47478991746902466, 0.93725490570068359,
0.93725490570068359), (0.47899159789085388, 0.94509804248809814,
0.94509804248809814), (0.48319327831268311, 0.9529411792755127,
0.9529411792755127), (0.48739495873451233, 0.96078431606292725,
0.96078431606292725), (0.49159663915634155, 0.9686274528503418,
0.9686274528503418), (0.49579831957817078, 0.97647058963775635,
0.97647058963775635), (0.5, 0.9843137264251709, 0.9843137264251709),
(0.50420171022415161, 1.0, 1.0), (0.50840336084365845, 0.9843137264251709,
0.9843137264251709), (0.51260507106781006, 0.9686274528503418,
0.9686274528503418), (0.51680672168731689, 0.9529411792755127,
0.9529411792755127), (0.52100843191146851, 0.93333333730697632,
0.93333333730697632), (0.52521008253097534, 0.91764706373214722,
0.91764706373214722), (0.52941179275512695, 0.90196079015731812,
0.90196079015731812), (0.53361344337463379, 0.88627451658248901,
0.88627451658248901), (0.5378151535987854, 0.86666667461395264,
0.86666667461395264), (0.54201680421829224, 0.85098040103912354,
0.85098040103912354), (0.54621851444244385, 0.81960785388946533,
0.81960785388946533), (0.55042016506195068, 0.80000001192092896,
0.80000001192092896), (0.55462187528610229, 0.78431373834609985,
0.78431373834609985), (0.55882352590560913, 0.76862746477127075,
0.76862746477127075), (0.56302523612976074, 0.75294119119644165,
0.75294119119644165), (0.56722688674926758, 0.73333334922790527,
0.73333334922790527), (0.57142859697341919, 0.71764707565307617,
0.71764707565307617), (0.57563024759292603, 0.70196080207824707,
0.70196080207824707), (0.57983195781707764, 0.68627452850341797,
0.68627452850341797), (0.58403360843658447, 0.66666668653488159,
0.66666668653488159), (0.58823531866073608, 0.65098041296005249,
0.65098041296005249), (0.59243696928024292, 0.63529413938522339,
0.63529413938522339), (0.59663867950439453, 0.61960786581039429,
0.61960786581039429), (0.60084033012390137, 0.60000002384185791,
0.60000002384185791), (0.60504204034805298, 0.58431375026702881,
0.58431375026702881), (0.60924369096755981, 0.56862747669219971,
0.56862747669219971), (0.61344540119171143, 0.55294120311737061,
0.55294120311737061), (0.61764705181121826, 0.53333336114883423,
0.53333336114883423), (0.62184876203536987, 0.51764708757400513,
0.51764708757400513), (0.62605041265487671, 0.50196081399917603,
0.50196081399917603), (0.63025212287902832, 0.46666666865348816,
0.46666666865348816), (0.63445377349853516, 0.45098039507865906,
0.45098039507865906), (0.63865548372268677, 0.43529412150382996,
0.43529412150382996), (0.6428571343421936, 0.41960784792900085,
0.41960784792900085), (0.64705884456634521, 0.40000000596046448,
0.40000000596046448), (0.65126049518585205, 0.38431373238563538,
0.38431373238563538), (0.65546220541000366, 0.36862745881080627,
0.36862745881080627), (0.6596638560295105, 0.35294118523597717,
0.35294118523597717), (0.66386556625366211, 0.3333333432674408,
0.3333333432674408), (0.66806721687316895, 0.31764706969261169,
0.31764706969261169), (0.67226892709732056, 0.30196079611778259,
0.30196079611778259), (0.67647057771682739, 0.28627452254295349,
0.28627452254295349), (0.680672287940979, 0.26666668057441711,
0.26666668057441711), (0.68487393856048584, 0.25098040699958801,
0.25098040699958801), (0.68907564878463745, 0.23529411852359772,
0.23529411852359772), (0.69327729940414429, 0.21960784494876862,
0.21960784494876862), (0.6974790096282959, 0.20000000298023224,
0.20000000298023224), (0.70168066024780273, 0.18431372940540314,
0.18431372940540314), (0.70588237047195435, 0.16862745583057404,
0.16862745583057404), (0.71008402109146118, 0.15294118225574493,
0.15294118225574493), (0.71428573131561279, 0.11764705926179886,
0.11764705926179886), (0.71848738193511963, 0.10196078568696976,
0.10196078568696976), (0.72268909215927124, 0.086274512112140656,
0.086274512112140656), (0.72689074277877808, 0.066666670143604279,
0.066666670143604279), (0.73109245300292969, 0.050980392843484879,
0.050980392843484879), (0.73529410362243652, 0.035294119268655777,
0.035294119268655777), (0.73949581384658813, 0.019607843831181526,
0.019607843831181526), (0.74369746446609497, 0.0, 0.0),
(0.74789917469024658, 0.011764706112444401, 0.011764706112444401),
(0.75210082530975342, 0.027450980618596077, 0.027450980618596077),
(0.75630253553390503, 0.058823529630899429, 0.058823529630899429),
(0.76050418615341187, 0.074509806931018829, 0.074509806931018829),
(0.76470589637756348, 0.086274512112140656, 0.086274512112140656),
(0.76890754699707031, 0.10196078568696976, 0.10196078568696976),
(0.77310925722122192, 0.11764705926179886, 0.11764705926179886),
(0.77731090784072876, 0.13333334028720856, 0.13333334028720856),
(0.78151261806488037, 0.14901961386203766, 0.14901961386203766),
(0.78571426868438721, 0.16078431904315948, 0.16078431904315948),
(0.78991597890853882, 0.17647059261798859, 0.17647059261798859),
(0.79411762952804565, 0.19215686619281769, 0.19215686619281769),
(0.79831933975219727, 0.22352941334247589, 0.22352941334247589),
(0.8025209903717041, 0.23529411852359772, 0.23529411852359772),
(0.80672270059585571, 0.25098040699958801, 0.25098040699958801),
(0.81092435121536255, 0.26666668057441711, 0.26666668057441711),
(0.81512606143951416, 0.28235295414924622, 0.28235295414924622),
(0.819327712059021, 0.29803922772407532, 0.29803922772407532),
(0.82352942228317261, 0.30980393290519714, 0.30980393290519714),
(0.82773107290267944, 0.32549020648002625, 0.32549020648002625),
(0.83193278312683105, 0.34117648005485535, 0.34117648005485535),
(0.83613443374633789, 0.35686275362968445, 0.35686275362968445),
(0.8403361439704895, 0.37254902720451355, 0.37254902720451355),
(0.84453779458999634, 0.38431373238563538, 0.38431373238563538),
(0.84873950481414795, 0.40000000596046448, 0.40000000596046448),
(0.85294115543365479, 0.41568627953529358, 0.41568627953529358),
(0.8571428656578064, 0.43137255311012268, 0.43137255311012268),
(0.86134451627731323, 0.44705882668495178, 0.44705882668495178),
(0.86554622650146484, 0.45882353186607361, 0.45882353186607361),
(0.86974787712097168, 0.47450980544090271, 0.47450980544090271),
(0.87394958734512329, 0.49019607901573181, 0.49019607901573181),
(0.87815123796463013, 0.5058823823928833, 0.5058823823928833),
(0.88235294818878174, 0.5372549295425415, 0.5372549295425415),
(0.88655459880828857, 0.54901963472366333, 0.54901963472366333),
(0.89075630903244019, 0.56470590829849243, 0.56470590829849243),
(0.89495795965194702, 0.58039218187332153, 0.58039218187332153),
(0.89915966987609863, 0.59607845544815063, 0.59607845544815063),
(0.90336132049560547, 0.61176472902297974, 0.61176472902297974),
(0.90756303071975708, 0.62352943420410156, 0.62352943420410156),
(0.91176468133926392, 0.63921570777893066, 0.63921570777893066),
(0.91596639156341553, 0.65490198135375977, 0.65490198135375977),
(0.92016804218292236, 0.67058825492858887, 0.67058825492858887),
(0.92436975240707397, 0.68627452850341797, 0.68627452850341797),
(0.92857140302658081, 0.69803923368453979, 0.69803923368453979),
(0.93277311325073242, 0.7137255072593689, 0.7137255072593689),
(0.93697476387023926, 0.729411780834198, 0.729411780834198),
(0.94117647409439087, 0.7450980544090271, 0.7450980544090271),
(0.94537812471389771, 0.7607843279838562, 0.7607843279838562),
(0.94957983493804932, 0.77254903316497803, 0.77254903316497803),
(0.95378148555755615, 0.78823530673980713, 0.78823530673980713),
(0.95798319578170776, 0.80392158031463623, 0.80392158031463623),
(0.9621848464012146, 0.81960785388946533, 0.81960785388946533),
(0.96638655662536621, 0.84705883264541626, 0.84705883264541626),
(0.97058820724487305, 0.86274510622024536, 0.86274510622024536),
(0.97478991746902466, 0.87843137979507446, 0.87843137979507446),
(0.97899156808853149, 0.89411765336990356, 0.89411765336990356),
(0.98319327831268311, 0.90980392694473267, 0.90980392694473267),
(0.98739492893218994, 0.92156863212585449, 0.92156863212585449),
(0.99159663915634155, 0.93725490570068359, 0.93725490570068359),
(0.99579828977584839, 0.9529411792755127, 0.9529411792755127), (1.0,
0.9686274528503418, 0.9686274528503418)], 'green': [(0.0, 0.0, 0.0),
(0.0042016808874905109, 0.0039215688593685627, 0.0039215688593685627),
(0.0084033617749810219, 0.0078431377187371254, 0.0078431377187371254),
(0.012605042196810246, 0.011764706112444401, 0.011764706112444401),
(0.016806723549962044, 0.015686275437474251, 0.015686275437474251),
(0.021008403971791267, 0.019607843831181526, 0.019607843831181526),
(0.025210084393620491, 0.023529412224888802, 0.023529412224888802),
(0.029411764815449715, 0.027450980618596077, 0.027450980618596077),
(0.033613447099924088, 0.031372550874948502, 0.031372550874948502),
(0.037815127521753311, 0.035294119268655777, 0.035294119268655777),
(0.042016807943582535, 0.043137256056070328, 0.043137256056070328),
(0.046218488365411758, 0.047058824449777603, 0.047058824449777603),
(0.050420168787240982, 0.050980392843484879, 0.050980392843484879),
(0.054621849209070206, 0.054901961237192154, 0.054901961237192154),
(0.058823529630899429, 0.058823529630899429, 0.058823529630899429),
(0.063025213778018951, 0.062745101749897003, 0.062745101749897003),
(0.067226894199848175, 0.066666670143604279, 0.066666670143604279),
(0.071428574621677399, 0.070588238537311554, 0.070588238537311554),
(0.075630255043506622, 0.074509806931018829, 0.074509806931018829),
(0.079831935465335846, 0.078431375324726105, 0.078431375324726105),
(0.08403361588716507, 0.08235294371843338, 0.08235294371843338),
(0.088235296308994293, 0.086274512112140656, 0.086274512112140656),
(0.092436976730823517, 0.090196080505847931, 0.090196080505847931),
(0.09663865715265274, 0.094117648899555206, 0.094117648899555206),
(0.10084033757448196, 0.098039217293262482, 0.098039217293262482),
(0.10504201799631119, 0.10196078568696976, 0.10196078568696976),
(0.10924369841814041, 0.10588235408067703, 0.10588235408067703),
(0.11344537883996964, 0.10980392247438431, 0.10980392247438431),
(0.11764705926179886, 0.11372549086809158, 0.11372549086809158),
(0.12184873968362808, 0.11764705926179886, 0.11764705926179886),
(0.1260504275560379, 0.12549020349979401, 0.12549020349979401),
(0.13025210797786713, 0.12941177189350128, 0.12941177189350128),
(0.13445378839969635, 0.13333334028720856, 0.13333334028720856),
(0.13865546882152557, 0.13725490868091583, 0.13725490868091583),
(0.1428571492433548, 0.14117647707462311, 0.14117647707462311),
(0.14705882966518402, 0.14509804546833038, 0.14509804546833038),
(0.15126051008701324, 0.14901961386203766, 0.14901961386203766),
(0.15546219050884247, 0.15294118225574493, 0.15294118225574493),
(0.15966387093067169, 0.15686275064945221, 0.15686275064945221),
(0.16386555135250092, 0.16078431904315948, 0.16078431904315948),
(0.16806723177433014, 0.16470588743686676, 0.16470588743686676),
(0.17226891219615936, 0.16862745583057404, 0.16862745583057404),
(0.17647059261798859, 0.17254902422428131, 0.17254902422428131),
(0.18067227303981781, 0.17647059261798859, 0.17647059261798859),
(0.18487395346164703, 0.18039216101169586, 0.18039216101169586),
(0.18907563388347626, 0.18431372940540314, 0.18431372940540314),
(0.19327731430530548, 0.18823529779911041, 0.18823529779911041),
(0.1974789947271347, 0.19215686619281769, 0.19215686619281769),
(0.20168067514896393, 0.19607843458652496, 0.19607843458652496),
(0.20588235557079315, 0.20000000298023224, 0.20000000298023224),
(0.21008403599262238, 0.20784313976764679, 0.20784313976764679),
(0.2142857164144516, 0.21176470816135406, 0.21176470816135406),
(0.21848739683628082, 0.21568627655506134, 0.21568627655506134),
(0.22268907725811005, 0.21960784494876862, 0.21960784494876862),
(0.22689075767993927, 0.22352941334247589, 0.22352941334247589),
(0.23109243810176849, 0.22745098173618317, 0.22745098173618317),
(0.23529411852359772, 0.23137255012989044, 0.23137255012989044),
(0.23949579894542694, 0.23529411852359772, 0.23529411852359772),
(0.24369747936725616, 0.23921568691730499, 0.23921568691730499),
(0.24789915978908539, 0.24313725531101227, 0.24313725531101227),
(0.25210085511207581, 0.25098040699958801, 0.25098040699958801),
(0.25630253553390503, 0.25490197539329529, 0.25490197539329529),
(0.26050421595573425, 0.25882354378700256, 0.25882354378700256),
(0.26470589637756348, 0.26274511218070984, 0.26274511218070984),
(0.2689075767993927, 0.26666668057441711, 0.26666668057441711),
(0.27310925722122192, 0.27058824896812439, 0.27058824896812439),
(0.27731093764305115, 0.27450981736183167, 0.27450981736183167),
(0.28151261806488037, 0.27843138575553894, 0.27843138575553894),
(0.28571429848670959, 0.28235295414924622, 0.28235295414924622),
(0.28991597890853882, 0.28627452254295349, 0.28627452254295349),
(0.29411765933036804, 0.29411765933036804, 0.29411765933036804),
(0.29831933975219727, 0.29803922772407532, 0.29803922772407532),
(0.30252102017402649, 0.30196079611778259, 0.30196079611778259),
(0.30672270059585571, 0.30588236451148987, 0.30588236451148987),
(0.31092438101768494, 0.30980393290519714, 0.30980393290519714),
(0.31512606143951416, 0.31372550129890442, 0.31372550129890442),
(0.31932774186134338, 0.31764706969261169, 0.31764706969261169),
(0.32352942228317261, 0.32156863808631897, 0.32156863808631897),
(0.32773110270500183, 0.32549020648002625, 0.32549020648002625),
(0.33193278312683105, 0.32941177487373352, 0.32941177487373352),
(0.33613446354866028, 0.3333333432674408, 0.3333333432674408),
(0.3403361439704895, 0.33725491166114807, 0.33725491166114807),
(0.34453782439231873, 0.34117648005485535, 0.34117648005485535),
(0.34873950481414795, 0.34509804844856262, 0.34509804844856262),
(0.35294118523597717, 0.3490196168422699, 0.3490196168422699),
(0.3571428656578064, 0.35294118523597717, 0.35294118523597717),
(0.36134454607963562, 0.35686275362968445, 0.35686275362968445),
(0.36554622650146484, 0.36078432202339172, 0.36078432202339172),
(0.36974790692329407, 0.364705890417099, 0.364705890417099),
(0.37394958734512329, 0.36862745881080627, 0.36862745881080627),
(0.37815126776695251, 0.37647059559822083, 0.37647059559822083),
(0.38235294818878174, 0.3803921639919281, 0.3803921639919281),
(0.38655462861061096, 0.38431373238563538, 0.38431373238563538),
(0.39075630903244019, 0.38823530077934265, 0.38823530077934265),
(0.39495798945426941, 0.39215686917304993, 0.39215686917304993),
(0.39915966987609863, 0.3960784375667572, 0.3960784375667572),
(0.40336135029792786, 0.40000000596046448, 0.40000000596046448),
(0.40756303071975708, 0.40392157435417175, 0.40392157435417175),
(0.4117647111415863, 0.40784314274787903, 0.40784314274787903),
(0.41596639156341553, 0.4117647111415863, 0.4117647111415863),
(0.42016807198524475, 0.41568627953529358, 0.41568627953529358),
(0.42436975240707397, 0.41960784792900085, 0.41960784792900085),
(0.4285714328289032, 0.42352941632270813, 0.42352941632270813),
(0.43277311325073242, 0.42745098471641541, 0.42745098471641541),
(0.43697479367256165, 0.43137255311012268, 0.43137255311012268),
(0.44117647409439087, 0.43529412150382996, 0.43529412150382996),
(0.44537815451622009, 0.43921568989753723, 0.43921568989753723),
(0.44957983493804932, 0.44313725829124451, 0.44313725829124451),
(0.45378151535987854, 0.44705882668495178, 0.44705882668495178),
(0.45798319578170776, 0.45098039507865906, 0.45098039507865906),
(0.46218487620353699, 0.45882353186607361, 0.45882353186607361),
(0.46638655662536621, 0.46274510025978088, 0.46274510025978088),
(0.47058823704719543, 0.46666666865348816, 0.46666666865348816),
(0.47478991746902466, 0.47058823704719543, 0.47058823704719543),
(0.47899159789085388, 0.47450980544090271, 0.47450980544090271),
(0.48319327831268311, 0.47843137383460999, 0.47843137383460999),
(0.48739495873451233, 0.48235294222831726, 0.48235294222831726),
(0.49159663915634155, 0.48627451062202454, 0.48627451062202454),
(0.49579831957817078, 0.49019607901573181, 0.49019607901573181), (0.5,
0.49411764740943909, 0.49411764740943909), (0.50420171022415161,
0.50196081399917603, 0.50196081399917603), (0.50840336084365845,
0.5058823823928833, 0.5058823823928833), (0.51260507106781006,
0.50980395078659058, 0.50980395078659058), (0.51680672168731689,
0.51372551918029785, 0.51372551918029785), (0.52100843191146851,
0.51764708757400513, 0.51764708757400513), (0.52521008253097534,
0.5215686559677124, 0.5215686559677124), (0.52941179275512695,
0.52549022436141968, 0.52549022436141968), (0.53361344337463379,
0.52941179275512695, 0.52941179275512695), (0.5378151535987854,
0.53333336114883423, 0.53333336114883423), (0.54201680421829224,
0.5372549295425415, 0.5372549295425415), (0.54621851444244385,
0.54509806632995605, 0.54509806632995605), (0.55042016506195068,
0.54901963472366333, 0.54901963472366333), (0.55462187528610229,
0.55294120311737061, 0.55294120311737061), (0.55882352590560913,
0.55686277151107788, 0.55686277151107788), (0.56302523612976074,
0.56078433990478516, 0.56078433990478516), (0.56722688674926758,
0.56470590829849243, 0.56470590829849243), (0.57142859697341919,
0.56862747669219971, 0.56862747669219971), (0.57563024759292603,
0.57254904508590698, 0.57254904508590698), (0.57983195781707764,
0.57647061347961426, 0.57647061347961426), (0.58403360843658447,
0.58039218187332153, 0.58039218187332153), (0.58823531866073608,
0.58431375026702881, 0.58431375026702881), (0.59243696928024292,
0.58823531866073608, 0.58823531866073608), (0.59663867950439453,
0.59215688705444336, 0.59215688705444336), (0.60084033012390137,
0.59607845544815063, 0.59607845544815063), (0.60504204034805298,
0.60000002384185791, 0.60000002384185791), (0.60924369096755981,
0.60392159223556519, 0.60392159223556519), (0.61344540119171143,
0.60784316062927246, 0.60784316062927246), (0.61764705181121826,
0.61176472902297974, 0.61176472902297974), (0.62184876203536987,
0.61568629741668701, 0.61568629741668701), (0.62605041265487671,
0.61960786581039429, 0.61960786581039429), (0.63025212287902832,
0.62745100259780884, 0.62745100259780884), (0.63445377349853516,
0.63137257099151611, 0.63137257099151611), (0.63865548372268677,
0.63529413938522339, 0.63529413938522339), (0.6428571343421936,
0.63921570777893066, 0.63921570777893066), (0.64705884456634521,
0.64313727617263794, 0.64313727617263794), (0.65126049518585205,
0.64705884456634521, 0.64705884456634521), (0.65546220541000366,
0.65098041296005249, 0.65098041296005249), (0.6596638560295105,
0.65490198135375977, 0.65490198135375977), (0.66386556625366211,
0.65882354974746704, 0.65882354974746704), (0.66806721687316895,
0.66274511814117432, 0.66274511814117432), (0.67226892709732056,
0.66666668653488159, 0.66666668653488159), (0.67647057771682739,
0.67058825492858887, 0.67058825492858887), (0.680672287940979,
0.67450982332229614, 0.67450982332229614), (0.68487393856048584,
0.67843139171600342, 0.67843139171600342), (0.68907564878463745,
0.68235296010971069, 0.68235296010971069), (0.69327729940414429,
0.68627452850341797, 0.68627452850341797), (0.6974790096282959,
0.69019609689712524, 0.69019609689712524), (0.70168066024780273,
0.69411766529083252, 0.69411766529083252), (0.70588237047195435,
0.69803923368453979, 0.69803923368453979), (0.71008402109146118,
0.70196080207824707, 0.70196080207824707), (0.71428573131561279,
0.70980393886566162, 0.70980393886566162), (0.71848738193511963,
0.7137255072593689, 0.7137255072593689), (0.72268909215927124,
0.71764707565307617, 0.71764707565307617), (0.72689074277877808,
0.72156864404678345, 0.72156864404678345), (0.73109245300292969,
0.72549021244049072, 0.72549021244049072), (0.73529410362243652,
0.729411780834198, 0.729411780834198), (0.73949581384658813,
0.73333334922790527, 0.73333334922790527), (0.74369746446609497,
0.73725491762161255, 0.73725491762161255), (0.74789917469024658,
0.74117648601531982, 0.74117648601531982), (0.75210082530975342,
0.7450980544090271, 0.7450980544090271), (0.75630253553390503,
0.75294119119644165, 0.75294119119644165), (0.76050418615341187,
0.75686275959014893, 0.75686275959014893), (0.76470589637756348,
0.7607843279838562, 0.7607843279838562), (0.76890754699707031,
0.76470589637756348, 0.76470589637756348), (0.77310925722122192,
0.76862746477127075, 0.76862746477127075), (0.77731090784072876,
0.77254903316497803, 0.77254903316497803), (0.78151261806488037,
0.7764706015586853, 0.7764706015586853), (0.78571426868438721,
0.78039216995239258, 0.78039216995239258), (0.78991597890853882,
0.78431373834609985, 0.78431373834609985), (0.79411762952804565,
0.78823530673980713, 0.78823530673980713), (0.79831933975219727,
0.79607844352722168, 0.79607844352722168), (0.8025209903717041,
0.80000001192092896, 0.80000001192092896), (0.80672270059585571,
0.80392158031463623, 0.80392158031463623), (0.81092435121536255,
0.80784314870834351, 0.80784314870834351), (0.81512606143951416,
0.81176471710205078, 0.81176471710205078), (0.819327712059021,
0.81568628549575806, 0.81568628549575806), (0.82352942228317261,
0.81960785388946533, 0.81960785388946533), (0.82773107290267944,
0.82352942228317261, 0.82352942228317261), (0.83193278312683105,
0.82745099067687988, 0.82745099067687988), (0.83613443374633789,
0.83137255907058716, 0.83137255907058716), (0.8403361439704895,
0.83529412746429443, 0.83529412746429443), (0.84453779458999634,
0.83921569585800171, 0.83921569585800171), (0.84873950481414795,
0.84313726425170898, 0.84313726425170898), (0.85294115543365479,
0.84705883264541626, 0.84705883264541626), (0.8571428656578064,
0.85098040103912354, 0.85098040103912354), (0.86134451627731323,
0.85490196943283081, 0.85490196943283081), (0.86554622650146484,
0.85882353782653809, 0.85882353782653809), (0.86974787712097168,
0.86274510622024536, 0.86274510622024536), (0.87394958734512329,
0.86666667461395264, 0.86666667461395264), (0.87815123796463013,
0.87058824300765991, 0.87058824300765991), (0.88235294818878174,
0.87843137979507446, 0.87843137979507446), (0.88655459880828857,
0.88235294818878174, 0.88235294818878174), (0.89075630903244019,
0.88627451658248901, 0.88627451658248901), (0.89495795965194702,
0.89019608497619629, 0.89019608497619629), (0.89915966987609863,
0.89411765336990356, 0.89411765336990356), (0.90336132049560547,
0.89803922176361084, 0.89803922176361084), (0.90756303071975708,
0.90196079015731812, 0.90196079015731812), (0.91176468133926392,
0.90588235855102539, 0.90588235855102539), (0.91596639156341553,
0.90980392694473267, 0.90980392694473267), (0.92016804218292236,
0.91372549533843994, 0.91372549533843994), (0.92436975240707397,
0.91764706373214722, 0.91764706373214722), (0.92857140302658081,
0.92156863212585449, 0.92156863212585449), (0.93277311325073242,
0.92549020051956177, 0.92549020051956177), (0.93697476387023926,
0.92941176891326904, 0.92941176891326904), (0.94117647409439087,
0.93333333730697632, 0.93333333730697632), (0.94537812471389771,
0.93725490570068359, 0.93725490570068359), (0.94957983493804932,
0.94117647409439087, 0.94117647409439087), (0.95378148555755615,
0.94509804248809814, 0.94509804248809814), (0.95798319578170776,
0.94901961088180542, 0.94901961088180542), (0.9621848464012146,
0.9529411792755127, 0.9529411792755127), (0.96638655662536621,
0.96078431606292725, 0.96078431606292725), (0.97058820724487305,
0.96470588445663452, 0.96470588445663452), (0.97478991746902466,
0.9686274528503418, 0.9686274528503418), (0.97899156808853149,
0.97254902124404907, 0.97254902124404907), (0.98319327831268311,
0.97647058963775635, 0.97647058963775635), (0.98739492893218994,
0.98039215803146362, 0.98039215803146362), (0.99159663915634155,
0.9843137264251709, 0.9843137264251709), (0.99579828977584839,
0.98823529481887817, 0.98823529481887817), (1.0, 0.99215686321258545,
0.99215686321258545)], 'red': [(0.0, 0.0, 0.0), (0.0042016808874905109,
0.070588238537311554, 0.070588238537311554), (0.0084033617749810219,
0.14117647707462311, 0.14117647707462311), (0.012605042196810246,
0.21176470816135406, 0.21176470816135406), (0.016806723549962044,
0.28235295414924622, 0.28235295414924622), (0.021008403971791267,
0.35294118523597717, 0.35294118523597717), (0.025210084393620491,
0.42352941632270813, 0.42352941632270813), (0.029411764815449715,
0.49803921580314636, 0.49803921580314636), (0.033613447099924088,
0.56862747669219971, 0.56862747669219971), (0.037815127521753311,
0.63921570777893066, 0.63921570777893066), (0.042016807943582535,
0.78039216995239258, 0.78039216995239258), (0.046218488365411758,
0.85098040103912354, 0.85098040103912354), (0.050420168787240982,
0.92156863212585449, 0.92156863212585449), (0.054621849209070206,
0.99607843160629272, 0.99607843160629272), (0.058823529630899429,
0.97647058963775635, 0.97647058963775635), (0.063025213778018951,
0.95686274766921997, 0.95686274766921997), (0.067226894199848175,
0.93725490570068359, 0.93725490570068359), (0.071428574621677399,
0.91764706373214722, 0.91764706373214722), (0.075630255043506622,
0.89803922176361084, 0.89803922176361084), (0.079831935465335846,
0.87450981140136719, 0.87450981140136719), (0.08403361588716507,
0.85490196943283081, 0.85490196943283081), (0.088235296308994293,
0.83529412746429443, 0.83529412746429443), (0.092436976730823517,
0.81568628549575806, 0.81568628549575806), (0.09663865715265274,
0.79607844352722168, 0.79607844352722168), (0.10084033757448196,
0.77254903316497803, 0.77254903316497803), (0.10504201799631119,
0.75294119119644165, 0.75294119119644165), (0.10924369841814041,
0.73333334922790527, 0.73333334922790527), (0.11344537883996964,
0.7137255072593689, 0.7137255072593689), (0.11764705926179886,
0.69411766529083252, 0.69411766529083252), (0.12184873968362808,
0.67450982332229614, 0.67450982332229614), (0.1260504275560379,
0.63137257099151611, 0.63137257099151611), (0.13025210797786713,
0.61176472902297974, 0.61176472902297974), (0.13445378839969635,
0.59215688705444336, 0.59215688705444336), (0.13865546882152557,
0.57254904508590698, 0.57254904508590698), (0.1428571492433548,
0.54901963472366333, 0.54901963472366333), (0.14705882966518402,
0.52941179275512695, 0.52941179275512695), (0.15126051008701324,
0.50980395078659058, 0.50980395078659058), (0.15546219050884247,
0.49019607901573181, 0.49019607901573181), (0.15966387093067169,
0.47058823704719543, 0.47058823704719543), (0.16386555135250092,
0.45098039507865906, 0.45098039507865906), (0.16806723177433014,
0.42745098471641541, 0.42745098471641541), (0.17226891219615936,
0.40784314274787903, 0.40784314274787903), (0.17647059261798859,
0.38823530077934265, 0.38823530077934265), (0.18067227303981781,
0.36862745881080627, 0.36862745881080627), (0.18487395346164703,
0.3490196168422699, 0.3490196168422699), (0.18907563388347626,
0.32549020648002625, 0.32549020648002625), (0.19327731430530548,
0.30588236451148987, 0.30588236451148987), (0.1974789947271347,
0.28627452254295349, 0.28627452254295349), (0.20168067514896393,
0.26666668057441711, 0.26666668057441711), (0.20588235557079315,
0.24705882370471954, 0.24705882370471954), (0.21008403599262238,
0.20392157137393951, 0.20392157137393951), (0.2142857164144516,
0.18431372940540314, 0.18431372940540314), (0.21848739683628082,
0.16470588743686676, 0.16470588743686676), (0.22268907725811005,
0.14509804546833038, 0.14509804546833038), (0.22689075767993927,
0.12549020349979401, 0.12549020349979401), (0.23109243810176849,
0.10196078568696976, 0.10196078568696976), (0.23529411852359772,
0.08235294371843338, 0.08235294371843338), (0.23949579894542694,
0.062745101749897003, 0.062745101749897003), (0.24369747936725616,
0.043137256056070328, 0.043137256056070328), (0.24789915978908539,
0.023529412224888802, 0.023529412224888802), (0.25210085511207581,
0.25098040699958801, 0.25098040699958801), (0.25630253553390503,
0.25490197539329529, 0.25490197539329529), (0.26050421595573425,
0.25882354378700256, 0.25882354378700256), (0.26470589637756348,
0.26274511218070984, 0.26274511218070984), (0.2689075767993927,
0.26666668057441711, 0.26666668057441711), (0.27310925722122192,
0.27058824896812439, 0.27058824896812439), (0.27731093764305115,
0.27450981736183167, 0.27450981736183167), (0.28151261806488037,
0.27843138575553894, 0.27843138575553894), (0.28571429848670959,
0.28235295414924622, 0.28235295414924622), (0.28991597890853882,
0.28627452254295349, 0.28627452254295349), (0.29411765933036804,
0.29411765933036804, 0.29411765933036804), (0.29831933975219727,
0.29803922772407532, 0.29803922772407532), (0.30252102017402649,
0.30196079611778259, 0.30196079611778259), (0.30672270059585571,
0.30588236451148987, 0.30588236451148987), (0.31092438101768494,
0.30980393290519714, 0.30980393290519714), (0.31512606143951416,
0.31372550129890442, 0.31372550129890442), (0.31932774186134338,
0.31764706969261169, 0.31764706969261169), (0.32352942228317261,
0.32156863808631897, 0.32156863808631897), (0.32773110270500183,
0.32549020648002625, 0.32549020648002625), (0.33193278312683105,
0.32941177487373352, 0.32941177487373352), (0.33613446354866028,
0.3333333432674408, 0.3333333432674408), (0.3403361439704895,
0.33725491166114807, 0.33725491166114807), (0.34453782439231873,
0.34117648005485535, 0.34117648005485535), (0.34873950481414795,
0.34509804844856262, 0.34509804844856262), (0.35294118523597717,
0.3490196168422699, 0.3490196168422699), (0.3571428656578064,
0.35294118523597717, 0.35294118523597717), (0.36134454607963562,
0.35686275362968445, 0.35686275362968445), (0.36554622650146484,
0.36078432202339172, 0.36078432202339172), (0.36974790692329407,
0.364705890417099, 0.364705890417099), (0.37394958734512329,
0.36862745881080627, 0.36862745881080627), (0.37815126776695251,
0.37647059559822083, 0.37647059559822083), (0.38235294818878174,
0.3803921639919281, 0.3803921639919281), (0.38655462861061096,
0.38431373238563538, 0.38431373238563538), (0.39075630903244019,
0.38823530077934265, 0.38823530077934265), (0.39495798945426941,
0.39215686917304993, 0.39215686917304993), (0.39915966987609863,
0.3960784375667572, 0.3960784375667572), (0.40336135029792786,
0.40000000596046448, 0.40000000596046448), (0.40756303071975708,
0.40392157435417175, 0.40392157435417175), (0.4117647111415863,
0.40784314274787903, 0.40784314274787903), (0.41596639156341553,
0.4117647111415863, 0.4117647111415863), (0.42016807198524475,
0.41568627953529358, 0.41568627953529358), (0.42436975240707397,
0.41960784792900085, 0.41960784792900085), (0.4285714328289032,
0.42352941632270813, 0.42352941632270813), (0.43277311325073242,
0.42745098471641541, 0.42745098471641541), (0.43697479367256165,
0.43137255311012268, 0.43137255311012268), (0.44117647409439087,
0.43529412150382996, 0.43529412150382996), (0.44537815451622009,
0.43921568989753723, 0.43921568989753723), (0.44957983493804932,
0.44313725829124451, 0.44313725829124451), (0.45378151535987854,
0.44705882668495178, 0.44705882668495178), (0.45798319578170776,
0.45098039507865906, 0.45098039507865906), (0.46218487620353699,
0.45882353186607361, 0.45882353186607361), (0.46638655662536621,
0.46274510025978088, 0.46274510025978088), (0.47058823704719543,
0.46666666865348816, 0.46666666865348816), (0.47478991746902466,
0.47058823704719543, 0.47058823704719543), (0.47899159789085388,
0.47450980544090271, 0.47450980544090271), (0.48319327831268311,
0.47843137383460999, 0.47843137383460999), (0.48739495873451233,
0.48235294222831726, 0.48235294222831726), (0.49159663915634155,
0.48627451062202454, 0.48627451062202454), (0.49579831957817078,
0.49019607901573181, 0.49019607901573181), (0.5, 0.49411764740943909,
0.49411764740943909), (0.50420171022415161, 0.50196081399917603,
0.50196081399917603), (0.50840336084365845, 0.5058823823928833,
0.5058823823928833), (0.51260507106781006, 0.50980395078659058,
0.50980395078659058), (0.51680672168731689, 0.51372551918029785,
0.51372551918029785), (0.52100843191146851, 0.51764708757400513,
0.51764708757400513), (0.52521008253097534, 0.5215686559677124,
0.5215686559677124), (0.52941179275512695, 0.52549022436141968,
0.52549022436141968), (0.53361344337463379, 0.52941179275512695,
0.52941179275512695), (0.5378151535987854, 0.53333336114883423,
0.53333336114883423), (0.54201680421829224, 0.5372549295425415,
0.5372549295425415), (0.54621851444244385, 0.54509806632995605,
0.54509806632995605), (0.55042016506195068, 0.54901963472366333,
0.54901963472366333), (0.55462187528610229, 0.55294120311737061,
0.55294120311737061), (0.55882352590560913, 0.55686277151107788,
0.55686277151107788), (0.56302523612976074, 0.56078433990478516,
0.56078433990478516), (0.56722688674926758, 0.56470590829849243,
0.56470590829849243), (0.57142859697341919, 0.56862747669219971,
0.56862747669219971), (0.57563024759292603, 0.57254904508590698,
0.57254904508590698), (0.57983195781707764, 0.57647061347961426,
0.57647061347961426), (0.58403360843658447, 0.58039218187332153,
0.58039218187332153), (0.58823531866073608, 0.58431375026702881,
0.58431375026702881), (0.59243696928024292, 0.58823531866073608,
0.58823531866073608), (0.59663867950439453, 0.59215688705444336,
0.59215688705444336), (0.60084033012390137, 0.59607845544815063,
0.59607845544815063), (0.60504204034805298, 0.60000002384185791,
0.60000002384185791), (0.60924369096755981, 0.60392159223556519,
0.60392159223556519), (0.61344540119171143, 0.60784316062927246,
0.60784316062927246), (0.61764705181121826, 0.61176472902297974,
0.61176472902297974), (0.62184876203536987, 0.61568629741668701,
0.61568629741668701), (0.62605041265487671, 0.61960786581039429,
0.61960786581039429), (0.63025212287902832, 0.62745100259780884,
0.62745100259780884), (0.63445377349853516, 0.63137257099151611,
0.63137257099151611), (0.63865548372268677, 0.63529413938522339,
0.63529413938522339), (0.6428571343421936, 0.63921570777893066,
0.63921570777893066), (0.64705884456634521, 0.64313727617263794,
0.64313727617263794), (0.65126049518585205, 0.64705884456634521,
0.64705884456634521), (0.65546220541000366, 0.65098041296005249,
0.65098041296005249), (0.6596638560295105, 0.65490198135375977,
0.65490198135375977), (0.66386556625366211, 0.65882354974746704,
0.65882354974746704), (0.66806721687316895, 0.66274511814117432,
0.66274511814117432), (0.67226892709732056, 0.66666668653488159,
0.66666668653488159), (0.67647057771682739, 0.67058825492858887,
0.67058825492858887), (0.680672287940979, 0.67450982332229614,
0.67450982332229614), (0.68487393856048584, 0.67843139171600342,
0.67843139171600342), (0.68907564878463745, 0.68235296010971069,
0.68235296010971069), (0.69327729940414429, 0.68627452850341797,
0.68627452850341797), (0.6974790096282959, 0.69019609689712524,
0.69019609689712524), (0.70168066024780273, 0.69411766529083252,
0.69411766529083252), (0.70588237047195435, 0.69803923368453979,
0.69803923368453979), (0.71008402109146118, 0.70196080207824707,
0.70196080207824707), (0.71428573131561279, 0.70980393886566162,
0.70980393886566162), (0.71848738193511963, 0.7137255072593689,
0.7137255072593689), (0.72268909215927124, 0.71764707565307617,
0.71764707565307617), (0.72689074277877808, 0.72156864404678345,
0.72156864404678345), (0.73109245300292969, 0.72549021244049072,
0.72549021244049072), (0.73529410362243652, 0.729411780834198,
0.729411780834198), (0.73949581384658813, 0.73333334922790527,
0.73333334922790527), (0.74369746446609497, 0.73725491762161255,
0.73725491762161255), (0.74789917469024658, 0.74117648601531982,
0.74117648601531982), (0.75210082530975342, 0.7450980544090271,
0.7450980544090271), (0.75630253553390503, 0.75294119119644165,
0.75294119119644165), (0.76050418615341187, 0.75686275959014893,
0.75686275959014893), (0.76470589637756348, 0.7607843279838562,
0.7607843279838562), (0.76890754699707031, 0.76470589637756348,
0.76470589637756348), (0.77310925722122192, 0.76862746477127075,
0.76862746477127075), (0.77731090784072876, 0.77254903316497803,
0.77254903316497803), (0.78151261806488037, 0.7764706015586853,
0.7764706015586853), (0.78571426868438721, 0.78039216995239258,
0.78039216995239258), (0.78991597890853882, 0.78431373834609985,
0.78431373834609985), (0.79411762952804565, 0.78823530673980713,
0.78823530673980713), (0.79831933975219727, 0.79607844352722168,
0.79607844352722168), (0.8025209903717041, 0.80000001192092896,
0.80000001192092896), (0.80672270059585571, 0.80392158031463623,
0.80392158031463623), (0.81092435121536255, 0.80784314870834351,
0.80784314870834351), (0.81512606143951416, 0.81176471710205078,
0.81176471710205078), (0.819327712059021, 0.81568628549575806,
0.81568628549575806), (0.82352942228317261, 0.81960785388946533,
0.81960785388946533), (0.82773107290267944, 0.82352942228317261,
0.82352942228317261), (0.83193278312683105, 0.82745099067687988,
0.82745099067687988), (0.83613443374633789, 0.83137255907058716,
0.83137255907058716), (0.8403361439704895, 0.83529412746429443,
0.83529412746429443), (0.84453779458999634, 0.83921569585800171,
0.83921569585800171), (0.84873950481414795, 0.84313726425170898,
0.84313726425170898), (0.85294115543365479, 0.84705883264541626,
0.84705883264541626), (0.8571428656578064, 0.85098040103912354,
0.85098040103912354), (0.86134451627731323, 0.85490196943283081,
0.85490196943283081), (0.86554622650146484, 0.85882353782653809,
0.85882353782653809), (0.86974787712097168, 0.86274510622024536,
0.86274510622024536), (0.87394958734512329, 0.86666667461395264,
0.86666667461395264), (0.87815123796463013, 0.87058824300765991,
0.87058824300765991), (0.88235294818878174, 0.87843137979507446,
0.87843137979507446), (0.88655459880828857, 0.88235294818878174,
0.88235294818878174), (0.89075630903244019, 0.88627451658248901,
0.88627451658248901), (0.89495795965194702, 0.89019608497619629,
0.89019608497619629), (0.89915966987609863, 0.89411765336990356,
0.89411765336990356), (0.90336132049560547, 0.89803922176361084,
0.89803922176361084), (0.90756303071975708, 0.90196079015731812,
0.90196079015731812), (0.91176468133926392, 0.90588235855102539,
0.90588235855102539), (0.91596639156341553, 0.90980392694473267,
0.90980392694473267), (0.92016804218292236, 0.91372549533843994,
0.91372549533843994), (0.92436975240707397, 0.91764706373214722,
0.91764706373214722), (0.92857140302658081, 0.92156863212585449,
0.92156863212585449), (0.93277311325073242, 0.92549020051956177,
0.92549020051956177), (0.93697476387023926, 0.92941176891326904,
0.92941176891326904), (0.94117647409439087, 0.93333333730697632,
0.93333333730697632), (0.94537812471389771, 0.93725490570068359,
0.93725490570068359), (0.94957983493804932, 0.94117647409439087,
0.94117647409439087), (0.95378148555755615, 0.94509804248809814,
0.94509804248809814), (0.95798319578170776, 0.94901961088180542,
0.94901961088180542), (0.9621848464012146, 0.9529411792755127,
0.9529411792755127), (0.96638655662536621, 0.96078431606292725,
0.96078431606292725), (0.97058820724487305, 0.96470588445663452,
0.96470588445663452), (0.97478991746902466, 0.9686274528503418,
0.9686274528503418), (0.97899156808853149, 0.97254902124404907,
0.97254902124404907), (0.98319327831268311, 0.97647058963775635,
0.97647058963775635), (0.98739492893218994, 0.98039215803146362,
0.98039215803146362), (0.99159663915634155, 0.9843137264251709,
0.9843137264251709), (0.99579828977584839, 0.98823529481887817,
0.98823529481887817), (1.0, 0.99215686321258545, 0.99215686321258545)]}
_gist_yarg_data = {'blue': [(0.0, 1.0, 1.0), (0.0042016808874905109,
0.99607843160629272, 0.99607843160629272), (0.0084033617749810219,
0.99215686321258545, 0.99215686321258545), (0.012605042196810246,
0.98823529481887817, 0.98823529481887817), (0.016806723549962044,
0.9843137264251709, 0.9843137264251709), (0.021008403971791267,
0.98039215803146362, 0.98039215803146362), (0.025210084393620491,
0.97647058963775635, 0.97647058963775635), (0.029411764815449715,
0.97254902124404907, 0.97254902124404907), (0.033613447099924088,
0.96470588445663452, 0.96470588445663452), (0.037815127521753311,
0.96078431606292725, 0.96078431606292725), (0.042016807943582535,
0.95686274766921997, 0.95686274766921997), (0.046218488365411758,
0.9529411792755127, 0.9529411792755127), (0.050420168787240982,
0.94901961088180542, 0.94901961088180542), (0.054621849209070206,
0.94509804248809814, 0.94509804248809814), (0.058823529630899429,
0.94117647409439087, 0.94117647409439087), (0.063025213778018951,
0.93725490570068359, 0.93725490570068359), (0.067226894199848175,
0.93333333730697632, 0.93333333730697632), (0.071428574621677399,
0.92941176891326904, 0.92941176891326904), (0.075630255043506622,
0.92549020051956177, 0.92549020051956177), (0.079831935465335846,
0.92156863212585449, 0.92156863212585449), (0.08403361588716507,
0.91764706373214722, 0.91764706373214722), (0.088235296308994293,
0.91372549533843994, 0.91372549533843994), (0.092436976730823517,
0.90980392694473267, 0.90980392694473267), (0.09663865715265274,
0.90196079015731812, 0.90196079015731812), (0.10084033757448196,
0.89803922176361084, 0.89803922176361084), (0.10504201799631119,
0.89411765336990356, 0.89411765336990356), (0.10924369841814041,
0.89019608497619629, 0.89019608497619629), (0.11344537883996964,
0.88627451658248901, 0.88627451658248901), (0.11764705926179886,
0.88235294818878174, 0.88235294818878174), (0.12184873968362808,
0.87843137979507446, 0.87843137979507446), (0.1260504275560379,
0.87450981140136719, 0.87450981140136719), (0.13025210797786713,
0.87058824300765991, 0.87058824300765991), (0.13445378839969635,
0.86666667461395264, 0.86666667461395264), (0.13865546882152557,
0.86274510622024536, 0.86274510622024536), (0.1428571492433548,
0.85882353782653809, 0.85882353782653809), (0.14705882966518402,
0.85490196943283081, 0.85490196943283081), (0.15126051008701324,
0.85098040103912354, 0.85098040103912354), (0.15546219050884247,
0.84705883264541626, 0.84705883264541626), (0.15966387093067169,
0.83921569585800171, 0.83921569585800171), (0.16386555135250092,
0.83529412746429443, 0.83529412746429443), (0.16806723177433014,
0.83137255907058716, 0.83137255907058716), (0.17226891219615936,
0.82745099067687988, 0.82745099067687988), (0.17647059261798859,
0.82352942228317261, 0.82352942228317261), (0.18067227303981781,
0.81960785388946533, 0.81960785388946533), (0.18487395346164703,
0.81568628549575806, 0.81568628549575806), (0.18907563388347626,
0.81176471710205078, 0.81176471710205078), (0.19327731430530548,
0.80784314870834351, 0.80784314870834351), (0.1974789947271347,
0.80392158031463623, 0.80392158031463623), (0.20168067514896393,
0.80000001192092896, 0.80000001192092896), (0.20588235557079315,
0.79607844352722168, 0.79607844352722168), (0.21008403599262238,
0.7921568751335144, 0.7921568751335144), (0.2142857164144516,
0.78823530673980713, 0.78823530673980713), (0.21848739683628082,
0.78431373834609985, 0.78431373834609985), (0.22268907725811005,
0.7764706015586853, 0.7764706015586853), (0.22689075767993927,
0.77254903316497803, 0.77254903316497803), (0.23109243810176849,
0.76862746477127075, 0.76862746477127075), (0.23529411852359772,
0.76470589637756348, 0.76470589637756348), (0.23949579894542694,
0.7607843279838562, 0.7607843279838562), (0.24369747936725616,
0.75686275959014893, 0.75686275959014893), (0.24789915978908539,
0.75294119119644165, 0.75294119119644165), (0.25210085511207581,
0.74901962280273438, 0.74901962280273438), (0.25630253553390503,
0.7450980544090271, 0.7450980544090271), (0.26050421595573425,
0.74117648601531982, 0.74117648601531982), (0.26470589637756348,
0.73725491762161255, 0.73725491762161255), (0.2689075767993927,
0.73333334922790527, 0.73333334922790527), (0.27310925722122192,
0.729411780834198, 0.729411780834198), (0.27731093764305115,
0.72549021244049072, 0.72549021244049072), (0.28151261806488037,
0.72156864404678345, 0.72156864404678345), (0.28571429848670959,
0.7137255072593689, 0.7137255072593689), (0.28991597890853882,
0.70980393886566162, 0.70980393886566162), (0.29411765933036804,
0.70588237047195435, 0.70588237047195435), (0.29831933975219727,
0.70196080207824707, 0.70196080207824707), (0.30252102017402649,
0.69803923368453979, 0.69803923368453979), (0.30672270059585571,
0.69411766529083252, 0.69411766529083252), (0.31092438101768494,
0.69019609689712524, 0.69019609689712524), (0.31512606143951416,
0.68627452850341797, 0.68627452850341797), (0.31932774186134338,
0.68235296010971069, 0.68235296010971069), (0.32352942228317261,
0.67843139171600342, 0.67843139171600342), (0.32773110270500183,
0.67450982332229614, 0.67450982332229614), (0.33193278312683105,
0.67058825492858887, 0.67058825492858887), (0.33613446354866028,
0.66666668653488159, 0.66666668653488159), (0.3403361439704895,
0.66274511814117432, 0.66274511814117432), (0.34453782439231873,
0.65882354974746704, 0.65882354974746704), (0.34873950481414795,
0.65098041296005249, 0.65098041296005249), (0.35294118523597717,
0.64705884456634521, 0.64705884456634521), (0.3571428656578064,
0.64313727617263794, 0.64313727617263794), (0.36134454607963562,
0.63921570777893066, 0.63921570777893066), (0.36554622650146484,
0.63529413938522339, 0.63529413938522339), (0.36974790692329407,
0.63137257099151611, 0.63137257099151611), (0.37394958734512329,
0.62745100259780884, 0.62745100259780884), (0.37815126776695251,
0.62352943420410156, 0.62352943420410156), (0.38235294818878174,
0.61960786581039429, 0.61960786581039429), (0.38655462861061096,
0.61568629741668701, 0.61568629741668701), (0.39075630903244019,
0.61176472902297974, 0.61176472902297974), (0.39495798945426941,
0.60784316062927246, 0.60784316062927246), (0.39915966987609863,
0.60392159223556519, 0.60392159223556519), (0.40336135029792786,
0.60000002384185791, 0.60000002384185791), (0.40756303071975708,
0.59607845544815063, 0.59607845544815063), (0.4117647111415863,
0.58823531866073608, 0.58823531866073608), (0.41596639156341553,
0.58431375026702881, 0.58431375026702881), (0.42016807198524475,
0.58039218187332153, 0.58039218187332153), (0.42436975240707397,
0.57647061347961426, 0.57647061347961426), (0.4285714328289032,
0.57254904508590698, 0.57254904508590698), (0.43277311325073242,
0.56862747669219971, 0.56862747669219971), (0.43697479367256165,
0.56470590829849243, 0.56470590829849243), (0.44117647409439087,
0.56078433990478516, 0.56078433990478516), (0.44537815451622009,
0.55686277151107788, 0.55686277151107788), (0.44957983493804932,
0.55294120311737061, 0.55294120311737061), (0.45378151535987854,
0.54901963472366333, 0.54901963472366333), (0.45798319578170776,
0.54509806632995605, 0.54509806632995605), (0.46218487620353699,
0.54117649793624878, 0.54117649793624878), (0.46638655662536621,
0.5372549295425415, 0.5372549295425415), (0.47058823704719543,
0.53333336114883423, 0.53333336114883423), (0.47478991746902466,
0.52549022436141968, 0.52549022436141968), (0.47899159789085388,
0.5215686559677124, 0.5215686559677124), (0.48319327831268311,
0.51764708757400513, 0.51764708757400513), (0.48739495873451233,
0.51372551918029785, 0.51372551918029785), (0.49159663915634155,
0.50980395078659058, 0.50980395078659058), (0.49579831957817078,
0.5058823823928833, 0.5058823823928833), (0.5, 0.50196081399917603,
0.50196081399917603), (0.50420171022415161, 0.49803921580314636,
0.49803921580314636), (0.50840336084365845, 0.49411764740943909,
0.49411764740943909), (0.51260507106781006, 0.49019607901573181,
0.49019607901573181), (0.51680672168731689, 0.48627451062202454,
0.48627451062202454), (0.52100843191146851, 0.48235294222831726,
0.48235294222831726), (0.52521008253097534, 0.47843137383460999,
0.47843137383460999), (0.52941179275512695, 0.47450980544090271,
0.47450980544090271), (0.53361344337463379, 0.47058823704719543,
0.47058823704719543), (0.5378151535987854, 0.46274510025978088,
0.46274510025978088), (0.54201680421829224, 0.45882353186607361,
0.45882353186607361), (0.54621851444244385, 0.45490196347236633,
0.45490196347236633), (0.55042016506195068, 0.45098039507865906,
0.45098039507865906), (0.55462187528610229, 0.44705882668495178,
0.44705882668495178), (0.55882352590560913, 0.44313725829124451,
0.44313725829124451), (0.56302523612976074, 0.43921568989753723,
0.43921568989753723), (0.56722688674926758, 0.43529412150382996,
0.43529412150382996), (0.57142859697341919, 0.43137255311012268,
0.43137255311012268), (0.57563024759292603, 0.42745098471641541,
0.42745098471641541), (0.57983195781707764, 0.42352941632270813,
0.42352941632270813), (0.58403360843658447, 0.41960784792900085,
0.41960784792900085), (0.58823531866073608, 0.41568627953529358,
0.41568627953529358), (0.59243696928024292, 0.4117647111415863,
0.4117647111415863), (0.59663867950439453, 0.40784314274787903,
0.40784314274787903), (0.60084033012390137, 0.40000000596046448,
0.40000000596046448), (0.60504204034805298, 0.3960784375667572,
0.3960784375667572), (0.60924369096755981, 0.39215686917304993,
0.39215686917304993), (0.61344540119171143, 0.38823530077934265,
0.38823530077934265), (0.61764705181121826, 0.38431373238563538,
0.38431373238563538), (0.62184876203536987, 0.3803921639919281,
0.3803921639919281), (0.62605041265487671, 0.37647059559822083,
0.37647059559822083), (0.63025212287902832, 0.37254902720451355,
0.37254902720451355), (0.63445377349853516, 0.36862745881080627,
0.36862745881080627), (0.63865548372268677, 0.364705890417099,
0.364705890417099), (0.6428571343421936, 0.36078432202339172,
0.36078432202339172), (0.64705884456634521, 0.35686275362968445,
0.35686275362968445), (0.65126049518585205, 0.35294118523597717,
0.35294118523597717), (0.65546220541000366, 0.3490196168422699,
0.3490196168422699), (0.6596638560295105, 0.34509804844856262,
0.34509804844856262), (0.66386556625366211, 0.33725491166114807,
0.33725491166114807), (0.66806721687316895, 0.3333333432674408,
0.3333333432674408), (0.67226892709732056, 0.32941177487373352,
0.32941177487373352), (0.67647057771682739, 0.32549020648002625,
0.32549020648002625), (0.680672287940979, 0.32156863808631897,
0.32156863808631897), (0.68487393856048584, 0.31764706969261169,
0.31764706969261169), (0.68907564878463745, 0.31372550129890442,
0.31372550129890442), (0.69327729940414429, 0.30980393290519714,
0.30980393290519714), (0.6974790096282959, 0.30588236451148987,
0.30588236451148987), (0.70168066024780273, 0.30196079611778259,
0.30196079611778259), (0.70588237047195435, 0.29803922772407532,
0.29803922772407532), (0.71008402109146118, 0.29411765933036804,
0.29411765933036804), (0.71428573131561279, 0.29019609093666077,
0.29019609093666077), (0.71848738193511963, 0.28627452254295349,
0.28627452254295349), (0.72268909215927124, 0.28235295414924622,
0.28235295414924622), (0.72689074277877808, 0.27450981736183167,
0.27450981736183167), (0.73109245300292969, 0.27058824896812439,
0.27058824896812439), (0.73529410362243652, 0.26666668057441711,
0.26666668057441711), (0.73949581384658813, 0.26274511218070984,
0.26274511218070984), (0.74369746446609497, 0.25882354378700256,
0.25882354378700256), (0.74789917469024658, 0.25490197539329529,
0.25490197539329529), (0.75210082530975342, 0.25098040699958801,
0.25098040699958801), (0.75630253553390503, 0.24705882370471954,
0.24705882370471954), (0.76050418615341187, 0.24313725531101227,
0.24313725531101227), (0.76470589637756348, 0.23921568691730499,
0.23921568691730499), (0.76890754699707031, 0.23529411852359772,
0.23529411852359772), (0.77310925722122192, 0.23137255012989044,
0.23137255012989044), (0.77731090784072876, 0.22745098173618317,
0.22745098173618317), (0.78151261806488037, 0.22352941334247589,
0.22352941334247589), (0.78571426868438721, 0.21960784494876862,
0.21960784494876862), (0.78991597890853882, 0.21176470816135406,
0.21176470816135406), (0.79411762952804565, 0.20784313976764679,
0.20784313976764679), (0.79831933975219727, 0.20392157137393951,
0.20392157137393951), (0.8025209903717041, 0.20000000298023224,
0.20000000298023224), (0.80672270059585571, 0.19607843458652496,
0.19607843458652496), (0.81092435121536255, 0.19215686619281769,
0.19215686619281769), (0.81512606143951416, 0.18823529779911041,
0.18823529779911041), (0.819327712059021, 0.18431372940540314,
0.18431372940540314), (0.82352942228317261, 0.18039216101169586,
0.18039216101169586), (0.82773107290267944, 0.17647059261798859,
0.17647059261798859), (0.83193278312683105, 0.17254902422428131,
0.17254902422428131), (0.83613443374633789, 0.16862745583057404,
0.16862745583057404), (0.8403361439704895, 0.16470588743686676,
0.16470588743686676), (0.84453779458999634, 0.16078431904315948,
0.16078431904315948), (0.84873950481414795, 0.15686275064945221,
0.15686275064945221), (0.85294115543365479, 0.14901961386203766,
0.14901961386203766), (0.8571428656578064, 0.14509804546833038,
0.14509804546833038), (0.86134451627731323, 0.14117647707462311,
0.14117647707462311), (0.86554622650146484, 0.13725490868091583,
0.13725490868091583), (0.86974787712097168, 0.13333334028720856,
0.13333334028720856), (0.87394958734512329, 0.12941177189350128,
0.12941177189350128), (0.87815123796463013, 0.12549020349979401,
0.12549020349979401), (0.88235294818878174, 0.12156862765550613,
0.12156862765550613), (0.88655459880828857, 0.11764705926179886,
0.11764705926179886), (0.89075630903244019, 0.11372549086809158,
0.11372549086809158), (0.89495795965194702, 0.10980392247438431,
0.10980392247438431), (0.89915966987609863, 0.10588235408067703,
0.10588235408067703), (0.90336132049560547, 0.10196078568696976,
0.10196078568696976), (0.90756303071975708, 0.098039217293262482,
0.098039217293262482), (0.91176468133926392, 0.094117648899555206,
0.094117648899555206), (0.91596639156341553, 0.086274512112140656,
0.086274512112140656), (0.92016804218292236, 0.08235294371843338,
0.08235294371843338), (0.92436975240707397, 0.078431375324726105,
0.078431375324726105), (0.92857140302658081, 0.074509806931018829,
0.074509806931018829), (0.93277311325073242, 0.070588238537311554,
0.070588238537311554), (0.93697476387023926, 0.066666670143604279,
0.066666670143604279), (0.94117647409439087, 0.062745101749897003,
0.062745101749897003), (0.94537812471389771, 0.058823529630899429,
0.058823529630899429), (0.94957983493804932, 0.054901961237192154,
0.054901961237192154), (0.95378148555755615, 0.050980392843484879,
0.050980392843484879), (0.95798319578170776, 0.047058824449777603,
0.047058824449777603), (0.9621848464012146, 0.043137256056070328,
0.043137256056070328), (0.96638655662536621, 0.039215687662363052,
0.039215687662363052), (0.97058820724487305, 0.035294119268655777,
0.035294119268655777), (0.97478991746902466, 0.031372550874948502,
0.031372550874948502), (0.97899156808853149, 0.023529412224888802,
0.023529412224888802), (0.98319327831268311, 0.019607843831181526,
0.019607843831181526), (0.98739492893218994, 0.015686275437474251,
0.015686275437474251), (0.99159663915634155, 0.011764706112444401,
0.011764706112444401), (0.99579828977584839, 0.0078431377187371254,
0.0078431377187371254), (1.0, 0.0039215688593685627,
0.0039215688593685627)], 'green': [(0.0, 1.0, 1.0),
(0.0042016808874905109, 0.99607843160629272, 0.99607843160629272),
(0.0084033617749810219, 0.99215686321258545, 0.99215686321258545),
(0.012605042196810246, 0.98823529481887817, 0.98823529481887817),
(0.016806723549962044, 0.9843137264251709, 0.9843137264251709),
(0.021008403971791267, 0.98039215803146362, 0.98039215803146362),
(0.025210084393620491, 0.97647058963775635, 0.97647058963775635),
(0.029411764815449715, 0.97254902124404907, 0.97254902124404907),
(0.033613447099924088, 0.96470588445663452, 0.96470588445663452),
(0.037815127521753311, 0.96078431606292725, 0.96078431606292725),
(0.042016807943582535, 0.95686274766921997, 0.95686274766921997),
(0.046218488365411758, 0.9529411792755127, 0.9529411792755127),
(0.050420168787240982, 0.94901961088180542, 0.94901961088180542),
(0.054621849209070206, 0.94509804248809814, 0.94509804248809814),
(0.058823529630899429, 0.94117647409439087, 0.94117647409439087),
(0.063025213778018951, 0.93725490570068359, 0.93725490570068359),
(0.067226894199848175, 0.93333333730697632, 0.93333333730697632),
(0.071428574621677399, 0.92941176891326904, 0.92941176891326904),
(0.075630255043506622, 0.92549020051956177, 0.92549020051956177),
(0.079831935465335846, 0.92156863212585449, 0.92156863212585449),
(0.08403361588716507, 0.91764706373214722, 0.91764706373214722),
(0.088235296308994293, 0.91372549533843994, 0.91372549533843994),
(0.092436976730823517, 0.90980392694473267, 0.90980392694473267),
(0.09663865715265274, 0.90196079015731812, 0.90196079015731812),
(0.10084033757448196, 0.89803922176361084, 0.89803922176361084),
(0.10504201799631119, 0.89411765336990356, 0.89411765336990356),
(0.10924369841814041, 0.89019608497619629, 0.89019608497619629),
(0.11344537883996964, 0.88627451658248901, 0.88627451658248901),
(0.11764705926179886, 0.88235294818878174, 0.88235294818878174),
(0.12184873968362808, 0.87843137979507446, 0.87843137979507446),
(0.1260504275560379, 0.87450981140136719, 0.87450981140136719),
(0.13025210797786713, 0.87058824300765991, 0.87058824300765991),
(0.13445378839969635, 0.86666667461395264, 0.86666667461395264),
(0.13865546882152557, 0.86274510622024536, 0.86274510622024536),
(0.1428571492433548, 0.85882353782653809, 0.85882353782653809),
(0.14705882966518402, 0.85490196943283081, 0.85490196943283081),
(0.15126051008701324, 0.85098040103912354, 0.85098040103912354),
(0.15546219050884247, 0.84705883264541626, 0.84705883264541626),
(0.15966387093067169, 0.83921569585800171, 0.83921569585800171),
(0.16386555135250092, 0.83529412746429443, 0.83529412746429443),
(0.16806723177433014, 0.83137255907058716, 0.83137255907058716),
(0.17226891219615936, 0.82745099067687988, 0.82745099067687988),
(0.17647059261798859, 0.82352942228317261, 0.82352942228317261),
(0.18067227303981781, 0.81960785388946533, 0.81960785388946533),
(0.18487395346164703, 0.81568628549575806, 0.81568628549575806),
(0.18907563388347626, 0.81176471710205078, 0.81176471710205078),
(0.19327731430530548, 0.80784314870834351, 0.80784314870834351),
(0.1974789947271347, 0.80392158031463623, 0.80392158031463623),
(0.20168067514896393, 0.80000001192092896, 0.80000001192092896),
(0.20588235557079315, 0.79607844352722168, 0.79607844352722168),
(0.21008403599262238, 0.7921568751335144, 0.7921568751335144),
(0.2142857164144516, 0.78823530673980713, 0.78823530673980713),
(0.21848739683628082, 0.78431373834609985, 0.78431373834609985),
(0.22268907725811005, 0.7764706015586853, 0.7764706015586853),
(0.22689075767993927, 0.77254903316497803, 0.77254903316497803),
(0.23109243810176849, 0.76862746477127075, 0.76862746477127075),
(0.23529411852359772, 0.76470589637756348, 0.76470589637756348),
(0.23949579894542694, 0.7607843279838562, 0.7607843279838562),
(0.24369747936725616, 0.75686275959014893, 0.75686275959014893),
(0.24789915978908539, 0.75294119119644165, 0.75294119119644165),
(0.25210085511207581, 0.74901962280273438, 0.74901962280273438),
(0.25630253553390503, 0.7450980544090271, 0.7450980544090271),
(0.26050421595573425, 0.74117648601531982, 0.74117648601531982),
(0.26470589637756348, 0.73725491762161255, 0.73725491762161255),
(0.2689075767993927, 0.73333334922790527, 0.73333334922790527),
(0.27310925722122192, 0.729411780834198, 0.729411780834198),
(0.27731093764305115, 0.72549021244049072, 0.72549021244049072),
(0.28151261806488037, 0.72156864404678345, 0.72156864404678345),
(0.28571429848670959, 0.7137255072593689, 0.7137255072593689),
(0.28991597890853882, 0.70980393886566162, 0.70980393886566162),
(0.29411765933036804, 0.70588237047195435, 0.70588237047195435),
(0.29831933975219727, 0.70196080207824707, 0.70196080207824707),
(0.30252102017402649, 0.69803923368453979, 0.69803923368453979),
(0.30672270059585571, 0.69411766529083252, 0.69411766529083252),
(0.31092438101768494, 0.69019609689712524, 0.69019609689712524),
(0.31512606143951416, 0.68627452850341797, 0.68627452850341797),
(0.31932774186134338, 0.68235296010971069, 0.68235296010971069),
(0.32352942228317261, 0.67843139171600342, 0.67843139171600342),
(0.32773110270500183, 0.67450982332229614, 0.67450982332229614),
(0.33193278312683105, 0.67058825492858887, 0.67058825492858887),
(0.33613446354866028, 0.66666668653488159, 0.66666668653488159),
(0.3403361439704895, 0.66274511814117432, 0.66274511814117432),
(0.34453782439231873, 0.65882354974746704, 0.65882354974746704),
(0.34873950481414795, 0.65098041296005249, 0.65098041296005249),
(0.35294118523597717, 0.64705884456634521, 0.64705884456634521),
(0.3571428656578064, 0.64313727617263794, 0.64313727617263794),
(0.36134454607963562, 0.63921570777893066, 0.63921570777893066),
(0.36554622650146484, 0.63529413938522339, 0.63529413938522339),
(0.36974790692329407, 0.63137257099151611, 0.63137257099151611),
(0.37394958734512329, 0.62745100259780884, 0.62745100259780884),
(0.37815126776695251, 0.62352943420410156, 0.62352943420410156),
(0.38235294818878174, 0.61960786581039429, 0.61960786581039429),
(0.38655462861061096, 0.61568629741668701, 0.61568629741668701),
(0.39075630903244019, 0.61176472902297974, 0.61176472902297974),
(0.39495798945426941, 0.60784316062927246, 0.60784316062927246),
(0.39915966987609863, 0.60392159223556519, 0.60392159223556519),
(0.40336135029792786, 0.60000002384185791, 0.60000002384185791),
(0.40756303071975708, 0.59607845544815063, 0.59607845544815063),
(0.4117647111415863, 0.58823531866073608, 0.58823531866073608),
(0.41596639156341553, 0.58431375026702881, 0.58431375026702881),
(0.42016807198524475, 0.58039218187332153, 0.58039218187332153),
(0.42436975240707397, 0.57647061347961426, 0.57647061347961426),
(0.4285714328289032, 0.57254904508590698, 0.57254904508590698),
(0.43277311325073242, 0.56862747669219971, 0.56862747669219971),
(0.43697479367256165, 0.56470590829849243, 0.56470590829849243),
(0.44117647409439087, 0.56078433990478516, 0.56078433990478516),
(0.44537815451622009, 0.55686277151107788, 0.55686277151107788),
(0.44957983493804932, 0.55294120311737061, 0.55294120311737061),
(0.45378151535987854, 0.54901963472366333, 0.54901963472366333),
(0.45798319578170776, 0.54509806632995605, 0.54509806632995605),
(0.46218487620353699, 0.54117649793624878, 0.54117649793624878),
(0.46638655662536621, 0.5372549295425415, 0.5372549295425415),
(0.47058823704719543, 0.53333336114883423, 0.53333336114883423),
(0.47478991746902466, 0.52549022436141968, 0.52549022436141968),
(0.47899159789085388, 0.5215686559677124, 0.5215686559677124),
(0.48319327831268311, 0.51764708757400513, 0.51764708757400513),
(0.48739495873451233, 0.51372551918029785, 0.51372551918029785),
(0.49159663915634155, 0.50980395078659058, 0.50980395078659058),
(0.49579831957817078, 0.5058823823928833, 0.5058823823928833), (0.5,
0.50196081399917603, 0.50196081399917603), (0.50420171022415161,
0.49803921580314636, 0.49803921580314636), (0.50840336084365845,
0.49411764740943909, 0.49411764740943909), (0.51260507106781006,
0.49019607901573181, 0.49019607901573181), (0.51680672168731689,
0.48627451062202454, 0.48627451062202454), (0.52100843191146851,
0.48235294222831726, 0.48235294222831726), (0.52521008253097534,
0.47843137383460999, 0.47843137383460999), (0.52941179275512695,
0.47450980544090271, 0.47450980544090271), (0.53361344337463379,
0.47058823704719543, 0.47058823704719543), (0.5378151535987854,
0.46274510025978088, 0.46274510025978088), (0.54201680421829224,
0.45882353186607361, 0.45882353186607361), (0.54621851444244385,
0.45490196347236633, 0.45490196347236633), (0.55042016506195068,
0.45098039507865906, 0.45098039507865906), (0.55462187528610229,
0.44705882668495178, 0.44705882668495178), (0.55882352590560913,
0.44313725829124451, 0.44313725829124451), (0.56302523612976074,
0.43921568989753723, 0.43921568989753723), (0.56722688674926758,
0.43529412150382996, 0.43529412150382996), (0.57142859697341919,
0.43137255311012268, 0.43137255311012268), (0.57563024759292603,
0.42745098471641541, 0.42745098471641541), (0.57983195781707764,
0.42352941632270813, 0.42352941632270813), (0.58403360843658447,
0.41960784792900085, 0.41960784792900085), (0.58823531866073608,
0.41568627953529358, 0.41568627953529358), (0.59243696928024292,
0.4117647111415863, 0.4117647111415863), (0.59663867950439453,
0.40784314274787903, 0.40784314274787903), (0.60084033012390137,
0.40000000596046448, 0.40000000596046448), (0.60504204034805298,
0.3960784375667572, 0.3960784375667572), (0.60924369096755981,
0.39215686917304993, 0.39215686917304993), (0.61344540119171143,
0.38823530077934265, 0.38823530077934265), (0.61764705181121826,
0.38431373238563538, 0.38431373238563538), (0.62184876203536987,
0.3803921639919281, 0.3803921639919281), (0.62605041265487671,
0.37647059559822083, 0.37647059559822083), (0.63025212287902832,
0.37254902720451355, 0.37254902720451355), (0.63445377349853516,
0.36862745881080627, 0.36862745881080627), (0.63865548372268677,
0.364705890417099, 0.364705890417099), (0.6428571343421936,
0.36078432202339172, 0.36078432202339172), (0.64705884456634521,
0.35686275362968445, 0.35686275362968445), (0.65126049518585205,
0.35294118523597717, 0.35294118523597717), (0.65546220541000366,
0.3490196168422699, 0.3490196168422699), (0.6596638560295105,
0.34509804844856262, 0.34509804844856262), (0.66386556625366211,
0.33725491166114807, 0.33725491166114807), (0.66806721687316895,
0.3333333432674408, 0.3333333432674408), (0.67226892709732056,
0.32941177487373352, 0.32941177487373352), (0.67647057771682739,
0.32549020648002625, 0.32549020648002625), (0.680672287940979,
0.32156863808631897, 0.32156863808631897), (0.68487393856048584,
0.31764706969261169, 0.31764706969261169), (0.68907564878463745,
0.31372550129890442, 0.31372550129890442), (0.69327729940414429,
0.30980393290519714, 0.30980393290519714), (0.6974790096282959,
0.30588236451148987, 0.30588236451148987), (0.70168066024780273,
0.30196079611778259, 0.30196079611778259), (0.70588237047195435,
0.29803922772407532, 0.29803922772407532), (0.71008402109146118,
0.29411765933036804, 0.29411765933036804), (0.71428573131561279,
0.29019609093666077, 0.29019609093666077), (0.71848738193511963,
0.28627452254295349, 0.28627452254295349), (0.72268909215927124,
0.28235295414924622, 0.28235295414924622), (0.72689074277877808,
0.27450981736183167, 0.27450981736183167), (0.73109245300292969,
0.27058824896812439, 0.27058824896812439), (0.73529410362243652,
0.26666668057441711, 0.26666668057441711), (0.73949581384658813,
0.26274511218070984, 0.26274511218070984), (0.74369746446609497,
0.25882354378700256, 0.25882354378700256), (0.74789917469024658,
0.25490197539329529, 0.25490197539329529), (0.75210082530975342,
0.25098040699958801, 0.25098040699958801), (0.75630253553390503,
0.24705882370471954, 0.24705882370471954), (0.76050418615341187,
0.24313725531101227, 0.24313725531101227), (0.76470589637756348,
0.23921568691730499, 0.23921568691730499), (0.76890754699707031,
0.23529411852359772, 0.23529411852359772), (0.77310925722122192,
0.23137255012989044, 0.23137255012989044), (0.77731090784072876,
0.22745098173618317, 0.22745098173618317), (0.78151261806488037,
0.22352941334247589, 0.22352941334247589), (0.78571426868438721,
0.21960784494876862, 0.21960784494876862), (0.78991597890853882,
0.21176470816135406, 0.21176470816135406), (0.79411762952804565,
0.20784313976764679, 0.20784313976764679), (0.79831933975219727,
0.20392157137393951, 0.20392157137393951), (0.8025209903717041,
0.20000000298023224, 0.20000000298023224), (0.80672270059585571,
0.19607843458652496, 0.19607843458652496), (0.81092435121536255,
0.19215686619281769, 0.19215686619281769), (0.81512606143951416,
0.18823529779911041, 0.18823529779911041), (0.819327712059021,
0.18431372940540314, 0.18431372940540314), (0.82352942228317261,
0.18039216101169586, 0.18039216101169586), (0.82773107290267944,
0.17647059261798859, 0.17647059261798859), (0.83193278312683105,
0.17254902422428131, 0.17254902422428131), (0.83613443374633789,
0.16862745583057404, 0.16862745583057404), (0.8403361439704895,
0.16470588743686676, 0.16470588743686676), (0.84453779458999634,
0.16078431904315948, 0.16078431904315948), (0.84873950481414795,
0.15686275064945221, 0.15686275064945221), (0.85294115543365479,
0.14901961386203766, 0.14901961386203766), (0.8571428656578064,
0.14509804546833038, 0.14509804546833038), (0.86134451627731323,
0.14117647707462311, 0.14117647707462311), (0.86554622650146484,
0.13725490868091583, 0.13725490868091583), (0.86974787712097168,
0.13333334028720856, 0.13333334028720856), (0.87394958734512329,
0.12941177189350128, 0.12941177189350128), (0.87815123796463013,
0.12549020349979401, 0.12549020349979401), (0.88235294818878174,
0.12156862765550613, 0.12156862765550613), (0.88655459880828857,
0.11764705926179886, 0.11764705926179886), (0.89075630903244019,
0.11372549086809158, 0.11372549086809158), (0.89495795965194702,
0.10980392247438431, 0.10980392247438431), (0.89915966987609863,
0.10588235408067703, 0.10588235408067703), (0.90336132049560547,
0.10196078568696976, 0.10196078568696976), (0.90756303071975708,
0.098039217293262482, 0.098039217293262482), (0.91176468133926392,
0.094117648899555206, 0.094117648899555206), (0.91596639156341553,
0.086274512112140656, 0.086274512112140656), (0.92016804218292236,
0.08235294371843338, 0.08235294371843338), (0.92436975240707397,
0.078431375324726105, 0.078431375324726105), (0.92857140302658081,
0.074509806931018829, 0.074509806931018829), (0.93277311325073242,
0.070588238537311554, 0.070588238537311554), (0.93697476387023926,
0.066666670143604279, 0.066666670143604279), (0.94117647409439087,
0.062745101749897003, 0.062745101749897003), (0.94537812471389771,
0.058823529630899429, 0.058823529630899429), (0.94957983493804932,
0.054901961237192154, 0.054901961237192154), (0.95378148555755615,
0.050980392843484879, 0.050980392843484879), (0.95798319578170776,
0.047058824449777603, 0.047058824449777603), (0.9621848464012146,
0.043137256056070328, 0.043137256056070328), (0.96638655662536621,
0.039215687662363052, 0.039215687662363052), (0.97058820724487305,
0.035294119268655777, 0.035294119268655777), (0.97478991746902466,
0.031372550874948502, 0.031372550874948502), (0.97899156808853149,
0.023529412224888802, 0.023529412224888802), (0.98319327831268311,
0.019607843831181526, 0.019607843831181526), (0.98739492893218994,
0.015686275437474251, 0.015686275437474251), (0.99159663915634155,
0.011764706112444401, 0.011764706112444401), (0.99579828977584839,
0.0078431377187371254, 0.0078431377187371254), (1.0,
0.0039215688593685627, 0.0039215688593685627)], 'red': [(0.0, 1.0, 1.0),
(0.0042016808874905109, 0.99607843160629272, 0.99607843160629272),
(0.0084033617749810219, 0.99215686321258545, 0.99215686321258545),
(0.012605042196810246, 0.98823529481887817, 0.98823529481887817),
(0.016806723549962044, 0.9843137264251709, 0.9843137264251709),
(0.021008403971791267, 0.98039215803146362, 0.98039215803146362),
(0.025210084393620491, 0.97647058963775635, 0.97647058963775635),
(0.029411764815449715, 0.97254902124404907, 0.97254902124404907),
(0.033613447099924088, 0.96470588445663452, 0.96470588445663452),
(0.037815127521753311, 0.96078431606292725, 0.96078431606292725),
(0.042016807943582535, 0.95686274766921997, 0.95686274766921997),
(0.046218488365411758, 0.9529411792755127, 0.9529411792755127),
(0.050420168787240982, 0.94901961088180542, 0.94901961088180542),
(0.054621849209070206, 0.94509804248809814, 0.94509804248809814),
(0.058823529630899429, 0.94117647409439087, 0.94117647409439087),
(0.063025213778018951, 0.93725490570068359, 0.93725490570068359),
(0.067226894199848175, 0.93333333730697632, 0.93333333730697632),
(0.071428574621677399, 0.92941176891326904, 0.92941176891326904),
(0.075630255043506622, 0.92549020051956177, 0.92549020051956177),
(0.079831935465335846, 0.92156863212585449, 0.92156863212585449),
(0.08403361588716507, 0.91764706373214722, 0.91764706373214722),
(0.088235296308994293, 0.91372549533843994, 0.91372549533843994),
(0.092436976730823517, 0.90980392694473267, 0.90980392694473267),
(0.09663865715265274, 0.90196079015731812, 0.90196079015731812),
(0.10084033757448196, 0.89803922176361084, 0.89803922176361084),
(0.10504201799631119, 0.89411765336990356, 0.89411765336990356),
(0.10924369841814041, 0.89019608497619629, 0.89019608497619629),
(0.11344537883996964, 0.88627451658248901, 0.88627451658248901),
(0.11764705926179886, 0.88235294818878174, 0.88235294818878174),
(0.12184873968362808, 0.87843137979507446, 0.87843137979507446),
(0.1260504275560379, 0.87450981140136719, 0.87450981140136719),
(0.13025210797786713, 0.87058824300765991, 0.87058824300765991),
(0.13445378839969635, 0.86666667461395264, 0.86666667461395264),
(0.13865546882152557, 0.86274510622024536, 0.86274510622024536),
(0.1428571492433548, 0.85882353782653809, 0.85882353782653809),
(0.14705882966518402, 0.85490196943283081, 0.85490196943283081),
(0.15126051008701324, 0.85098040103912354, 0.85098040103912354),
(0.15546219050884247, 0.84705883264541626, 0.84705883264541626),
(0.15966387093067169, 0.83921569585800171, 0.83921569585800171),
(0.16386555135250092, 0.83529412746429443, 0.83529412746429443),
(0.16806723177433014, 0.83137255907058716, 0.83137255907058716),
(0.17226891219615936, 0.82745099067687988, 0.82745099067687988),
(0.17647059261798859, 0.82352942228317261, 0.82352942228317261),
(0.18067227303981781, 0.81960785388946533, 0.81960785388946533),
(0.18487395346164703, 0.81568628549575806, 0.81568628549575806),
(0.18907563388347626, 0.81176471710205078, 0.81176471710205078),
(0.19327731430530548, 0.80784314870834351, 0.80784314870834351),
(0.1974789947271347, 0.80392158031463623, 0.80392158031463623),
(0.20168067514896393, 0.80000001192092896, 0.80000001192092896),
(0.20588235557079315, 0.79607844352722168, 0.79607844352722168),
(0.21008403599262238, 0.7921568751335144, 0.7921568751335144),
(0.2142857164144516, 0.78823530673980713, 0.78823530673980713),
(0.21848739683628082, 0.78431373834609985, 0.78431373834609985),
(0.22268907725811005, 0.7764706015586853, 0.7764706015586853),
(0.22689075767993927, 0.77254903316497803, 0.77254903316497803),
(0.23109243810176849, 0.76862746477127075, 0.76862746477127075),
(0.23529411852359772, 0.76470589637756348, 0.76470589637756348),
(0.23949579894542694, 0.7607843279838562, 0.7607843279838562),
(0.24369747936725616, 0.75686275959014893, 0.75686275959014893),
(0.24789915978908539, 0.75294119119644165, 0.75294119119644165),
(0.25210085511207581, 0.74901962280273438, 0.74901962280273438),
(0.25630253553390503, 0.7450980544090271, 0.7450980544090271),
(0.26050421595573425, 0.74117648601531982, 0.74117648601531982),
(0.26470589637756348, 0.73725491762161255, 0.73725491762161255),
(0.2689075767993927, 0.73333334922790527, 0.73333334922790527),
(0.27310925722122192, 0.729411780834198, 0.729411780834198),
(0.27731093764305115, 0.72549021244049072, 0.72549021244049072),
(0.28151261806488037, 0.72156864404678345, 0.72156864404678345),
(0.28571429848670959, 0.7137255072593689, 0.7137255072593689),
(0.28991597890853882, 0.70980393886566162, 0.70980393886566162),
(0.29411765933036804, 0.70588237047195435, 0.70588237047195435),
(0.29831933975219727, 0.70196080207824707, 0.70196080207824707),
(0.30252102017402649, 0.69803923368453979, 0.69803923368453979),
(0.30672270059585571, 0.69411766529083252, 0.69411766529083252),
(0.31092438101768494, 0.69019609689712524, 0.69019609689712524),
(0.31512606143951416, 0.68627452850341797, 0.68627452850341797),
(0.31932774186134338, 0.68235296010971069, 0.68235296010971069),
(0.32352942228317261, 0.67843139171600342, 0.67843139171600342),
(0.32773110270500183, 0.67450982332229614, 0.67450982332229614),
(0.33193278312683105, 0.67058825492858887, 0.67058825492858887),
(0.33613446354866028, 0.66666668653488159, 0.66666668653488159),
(0.3403361439704895, 0.66274511814117432, 0.66274511814117432),
(0.34453782439231873, 0.65882354974746704, 0.65882354974746704),
(0.34873950481414795, 0.65098041296005249, 0.65098041296005249),
(0.35294118523597717, 0.64705884456634521, 0.64705884456634521),
(0.3571428656578064, 0.64313727617263794, 0.64313727617263794),
(0.36134454607963562, 0.63921570777893066, 0.63921570777893066),
(0.36554622650146484, 0.63529413938522339, 0.63529413938522339),
(0.36974790692329407, 0.63137257099151611, 0.63137257099151611),
(0.37394958734512329, 0.62745100259780884, 0.62745100259780884),
(0.37815126776695251, 0.62352943420410156, 0.62352943420410156),
(0.38235294818878174, 0.61960786581039429, 0.61960786581039429),
(0.38655462861061096, 0.61568629741668701, 0.61568629741668701),
(0.39075630903244019, 0.61176472902297974, 0.61176472902297974),
(0.39495798945426941, 0.60784316062927246, 0.60784316062927246),
(0.39915966987609863, 0.60392159223556519, 0.60392159223556519),
(0.40336135029792786, 0.60000002384185791, 0.60000002384185791),
(0.40756303071975708, 0.59607845544815063, 0.59607845544815063),
(0.4117647111415863, 0.58823531866073608, 0.58823531866073608),
(0.41596639156341553, 0.58431375026702881, 0.58431375026702881),
(0.42016807198524475, 0.58039218187332153, 0.58039218187332153),
(0.42436975240707397, 0.57647061347961426, 0.57647061347961426),
(0.4285714328289032, 0.57254904508590698, 0.57254904508590698),
(0.43277311325073242, 0.56862747669219971, 0.56862747669219971),
(0.43697479367256165, 0.56470590829849243, 0.56470590829849243),
(0.44117647409439087, 0.56078433990478516, 0.56078433990478516),
(0.44537815451622009, 0.55686277151107788, 0.55686277151107788),
(0.44957983493804932, 0.55294120311737061, 0.55294120311737061),
(0.45378151535987854, 0.54901963472366333, 0.54901963472366333),
(0.45798319578170776, 0.54509806632995605, 0.54509806632995605),
(0.46218487620353699, 0.54117649793624878, 0.54117649793624878),
(0.46638655662536621, 0.5372549295425415, 0.5372549295425415),
(0.47058823704719543, 0.53333336114883423, 0.53333336114883423),
(0.47478991746902466, 0.52549022436141968, 0.52549022436141968),
(0.47899159789085388, 0.5215686559677124, 0.5215686559677124),
(0.48319327831268311, 0.51764708757400513, 0.51764708757400513),
(0.48739495873451233, 0.51372551918029785, 0.51372551918029785),
(0.49159663915634155, 0.50980395078659058, 0.50980395078659058),
(0.49579831957817078, 0.5058823823928833, 0.5058823823928833), (0.5,
0.50196081399917603, 0.50196081399917603), (0.50420171022415161,
0.49803921580314636, 0.49803921580314636), (0.50840336084365845,
0.49411764740943909, 0.49411764740943909), (0.51260507106781006,
0.49019607901573181, 0.49019607901573181), (0.51680672168731689,
0.48627451062202454, 0.48627451062202454), (0.52100843191146851,
0.48235294222831726, 0.48235294222831726), (0.52521008253097534,
0.47843137383460999, 0.47843137383460999), (0.52941179275512695,
0.47450980544090271, 0.47450980544090271), (0.53361344337463379,
0.47058823704719543, 0.47058823704719543), (0.5378151535987854,
0.46274510025978088, 0.46274510025978088), (0.54201680421829224,
0.45882353186607361, 0.45882353186607361), (0.54621851444244385,
0.45490196347236633, 0.45490196347236633), (0.55042016506195068,
0.45098039507865906, 0.45098039507865906), (0.55462187528610229,
0.44705882668495178, 0.44705882668495178), (0.55882352590560913,
0.44313725829124451, 0.44313725829124451), (0.56302523612976074,
0.43921568989753723, 0.43921568989753723), (0.56722688674926758,
0.43529412150382996, 0.43529412150382996), (0.57142859697341919,
0.43137255311012268, 0.43137255311012268), (0.57563024759292603,
0.42745098471641541, 0.42745098471641541), (0.57983195781707764,
0.42352941632270813, 0.42352941632270813), (0.58403360843658447,
0.41960784792900085, 0.41960784792900085), (0.58823531866073608,
0.41568627953529358, 0.41568627953529358), (0.59243696928024292,
0.4117647111415863, 0.4117647111415863), (0.59663867950439453,
0.40784314274787903, 0.40784314274787903), (0.60084033012390137,
0.40000000596046448, 0.40000000596046448), (0.60504204034805298,
0.3960784375667572, 0.3960784375667572), (0.60924369096755981,
0.39215686917304993, 0.39215686917304993), (0.61344540119171143,
0.38823530077934265, 0.38823530077934265), (0.61764705181121826,
0.38431373238563538, 0.38431373238563538), (0.62184876203536987,
0.3803921639919281, 0.3803921639919281), (0.62605041265487671,
0.37647059559822083, 0.37647059559822083), (0.63025212287902832,
0.37254902720451355, 0.37254902720451355), (0.63445377349853516,
0.36862745881080627, 0.36862745881080627), (0.63865548372268677,
0.364705890417099, 0.364705890417099), (0.6428571343421936,
0.36078432202339172, 0.36078432202339172), (0.64705884456634521,
0.35686275362968445, 0.35686275362968445), (0.65126049518585205,
0.35294118523597717, 0.35294118523597717), (0.65546220541000366,
0.3490196168422699, 0.3490196168422699), (0.6596638560295105,
0.34509804844856262, 0.34509804844856262), (0.66386556625366211,
0.33725491166114807, 0.33725491166114807), (0.66806721687316895,
0.3333333432674408, 0.3333333432674408), (0.67226892709732056,
0.32941177487373352, 0.32941177487373352), (0.67647057771682739,
0.32549020648002625, 0.32549020648002625), (0.680672287940979,
0.32156863808631897, 0.32156863808631897), (0.68487393856048584,
0.31764706969261169, 0.31764706969261169), (0.68907564878463745,
0.31372550129890442, 0.31372550129890442), (0.69327729940414429,
0.30980393290519714, 0.30980393290519714), (0.6974790096282959,
0.30588236451148987, 0.30588236451148987), (0.70168066024780273,
0.30196079611778259, 0.30196079611778259), (0.70588237047195435,
0.29803922772407532, 0.29803922772407532), (0.71008402109146118,
0.29411765933036804, 0.29411765933036804), (0.71428573131561279,
0.29019609093666077, 0.29019609093666077), (0.71848738193511963,
0.28627452254295349, 0.28627452254295349), (0.72268909215927124,
0.28235295414924622, 0.28235295414924622), (0.72689074277877808,
0.27450981736183167, 0.27450981736183167), (0.73109245300292969,
0.27058824896812439, 0.27058824896812439), (0.73529410362243652,
0.26666668057441711, 0.26666668057441711), (0.73949581384658813,
0.26274511218070984, 0.26274511218070984), (0.74369746446609497,
0.25882354378700256, 0.25882354378700256), (0.74789917469024658,
0.25490197539329529, 0.25490197539329529), (0.75210082530975342,
0.25098040699958801, 0.25098040699958801), (0.75630253553390503,
0.24705882370471954, 0.24705882370471954), (0.76050418615341187,
0.24313725531101227, 0.24313725531101227), (0.76470589637756348,
0.23921568691730499, 0.23921568691730499), (0.76890754699707031,
0.23529411852359772, 0.23529411852359772), (0.77310925722122192,
0.23137255012989044, 0.23137255012989044), (0.77731090784072876,
0.22745098173618317, 0.22745098173618317), (0.78151261806488037,
0.22352941334247589, 0.22352941334247589), (0.78571426868438721,
0.21960784494876862, 0.21960784494876862), (0.78991597890853882,
0.21176470816135406, 0.21176470816135406), (0.79411762952804565,
0.20784313976764679, 0.20784313976764679), (0.79831933975219727,
0.20392157137393951, 0.20392157137393951), (0.8025209903717041,
0.20000000298023224, 0.20000000298023224), (0.80672270059585571,
0.19607843458652496, 0.19607843458652496), (0.81092435121536255,
0.19215686619281769, 0.19215686619281769), (0.81512606143951416,
0.18823529779911041, 0.18823529779911041), (0.819327712059021,
0.18431372940540314, 0.18431372940540314), (0.82352942228317261,
0.18039216101169586, 0.18039216101169586), (0.82773107290267944,
0.17647059261798859, 0.17647059261798859), (0.83193278312683105,
0.17254902422428131, 0.17254902422428131), (0.83613443374633789,
0.16862745583057404, 0.16862745583057404), (0.8403361439704895,
0.16470588743686676, 0.16470588743686676), (0.84453779458999634,
0.16078431904315948, 0.16078431904315948), (0.84873950481414795,
0.15686275064945221, 0.15686275064945221), (0.85294115543365479,
0.14901961386203766, 0.14901961386203766), (0.8571428656578064,
0.14509804546833038, 0.14509804546833038), (0.86134451627731323,
0.14117647707462311, 0.14117647707462311), (0.86554622650146484,
0.13725490868091583, 0.13725490868091583), (0.86974787712097168,
0.13333334028720856, 0.13333334028720856), (0.87394958734512329,
0.12941177189350128, 0.12941177189350128), (0.87815123796463013,
0.12549020349979401, 0.12549020349979401), (0.88235294818878174,
0.12156862765550613, 0.12156862765550613), (0.88655459880828857,
0.11764705926179886, 0.11764705926179886), (0.89075630903244019,
0.11372549086809158, 0.11372549086809158), (0.89495795965194702,
0.10980392247438431, 0.10980392247438431), (0.89915966987609863,
0.10588235408067703, 0.10588235408067703), (0.90336132049560547,
0.10196078568696976, 0.10196078568696976), (0.90756303071975708,
0.098039217293262482, 0.098039217293262482), (0.91176468133926392,
0.094117648899555206, 0.094117648899555206), (0.91596639156341553,
0.086274512112140656, 0.086274512112140656), (0.92016804218292236,
0.08235294371843338, 0.08235294371843338), (0.92436975240707397,
0.078431375324726105, 0.078431375324726105), (0.92857140302658081,
0.074509806931018829, 0.074509806931018829), (0.93277311325073242,
0.070588238537311554, 0.070588238537311554), (0.93697476387023926,
0.066666670143604279, 0.066666670143604279), (0.94117647409439087,
0.062745101749897003, 0.062745101749897003), (0.94537812471389771,
0.058823529630899429, 0.058823529630899429), (0.94957983493804932,
0.054901961237192154, 0.054901961237192154), (0.95378148555755615,
0.050980392843484879, 0.050980392843484879), (0.95798319578170776,
0.047058824449777603, 0.047058824449777603), (0.9621848464012146,
0.043137256056070328, 0.043137256056070328), (0.96638655662536621,
0.039215687662363052, 0.039215687662363052), (0.97058820724487305,
0.035294119268655777, 0.035294119268655777), (0.97478991746902466,
0.031372550874948502, 0.031372550874948502), (0.97899156808853149,
0.023529412224888802, 0.023529412224888802), (0.98319327831268311,
0.019607843831181526, 0.019607843831181526), (0.98739492893218994,
0.015686275437474251, 0.015686275437474251), (0.99159663915634155,
0.011764706112444401, 0.011764706112444401), (0.99579828977584839,
0.0078431377187371254, 0.0078431377187371254), (1.0,
0.0039215688593685627, 0.0039215688593685627)]}
Accent = colors.LinearSegmentedColormap('Accent', _Accent_data, LUTSIZE)
Blues = colors.LinearSegmentedColormap('Blues', _Blues_data, LUTSIZE)
BrBG = colors.LinearSegmentedColormap('BrBG', _BrBG_data, LUTSIZE)
BuGn = colors.LinearSegmentedColormap('BuGn', _BuGn_data, LUTSIZE)
BuPu = colors.LinearSegmentedColormap('BuPu', _BuPu_data, LUTSIZE)
Dark2 = colors.LinearSegmentedColormap('Dark2', _Dark2_data, LUTSIZE)
GnBu = colors.LinearSegmentedColormap('GnBu', _GnBu_data, LUTSIZE)
Greens = colors.LinearSegmentedColormap('Greens', _Greens_data, LUTSIZE)
Greys = colors.LinearSegmentedColormap('Greys', _Greys_data, LUTSIZE)
Oranges = colors.LinearSegmentedColormap('Oranges', _Oranges_data, LUTSIZE)
OrRd = colors.LinearSegmentedColormap('OrRd', _OrRd_data, LUTSIZE)
Paired = colors.LinearSegmentedColormap('Paired', _Paired_data, LUTSIZE)
Pastel1 = colors.LinearSegmentedColormap('Pastel1', _Pastel1_data, LUTSIZE)
Pastel2 = colors.LinearSegmentedColormap('Pastel2', _Pastel2_data, LUTSIZE)
PiYG = colors.LinearSegmentedColormap('PiYG', _PiYG_data, LUTSIZE)
PRGn = colors.LinearSegmentedColormap('PRGn', _PRGn_data, LUTSIZE)
PuBu = colors.LinearSegmentedColormap('PuBu', _PuBu_data, LUTSIZE)
PuBuGn = colors.LinearSegmentedColormap('PuBuGn', _PuBuGn_data, LUTSIZE)
PuOr = colors.LinearSegmentedColormap('PuOr', _PuOr_data, LUTSIZE)
PuRd = colors.LinearSegmentedColormap('PuRd', _PuRd_data, LUTSIZE)
Purples = colors.LinearSegmentedColormap('Purples', _Purples_data, LUTSIZE)
RdBu = colors.LinearSegmentedColormap('RdBu', _RdBu_data, LUTSIZE)
RdGy = colors.LinearSegmentedColormap('RdGy', _RdGy_data, LUTSIZE)
RdPu = colors.LinearSegmentedColormap('RdPu', _RdPu_data, LUTSIZE)
RdYlBu = colors.LinearSegmentedColormap('RdYlBu', _RdYlBu_data, LUTSIZE)
RdYlGn = colors.LinearSegmentedColormap('RdYlGn', _RdYlGn_data, LUTSIZE)
Reds = colors.LinearSegmentedColormap('Reds', _Reds_data, LUTSIZE)
Set1 = colors.LinearSegmentedColormap('Set1', _Set1_data, LUTSIZE)
Set2 = colors.LinearSegmentedColormap('Set2', _Set2_data, LUTSIZE)
Set3 = colors.LinearSegmentedColormap('Set3', _Set3_data, LUTSIZE)
Spectral = colors.LinearSegmentedColormap('Spectral', _Spectral_data, LUTSIZE)
YlGn = colors.LinearSegmentedColormap('YlGn', _YlGn_data, LUTSIZE)
YlGnBu = colors.LinearSegmentedColormap('YlGnBu', _YlGnBu_data, LUTSIZE)
YlOrBr = colors.LinearSegmentedColormap('YlOrBr', _YlOrBr_data, LUTSIZE)
YlOrRd = colors.LinearSegmentedColormap('YlOrRd', _YlOrRd_data, LUTSIZE)
gist_earth = colors.LinearSegmentedColormap('gist_earth', _gist_earth_data, LUTSIZE)
gist_gray = colors.LinearSegmentedColormap('gist_gray', _gist_gray_data, LUTSIZE)
gist_heat = colors.LinearSegmentedColormap('gist_heat', _gist_heat_data, LUTSIZE)
gist_ncar = colors.LinearSegmentedColormap('gist_ncar', _gist_ncar_data, LUTSIZE)
gist_rainbow = colors.LinearSegmentedColormap('gist_rainbow', _gist_rainbow_data, LUTSIZE)
gist_stern = colors.LinearSegmentedColormap('gist_stern', _gist_stern_data, LUTSIZE)
gist_yarg = colors.LinearSegmentedColormap('gist_yarg', _gist_yarg_data, LUTSIZE)
datad['Accent']=_Accent_data
datad['Blues']=_Blues_data
datad['BrBG']=_BrBG_data
datad['BuGn']=_BuGn_data
datad['BuPu']=_BuPu_data
datad['Dark2']=_Dark2_data
datad['GnBu']=_GnBu_data
datad['Greens']=_Greens_data
datad['Greys']=_Greys_data
datad['Oranges']=_Oranges_data
datad['OrRd']=_OrRd_data
datad['Paired']=_Paired_data
datad['Pastel1']=_Pastel1_data
datad['Pastel2']=_Pastel2_data
datad['PiYG']=_PiYG_data
datad['PRGn']=_PRGn_data
datad['PuBu']=_PuBu_data
datad['PuBuGn']=_PuBuGn_data
datad['PuOr']=_PuOr_data
datad['PuRd']=_PuRd_data
datad['Purples']=_Purples_data
datad['RdBu']=_RdBu_data
datad['RdGy']=_RdGy_data
datad['RdPu']=_RdPu_data
datad['RdYlBu']=_RdYlBu_data
datad['RdYlGn']=_RdYlGn_data
datad['Reds']=_Reds_data
datad['Set1']=_Set1_data
datad['Set2']=_Set2_data
datad['Set3']=_Set3_data
datad['Spectral']=_Spectral_data
datad['YlGn']=_YlGn_data
datad['YlGnBu']=_YlGnBu_data
datad['YlOrBr']=_YlOrBr_data
datad['YlOrRd']=_YlOrRd_data
datad['gist_earth']=_gist_earth_data
datad['gist_gray']=_gist_gray_data
datad['gist_heat']=_gist_heat_data
datad['gist_ncar']=_gist_ncar_data
datad['gist_rainbow']=_gist_rainbow_data
datad['gist_stern']=_gist_stern_data
datad['gist_yarg']=_gist_yarg_data
# reverse all the colormaps.
# reversed colormaps have '_r' appended to the name.
def revcmap(data):
data_r = {}
for key, val in data.iteritems():
valnew = [(1.-a, b, c) for a, b, c in reversed(val)]
data_r[key] = valnew
return data_r
cmapnames = datad.keys()
for cmapname in cmapnames:
cmapname_r = cmapname+'_r'
cmapdat_r = revcmap(datad[cmapname])
datad[cmapname_r] = cmapdat_r
locals()[cmapname_r] = colors.LinearSegmentedColormap(cmapname_r, cmapdat_r, LUTSIZE)
| agpl-3.0 |
dagnir/servo | python/mach/mach/registrar.py | 46 | 3774 | # This Source Code Form is subject to the terms of the Mozilla Public
# License, v. 2.0. If a copy of the MPL was not distributed with this
# file, You can obtain one at http://mozilla.org/MPL/2.0/.
from __future__ import absolute_import, unicode_literals
from .base import MachError
INVALID_COMMAND_CONTEXT = r'''
It looks like you tried to run a mach command from an invalid context. The %s
command failed to meet the following conditions: %s
Run |mach help| to show a list of all commands available to the current context.
'''.lstrip()
class MachRegistrar(object):
"""Container for mach command and config providers."""
def __init__(self):
self.command_handlers = {}
self.commands_by_category = {}
self.settings_providers = set()
self.categories = {}
self.require_conditions = False
def register_command_handler(self, handler):
name = handler.name
if not handler.category:
raise MachError('Cannot register a mach command without a '
'category: %s' % name)
if handler.category not in self.categories:
raise MachError('Cannot register a command to an undefined '
'category: %s -> %s' % (name, handler.category))
self.command_handlers[name] = handler
self.commands_by_category[handler.category].add(name)
def register_settings_provider(self, cls):
self.settings_providers.add(cls)
def register_category(self, name, title, description, priority=50):
self.categories[name] = (title, description, priority)
self.commands_by_category[name] = set()
@classmethod
def _condition_failed_message(cls, name, conditions):
msg = ['\n']
for c in conditions:
part = [' %s' % c.__name__]
if c.__doc__ is not None:
part.append(c.__doc__)
msg.append(' - '.join(part))
return INVALID_COMMAND_CONTEXT % (name, '\n'.join(msg))
def _run_command_handler(self, handler, context=None, debug_command=False, **kwargs):
cls = handler.cls
if handler.pass_context and not context:
raise Exception('mach command class requires context.')
if handler.pass_context:
instance = cls(context)
else:
instance = cls()
if handler.conditions:
fail_conditions = []
for c in handler.conditions:
if not c(instance):
fail_conditions.append(c)
if fail_conditions:
print(self._condition_failed_message(handler.name, fail_conditions))
return 1
fn = getattr(instance, handler.method)
if debug_command:
import pdb
result = pdb.runcall(fn, **kwargs)
else:
result = fn(**kwargs)
result = result or 0
assert isinstance(result, (int, long))
return result
def dispatch(self, name, context=None, argv=None, **kwargs):
"""Dispatch/run a command.
Commands can use this to call other commands.
"""
# TODO handler.subcommand_handlers are ignored
handler = self.command_handlers[name]
if handler.parser:
parser = handler.parser
# save and restore existing defaults so **kwargs don't persist across
# subsequent invocations of Registrar.dispatch()
old_defaults = parser._defaults.copy()
parser.set_defaults(**kwargs)
kwargs, _ = parser.parse_known_args(argv or [])
kwargs = vars(kwargs)
parser._defaults = old_defaults
return self._run_command_handler(handler, context=context, **kwargs)
Registrar = MachRegistrar()
| mpl-2.0 |
wangzhangup/cuda-convnet2 | layer.py | 162 | 82481 | # Copyright 2014 Google Inc. All rights reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
from math import exp
import sys
import ConfigParser as cfg
import os
import numpy as n
import numpy.random as nr
from math import ceil, floor
from collections import OrderedDict
from os import linesep as NL
from python_util.options import OptionsParser
import re
class LayerParsingError(Exception):
pass
# A neuron that doesn't take parameters
class NeuronParser:
def __init__(self, type, func_str, uses_acts=True, uses_inputs=True):
self.type = type
self.func_str = func_str
self.uses_acts = uses_acts
self.uses_inputs = uses_inputs
def parse(self, type):
if type == self.type:
return {'type': self.type,
'params': {},
'usesActs': self.uses_acts,
'usesInputs': self.uses_inputs}
return None
# A neuron that takes parameters
class ParamNeuronParser(NeuronParser):
neuron_regex = re.compile(r'^\s*(\w+)\s*\[\s*(\w+(\s*,\w+)*)\s*\]\s*$')
def __init__(self, type, func_str, uses_acts=True, uses_inputs=True):
NeuronParser.__init__(self, type, func_str, uses_acts, uses_inputs)
m = self.neuron_regex.match(type)
self.base_type = m.group(1)
self.param_names = m.group(2).split(',')
assert len(set(self.param_names)) == len(self.param_names)
def parse(self, type):
m = re.match(r'^%s\s*\[([\d,\.\s\-]*)\]\s*$' % self.base_type, type)
if m:
try:
param_vals = [float(v.strip()) for v in m.group(1).split(',')]
if len(param_vals) == len(self.param_names):
return {'type': self.base_type,
'params': dict(zip(self.param_names, param_vals)),
'usesActs': self.uses_acts,
'usesInputs': self.uses_inputs}
except TypeError:
pass
return None
class AbsTanhNeuronParser(ParamNeuronParser):
def __init__(self):
ParamNeuronParser.__init__(self, 'abstanh[a,b]', 'f(x) = a * |tanh(b * x)|')
def parse(self, type):
dic = ParamNeuronParser.parse(self, type)
# Make b positive, since abs(tanh(bx)) = abs(tanh(-bx)) and the C++ code
# assumes b is positive.
if dic:
dic['params']['b'] = abs(dic['params']['b'])
return dic
class ParamParser:
lrs_regex = re.compile(r'^\s*(\w+)\s*(?:\[\s*(\w+(\s*;\w+)*)\s*\])?\s*$')
param_converters = {'i': int,
'f': float}
def __init__(self, type):
m = self.lrs_regex.match(type)
self.base_type = m.group(1)
param_names_with_type = m.group(2).split(';') if m.group(2) is not None else []
self.param_names = [p[1:] for p in param_names_with_type]
self.param_types = [self.param_converters[p[0]] for p in param_names_with_type]
self.param_regex_inner = ";".join([('\s*%s\s*=\s*[^;,\s=]+\s*' % p) for p in self.param_names])
self.regex_str = ('^%s\s*(?:\[(%s)\])?\s*$') % (self.base_type, self.param_regex_inner)
assert len(set(self.param_names)) == len(self.param_names)
def parse(self, type):
m = re.match(self.regex_str, type, flags=re.IGNORECASE)
if m:
try:
param_vals = [ptype(v.split('=')[1].strip()) for ptype,v in zip(self.param_types, m.group(1).split(';'))] if m.group(1) is not None else []
if len(param_vals) == len(self.param_names):
return {'type': self.base_type,
'params': dict(zip(self.param_names, param_vals))}
except TypeError:
pass
return None
# Subclass that throws more convnet-specific exceptions than the default
class MyConfigParser(cfg.SafeConfigParser):
def safe_get(self, section, option, f=cfg.SafeConfigParser.get, typestr=None, default=None):
try:
return f(self, section, option)
except cfg.NoOptionError, e:
if default is not None:
return default
raise LayerParsingError("Layer '%s': required parameter '%s' missing" % (section, option))
except ValueError, e:
if typestr is None:
raise e
raise LayerParsingError("Layer '%s': parameter '%s' must be %s" % (section, option, typestr))
def safe_get_list(self, section, option, f=str, typestr='strings', default=None):
v = self.safe_get(section, option, default=default)
if type(v) == list:
return v
try:
return [f(x.strip()) for x in v.split(',')]
except:
raise LayerParsingError("Layer '%s': parameter '%s' must be ','-delimited list of %s" % (section, option, typestr))
def safe_get_int(self, section, option, default=None):
return self.safe_get(section, option, f=cfg.SafeConfigParser.getint, typestr='int', default=default)
def safe_get_float(self, section, option, default=None):
return self.safe_get(section, option, f=cfg.SafeConfigParser.getfloat, typestr='float', default=default)
def safe_get_bool(self, section, option, default=None):
return self.safe_get(section, option, f=cfg.SafeConfigParser.getboolean, typestr='bool', default=default)
def safe_get_float_list(self, section, option, default=None):
return self.safe_get_list(section, option, float, typestr='floats', default=default)
def safe_get_int_list(self, section, option, default=None):
return self.safe_get_list(section, option, int, typestr='ints', default=default)
def safe_get_bool_list(self, section, option, default=None):
return self.safe_get_list(section, option, lambda x: x.lower() in ('true', '1'), typestr='bools', default=default)
# A class that implements part of the interface of MyConfigParser
class FakeConfigParser(object):
def __init__(self, dic):
self.dic = dic
def safe_get(self, section, option, default=None):
if option in self.dic:
return self.dic[option]
return default
def safe_get_int(self, section, option, default=None):
return int(self.safe_get(section, option, default))
def safe_get_int_list(self, section, option, default=None):
return list(self.safe_get(section, option, default))
class LayerParser:
def __init__(self):
self.dic = {}
self.set_defaults()
# Post-processing step -- this is called after all layers have been initialized
def optimize(self, layers):
self.dic['actsTarget'] = -1
self.dic['actsGradTarget'] = -1
if len(set(len(l['gpu']) for l in layers.values() if 'inputs' in l and self.dic['name'] in l['inputs'])) > 1:
# print set(len(l['gpu']) for l in layers.values())
raise LayerParsingError("Layer '%s': all next layers must have equal number of replicas." % (self.dic['name']))
def parse_params(self, vals, parsers, param_name, human_name, num_params=1):
dic, name = self.dic, self.dic['name']
# print vals
if len(vals) != num_params and len(vals) != 1:
raise LayerParsingError("Layer '%s': expected list of length %d for %s but got list of length %d."% (name, num_params, param_name, len(vals)))
parsed = []
# print vals
for v in vals:
for p in parsers:
parsedv = p.parse(v)
if parsedv:
parsed += [parsedv]
break
if len(parsed) == 1 and num_params > 1:
parsed = parsed * num_params
if len(parsed) == num_params:
return parsed
# print parsed, vals
raise LayerParsingError("Layer '%s': unable to parse %s %s=%s." % (name, human_name, param_name, ",".join(vals)))
# Add parameters from layer parameter file
def add_params(self, mcp):
pass
# self.dic['conserveMem'] = mcp.convnet.op.get_value('conserve_mem') if mcp.convnet is not None else 0
def init(self, dic):
self.dic = dic
return self
def set_defaults(self):
self.dic['outputs'] = 0
self.dic['parser'] = self
self.dic['requiresParams'] = False
# Does this layer use its own activity matrix
# for some purpose other than computing its output?
# Usually, this will only be true for layers that require their
# own activity matrix for gradient computations. For example, layers
# with logistic units must compute the gradient y * (1 - y), where y is
# the activity matrix.
#
# Layers that do not not use their own activity matrix should advertise
# this, since this will enable memory-saving matrix re-use optimizations.
#
# The default value of this property is True, for safety purposes.
# If a layer advertises that it does not use its own activity matrix when
# in fact it does, bad things will happen.
self.dic['usesActs'] = True
# Does this layer use the activity matrices of its input layers
# for some purpose other than computing its output?
#
# Again true by default for safety
self.dic['usesInputs'] = True
# Force this layer to use its own activity gradient matrix,
# instead of borrowing one from one of its inputs.
#
# This should be true for layers where the mapping from output
# gradient to input gradient is non-elementwise.
self.dic['forceOwnActs'] = True
# Does this layer need the gradient at all?
# Should only be true for layers with parameters (weights).
self.dic['gradConsumer'] = False
# The gpu indices on which this layer runs
self.dic['gpu'] = [-1]
def parse(self, name, mcp, prev_layers, model=None):
self.prev_layers = prev_layers
self.dic['name'] = name
self.dic['type'] = mcp.safe_get(name, 'type')
self.dic['id'] = len(prev_layers)
return self.dic
def verify_float_range(self, v, param_name, _min, _max):
self.verify_num_range(v, param_name, _min, _max, strconv=lambda x: '%.3f' % x)
def verify_num_range(self, v, param_name, _min, _max, strconv=lambda x:'%d' % x):
if type(v) == list:
for i,vv in enumerate(v):
self._verify_num_range(vv, param_name, _min, _max, i, strconv=strconv)
else:
self._verify_num_range(v, param_name, _min, _max, strconv=strconv)
def _verify_num_range(self, v, param_name, _min, _max, input=-1, strconv=lambda x:'%d' % x):
layer_name = self.dic['name'] if input < 0 else '%s[%d]' % (self.dic['name'], input)
if _min is not None and _max is not None and (v < _min or v > _max):
raise LayerParsingError("Layer '%s': parameter '%s' must be in the range %s-%s" % (layer_name, param_name, strconv(_min), strconv(_max)))
elif _min is not None and v < _min:
raise LayerParsingError("Layer '%s': parameter '%s' must be greater than or equal to %s" % (layer_name, param_name, strconv(_min)))
elif _max is not None and v > _max:
raise LayerParsingError("Layer '%s': parameter '%s' must be smaller than or equal to %s" % (layer_name, param_name, strconv(_max)))
def verify_divisible(self, value, div, value_name, div_name=None, input_idx=0):
layer_name = self.dic['name'] if len(self.dic['inputs']) == 0 else '%s[%d]' % (self.dic['name'], input_idx)
if value % div != 0:
raise LayerParsingError("Layer '%s': parameter '%s' must be divisible by %s" % (layer_name, value_name, str(div) if div_name is None else "'%s'" % div_name))
def verify_str_in(self, value, param_name, lst, input_idx=-1):
lname = self.dic['name'] if input_idx == -1 else ('%s[%d]' % (self.dic['name'], input_idx))
if value not in lst:
raise LayerParsingError("Layer '%s': parameter '%s' must be one of %s" % (lname, param_name, ", ".join("'%s'" % s for s in lst)))
def verify_int_in(self, value, param_name, lst):
if value not in lst:
raise LayerParsingError("Layer '%s': parameter '%s' must be one of %s" % (self.dic['name'], param_name, ", ".join("'%d'" % s for s in lst)))
def verify_all_ints_in(self, values, param_name, lst):
if len([v for v in values if v not in lst]) > 0:
raise LayerParsingError("Layer '%s': all parameters to '%s' must be among %s" % (self.dic['name'], param_name, ", ".join("'%d'" % s for s in lst)))
def verify_input_dims(self, dims):
for i,d in enumerate(dims):
if d is not None and self.dic['numInputs'][i] != d: # first input must be labels
raise LayerParsingError("Layer '%s': dimensionality of input %d must be %d" % (self.dic['name'], i, d))
# This looks for neuron=x arguments in various layers, and creates
# separate layer definitions for them.
@staticmethod
def detach_neuron_layers(layers):
for name,l in layers.items():
if l['type'] != 'neuron' and 'neuron' in l and l['neuron']:
NeuronLayerParser().detach_neuron_layer(name, layers)
@staticmethod
def parse_layers(layer_cfg_path, param_cfg_path, model, layers={}):
try:
if not os.path.exists(layer_cfg_path):
raise LayerParsingError("Layer definition file '%s' does not exist" % layer_cfg_path)
if not os.path.exists(param_cfg_path):
raise LayerParsingError("Layer parameter file '%s' does not exist" % param_cfg_path)
if len(layers) == 0:
mcp = MyConfigParser(dict_type=OrderedDict)
mcp.readfp(open(layer_cfg_path))
for name in mcp.sections():
if not mcp.has_option(name, 'type'):
raise LayerParsingError("Layer '%s': no type given" % name)
ltype = mcp.safe_get(name, 'type')
if ltype not in layer_parsers:
raise LayerParsingError("Layer '%s': Unknown layer type: '%s'" % (name, ltype))
layers[name] = layer_parsers[ltype]().parse(name, mcp, layers, model)
LayerParser.detach_neuron_layers(layers)
for l in layers.values():
l['parser'].optimize(layers)
del l['parser']
for name,l in layers.items():
if not l['type'].startswith('cost.'):
found = max(name in l2['inputs'] for l2 in layers.values() if 'inputs' in l2)
if not found:
raise LayerParsingError("Layer '%s' of type '%s' is unused" % (name, l['type']))
mcp = MyConfigParser(dict_type=OrderedDict)
mcp.readfp(open(param_cfg_path))
# mcp.convnet = model
for name,l in layers.items():
if not mcp.has_section(name) and l['requiresParams']:
raise LayerParsingError("Layer '%s' of type '%s' requires extra parameters, but none given in file '%s'." % (name, l['type'], param_cfg_path))
lp = layer_parsers[l['type']]().init(l)
lp.add_params(mcp)
except LayerParsingError, e:
print e
sys.exit(1)
return layers
@staticmethod
def register_layer_parser(ltype, cls):
if ltype in layer_parsers:
raise LayerParsingError("Layer type '%s' already registered" % ltype)
layer_parsers[ltype] = cls
# Any layer that takes an input (i.e. non-data layer)
class LayerWithInputParser(LayerParser):
def __init__(self, num_inputs=-1):
LayerParser.__init__(self)
self.num_inputs = num_inputs
def verify_num_params(self, params, auto_expand=True):
for param in params:
if len(self.dic[param]) != len(self.dic['inputs']):
if auto_expand and len(self.dic[param]) == 1:
self.dic[param] *= len(self.dic['inputs'])
else:
raise LayerParsingError("Layer '%s': %s list length does not match number of inputs" % (self.dic['name'], param))
# layers: dictionary: name -> layer
def optimize(self, layers):
LayerParser.optimize(self, layers)
dic = self.dic
# Check if I have an input that no one else uses.
#print "Layer %s optimizing" % dic['name']
if not dic['forceOwnActs']:
for i, inp in enumerate(dic['inputLayers']):
if inp['outputs'] == dic['outputs'] and sum(('inputs' in ll) and (inp['name'] in ll['inputs']) for ll in layers.itervalues()) == 1:
# I can share my activity matrix with this layer
# if it does not use its activity matrix, and I
# do not need to remember my inputs.
# TODO: a dropout layer should always be able to overwrite
# its input. Make it so.
# print "Layer %s(uses inputs=%d), input %s(uses acts = %d)" % (dic['name'], dic['usesInputs'], inp['name'], inp['usesActs'])
if not inp['usesActs'] and not dic['usesInputs']:
dic['actsTarget'] = i
print "Layer %s using acts from layer %s" % (dic['name'], inp['name'])
# print "Layer '%s' sharing activity matrix with layer '%s'" % (dic['name'], l['name'])
# I can share my gradient matrix with this layer if we're on the same GPU.
# This is different from the logic for actsTarget because this guy doesn't
# have an actsGrad matrix on my GPU if our GPUs are different, so there's
# nothing to share.
if dic['gpu'] == inp['gpu']:
dic['actsGradTarget'] = i
# print "Layer '%s' sharing activity gradient matrix with layer '%s'" % (dic['name'], l['name'])
def parse(self, name, mcp, prev_layers, model=None):
dic = LayerParser.parse(self, name, mcp, prev_layers, model)
dic['inputs'] = [inp.strip() for inp in mcp.safe_get(name, 'inputs').split(',')]
for inp in dic['inputs']:
if inp not in prev_layers:
raise LayerParsingError("Layer '%s': input layer '%s' not defined" % (name, inp))
dic['inputLayers'] = [prev_layers[inp] for inp in dic['inputs']]
dic['gpu'] = mcp.safe_get_int_list(name, 'gpu', default=dic['inputLayers'][0]['gpu'])
dic['gpus'] = ", ".join('%s' % d for d in dic['gpu'])
dic['numReplicas'] = len(dic['gpu'])
if len(set(dic['gpu'])) != len(dic['gpu']):
raise LayerParsingError("Layer '%s': all replicas must run on different GPUs." % (name))
for inp in dic['inputs']:
# Data layers do not explicitly define how many replicas they have.
# The number of replicas for a data layer is given by the number of replicas
# in the next layer(s). So we set that here.
inpl = prev_layers[inp]
if inpl['type'] == 'data':
inpl['numReplicas'] = dic['numReplicas']
if inpl['numReplicas'] % dic['numReplicas'] != 0:
raise LayerParsingError("Layer '%s': number of replicas (%d) must divide number of replicas in all input layers (input %s has %d replicas)." % (name, dic['numReplicas'], inpl['name'], inpl['numReplicas']))
if len(set(inp['numReplicas'] for inp in dic['inputLayers'])) != 1:
raise LayerParsingError("Layer '%s': all input layers must have equal numbers of replicas." % (name))
# Need to also assert that all *next* layers have equal number of replicas but this is hard so it's done in Layer.optimize
for inp in dic['inputLayers']:
if inp['outputs'] == 0:
raise LayerParsingError("Layer '%s': input layer '%s' does not produce any output" % (name, inp['name']))
dic['numInputs'] = [inp['outputs'] for inp in dic['inputLayers']]
# Layers can declare a neuron activation function to apply to their output, as a shortcut
# to avoid declaring a separate neuron layer above themselves.
dic['neuron'] = mcp.safe_get(name, 'neuron', default="")
if self.num_inputs > 0 and len(dic['numInputs']) != self.num_inputs:
raise LayerParsingError("Layer '%s': number of inputs must be %d" % (name, self.num_inputs))
if model:
self.verify_all_ints_in(dic['gpu'], 'gpu', range(len(model.op.get_value('gpu'))))
return dic
def verify_img_size(self):
dic = self.dic
if dic['numInputs'][0] % dic['imgPixels'] != 0 or dic['imgSize'] * dic['imgSize'] != dic['imgPixels']:
raise LayerParsingError("Layer '%s': has %-d dimensional input, not interpretable as %d-channel images" % (dic['name'], dic['numInputs'][0], dic['channels']))
@staticmethod
def grad_consumers_below(dic):
if dic['gradConsumer']:
return True
if 'inputLayers' in dic:
return any(LayerWithInputParser.grad_consumers_below(l) for l in dic['inputLayers'])
def verify_no_grads(self):
if LayerWithInputParser.grad_consumers_below(self.dic):
raise LayerParsingError("Layer '%s': layers of type '%s' cannot propagate gradient and must not be placed over layers with parameters." % (self.dic['name'], self.dic['type']))
class NailbedLayerParser(LayerWithInputParser):
def __init__(self):
LayerWithInputParser.__init__(self, num_inputs=1)
def parse(self, name, mcp, prev_layers, model=None):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
dic['forceOwnActs'] = False
dic['usesActs'] = False
dic['usesInputs'] = False
dic['channels'] = mcp.safe_get_int(name, 'channels')
dic['stride'] = mcp.safe_get_int(name, 'stride')
self.verify_num_range(dic['channels'], 'channels', 1, None)
# Computed values
dic['imgPixels'] = dic['numInputs'][0] / dic['channels']
dic['imgSize'] = int(n.sqrt(dic['imgPixels']))
dic['outputsX'] = (dic['imgSize'] + dic['stride'] - 1) / dic['stride']
dic['start'] = (dic['imgSize'] - dic['stride'] * (dic['outputsX'] - 1)) / 2
dic['outputs'] = dic['channels'] * dic['outputsX']**2
self.verify_num_range(dic['outputsX'], 'outputsX', 0, None)
self.verify_img_size()
print "Initialized bed-of-nails layer '%s' on GPUs %s, producing %dx%d %d-channel output" % (name, dic['gpus'], dic['outputsX'], dic['outputsX'], dic['channels'])
return dic
class GaussianBlurLayerParser(LayerWithInputParser):
def __init__(self):
LayerWithInputParser.__init__(self, num_inputs=1)
def parse(self, name, mcp, prev_layers, model=None):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
dic['forceOwnActs'] = False
dic['usesActs'] = False
dic['usesInputs'] = False
dic['outputs'] = dic['numInputs'][0]
dic['channels'] = mcp.safe_get_int(name, 'channels')
dic['filterSize'] = mcp.safe_get_int(name, 'filterSize')
dic['stdev'] = mcp.safe_get_float(name, 'stdev')
self.verify_num_range(dic['channels'], 'channels', 1, None)
self.verify_int_in(dic['filterSize'], 'filterSize', [3, 5, 7, 9])
# Computed values
dic['imgPixels'] = dic['numInputs'][0] / dic['channels']
dic['imgSize'] = int(n.sqrt(dic['imgPixels']))
dic['filter'] = n.array([exp(-(dic['filterSize']/2 - i)**2 / float(2 * dic['stdev']**2))
for i in xrange(dic['filterSize'])], dtype=n.float32).reshape(1, dic['filterSize'])
dic['filter'] /= dic['filter'].sum()
self.verify_img_size()
if dic['filterSize'] > dic['imgSize']:
raise LayerParsingError("Later '%s': filter size (%d) must be smaller than image size (%d)." % (dic['name'], dic['filterSize'], dic['imgSize']))
print "Initialized Gaussian blur layer '%s', producing %dx%d %d-channel output" % (name, dic['imgSize'], dic['imgSize'], dic['channels'])
return dic
class HorizontalReflectionLayerParser(LayerWithInputParser):
def __init__(self):
LayerWithInputParser.__init__(self, num_inputs=1)
def parse(self, name, mcp, prev_layers, model=None):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
dic['outputs'] = dic['numInputs'][0]
dic['channels'] = mcp.safe_get_int(name, 'channels')
self.verify_num_range(dic['channels'], 'channels', 1, 3)
# Computed values
dic['imgPixels'] = dic['numInputs'][0] / dic['channels']
dic['imgSize'] = int(n.sqrt(dic['imgPixels']))
self.verify_img_size()
print "Initialized horizontal reflection layer '%s', producing %dx%d %d-channel output" % (name, dic['imgSize'], dic['imgSize'], dic['channels'])
return dic
class ResizeLayerParser(LayerWithInputParser):
def __init__(self):
LayerWithInputParser.__init__(self, num_inputs=1)
def parse(self, name, mcp, prev_layers, model=None):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
dic['forceOwnActs'] = False
dic['usesActs'] = False
dic['usesInputs'] = False
dic['channels'] = mcp.safe_get_int(name, 'channels')
dic['imgPixels'] = dic['numInputs'][0] / dic['channels']
dic['imgSize'] = int(n.sqrt(dic['imgPixels']))
dic['scale'] = mcp.safe_get_float(name, 'scale')
dic['tgtSize'] = int(floor(dic['imgSize'] / dic['scale']))
dic['tgtPixels'] = dic['tgtSize']**2
self.verify_num_range(dic['channels'], 'channels', 1, None)
# Really not recommended to use this for such severe scalings
self.verify_float_range(dic['scale'], 'scale', 0.5, 2)
dic['outputs'] = dic['channels'] * dic['tgtPixels']
self.verify_img_size()
self.verify_no_grads()
print "Initialized resize layer '%s', producing %dx%d %d-channel output" % (name, dic['tgtSize'], dic['tgtSize'], dic['channels'])
return dic
class RandomScaleLayerParser(LayerWithInputParser):
def __init__(self):
LayerWithInputParser.__init__(self, num_inputs=1)
def parse(self, name, mcp, prev_layers, model=None):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
dic['forceOwnActs'] = False
dic['usesActs'] = False
dic['usesInputs'] = False
dic['channels'] = mcp.safe_get_int(name, 'channels')
self.verify_num_range(dic['channels'], 'channels', 1, None)
# Computed values
dic['imgPixels'] = dic['numInputs'][0] / dic['channels']
dic['imgSize'] = int(n.sqrt(dic['imgPixels']))
dic['maxScale'] = mcp.safe_get_float(name, 'maxScale')
dic['tgtSize'] = mcp.safe_get_int(name, 'tgtSize')
min_size = int(floor(dic['imgSize'] / dic['maxScale']))
max_size = dic['imgSize'] #int(floor(dic['imgSize'] * dic['maxScale']))
if dic['tgtSize'] < min_size:
raise LayerParsingError("Layer '%s': target size must be greater than minimum image size after rescaling (%d)" % (name, min_size))
if dic['tgtSize'] > max_size:
raise LayerParsingError("Layer '%s': target size must be smaller than maximum image size after rescaling (%d)" % (name, max_size))
dic['tgtPixels'] = dic['tgtSize']**2
self.verify_float_range(dic['maxScale'], 'maxScale', 1, 2)
dic['outputs'] = dic['channels'] * dic['tgtPixels']
self.verify_img_size()
self.verify_no_grads()
print "Initialized random scale layer '%s', producing %dx%d %d-channel output" % (name, dic['tgtSize'], dic['tgtSize'], dic['channels'])
return dic
class CropLayerParser(LayerWithInputParser):
def __init__(self):
LayerWithInputParser.__init__(self, num_inputs=1)
def parse(self, name, mcp, prev_layers, model=None):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
dic['forceOwnActs'] = False
dic['usesActs'] = False
dic['usesInputs'] = False
dic['channels'] = mcp.safe_get_int(name, 'channels')
self.verify_num_range(dic['channels'], 'channels', 1, None)
dic['startX'] = mcp.safe_get_int(name, 'startX')
dic['startY'] = mcp.safe_get_int(name, 'startY', default=dic['startX'])
dic['sizeX'] = mcp.safe_get_int(name, 'sizeX')
# Computed values
dic['imgPixels'] = dic['numInputs'][0] / dic['channels']
dic['imgSize'] = int(n.sqrt(dic['imgPixels']))
dic['outputs'] = dic['channels'] * (dic['sizeX']**2)
self.verify_num_range(dic['startX'], 'startX', 0, dic['imgSize']-1)
self.verify_num_range(dic['sizeX'], 'sizeX', 1, dic['imgSize'])
self.verify_num_range(dic['startY'], 'startY', 0, dic['imgSize']-1)
self.verify_img_size()
self.verify_no_grads()
if dic['startX'] + dic['sizeX'] > dic['imgSize']:
raise LayerParsingError("Layer '%s': startX (%d) + sizeX (%d) > imgSize (%d)" % (name, dic['startX'], dic['sizeX'], dic['imgSize']))
print "Initialized cropping layer '%s', producing %dx%d %d-channel output" % (name, dic['sizeX'], dic['sizeX'], dic['channels'])
return dic
class ColorTransformLayerParser(LayerWithInputParser):
def __init__(self):
LayerWithInputParser.__init__(self, num_inputs=1)
def parse(self, name, mcp, prev_layers, model=None):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
dic['forceOwnActs'] = False
dic['usesActs'] = False
dic['usesInputs'] = False
# Computed values
dic['imgPixels'] = dic['numInputs'][0] / 3
dic['imgSize'] = int(n.sqrt(dic['imgPixels']))
dic['channels'] = 3
dic['outputs'] = dic['numInputs'][0]
self.verify_img_size()
self.verify_no_grads()
return dic
class RGBToYUVLayerParser(ColorTransformLayerParser):
def __init__(self):
ColorTransformLayerParser.__init__(self)
def parse(self, name, mcp, prev_layers, model=None):
dic = ColorTransformLayerParser.parse(self, name, mcp, prev_layers, model)
print "Initialized RGB --> YUV layer '%s', producing %dx%d %d-channel output" % (name, dic['imgSize'], dic['imgSize'], dic['channels'])
return dic
class RGBToLABLayerParser(ColorTransformLayerParser):
def __init__(self):
ColorTransformLayerParser.__init__(self)
def parse(self, name, mcp, prev_layers, model=None):
dic = ColorTransformLayerParser.parse(self, name, mcp, prev_layers, model)
dic['center'] = mcp.safe_get_bool(name, 'center', default=False)
print "Initialized RGB --> LAB layer '%s', producing %dx%d %d-channel output" % (name, dic['imgSize'], dic['imgSize'], dic['channels'])
return dic
class NeuronLayerParser(LayerWithInputParser):
def __init__(self):
LayerWithInputParser.__init__(self, num_inputs=1)
@staticmethod
def get_unused_layer_name(layers, wish):
if wish not in layers:
return wish
for i in xrange(1, 100):
name = '%s.%d' % (wish, i)
if name not in layers:
return name
raise LayerParsingError("This is insane.")
def parse_neuron(self, neuron_str):
for n in neuron_parsers:
p = n.parse(neuron_str)
if p: # Successfully parsed neuron, return it
self.dic['neuron'] = p
self.dic['usesActs'] = self.dic['neuron']['usesActs']
self.dic['usesInputs'] = self.dic['neuron']['usesInputs']
return
# Could not parse neuron
# Print available neuron types
colnames = ['Neuron type', 'Function']
m = max(len(colnames[0]), OptionsParser._longest_value(neuron_parsers, key=lambda x:x.type)) + 2
ntypes = [OptionsParser._bold(colnames[0].ljust(m))] + [n.type.ljust(m) for n in neuron_parsers]
fnames = [OptionsParser._bold(colnames[1])] + [n.func_str for n in neuron_parsers]
usage_lines = NL.join(ntype + fname for ntype,fname in zip(ntypes, fnames))
raise LayerParsingError("Layer '%s': unable to parse neuron type '%s'. Valid neuron types: %sWhere neurons have parameters, they must be floats." % (self.dic['name'], neuron_str, NL + usage_lines + NL))
def detach_neuron_layer(self, src_name, layers):
dic = self.dic
# self.set_defaults()
dic['name'] = NeuronLayerParser.get_unused_layer_name(layers, '%s_neuron' % src_name)
dic['type'] = 'neuron'
dic['inputs'] = src_name
dic['neuron'] = layers[src_name]['neuron']
dic['gpu'] = layers[src_name]['gpu']
# Yes it's not entirely correct to pass all of layers as prev_layers, but it's harmless
dic = self.parse(dic['name'], FakeConfigParser(dic), layers)
dic['src_layer'] = src_name
# Link upper layers to this new one
for l in layers.values():
if 'inputs' in l:
l['inputs'] = [inp if inp != src_name else dic['name'] for inp in l['inputs']]
l['inputLayers'] = [inp if inp['name'] != src_name else dic for inp in l['inputLayers']]
layers[dic['name']] = dic
def parse(self, name, mcp, prev_layers, model=None):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
dic['outputs'] = dic['numInputs'][0]
self.parse_neuron(dic['neuron'])
dic['forceOwnActs'] = False
print "Initialized neuron layer '%s' on GPUs %s, producing %d outputs" % (name, dic['gpus'], dic['outputs'])
return dic
class EltwiseSumLayerParser(LayerWithInputParser):
def __init__(self):
LayerWithInputParser.__init__(self)
def add_params(self, mcp):
LayerWithInputParser.add_params(self, mcp)
dic, name = self.dic, self.dic['name']
dic['coeffs'] = mcp.safe_get_float_list(name, 'coeffs', default=[1.0] * len(dic['inputs']))
def parse(self, name, mcp, prev_layers, model):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
if len(set(dic['numInputs'])) != 1:
raise LayerParsingError("Layer '%s': all inputs must have the same dimensionality. Got dimensionalities: %s" % (name, ", ".join(str(s) for s in dic['numInputs'])))
dic['outputs'] = dic['numInputs'][0]
dic['usesInputs'] = False
dic['usesActs'] = False
dic['forceOwnActs'] = False
dic['requiresParams'] = True
print "Initialized elementwise sum layer '%s' on GPUs %s, producing %d outputs" % (name, dic['gpus'], dic['outputs'])
return dic
class EltwiseMaxLayerParser(LayerWithInputParser):
def __init__(self):
LayerWithInputParser.__init__(self)
def parse(self, name, mcp, prev_layers, model):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
if len(dic['inputs']) < 2:
raise LayerParsingError("Layer '%s': elementwise max layer must have at least 2 inputs, got %d." % (name, len(dic['inputs'])))
if len(set(dic['numInputs'])) != 1:
raise LayerParsingError("Layer '%s': all inputs must have the same dimensionality. Got dimensionalities: %s" % (name, ", ".join(str(s) for s in dic['numInputs'])))
dic['outputs'] = dic['numInputs'][0]
print "Initialized elementwise max layer '%s' on GPUs %s, producing %d outputs" % (name, dic['gpus'], dic['outputs'])
return dic
class SumLayerParser(LayerWithInputParser):
def __init__(self):
LayerWithInputParser.__init__(self, num_inputs=1)
def parse(self, name, mcp, prev_layers, model):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
dic['stride'] = mcp.safe_get_int(name, 'stride', default=1)
self.verify_divisible(dic['numInputs'][0], dic['stride'], 'input dimensionality', 'stride')
dic['outputs'] = dic['numInputs'][0] / dic['stride']
print "Initialized sum layer '%s' on GPUs %s, producing %d outputs" % (name, dic['gpus'], dic['outputs'])
return dic
class DropoutLayerParser(LayerWithInputParser):
def __init__(self):
LayerWithInputParser.__init__(self, num_inputs=1)
def add_params(self, mcp):
LayerWithInputParser.add_params(self, mcp)
dic, name = self.dic, self.dic['name']
dic['enable'] = mcp.safe_get_bool(name, 'enable', default=True)
dic['keep'] = mcp.safe_get_float(name, 'keep', default=0.5)
def parse(self, name, mcp, prev_layers, model):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
dic['requiresParams'] = True
dic['usesInputs'] = False
dic['usesActs'] = False
dic['forceOwnActs'] = False
dic['outputs'] = dic['numInputs'][0]
print "Initialized %s layer '%s' on GPUs %s, producing %d outputs" % (dic['type'], name, dic['gpus'], dic['outputs'])
return dic
class Dropout2LayerParser(DropoutLayerParser):
def __init__(self):
DropoutLayerParser.__init__(self)
class WeightLayerParser(LayerWithInputParser):
LAYER_PAT = re.compile(r'^\s*([^\s\[]+)(?:\[(\d+)\])?\s*$') # matches things like layername[5], etc
def __init__(self, num_inputs=-1):
LayerWithInputParser.__init__(self, num_inputs=num_inputs)
@staticmethod
def get_layer_name(name_str):
m = WeightLayerParser.LAYER_PAT.match(name_str)
if not m:
return None
return m.group(1), m.group(2)
def add_params(self, mcp):
LayerWithInputParser.add_params(self, mcp)
dic, name = self.dic, self.dic['name']
dic['momW'] = mcp.safe_get_float_list(name, 'momW')
dic['momB'] = mcp.safe_get_float(name, 'momB')
dic['superEps'] = mcp.safe_get_float(name, 'superEps', default=0.0)
dic['superMom'] = mcp.safe_get_float(name, 'superMom', default=0.0)
dic['wc'] = mcp.safe_get_float_list(name, 'wc', default=[0.0] * len(dic['inputs']))
dic['wball'] = mcp.safe_get_float_list(name, 'wball', default=[0.0] * len(dic['inputs']))
self.verify_num_params(['momW', 'wc', 'wball'])
# dic['wballNormed'] = [wball * nweights for wball,nweights in zip(dic['wball'], dic['weightsPerFilter'])]
dic['wballNormed'] = dic['wball']
# Convert from old-style 0.001,0.02 hyperparam specification to new-stye
# const[base=0.001],const[base=0.02] and so forth
def convert_scalars_to_schedules(scalars):
parts = scalars.split(',')
for i,p in enumerate(parts):
p = p.strip()
if re.match('(?:\d*\.)?\d+$', p):
parts[i] = 'const[base=%s]' % p
return parts
dic['epsW'] = self.parse_params(convert_scalars_to_schedules(mcp.safe_get(name, 'epsW')), lrs_parsers, 'epsW', 'learning rate schedule', num_params=len(dic['inputs']))
dic['epsB'] = self.parse_params(convert_scalars_to_schedules(mcp.safe_get(name, 'epsB')), lrs_parsers, 'epsB', 'learning rate schedule', num_params=1)[0]
dic['updatePeriod'] = mcp.safe_get_int(name, 'updatePeriod', default=0) # 0 means update as often as possible
# TODO: assert that updatePeriod is a multiple of active pass period, which is unknown here.
# the assert has to go in some post-processing step..
dic['gradConsumer'] = dic['epsB']['params']['base'] > 0 or any(w['params']['base'] > 0 for w in dic['epsW'])
@staticmethod
def unshare_weights(layer, layers, matrix_idx=None):
def unshare(layer, layers, indices):
for i in indices:
if layer['weightSourceLayers'][i] >= 0:
src_matrix_idx = layer['weightSourceMatrixIndices'][i]
layer['weightSourceLayers'][i] = ""
layer['weightSourceMatrixIndices'][i] = -1
layer['weights'][i] = layer['weights'][i].copy()
layer['weightsInc'][i] = n.zeros_like(layer['weights'][i])
print "Unshared weight matrix %s[%d] from %s[%d]." % (layer['name'], i, layer['weightSourceLayers'][i], src_matrix_idx)
else:
print "Weight matrix %s[%d] already unshared." % (layer['name'], i)
if 'weightSourceLayers' in layer:
unshare(layer, layers, range(len(layer['inputs'])) if matrix_idx is None else [matrix_idx])
# Load weight/biases initialization module
def call_init_func(self, param_name, shapes, input_idx=-1):
dic = self.dic
func_pat = re.compile('^([^\.]+)\.([^\(\)]+)\s*(?:\(([^,]+(?:,[^,]+)*)\))?$')
m = func_pat.match(dic[param_name])
if not m:
raise LayerParsingError("Layer '%s': '%s' parameter must have format 'moduleName.functionName(param1,param2,...)'; got: %s." % (dic['name'], param_name, dic['initWFunc']))
module, func = m.group(1), m.group(2)
params = m.group(3).split(',') if m.group(3) is not None else []
try:
mod = __import__(module)
return getattr(mod, func)(dic['name'], input_idx, shapes, params=params) if input_idx >= 0 else getattr(mod, func)(dic['name'], shapes, params=params)
except (ImportError, AttributeError, TypeError), e:
raise LayerParsingError("Layer '%s': %s." % (dic['name'], e))
def make_weights(self, initW, rows, cols, order='C'):
dic = self.dic
dic['weights'], dic['weightsInc'] = [], []
if dic['initWFunc']: # Initialize weights from user-supplied python function
# Initialization function is supplied in the format
# module.func
for i in xrange(len(dic['inputs'])):
dic['weights'] += [self.call_init_func('initWFunc', (rows[i], cols[i]), input_idx=i)]
if type(dic['weights'][i]) != n.ndarray:
raise LayerParsingError("Layer '%s[%d]': weight initialization function %s must return numpy.ndarray object. Got: %s." % (dic['name'], i, dic['initWFunc'], type(dic['weights'][i])))
if dic['weights'][i].dtype != n.float32:
raise LayerParsingError("Layer '%s[%d]': weight initialization function %s must weight matrices consisting of single-precision floats. Got: %s." % (dic['name'], i, dic['initWFunc'], dic['weights'][i].dtype))
if dic['weights'][i].shape != (rows[i], cols[i]):
raise LayerParsingError("Layer '%s[%d]': weight matrix returned by weight initialization function %s has wrong shape. Should be: %s; got: %s." % (dic['name'], i, dic['initWFunc'], (rows[i], cols[i]), dic['weights'][i].shape))
# Convert to desired order
dic['weights'][i] = n.require(dic['weights'][i], requirements=order)
dic['weightsInc'] += [n.zeros_like(dic['weights'][i])]
print "Layer '%s[%d]' initialized weight matrices from function %s" % (dic['name'], i, dic['initWFunc'])
else:
for i in xrange(len(dic['inputs'])):
if dic['weightSourceLayers'][i] != '': # Shared weight matrix
src_layer = self.prev_layers[dic['weightSourceLayers'][i]] if dic['weightSourceLayers'][i] != dic['name'] else dic
dic['weights'] += [src_layer['weights'][dic['weightSourceMatrixIndices'][i]]]
dic['weightsInc'] += [src_layer['weightsInc'][dic['weightSourceMatrixIndices'][i]]]
if dic['weights'][i].shape != (rows[i], cols[i]):
raise LayerParsingError("Layer '%s': weight sharing source matrix '%s' has shape %dx%d; should be %dx%d."
% (dic['name'], dic['weightSource'][i], dic['weights'][i].shape[0], dic['weights'][i].shape[1], rows[i], cols[i]))
print "Layer '%s' initialized weight matrix %d from %s" % (dic['name'], i, dic['weightSource'][i])
else:
dic['weights'] += [n.array(initW[i] * nr.randn(rows[i], cols[i]), dtype=n.single, order=order)]
dic['weightsInc'] += [n.zeros_like(dic['weights'][i])]
def make_biases(self, rows, cols, order='C'):
dic = self.dic
if dic['initBFunc']:
dic['biases'] = self.call_init_func('initBFunc', (rows, cols))
if type(dic['biases']) != n.ndarray:
raise LayerParsingError("Layer '%s': bias initialization function %s must return numpy.ndarray object. Got: %s." % (dic['name'], dic['initBFunc'], type(dic['biases'])))
if dic['biases'].dtype != n.float32:
raise LayerParsingError("Layer '%s': bias initialization function %s must return numpy.ndarray object consisting of single-precision floats. Got: %s." % (dic['name'], dic['initBFunc'], dic['biases'].dtype))
if dic['biases'].shape != (rows, cols):
raise LayerParsingError("Layer '%s': bias vector returned by bias initialization function %s has wrong shape. Should be: %s; got: %s." % (dic['name'], dic['initBFunc'], (rows, cols), dic['biases'].shape))
dic['biases'] = n.require(dic['biases'], requirements=order)
print "Layer '%s' initialized bias vector from function %s" % (dic['name'], dic['initBFunc'])
else:
dic['biases'] = dic['initB'] * n.ones((rows, cols), order=order, dtype=n.single)
dic['biasesInc'] = n.zeros_like(dic['biases'])
def parse(self, name, mcp, prev_layers, model):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
dic['requiresParams'] = True
dic['gradConsumer'] = True
dic['usesActs'] = False
dic['initW'] = mcp.safe_get_float_list(name, 'initW', default=0.01)
dic['initB'] = mcp.safe_get_float(name, 'initB', default=0)
dic['initWFunc'] = mcp.safe_get(name, 'initWFunc', default="")
dic['initBFunc'] = mcp.safe_get(name, 'initBFunc', default="")
# Find shared weight matrices
dic['weightSource'] = mcp.safe_get_list(name, 'weightSource', default=[''] * len(dic['inputs']))
self.verify_num_params(['initW'])
self.verify_num_params(['weightSource'], auto_expand=False)
dic['weightSourceLayers'] = []
dic['weightSourceMatrixIndices'] = []
for i, src_name in enumerate(dic['weightSource']):
src_layer_matrix_idx = -1
src_layer_name = ''
if src_name != '':
src_layer_match = WeightLayerParser.get_layer_name(src_name)
if src_layer_match is None:
raise LayerParsingError("Layer '%s': unable to parse weight sharing source '%s'. Format is layer[idx] or just layer, in which case idx=0 is used." % (name, src_name))
src_layer_name = src_layer_match[0]
src_layer_matrix_idx = int(src_layer_match[1]) if src_layer_match[1] is not None else 0
if src_layer_name not in prev_layers and src_layer_name != name:
raise LayerParsingError("Layer '%s': weight sharing source layer '%s' does not exist." % (name, src_layer_name))
# src_layer_idx = prev_names.index(src_layer_name) if src_layer_name != name else len(prev_names)
src_layer = prev_layers[src_layer_name] if src_layer_name != name else dic
if src_layer['gpu'] != dic['gpu']:
raise LayerParsingError("Layer '%s': weight sharing source layer '%s' runs on GPUs %s, while '%s' runs on GPUs %s." % (name, src_layer_name, src_layer['gpu'], name, dic['gpu']))
if src_layer['type'] != dic['type']:
raise LayerParsingError("Layer '%s': weight sharing source layer '%s' is of type '%s'; should be '%s'." % (name, src_layer_name, src_layer['type'], dic['type']))
if src_layer_name != name and len(src_layer['weights']) <= src_layer_matrix_idx:
raise LayerParsingError("Layer '%s': weight sharing source layer '%s' has %d weight matrices, but '%s[%d]' requested." % (name, src_layer_name, len(src_layer['weights']), src_name, src_layer_matrix_idx))
if src_layer_name == name and src_layer_matrix_idx >= i:
raise LayerParsingError("Layer '%s': weight sharing source '%s[%d]' not defined yet." % (name, name, src_layer_matrix_idx))
dic['weightSourceLayers'] += [src_layer_name]
dic['weightSourceMatrixIndices'] += [src_layer_matrix_idx]
return dic
class FCLayerParser(WeightLayerParser):
def __init__(self):
WeightLayerParser.__init__(self)
def parse(self, name, mcp, prev_layers, model):
dic = WeightLayerParser.parse(self, name, mcp, prev_layers, model)
dic['outputs'] = mcp.safe_get_int(name, 'outputs')
dic['weightsPerFilter'] = dic['numInputs']
self.verify_num_range(dic['outputs'], 'outputs', 1, None)
self.make_weights(dic['initW'], dic['numInputs'], [dic['outputs']] * len(dic['numInputs']), order='F')
self.make_biases(1, dic['outputs'], order='F')
print "Initialized fully-connected layer '%s' on GPUs %s, producing %d outputs" % (name, dic['gpus'], dic['outputs'])
return dic
class SplitFCLayerParser(WeightLayerParser):
def __init__(self):
WeightLayerParser.__init__(self)
def parse(self, name, mcp, prev_layers, model):
dic = WeightLayerParser.parse(self, name, mcp, prev_layers, model)
dic['parts'] = mcp.safe_get_int(name, 'parts')
dic['outputs'] = mcp.safe_get_int(name, 'outputs') * dic['parts']
dic['weightsPerFilter'] = dic['numInputs']
self.verify_num_range(dic['parts'], 'parts', 1, None)
self.make_weights(dic['initW'], dic['numInputs'], [dic['outputs']/dic['parts']] * len(dic['numInputs']), order='F')
self.make_biases(1, dic['outputs'], order='F')
for i in xrange(len(dic['numInputs'])):
self.verify_divisible(dic['numInputs'][i], dic['parts'], 'numInputs', 'parts', input_idx=i)
print "Initialized split fully-connected layer '%s' on GPUs %s, producing %d outputs in %d parts" % (name, dic['gpus'], dic['outputs'], dic['parts'])
return dic
class LocalLayerParser(WeightLayerParser):
def __init__(self):
WeightLayerParser.__init__(self)
# Convert convolutional layer to unshared, locally-connected layer
@staticmethod
def conv_to_local(layers, lname):
layer = layers[lname]
if layer['type'] == 'conv':
layer['type'] = 'local'
for inp,inpname in enumerate(layer['inputs']):
src_layer_name = layer['weightSourceLayers'][inp]
if src_layer_name != '':
src_layer = layers[src_layer_name]
src_matrix_idx = layer['weightSourceMatrixIndices'][inp]
LocalLayerParser.conv_to_local(layers, src_layer_name)
for w in ('weights', 'weightsInc'):
layer[w][inp] = src_layer[w][src_matrix_idx]
else:
layer['weights'][inp] = n.require(n.reshape(n.tile(n.reshape(layer['weights'][inp], (1, n.prod(layer['weights'][inp].shape))), (layer['modules'], 1)),
(layer['modules'] * layer['filterChannels'][inp] * layer['filterPixels'][inp], layer['filters'])),
requirements='C')
layer['weightsInc'][inp] = n.zeros_like(layer['weights'][inp])
if layer['sharedBiases']:
layer['biases'] = n.require(n.repeat(layer['biases'], layer['modules'], axis=0), requirements='C')
layer['biasesInc'] = n.zeros_like(layer['biases'])
print "Converted layer '%s' from convolutional to unshared, locally-connected" % layer['name']
# Also call this function on any layers sharing my weights
for l in layers:
if 'weightSourceLayers' in l and lname in l['weightSourceLayers']:
LocalLayerParser.conv_to_local(layers, l)
return layer
def parse(self, name, mcp, prev_layers, model):
dic = WeightLayerParser.parse(self, name, mcp, prev_layers, model)
dic['requiresParams'] = True
dic['usesActs'] = False
# Supplied values
dic['channels'] = mcp.safe_get_int_list(name, 'channels')
dic['padding'] = mcp.safe_get_int_list(name, 'padding', default=[0]*len(dic['inputs']))
dic['stride'] = mcp.safe_get_int_list(name, 'stride', default=[1]*len(dic['inputs']))
dic['filterSize'] = mcp.safe_get_int_list(name, 'filterSize')
dic['filters'] = mcp.safe_get_int_list(name, 'filters')
dic['groups'] = mcp.safe_get_int_list(name, 'groups', default=[1]*len(dic['inputs']))
dic['initW'] = mcp.safe_get_float_list(name, 'initW')
dic['initCFunc'] = mcp.safe_get(name, 'initCFunc', default='')
dic['modulesX'] = mcp.safe_get_int(name, 'modulesX', default=0)
self.verify_num_params(['channels', 'padding', 'stride', 'filterSize', \
'filters', 'groups', 'initW'])
self.verify_num_range(dic['stride'], 'stride', 1, None)
self.verify_num_range(dic['filterSize'],'filterSize', 1, None)
self.verify_num_range(dic['padding'], 'padding', 0, None)
self.verify_num_range(dic['channels'], 'channels', 1, None)
self.verify_num_range(dic['groups'], 'groups', 1, None)
self.verify_num_range(dic['modulesX'], 'modulesX', 0, None)
for i in xrange(len(dic['filters'])):
self.verify_divisible(dic['filters'][i], 16, 'filters', input_idx=i)
# Computed values
dic['imgPixels'] = [numInputs/channels for numInputs,channels in zip(dic['numInputs'], dic['channels'])]
dic['imgSize'] = [int(n.sqrt(imgPixels)) for imgPixels in dic['imgPixels']]
self.verify_num_range(dic['imgSize'], 'imgSize', 1, None)
dic['filters'] = [filters*groups for filters,groups in zip(dic['filters'], dic['groups'])]
dic['filterPixels'] = [filterSize**2 for filterSize in dic['filterSize']]
if dic['modulesX'] <= 0:
dic['modulesX'] = [1 + int(ceil((2*padding + imgSize - filterSize) / float(stride))) for padding,imgSize,filterSize,stride in zip(dic['padding'], dic['imgSize'], dic['filterSize'], dic['stride'])]
else:
dic['modulesX'] = [dic['modulesX']] * len(dic['inputs'])
dic['filterChannels'] = [channels/groups for channels,groups in zip(dic['channels'], dic['groups'])]
if len(set(dic['modulesX'])) != 1 or len(set(dic['filters'])) != 1:
raise LayerParsingError("Layer '%s': all inputs must produce equally-dimensioned output. Dimensions are: %s." % (name, ", ".join("%dx%dx%d" % (filters, modulesX, modulesX) for filters,modulesX in zip(dic['filters'], dic['modulesX']))))
dic['modulesX'] = dic['modulesX'][0]
dic['modules'] = dic['modulesX']**2
dic['filters'] = dic['filters'][0]
dic['outputs'] = dic['modules'] * dic['filters']
# dic['filterConns'] = [[]] * len(dic['inputs'])
for i in xrange(len(dic['inputs'])):
if dic['numInputs'][i] % dic['imgPixels'][i] != 0 or dic['imgSize'][i] * dic['imgSize'][i] != dic['imgPixels'][i]:
raise LayerParsingError("Layer '%s[%d]': has %-d dimensional input, not interpretable as square %d-channel images" % (name, i, dic['numInputs'][i], dic['channels'][i]))
if dic['channels'][i] > 3 and dic['channels'][i] % 4 != 0:
raise LayerParsingError("Layer '%s[%d]': number of channels must be smaller than 4 or divisible by 4" % (name, i))
# if dic['filterSize'][i] > totalPadding[i] + dic['imgSize'][i]:
# raise LayerParsingError("Layer '%s[%d]': filter size (%d) greater than image size + padding (%d)" % (name, i, dic['filterSize'][i], dic['padding'][i] + dic['imgSize'][i]))
if -dic['padding'][i] + dic['stride'][i] * (dic['modulesX'] - 1) + dic['filterSize'][i] < dic['imgSize'][i]:
raise LayerParsingError("Layer '%s[%d]': %dx%d output map with padding=%d, stride=%d does not cover entire input image." % (name, i, dic['modulesX'], dic['outputsX'], dic['padding'][i], dic['stride'][i]))
if dic['groups'][i] > 1:
self.verify_divisible(dic['channels'][i], 4*dic['groups'][i], 'channels', '4 * groups', input_idx=i)
self.verify_divisible(dic['channels'][i], dic['groups'][i], 'channels', 'groups', input_idx=i)
self.verify_divisible(dic['filters'], 16*dic['groups'][i], 'filters * groups', input_idx=i)
dic['padding'][i] = -dic['padding'][i]
# dic['overSample'] = [groups*filterChannels/channels for groups,filterChannels,channels in zip(dic['groups'], dic['filterChannels'], dic['channels'])]
dic['weightsPerFilter'] = [fc * (fz**2) for fc, fz in zip(dic['filterChannels'], dic['filterSize'])]
return dic
class ConvLayerParser(LocalLayerParser):
def __init__(self):
LocalLayerParser.__init__(self)
def add_params(self, mcp):
LocalLayerParser.add_params(self, mcp)
self.dic['wcNormMax'] = mcp.safe_get_float_list(self.dic['name'], 'wcNormMax', default=[0.0] * len(self.dic['inputs']))
self.dic['wcNormMin'] = mcp.safe_get_float_list(self.dic['name'], 'wcNormMin', default=[0.0] * len(self.dic['inputs']))
self.verify_num_params(['wcNormMax', 'wcNormMin'])
for min,max in zip(self.dic['wcNormMin'], self.dic['wcNormMax']):
if min > max:
raise LayerParsingError("Layer '%s': wcNormMin must be <= wcNormMax." % (self.dic['name']))
def parse(self, name, mcp, prev_layers, model):
dic = LocalLayerParser.parse(self, name, mcp, prev_layers, model)
dic['sumWidth'] = mcp.safe_get_int(name, 'sumWidth')
dic['sharedBiases'] = mcp.safe_get_bool(name, 'sharedBiases', default=True)
num_biases = dic['filters'] if dic['sharedBiases'] else dic['modules']*dic['filters']
eltmult = lambda list1, list2: [l1 * l2 for l1,l2 in zip(list1, list2)]
self.make_weights(dic['initW'], eltmult(dic['filterPixels'], dic['filterChannels']), [dic['filters']] * len(dic['inputs']), order='C')
self.make_biases(num_biases, 1, order='C')
print "Initialized convolutional layer '%s' on GPUs %s, producing %dx%d %d-channel output" % (name, dic['gpus'], dic['modulesX'], dic['modulesX'], dic['filters'])
return dic
class LocalUnsharedLayerParser(LocalLayerParser):
def __init__(self):
LocalLayerParser.__init__(self)
def parse(self, name, mcp, prev_layers, model):
dic = LocalLayerParser.parse(self, name, mcp, prev_layers, model)
eltmult = lambda list1, list2: [l1 * l2 for l1,l2 in zip(list1, list2)]
scmult = lambda x, lst: [x * l for l in lst]
self.make_weights(dic['initW'], scmult(dic['modules'], eltmult(dic['filterPixels'], dic['filterChannels'])), [dic['filters']] * len(dic['inputs']), order='C')
self.make_biases(dic['modules'] * dic['filters'], 1, order='C')
print "Initialized locally-connected layer '%s' on GPUs %s, producing %dx%d %d-channel output" % (name, dic['gpus'], dic['modulesX'], dic['modulesX'], dic['filters'])
return dic
class DataLayerParser(LayerParser):
def __init__(self):
LayerParser.__init__(self)
def parse(self, name, mcp, prev_layers, model):
dic = LayerParser.parse(self, name, mcp, prev_layers, model)
dic['dataIdx'] = mcp.safe_get_int(name, 'dataIdx')
dic['start'] = mcp.safe_get_int(name, 'start', default=0)
dic['end'] = mcp.safe_get_int(name, 'end', default=model.train_data_provider.get_data_dims(idx=dic['dataIdx']))
dic['outputs'] = dic['end'] - dic['start']
# dic['usesActs'] = False
print "Initialized data layer '%s', producing %d outputs" % (name, dic['outputs'])
return dic
class SoftmaxLayerParser(LayerWithInputParser):
def __init__(self):
LayerWithInputParser.__init__(self, num_inputs=1)
def parse(self, name, mcp, prev_layers, model):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
dic['outputs'] = dic['inputLayers'][0]['outputs']
print "Initialized softmax layer '%s' on GPUs %s, producing %d outputs" % (name, dic['gpus'], dic['outputs'])
return dic
class ConcatentionLayerParser(LayerWithInputParser):
def __init__(self):
LayerWithInputParser.__init__(self)
def parse(self, name, mcp, prev_layers, model):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
dic['outputs'] = sum(l['outputs'] for l in dic['inputLayers'])
dic['copyOffsets'] = [sum(dic['inputLayers'][j]['outputs'] for j in xrange(i)) for i in xrange(len(dic['inputLayers']))]
print "Initialized concatenation layer '%s' on GPUs %s, producing %d outputs" % (name, dic['gpus'], dic['outputs'])
return dic
class PassThroughLayerParser(LayerWithInputParser):
def __init__(self):
LayerWithInputParser.__init__(self)
# Note: this doesn't verify all the necessary constraints. Layer construction may still fail in C++ code.
# For example, it does not verify that every layer only has one pass-through parent. Obviously having
# two such parents is incoherent.
def parse(self, name, mcp, prev_layers, model):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
# if len(dic['inputLayers']) == 1:
# raise LayerParsingError("Layer %s: pass-through layer must have more than one input." % dic['name'])
if len(dic['gpu']) != len(dic['inputLayers'][0]['gpu']):
raise LayerParsingError("Layer '%s': number of replicas in pass-through layer must be equivalent to number of replicas in input layers." % dic['name'])
for inp in dic['inputLayers']:
conflicting_layers = [l for l in prev_layers.values() if l['type'] == 'pass' and inp['name'] in l['inputs'] and len(set(dic['gpu']).intersection(set(l['gpu']))) > 0]
if len(conflicting_layers) > 0:
raise LayerParsingError("Layer '%s' conflicts with layer '%s'. Both pass-through layers take layer '%s' as input and operate on an overlapping set of GPUs." % (dic['name'], conflicting_layers[0]['name'], inp['name']))
dic['outputs'] = sum(l['outputs'] for l in dic['inputLayers'])
# dic['copyOffsets'] = [sum(dic['inputLayers'][j]['outputs'] for j in xrange(i)) for i in xrange(len(dic['inputLayers']))]
print "Initialized pass-through layer '%s' on GPUs %s, producing %d outputs" % (name, dic['gpus'], dic['outputs'])
return dic
class PoolLayerParser(LayerWithInputParser):
def __init__(self):
LayerWithInputParser.__init__(self, num_inputs=1)
def add_params(self, mcp):
LayerWithInputParser.add_params(self, mcp)
dic, name = self.dic, self.dic['name']
def parse(self, name, mcp, prev_layers, model):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
dic['channels'] = mcp.safe_get_int(name, 'channels')
dic['sizeX'] = mcp.safe_get_int(name, 'sizeX')
dic['start'] = mcp.safe_get_int(name, 'start', default=0)
dic['stride'] = mcp.safe_get_int(name, 'stride')
dic['outputsX'] = mcp.safe_get_int(name, 'outputsX', default=0)
dic['pool'] = mcp.safe_get(name, 'pool')
# Avg pooler does not use its acts or inputs
dic['usesActs'] = dic['pool'] != 'avg'
dic['usesInputs'] = dic['pool'] != 'avg'
dic['imgPixels'] = dic['numInputs'][0] / dic['channels']
dic['imgSize'] = int(n.sqrt(dic['imgPixels']))
if dic['pool'] == 'avg':
dic['sum'] = mcp.safe_get_bool(name, 'sum', default=False)
self.verify_num_range(dic['sizeX'], 'sizeX', 1, dic['imgSize'])
self.verify_num_range(dic['stride'], 'stride', 1, dic['sizeX'])
self.verify_num_range(dic['outputsX'], 'outputsX', 0, None)
self.verify_num_range(dic['channels'], 'channels', 1, None)
if LayerWithInputParser.grad_consumers_below(dic):
self.verify_divisible(dic['channels'], 16, 'channels')
self.verify_str_in(dic['pool'], 'pool', ['max', 'maxabs', 'avg'])
self.verify_img_size()
if dic['outputsX'] <= 0:
dic['outputsX'] = int(ceil((dic['imgSize'] - dic['start'] - dic['sizeX']) / float(dic['stride']))) + 1;
dic['outputs'] = dic['outputsX']**2 * dic['channels']
print "Initialized %s-pooling layer '%s' on GPUs %s, producing %dx%d %d-channel output" % (dic['pool'], name, dic['gpus'], dic['outputsX'], dic['outputsX'], dic['channels'])
return dic
class CrossMapPoolLayerParser(LayerWithInputParser):
def __init__(self):
LayerWithInputParser.__init__(self, num_inputs=1)
def parse(self, name, mcp, prev_layers, model):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
dic['channels'] = mcp.safe_get_int(name, 'channels')
dic['size'] = mcp.safe_get_int(name, 'size')
dic['start'] = mcp.safe_get_int(name, 'start', default=0)
dic['stride'] = mcp.safe_get_int(name, 'stride')
dic['outputChannels'] = mcp.safe_get_int(name, 'outputs', default=0)
dic['pool'] = mcp.safe_get(name, 'pool')
dic['requiresParams'] = False
# Avg pooler does not use its acts or inputs
dic['usesActs'] = 'pool' != 'avg'
dic['usesInputs'] = 'pool' != 'avg'
dic['imgPixels'] = dic['numInputs'][0] / dic['channels']
dic['imgSize'] = int(n.sqrt(dic['imgPixels']))
dic['outputs'] = dic['outputChannels'] * dic['imgPixels']
self.verify_num_range(dic['size'], 'size', 1, dic['channels'])
self.verify_num_range(dic['stride'], 'stride', 1, dic['size'])
self.verify_num_range(dic['outputChannels'], 'outputChannels', 0, None)
self.verify_num_range(dic['channels'], 'channels', 1, None)
self.verify_num_range(dic['start'], 'start', None, 0)
self.verify_str_in(dic['pool'], 'pool', ['max'])
self.verify_img_size()
covered_chans = dic['start'] + (dic['outputChannels'] - 1) * dic['stride'] + dic['size']
if covered_chans < dic['channels']:
raise LayerParsingError("Layer '%s': cross-map pooling with start=%d, stride=%d, size=%d, outputs=%d covers only %d of %d input channels." % \
(name, dic['start'], dic['stride'], dic['size'], dic['outputChannels'], covered_chans, dic['channels']))
print "Initialized cross-map %s-pooling layer '%s' on GPUs %s, producing %dx%d %d-channel output" % (dic['pool'], name, dic['gpus'], dic['imgSize'], dic['imgSize'], dic['outputChannels'])
return dic
class NormLayerParser(LayerWithInputParser):
RESPONSE_NORM = 'response'
CONTRAST_NORM = 'contrast'
CROSSMAP_RESPONSE_NORM = 'cross-map response'
def __init__(self, norm_type):
LayerWithInputParser.__init__(self, num_inputs=1)
self.norm_type = norm_type
def add_params(self, mcp):
LayerWithInputParser.add_params(self, mcp)
dic, name = self.dic, self.dic['name']
dic['scale'] = mcp.safe_get_float(name, 'scale')
dic['scale'] /= dic['size'] if self.norm_type == self.CROSSMAP_RESPONSE_NORM else dic['size']**2
dic['pow'] = mcp.safe_get_float(name, 'pow')
dic['minDiv'] = mcp.safe_get_float(name, 'minDiv', default=1.0)
def parse(self, name, mcp, prev_layers, model):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
dic['requiresParams'] = True
dic['channels'] = mcp.safe_get_int(name, 'channels')
dic['size'] = mcp.safe_get_int(name, 'size')
dic['blocked'] = mcp.safe_get_bool(name, 'blocked', default=False)
dic['imgPixels'] = dic['numInputs'][0] / dic['channels']
dic['imgSize'] = int(n.sqrt(dic['imgPixels']))
# Contrast normalization layer does not use its inputs
dic['usesInputs'] = self.norm_type != self.CONTRAST_NORM
self.verify_num_range(dic['channels'], 'channels', 1, None)
if self.norm_type == self.CROSSMAP_RESPONSE_NORM:
self.verify_num_range(dic['size'], 'size', 2, dic['channels'])
if dic['channels'] % 16 != 0:
raise LayerParsingError("Layer '%s': number of channels must be divisible by 16 when using crossMap" % name)
else:
self.verify_num_range(dic['size'], 'size', 1, dic['imgSize'])
if self.norm_type != self.CROSSMAP_RESPONSE_NORM and dic['channels'] > 3 and dic['channels'] % 4 != 0:
raise LayerParsingError("Layer '%s': number of channels must be smaller than 4 or divisible by 4" % name)
self.verify_img_size()
dic['outputs'] = dic['imgPixels'] * dic['channels']
print "Initialized %s-normalization layer '%s' on GPUs %s, producing %dx%d %d-channel output" % (self.norm_type, name, dic['gpus'], dic['imgSize'], dic['imgSize'], dic['channels'])
return dic
class CostParser(LayerWithInputParser):
def __init__(self, num_inputs=-1):
LayerWithInputParser.__init__(self, num_inputs=num_inputs)
def parse(self, name, mcp, prev_layers, model):
dic = LayerWithInputParser.parse(self, name, mcp, prev_layers, model)
dic['requiresParams'] = True
# Stored as string because python can't pickle lambda functions
dic['outputFilter'] = 'lambda costs,num_cases: [c/num_cases for c in costs]'
dic['children'] = mcp.safe_get_list(name, 'children', default=[])
# Aggregated costs only produce outputs which are additive.
for c in dic['children']:
if c not in prev_layers:
raise LayerParsingError("Layer '%s': child cost layer '%s' not defined" % (name, c))
if prev_layers[c]['type'] != dic['type']:
raise LayerParsingError("Layer '%s': child cost layer '%s' must have same type as parent" % (name, c))
prev_layers[c]['aggregated'] = 1
dic['aggregated'] = dic['children'] != []
del dic['neuron']
return dic
def add_params(self, mcp):
LayerWithInputParser.add_params(self, mcp)
dic, name = self.dic, self.dic['name']
dic['coeff'] = mcp.safe_get_float(name, 'coeff')
dic['gradConsumer'] = dic['coeff'] > 0
class CrossEntCostParser(CostParser):
def __init__(self):
CostParser.__init__(self, num_inputs=2)
def parse(self, name, mcp, prev_layers, model):
dic = CostParser.parse(self, name, mcp, prev_layers, model)
if dic['numInputs'][0] != model.train_data_provider.get_num_classes(): # first input must be labels
raise LayerParsingError("Layer '%s': Dimensionality of first input must be equal to number of labels" % name)
if dic['inputLayers'][1]['type'] != 'softmax':
raise LayerParsingError("Layer '%s': Second input must be softmax layer" % name)
if dic['numInputs'][1] != model.train_data_provider.get_num_classes():
raise LayerParsingError("Layer '%s': Softmax input '%s' must produce %d outputs, because that is the number of classes in the dataset" \
% (name, dic['inputs'][1], model.train_data_provider.get_num_classes()))
print "Initialized cross-entropy cost '%s' on GPUs %s" % (name, dic['gpus'])
return dic
class LogregCostParser(CostParser):
def __init__(self):
CostParser.__init__(self, num_inputs=2)
def add_params(self, mcp):
CostParser.add_params(self, mcp)
dic, name = self.dic, self.dic['name']
dic['topk'] = mcp.safe_get_int(name, 'topk', default=1)
if dic['topk'] > dic['numInputs'][1]:
raise LayerParsingError("Layer '%s': parameter 'topk'must not have value greater than the number of classess." % (name))
def parse(self, name, mcp, prev_layers, model):
dic = CostParser.parse(self, name, mcp, prev_layers, model)
dic['requiresParams'] = True
if dic['numInputs'][0] != 1: # first input must be labels
raise LayerParsingError("Layer '%s': dimensionality of first input must be 1" % name)
if dic['inputLayers'][1]['type'] != 'softmax':
raise LayerParsingError("Layer '%s': second input must be softmax layer" % name)
if dic['numInputs'][1] != model.train_data_provider.get_num_classes():
raise LayerParsingError("Layer '%s': softmax input '%s' must produce %d outputs, because that is the number of classes in the dataset" \
% (name, dic['inputs'][1], model.train_data_provider.get_num_classes()))
print "Initialized logistic regression cost '%s' on GPUs %s" % (name, dic['gpus'])
return dic
class BinomialCrossEntCostParser(CostParser):
def __init__(self):
CostParser.__init__(self, num_inputs=2)
def add_params(self, mcp):
CostParser.add_params(self, mcp)
self.dic['posWeight'] = mcp.safe_get_float(self.dic['name'], 'posWeight', default=1.0)
def parse(self, name, mcp, prev_layers, model):
dic = CostParser.parse(self, name, mcp, prev_layers, model)
if dic['numInputs'][0] != dic['numInputs'][1]:
raise LayerParsingError("Layer '%s': both inputs must produce the same number of outputs" % (name))
if 'neuron' not in dic['inputLayers'][1] or dic['inputLayers'][1]['neuron'] != 'logistic':
print "WARNING: Layer '%s': input '%s' is not logistic, results may not be what you intend." % (dic['name'], dic['inputs'][1])
if dic['type'] == 'cost.bce':
print "Initialized binomial cross-entropy cost '%s' on GPUs %s" % (name, dic['gpus'])
dic['computeSoftmaxErrorRate'] = True
return dic
class DetectionCrossEntCostParser(BinomialCrossEntCostParser):
def __init__(self):
BinomialCrossEntCostParser.__init__(self)
def parse(self, name, mcp, prev_layers, model):
dic = BinomialCrossEntCostParser.parse(self, name, mcp, prev_layers, model)
if dic['numInputs'][0] != model.train_data_provider.get_num_classes(): # first input must be labels
raise LayerParsingError("Layer '%s': Dimensionality of first input must be equal to number of labels" % name)
dic['computeSoftmaxErrorRate'] = False
dic['outputFilter'] = 'lambda costs,num_cases: [c/num_cases for c in costs[:2]] + [(class_cost[2] / class_cost[j] if class_cost[j] > 0 else n.inf) for class_cost in [costs[2:][i*3:(i+1)*3] for i in range(len(costs[2:])/3)] for j in range(2)]'
dic['outputFilterFormatter'] = 'lambda self,costs: "(crossent) %.6f, (err) %.6f, " % (costs[0], costs[1]) + ", ".join("(%s) %.6f, %.6f" % (self.train_data_provider.batch_meta["label_names"][i/2-1],costs[i],costs[i+1]) for i in xrange(2, len(costs), 2))'
print "Initialized detection cross-entropy cost '%s' on GPUs %s" % (name, dic['gpus'])
return dic
class SumOfSquaresCostParser(CostParser):
def __init__(self):
CostParser.__init__(self, num_inputs=1)
def parse(self, name, mcp, prev_layers, model):
dic = CostParser.parse(self, name, mcp, prev_layers, model)
print "Initialized sum-of-squares cost '%s' on GPUs %s" % (name, dic['gpus'])
return dic
# All the layer parsers
layer_parsers = {'data' : lambda : DataLayerParser(),
'fc': lambda : FCLayerParser(),
'sfc': lambda : SplitFCLayerParser(),
'conv': lambda : ConvLayerParser(),
'local': lambda : LocalUnsharedLayerParser(),
'softmax': lambda : SoftmaxLayerParser(),
'eltsum': lambda : EltwiseSumLayerParser(),
'eltmax': lambda : EltwiseMaxLayerParser(),
'sum': lambda : SumLayerParser(),
'neuron': lambda : NeuronLayerParser(),
'pool': lambda : PoolLayerParser(),
'cmpool': lambda : CrossMapPoolLayerParser(),
'rnorm': lambda : NormLayerParser(NormLayerParser.RESPONSE_NORM),
'cnorm': lambda : NormLayerParser(NormLayerParser.CONTRAST_NORM),
'cmrnorm': lambda : NormLayerParser(NormLayerParser.CROSSMAP_RESPONSE_NORM),
'nailbed': lambda : NailbedLayerParser(),
'blur': lambda : GaussianBlurLayerParser(),
'href': lambda : HorizontalReflectionLayerParser(),
'resize': lambda : ResizeLayerParser(),
'rgb2yuv': lambda : RGBToYUVLayerParser(),
'rgb2lab': lambda : RGBToLABLayerParser(),
'rscale': lambda : RandomScaleLayerParser(),
'crop': lambda : CropLayerParser(),
'concat': lambda : ConcatentionLayerParser(),
'pass': lambda : PassThroughLayerParser(),
'dropout': lambda : DropoutLayerParser(),
'dropout2': lambda : Dropout2LayerParser(),
'cost.logreg': lambda : LogregCostParser(),
'cost.crossent': lambda : CrossEntCostParser(),
'cost.bce': lambda : BinomialCrossEntCostParser(),
'cost.dce': lambda : DetectionCrossEntCostParser(),
'cost.sum2': lambda : SumOfSquaresCostParser()}
# All the neuron parsers
# This isn't a name --> parser mapping as the layer parsers above because neurons don't have fixed names.
# A user may write tanh[0.5,0.25], etc.
neuron_parsers = sorted([NeuronParser('ident', 'f(x) = x', uses_acts=False, uses_inputs=False),
NeuronParser('logistic', 'f(x) = 1 / (1 + e^-x)', uses_acts=True, uses_inputs=False),
NeuronParser('abs', 'f(x) = |x|', uses_acts=False, uses_inputs=True),
NeuronParser('relu', 'f(x) = max(0, x)', uses_acts=True, uses_inputs=False),
NeuronParser('nrelu', 'f(x) = max(0, x) + noise', uses_acts=True, uses_inputs=False),
NeuronParser('softrelu', 'f(x) = log(1 + e^x)', uses_acts=True, uses_inputs=False),
NeuronParser('square', 'f(x) = x^2', uses_acts=False, uses_inputs=True),
NeuronParser('sqrt', 'f(x) = sqrt(x)', uses_acts=True, uses_inputs=False),
ParamNeuronParser('log[a]', 'f(x) = log(a + x)', uses_acts=False, uses_inputs=True),
ParamNeuronParser('tanh[a,b]', 'f(x) = a * tanh(b * x)', uses_acts=True, uses_inputs=False),
ParamNeuronParser('brelu[a]', 'f(x) = min(a, max(0, x))', uses_acts=True, uses_inputs=False),
ParamNeuronParser('linear[a,b]', 'f(x) = a * x + b', uses_acts=True, uses_inputs=False),
ParamNeuronParser('drelu[a]', 'f(x) = x - a * tanh(x / a)', uses_acts=False, uses_inputs=True)],
key=lambda x:x.type)
# Learning rate schedules
lrs_parsers = sorted([ParamParser('const[fbase]'),
ParamParser('linear[fbase;ftgtFactor]'),
ParamParser('exp[fbase;ftgtFactor]'),
ParamParser('dexp[fbase;ftgtFactor;inumSteps]')])
| apache-2.0 |
tiagofrepereira2012/tensorflow | tensorflow/python/debug/cli/tensor_format_test.py | 41 | 37994 | # Copyright 2016 The TensorFlow Authors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
# ==============================================================================
"""Unit tests for tensor formatter."""
from __future__ import absolute_import
from __future__ import division
from __future__ import print_function
import numpy as np
from six.moves import xrange # pylint: disable=redefined-builtin
from tensorflow.core.framework import tensor_pb2
from tensorflow.core.framework import tensor_shape_pb2
from tensorflow.core.framework import types_pb2
from tensorflow.python.debug.cli import tensor_format
from tensorflow.python.debug.lib import debug_data
from tensorflow.python.framework import test_util
from tensorflow.python.platform import googletest
class RichTextLinesTest(test_util.TensorFlowTestCase):
def setUp(self):
np.set_printoptions(
precision=8, threshold=1000, edgeitems=3, linewidth=75)
def _checkTensorMetadata(self, tensor, annotations):
self.assertEqual(
{"dtype": tensor.dtype, "shape": tensor.shape},
annotations["tensor_metadata"])
def _checkBeginIndices(self, expected_indices, annot):
self.assertEqual({tensor_format.BEGIN_INDICES_KEY: expected_indices},
annot)
def _checkOmittedIndices(self, expected_indices, annot):
self.assertEqual({tensor_format.OMITTED_INDICES_KEY: expected_indices},
annot)
def testFormatZeroDimensionTensor(self):
a = np.array(42.0, dtype=np.float32)
out = tensor_format.format_tensor(a, "a")
self.assertEqual(["Tensor \"a\":", "", "array(42.0, dtype=float32)"],
out.lines)
self._checkTensorMetadata(a, out.annotations)
def testFormatTensorHighlightsTensorNameWithoutDebugOp(self):
tensor_name = "a_tensor:0"
a = np.zeros(2)
out = tensor_format.format_tensor(
a, tensor_name, np_printoptions={"linewidth": 40})
self.assertEqual([(8, 8 + len(tensor_name), "bold")], out.font_attr_segs[0])
def testFormatTensorHighlightsTensorNameWithDebugOp(self):
tensor_name = "a_tensor:0"
debug_op = "DebugIdentity"
a = np.zeros(2)
out = tensor_format.format_tensor(
a, "%s:%s" % (tensor_name, debug_op), np_printoptions={"linewidth": 40})
self.assertEqual([(8, 8 + len(tensor_name), "bold"),
(8 + len(tensor_name) + 1,
8 + len(tensor_name) + 1 + len(debug_op), "yellow")],
out.font_attr_segs[0])
def testFormatTensor1DNoEllipsis(self):
a = np.zeros(20)
out = tensor_format.format_tensor(
a, "a", np_printoptions={"linewidth": 40})
self.assertEqual([
"Tensor \"a\":",
"",
"array([ 0., 0., 0., 0., 0., 0.,",
" 0., 0., 0., 0., 0., 0.,",
" 0., 0., 0., 0., 0., 0.,",
" 0., 0.])",
], out.lines)
self._checkTensorMetadata(a, out.annotations)
# Check annotations for beginning indices of the lines.
self._checkBeginIndices([0], out.annotations[2])
self._checkBeginIndices([6], out.annotations[3])
self._checkBeginIndices([12], out.annotations[4])
self._checkBeginIndices([18], out.annotations[5])
def testFormatTensor2DNoEllipsisNoRowBreak(self):
a = np.linspace(0.0, 1.0 - 1.0 / 16.0, 16).reshape([4, 4])
out = tensor_format.format_tensor(a, "a")
self.assertEqual([
"Tensor \"a\":",
"",
"array([[ 0. , 0.0625, 0.125 , 0.1875],",
" [ 0.25 , 0.3125, 0.375 , 0.4375],",
" [ 0.5 , 0.5625, 0.625 , 0.6875],",
" [ 0.75 , 0.8125, 0.875 , 0.9375]])",
], out.lines)
self._checkTensorMetadata(a, out.annotations)
# Check annotations for the beginning indices of the lines.
for i in xrange(2, 6):
self._checkBeginIndices([i - 2, 0], out.annotations[i])
def testFormatTensorSuppressingTensorName(self):
a = np.linspace(0.0, 1.0 - 1.0 / 16.0, 16).reshape([4, 4])
out = tensor_format.format_tensor(a, None)
self.assertEqual([
"array([[ 0. , 0.0625, 0.125 , 0.1875],",
" [ 0.25 , 0.3125, 0.375 , 0.4375],",
" [ 0.5 , 0.5625, 0.625 , 0.6875],",
" [ 0.75 , 0.8125, 0.875 , 0.9375]])",
], out.lines)
self._checkTensorMetadata(a, out.annotations)
# Check annotations for the beginning indices of the lines.
for i in xrange(4):
self._checkBeginIndices([i, 0], out.annotations[i])
def testFormatTensorWithMetadata(self):
a = np.linspace(0.0, 1.0 - 1.0 / 16.0, 16).reshape([4, 4])
out = tensor_format.format_tensor(a, "a", include_metadata=True)
self.assertEqual([
"Tensor \"a\":",
" dtype: float64",
" shape: (4, 4)",
"",
"array([[ 0. , 0.0625, 0.125 , 0.1875],",
" [ 0.25 , 0.3125, 0.375 , 0.4375],",
" [ 0.5 , 0.5625, 0.625 , 0.6875],",
" [ 0.75 , 0.8125, 0.875 , 0.9375]])",
], out.lines)
self._checkTensorMetadata(a, out.annotations)
# Check annotations for the beginning indices of the lines.
for i in xrange(4, 7):
self._checkBeginIndices([i - 4, 0], out.annotations[i])
def testFormatTensor2DNoEllipsisWithRowBreak(self):
a = np.linspace(0.0, 1.0 - 1.0 / 40.0, 40).reshape([2, 20])
out = tensor_format.format_tensor(
a, "a", np_printoptions={"linewidth": 50})
self.assertEqual(
{"dtype": a.dtype, "shape": a.shape},
out.annotations["tensor_metadata"])
self.assertEqual([
"Tensor \"a\":",
"",
"array([[ 0. , 0.025, 0.05 , 0.075, 0.1 ,",
" 0.125, 0.15 , 0.175, 0.2 , 0.225,",
" 0.25 , 0.275, 0.3 , 0.325, 0.35 ,",
" 0.375, 0.4 , 0.425, 0.45 , 0.475],",
" [ 0.5 , 0.525, 0.55 , 0.575, 0.6 ,",
" 0.625, 0.65 , 0.675, 0.7 , 0.725,",
" 0.75 , 0.775, 0.8 , 0.825, 0.85 ,",
" 0.875, 0.9 , 0.925, 0.95 , 0.975]])",
], out.lines)
self._checkTensorMetadata(a, out.annotations)
# Check annotations for the beginning indices of the lines.
self._checkBeginIndices([0, 0], out.annotations[2])
self._checkBeginIndices([0, 5], out.annotations[3])
self._checkBeginIndices([0, 10], out.annotations[4])
self._checkBeginIndices([0, 15], out.annotations[5])
self._checkBeginIndices([1, 0], out.annotations[6])
self._checkBeginIndices([1, 5], out.annotations[7])
self._checkBeginIndices([1, 10], out.annotations[8])
self._checkBeginIndices([1, 15], out.annotations[9])
def testFormatTensor3DNoEllipsis(self): # TODO(cais): Test name.
a = np.linspace(0.0, 1.0 - 1.0 / 24.0, 24).reshape([2, 3, 4])
out = tensor_format.format_tensor(a, "a")
self.assertEqual([
"Tensor \"a\":",
"",
"array([[[ 0. , 0.04166667, 0.08333333, 0.125 ],",
" [ 0.16666667, 0.20833333, 0.25 , 0.29166667],",
" [ 0.33333333, 0.375 , 0.41666667, 0.45833333]],",
"",
" [[ 0.5 , 0.54166667, 0.58333333, 0.625 ],",
" [ 0.66666667, 0.70833333, 0.75 , 0.79166667],",
" [ 0.83333333, 0.875 , 0.91666667, 0.95833333]]])",
], out.lines)
self._checkTensorMetadata(a, out.annotations)
# Check annotations for beginning indices of the lines.
self._checkBeginIndices([0, 0, 0], out.annotations[2])
self._checkBeginIndices([0, 1, 0], out.annotations[3])
self._checkBeginIndices([0, 2, 0], out.annotations[4])
self.assertNotIn(5, out.annotations)
self._checkBeginIndices([1, 0, 0], out.annotations[6])
self._checkBeginIndices([1, 1, 0], out.annotations[7])
self._checkBeginIndices([1, 2, 0], out.annotations[8])
def testFormatTensor3DNoEllipsisWithArgwhereHighlightWithMatches(self):
a = np.linspace(0.0, 1.0 - 1.0 / 24.0, 24).reshape([2, 3, 4])
lower_bound = 0.26
upper_bound = 0.5
def highlight_filter(x):
return np.logical_and(x > lower_bound, x < upper_bound)
highlight_options = tensor_format.HighlightOptions(
highlight_filter, description="between 0.26 and 0.5")
out = tensor_format.format_tensor(
a, "a", highlight_options=highlight_options)
self.assertEqual([
"Tensor \"a\": "
"Highlighted(between 0.26 and 0.5): 5 of 24 element(s) (20.83%)",
"",
"array([[[ 0. , 0.04166667, 0.08333333, 0.125 ],",
" [ 0.16666667, 0.20833333, 0.25 , 0.29166667],",
" [ 0.33333333, 0.375 , 0.41666667, 0.45833333]],",
"",
" [[ 0.5 , 0.54166667, 0.58333333, 0.625 ],",
" [ 0.66666667, 0.70833333, 0.75 , 0.79166667],",
" [ 0.83333333, 0.875 , 0.91666667, 0.95833333]]])",
], out.lines)
self._checkTensorMetadata(a, out.annotations)
# Check annotations for beginning indices of the lines.
self._checkBeginIndices([0, 0, 0], out.annotations[2])
self._checkBeginIndices([0, 1, 0], out.annotations[3])
self._checkBeginIndices([0, 2, 0], out.annotations[4])
self.assertNotIn(5, out.annotations)
self._checkBeginIndices([1, 0, 0], out.annotations[6])
self._checkBeginIndices([1, 1, 0], out.annotations[7])
self._checkBeginIndices([1, 2, 0], out.annotations[8])
# Check font attribute segments for highlighted elements.
self.assertNotIn(2, out.font_attr_segs)
self.assertEqual([(49, 59, "bold")], out.font_attr_segs[3])
self.assertEqual([(10, 20, "bold"), (23, 28, "bold"), (36, 46, "bold"),
(49, 59, "bold")], out.font_attr_segs[4])
self.assertNotIn(5, out.font_attr_segs)
self.assertNotIn(6, out.font_attr_segs)
self.assertNotIn(7, out.font_attr_segs)
self.assertNotIn(8, out.font_attr_segs)
def testFormatTensor3DNoEllipsisWithArgwhereHighlightWithNoMatches(self):
a = np.linspace(0.0, 1.0 - 1.0 / 24.0, 24).reshape([2, 3, 4])
def highlight_filter(x):
return x > 10.0
highlight_options = tensor_format.HighlightOptions(highlight_filter)
out = tensor_format.format_tensor(
a, "a", highlight_options=highlight_options)
self.assertEqual([
"Tensor \"a\": Highlighted: 0 of 24 element(s) (0.00%)", "",
"array([[[ 0. , 0.04166667, 0.08333333, 0.125 ],",
" [ 0.16666667, 0.20833333, 0.25 , 0.29166667],",
" [ 0.33333333, 0.375 , 0.41666667, 0.45833333]],", "",
" [[ 0.5 , 0.54166667, 0.58333333, 0.625 ],",
" [ 0.66666667, 0.70833333, 0.75 , 0.79166667],",
" [ 0.83333333, 0.875 , 0.91666667, 0.95833333]]])"
], out.lines)
self._checkTensorMetadata(a, out.annotations)
# Check annotations for beginning indices of the lines.
self._checkBeginIndices([0, 0, 0], out.annotations[2])
self._checkBeginIndices([0, 1, 0], out.annotations[3])
self._checkBeginIndices([0, 2, 0], out.annotations[4])
self.assertNotIn(5, out.annotations)
self._checkBeginIndices([1, 0, 0], out.annotations[6])
self._checkBeginIndices([1, 1, 0], out.annotations[7])
self._checkBeginIndices([1, 2, 0], out.annotations[8])
# Check font attribute segments for highlighted elements.
self.assertNotIn(2, out.font_attr_segs)
self.assertNotIn(3, out.font_attr_segs)
self.assertNotIn(4, out.font_attr_segs)
self.assertNotIn(5, out.font_attr_segs)
self.assertNotIn(6, out.font_attr_segs)
self.assertNotIn(7, out.font_attr_segs)
self.assertNotIn(8, out.font_attr_segs)
def testFormatTensorWithEllipses(self):
a = np.zeros([11, 11, 11])
out = tensor_format.format_tensor(
a, "a", False, np_printoptions={"threshold": 100, "edgeitems": 2})
self.assertEqual([
"Tensor \"a\":",
"",
"array([[[ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.],",
" ..., ",
" [ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.]],",
"",
" [[ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.],",
" ..., ",
" [ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.]],",
"",
" ..., ",
" [[ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.],",
" ..., ",
" [ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.]],",
"",
" [[ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.],",
" ..., ",
" [ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.]]])",
], out.lines)
self._checkTensorMetadata(a, out.annotations)
# Check annotations for beginning indices of the lines.
for i in xrange(2):
self._checkBeginIndices([i, 0, 0], out.annotations[i * 6 + 2])
self._checkBeginIndices([i, 1, 0], out.annotations[i * 6 + 3])
self._checkOmittedIndices([i, 2, 0], out.annotations[i * 6 + 4])
self._checkBeginIndices([i, 9, 0], out.annotations[i * 6 + 5])
self._checkBeginIndices([i, 10, 0], out.annotations[i * 6 + 6])
self.assertNotIn(i * 6 + 7, out.annotations)
p = 15
for i in xrange(2):
self._checkBeginIndices([9 + i, 0, 0], out.annotations[p + i * 6])
self._checkBeginIndices([9 + i, 1, 0], out.annotations[p + i * 6 + 1])
self._checkOmittedIndices(
[9 + i, 2, 0], out.annotations[p + i * 6 + 2])
self._checkBeginIndices([9 + i, 9, 0], out.annotations[p + i * 6 + 3])
self._checkBeginIndices([9 + i, 10, 0], out.annotations[p + i * 6 + 4])
if i < 1:
self.assertNotIn(p + i * 6 + 5, out.annotations)
def testFormatUninitializedTensor(self):
tensor_proto = tensor_pb2.TensorProto(
dtype=types_pb2.DataType.Value("DT_FLOAT"),
tensor_shape=tensor_shape_pb2.TensorShapeProto(
dim=[tensor_shape_pb2.TensorShapeProto.Dim(size=1)]))
out = tensor_format.format_tensor(
debug_data.InconvertibleTensorProto(tensor_proto, False), "a")
self.assertEqual(["Tensor \"a\":", "", "Uninitialized tensor:"],
out.lines[:3])
self.assertEqual(str(tensor_proto).split("\n"), out.lines[3:])
def testFormatResourceTypeTensor(self):
tensor_proto = tensor_pb2.TensorProto(
dtype=types_pb2.DataType.Value("DT_RESOURCE"),
tensor_shape=tensor_shape_pb2.TensorShapeProto(
dim=[tensor_shape_pb2.TensorShapeProto.Dim(size=1)]))
out = tensor_format.format_tensor(
debug_data.InconvertibleTensorProto(tensor_proto), "a")
self.assertEqual(["Tensor \"a\":", ""], out.lines[:2])
self.assertEqual(str(tensor_proto).split("\n"), out.lines[2:])
def testLocateTensorElement1DNoEllipsis(self):
a = np.zeros(20)
out = tensor_format.format_tensor(
a, "a", np_printoptions={"linewidth": 40})
self.assertEqual([
"Tensor \"a\":",
"",
"array([ 0., 0., 0., 0., 0., 0.,",
" 0., 0., 0., 0., 0., 0.,",
" 0., 0., 0., 0., 0., 0.,",
" 0., 0.])",
], out.lines)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [0])
self.assertFalse(is_omitted)
self.assertEqual(2, row)
self.assertEqual(8, start_col)
self.assertEqual(10, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [5])
self.assertFalse(is_omitted)
self.assertEqual(2, row)
self.assertEqual(33, start_col)
self.assertEqual(35, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [6])
self.assertFalse(is_omitted)
self.assertEqual(3, row)
self.assertEqual(8, start_col)
self.assertEqual(10, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [11])
self.assertFalse(is_omitted)
self.assertEqual(3, row)
self.assertEqual(33, start_col)
self.assertEqual(35, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [12])
self.assertFalse(is_omitted)
self.assertEqual(4, row)
self.assertEqual(8, start_col)
self.assertEqual(10, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [18])
self.assertFalse(is_omitted)
self.assertEqual(5, row)
self.assertEqual(8, start_col)
self.assertEqual(10, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [19])
self.assertFalse(is_omitted)
self.assertEqual(5, row)
self.assertEqual(13, start_col)
self.assertEqual(15, end_col)
with self.assertRaisesRegexp(
ValueError, "Indices exceed tensor dimensions"):
tensor_format.locate_tensor_element(out, [20])
with self.assertRaisesRegexp(
ValueError, "Indices contain negative"):
tensor_format.locate_tensor_element(out, [-1])
with self.assertRaisesRegexp(
ValueError, "Dimensions mismatch"):
tensor_format.locate_tensor_element(out, [0, 0])
def testLocateTensorElement1DNoEllipsisBatchMode(self):
a = np.zeros(20)
out = tensor_format.format_tensor(
a, "a", np_printoptions={"linewidth": 40})
self.assertEqual([
"Tensor \"a\":",
"",
"array([ 0., 0., 0., 0., 0., 0.,",
" 0., 0., 0., 0., 0., 0.,",
" 0., 0., 0., 0., 0., 0.,",
" 0., 0.])",
], out.lines)
(are_omitted, rows, start_cols,
end_cols) = tensor_format.locate_tensor_element(out, [[0]])
self.assertEqual([False], are_omitted)
self.assertEqual([2], rows)
self.assertEqual([8], start_cols)
self.assertEqual([10], end_cols)
(are_omitted, rows, start_cols,
end_cols) = tensor_format.locate_tensor_element(out, [[0], [5]])
self.assertEqual([False, False], are_omitted)
self.assertEqual([2, 2], rows)
self.assertEqual([8, 33], start_cols)
self.assertEqual([10, 35], end_cols)
(are_omitted, rows, start_cols,
end_cols) = tensor_format.locate_tensor_element(out, [[0], [6]])
self.assertEqual([False, False], are_omitted)
self.assertEqual([2, 3], rows)
self.assertEqual([8, 8], start_cols)
self.assertEqual([10, 10], end_cols)
(are_omitted, rows, start_cols,
end_cols) = tensor_format.locate_tensor_element(out, [[0], [5], [6]])
self.assertEqual([False, False, False], are_omitted)
self.assertEqual([2, 2, 3], rows)
self.assertEqual([8, 33, 8], start_cols)
self.assertEqual([10, 35, 10], end_cols)
(are_omitted, rows, start_cols,
end_cols) = tensor_format.locate_tensor_element(out, [[0], [5], [6], [19]])
self.assertEqual([False, False, False, False], are_omitted)
self.assertEqual([2, 2, 3, 5], rows)
self.assertEqual([8, 33, 8, 13], start_cols)
self.assertEqual([10, 35, 10, 15], end_cols)
def testBatchModeWithErrors(self):
a = np.zeros(20)
out = tensor_format.format_tensor(
a, "a", np_printoptions={"linewidth": 40})
self.assertEqual([
"Tensor \"a\":",
"",
"array([ 0., 0., 0., 0., 0., 0.,",
" 0., 0., 0., 0., 0., 0.,",
" 0., 0., 0., 0., 0., 0.,",
" 0., 0.])",
], out.lines)
with self.assertRaisesRegexp(ValueError, "Dimensions mismatch"):
tensor_format.locate_tensor_element(out, [[0, 0], [0]])
with self.assertRaisesRegexp(ValueError,
"Indices exceed tensor dimensions"):
tensor_format.locate_tensor_element(out, [[0], [20]])
with self.assertRaisesRegexp(ValueError,
r"Indices contain negative value\(s\)"):
tensor_format.locate_tensor_element(out, [[0], [-1]])
with self.assertRaisesRegexp(
ValueError, "Input indices sets are not in ascending order"):
tensor_format.locate_tensor_element(out, [[5], [0]])
def testLocateTensorElement1DTinyAndNanValues(self):
a = np.ones([3, 3]) * 1e-8
a[1, 0] = np.nan
a[1, 2] = np.inf
out = tensor_format.format_tensor(
a, "a", np_printoptions={"linewidth": 100})
self.assertEqual([
"Tensor \"a\":",
"",
"array([[ 1.00000000e-08, 1.00000000e-08, 1.00000000e-08],",
" [ nan, 1.00000000e-08, inf],",
" [ 1.00000000e-08, 1.00000000e-08, 1.00000000e-08]])",
], out.lines)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [0, 0])
self.assertFalse(is_omitted)
self.assertEqual(2, row)
self.assertEqual(10, start_col)
self.assertEqual(24, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [0, 2])
self.assertFalse(is_omitted)
self.assertEqual(2, row)
self.assertEqual(46, start_col)
self.assertEqual(60, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [1, 0])
self.assertFalse(is_omitted)
self.assertEqual(3, row)
self.assertEqual(21, start_col)
self.assertEqual(24, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [1, 1])
self.assertFalse(is_omitted)
self.assertEqual(3, row)
self.assertEqual(28, start_col)
self.assertEqual(42, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [1, 2])
self.assertFalse(is_omitted)
self.assertEqual(3, row)
self.assertEqual(57, start_col)
self.assertEqual(60, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [2, 2])
self.assertFalse(is_omitted)
self.assertEqual(4, row)
self.assertEqual(46, start_col)
self.assertEqual(60, end_col)
def testLocateTensorElement2DNoEllipsis(self):
a = np.linspace(0.0, 1.0 - 1.0 / 16.0, 16).reshape([4, 4])
out = tensor_format.format_tensor(a, "a")
self.assertEqual([
"Tensor \"a\":",
"",
"array([[ 0. , 0.0625, 0.125 , 0.1875],",
" [ 0.25 , 0.3125, 0.375 , 0.4375],",
" [ 0.5 , 0.5625, 0.625 , 0.6875],",
" [ 0.75 , 0.8125, 0.875 , 0.9375]])",
], out.lines)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [0, 0])
self.assertFalse(is_omitted)
self.assertEqual(2, row)
self.assertEqual(9, start_col)
self.assertEqual(11, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [0, 3])
self.assertFalse(is_omitted)
self.assertEqual(2, row)
self.assertEqual(36, start_col)
self.assertEqual(42, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [1, 0])
self.assertFalse(is_omitted)
self.assertEqual(3, row)
self.assertEqual(9, start_col)
self.assertEqual(13, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [1, 3])
self.assertFalse(is_omitted)
self.assertEqual(3, row)
self.assertEqual(36, start_col)
self.assertEqual(42, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [3, 3])
self.assertFalse(is_omitted)
self.assertEqual(5, row)
self.assertEqual(36, start_col)
self.assertEqual(42, end_col)
with self.assertRaisesRegexp(
ValueError, "Indices exceed tensor dimensions"):
tensor_format.locate_tensor_element(out, [1, 4])
with self.assertRaisesRegexp(
ValueError, "Indices contain negative"):
tensor_format.locate_tensor_element(out, [-1, 2])
with self.assertRaisesRegexp(
ValueError, "Dimensions mismatch"):
tensor_format.locate_tensor_element(out, [0])
def testLocateTensorElement2DNoEllipsisWithNumericSummary(self):
a = np.linspace(0.0, 1.0 - 1.0 / 16.0, 16).reshape([4, 4])
out = tensor_format.format_tensor(a, "a", include_numeric_summary=True)
self.assertEqual([
"Tensor \"a\":",
"",
"Numeric summary:",
"| 0 + | total |",
"| 1 15 | 16 |",
"| min max mean std |",
"| 0.0 0.9375 0.46875 0.28811076429 |",
"",
"array([[ 0. , 0.0625, 0.125 , 0.1875],",
" [ 0.25 , 0.3125, 0.375 , 0.4375],",
" [ 0.5 , 0.5625, 0.625 , 0.6875],",
" [ 0.75 , 0.8125, 0.875 , 0.9375]])",
], out.lines)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [0, 0])
self.assertFalse(is_omitted)
self.assertEqual(8, row)
self.assertEqual(9, start_col)
self.assertEqual(11, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [0, 3])
self.assertFalse(is_omitted)
self.assertEqual(8, row)
self.assertEqual(36, start_col)
self.assertEqual(42, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [1, 0])
self.assertFalse(is_omitted)
self.assertEqual(9, row)
self.assertEqual(9, start_col)
self.assertEqual(13, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [1, 3])
self.assertFalse(is_omitted)
self.assertEqual(9, row)
self.assertEqual(36, start_col)
self.assertEqual(42, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [3, 3])
self.assertFalse(is_omitted)
self.assertEqual(11, row)
self.assertEqual(36, start_col)
self.assertEqual(42, end_col)
with self.assertRaisesRegexp(
ValueError, "Indices exceed tensor dimensions"):
tensor_format.locate_tensor_element(out, [1, 4])
with self.assertRaisesRegexp(
ValueError, "Indices contain negative"):
tensor_format.locate_tensor_element(out, [-1, 2])
with self.assertRaisesRegexp(
ValueError, "Dimensions mismatch"):
tensor_format.locate_tensor_element(out, [0])
def testLocateTensorElement3DWithEllipses(self):
a = np.zeros([11, 11, 11])
out = tensor_format.format_tensor(
a, "a", False, np_printoptions={"threshold": 100, "edgeitems": 2})
self.assertEqual([
"Tensor \"a\":",
"",
"array([[[ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.],",
" ..., ",
" [ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.]],",
"",
" [[ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.],",
" ..., ",
" [ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.]],",
"",
" ..., ",
" [[ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.],",
" ..., ",
" [ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.]],",
"",
" [[ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.],",
" ..., ",
" [ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.]]])",
], out.lines)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [0, 0, 0])
self.assertFalse(is_omitted)
self.assertEqual(2, row)
self.assertEqual(10, start_col)
self.assertEqual(12, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [0, 0, 10])
self.assertFalse(is_omitted)
self.assertEqual(2, row)
self.assertIsNone(start_col) # Passes ellipsis.
self.assertIsNone(end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [0, 1, 0])
self.assertFalse(is_omitted)
self.assertEqual(3, row)
self.assertEqual(10, start_col)
self.assertEqual(12, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [0, 2, 0])
self.assertTrue(is_omitted) # In omitted line.
self.assertEqual(4, row)
self.assertIsNone(start_col)
self.assertIsNone(end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [0, 2, 10])
self.assertTrue(is_omitted) # In omitted line.
self.assertEqual(4, row)
self.assertIsNone(start_col)
self.assertIsNone(end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [0, 8, 10])
self.assertTrue(is_omitted) # In omitted line.
self.assertEqual(4, row)
self.assertIsNone(start_col)
self.assertIsNone(end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [0, 10, 1])
self.assertFalse(is_omitted)
self.assertEqual(6, row)
self.assertEqual(15, start_col)
self.assertEqual(17, end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [5, 1, 1])
self.assertTrue(is_omitted) # In omitted line.
self.assertEqual(14, row)
self.assertIsNone(start_col)
self.assertIsNone(end_col)
is_omitted, row, start_col, end_col = tensor_format.locate_tensor_element(
out, [10, 10, 10])
self.assertFalse(is_omitted)
self.assertEqual(25, row)
self.assertIsNone(start_col) # Past ellipsis.
self.assertIsNone(end_col)
with self.assertRaisesRegexp(
ValueError, "Indices exceed tensor dimensions"):
tensor_format.locate_tensor_element(out, [11, 5, 5])
with self.assertRaisesRegexp(
ValueError, "Indices contain negative"):
tensor_format.locate_tensor_element(out, [-1, 5, 5])
with self.assertRaisesRegexp(
ValueError, "Dimensions mismatch"):
tensor_format.locate_tensor_element(out, [5, 5])
def testLocateTensorElement3DWithEllipsesBatchMode(self):
a = np.zeros([11, 11, 11])
out = tensor_format.format_tensor(
a, "a", False, np_printoptions={"threshold": 100,
"edgeitems": 2})
self.assertEqual([
"Tensor \"a\":",
"",
"array([[[ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.],",
" ..., ",
" [ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.]],",
"",
" [[ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.],",
" ..., ",
" [ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.]],",
"",
" ..., ",
" [[ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.],",
" ..., ",
" [ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.]],",
"",
" [[ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.],",
" ..., ",
" [ 0., 0., ..., 0., 0.],",
" [ 0., 0., ..., 0., 0.]]])",
], out.lines)
(are_omitted, rows, start_cols,
end_cols) = tensor_format.locate_tensor_element(out, [[0, 0, 0]])
self.assertEqual([False], are_omitted)
self.assertEqual([2], rows)
self.assertEqual([10], start_cols)
self.assertEqual([12], end_cols)
(are_omitted, rows, start_cols,
end_cols) = tensor_format.locate_tensor_element(out,
[[0, 0, 0], [0, 0, 10]])
self.assertEqual([False, False], are_omitted)
self.assertEqual([2, 2], rows)
self.assertEqual([10, None], start_cols)
self.assertEqual([12, None], end_cols)
(are_omitted, rows, start_cols,
end_cols) = tensor_format.locate_tensor_element(out,
[[0, 0, 0], [0, 2, 0]])
self.assertEqual([False, True], are_omitted)
self.assertEqual([2, 4], rows)
self.assertEqual([10, None], start_cols)
self.assertEqual([12, None], end_cols)
(are_omitted, rows, start_cols,
end_cols) = tensor_format.locate_tensor_element(out,
[[0, 0, 0], [10, 10, 10]])
self.assertEqual([False, False], are_omitted)
self.assertEqual([2, 25], rows)
self.assertEqual([10, None], start_cols)
self.assertEqual([12, None], end_cols)
def testLocateTensorElementAnnotationsUnavailable(self):
tensor_proto = tensor_pb2.TensorProto(
dtype=types_pb2.DataType.Value("DT_FLOAT"),
tensor_shape=tensor_shape_pb2.TensorShapeProto(
dim=[tensor_shape_pb2.TensorShapeProto.Dim(size=1)]))
out = tensor_format.format_tensor(
debug_data.InconvertibleTensorProto(tensor_proto, False), "a")
self.assertEqual(["Tensor \"a\":", "", "Uninitialized tensor:"],
out.lines[:3])
with self.assertRaisesRegexp(
AttributeError, "tensor_metadata is not available in annotations"):
tensor_format.locate_tensor_element(out, [0])
class NumericSummaryTest(test_util.TensorFlowTestCase):
def testNumericSummaryOnFloatFullHouse(self):
x = np.array([np.nan, np.nan, -np.inf, np.inf, np.inf, np.inf, -2, -3, -4,
0, 1, 2, 2, 2, 2, 0, 0, 0, np.inf, np.inf, np.inf])
out = tensor_format.numeric_summary(x)
self.assertEqual(
"| nan -inf - 0 + +inf | total |", out.lines[0])
self.assertEqual(
"| 2 1 3 4 5 6 | 21 |", out.lines[1])
self.assertEqual(
"| min max mean std |",
out.lines[2])
self.assertEqual(
"| -4.0 2.0 0.0 1.95789002075 |",
out.lines[3])
def testNumericSummaryOnFloatMissingCategories(self):
x = np.array([np.nan, np.nan])
out = tensor_format.numeric_summary(x)
self.assertEqual(2, len(out.lines))
self.assertEqual("| nan | total |", out.lines[0])
self.assertEqual("| 2 | 2 |", out.lines[1])
x = np.array([-np.inf, np.inf, 0, 0, np.inf, np.inf])
out = tensor_format.numeric_summary(x)
self.assertEqual("| -inf 0 +inf | total |", out.lines[0])
self.assertEqual("| 1 2 3 | 6 |", out.lines[1])
self.assertEqual("| min max mean std |", out.lines[2])
self.assertEqual("| 0.0 0.0 0.0 0.0 |", out.lines[3])
x = np.array([-120, 120, 130])
out = tensor_format.numeric_summary(x)
self.assertEqual("| - + | total |", out.lines[0])
self.assertEqual("| 1 2 | 3 |", out.lines[1])
self.assertEqual(
"| min max mean std |",
out.lines[2])
self.assertEqual(
"| -120 130 43.3333333333 115.566238822 |",
out.lines[3])
def testNumericSummaryOnEmptyFloat(self):
x = np.array([], dtype=np.float32)
out = tensor_format.numeric_summary(x)
self.assertEqual(["No numeric summary available due to empty tensor."],
out.lines)
def testNumericSummaryOnInt(self):
x = np.array([-3] * 50 + [3] * 200 + [0], dtype=np.int32)
out = tensor_format.numeric_summary(x)
self.assertEqual("| - 0 + | total |", out.lines[0])
self.assertEqual("| 50 1 200 | 251 |", out.lines[1])
self.assertEqual(
"| min max mean std |",
out.lines[2])
self.assertEqual(
"| -3 3 1.79282868526 2.39789673081 |",
out.lines[3])
def testNumericSummaryOnBool(self):
x = np.array([False, True, True, False], dtype=np.bool)
out = tensor_format.numeric_summary(x)
self.assertEqual(2, len(out.lines))
self.assertEqual("| False True | total |", out.lines[0])
self.assertEqual("| 2 2 | 4 |", out.lines[1])
x = np.array([True] * 10, dtype=np.bool)
out = tensor_format.numeric_summary(x)
self.assertEqual(2, len(out.lines))
self.assertEqual("| True | total |", out.lines[0])
self.assertEqual("| 10 | 10 |", out.lines[1])
x = np.array([False] * 10, dtype=np.bool)
out = tensor_format.numeric_summary(x)
self.assertEqual(2, len(out.lines))
self.assertEqual("| False | total |", out.lines[0])
self.assertEqual("| 10 | 10 |", out.lines[1])
x = np.array([], dtype=np.bool)
out = tensor_format.numeric_summary(x)
self.assertEqual(["No numeric summary available due to empty tensor."],
out.lines)
def testNumericSummaryOnStrTensor(self):
x = np.array(["spam", "egg"], dtype=np.object)
out = tensor_format.numeric_summary(x)
self.assertEqual(
["No numeric summary available due to tensor dtype: object."],
out.lines)
if __name__ == "__main__":
googletest.main()
| apache-2.0 |
tashaxe/Red-DiscordBot | lib/youtube_dl/extractor/uol.py | 43 | 4977 | # coding: utf-8
from __future__ import unicode_literals
from .common import InfoExtractor
from ..utils import (
clean_html,
int_or_none,
parse_duration,
update_url_query,
str_or_none,
)
class UOLIE(InfoExtractor):
IE_NAME = 'uol.com.br'
_VALID_URL = r'https?://(?:.+?\.)?uol\.com\.br/.*?(?:(?:mediaId|v)=|view/(?:[a-z0-9]+/)?|video(?:=|/(?:\d{4}/\d{2}/\d{2}/)?))(?P<id>\d+|[\w-]+-[A-Z0-9]+)'
_TESTS = [{
'url': 'http://player.mais.uol.com.br/player_video_v3.swf?mediaId=15951931',
'md5': '25291da27dc45e0afb5718a8603d3816',
'info_dict': {
'id': '15951931',
'ext': 'mp4',
'title': 'Miss simpatia é encontrada morta',
'description': 'md5:3f8c11a0c0556d66daf7e5b45ef823b2',
}
}, {
'url': 'http://tvuol.uol.com.br/video/incendio-destroi-uma-das-maiores-casas-noturnas-de-londres-04024E9A3268D4C95326',
'md5': 'e41a2fb7b7398a3a46b6af37b15c00c9',
'info_dict': {
'id': '15954259',
'ext': 'mp4',
'title': 'Incêndio destrói uma das maiores casas noturnas de Londres',
'description': 'Em Londres, um incêndio destruiu uma das maiores boates da cidade. Não há informações sobre vítimas.',
}
}, {
'url': 'http://mais.uol.com.br/static/uolplayer/index.html?mediaId=15951931',
'only_matching': True,
}, {
'url': 'http://mais.uol.com.br/view/15954259',
'only_matching': True,
}, {
'url': 'http://noticias.band.uol.com.br/brasilurgente/video/2016/08/05/15951931/miss-simpatia-e-encontrada-morta.html',
'only_matching': True,
}, {
'url': 'http://videos.band.uol.com.br/programa.asp?e=noticias&pr=brasil-urgente&v=15951931&t=Policia-desmonte-base-do-PCC-na-Cracolandia',
'only_matching': True,
}, {
'url': 'http://mais.uol.com.br/view/cphaa0gl2x8r/incendio-destroi-uma-das-maiores-casas-noturnas-de-londres-04024E9A3268D4C95326',
'only_matching': True,
}, {
'url': 'http://noticias.uol.com.br//videos/assistir.htm?video=rafaela-silva-inspira-criancas-no-judo-04024D983968D4C95326',
'only_matching': True,
}, {
'url': 'http://mais.uol.com.br/view/e0qbgxid79uv/15275470',
'only_matching': True,
}]
_FORMATS = {
'2': {
'width': 640,
'height': 360,
},
'5': {
'width': 1080,
'height': 720,
},
'6': {
'width': 426,
'height': 240,
},
'7': {
'width': 1920,
'height': 1080,
},
'8': {
'width': 192,
'height': 144,
},
'9': {
'width': 568,
'height': 320,
},
}
def _real_extract(self, url):
video_id = self._match_id(url)
media_id = None
if video_id.isdigit():
media_id = video_id
if not media_id:
embed_page = self._download_webpage(
'https://jsuol.com.br/c/tv/uol/embed/?params=[embed,%s]' % video_id,
video_id, 'Downloading embed page', fatal=False)
if embed_page:
media_id = self._search_regex(
(r'uol\.com\.br/(\d+)', r'mediaId=(\d+)'),
embed_page, 'media id', default=None)
if not media_id:
webpage = self._download_webpage(url, video_id)
media_id = self._search_regex(r'mediaId=(\d+)', webpage, 'media id')
video_data = self._download_json(
'http://mais.uol.com.br/apiuol/v3/player/getMedia/%s.json' % media_id,
media_id)['item']
title = video_data['title']
query = {
'ver': video_data.get('numRevision', 2),
'r': 'http://mais.uol.com.br',
}
formats = []
for f in video_data.get('formats', []):
f_url = f.get('url') or f.get('secureUrl')
if not f_url:
continue
format_id = str_or_none(f.get('id'))
fmt = {
'format_id': format_id,
'url': update_url_query(f_url, query),
}
fmt.update(self._FORMATS.get(format_id, {}))
formats.append(fmt)
self._sort_formats(formats)
tags = []
for tag in video_data.get('tags', []):
tag_description = tag.get('description')
if not tag_description:
continue
tags.append(tag_description)
return {
'id': media_id,
'title': title,
'description': clean_html(video_data.get('desMedia')),
'thumbnail': video_data.get('thumbnail'),
'duration': int_or_none(video_data.get('durationSeconds')) or parse_duration(video_data.get('duration')),
'tags': tags,
'formats': formats,
}
| gpl-3.0 |
kxliugang/edx-platform | common/test/acceptance/pages/lms/pay_and_verify.py | 110 | 6385 | """Payment and verification pages"""
import re
from bok_choy.page_object import PageObject
from bok_choy.promise import Promise
from . import BASE_URL
from .dashboard import DashboardPage
class PaymentAndVerificationFlow(PageObject):
"""Interact with the split payment and verification flow.
The flow can be accessed at the following URLs:
`/verify_student/start-flow/{course}/`
`/verify_student/upgrade/{course}/`
`/verify_student/verify-now/{course}/`
`/verify_student/verify-later/{course}/`
`/verify_student/payment-confirmation/{course}/`
Users can reach the flow when attempting to enroll in a course's verified
mode, either directly from the track selection page, or by upgrading from
the honor mode. Users can also reach the flow when attempting to complete
a deferred verification, or when attempting to view a receipt corresponding
to an earlier payment.
"""
def __init__(self, browser, course_id, entry_point='start-flow'):
"""Initialize the page.
Arguments:
browser (Browser): The browser instance.
course_id (unicode): The course in which the user is enrolling.
Keyword Arguments:
entry_point (str): Where to begin the flow; must be one of 'start-flow',
'upgrade', 'verify-now', verify-later', or 'payment-confirmation'.
Raises:
ValueError
"""
super(PaymentAndVerificationFlow, self).__init__(browser)
self._course_id = course_id
if entry_point not in ['start-flow', 'upgrade', 'verify-now', 'verify-later', 'payment-confirmation']:
raise ValueError(
"Entry point must be either 'start-flow', 'upgrade', 'verify-now', 'verify-later', or 'payment-confirmation'."
)
self._entry_point = entry_point
@property
def url(self):
"""Return the URL corresponding to the initial position in the flow."""
url = "{base}/verify_student/{entry_point}/{course}/".format(
base=BASE_URL,
entry_point=self._entry_point,
course=self._course_id
)
return url
def is_browser_on_page(self):
"""Check if a step in the payment and verification flow has loaded."""
return (
self.q(css="div .make-payment-step").is_present() or
self.q(css="div .payment-confirmation-step").is_present() or
self.q(css="div .face-photo-step").is_present() or
self.q(css="div .id-photo-step").is_present() or
self.q(css="div .review-photos-step").is_present() or
self.q(css="div .enrollment-confirmation-step").is_present()
)
def indicate_contribution(self):
"""Interact with the radio buttons appearing on the first page of the upgrade flow."""
self.q(css=".contribution-option > input").first.click()
def proceed_to_payment(self):
"""Interact with the payment button."""
self.q(css=".payment-button").click()
FakePaymentPage(self.browser, self._course_id).wait_for_page()
def immediate_verification(self):
"""Interact with the immediate verification button."""
self.q(css="#verify_now_button").click()
PaymentAndVerificationFlow(self.browser, self._course_id, entry_point='verify-now').wait_for_page()
def defer_verification(self):
"""Interact with the link allowing the user to defer their verification."""
self.q(css="#verify_later_button").click()
DashboardPage(self.browser).wait_for_page()
def webcam_capture(self):
"""Interact with a webcam capture button."""
self.q(css="#webcam_capture_button").click()
def _check_func():
next_step_button_classes = self.q(css="#next_step_button").attrs('class')
next_step_button_enabled = 'is-disabled' not in next_step_button_classes
return (next_step_button_enabled, next_step_button_classes)
# Check that the #next_step_button is enabled before returning control to the caller
Promise(_check_func, "The 'Next Step' button is enabled.").fulfill()
def next_verification_step(self, next_page_object):
"""Interact with the 'Next' step button found in the verification flow."""
self.q(css="#next_step_button").click()
next_page_object.wait_for_page()
def go_to_dashboard(self):
"""Interact with the link to the dashboard appearing on the enrollment confirmation page."""
if self.q(css="div .enrollment-confirmation-step").is_present():
self.q(css=".action-primary").click()
else:
raise Exception("The dashboard can only be accessed from the enrollment confirmation.")
DashboardPage(self.browser).wait_for_page()
class FakePaymentPage(PageObject):
"""Interact with the fake payment endpoint.
This page is hidden behind the feature flag `ENABLE_PAYMENT_FAKE`,
which is enabled in the Bok Choy env settings.
Configuring this payment endpoint also requires configuring the Bok Choy
auth settings with the following:
"CC_PROCESSOR_NAME": "CyberSource2",
"CC_PROCESSOR": {
"CyberSource2": {
"SECRET_KEY": <string>,
"ACCESS_KEY": <string>,
"PROFILE_ID": "edx",
"PURCHASE_ENDPOINT": "/shoppingcart/payment_fake"
}
}
"""
def __init__(self, browser, course_id):
"""Initialize the page.
Arguments:
browser (Browser): The browser instance.
course_id (unicode): The course in which the user is enrolling.
"""
super(FakePaymentPage, self).__init__(browser)
self._course_id = course_id
url = BASE_URL + "/shoppingcart/payment_fake/"
def is_browser_on_page(self):
"""Check if a step in the payment and verification flow has loaded."""
message = self.q(css='BODY').text[0]
match = re.search('Payment page', message)
return True if match else False
def submit_payment(self):
"""Interact with the payment submission button."""
self.q(css="input[value='Submit']").click()
return PaymentAndVerificationFlow(self.browser, self._course_id, entry_point='payment-confirmation').wait_for_page()
| agpl-3.0 |
WorldMG/production-email | lib/werkzeug/exceptions.py | 316 | 17799 | # -*- coding: utf-8 -*-
"""
werkzeug.exceptions
~~~~~~~~~~~~~~~~~~~
This module implements a number of Python exceptions you can raise from
within your views to trigger a standard non-200 response.
Usage Example
-------------
::
from werkzeug.wrappers import BaseRequest
from werkzeug.wsgi import responder
from werkzeug.exceptions import HTTPException, NotFound
def view(request):
raise NotFound()
@responder
def application(environ, start_response):
request = BaseRequest(environ)
try:
return view(request)
except HTTPException as e:
return e
As you can see from this example those exceptions are callable WSGI
applications. Because of Python 2.4 compatibility those do not extend
from the response objects but only from the python exception class.
As a matter of fact they are not Werkzeug response objects. However you
can get a response object by calling ``get_response()`` on a HTTP
exception.
Keep in mind that you have to pass an environment to ``get_response()``
because some errors fetch additional information from the WSGI
environment.
If you want to hook in a different exception page to say, a 404 status
code, you can add a second except for a specific subclass of an error::
@responder
def application(environ, start_response):
request = BaseRequest(environ)
try:
return view(request)
except NotFound, e:
return not_found(request)
except HTTPException, e:
return e
:copyright: (c) 2013 by the Werkzeug Team, see AUTHORS for more details.
:license: BSD, see LICENSE for more details.
"""
import sys
# Because of bootstrapping reasons we need to manually patch ourselves
# onto our parent module.
import werkzeug
werkzeug.exceptions = sys.modules[__name__]
from werkzeug._internal import _get_environ
from werkzeug._compat import iteritems, integer_types, text_type, \
implements_to_string
from werkzeug.wrappers import Response
@implements_to_string
class HTTPException(Exception):
"""
Baseclass for all HTTP exceptions. This exception can be called as WSGI
application to render a default error page or you can catch the subclasses
of it independently and render nicer error messages.
"""
code = None
description = None
def __init__(self, description=None, response=None):
Exception.__init__(self)
if description is not None:
self.description = description
self.response = response
@classmethod
def wrap(cls, exception, name=None):
"""This method returns a new subclass of the exception provided that
also is a subclass of `BadRequest`.
"""
class newcls(cls, exception):
def __init__(self, arg=None, *args, **kwargs):
cls.__init__(self, *args, **kwargs)
exception.__init__(self, arg)
newcls.__module__ = sys._getframe(1).f_globals.get('__name__')
newcls.__name__ = name or cls.__name__ + exception.__name__
return newcls
@property
def name(self):
"""The status name."""
return HTTP_STATUS_CODES.get(self.code, 'Unknown Error')
def get_description(self, environ=None):
"""Get the description."""
return u'<p>%s</p>' % escape(self.description)
def get_body(self, environ=None):
"""Get the HTML body."""
return text_type((
u'<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 3.2 Final//EN">\n'
u'<title>%(code)s %(name)s</title>\n'
u'<h1>%(name)s</h1>\n'
u'%(description)s\n'
) % {
'code': self.code,
'name': escape(self.name),
'description': self.get_description(environ)
})
def get_headers(self, environ=None):
"""Get a list of headers."""
return [('Content-Type', 'text/html')]
def get_response(self, environ=None):
"""Get a response object. If one was passed to the exception
it's returned directly.
:param environ: the optional environ for the request. This
can be used to modify the response depending
on how the request looked like.
:return: a :class:`Response` object or a subclass thereof.
"""
if self.response is not None:
return self.response
if environ is not None:
environ = _get_environ(environ)
headers = self.get_headers(environ)
return Response(self.get_body(environ), self.code, headers)
def __call__(self, environ, start_response):
"""Call the exception as WSGI application.
:param environ: the WSGI environment.
:param start_response: the response callable provided by the WSGI
server.
"""
response = self.get_response(environ)
return response(environ, start_response)
def __str__(self):
return '%d: %s' % (self.code, self.name)
def __repr__(self):
return '<%s \'%s\'>' % (self.__class__.__name__, self)
class BadRequest(HTTPException):
"""*400* `Bad Request`
Raise if the browser sends something to the application the application
or server cannot handle.
"""
code = 400
description = (
'The browser (or proxy) sent a request that this server could '
'not understand.'
)
class ClientDisconnected(BadRequest):
"""Internal exception that is raised if Werkzeug detects a disconnected
client. Since the client is already gone at that point attempting to
send the error message to the client might not work and might ultimately
result in another exception in the server. Mainly this is here so that
it is silenced by default as far as Werkzeug is concerned.
Since disconnections cannot be reliably detected and are unspecified
by WSGI to a large extend this might or might not be raised if a client
is gone.
.. versionadded:: 0.8
"""
class SecurityError(BadRequest):
"""Raised if something triggers a security error. This is otherwise
exactly like a bad request error.
.. versionadded:: 0.9
"""
class Unauthorized(HTTPException):
"""*401* `Unauthorized`
Raise if the user is not authorized. Also used if you want to use HTTP
basic auth.
"""
code = 401
description = (
'The server could not verify that you are authorized to access '
'the URL requested. You either supplied the wrong credentials (e.g. '
'a bad password), or your browser doesn\'t understand how to supply '
'the credentials required.'
)
class Forbidden(HTTPException):
"""*403* `Forbidden`
Raise if the user doesn't have the permission for the requested resource
but was authenticated.
"""
code = 403
description = (
'You don\'t have the permission to access the requested resource. '
'It is either read-protected or not readable by the server.'
)
class NotFound(HTTPException):
"""*404* `Not Found`
Raise if a resource does not exist and never existed.
"""
code = 404
description = (
'The requested URL was not found on the server. '
'If you entered the URL manually please check your spelling and '
'try again.'
)
class MethodNotAllowed(HTTPException):
"""*405* `Method Not Allowed`
Raise if the server used a method the resource does not handle. For
example `POST` if the resource is view only. Especially useful for REST.
The first argument for this exception should be a list of allowed methods.
Strictly speaking the response would be invalid if you don't provide valid
methods in the header which you can do with that list.
"""
code = 405
description = 'The method is not allowed for the requested URL.'
def __init__(self, valid_methods=None, description=None):
"""Takes an optional list of valid http methods
starting with werkzeug 0.3 the list will be mandatory."""
HTTPException.__init__(self, description)
self.valid_methods = valid_methods
def get_headers(self, environ):
headers = HTTPException.get_headers(self, environ)
if self.valid_methods:
headers.append(('Allow', ', '.join(self.valid_methods)))
return headers
class NotAcceptable(HTTPException):
"""*406* `Not Acceptable`
Raise if the server can't return any content conforming to the
`Accept` headers of the client.
"""
code = 406
description = (
'The resource identified by the request is only capable of '
'generating response entities which have content characteristics '
'not acceptable according to the accept headers sent in the '
'request.'
)
class RequestTimeout(HTTPException):
"""*408* `Request Timeout`
Raise to signalize a timeout.
"""
code = 408
description = (
'The server closed the network connection because the browser '
'didn\'t finish the request within the specified time.'
)
class Conflict(HTTPException):
"""*409* `Conflict`
Raise to signal that a request cannot be completed because it conflicts
with the current state on the server.
.. versionadded:: 0.7
"""
code = 409
description = (
'A conflict happened while processing the request. The resource '
'might have been modified while the request was being processed.'
)
class Gone(HTTPException):
"""*410* `Gone`
Raise if a resource existed previously and went away without new location.
"""
code = 410
description = (
'The requested URL is no longer available on this server and '
'there is no forwarding address.</p><p>If you followed a link '
'from a foreign page, please contact the author of this page.'
)
class LengthRequired(HTTPException):
"""*411* `Length Required`
Raise if the browser submitted data but no ``Content-Length`` header which
is required for the kind of processing the server does.
"""
code = 411
description = (
'A request with this method requires a valid <code>Content-'
'Length</code> header.'
)
class PreconditionFailed(HTTPException):
"""*412* `Precondition Failed`
Status code used in combination with ``If-Match``, ``If-None-Match``, or
``If-Unmodified-Since``.
"""
code = 412
description = (
'The precondition on the request for the URL failed positive '
'evaluation.'
)
class RequestEntityTooLarge(HTTPException):
"""*413* `Request Entity Too Large`
The status code one should return if the data submitted exceeded a given
limit.
"""
code = 413
description = (
'The data value transmitted exceeds the capacity limit.'
)
class RequestURITooLarge(HTTPException):
"""*414* `Request URI Too Large`
Like *413* but for too long URLs.
"""
code = 414
description = (
'The length of the requested URL exceeds the capacity limit '
'for this server. The request cannot be processed.'
)
class UnsupportedMediaType(HTTPException):
"""*415* `Unsupported Media Type`
The status code returned if the server is unable to handle the media type
the client transmitted.
"""
code = 415
description = (
'The server does not support the media type transmitted in '
'the request.'
)
class RequestedRangeNotSatisfiable(HTTPException):
"""*416* `Requested Range Not Satisfiable`
The client asked for a part of the file that lies beyond the end
of the file.
.. versionadded:: 0.7
"""
code = 416
description = (
'The server cannot provide the requested range.'
)
class ExpectationFailed(HTTPException):
"""*417* `Expectation Failed`
The server cannot meet the requirements of the Expect request-header.
.. versionadded:: 0.7
"""
code = 417
description = (
'The server could not meet the requirements of the Expect header'
)
class ImATeapot(HTTPException):
"""*418* `I'm a teapot`
The server should return this if it is a teapot and someone attempted
to brew coffee with it.
.. versionadded:: 0.7
"""
code = 418
description = (
'This server is a teapot, not a coffee machine'
)
class UnprocessableEntity(HTTPException):
"""*422* `Unprocessable Entity`
Used if the request is well formed, but the instructions are otherwise
incorrect.
"""
code = 422
description = (
'The request was well-formed but was unable to be followed '
'due to semantic errors.'
)
class PreconditionRequired(HTTPException):
"""*428* `Precondition Required`
The server requires this request to be conditional, typically to prevent
the lost update problem, which is a race condition between two or more
clients attempting to update a resource through PUT or DELETE. By requiring
each client to include a conditional header ("If-Match" or "If-Unmodified-
Since") with the proper value retained from a recent GET request, the
server ensures that each client has at least seen the previous revision of
the resource.
"""
code = 428
description = (
'This request is required to be conditional; try using "If-Match" '
'or "If-Unmodified-Since".'
)
class TooManyRequests(HTTPException):
"""*429* `Too Many Requests`
The server is limiting the rate at which this user receives responses, and
this request exceeds that rate. (The server may use any convenient method
to identify users and their request rates). The server may include a
"Retry-After" header to indicate how long the user should wait before
retrying.
"""
code = 429
description = (
'This user has exceeded an allotted request count. Try again later.'
)
class RequestHeaderFieldsTooLarge(HTTPException):
"""*431* `Request Header Fields Too Large`
The server refuses to process the request because the header fields are too
large. One or more individual fields may be too large, or the set of all
headers is too large.
"""
code = 431
description = (
'One or more header fields exceeds the maximum size.'
)
class InternalServerError(HTTPException):
"""*500* `Internal Server Error`
Raise if an internal server error occurred. This is a good fallback if an
unknown error occurred in the dispatcher.
"""
code = 500
description = (
'The server encountered an internal error and was unable to '
'complete your request. Either the server is overloaded or there '
'is an error in the application.'
)
class NotImplemented(HTTPException):
"""*501* `Not Implemented`
Raise if the application does not support the action requested by the
browser.
"""
code = 501
description = (
'The server does not support the action requested by the '
'browser.'
)
class BadGateway(HTTPException):
"""*502* `Bad Gateway`
If you do proxying in your application you should return this status code
if you received an invalid response from the upstream server it accessed
in attempting to fulfill the request.
"""
code = 502
description = (
'The proxy server received an invalid response from an upstream '
'server.'
)
class ServiceUnavailable(HTTPException):
"""*503* `Service Unavailable`
Status code you should return if a service is temporarily unavailable.
"""
code = 503
description = (
'The server is temporarily unable to service your request due to '
'maintenance downtime or capacity problems. Please try again '
'later.'
)
default_exceptions = {}
__all__ = ['HTTPException']
def _find_exceptions():
for name, obj in iteritems(globals()):
try:
if getattr(obj, 'code', None) is not None:
default_exceptions[obj.code] = obj
__all__.append(obj.__name__)
except TypeError: # pragma: no cover
continue
_find_exceptions()
del _find_exceptions
class Aborter(object):
"""
When passed a dict of code -> exception items it can be used as
callable that raises exceptions. If the first argument to the
callable is an integer it will be looked up in the mapping, if it's
a WSGI application it will be raised in a proxy exception.
The rest of the arguments are forwarded to the exception constructor.
"""
def __init__(self, mapping=None, extra=None):
if mapping is None:
mapping = default_exceptions
self.mapping = dict(mapping)
if extra is not None:
self.mapping.update(extra)
def __call__(self, code, *args, **kwargs):
if not args and not kwargs and not isinstance(code, integer_types):
raise HTTPException(response=code)
if code not in self.mapping:
raise LookupError('no exception for %r' % code)
raise self.mapping[code](*args, **kwargs)
abort = Aborter()
#: an exception that is used internally to signal both a key error and a
#: bad request. Used by a lot of the datastructures.
BadRequestKeyError = BadRequest.wrap(KeyError)
# imported here because of circular dependencies of werkzeug.utils
from werkzeug.utils import escape
from werkzeug.http import HTTP_STATUS_CODES
| apache-2.0 |
naresh21/synergetics-edx-platform | lms/djangoapps/notes/models.py | 13 | 3225 | from django.db import models
from django.contrib.auth.models import User
from django.core.urlresolvers import reverse
from django.core.exceptions import ValidationError
from django.utils.html import strip_tags
import json
from openedx.core.djangoapps.xmodule_django.models import CourseKeyField
class Note(models.Model):
user = models.ForeignKey(User, db_index=True)
course_id = CourseKeyField(max_length=255, db_index=True)
uri = models.CharField(max_length=255, db_index=True)
text = models.TextField(default="")
quote = models.TextField(default="")
range_start = models.CharField(max_length=2048) # xpath string
range_start_offset = models.IntegerField()
range_end = models.CharField(max_length=2048) # xpath string
range_end_offset = models.IntegerField()
tags = models.TextField(default="") # comma-separated string
created = models.DateTimeField(auto_now_add=True, null=True, db_index=True)
updated = models.DateTimeField(auto_now=True, db_index=True)
class Meta:
app_label = 'notes'
def clean(self, json_body):
"""
Cleans the note object or raises a ValidationError.
"""
if json_body is None:
raise ValidationError('Note must have a body.')
body = json.loads(json_body)
if not isinstance(body, dict):
raise ValidationError('Note body must be a dictionary.')
# NOTE: all three of these fields should be considered user input
# and may be output back to the user, so we need to sanitize them.
# These fields should only contain _plain text_.
self.uri = strip_tags(body.get('uri', ''))
self.text = strip_tags(body.get('text', ''))
self.quote = strip_tags(body.get('quote', ''))
ranges = body.get('ranges')
if ranges is None or len(ranges) != 1:
raise ValidationError('Note must contain exactly one range.')
self.range_start = ranges[0]['start']
self.range_start_offset = ranges[0]['startOffset']
self.range_end = ranges[0]['end']
self.range_end_offset = ranges[0]['endOffset']
self.tags = ""
tags = [strip_tags(tag) for tag in body.get('tags', [])]
if len(tags) > 0:
self.tags = ",".join(tags)
def get_absolute_url(self):
"""
Returns the absolute url for the note object.
"""
# pylint: disable=no-member
kwargs = {'course_id': self.course_id.to_deprecated_string(), 'note_id': str(self.pk)}
return reverse('notes_api_note', kwargs=kwargs)
def as_dict(self):
"""
Returns the note object as a dictionary.
"""
return {
'id': self.pk,
'user_id': self.user.pk,
'uri': self.uri,
'text': self.text,
'quote': self.quote,
'ranges': [{
'start': self.range_start,
'startOffset': self.range_start_offset,
'end': self.range_end,
'endOffset': self.range_end_offset
}],
'tags': self.tags.split(","),
'created': str(self.created),
'updated': str(self.updated)
}
| agpl-3.0 |
swarna-k/MyDiary | flask/lib/python2.7/site-packages/wheel/archive.py | 239 | 1559 | """
Archive tools for wheel.
"""
import logging
import os.path
import zipfile
log = logging.getLogger("wheel")
def archive_wheelfile(base_name, base_dir):
'''Archive all files under `base_dir` in a whl file and name it like
`base_name`.
'''
olddir = os.path.abspath(os.curdir)
base_name = os.path.abspath(base_name)
try:
os.chdir(base_dir)
return make_wheelfile_inner(base_name)
finally:
os.chdir(olddir)
def make_wheelfile_inner(base_name, base_dir='.'):
"""Create a whl file from all the files under 'base_dir'.
Places .dist-info at the end of the archive."""
zip_filename = base_name + ".whl"
log.info("creating '%s' and adding '%s' to it", zip_filename, base_dir)
# XXX support bz2, xz when available
zip = zipfile.ZipFile(open(zip_filename, "wb+"), "w",
compression=zipfile.ZIP_DEFLATED)
score = {'WHEEL': 1, 'METADATA': 2, 'RECORD': 3}
deferred = []
def writefile(path):
zip.write(path, path)
log.info("adding '%s'" % path)
for dirpath, dirnames, filenames in os.walk(base_dir):
for name in filenames:
path = os.path.normpath(os.path.join(dirpath, name))
if os.path.isfile(path):
if dirpath.endswith('.dist-info'):
deferred.append((score.get(name, 0), path))
else:
writefile(path)
deferred.sort()
for score, path in deferred:
writefile(path)
zip.close()
return zip_filename
| bsd-3-clause |
ComputationalPhysics/atomify-lammps | libs/lammps/tools/i-pi/ipi/engine/properties.py | 18 | 57969 | """Holds the class which computes important properties of the system, and
prepares them for output.
Copyright (C) 2013, Joshua More and Michele Ceriotti
This program is free software: you can redistribute it and/or modify
it under the terms of the GNU General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
This program is distributed in the hope that it will be useful,
but WITHOUT ANY WARRANTY; without even the implied warranty of
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
GNU General Public License for more details.
You should have received a copy of the GNU General Public License
along with this program. If not, see <http.//www.gnu.org/licenses/>.
Classes:
Properties: This is the class that holds all the algorithms to calculate
the important properties that should be output.
Trajectories: This class deals with outputting all position data in the
appropriate format.
Functions:
getkey: This function strips the units and argument list specification
from a string specifying an output parameter.
getall: This function gives the keyword, units and argument list
specification from a string specifying an output parameter.
help_latex: This returns a string that can be used in the manual to
specify the different available outputs.
"""
__all__ = ['Properties', 'Trajectories', 'getkey', 'getall', 'help_latex']
import os
import numpy as np
from ipi.utils.messages import verbosity, info, warning
from ipi.utils.depend import *
from ipi.utils.units import Constants, unit_to_internal, unit_to_user
from ipi.utils.mathtools import logsumlog, h2abc_deg
from ipi.utils.io import *
from ipi.engine.atoms import *
from ipi.engine.cell import *
from ipi.engine.ensembles import *
from ipi.engine.forces import *
def getkey(pstring):
"""Strips units and argument lists from a property/trajectory keyword.
Args:
pstring: The string input by the user that specifies an output,
which in general will specify units and argument lists.
Returns: A string giving the keyword for the property, stripped of the
argument lists and units key words.
"""
pa = pstring.find('(')
if pa < 0:
pa = len(pstring)
pu = pstring.find('{')
if pu < 0:
pu = len(pstring)
return pstring[0:min(pa,pu)].strip()
def getall(pstring):
"""Returns the keyword, units and argument list separately.
Args:
pstring: The string input by the user that specifies an output,
which in general will specify units and argument lists.
Returns: A tuple giving the keyword for the property, and its units
argument list and key word argument list.
"""
unit = ""
arglist = ()
kwarglist = {}
unstart = len(pstring)
argstart = unstart
if '}' in pstring:
# the property has a user-defined unit
unstart = pstring.find('{')
unstop = pstring.find('}', unstart)
if unstop == -1:
raise ValueError("Incorrect format in units specification " + pstring)
unit = pstring[unstart+1:unstop]
if '(' in pstring:
# If the property has additional arguments
argstart = pstring.find('(')
argstop = pstring.find(')', argstart)
if argstop == -1:
raise ValueError("Incorrect format in argument list " + pstring)
argstr = pstring[argstart:argstop+1]
arglist = io_xml.read_tuple(argstr, delims="()", split=";", arg_type=str)
for arg in arglist:
# If a keyword argument is used
equals = arg.find('=')
if equals >= 0:
kwarglist[arg[0:equals].strip()] = arg[equals+1:].strip()
arglist = tuple(a for a in arglist if not a == arg)
pstring = pstring[0:min(unstart,argstart)].strip() # strips the arguments from pstring name
return (pstring, unit, arglist, kwarglist)
def help_latex(idict, standalone=True):
"""Function to generate a LaTeX formatted file.
Args:
idict: Either property_dict or traj_dict, to be used to
generate the help file.
standalone: A boolean giving whether the latex file produced will be a
stand-alone document, or will be intended as a section of a larger
document with cross-references between the different sections.
Returns:
A LaTeX formatted string.
"""
rstr = ""
if standalone:
#assumes that it is a stand-alone document, so must have document
#options.
rstr += r"\documentclass[12pt,fleqn]{report}"
rstr += r"""
\usepackage{etoolbox}
\usepackage{suffix}
\newcommand{\ipiitem}[3]{%
\ifblank{#1}{}{\ifstrequal{#1}{\underline{}}{}{
{\noindent\textbf{#1}:\rule{0.0pt}{1.05\baselineskip}\quad}}}% uses a strut to add a bit of vertical space
{#2}\parskip=0pt\par
\ifblank{#3}{}%
{ {\hfill\raggedleft\textit{\small #3}\par} }
}
"""
rstr += "\n\\begin{document}\n"
rstr += "The following are the different allowable ouputs:\n\\par"
for out in sorted(idict):
rstr += "\\ipiitem{" + out + "}"
if "longhelp" in idict[out]:
rstr += "{" + idict[out]['longhelp'] +"}"
else:
rstr += "{" + idict[out]['help'] +"}"
#see if there are additional attributes to print out
xstr = ""
if "dimension" in idict[out] and idict[out]['dimension'] != "undefined": #doesn't print out dimension if not necessary.
xstr += "dimension: " + idict[out]['dimension'] + '; '
if "size" in idict[out]:
xstr += "size: " + str(idict[out]['size']) +"; "
rstr += "{" + xstr + "}"
if standalone:
#ends the created document if it is not part of a larger document
rstr += "\\end{document}"
# Some escape characters are necessary for the proper latex formatting
rstr = rstr.replace('_', '\\_')
rstr = rstr.replace('\\\\_', '\\_')
rstr = rstr.replace('...', '\\ldots ')
rstr = rstr.replace('<', '$<$')
rstr = rstr.replace('>', '$>$')
rstr = rstr.replace('[', '$[$')
rstr = rstr.replace(']', '$]$')
return rstr
class Properties(dobject):
"""A proxy to compute and output properties of the system.
Takes the fundamental properties calculated during the simulation, and
prepares them for output. It also contains simple algorithms to calculate
other properties not calculated during the simulation itself, so that
these can also be output.
Attributes:
fd_delta: A float giving the size of the finite difference
parameter used in the Yamamoto kinetic energy estimator. Defaults
to _DEFAULT_FINDIFF.
_DEFAULT_FDERROR: A float giving the size of the minimum precision
allowed for the finite difference calculation in the Yamamoto kinetic
energy estimator.
_DEFAULT_MINFID: A float giving the maximum displacement in the Yamamoto
kinetic energy estimator.
dbeads: A dummy Beads object used in the Yamamoto kinetic energy
estimator.
dforces: A dummy Forces object used in the Yamamoto kinetic energy
estimator.
simul: The Simulation object containing the data to be output.
ensemble: An ensemble object giving the objects necessary for producing
the correct ensemble.
beads: A beads object giving the atoms positions.
nm: A normal modes object giving the normal mode representation.
cell: A cell object giving the system box.
forces: A forcefield object giving the force calculator for each
replica of the system.
property_dict: A dictionary containing all the properties that can be
output.
"""
_DEFAULT_FINDIFF = 1e-5
_DEFAULT_FDERROR = 1e-9
_DEFAULT_MINFID = 1e-12
def __init__(self):
"""Initialises Properties."""
self.property_dict = {
"step": { "dimension" : "number",
"help" : "The current simulation time step.",
'func': (lambda: (1 + self.simul.step))},
"time": { "dimension": "time",
"help": "The elapsed simulation time.",
'func': (lambda: (1 + self.simul.step)*self.ensemble.dt)},
"temperature": {"dimension": "temperature",
"help": "The current temperature, as obtained from the MD kinetic energy.",
"longhelp" : """The current temperature, as obtained from the MD kinetic energy of the (extended)
ring polymer. Takes a single, optional argument 'atom', which can be either an
atom label or an index (zero-based) to specify which species or individual atom
to output the temperature of. If not specified, all atoms are used and averaged.""",
'func': self.get_temp },
"density": { "dimension": "density",
"help": "The mass density of the physical system.",
'func': (lambda: self.beads.m.sum()/self.cell.V)},
"volume": { "dimension": "volume",
"help": "The volume of the cell box.",
'func': (lambda: self.cell.V) },
"cell_h": { "dimension" : "length",
"help": "The simulation cell as a matrix. Returns the 6 non-zero components in the form [xx, yy, zz, xy, xz, yz].",
"size": 6,
"func": (lambda: self.tensor2vec(self.cell.h))},
"cell_abcABC": {"dimension" : "undefined",
"help": "The lengths of the cell vectors and the angles between them in degrees as a list of the form [a, b, c, A, B, C]",
"longhelp": """The lengths of the cell vectors and the angles between them in degrees as a list of the
form [a, b, c, A, B, C], where A is the angle between the sides of length b and c in degrees, and B and C
are defined similarly. Since the output mixes different units, a, b and c can only be output in bohr.""",
"size": 6,
'func': (lambda: np.asarray(h2abc_deg(self.cell.h)))},
"conserved": { "dimension": "energy",
"help": "The value of the conserved energy quantity per bead.",
'func': (lambda: self.ensemble.econs/float(self.beads.nbeads))},
"potential": { "dimension" : "energy",
"help": "The physical system potential energy.",
'func': (lambda: self.forces.pot/self.beads.nbeads)},
"spring": { "dimension" : "energy",
"help": "The total spring potential energy between the beads of all the ring polymers in the system.",
'func': (lambda: self.beads.vpath*self.nm.omegan2/self.beads.nbeads)},
"kinetic_md": {"dimension" : "energy",
"help": "The kinetic energy of the (extended) classical system.",
"longhelp" : """The kinetic energy of the (extended) classical system. Takes an argument 'atom',
which can be either an atom label or index (zero based) to specify which species to find the
kinetic energy of. If not specified, all atoms are used.""",
'func': self.get_kinmd},
"kinetic_cv": {"dimension" : "energy",
"help": "The centroid-virial quantum kinetic energy of the physical system.",
"longhelp": """The centroid-virial quantum kinetic energy of the physical system.
Takes an argument 'atom', which can be either an atom label or index (zero based)
to specify which species to find the kinetic energy of. If not specified, all atoms are used.""",
'func': self.get_kincv},
"kinetic_tens":{"dimension" : "energy",
"help" : "The centroid-virial quantum kinetic energy tensor of the physical system.",
"longhelp" : """The centroid-virial quantum kinetic energy tensor of the physical system.
Returns the 6 independent components in the form [xx, yy, zz, xy, xz, yz]. Takes an
argument 'atom', which can be either an atom label or index (zero based) to specify
which species to find the kinetic tensor components of. If not specified, all atoms are used.""",
"size" : 6,
"func" : self.get_ktens},
"kinetic_ij": {"dimension" : "energy",
"help" : "The centroid-virial off-diagonal quantum kinetic energy tensor of the physical system.",
"longhelp" : """The centroid-virial off-diagonal quantum kinetic energy tensor of the physical system.
This computes the cross terms between atoms i and atom j, whose average is <p_i*p_j/(2*sqrt(m_i*m_j))>.
Returns the 6 independent components in the form [xx, yy, zz, xy, xz, yz]. Takes arguments 'i' and 'j',
which give the indices of the two desired atoms.""",
"size" : 6,
"func" : self.get_kij},
"r_gyration": { "dimension" : "length",
"help" : "The average radius of gyration of the selected ring polymers.",
"longhelp" : """The average radius of gyration of the selected ring polymers. Takes an
argument 'atom', which can be either an atom label or index (zero based) to specify which
species to find the radius of gyration of. If not specified, all atoms are used and averaged.""",
"func": self.get_rg},
"atom_x": { "dimension" : "length",
"help": "The position (x,y,z) of a particle given its index.",
"longhelp" : """The position (x,y,z) of a particle given its index. Takes arguments index
and bead (both zero based). If bead is not specified, refers to the centroid.""",
"size" : 3,
"func" : (lambda atom="", bead="-1": self.get_atom_vec(self.beads.q, atom=atom, bead=bead))},
"atom_v": { "dimension" : "velocity",
"help": "The velocity (x,y,z) of a particle given its index.",
"longhelp": """The velocity (x,y,z) of a particle given its index. Takes arguments index
and bead (both zero based). If bead is not specified, refers to the centroid.""",
"size" : 3,
"func" : (lambda atom="", bead="-1": self.get_atom_vec(self.beads.p/self.beads.m3, atom=atom, bead=bead))},
"atom_p": { "dimension" : "momentum",
"help": "The momentum (x,y,z) of a particle given its index.",
"longhelp": """The momentum (x,y,z) of a particle given its index. Takes arguments index
and bead (both zero based). If bead is not specified, refers to the centroid.""",
"size" : 3,
"func" : (lambda atom="", bead="-1": self.get_atom_vec(self.beads.p, atom=atom, bead=bead))},
"atom_f": { "dimension" : "force",
"help": "The force (x,y,z) acting on a particle given its index.",
"longhelp": """The force (x,y,z) acting on a particle given its index. Takes arguments index
and bead (both zero based). If bead is not specified, refers to the centroid.""",
"size" : 3,
"func" : (lambda atom="", bead="-1": self.get_atom_vec(self.forces.f, atom=atom, bead=bead))},
"stress_md": { "dimension": "pressure",
"size" : 6,
"help": "The total stress tensor of the (extended) classical system.",
"longhelp": """The total stress tensor of the (extended) classical system. Returns the 6
independent components in the form [xx, yy, zz, xy, xz, yz].""",
"func": (lambda: self.tensor2vec((self.forces.vir + self.nm.kstress)/self.cell.V))},
"pressure_md": {"dimension": "pressure",
"help": "The pressure of the (extended) classical system.",
"func": (lambda: np.trace((self.forces.vir + self.nm.kstress)/(3.0*self.cell.V)))},
"kstress_md": {"dimension": "pressure",
"size" : 6,
"help": "The kinetic stress tensor of the (extended) classical system.",
"longhelp": """The kinetic stress tensor of the (extended) classical system. Returns the 6
independent components in the form [xx, yy, zz, xy, xz, yz].""",
"func": (lambda: self.tensor2vec(self.nm.kstress/self.cell.V))},
"virial_md": { "dimension": "pressure",
"size" : 6,
"help": "The virial tensor of the (extended) classical system.",
"longhelp": """The virial tensor of the (extended) classical system. Returns the 6
independent components in the form [xx, yy, zz, xy, xz, yz].""",
"func": (lambda: self.tensor2vec(self.forces.vir/self.cell.V))},
"stress_cv": { "dimension": "pressure",
"size" : 6,
"help": "The total quantum estimator for the stress tensor of the physical system.",
"longhelp": """The total quantum estimator for the stress tensor of the physical system. Returns the
6 independent components in the form [xx, yy, zz, xy, xz, yz].""",
"func": (lambda: self.tensor2vec(self.forces.vir + self.kstress_cv())/(self.cell.V*self.beads.nbeads))},
"pressure_cv": {"dimension": "pressure",
"help": "The quantum estimator for pressure of the physical system.",
"func": (lambda: np.trace(self.forces.vir + self.kstress_cv())/(3.0*self.cell.V*self.beads.nbeads))},
"kstress_cv": {"dimension": "pressure",
"size" : 6,
"help": "The quantum estimator for the kinetic stress tensor of the physical system.",
"longhelp": """The quantum estimator for the kinetic stress tensor of the physical system.
Returns the 6 independent components in the form [xx, yy, zz, xy, xz, yz].""",
"func": (lambda: self.tensor2vec(self.kstress_cv()/(self.cell.V*self.beads.nbeads)))},
"virial_cv": { "dimension": "pressure",
"size" : 6,
"help": "The quantum estimator for the virial stress tensor of the physical system.",
"longhelp": """The quantum estimator for the virial stress tensor of the physical system.
Returns the 6 independent components in the form [xx, yy, zz, xy, xz, yz].""",
"func": (lambda: self.tensor2vec(self.forces.vir/(self.cell.V*self.beads.nbeads)))},
"displacedpath": { "dimension": "undefined",
"help": "The displaced path end-to-end distribution estimator",
"longhelp": """This is the estimator for the end-to-end distribution, that can be used to calculate the
particle momentum distribution as described in in L. Lin, J. A. Morrone, R. Car and M. Parrinello,
105, 110602 (2010), Phys. Rev. Lett. Takes arguments 'ux', 'uy' and 'uz', which are the components of
the path opening vector. Also takes an argument 'atom', which can be either an atom label or index
(zero based) to specify which species to find the end-to-end distribution estimator for. If not
specified, all atoms are used. Note that one atom is computed at a time, and that each path opening
operation costs as much as a PIMD step. Returns the average over the selected atoms of the estimator of
exp(-U(u)) for each frame.""",
"func": self.get_linlin},
"scaledcoords": { "dimension": "undefined",
"help" : "The scaled coordinates estimators that can be used to compute energy and heat capacity",
"longhelp": """Returns the estimators that are required to evaluate the scaled-coordinates estimators
for total energy and heat capacity, as described in T. M. Yamamoto,
J. Chem. Phys., 104101, 123 (2005). Returns eps_v and eps_v', as defined in that paper.
As the two estimators have a different dimensions, this can only be output in atomic units.
Takes one argument, 'fd_delta', which gives the value of the finite difference parameter used -
which defaults to """+ str(-self._DEFAULT_FINDIFF) + """. If the value of 'fd_delta' is negative,
then its magnitude will be reduced automatically by the code if the finite difference error
becomes too large.""",
'func': self.get_yama_estimators,
"size": 2},
"isotope_scfep": {"dimension": "undefined",
"size": 7,
'func': self.get_isotope_yama,
"help": "The scaled-coordinates free energy perturbation scaled mass KE estimator.",
"longhelp" : """Returns the (many) terms needed to compute the scaled-coordinates free energy
perturbation scaled mass KE estimator (M. Ceriotti, T. Markland, J. Chem. Phys. 138, 014112 (2013)).
Takes two arguments, 'alpha' and 'atom', which give the
scaled mass parameter and the atom of interest respectively, and default to '1.0' and ''. The
'atom' argument can either be the label of a particular kind of atom, or an index (zero based)
of a specific atom. This property computes, for each atom in the selection, an estimator for
the kinetic energy it would have had if it had the mass scaled by alpha. The 7 numbers output
are the average over the selected atoms of the log of the weights <h>, the average of the
squares <h**2>, the average of the un-weighted scaled-coordinates kinetic energies <T_CV>
and of the squares <T_CV**2>, the log sum of the weights LW=ln(sum(e**(-h))), the sum of the
re-weighted kinetic energies, stored as a log modulus and sign, LTW=ln(abs(sum(T_CV e**(-h))))
STW=sign(sum(T_CV e**(-h))). In practice, the best estimate of the estimator can be computed
as [sum_i exp(LTW_i)*STW_i]/[sum_i exp(LW_i)]. The other terms can be used to compute diagnostics
for the statistical accuracy of the re-weighting process. Note that evaluating this estimator costs
as much as a PIMD step for each atom in the list. The elements that are output have different
units, so the output can be only in atomic units.""" },
"isotope_tdfep": {"dimension" : "undefined",
"size" : 7,
'func': self.get_isotope_thermo,
"help": "The thermodynamic free energy perturbation scaled mass KE estimator.",
"longhelp" : """Returns the (many) terms needed to compute the thermodynamic free energy
perturbation scaled mass KE estimator (M. Ceriotti, T. Markland, J. Chem. Phys. 138, 014112 (2013)).
Takes two arguments, 'alpha' and 'atom', which give the
scaled mass parameter and the atom of interest respectively, and default to '1.0' and ''. The
'atom' argument can either be the label of a particular kind of atom, or an index (zero based)
of a specific atom. This property computes, for each atom in the selection, an estimator for
the kinetic energy it would have had if it had the mass scaled by alpha. The 7 numbers output
are the average over the selected atoms of the log of the weights <h>, the average of the
squares <h**2>, the average of the un-weighted scaled-coordinates kinetic energies <T_CV>
and of the squares <T_CV**2>, the log sum of the weights LW=ln(sum(e**(-h))), the sum of the
re-weighted kinetic energies, stored as a log modulus and sign, LTW=ln(abs(sum(T_CV e**(-h))))
STW=sign(sum(T_CV e**(-h))). In practice, the best estimate of the estimator can be computed
as [sum_i exp(LTW_i)*STW_i]/[sum_i exp(LW_i)]. The other terms can be used to compute diagnostics
for the statistical accuracy of the re-weighting process. Evaluating this estimator is inexpensive,
but typically the statistical accuracy is worse than with the scaled coordinates estimator.
The elements that are output have different
units, so the output can be only in atomic units.""" }
}
def bind(self, simul):
"""Binds the necessary objects from the simulation to calculate the
required properties.
Args:
simul: The Simulation object to be bound.
"""
self.ensemble = simul.ensemble
self.beads = simul.beads
self.nm = simul.nm
self.cell = simul.cell
self.forces = simul.forces
self.simul = simul
# dummy beads and forcefield objects so that we can use scaled and
# displaced path estimators without changing the simulation bead
# coordinates
self.dbeads = simul.beads.copy()
self.dforces = Forces()
self.dforces.bind(self.dbeads, self.simul.cell, self.simul.flist)
def __getitem__(self, key):
"""Retrieves the item given by key.
Note that if the key contains a string (arg1; arg2; ... )
then it will pass the appropriate positional arguments to the
calculation function of the property. Note the brackets and
the semi-colon separators. If instead we have the syntax
(arg1=val1;arg2; ... ), then the keyword/value pair (arg1,val1)
will be added to the keyword argument list. The appropriate key word
arguments will then be passed to the calculation function instead.
Similarly, if the key contains a string {unit}, then it will take
the string 'unit' and use it to define the units that the property
is output in.
Args:
key: A string contained in property_dict.
Returns:
The property labeled by the keyword key, along with its unit
keyword, and the argument lists for the function used to calculate
the property specified by the keyword key.
"""
(key, unit, arglist, kwarglist) = getall(key)
pkey = self.property_dict[key]
#pkey["func"](*arglist,**kwarglist) gives the value of the property
#in atomic units. unit_to_user() returns the value in the user
#specified units.
if "dimension" in pkey and unit != "":
return unit_to_user(pkey["dimension"], unit, pkey["func"](*arglist,**kwarglist))
else:
return pkey["func"](*arglist,**kwarglist)
def tensor2vec(self, tensor):
"""Takes a 3*3 symmetric tensor and returns it as a 1D array,
containing the elements [xx, yy, zz, xy, xz, yz].
"""
return np.array([tensor[0,0], tensor[1,1], tensor[2,2], tensor[0,1], tensor[0,2], tensor[1,2]])
def get_atom_vec(self, prop_vec, atom="", bead="-1"):
"""Gives a vector for one atom.
Args:
prop_vec: An array from which to take the atomic vector from.
atom: The index of the atom for which the vector will
be output.
bead: The index of the replica of the atom for which the
vector will be output. If less than 0, then the centroid is used.
"""
if atom == "":
raise IndexError("Must specify the index for atom_vec property")
atom = int(atom)
bead = int(bead)
if atom >= self.beads.natoms:
raise IndexError("Cannot output atom_vec property as atom index %d is larger than the number of atoms" % atom)
if bead >= self.beads.nbeads:
raise IndexError("Cannot output atom_vec property as bead index %d is larger than the number of beads" % bead)
if bead < 0:
atom_vec = np.zeros(3)
for b in range(self.beads.nbeads):
atom_vec += prop_vec[b,3*atom:3*(atom+1)]
return atom_vec/float(self.beads.nbeads)
else:
return prop_vec[bead,3*atom:3*(atom+1)]
def get_temp(self, atom=""):
"""Calculates the MD kinetic temperature.
Note that in the case that the centre of mass constraint there will be
3 fewer degrees of freedom than without, so this has to be taken into
account when calculating the kinetic temperature.
Args:
atom: If given, specifies the atom to give the temperature
for. If not, then the simulation temperature.
"""
if self.ensemble.fixcom:
mdof = 3
else:
mdof = 0
if atom == "":
# use the KE computed in the NM representation in order to avoid problems when mass scaling is used
kedof = self.get_kinmd()/(3*self.beads.natoms*self.beads.nbeads - mdof)
else:
try:
#iatom gives the index of the atom to be studied
iatom = int(atom)
latom = ""
if iatom >= self.beads.natoms:
raise IndexError("Cannot output temperature as atom index %d is larger than the number of atoms" % iatom)
except ValueError:
#here 'atom' is a label rather than an index which is stored in latom
iatom = -1
latom = atom
ncount = 0
for i in range(self.beads.natoms):
if (iatom == i or latom == self.beads.names[i]):
ncount += 1
if ncount == 0:
raise IndexError("Couldn't find an atom which matched the argument of temperature")
# "spreads" the COM removal correction evenly over all the atoms...
kedof = self.get_kinmd(atom)/ncount*(self.beads.natoms/(3.0*self.beads.natoms*self.beads.nbeads - mdof))
return kedof/(0.5*Constants.kb)
def get_kincv(self, atom=""):
"""Calculates the quantum centroid virial kinetic energy estimator.
Args:
atom: If given, specifies the atom to give the kinetic energy
for. If not, the system kinetic energy is given.
"""
try:
#iatom gives the index of the atom to be studied
iatom = int(atom)
latom = ""
if iatom >= self.beads.natoms:
raise IndexError("Cannot output kinetic energy as atom index %d is larger than the number of atoms" % iatom)
except ValueError:
#here 'atom' is a label rather than an index which is stored in latom
iatom = -1
latom = atom
q = depstrip(self.beads.q)
qc = depstrip(self.beads.qc)
f = depstrip(self.forces.f)
acv = 0.0
ncount = 0
for i in range(self.beads.natoms):
if (atom != "" and iatom != i and latom != self.beads.names[i]):
continue
kcv = 0.0
k = 3*i
for b in range(self.beads.nbeads):
kcv += (q[b,k] - qc[k])* f[b,k] + (q[b,k+1] - qc[k+1])* f[b,k+1] + (q[b,k+2] - qc[k+2])* f[b,k+2]
kcv *= -0.5/self.beads.nbeads
kcv += 1.5*Constants.kb*self.ensemble.temp
acv += kcv
ncount += 1
if ncount == 0:
warning("Couldn't find an atom which matched the argument of kinetic energy, setting to zero.", verbosity.medium)
return acv
def get_kinmd(self, atom=""):
"""Calculates the classical kinetic energy of the simulation (p^2/2m)
Args:
atom: If given, specifies the atom to give the kinetic energy
for. If not, the simulation kinetic energy is given.
"""
if atom == "":
return self.nm.kin/self.beads.nbeads
else:
try:
#iatom gives the index of the atom to be studied
iatom = int(atom)
latom = ""
if iatom >= self.beads.natoms:
raise IndexError("Cannot output kinetic energy as atom index %d is larger than the number of atoms" % iatom)
except ValueError:
#here 'atom' is a label rather than an index which is stored in latom
iatom = -1
latom = atom
pnm = depstrip(self.nm.pnm)
dm3 = depstrip(self.nm.dynm3)
kmd = 0.0
ncount = 0
for i in range(self.beads.natoms):
if (atom != "" and iatom != i and latom != self.beads.names[i]):
continue
k = 3*i
for b in range(self.beads.nbeads):
kmd += (pnm[b,k]**2 + pnm[b,k+1]**2 + pnm[b,k+2]**2)/(2.0*dm3[b,k])
ncount += 1
if ncount == 0:
warning("Couldn't find an atom which matched the argument of kinetic energy, setting to zero.", verbosity.medium)
return kmd/self.beads.nbeads
def get_ktens(self, atom=""):
"""Calculates the quantum centroid virial kinetic energy
TENSOR estimator.
Args:
atom: The index of the atom for which the kinetic energy tensor
is to be output, or the index of the type of atoms for which
it should be output.
"""
try:
#iatom gives the index of the atom to be studied
iatom = int(atom)
latom = ""
if iatom >= self.beads.natoms:
raise IndexError("Cannot output kinetic tensor as atom index %d is larger than the number of atoms" % iatom)
except ValueError:
#here 'atom' is a label rather than an index which is stored in latom
iatom = -1
latom = atom
tkcv = np.zeros((6),float)
ncount = 0
for i in range(self.beads.natoms):
if (atom != "" and iatom != i and latom != self.beads.names[i]):
continue
tkcv += self.get_kij(str(i), str(i))
ncount += 1
if ncount == 0:
warning("Couldn't find an atom which matched the argument of kinetic tensor, setting to zero.", verbosity.medium)
return tkcv
def get_kij(self, ni="0", nj="0"):
"""Calculates the quantum centroid virial kinetic energy
TENSOR estimator for two possibly different atom indices.
Args:
ni: The index of atom i.
nj: The index of atom j.
Returns:
The contribution to the kinetic energy tensor estimator from
the interactions between atom i and atom j.
"""
i = int(ni)
j = int(nj)
if i >= self.beads.natoms:
raise IndexError("Cannot output kinetic_ij as atom index %d is larger than the number of atoms" % i)
if j >= self.beads.natoms:
raise IndexError("Cannot output kinetic_ij as atom index %d is larger than the number of atoms" % j)
mi = self.beads.m[i]
mj = self.beads.m[j]
ai = 3*i
aj = 3*j
q = depstrip(self.beads.q)
qc = depstrip(self.beads.qc)
f = depstrip(self.forces.f)
# I implement this for the most general case. In practice T_ij = <p_i p_j>/(2sqrt(m_i m_j))
kcv = np.zeros((6),float)
for b in range(self.beads.nbeads):
kcv[0] += mi*(q[b,ai] - qc[ai]) *f[b,aj] + mj*(q[b,aj] - qc[aj]) *f[b,ai] #Txx
kcv[1] += mi*(q[b,ai+1] - qc[ai+1])*f[b,aj+1] + mj*(q[b,aj+1] - qc[aj+1])*f[b,ai+1] #Tyy
kcv[2] += mi*(q[b,ai+2] - qc[ai+2])*f[b,aj+2] + mj*(q[b,aj+2] - qc[aj+2])*f[b,ai+2] #Tzz
kcv[3] += mi*(q[b,ai] - qc[ai])* f[b,aj+1] + mj*(q[b,aj+1] - qc[aj+1])*f[b,ai] #Txy
kcv[4] += mi*(q[b,ai] - qc[ai])* f[b,aj+2] + mj*(q[b,aj+2] - qc[aj+2])*f[b,ai] #Txz
kcv[5] += mi*(q[b,ai+1] - qc[ai+1])*f[b,aj+2] + mj*(q[b,aj+2] - qc[aj+2])*f[b,ai+1] #Tyz
kcv *= -0.5/(self.beads.nbeads*2*np.sqrt(mi*mj))
if i == j:
kcv[0:3] += 0.5*Constants.kb*self.ensemble.temp
return kcv
def get_rg(self, atom=""):
"""Calculates the radius of gyration of the ring polymers.
Args:
atom: If given, specifies the atom to give the gyration radius
for. If not, the system average gyration radius is given.
"""
try:
#iatom gives the index of the atom to be studied
iatom = int(atom)
latom = ""
if iatom >= self.beads.natoms:
raise IndexError("Cannot output gyration radius as atom index %d is larger than the number of atoms" % iatom)
except ValueError:
#here 'atom' is a label rather than an index which is stored in latom
iatom = -1
latom = atom
q = depstrip(self.beads.q)
qc = depstrip(self.beads.qc)
nat = self.beads.natoms
nb = self.beads.nbeads
rg_tot = 0.0
ncount = 0
for i in range(nat):
if (atom != "" and iatom != i and latom != self.beads.names[i]):
continue
rg_at = 0.0
for j in range(nb):
dq = q[j,3*i:3*(i+1)] - qc[3*i:3*(i+1)]
rg_at += np.dot(dq, dq)
ncount += 1
rg_tot += np.sqrt(rg_at/float(nb))
if ncount == 0:
raise IndexError("Couldn't find an atom which matched the argument of r_gyration")
return rg_tot/float(ncount)
def kstress_cv(self):
"""Calculates the quantum centroid virial kinetic stress tensor
estimator.
Note that this is not divided by the volume or the number of beads.
Returns:
A 3*3 tensor with all the components of the tensor.
"""
kst = np.zeros((3,3),float)
q = depstrip(self.beads.q)
qc = depstrip(self.beads.qc)
pc = depstrip(self.beads.pc)
m = depstrip(self.beads.m)
fall = depstrip(self.forces.f)
na3 = 3*self.beads.natoms
for b in range(self.beads.nbeads):
for i in range(3):
for j in range(i,3):
kst[i,j] -= np.dot(q[b,i:na3:3] - qc[i:na3:3],
fall[b,j:na3:3])
# return the CV estimator MULTIPLIED BY NBEADS -- again for consistency with the virial, kstress_MD, etc...
for i in range(3):
kst[i,i] += self.beads.nbeads * ( np.dot(pc[i:na3:3],pc[i:na3:3]/m) )
return kst
def opening(self, bead):
"""Path opening function, used in linlin momentum distribution
estimator.
Args:
bead: The index of the bead to shift.
"""
return bead/float(self.beads.nbeads) + 0.5*(1.0/self.beads.nbeads - 1)
def get_linlin(self, ux="0", uy="0", uz="0", atom=""):
"""Calculates the end-to-end distribution for a particular path opening
vector.
Args:
ux: The x-component of the path opening vector.
uy: The y-component of the path opening vector.
uz: The z-component of the path opening vector.
atom: If given, specifies the atom to give the kinetic energy
for. If not, the simulation kinetic energy is given.
"""
try:
#iatom gives the index of the atom to be studied
iatom = int(atom)
latom = ""
if iatom >= self.beads.natoms:
raise IndexError("Cannot output linlin estimator as atom index %d is larger than the number of atoms" % iatom)
except ValueError:
#here 'atom' is a label rather than an index which is stored in latom
iatom = -1
latom = atom
beta = 1.0/(self.ensemble.temp*Constants.kb)
u = np.array([float(ux), float(uy), float(uz)])
u_size = np.dot(u,u)
q = depstrip(self.beads.q)
nat = self.beads.natoms
nb = self.beads.nbeads
nx_tot = 0.0
ncount = 0
for i in range(nat):
if (atom != "" and iatom != i and latom != self.beads.names[i]):
continue
mass = self.beads.m[i]
self.dbeads.q[:] = q
for b in range(nb):
self.dbeads.q[b,3*i:3*(i+1)] += self.opening(b)*u
dV = self.dforces.pot - self.forces.pot
n0 = np.exp(-mass*u_size/(2.0*beta*Constants.hbar**2))
nx_tot += n0*np.exp(-dV*beta/float(self.beads.nbeads))
ncount += 1
if ncount == 0:
raise IndexError("Couldn't find an atom which matched the argument of linlin")
return nx_tot/float(ncount)
def get_yama_estimators(self, fd_delta= - _DEFAULT_FINDIFF):
"""Calculates the quantum scaled coordinate kinetic energy estimator.
Uses a finite difference method to calculate the estimators
needed to calculate the energy and heat capacity of the system, as
shown in Takeshi M. Yamamoto, Journal of Chemical Physics,
104101, 123 (2005). Returns both eps_v and eps_v' as defined in
the above article. Note that heat capacity is calculated as
beta**2*kboltzmann*(<eps_v**2> - <eps_v>**2 - <eps_v'>), and the
energy of the system as <eps_v>.
Args:
fd_delta: the relative finite difference in temperature to apply in
computing finite-difference quantities. If it is negative, will be
scaled down automatically to avoid discontinuities in the potential.
"""
dbeta = abs(float(fd_delta))
beta = 1.0/(Constants.kb*self.ensemble.temp)
qc = depstrip(self.beads.centroid.q)
q = depstrip(self.beads.q)
v0 = self.forces.pot/self.beads.nbeads
while True:
splus = np.sqrt(1.0 + dbeta)
sminus = np.sqrt(1.0 - dbeta)
for b in range(self.beads.nbeads):
self.dbeads[b].q = qc*(1.0 - splus) + splus*q[b,:]
vplus = self.dforces.pot/self.beads.nbeads
for b in range(self.beads.nbeads):
self.dbeads[b].q = qc*(1.0 - sminus) + sminus*q[b,:]
vminus = self.dforces.pot/self.beads.nbeads
if (fd_delta < 0 and abs((vplus + vminus)/(v0*2) - 1.0) > self._DEFAULT_FDERROR and dbeta > self._DEFAULT_MINFID):
dbeta *= 0.5
info("Reducing displacement in Yamamoto kinetic estimator", verbosity.low)
continue
else:
eps = ((1.0 + dbeta)*vplus - (1.0 - dbeta)*vminus)/(2*dbeta)
eps += 0.5*(3*self.beads.natoms)/beta
eps_prime = ((1.0 + dbeta)*vplus + (1.0 - dbeta)*vminus - 2*v0)/(dbeta**2*beta)
eps_prime -= 0.5*(3*self.beads.natoms)/beta**2
break
return np.asarray([eps, eps_prime])
def get_isotope_yama(self, alpha="1.0", atom=""):
"""Gives the components of the yamamoto scaled-mass KE estimator
for a given atom index.
Args:
alpha: m'/m the mass ratio
atom: the index of the atom to compute the isotope fractionation
pair for, or a label
Returns:
a tuple from which one can reconstruct all that is needed to
compute the SMKEE, and its statistical accuracy:
(sum_deltah, sum_ke, log(sum(weights)), log(sum(weight*ke)),
sign(sum(weight*ke)) )
"""
try:
#iatom gives the index of the atom to be studied
iatom = int(atom)
latom = ""
if iatom >= self.beads.natoms:
raise IndexError("Cannot output scaled-mass kinetic energy estimator as atom index %d is larger than the number of atoms" % iatom)
except ValueError:
#here 'atom' is a label rather than an index which is stored in latom
iatom = -1
latom = atom
alpha = float(alpha)
atcv = 0.0
atcv2 = 0.0
alogr = 0.0
alogr2 = 0.0
law = 0.0
lawke = 0.0
sawke = 1.0
ni = 0
# strips dependency control since we are not gonna change the true beads in what follows
q = depstrip(self.beads.q)
f = depstrip(self.forces.f)
qc = depstrip(self.beads.qc)
for i in range(self.beads.natoms):
# selects only the atoms we care about
if (atom != "" and iatom != i and latom != self.beads.names[i]):
continue
ni += 1
# arranges coordinate-scaled beads in a auxiliary beads object
self.dbeads.q[:] = q[:]
for b in range(self.beads.nbeads):
self.dbeads.q[b,3*i:3*(i+1)] = ( qc[3*i:3*(i+1)]+
np.sqrt(1.0/alpha)*(q[b,3*i:3*(i+1)]-qc[3*i:3*(i+1)]) )
tcv = 0.0
for b in range(self.beads.nbeads):
tcv += np.dot( (self.dbeads.q[b,3*i:3*(i+1)]-self.dbeads.qc[3*i:3*(i+1)]),
self.dforces.f[b,3*i:3*(i+1)] )
tcv *= -0.5/self.beads.nbeads
tcv += 1.5*Constants.kb*self.simul.ensemble.temp
logr = (self.dforces.pot-self.forces.pot)/(Constants.kb*self.simul.ensemble.temp*self.beads.nbeads)
atcv += tcv
atcv2 += tcv*tcv
alogr += logr
alogr2 += logr*logr;
#accumulates log averages in a way which preserves accuracy
if (ni == 1):
law = -logr
else:
(law, drop) = logsumlog( (law,1.0), (-logr,1.0))
#here we need to take care of the sign of tcv, which might as well be
#negative... almost never but...
if (ni == 1):
lawke = -logr + np.log(abs(tcv))
sawke = np.sign(tcv);
else:
(lawke, sawke) = logsumlog( (lawke, sawke), (-logr+np.log(abs(tcv)), np.sign(tcv)) )
if ni == 0:
raise IndexError("Couldn't find an atom which matched the argument of isotope_y")
return np.asarray([alogr/ni, alogr2/ni, atcv/ni, atcv2/ni, law, lawke, sawke])
def get_isotope_thermo(self, alpha="1.0", atom=""):
"""Gives the components of the thermodynamic scaled-mass KE
estimator for a given atom index.
Args:
alpha: m'/m the mass ratio
atom: the index of the atom to compute the isotope fractionation
pair for, or a label
Returns:
a tuple from which one can reconstruct all that is needed to
compute the SMKEE:
(sum_deltah, sum_ke, log(sum(weights)), log(sum(weight*ke)),
sign(sum(weight*ke)) )
"""
try:
#iatom gives the index of the atom to be studied
iatom = int(atom)
latom = ""
if iatom >= self.beads.natoms:
raise IndexError("Cannot output scaled-mass kinetic energy estimator as atom index %d is larger than the number of atoms" % iatom)
except ValueError:
#here 'atom' is a label rather than an index which is stored in latom
iatom = -1
latom = atom
alpha = float(alpha)
atcv = 0.0
alogr = 0.0
atcv2 = 0.0
alogr2 = 0.0
law = 0.0
lawke = 0.0
sawke = 1.0
ni = 0
# strips dependency control since we are not gonna change the true beads in what follows
q = depstrip(self.beads.q)
f = depstrip(self.forces.f)
qc = depstrip(self.beads.qc)
for i in range(self.beads.natoms):
# selects only the atoms we care about
if (atom != "" and iatom != i and latom != self.beads.names[i]):
continue
ni += 1
spr = 0.0
for b in range(1,self.beads.nbeads):
for j in range(3*i,3*(i+1)):
spr += (q[b,j]-q[b-1,j])**2
for j in range(3*i,3*(i+1)):
spr += (q[self.beads.nbeads-1,j]-q[0,j])**2
spr *= 0.5*self.beads.m[i]*self.nm.omegan2
# centroid virial contribution from atom i
tcv = 0.0
for b in range(self.beads.nbeads):
tcv += np.dot( (q[b,3*i:3*(i+1)]-qc[3*i:3*(i+1)]), f[b,3*i:3*(i+1)])
tcv *= -0.5/self.beads.nbeads
tcv += 1.5*Constants.kb*self.simul.ensemble.temp
logr = (alpha-1)*spr/(Constants.kb*self.simul.ensemble.temp*self.beads.nbeads)
atcv += tcv
atcv2 += tcv*tcv
alogr += logr
alogr2 += logr*logr
#accumulates log averages in a way which preserves accuracy
if (ni == 1):
law = -logr
else:
(law, drop) = logsumlog( (law,1.0), (-logr,1.0))
#here we need to take care of the sign of tcv, which might as well be
#negative... almost never but...
if (ni == 1):
lawke = -logr + np.log(abs(tcv))
sawke = np.sign(tcv)
else:
(lawke, sawke) = logsumlog( (lawke, sawke), (-logr+np.log(abs(tcv)), np.sign(tcv)) )
if ni == 0:
raise IndexError("Couldn't find an atom which matched the argument of isotope_y")
return np.asarray([alogr/ni, alogr2/ni, atcv/ni, atcv2/ni, law, lawke, sawke])
class Trajectories(dobject):
"""A simple class to take care of output of trajectory data.
Attributes:
simul: The simulation object from which the position data will be
obtained.
fatom: A dummy beads object used so that individual replica trajectories
can be output.
traj_dict: A dictionary containing all the trajectories that can be
output.
"""
def __init__(self):
"""Initialises a Trajectories object."""
self.traj_dict = {
# Note that here we want to return COPIES of the different arrays, so we make sure to make an operation in order not to return a reference.
"positions": { "dimension" : "length",
"help": "The atomic coordinate trajectories. Will print out one file per bead, unless the bead attribute is set by the user.",
'func': (lambda : 1.0*self.simul.beads.q)},
"velocities": {"dimension" : "velocity",
"help": "The velocity trajectories. Will print out one file per bead, unless the bead attribute is set by the user.",
'func': (lambda : self.simul.beads.p/self.simul.beads.m3)},
"momenta": {"dimension" : "momentum",
"help": "The momentum trajectories. Will print out one file per bead, unless the bead attribute is set by the user.",
'func': (lambda : 1.0*self.simul.beads.p)},
"forces": { "dimension" : "force",
"help": "The force trajectories. Will print out one file per bead, unless the bead attribute is set by the user.",
'func': (lambda : 1.0*self.simul.forces.f)},
"x_centroid": {"dimension" : "length",
"help": "The centroid coordinates.",
'func': (lambda : 1.0*self.simul.beads.qc)},
"v_centroid": {"dimension" : "velocity",
"help": "The centroid velocity.",
'func': (lambda : self.simul.beads.pc/self.simul.beads.m3[0])},
"p_centroid": {"dimension" : "momentum",
"help": "The centroid momentum.",
'func': (lambda : 1.0*self.simul.beads.pc)},
"f_centroid": {"dimension" : "force",
"help": "The force acting on the centroid.",
'func': (lambda : np.sum(self.simul.forces.f,0)/float(self.simul.beads.nbeads))},
"kinetic_cv": {"dimension" : "energy",
"help": "The centroid virial quantum kinetic energy estimator for each atom, resolved into Cartesian components [xx, yy, zz]",
'func': self.get_akcv},
"kinetic_od": {"dimension" : "energy",
"help": "The off diagonal elements of the centroid virial quantum kinetic energy tensor [xy, xz, yz]",
'func': self.get_akcv_od},
"r_gyration": {"dimension" : "length",
"help": "The radius of gyration of the ring polymer, for each atom and resolved into Cartesian components [xx, yy, zz]",
'func': self.get_rg},
"extras": { "help": """The additional data returned by the client code, printed verbatim. Will print
out one file per bead, unless the bead attribute is set by the user.""",
'func': (lambda : self.simul.forces.extras)}
}
def bind(self, simul):
""" Binds to a simulation object to fetch atomic and force data.
Args:
simul: The simulation object that will be managed by this Trajectories.
"""
self.simul = simul
self.fatom = simul.beads[0].copy()
def get_akcv(self):
"""Calculates the contribution to the kinetic energy due to each degree
of freedom.
"""
rv = np.zeros(self.simul.beads.natoms*3)
for b in range(self.simul.beads.nbeads):
rv[:] += (self.simul.beads.q[b]-self.simul.beads.qc)*self.simul.forces.f[b]
rv *= -0.5/self.simul.beads.nbeads
rv += 0.5*Constants.kb*self.simul.ensemble.temp
return rv
def get_akcv_od(self):
"""Calculates the "off-diagonal" contribution to the kinetic energy tensor
due to each atom.
"""
rv = np.zeros((self.simul.beads.natoms,3))
# helper arrays to make it more obvious what we are computing
dq = np.zeros((self.simul.beads.natoms,3))
f = np.zeros((self.simul.beads.natoms,3))
for b in range(self.simul.beads.nbeads):
dq[:] = (self.simul.beads.q[b]-self.simul.beads.qc).reshape((self.simul.beads.natoms,3))
f[:] = self.simul.forces.f[b].reshape((self.simul.beads.natoms,3))
rv[:,0] += dq[:,0]*f[:,1] + dq[:,1]*f[:,0]
rv[:,1] += dq[:,0]*f[:,2] + dq[:,2]*f[:,0]
rv[:,2] += dq[:,1]*f[:,2] + dq[:,2]*f[:,1]
rv *= 0.5
rv *= -0.5/self.simul.beads.nbeads
return rv.reshape(self.simul.beads.natoms*3)
def get_rg(self):
"""Calculates the radius of gyration of the ring polymers.
Computes separately the x, y, z contributions so that the actual
gyration radius can be recovered as sqrt(rx^2+ry^2+rz^2).
"""
q = depstrip(self.simul.beads.q)
qc = depstrip(self.simul.beads.qc)
nat = self.simul.beads.natoms
nb = self.simul.beads.nbeads
rg = np.zeros(3*nat)
for i in range(nb):
for j in range(nat):
dq = q[i,3*j:3*(j+1)] - qc[3*j:3*(j+1)]
rg[3*j:3*(j+1)] += dq*dq
return np.sqrt(rg/float(nb))
def __getitem__(self, key):
"""Retrieves the item given by key.
Note that if the key contains a string (arg1; arg2; ... )
then it will pass the appropriate positional arguments to the
calculation function of the property. Note the brackets and
the semi-colon separators. If instead we have the syntax
(arg1=val1;arg2; ... ), then the keyword/value pair (arg1,val1)
will be added to the keyword argument list. The appropriate key word
arguments will then be passed to the calculation function instead.
Similarly, if the key contains a string {unit}, then it will take
the string 'unit' and use it to define the units that the trajectory
is output in.
Args:
key: A string contained in trajectory_dict.
Returns:
The trajectory labeled by the keyword key, along with its unit
keyword, and the argument lists for the function used to calculate
the trajectory specified by the keyword key.
"""
(key, unit, arglist, kwarglist) = getall(key)
pkey = self.traj_dict[key]
#pkey["func"](*arglist,**kwarglist) gives the value of the trajectory
#in atomic units. unit_to_user() returns the value in the user
#specified units.
if "dimension" in pkey and unit != "":
return unit_to_user(pkey["dimension"], unit, 1.0) * pkey["func"](*arglist,**kwarglist)
else:
return pkey["func"](*arglist,**kwarglist)
def print_traj(self, what, stream, b=0, format="pdb", cell_units="atomic_unit", flush=True):
"""Prints out a frame of a trajectory for the specified quantity and bead.
Args:
what: A string specifying what to print.
b: The bead index. Defaults to 0.
stream: A reference to the stream on which data will be printed.
format: The output file format.
cell_units: The units used to specify the cell parameters.
flush: A boolean which specifies whether to flush the output buffer
after each write to file or not.
"""
cq = self[what]
if getkey(what) in [ "extras" ] :
stream.write(" #*EXTRAS*# Step: %10d Bead: %5d \n" % (self.simul.step+1, b) )
stream.write(cq[b])
stream.write("\n")
if flush :
stream.flush()
os.fsync(stream)
return
elif getkey(what) in [ "positions", "velocities", "forces" ] :
self.fatom.q[:] = cq[b]
else:
self.fatom.q[:] = cq
fcell = Cell()
fcell.h = self.simul.cell.h*unit_to_user("length", cell_units, 1.0)
if format == "pdb":
io_pdb.print_pdb(self.fatom, fcell, stream, title=("Traj: %s Step: %10d Bead: %5d " % (what, self.simul.step+1, b) ) )
elif format == "xyz":
io_xyz.print_xyz(self.fatom, fcell, stream, title=("Traj: %s Step: %10d Bead: %5d " % (what, self.simul.step+1, b) ) )
elif format == "bin":
io_binary.print_bin(self.fatom, fcell, stream, title=("Traj: %s Step: %10d Bead: %5d " % (what, self.simul.step+1, b) ) )
if flush :
stream.flush()
os.fsync(stream)
| gpl-3.0 |
rymate1234/rymate-blog | migrations/versions/413f129e8b07_.py | 1 | 1535 | """empty message
Revision ID: 413f129e8b07
Revises: None
Create Date: 2014-05-02 08:09:09.906725
"""
# revision identifiers, used by Alembic.
revision = '413f129e8b07'
down_revision = None
from alembic import op
import sqlalchemy as sa
def upgrade():
### commands auto generated by Alembic - please adjust! ###
op.create_table('users',
sa.Column('id', sa.Integer(), nullable=False),
sa.Column('username', sa.String(length=80), nullable=False),
sa.Column('email', sa.String(length=80), nullable=False),
sa.Column('password', sa.String(length=128), nullable=True),
sa.Column('created_at', sa.DateTime(), nullable=False),
sa.Column('first_name', sa.String(length=30), nullable=True),
sa.Column('last_name', sa.String(length=30), nullable=True),
sa.Column('active', sa.Boolean(), nullable=True),
sa.Column('is_admin', sa.Boolean(), nullable=True),
sa.PrimaryKeyConstraint('id'),
sa.UniqueConstraint('email'),
sa.UniqueConstraint('username')
)
op.create_table('roles',
sa.Column('id', sa.Integer(), nullable=False),
sa.Column('name', sa.String(length=80), nullable=False),
sa.Column('user_id', sa.Integer(), nullable=True),
sa.ForeignKeyConstraint(['user_id'], ['users.id'], ),
sa.PrimaryKeyConstraint('id'),
sa.UniqueConstraint('name')
)
### end Alembic commands ###
def downgrade():
### commands auto generated by Alembic - please adjust! ###
op.drop_table('roles')
op.drop_table('users')
### end Alembic commands ###
| bsd-3-clause |
IronManMark20/pyside2 | tests/QtGui/deepcopy_test.py | 3 | 4226 |
import unittest
from copy import deepcopy
from PySide2.QtCore import QPoint
from PySide2.QtGui import QMatrix
from PySide2.QtGui import QMatrix2x2, QMatrix2x3, QMatrix2x4
from PySide2.QtGui import QMatrix3x2, QMatrix3x3, QMatrix3x4
from PySide2.QtGui import QMatrix4x2, QMatrix4x3, QMatrix4x4
from PySide2.QtGui import QVector2D, QVector3D, QVector4D
from PySide2.QtGui import QColor, QTransform, QKeySequence, QQuaternion
from PySide2.QtGui import QPolygon
class DeepCopyHelper:
def testCopy(self):
copy = deepcopy([self.original])[0]
self.assert_(copy is not self.original)
self.assertEqual(copy, self.original)
class DeepCopyColorHelperF:
def testCopy(self):
copy = deepcopy([self.original])[0]
self.assert_(copy is not self.original)
self.assertEqual(copy.spec(), self.original.spec())
# impossible to compare float point
# self.assertEqual(copy, self.original)
class QColorDeepCopy(DeepCopyHelper, unittest.TestCase):
def setUp(self):
self.original = QColor("red")
class QColorRGBDeepCopy(DeepCopyColorHelperF, unittest.TestCase):
def setUp(self):
self.original = QColor.fromRgbF(0.2, 0.3, 0.4, 0.5)
class QColorHSLDeepCopy(DeepCopyColorHelperF, unittest.TestCase):
def setUp(self):
self.original = QColor.fromHslF(0.2, 0.3, 0.4, 0.5)
class QColorHSVDeepCopy(DeepCopyColorHelperF, unittest.TestCase):
def setUp(self):
self.original = QColor.fromHsvF(0.2, 0.3, 0.4, 0.5)
class QColorCMYKDeepCopy(DeepCopyColorHelperF, unittest.TestCase):
def setUp(self):
self.original = QColor.fromCmykF(0.2, 0.3, 0.4, 0.5, 0.6)
class QTransformDeepCopy(DeepCopyHelper, unittest.TestCase):
def setUp(self):
self.original = QTransform(1, 2, 3, 4, 5, 6, 7, 8)
class QKeySequenceDeepCopy(DeepCopyHelper, unittest.TestCase):
def setUp(self):
self.original = QKeySequence("Ctrl+P")
class QQuaternionDeepCopy(DeepCopyHelper, unittest.TestCase):
def setUp(self):
self.original = QQuaternion(1, 2, 3, 4)
class QVector2DDeepCopy(DeepCopyHelper, unittest.TestCase):
def setUp(self):
self.original = QVector2D(1, 2)
class QVector3DDeepCopy(DeepCopyHelper, unittest.TestCase):
def setUp(self):
self.original = QVector3D(1, 2, 3)
class QVector4DDeepCopy(DeepCopyHelper, unittest.TestCase):
def setUp(self):
self.original = QVector4D(1, 2, 3, 4)
class QPolygonDeepCopy(DeepCopyHelper, unittest.TestCase):
def setUp(self):
self.original = QPolygon([QPoint(1, 2), QPoint(3, 4), QPoint(5, 6)])
class QMatrixDeepCopy(DeepCopyHelper, unittest.TestCase):
def setUp(self):
self.original = QMatrix(1, 2, 3, 4, 5, 6)
# Avoid these tests until get gcc fixed
# Related bug: http://gcc.gnu.org/bugzilla/show_bug.cgi?id=43247
"""
class QMatrix2x2DeepCopy(DeepCopyHelper, unittest.TestCase):
def setUp(self):
self.original = QMatrix2x2([1, 2, 3, 4])
class QMatrix2x3DeepCopy(DeepCopyHelper, unittest.TestCase):
def setUp(self):
self.original = QMatrix2x3([1, 2, 3, 4, 5, 6])
class QMatrix2x4DeepCopy(DeepCopyHelper, unittest.TestCase):
def setUp(self):
self.original = QMatrix2x4([1, 2, 3, 4, 5, 6, 7, 8])
class QMatrix3x2DeepCopy(DeepCopyHelper, unittest.TestCase):
def setUp(self):
self.original = QMatrix3x2([1, 2, 3, 4, 5, 6])
class QMatrix3x3DeepCopy(DeepCopyHelper, unittest.TestCase):
def setUp(self):
self.original = QMatrix3x3([1, 2, 3, 4, 5, 6, 7, 8, 9])
class QMatrix3x4DeepCopy(DeepCopyHelper, unittest.TestCase):
def setUp(self):
self.original = QMatrix3x4([1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12])
class QMatrix4x2DeepCopy(DeepCopyHelper, unittest.TestCase):
def setUp(self):
self.original = QMatrix4x2([1, 2, 3, 4, 5, 6, 7, 8])
class QMatrix4x3DeepCopy(DeepCopyHelper, unittest.TestCase):
def setUp(self):
self.original = QMatrix4x3([1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12])
class QMatrix4x4DeepCopy(DeepCopyHelper, unittest.TestCase):
def setUp(self):
self.original = QMatrix4x4([1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16])
"""
if __name__ == '__main__':
unittest.main()
| lgpl-2.1 |
zdomjus60/astrometry | tools.py | 1 | 10051 | # -*- coding: utf-8 -*-
""" helper functions for time management
"""
import math
def sin(x):
return math.sin(math.radians(x))
def cos(x):
return math.cos(math.radians(x))
def atan2(y , x):
return math.degrees(math.atan2(y, x))
def reduce360(x):
return x % 360.0
def dms2ddd(hour, minute, second):
""" from sexagesimal to decimal """
return hour+minute/60.0+second/3600.0
def ddd2dms(dec_hour):
""" from decimal to sexagesimal representation of hours and angles."""
if dec_hour < 0:
sign = -1
dec_hour *= sign
else:
sign = 1
total_seconds = int(dec_hour * 3600.0+.5)
seconds = total_seconds % 60
total_minutes = int((total_seconds - seconds)/60.0)
minutes = total_minutes % 60
hours = int((total_minutes - minutes)/60.0)
return (hours * sign, minutes * sign, seconds * sign)
def cal2jul(year, month, day, hour=0, minute=0, second=0):
""" converts calendar date to julian date
this routine and the following are built following Duffet Smith /Zwart instructions
as given in Peter Duffett-Smith-Zwart Practical Astronomy with your Calculator or Spreadsheet
Fourth Edition, Cambridge University Press, Fourth Ed. 2011
For an easier use of the function, hours minutes and seconds are defaulted to 0, so it's
not necessary to give them as parameters when the hour is 00:00:00
"""
month2 = month
year2 = year
if month2 <= 2:
year2 -= 1
month2 += 12
else:
pass
if (year*10000 + month*100 + day) >= 15821015:
a = math.trunc(year2/100.0)
b = 2 - a + math.trunc(a/4.0)
else:
a = 0
b = 0
if year < 0:
c = math.trunc((365.25 * year2)-0.75)
else:
c = math.trunc(365.25 * year2)
d = math.trunc(30.6001 *(month2 + 1))
return b + c + d + day + hour / 24.0 + minute / 1440.0 + second / 86400.0 + 1720994.5
def jul2cal(jd):
""" converts julian date to calendar date """
jd += 0.5
i = math.modf(jd)[1]
f = math.modf(jd)[0]
if i > 2299160:
a = math.trunc((i-1867216.25)/36524.25)
b = i + a - math.trunc(a/4)+1
else:
b = i
c = b + 1524
d = math.trunc((c-122.1)/365.25)
e = math.trunc(365.25 * d)
g = math.trunc((c-e)/30.6001)
day = c-e+f-math.trunc(30.6001*g)
if g < 13.5:
month = g - 1
else:
month = g - 13
if month > 2.5:
year = d - 4716
else:
year = d - 4715
hours_frac = math.modf(day)[0]*24
day = int(day)
hour, minute, second = ddd2dms(hours_frac)
return (year, month, day, hour, minute, second)
def day_of_the_week(year, month, day):
""" given a calendar date, the routine returns a tuple with the Day Of The Week in number and in plaintext
0 for Sunday 1 for Monday and so on up to 6 Saturday
"""
doth = {0:'Sunday', 1:'Monday', 2:'Tuesday',
3:'Wednesday', 4:'Thursday', 5:'Friday',
6:'Saturday'}
jd = cal2jul(year, month, day, 0, 0, 0)
a = (jd+1.5)/7
f = math.trunc((a % 1)*7 +.5)
return (f,doth[f])
def lt2ut(year, month, day, hour=0, minute=0, second=0, timezone=0, DS=0):
""" Given, for a location on the Earth,a date, a time, a timezone (East + West - in hours) and the Daylight
Savings (0 normal time 1 Daylight Savings), this routine gives back a calendar date in Universal Time
representation (year, month, day, hour, minute, second).
It aims to restore a common date and time for all places in the Earth. Timezone and
Daylight Savings can be automized knowing the location using the pytz module (Olson
database)
"""
ut = dms2ddd(hour,minute,second) - timezone - DS
greenwich_calendar_date = day + ut/24
jd = cal2jul(year, month, greenwich_calendar_date)
greenwich_calendar_date = jul2cal(jd)
return greenwich_calendar_date
def ut2lt(year, month, day, hour=0, minute=0, second=0, timezone=0, DS=0):
""" Given a date, a time for Greenwich in UT format this routine gives back a calendar date
in local time representation (year, month, day, hour, minute, second).
It's the inverse function of the previous formula
"""
lt = dms2ddd(hour,minute,second) + timezone +DS
local_calendar_date = day + lt/24
jd = cal2jul(year, month, local_calendar_date)
local_calendar_date = jul2cal(jd)
return local_calendar_date
def ut2gst(year, month, day, hour, minute, second):
""" Sidereal time is a time-keeping system astronomers use to keep track of the direction to point
their telescopes to view a given star in the night sky.
Briefly, sidereal time is a "time scale that is based on the Earth's rate of rotation measured
relative to the fixed stars." (source Wikipedia)
This routine converts Universal Time to Sidereal Time for Greenwich (Greenwich Sidereal Time)
"""
jd = cal2jul(year, month, day)
S = jd - 2451545.0
T = S/36525.0
T0 = (6.697374558 + (2400.051336 * T)+ 0.000025862 *T*T) % 24
UT = dms2ddd(hour, minute, second)*1.002737909
GST = ddd2dms((UT + T0) % 24)
return GST
def gst2ut( year, month, day, hour, minute, second):
""" Inverse of the previous function
"""
jd = cal2jul(year, month, day, 0,0,0)
S = jd - 2451545.0
T = S/36525.0
T0 = (6.697374558 + 2400.051336 * T + 0.000025862 *T*T) % 24
GST = (dms2ddd(hour, minute, second) - T0) % 24
while GST <0:
GST += 24
UT = GST * .9972695663
return ddd2dms(UT)
def gst2lst( hour, minute, second, long_degree, long_minute, long_second=0):
""" Corrects GST for a different location on the Earth
"""
GST = dms2ddd(hour,minute,second)
lg = dms2ddd(long_degree, long_minute, long_second)/15.0
lst = ddd2dms((GST + lg) % 24)
return lst
def lst2gst( hour, minute, second, long_degree, long_minute, long_second=0):
""" Inverse of the previous method
"""
lst = dms2ddd(hour,minute,second)
lg = dms2ddd(long_degree, long_minute, long_second)/15.0
GST = ddd2dms((lst + lg) % 24)
return GST
def julian_centuries(year, month, day, hour=0, minute =0, second=0):
d1 = cal2jul(year, month, day, hour, minute, second)
d2 = cal2jul(2000,1,1,12)
return (d1-d2) / 36525.0
def julian_millennia(year, month, day, hour=0, minute =0, second=0):
return julian_centuries(year, month, day, hour, minute, second) / 10.0
def julian_decamillennia(year, month, day, hour=0, minute =0, second=0):
return julian_centuries(year, month, day, hour, minute, second) / 100.0
def obl_ecl_JPL(year, month, day, hour=0, minute = 0, second = 0):
t = julian_centuries(year, month, day, hour, minute, second)
""" from JPL Astronomical Almanac 2010 """
return (23 * 3600 + 26*60 + 21.406
- 46.836769 * t
- 0.0001831 * t * t
+ 0.00200340 * t * t * t
- 0.576e-6 * t * t * t * t
- 4.34e-8 * t * t * t * t * t) / 3600.0
def obl_ecl_Laskar(year, month, day, hour = 0, minute = 0, second = 0):
"""
Original work from Jay Tanner
- converted to Python code by Domenico Mustara 2015
This PHP function computes the mean obliquity of the ecliptic
given a JD argument corresponding to any given date and time.
Author: Jay Tanner - 2010
The algorithm used here is based on work published by J. Laskar
Astronomy and Astrophysics, Vol 157, p68 (1986),
New Formulas for the Precession, Valid Over 10000 years,
Table 8.
Source code provided under the provisions of the
GNU Affero General Public License (AGPL), version 3.
http://www.gnu.org/licenses/agpl.html
// -----------------------------------------------------------
// Compute the (t) value in Julian decamillennia corresponding
// to the JD argument and reckoned from J2000.
$t = ($JD - 2451545.0) / 3652500.0;
// --------------------------------------
"""
t = julian_decamillennia(year, month, day, hour, minute, second)
w = 84381.448
w -= 4680.93 * t
w -= 1.55 * t * t
w += 1999.25 * t * t * t
w -= 51.38 * t * t * t * t
w -= 249.67 * t * t * t * t * t
w -= 39.05 * t * t * t * t * t * t
w += 7.12 * t * t * t * t * t * t * t
w += 27.87 * t * t * t * t * t * t * t * t
w += 5.79 * t * t * t * t * t * t * t * t * t
w += 2.45 * t * t * t * t * t * t * t * t * t * t
return w / 3600.0
""" Some conversion utilities between various coordinate systems """
def sph_ecl2rect_ecl(r, longitude, latitude):
x = r * cos(latitude) * cos(longitude)
y = r * cos(latitude) * sin(longitude)
z = r * sin(latitude)
return (x,y,z)
def rect_ecl2sph_ecl(x,y,z):
r = math.sqrt(x*x + y*y + z*z)
longitude = atan2(y,x)
latitude = atan2(z, math.sqrt(x*x + y*y))
return (r, longitude, latitude)
def sph_equat2rect_equat(r, RA, Declination):
x = r * cos(RA) * cos(Declination)
y = r * sin(RA) * cos(Declination)
z = r * sin(Declination)
return (x,y,x)
def rect_equat2sph_equat(x,y,z):
r = math.sqrt(x*x + y*y +z*z)
RA = atan2(y, x)
Decl = atan2(z, math.sqrt(x*x + y*y))
return (r, RA, Decl)
def rect_ecl2rect_equat(xeclip, yeclip, zeclip, year, month, day, hour = 0, minute = 0, second = 0):
oblecl = obl_ecl_JPL(year, month, day, hour, minute, second)
xequat = xeclip
yequat = yeclip * cos(oblecl) - zeclip * sin(oblecl)
zequat = yeclip * sin(oblecl) + zeclip * cos(oblecl)
return (xequat, yequat, zequat)
def rect_equat2rect_ecl(xequat, yequat, zequat, year, month, day, hour = 0, minute = 0, second = 0):
oblecl = obl_ecl_JPL(year, month, day, hour, minute, second)
xeclip = xequat
yeclip = yequat * cos(- oblecl) - zequat * sin(- oblecl)
zeclip = yequat * sin(- oblecl) + zequat * cos(- oblecl)
return (xeclip, yeclip, zeclip)
| cc0-1.0 |
Aploium/MagicWebsiteMirror | zmirror/lru_dict.py | 3 | 1167 | # coding=utf-8
from collections import OrderedDict
class LRUDictManual(OrderedDict): # pragma: no cover
"""一个手动实现的LRUDict"""
def __init__(self, size=32):
super().__init__()
self.maxsize = size
def __getitem__(self, key):
value = super().__getitem__(key)
try:
self.move_to_end(key)
except:
pass
return value
# noinspection PyMethodOverriding
def __setitem__(self, key, value):
if len(self) >= self.maxsize:
self.popitem(last=False)
if key in self:
del self[key]
super().__setitem__(key, value)
def keys(self):
return list(reversed(list(super().keys())))
def values(self):
return list(reversed(list(super().values())))
def items(self):
return list(reversed(list(super().items())))
def get_size(self):
return len(self)
def set_size(self, size):
self.maxsize = size
try:
# 如果安装了 lru-dict, 则导入, 否则使用上面的手动实现的 LRUDict
from lru import LRU
except:
LRUDict = LRUDictManual
else:
LRUDict = LRU
| mit |
stoeckli/iMatrixSpray | octoprint/printer.py | 1 | 20362 | # coding=utf-8
__author__ = "Gina Häußge <[email protected]>"
__license__ = 'GNU Affero General Public License http://www.gnu.org/licenses/agpl.html'
import time
import datetime
import threading
import copy
import os
#import logging, logging.config
import octoprint.util.comm as comm
import octoprint.util as util
from octoprint.settings import settings
from octoprint.events import eventManager
def getConnectionOptions():
"""
Retrieves the available ports, baudrates, prefered port and baudrate for connecting to the printer.
"""
return {
"ports": comm.serialList(),
"baudrates": comm.baudrateList(),
"portPreference": settings().get(["serial", "port"]),
"baudratePreference": settings().getInt(["serial", "baudrate"]),
"autoconnect": settings().getBoolean(["serial", "autoconnect"])
}
class Printer():
def __init__(self, gcodeManager):
from collections import deque
self._gcodeManager = gcodeManager
self._gcodeManager.registerCallback(self)
# state
self._temp = None
self._bedTemp = None
self._targetTemp = None
self._targetBedTemp = None
self._temps = {
"actual": deque([], 300),
"target": deque([], 300),
"actualBed": deque([], 300),
"targetBed": deque([], 300)
}
self._tempBacklog = []
self._latestMessage = None
self._messages = deque([], 300)
self._messageBacklog = []
self._latestLog = None
self._log = deque([], 300)
self._logBacklog = []
self._state = None
self._currentZ = None
self._progress = None
self._printTime = None
self._printTimeLeft = None
self._printAfterSelect = False
# sd handling
self._sdPrinting = False
self._sdStreaming = False
self._selectedFile = None
# comm
self._comm = None
# callbacks
self._callbacks = []
self._lastProgressReport = None
self._stateMonitor = StateMonitor(
ratelimit=0.5,
updateCallback=self._sendCurrentDataCallbacks,
addTemperatureCallback=self._sendAddTemperatureCallbacks,
addLogCallback=self._sendAddLogCallbacks,
addMessageCallback=self._sendAddMessageCallbacks
)
self._stateMonitor.reset(
state={"state": None, "stateString": self.getStateString(), "flags": self._getStateFlags()},
jobData={"filename": None, "filesize": None, "estimatedSprayTime": None, "filament": None},
progress={"progress": None, "filepos": None, "sprayTime": None, "sprayTimeLeft": None},
currentZ=None
)
#~~ callback handling
def registerCallback(self, callback):
self._callbacks.append(callback)
self._sendInitialStateUpdate(callback)
def unregisterCallback(self, callback):
if callback in self._callbacks:
self._callbacks.remove(callback)
def _sendAddTemperatureCallbacks(self, data):
for callback in self._callbacks:
try: callback.addTemperature(data)
except: pass
def _sendAddLogCallbacks(self, data):
for callback in self._callbacks:
try: callback.addLog(data)
except: pass
def _sendAddMessageCallbacks(self, data):
for callback in self._callbacks:
try: callback.addMessage(data)
except: pass
def _sendCurrentDataCallbacks(self, data):
for callback in self._callbacks:
try: callback.sendCurrentData(copy.deepcopy(data))
except: pass
def _sendTriggerUpdateCallbacks(self, type):
for callback in self._callbacks:
try: callback.sendUpdateTrigger(type)
except: pass
def _sendFeedbackCommandOutput(self, name, output):
for callback in self._callbacks:
try: callback.sendFeedbackCommandOutput(name, output)
except: pass
#~~ callback from gcodemanager
def sendUpdateTrigger(self, type):
if type == "gcodeFiles" and self._selectedFile:
self._setJobData(self._selectedFile["filename"],
self._selectedFile["filesize"],
self._selectedFile["sd"])
#~~ printer commands
def connect(self, port=None, baudrate=None):
"""
Connects to the printer. If port and/or baudrate is provided, uses these settings, otherwise autodetection
will be attempted.
"""
if self._comm is not None:
self._comm.close()
self._comm = comm.MachineCom(port, baudrate, callbackObject=self)
def disconnect(self):
"""
Closes the connection to the printer.
"""
if self._comm is not None:
self._comm.close()
self._comm = None
eventManager().fire("Disconnected")
def command(self, command):
"""
Sends a single gcode command to the printer.
"""
self.commands([command])
def commands(self, commands):
"""
Sends multiple gcode commands (provided as a list) to the printer.
"""
for command in commands:
self._comm.sendCommand(command)
def selectFile(self, filename, sd, printAfterSelect=False):
if self._comm is None or (self._comm.isBusy() or self._comm.isStreaming()):
return
self._printAfterSelect = printAfterSelect
self._comm.selectFile(filename, sd)
self._setProgressData(0, None, None, None)
self._setCurrentZ(None)
def unselectFile(self):
if self._comm is not None and (self._comm.isBusy() or self._comm.isStreaming()):
return
self._comm.unselectFile()
self._setProgressData(0, None, None, None)
self._setCurrentZ(None)
def startPrint(self):
"""
Starts the currently loaded print job.
Only starts if the printer is connected and operational, not currently printing and a printjob is loaded
"""
if self._comm is None or not self._comm.isOperational() or self._comm.isPrinting():
return
if self._selectedFile is None:
return
self._setCurrentZ(None)
self._comm.startPrint()
def togglePausePrint(self):
"""
Pause the current printjob.
"""
if self._comm is None:
return
self._comm.setPause(not self._comm.isPaused())
def cancelPrint(self, disableMotorsAndHeater=True):
"""
Cancel the current printjob.
"""
if self._comm is None:
return
self._comm.cancelPrint()
if disableMotorsAndHeater:
self.commands(["M84", "M104 S0", "M140 S0", "M106 S0"]) # disable motors, switch off heaters and fan
# reset progress, height, print time
self._setCurrentZ(None)
self._setProgressData(None, None, None, None)
# mark print as failure
if self._selectedFile is not None:
self._gcodeManager.printFailed(self._selectedFile["filename"])
eventManager().fire("PrintFailed", self._selectedFile["filename"])
#~~ state monitoring
def _setCurrentZ(self, currentZ):
self._currentZ = currentZ
formattedCurrentZ = None
if self._currentZ:
formattedCurrentZ = "%.2f mm" % (self._currentZ)
self._stateMonitor.setCurrentZ(formattedCurrentZ)
def _setState(self, state):
self._state = state
self._stateMonitor.setState({"state": self._state, "stateString": self.getStateString(), "flags": self._getStateFlags()})
def _addLog(self, log):
self._log.append(log)
self._stateMonitor.addLog(log)
def _addMessage(self, message):
self._messages.append(message)
self._stateMonitor.addMessage(message)
def _setProgressData(self, progress, filepos, printTime, printTimeLeft):
self._progress = progress
self._printTime = printTime
self._printTimeLeft = printTimeLeft
formattedPrintTime = None
if (self._printTime):
formattedPrintTime = util.getFormattedTimeDelta(datetime.timedelta(seconds=self._printTime))
formattedPrintTimeLeft = None
if (self._printTimeLeft):
formattedPrintTimeLeft = util.getFormattedTimeDelta(datetime.timedelta(minutes=self._printTimeLeft))
formattedFilePos = None
if (filepos):
formattedFilePos = util.getFormattedSize(filepos)
self._stateMonitor.setProgress({"progress": self._progress, "filepos": formattedFilePos, "printTime": formattedPrintTime, "printTimeLeft": formattedPrintTimeLeft})
def _addTemperatureData(self, temp, bedTemp, targetTemp, bedTargetTemp):
currentTimeUtc = int(time.time() * 1000)
self._temps["actual"].append((currentTimeUtc, temp))
self._temps["target"].append((currentTimeUtc, targetTemp))
self._temps["actualBed"].append((currentTimeUtc, bedTemp))
self._temps["targetBed"].append((currentTimeUtc, bedTargetTemp))
self._temp = temp
self._bedTemp = bedTemp
self._targetTemp = targetTemp
self._targetBedTemp = bedTargetTemp
self._stateMonitor.addTemperature({"currentTime": currentTimeUtc, "temp": self._temp, "bedTemp": self._bedTemp, "targetTemp": self._targetTemp, "targetBedTemp": self._targetBedTemp})
def _setJobData(self, filename, filesize, sd):
if filename is not None:
self._selectedFile = {
"filename": filename,
"filesize": filesize,
"sd": sd
}
else:
self._selectedFile = None
formattedFilename = None
formattedFilesize = None
estimatedPrintTime = None
fileMTime = None
filament = None
if filename:
formattedFilename = os.path.basename(filename)
# Use a string for mtime because it could be float and the
# javascript needs to exact match
if not sd:
fileMTime = str(os.stat(filename).st_mtime)
if filesize:
formattedFilesize = util.getFormattedSize(filesize)
fileData = self._gcodeManager.getFileData(filename)
if fileData is not None and "gcodeAnalysis" in fileData.keys():
if "estimatedPrintTime" in fileData["gcodeAnalysis"].keys():
estimatedPrintTime = fileData["gcodeAnalysis"]["estimatedPrintTime"]
if "filament" in fileData["gcodeAnalysis"].keys():
filament = fileData["gcodeAnalysis"]["filament"]
self._stateMonitor.setJobData({"filename": formattedFilename, "filesize": formattedFilesize, "estimatedPrintTime": estimatedPrintTime, "filament": filament, "sd": sd, "mtime": fileMTime})
def _sendInitialStateUpdate(self, callback):
try:
data = self._stateMonitor.getCurrentData()
# convert the dict of deques to a dict of lists
temps = {k: list(v) for (k,v) in self._temps.iteritems()}
data.update({
"temperatureHistory": temps,
"logHistory": list(self._log),
"messageHistory": list(self._messages)
})
callback.sendHistoryData(data)
except Exception, err:
import sys
sys.stderr.write("ERROR: %s\n" % str(err))
pass
def _getStateFlags(self):
if not settings().getBoolean(["feature", "sdSupport"]) or self._comm is None:
sdReady = False
else:
sdReady = self._comm.isSdReady()
return {
"operational": self.isOperational(),
"printing": self.isPrinting(),
"closedOrError": self.isClosedOrError(),
"error": self.isError(),
"paused": self.isPaused(),
"ready": self.isReady(),
"sdReady": sdReady
}
def getCurrentData(self):
return self._stateMonitor.getCurrentData()
#~~ callbacks triggered from self._comm
def mcLog(self, message):
"""
Callback method for the comm object, called upon log output.
"""
self._addLog(message)
def mcTempUpdate(self, temp, bedTemp, targetTemp, bedTargetTemp):
self._addTemperatureData(temp, bedTemp, targetTemp, bedTargetTemp)
def mcStateChange(self, state):
"""
Callback method for the comm object, called if the connection state changes.
"""
oldState = self._state
# forward relevant state changes to gcode manager
if self._comm is not None and oldState == self._comm.STATE_PRINTING:
if self._selectedFile is not None:
if state == self._comm.STATE_OPERATIONAL:
self._gcodeManager.printSucceeded(self._selectedFile["filename"])
elif state == self._comm.STATE_CLOSED or state == self._comm.STATE_ERROR or state == self._comm.STATE_CLOSED_WITH_ERROR:
self._gcodeManager.printFailed(self._selectedFile["filename"])
self._gcodeManager.resumeAnalysis() # printing done, put those cpu cycles to good use
elif self._comm is not None and state == self._comm.STATE_PRINTING:
self._gcodeManager.pauseAnalysis() # do not analyse gcode while printing
self._setState(state)
def mcMessage(self, message):
"""
Callback method for the comm object, called upon message exchanges via serial.
Stores the message in the message buffer, truncates buffer to the last 300 lines.
"""
self._addMessage(message)
def mcProgress(self):
"""
Callback method for the comm object, called upon any change in progress of the printjob.
Triggers storage of new values for printTime, printTimeLeft and the current progress.
"""
self._setProgressData(self._comm.getPrintProgress(), self._comm.getPrintFilepos(), self._comm.getPrintTime(), self._comm.getPrintTimeRemainingEstimate())
def mcZChange(self, newZ):
"""
Callback method for the comm object, called upon change of the z-layer.
"""
oldZ = self._currentZ
if newZ != oldZ:
# we have to react to all z-changes, even those that might "go backward" due to a slicer's retraction or
# anti-backlash-routines. Event subscribes should individually take care to filter out "wrong" z-changes
eventManager().fire("ZChange", newZ)
self._setCurrentZ(newZ)
def mcSdStateChange(self, sdReady):
self._stateMonitor.setState({"state": self._state, "stateString": self.getStateString(), "flags": self._getStateFlags()})
def mcSdFiles(self, files):
self._sendTriggerUpdateCallbacks("gcodeFiles")
def mcFileSelected(self, filename, filesize, sd):
self._setJobData(filename, filesize, sd)
self._stateMonitor.setState({"state": self._state, "stateString": self.getStateString(), "flags": self._getStateFlags()})
if self._printAfterSelect:
self.startPrint()
def mcPrintjobDone(self):
self._setProgressData(1.0, self._selectedFile["filesize"], self._comm.getPrintTime(), 0)
self._stateMonitor.setState({"state": self._state, "stateString": self.getStateString(), "flags": self._getStateFlags()})
def mcFileTransferStarted(self, filename, filesize):
self._sdStreaming = True
self._setJobData(filename, filesize, True)
self._setProgressData(0.0, 0, 0, None)
self._stateMonitor.setState({"state": self._state, "stateString": self.getStateString(), "flags": self._getStateFlags()})
def mcFileTransferDone(self):
self._sdStreaming = False
self._setCurrentZ(None)
self._setJobData(None, None, None)
self._setProgressData(None, None, None, None)
self._stateMonitor.setState({"state": self._state, "stateString": self.getStateString(), "flags": self._getStateFlags()})
def mcReceivedRegisteredMessage(self, command, output):
self._sendFeedbackCommandOutput(command, output)
#~~ sd file handling
def getSdFiles(self):
if self._comm is None:
return
return self._comm.getSdFiles()
def addSdFile(self, filename, path):
if not self._comm or self._comm.isBusy():
return
self._comm.startFileTransfer(path, filename[:8].lower() + ".gco")
def deleteSdFile(self, filename):
if not self._comm:
return
self._comm.deleteSdFile(filename)
def initSdCard(self):
if not self._comm:
return
self._comm.initSdCard()
def releaseSdCard(self):
if not self._comm:
return
self._comm.releaseSdCard()
def refreshSdFiles(self):
if not self._comm:
return
self._comm.refreshSdFiles()
#~~ state reports
def getStateString(self):
"""
Returns a human readable string corresponding to the current communication state.
"""
if self._comm is None:
return "Offline"
else:
return self._comm.getStateString()
def getCurrentData(self):
return self._stateMonitor.getCurrentData()
def getCurrentJob(self):
currentData = self._stateMonitor.getCurrentData()
return currentData["job"]
def getCurrentTemperatures(self):
return {
"extruder": {
"current": self._temp,
"target": self._targetTemp
},
"bed": {
"current": self._bedTemp,
"target": self._targetBedTemp
}
}
def isClosedOrError(self):
return self._comm is None or self._comm.isClosedOrError()
def isOperational(self):
return self._comm is not None and self._comm.isOperational()
def isPrinting(self):
return self._comm is not None and self._comm.isPrinting()
def isPaused(self):
return self._comm is not None and self._comm.isPaused()
def isError(self):
return self._comm is not None and self._comm.isError()
def isReady(self):
return self.isOperational() and not self._comm.isStreaming()
def isLoading(self):
return self._gcodeLoader is not None
class GcodeLoader(threading.Thread):
"""
The GcodeLoader takes care of loading a gcode-File from disk and parsing it into a gcode object in a separate
thread while constantly notifying interested listeners about the current progress.
The progress is returned as a float value between 0 and 1 which is to be interpreted as the percentage of completion.
"""
def __init__(self, filename, progressCallback, loadedCallback):
threading.Thread.__init__(self)
self._progressCallback = progressCallback
self._loadedCallback = loadedCallback
self._filename = filename
self._gcodeList = None
def run(self):
#Send an initial M110 to reset the line counter to zero.
prevLineType = lineType = "CUSTOM"
gcodeList = ["M110 N0"]
filesize = os.stat(self._filename).st_size
with open(self._filename, "r") as file:
for line in file:
if line.startswith(";TYPE:"):
lineType = line[6:].strip()
if ";" in line:
line = line[0:line.find(";")]
line = line.strip()
if len(line) > 0:
if prevLineType != lineType:
gcodeList.append((line, lineType, ))
else:
gcodeList.append(line)
prevLineType = lineType
self._onLoadingProgress(float(file.tell()) / float(filesize))
self._gcodeList = gcodeList
self._loadedCallback(self._filename, self._gcodeList)
def _onLoadingProgress(self, progress):
self._progressCallback(self._filename, progress, "loading")
def _onParsingProgress(self, progress):
self._progressCallback(self._filename, progress, "parsing")
class SdFileStreamer(threading.Thread):
def __init__(self, comm, filename, file, progressCallback, finishCallback):
threading.Thread.__init__(self)
self._comm = comm
self._filename = filename
self._file = file
self._progressCallback = progressCallback
self._finishCallback = finishCallback
def run(self):
if self._comm.isBusy():
return
name = self._filename[:self._filename.rfind(".")]
sdFilename = name[:8].lower() + ".gco"
try:
size = os.stat(self._file).st_size
with open(self._file, "r") as f:
self._comm.startSdFileTransfer(sdFilename)
for line in f:
if ";" in line:
line = line[0:line.find(";")]
line = line.strip()
if len(line) > 0:
self._comm.sendCommand(line)
time.sleep(0.001) # do not send too fast
self._progressCallback(sdFilename, float(f.tell()) / float(size))
finally:
self._comm.endSdFileTransfer(sdFilename)
self._finishCallback(sdFilename)
class StateMonitor(object):
def __init__(self, ratelimit, updateCallback, addTemperatureCallback, addLogCallback, addMessageCallback):
self._ratelimit = ratelimit
self._updateCallback = updateCallback
self._addTemperatureCallback = addTemperatureCallback
self._addLogCallback = addLogCallback
self._addMessageCallback = addMessageCallback
self._state = None
self._jobData = None
self._gcodeData = None
self._sdUploadData = None
self._currentZ = None
self._progress = None
self._changeEvent = threading.Event()
self._lastUpdate = time.time()
self._worker = threading.Thread(target=self._work)
self._worker.daemon = True
self._worker.start()
def reset(self, state=None, jobData=None, progress=None, currentZ=None):
self.setState(state)
self.setJobData(jobData)
self.setProgress(progress)
self.setCurrentZ(currentZ)
def addTemperature(self, temperature):
self._addTemperatureCallback(temperature)
self._changeEvent.set()
def addLog(self, log):
self._addLogCallback(log)
self._changeEvent.set()
def addMessage(self, message):
self._addMessageCallback(message)
self._changeEvent.set()
def setCurrentZ(self, currentZ):
self._currentZ = currentZ
self._changeEvent.set()
def setState(self, state):
self._state = state
self._changeEvent.set()
def setJobData(self, jobData):
self._jobData = jobData
self._changeEvent.set()
def setProgress(self, progress):
self._progress = progress
self._changeEvent.set()
def _work(self):
while True:
self._changeEvent.wait()
now = time.time()
delta = now - self._lastUpdate
additionalWaitTime = self._ratelimit - delta
if additionalWaitTime > 0:
time.sleep(additionalWaitTime)
data = self.getCurrentData()
self._updateCallback(data)
self._lastUpdate = time.time()
self._changeEvent.clear()
def getCurrentData(self):
return {
"state": self._state,
"job": self._jobData,
"currentZ": self._currentZ,
"progress": self._progress
}
| agpl-3.0 |
photoninger/ansible | lib/ansible/modules/network/nxos/nxos_config.py | 6 | 19603 | #!/usr/bin/python
#
# This file is part of Ansible
#
# Ansible is free software: you can redistribute it and/or modify
# it under the terms of the GNU General Public License as published by
# the Free Software Foundation, either version 3 of the License, or
# (at your option) any later version.
#
# Ansible is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
# GNU General Public License for more details.
#
# You should have received a copy of the GNU General Public License
# along with Ansible. If not, see <http://www.gnu.org/licenses/>.
#
ANSIBLE_METADATA = {'metadata_version': '1.1',
'status': ['preview'],
'supported_by': 'network'}
DOCUMENTATION = """
---
module: nxos_config
extends_documentation_fragment: nxos
version_added: "2.1"
author: "Peter Sprygada (@privateip)"
short_description: Manage Cisco NXOS configuration sections
description:
- Cisco NXOS configurations use a simple block indent file syntax
for segmenting configuration into sections. This module provides
an implementation for working with NXOS configuration sections in
a deterministic way. This module works with either CLI or NXAPI
transports.
options:
lines:
description:
- The ordered set of commands that should be configured in the
section. The commands must be the exact same commands as found
in the device running-config. Be sure to note the configuration
command syntax as some commands are automatically modified by the
device config parser.
required: false
default: null
aliases: ['commands']
parents:
description:
- The ordered set of parents that uniquely identify the section
the commands should be checked against. If the parents argument
is omitted, the commands are checked against the set of top
level or global commands.
required: false
default: null
src:
description:
- The I(src) argument provides a path to the configuration file
to load into the remote system. The path can either be a full
system path to the configuration file if the value starts with /
or relative to the root of the implemented role or playbook.
This argument is mutually exclusive with the I(lines) and
I(parents) arguments.
required: false
default: null
version_added: "2.2"
replace_src:
description:
- The I(replace_src) argument provides path to the configuration file
to load into the remote system. This argument is used to replace the
entire config with a flat-file. This is used with argument I(replace)
with value I(config). This is mutually exclusive with the I(lines) and
I(src) arguments. This argument is supported on Nexus 9K device.
Use I(nxos_file_copy) module to copy the flat file to remote device and
then use the path with this argument.
required: false
default: null
version_added: "2.5"
before:
description:
- The ordered set of commands to push on to the command stack if
a change needs to be made. This allows the playbook designer
the opportunity to perform configuration commands prior to pushing
any changes without affecting how the set of commands are matched
against the system.
required: false
default: null
after:
description:
- The ordered set of commands to append to the end of the command
stack if a change needs to be made. Just like with I(before) this
allows the playbook designer to append a set of commands to be
executed after the command set.
required: false
default: null
match:
description:
- Instructs the module on the way to perform the matching of
the set of commands against the current device config. If
match is set to I(line), commands are matched line by line. If
match is set to I(strict), command lines are matched with respect
to position. If match is set to I(exact), command lines
must be an equal match. Finally, if match is set to I(none), the
module will not attempt to compare the source configuration with
the running configuration on the remote device.
required: false
default: line
choices: ['line', 'strict', 'exact', 'none']
replace:
description:
- Instructs the module on the way to perform the configuration
on the device. If the replace argument is set to I(line) then
the modified lines are pushed to the device in configuration
mode. If the replace argument is set to I(block) then the entire
command block is pushed to the device in configuration mode if any
line is not correct. I(replace config) is supported on Nexus 9K device.
required: false
default: lineo
choices: ['line', 'block', 'config']
force:
description:
- The force argument instructs the module to not consider the
current devices running-config. When set to true, this will
cause the module to push the contents of I(src) into the device
without first checking if already configured.
- Note this argument should be considered deprecated. To achieve
the equivalent, set the C(match=none) which is idempotent. This argument
will be removed in a future release.
required: false
default: false
type: bool
backup:
description:
- This argument will cause the module to create a full backup of
the current C(running-config) from the remote device before any
changes are made. The backup file is written to the C(backup)
folder in the playbook root directory. If the directory does not
exist, it is created.
required: false
default: false
type: bool
version_added: "2.2"
running_config:
description:
- The module, by default, will connect to the remote device and
retrieve the current running-config to use as a base for comparing
against the contents of source. There are times when it is not
desirable to have the task get the current running-config for
every task in a playbook. The I(running_config) argument allows the
implementer to pass in the configuration to use as the base
config for comparison.
required: false
default: null
aliases: ['config']
version_added: "2.4"
defaults:
description:
- The I(defaults) argument will influence how the running-config
is collected from the device. When the value is set to true,
the command used to collect the running-config is append with
the all keyword. When the value is set to false, the command
is issued without the all keyword
required: false
default: false
type: bool
version_added: "2.2"
save:
description:
- The C(save) argument instructs the module to save the
running-config to startup-config. This operation is performed
after any changes are made to the current running config. If
no changes are made, the configuration is still saved to the
startup config. This option will always cause the module to
return changed.
- This option is deprecated as of Ansible 2.4, use C(save_when)
required: false
default: false
type: bool
version_added: "2.2"
save_when:
description:
- When changes are made to the device running-configuration, the
changes are not copied to non-volatile storage by default. Using
this argument will change that before. If the argument is set to
I(always), then the running-config will always be copied to the
startup-config and the I(modified) flag will always be set to
True. If the argument is set to I(modified), then the running-config
will only be copied to the startup-config if it has changed since
the last save to startup-config. If the argument is set to
I(never), the running-config will never be copied to the
startup-config
required: false
default: never
choices: ['always', 'never', 'modified']
version_added: "2.4"
diff_against:
description:
- When using the C(ansible-playbook --diff) command line argument
the module can generate diffs against different sources.
- When this option is configure as I(startup), the module will return
the diff of the running-config against the startup-config.
- When this option is configured as I(intended), the module will
return the diff of the running-config against the configuration
provided in the C(intended_config) argument.
- When this option is configured as I(running), the module will
return the before and after diff of the running-config with respect
to any changes made to the device configuration.
required: false
default: startup
choices: ['startup', 'intended', 'running']
version_added: "2.4"
diff_ignore_lines:
description:
- Use this argument to specify one or more lines that should be
ignored during the diff. This is used for lines in the configuration
that are automatically updated by the system. This argument takes
a list of regular expressions or exact line matches.
required: false
version_added: "2.4"
intended_config:
description:
- The C(intended_config) provides the master configuration that
the node should conform to and is used to check the final
running-config against. This argument will not modify any settings
on the remote device and is strictly used to check the compliance
of the current device's configuration against. When specifying this
argument, the task should also modify the C(diff_against) value and
set it to I(intended).
required: false
version_added: "2.4"
"""
EXAMPLES = """
---
- name: configure top level configuration and save it
nxos_config:
lines: hostname {{ inventory_hostname }}
save_when: modified
- name: diff the running-config against a provided config
nxos_config:
diff_against: intended
intended_config: "{{ lookup('file', 'master.cfg') }}"
- nxos_config:
lines:
- 10 permit ip 1.1.1.1/32 any log
- 20 permit ip 2.2.2.2/32 any log
- 30 permit ip 3.3.3.3/32 any log
- 40 permit ip 4.4.4.4/32 any log
- 50 permit ip 5.5.5.5/32 any log
parents: ip access-list test
before: no ip access-list test
match: exact
- nxos_config:
lines:
- 10 permit ip 1.1.1.1/32 any log
- 20 permit ip 2.2.2.2/32 any log
- 30 permit ip 3.3.3.3/32 any log
- 40 permit ip 4.4.4.4/32 any log
parents: ip access-list test
before: no ip access-list test
replace: block
- name: replace config with flat file
nxos_config:
replace_src: config.txt
replace: config
"""
RETURN = """
commands:
description: The set of commands that will be pushed to the remote device
returned: always
type: list
sample: ['hostname foo', 'vlan 1', 'name default']
updates:
description: The set of commands that will be pushed to the remote device
returned: always
type: list
sample: ['hostname foo', 'vlan 1', 'name default']
backup_path:
description: The full path to the backup file
returned: when backup is yes
type: string
sample: /playbooks/ansible/backup/nxos_config.2016-07-16@22:28:34
"""
from ansible.module_utils.basic import AnsibleModule
from ansible.module_utils.network.common.config import NetworkConfig, dumps
from ansible.module_utils.network.nxos.nxos import get_config, load_config, run_commands
from ansible.module_utils.network.nxos.nxos import get_capabilities
from ansible.module_utils.network.nxos.nxos import nxos_argument_spec
from ansible.module_utils.network.nxos.nxos import check_args as nxos_check_args
from ansible.module_utils.network.common.utils import to_list
def get_running_config(module, config=None):
contents = module.params['running_config']
if not contents:
if not module.params['defaults'] and config:
contents = config
else:
flags = ['all']
contents = get_config(module, flags=flags)
return NetworkConfig(indent=2, contents=contents)
def get_candidate(module):
candidate = NetworkConfig(indent=2)
if module.params['src']:
if module.params['replace'] != 'config':
candidate.load(module.params['src'])
if module.params['replace'] == 'config':
candidate.load('config replace {0}'.format(module.params['replace_src']))
elif module.params['lines']:
parents = module.params['parents'] or list()
candidate.add(module.params['lines'], parents=parents)
return candidate
def execute_show_commands(module, commands, output='text'):
cmds = []
for command in to_list(commands):
cmd = {'command': command,
'output': output,
}
cmds.append(cmd)
body = run_commands(module, cmds)
return body
def main():
""" main entry point for module execution
"""
argument_spec = dict(
src=dict(type='path'),
replace_src=dict(),
lines=dict(aliases=['commands'], type='list'),
parents=dict(type='list'),
before=dict(type='list'),
after=dict(type='list'),
match=dict(default='line', choices=['line', 'strict', 'exact', 'none']),
replace=dict(default='line', choices=['line', 'block', 'config']),
running_config=dict(aliases=['config']),
intended_config=dict(),
defaults=dict(type='bool', default=False),
backup=dict(type='bool', default=False),
save_when=dict(choices=['always', 'never', 'modified'], default='never'),
diff_against=dict(choices=['running', 'startup', 'intended']),
diff_ignore_lines=dict(type='list'),
# save is deprecated as of ans2.4, use save_when instead
save=dict(default=False, type='bool', removed_in_version='2.4'),
# force argument deprecated in ans2.2
force=dict(default=False, type='bool', removed_in_version='2.2')
)
argument_spec.update(nxos_argument_spec)
mutually_exclusive = [('lines', 'src', 'replace_src'),
('parents', 'src'),
('save', 'save_when')]
required_if = [('match', 'strict', ['lines']),
('match', 'exact', ['lines']),
('replace', 'block', ['lines']),
('replace', 'config', ['replace_src']),
('diff_against', 'intended', ['intended_config'])]
module = AnsibleModule(argument_spec=argument_spec,
mutually_exclusive=mutually_exclusive,
required_if=required_if,
supports_check_mode=True)
warnings = list()
nxos_check_args(module, warnings)
result = {'changed': False, 'warnings': warnings}
config = None
info = get_capabilities(module).get('device_info', {})
os_platform = info.get('network_os_platform', '')
if module.params['replace'] == 'config':
if '9K' not in os_platform:
module.fail_json(msg='replace: config is supported only for Nexus 9K series switches')
if module.params['replace_src']:
if module.params['replace'] != 'config':
module.fail_json(msg='replace: config is required with replace_src')
if module.params['backup'] or (module._diff and module.params['diff_against'] == 'running'):
contents = get_config(module)
config = NetworkConfig(indent=2, contents=contents)
if module.params['backup']:
result['__backup__'] = contents
if any((module.params['src'], module.params['lines'], module.params['replace_src'])):
match = module.params['match']
replace = module.params['replace']
candidate = get_candidate(module)
if match != 'none' and replace != 'config':
config = get_running_config(module, config)
path = module.params['parents']
configobjs = candidate.difference(config, match=match, replace=replace, path=path)
else:
configobjs = candidate.items
if configobjs:
commands = dumps(configobjs, 'commands').split('\n')
if module.params['before']:
commands[:0] = module.params['before']
if module.params['after']:
commands.extend(module.params['after'])
result['commands'] = commands
result['updates'] = commands
if not module.check_mode:
load_config(module, commands)
result['changed'] = True
running_config = None
startup_config = None
diff_ignore_lines = module.params['diff_ignore_lines']
if module.params['save']:
module.params['save_when'] = 'always'
if module.params['save_when'] != 'never':
output = execute_show_commands(module, ['show running-config', 'show startup-config'])
running_config = NetworkConfig(indent=1, contents=output[0], ignore_lines=diff_ignore_lines)
startup_config = NetworkConfig(indent=1, contents=output[1], ignore_lines=diff_ignore_lines)
if running_config.sha1 != startup_config.sha1 or module.params['save_when'] == 'always':
result['changed'] = True
if not module.check_mode:
cmd = {'command': 'copy running-config startup-config', 'output': 'text'}
run_commands(module, [cmd])
else:
module.warn('Skipping command `copy running-config startup-config` '
'due to check_mode. Configuration not copied to '
'non-volatile storage')
if module._diff:
if not running_config:
output = execute_show_commands(module, 'show running-config')
contents = output[0]
else:
contents = running_config.config_text
# recreate the object in order to process diff_ignore_lines
running_config = NetworkConfig(indent=1, contents=contents, ignore_lines=diff_ignore_lines)
if module.params['diff_against'] == 'running':
if module.check_mode:
module.warn("unable to perform diff against running-config due to check mode")
contents = None
else:
contents = config.config_text
elif module.params['diff_against'] == 'startup':
if not startup_config:
output = execute_show_commands(module, 'show startup-config')
contents = output[0]
else:
contents = output[0]
contents = startup_config.config_text
elif module.params['diff_against'] == 'intended':
contents = module.params['intended_config']
if contents is not None:
base_config = NetworkConfig(indent=1, contents=contents, ignore_lines=diff_ignore_lines)
if running_config.sha1 != base_config.sha1:
result.update({
'changed': True,
'diff': {'before': str(base_config), 'after': str(running_config)}
})
module.exit_json(**result)
if __name__ == '__main__':
main()
| gpl-3.0 |
ekr/nss-old | external_tests/google_test/gtest/xcode/Scripts/versiongenerate.py | 3088 | 4536 | #!/usr/bin/env python
#
# Copyright 2008, Google Inc.
# All rights reserved.
#
# Redistribution and use in source and binary forms, with or without
# modification, are permitted provided that the following conditions are
# met:
#
# * Redistributions of source code must retain the above copyright
# notice, this list of conditions and the following disclaimer.
# * Redistributions in binary form must reproduce the above
# copyright notice, this list of conditions and the following disclaimer
# in the documentation and/or other materials provided with the
# distribution.
# * Neither the name of Google Inc. nor the names of its
# contributors may be used to endorse or promote products derived from
# this software without specific prior written permission.
#
# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
# A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
# OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
# SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
# LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
# DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
# THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
# OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
"""A script to prepare version informtion for use the gtest Info.plist file.
This script extracts the version information from the configure.ac file and
uses it to generate a header file containing the same information. The
#defines in this header file will be included in during the generation of
the Info.plist of the framework, giving the correct value to the version
shown in the Finder.
This script makes the following assumptions (these are faults of the script,
not problems with the Autoconf):
1. The AC_INIT macro will be contained within the first 1024 characters
of configure.ac
2. The version string will be 3 integers separated by periods and will be
surrounded by squre brackets, "[" and "]" (e.g. [1.0.1]). The first
segment represents the major version, the second represents the minor
version and the third represents the fix version.
3. No ")" character exists between the opening "(" and closing ")" of
AC_INIT, including in comments and character strings.
"""
import sys
import re
# Read the command line argument (the output directory for Version.h)
if (len(sys.argv) < 3):
print "Usage: versiongenerate.py input_dir output_dir"
sys.exit(1)
else:
input_dir = sys.argv[1]
output_dir = sys.argv[2]
# Read the first 1024 characters of the configure.ac file
config_file = open("%s/configure.ac" % input_dir, 'r')
buffer_size = 1024
opening_string = config_file.read(buffer_size)
config_file.close()
# Extract the version string from the AC_INIT macro
# The following init_expression means:
# Extract three integers separated by periods and surrounded by squre
# brackets(e.g. "[1.0.1]") between "AC_INIT(" and ")". Do not be greedy
# (*? is the non-greedy flag) since that would pull in everything between
# the first "(" and the last ")" in the file.
version_expression = re.compile(r"AC_INIT\(.*?\[(\d+)\.(\d+)\.(\d+)\].*?\)",
re.DOTALL)
version_values = version_expression.search(opening_string)
major_version = version_values.group(1)
minor_version = version_values.group(2)
fix_version = version_values.group(3)
# Write the version information to a header file to be included in the
# Info.plist file.
file_data = """//
// DO NOT MODIFY THIS FILE (but you can delete it)
//
// This file is autogenerated by the versiongenerate.py script. This script
// is executed in a "Run Script" build phase when creating gtest.framework. This
// header file is not used during compilation of C-source. Rather, it simply
// defines some version strings for substitution in the Info.plist. Because of
// this, we are not not restricted to C-syntax nor are we using include guards.
//
#define GTEST_VERSIONINFO_SHORT %s.%s
#define GTEST_VERSIONINFO_LONG %s.%s.%s
""" % (major_version, minor_version, major_version, minor_version, fix_version)
version_file = open("%s/Version.h" % output_dir, 'w')
version_file.write(file_data)
version_file.close()
| mpl-2.0 |
nimasmi/wagtail | wagtail/core/blocks/struct_block.py | 1 | 8310 | import collections
from django import forms
from django.core.exceptions import ValidationError
from django.forms.utils import ErrorList
from django.template.loader import render_to_string
from django.utils.functional import cached_property
from django.utils.html import format_html, format_html_join
from django.utils.safestring import mark_safe
from wagtail.admin.staticfiles import versioned_static
from .base import Block, DeclarativeSubBlocksMetaclass
from .utils import js_dict
__all__ = ['BaseStructBlock', 'StructBlock', 'StructValue']
class StructValue(collections.OrderedDict):
""" A class that generates a StructBlock value from provded sub-blocks """
def __init__(self, block, *args):
super().__init__(*args)
self.block = block
def __html__(self):
return self.block.render(self)
def render_as_block(self, context=None):
return self.block.render(self, context=context)
@cached_property
def bound_blocks(self):
return collections.OrderedDict([
(name, block.bind(self.get(name)))
for name, block in self.block.child_blocks.items()
])
class BaseStructBlock(Block):
def __init__(self, local_blocks=None, **kwargs):
self._constructor_kwargs = kwargs
super().__init__(**kwargs)
# create a local (shallow) copy of base_blocks so that it can be supplemented by local_blocks
self.child_blocks = self.base_blocks.copy()
if local_blocks:
for name, block in local_blocks:
block.set_name(name)
self.child_blocks[name] = block
self.child_js_initializers = {}
for name, block in self.child_blocks.items():
js_initializer = block.js_initializer()
if js_initializer is not None:
self.child_js_initializers[name] = js_initializer
self.dependencies = self.child_blocks.values()
def get_default(self):
"""
Any default value passed in the constructor or self.meta is going to be a dict
rather than a StructValue; for consistency, we need to convert it to a StructValue
for StructBlock to work with
"""
return self._to_struct_value(self.meta.default.items())
def js_initializer(self):
# skip JS setup entirely if no children have js_initializers
if not self.child_js_initializers:
return None
return "StructBlock(%s)" % js_dict(self.child_js_initializers)
@property
def media(self):
return forms.Media(js=[versioned_static('wagtailadmin/js/blocks/struct.js')])
def get_form_context(self, value, prefix='', errors=None):
if errors:
if len(errors) > 1:
# We rely on StructBlock.clean throwing a single ValidationError with a specially crafted
# 'params' attribute that we can pull apart and distribute to the child blocks
raise TypeError('StructBlock.render_form unexpectedly received multiple errors')
error_dict = errors.as_data()[0].params
else:
error_dict = {}
bound_child_blocks = collections.OrderedDict([
(
name,
block.bind(value.get(name, block.get_default()),
prefix="%s-%s" % (prefix, name), errors=error_dict.get(name))
)
for name, block in self.child_blocks.items()
])
return {
'children': bound_child_blocks,
'help_text': getattr(self.meta, 'help_text', None),
'classname': self.meta.form_classname,
'block_definition': self,
'prefix': prefix,
}
def render_form(self, value, prefix='', errors=None):
context = self.get_form_context(value, prefix=prefix, errors=errors)
return mark_safe(render_to_string(self.meta.form_template, context))
def value_from_datadict(self, data, files, prefix):
return self._to_struct_value([
(name, block.value_from_datadict(data, files, '%s-%s' % (prefix, name)))
for name, block in self.child_blocks.items()
])
def value_omitted_from_data(self, data, files, prefix):
return all(
block.value_omitted_from_data(data, files, '%s-%s' % (prefix, name))
for name, block in self.child_blocks.items()
)
def clean(self, value):
result = [] # build up a list of (name, value) tuples to be passed to the StructValue constructor
errors = {}
for name, val in value.items():
try:
result.append((name, self.child_blocks[name].clean(val)))
except ValidationError as e:
errors[name] = ErrorList([e])
if errors:
# The message here is arbitrary - StructBlock.render_form will suppress it
# and delegate the errors contained in the 'params' dict to the child blocks instead
raise ValidationError('Validation error in StructBlock', params=errors)
return self._to_struct_value(result)
def to_python(self, value):
""" Recursively call to_python on children and return as a StructValue """
return self._to_struct_value([
(
name,
(child_block.to_python(value[name]) if name in value else child_block.get_default())
# NB the result of get_default is NOT passed through to_python, as it's expected
# to be in the block's native type already
)
for name, child_block in self.child_blocks.items()
])
def _to_struct_value(self, block_items):
""" Return a Structvalue representation of the sub-blocks in this block """
return self.meta.value_class(self, block_items)
def get_prep_value(self, value):
""" Recursively call get_prep_value on children and return as a plain dict """
return dict([
(name, self.child_blocks[name].get_prep_value(val))
for name, val in value.items()
])
def get_api_representation(self, value, context=None):
""" Recursively call get_api_representation on children and return as a plain dict """
return dict([
(name, self.child_blocks[name].get_api_representation(val, context=context))
for name, val in value.items()
])
def get_searchable_content(self, value):
content = []
for name, block in self.child_blocks.items():
content.extend(block.get_searchable_content(value.get(name, block.get_default())))
return content
def deconstruct(self):
"""
Always deconstruct StructBlock instances as if they were plain StructBlocks with all of the
field definitions passed to the constructor - even if in reality this is a subclass of StructBlock
with the fields defined declaratively, or some combination of the two.
This ensures that the field definitions get frozen into migrations, rather than leaving a reference
to a custom subclass in the user's models.py that may or may not stick around.
"""
path = 'wagtail.core.blocks.StructBlock'
args = [list(self.child_blocks.items())]
kwargs = self._constructor_kwargs
return (path, args, kwargs)
def check(self, **kwargs):
errors = super().check(**kwargs)
for name, child_block in self.child_blocks.items():
errors.extend(child_block.check(**kwargs))
errors.extend(child_block._check_name(**kwargs))
return errors
def render_basic(self, value, context=None):
return format_html('<dl>\n{}\n</dl>', format_html_join(
'\n', ' <dt>{}</dt>\n <dd>{}</dd>', value.items()))
class Meta:
default = {}
form_classname = 'struct-block'
form_template = 'wagtailadmin/block_forms/struct.html'
value_class = StructValue
# No icon specified here, because that depends on the purpose that the
# block is being used for. Feel encouraged to specify an icon in your
# descendant block type
icon = "placeholder"
class StructBlock(BaseStructBlock, metaclass=DeclarativeSubBlocksMetaclass):
pass
| bsd-3-clause |
nkgilley/home-assistant | homeassistant/components/spc/binary_sensor.py | 6 | 2100 | """Support for Vanderbilt (formerly Siemens) SPC alarm systems."""
import logging
from pyspcwebgw.const import ZoneInput, ZoneType
from homeassistant.components.binary_sensor import BinarySensorEntity
from homeassistant.core import callback
from homeassistant.helpers.dispatcher import async_dispatcher_connect
from . import DATA_API, SIGNAL_UPDATE_SENSOR
_LOGGER = logging.getLogger(__name__)
def _get_device_class(zone_type):
return {
ZoneType.ALARM: "motion",
ZoneType.ENTRY_EXIT: "opening",
ZoneType.FIRE: "smoke",
ZoneType.TECHNICAL: "power",
}.get(zone_type)
async def async_setup_platform(hass, config, async_add_entities, discovery_info=None):
"""Set up the SPC binary sensor."""
if discovery_info is None:
return
api = hass.data[DATA_API]
async_add_entities(
[
SpcBinarySensor(zone)
for zone in api.zones.values()
if _get_device_class(zone.type)
]
)
class SpcBinarySensor(BinarySensorEntity):
"""Representation of a sensor based on a SPC zone."""
def __init__(self, zone):
"""Initialize the sensor device."""
self._zone = zone
async def async_added_to_hass(self):
"""Call for adding new entities."""
self.async_on_remove(
async_dispatcher_connect(
self.hass,
SIGNAL_UPDATE_SENSOR.format(self._zone.id),
self._update_callback,
)
)
@callback
def _update_callback(self):
"""Call update method."""
self.async_schedule_update_ha_state(True)
@property
def name(self):
"""Return the name of the device."""
return self._zone.name
@property
def is_on(self):
"""Whether the device is switched on."""
return self._zone.input == ZoneInput.OPEN
@property
def should_poll(self):
"""No polling needed."""
return False
@property
def device_class(self):
"""Return the device class."""
return _get_device_class(self._zone.type)
| apache-2.0 |
ypid/series60-remote | pc/devices/status_numbers.py | 1 | 2071 | # -*- coding: utf-8 -*-
# Copyright (c) 2008 - 2010 Lukas Hetzenecker <[email protected]>
NUM_CONNECTED = 100
NUM_HELLO_REQUEST = 110
NUM_HELLO_REPLY = 111
NUM_QUIT = 120
NUM_PARTIAL_MESSAGE = 130
NUM_CONTACTS_REQUEST_HASH_ALL = 200
NUM_CONTACTS_REQUEST_HASH_SINGLE= 201
NUM_CONTACTS_REQUEST_CONTACT = 204
NUM_CONTACTS_REQUEST_CONTACTS_ALL = 205
NUM_CONTACTS_REPLY_HASH_ALL= 210
NUM_CONTACTS_REPLY_HASH_SINGLE_START= 211
NUM_CONTACTS_REPLY_HASH_SINGLE_LINE= 212
NUM_CONTACTS_REPLY_HASH_SINGLE_END= 213
NUM_CONTACTS_REPLY_CONTACT_START = 220
NUM_CONTACTS_REPLY_CONTACT_LINE = 221
NUM_CONTACTS_REPLY_CONTACT_END = 222
NUM_CONTACTS_REPLY_CONTACTS_ALL_END = 223
NUM_CONTACTS_ADD = 230
NUM_CONTACTS_ADD_REPLY_ID = 231
NUM_CONTACTS_DELETE = 232
NUM_CONTACTS_CHANGE_ADDFIELD = 233
NUM_CONTACTS_CHANGE_REMOVEFIELD = 234
NUM_SYSINFO_REQUEST = 250
NUM_SYSINFO_REPLY_START = 260
NUM_SYSINFO_REPLY_LINE = 261
NUM_SYSINFO_REPLY_END = 262
NUM_MESSAGE_SEND_REQUEST = 300
NUM_MESSAGE_SEND_REPLY_OK = 301
NUM_MESSAGE_SEND_REPLY_STATUS = 302
NUM_MESSAGE_SEND_REPLY_FAILURE = 303
NUM_MESSAGE_SEND_REPLY_RETRY = 304
NUM_SET_READ = 320
NUM_MESSAGE_NEW = 350
NUM_MESSAGE_REQUEST = 351
NUM_MESSAGE_REPLY_LINE = 352
NUM_MESSAGE_REPLY_END = 353
NUM_MESSAGE_REQUEST_UNREAD = 370
NUM_MESSAGE_REPLY_UNREAD = 371
NUM_CALENDAR_REQUEST_HASH_ALL = 380
#NUM_CALENDAR_REQUEST_HASH_SINGLE = 381
NUM_CALENDAR_REQUEST_ENTRY = 382
NUM_CALENDAR_REQUEST_ENTRIES_ALL = 383
NUM_CALENDAR_REPLY_HASH_ALL= 384
#NUM_CALENDAR_REPLY_HASH_SINGLE_START= 385
#NUM_CALENDAR_REPLY_HASH_SINGLE_LINE= 386
#NUM_CALENDAR_REPLY_HASH_SINGLE_END= 387
NUM_CALENDAR_REPLY_ENTRIES_START = 388
NUM_CALENDAR_REPLY_ENTRY = 389
NUM_CALENDAR_REPLY_ENTRIES_END = 390
NUM_CALENDAR_ENTRY_ADD = 395
NUM_CALENDAR_ENTRY_ADD_REPLY = 396
NUM_CALENDAR_ENTRY_DELETE = 397
NUM_CALENDAR_ENTRY_CHANGE = 398
NUM_CALENDAR_ENTRY_CHANGE_REPLY_TIME = 399
NUM_INCOMING_CALL = 400
NUM_DEBUG = 999
NUM_END_HEADER = chr(0x02) # Start of Text
NUM_SEPERATOR = chr(0x1E) # Record Separator
NUM_END_TEXT = chr(0x03) # End of Text
PROTOCOL_VERSION = 1.5
| gpl-2.0 |
DooMLoRD/android_kernel_sony_msm8960t_aosp | tools/perf/scripts/python/futex-contention.py | 11261 | 1486 | # futex contention
# (c) 2010, Arnaldo Carvalho de Melo <[email protected]>
# Licensed under the terms of the GNU GPL License version 2
#
# Translation of:
#
# http://sourceware.org/systemtap/wiki/WSFutexContention
#
# to perf python scripting.
#
# Measures futex contention
import os, sys
sys.path.append(os.environ['PERF_EXEC_PATH'] + '/scripts/python/Perf-Trace-Util/lib/Perf/Trace')
from Util import *
process_names = {}
thread_thislock = {}
thread_blocktime = {}
lock_waits = {} # long-lived stats on (tid,lock) blockage elapsed time
process_names = {} # long-lived pid-to-execname mapping
def syscalls__sys_enter_futex(event, ctxt, cpu, s, ns, tid, comm,
nr, uaddr, op, val, utime, uaddr2, val3):
cmd = op & FUTEX_CMD_MASK
if cmd != FUTEX_WAIT:
return # we don't care about originators of WAKE events
process_names[tid] = comm
thread_thislock[tid] = uaddr
thread_blocktime[tid] = nsecs(s, ns)
def syscalls__sys_exit_futex(event, ctxt, cpu, s, ns, tid, comm,
nr, ret):
if thread_blocktime.has_key(tid):
elapsed = nsecs(s, ns) - thread_blocktime[tid]
add_stats(lock_waits, (tid, thread_thislock[tid]), elapsed)
del thread_blocktime[tid]
del thread_thislock[tid]
def trace_begin():
print "Press control+C to stop and show the summary"
def trace_end():
for (tid, lock) in lock_waits:
min, max, avg, count = lock_waits[tid, lock]
print "%s[%d] lock %x contended %d times, %d avg ns" % \
(process_names[tid], tid, lock, count, avg)
| gpl-2.0 |
kpespinosa/BuildingMachineLearningSystemsWithPython | ch04/blei_lda.py | 21 | 2601 | # This code is supporting material for the book
# Building Machine Learning Systems with Python
# by Willi Richert and Luis Pedro Coelho
# published by PACKT Publishing
#
# It is made available under the MIT License
from __future__ import print_function
from wordcloud import create_cloud
try:
from gensim import corpora, models, matutils
except:
print("import gensim failed.")
print()
print("Please install it")
raise
import matplotlib.pyplot as plt
import numpy as np
from os import path
NUM_TOPICS = 100
# Check that data exists
if not path.exists('./data/ap/ap.dat'):
print('Error: Expected data to be present at data/ap/')
print('Please cd into ./data & run ./download_ap.sh')
# Load the data
corpus = corpora.BleiCorpus('./data/ap/ap.dat', './data/ap/vocab.txt')
# Build the topic model
model = models.ldamodel.LdaModel(
corpus, num_topics=NUM_TOPICS, id2word=corpus.id2word, alpha=None)
# Iterate over all the topics in the model
for ti in range(model.num_topics):
words = model.show_topic(ti, 64)
tf = sum(f for f, w in words)
with open('topics.txt', 'w') as output:
output.write('\n'.join('{}:{}'.format(w, int(1000. * f / tf)) for f, w in words))
output.write("\n\n\n")
# We first identify the most discussed topic, i.e., the one with the
# highest total weight
topics = matutils.corpus2dense(model[corpus], num_terms=model.num_topics)
weight = topics.sum(1)
max_topic = weight.argmax()
# Get the top 64 words for this topic
# Without the argument, show_topic would return only 10 words
words = model.show_topic(max_topic, 64)
# This function will actually check for the presence of pytagcloud and is otherwise a no-op
create_cloud('cloud_blei_lda.png', words)
num_topics_used = [len(model[doc]) for doc in corpus]
fig,ax = plt.subplots()
ax.hist(num_topics_used, np.arange(42))
ax.set_ylabel('Nr of documents')
ax.set_xlabel('Nr of topics')
fig.tight_layout()
fig.savefig('Figure_04_01.png')
# Now, repeat the same exercise using alpha=1.0
# You can edit the constant below to play around with this parameter
ALPHA = 1.0
model1 = models.ldamodel.LdaModel(
corpus, num_topics=NUM_TOPICS, id2word=corpus.id2word, alpha=ALPHA)
num_topics_used1 = [len(model1[doc]) for doc in corpus]
fig,ax = plt.subplots()
ax.hist([num_topics_used, num_topics_used1], np.arange(42))
ax.set_ylabel('Nr of documents')
ax.set_xlabel('Nr of topics')
# The coordinates below were fit by trial and error to look good
ax.text(9, 223, r'default alpha')
ax.text(26, 156, 'alpha=1.0')
fig.tight_layout()
fig.savefig('Figure_04_02.png')
| mit |
daenamkim/ansible | test/units/modules/network/junos/test_junos_config.py | 35 | 8141 | #
# (c) 2017 Red Hat Inc.
#
# This file is part of Ansible
#
# Ansible is free software: you can redistribute it and/or modify
# it under the terms of the GNU General Public License as published by
# the Free Software Foundation, either version 3 of the License, or
# (at your option) any later version.
#
# Ansible is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
# GNU General Public License for more details.
#
# You should have received a copy of the GNU General Public License
# along with Ansible. If not, see <http://www.gnu.org/licenses/>.
# Make coding more python3-ish
from __future__ import (absolute_import, division, print_function)
__metaclass__ = type
from ansible.compat.tests.mock import patch
from ansible.modules.network.junos import junos_config
from units.modules.utils import set_module_args
from .junos_module import TestJunosModule, load_fixture
class TestJunosConfigModule(TestJunosModule):
module = junos_config
def setUp(self):
super(TestJunosConfigModule, self).setUp()
self.mock_get_config = patch('ansible.modules.network.junos.junos_config.get_configuration')
self.get_config = self.mock_get_config.start()
self.mock_load_config = patch('ansible.modules.network.junos.junos_config.load_config')
self.load_config = self.mock_load_config.start()
self.mock_load_configuration = patch('ansible.modules.network.junos.junos_config.load_configuration')
self.load_configuration = self.mock_load_configuration.start()
self.mock_lock_configuration = patch('ansible.module_utils.network.junos.junos.lock_configuration')
self.lock_configuration = self.mock_lock_configuration.start()
self.mock_unlock_configuration = patch('ansible.module_utils.network.junos.junos.unlock_configuration')
self.unlock_configuration = self.mock_unlock_configuration.start()
self.mock_commit_configuration = patch('ansible.modules.network.junos.junos_config.commit_configuration')
self.commit_configuration = self.mock_commit_configuration.start()
self.mock_get_diff = patch('ansible.modules.network.junos.junos_config.get_diff')
self.get_diff = self.mock_get_diff.start()
self.mock_conn = patch('ansible.module_utils.connection.Connection')
self.conn = self.mock_conn.start()
self.mock_netconf = patch('ansible.module_utils.network.junos.junos.NetconfConnection')
self.netconf_conn = self.mock_netconf.start()
self.mock_exec_rpc = patch('ansible.modules.network.junos.junos_config.exec_rpc')
self.exec_rpc = self.mock_exec_rpc.start()
self.mock_netconf_rpc = patch('ansible.module_utils.network.common.netconf.NetconfConnection')
self.netconf_rpc = self.mock_netconf_rpc.start()
def tearDown(self):
super(TestJunosConfigModule, self).tearDown()
self.mock_get_config.stop()
self.mock_load_config.stop()
self.mock_lock_configuration.stop()
self.mock_unlock_configuration.stop()
self.mock_commit_configuration.stop()
self.mock_get_diff.stop()
self.load_configuration.stop()
self.mock_conn.stop()
self.mock_netconf.stop()
self.mock_exec_rpc.stop()
self.mock_netconf_rpc.stop()
def load_fixtures(self, commands=None, format='text', changed=False):
self.get_config.return_value = load_fixture('get_configuration_rpc_reply.txt')
if changed:
self.load_config.return_value = load_fixture('get_configuration_rpc_reply_diff.txt')
else:
self.load_config.return_value = None
def test_junos_config_unchanged(self):
src = load_fixture('junos_config.set', content='str')
set_module_args(dict(src=src))
self.execute_module()
def test_junos_config_src_set(self):
src = load_fixture('junos_config.set', content='str')
set_module_args(dict(src=src))
self.execute_module(changed=True)
args, kwargs = self.load_config.call_args
self.assertEqual(kwargs['action'], 'set')
self.assertEqual(kwargs['format'], 'text')
def test_junos_config_backup(self):
set_module_args(dict(backup=True))
result = self.execute_module()
self.assertIn('__backup__', result)
def test_junos_config_lines(self):
set_module_args(dict(lines=['delete interfaces ae11', 'set interfaces ae11 unit 0 description Test']))
self.execute_module(changed=True)
args, kwargs = self.load_config.call_args
self.assertEqual(args[1][0], 'set interfaces ae11 unit 0 description Test')
self.assertEqual(kwargs['action'], 'set')
self.assertEqual(kwargs['format'], 'text')
def test_junos_config_confirm(self):
src = load_fixture('junos_config.set', content='str')
set_module_args(dict(src=src, confirm=40))
self.execute_module(changed=True)
args, kwargs = self.commit_configuration.call_args
self.assertEqual(kwargs['confirm_timeout'], 40)
def test_junos_config_rollback(self):
rollback = 10
set_module_args(dict(rollback=rollback))
self.execute_module(changed=True)
self.assertEqual(self.get_diff.call_count, 1)
self.assertEqual(self.load_configuration.call_count, 1)
self.assertEqual(self.commit_configuration.call_count, 1)
load_configuration_args = self.load_configuration.call_args
self.assertEqual(rollback, load_configuration_args[1].get('rollback'))
def test_junos_config_src_text(self):
src = load_fixture('junos_config.text', content='str')
set_module_args(dict(src=src))
self.execute_module(changed=True)
args, kwargs = self.load_config.call_args
self.assertEqual(kwargs['action'], 'merge')
self.assertEqual(kwargs['format'], 'text')
def test_junos_config_src_xml(self):
src = load_fixture('junos_config.xml', content='str')
set_module_args(dict(src=src))
self.execute_module(changed=True)
args, kwargs = self.load_config.call_args
self.assertEqual(kwargs['action'], 'merge')
self.assertEqual(kwargs['format'], 'xml')
def test_junos_config_src_json(self):
src = load_fixture('junos_config.json', content='str')
set_module_args(dict(src=src))
self.execute_module(changed=True)
args, kwargs = self.load_config.call_args
self.assertEqual(kwargs['action'], 'merge')
self.assertEqual(kwargs['format'], 'json')
def test_junos_config_update_override(self):
src = load_fixture('junos_config.xml', content='str')
set_module_args(dict(src=src, update='override'))
self.execute_module()
args, kwargs = self.load_config.call_args
self.assertEqual(kwargs['action'], 'override')
self.assertEqual(kwargs['format'], 'xml')
def test_junos_config_update_replace(self):
src = load_fixture('junos_config.json', content='str')
set_module_args(dict(src=src, update='replace'))
self.execute_module()
args, kwargs = self.load_config.call_args
self.assertEqual(kwargs['action'], 'replace')
self.assertEqual(kwargs['format'], 'json')
def test_junos_config_zeroize(self):
src = load_fixture('junos_config.json', content='str')
set_module_args(dict(zeroize='yes'))
self.execute_module(changed=True)
self.assertEqual(self.exec_rpc.call_count, 1)
def test_junos_config_src_format_xml(self):
src = load_fixture('junos_config.json', content='str')
set_module_args(dict(src=src, src_format='xml'))
self.execute_module()
args, kwargs = self.load_config.call_args
self.assertEqual(kwargs['format'], 'xml')
def test_junos_config_confirm_commit(self):
set_module_args(dict(confirm_commit=True))
self.execute_module(changed=True)
self.assertEqual(self.commit_configuration.call_count, 1)
| gpl-3.0 |
AlexCaranha/Wox | PythonHome/Lib/site-packages/chardet/big5freq.py | 3133 | 82594 | ######################## BEGIN LICENSE BLOCK ########################
# The Original Code is Mozilla Communicator client code.
#
# The Initial Developer of the Original Code is
# Netscape Communications Corporation.
# Portions created by the Initial Developer are Copyright (C) 1998
# the Initial Developer. All Rights Reserved.
#
# Contributor(s):
# Mark Pilgrim - port to Python
#
# This library is free software; you can redistribute it and/or
# modify it under the terms of the GNU Lesser General Public
# License as published by the Free Software Foundation; either
# version 2.1 of the License, or (at your option) any later version.
#
# This library is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
# Lesser General Public License for more details.
#
# You should have received a copy of the GNU Lesser General Public
# License along with this library; if not, write to the Free Software
# Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA
# 02110-1301 USA
######################### END LICENSE BLOCK #########################
# Big5 frequency table
# by Taiwan's Mandarin Promotion Council
# <http://www.edu.tw:81/mandr/>
#
# 128 --> 0.42261
# 256 --> 0.57851
# 512 --> 0.74851
# 1024 --> 0.89384
# 2048 --> 0.97583
#
# Ideal Distribution Ratio = 0.74851/(1-0.74851) =2.98
# Random Distribution Ration = 512/(5401-512)=0.105
#
# Typical Distribution Ratio about 25% of Ideal one, still much higher than RDR
BIG5_TYPICAL_DISTRIBUTION_RATIO = 0.75
#Char to FreqOrder table
BIG5_TABLE_SIZE = 5376
Big5CharToFreqOrder = (
1,1801,1506, 255,1431, 198, 9, 82, 6,5008, 177, 202,3681,1256,2821, 110, # 16
3814, 33,3274, 261, 76, 44,2114, 16,2946,2187,1176, 659,3971, 26,3451,2653, # 32
1198,3972,3350,4202, 410,2215, 302, 590, 361,1964, 8, 204, 58,4510,5009,1932, # 48
63,5010,5011, 317,1614, 75, 222, 159,4203,2417,1480,5012,3555,3091, 224,2822, # 64
3682, 3, 10,3973,1471, 29,2787,1135,2866,1940, 873, 130,3275,1123, 312,5013, # 80
4511,2052, 507, 252, 682,5014, 142,1915, 124, 206,2947, 34,3556,3204, 64, 604, # 96
5015,2501,1977,1978, 155,1991, 645, 641,1606,5016,3452, 337, 72, 406,5017, 80, # 112
630, 238,3205,1509, 263, 939,1092,2654, 756,1440,1094,3453, 449, 69,2987, 591, # 128
179,2096, 471, 115,2035,1844, 60, 50,2988, 134, 806,1869, 734,2036,3454, 180, # 144
995,1607, 156, 537,2907, 688,5018, 319,1305, 779,2145, 514,2379, 298,4512, 359, # 160
2502, 90,2716,1338, 663, 11, 906,1099,2553, 20,2441, 182, 532,1716,5019, 732, # 176
1376,4204,1311,1420,3206, 25,2317,1056, 113, 399, 382,1950, 242,3455,2474, 529, # 192
3276, 475,1447,3683,5020, 117, 21, 656, 810,1297,2300,2334,3557,5021, 126,4205, # 208
706, 456, 150, 613,4513, 71,1118,2037,4206, 145,3092, 85, 835, 486,2115,1246, # 224
1426, 428, 727,1285,1015, 800, 106, 623, 303,1281,5022,2128,2359, 347,3815, 221, # 240
3558,3135,5023,1956,1153,4207, 83, 296,1199,3093, 192, 624, 93,5024, 822,1898, # 256
2823,3136, 795,2065, 991,1554,1542,1592, 27, 43,2867, 859, 139,1456, 860,4514, # 272
437, 712,3974, 164,2397,3137, 695, 211,3037,2097, 195,3975,1608,3559,3560,3684, # 288
3976, 234, 811,2989,2098,3977,2233,1441,3561,1615,2380, 668,2077,1638, 305, 228, # 304
1664,4515, 467, 415,5025, 262,2099,1593, 239, 108, 300, 200,1033, 512,1247,2078, # 320
5026,5027,2176,3207,3685,2682, 593, 845,1062,3277, 88,1723,2038,3978,1951, 212, # 336
266, 152, 149, 468,1899,4208,4516, 77, 187,5028,3038, 37, 5,2990,5029,3979, # 352
5030,5031, 39,2524,4517,2908,3208,2079, 55, 148, 74,4518, 545, 483,1474,1029, # 368
1665, 217,1870,1531,3138,1104,2655,4209, 24, 172,3562, 900,3980,3563,3564,4519, # 384
32,1408,2824,1312, 329, 487,2360,2251,2717, 784,2683, 4,3039,3351,1427,1789, # 400
188, 109, 499,5032,3686,1717,1790, 888,1217,3040,4520,5033,3565,5034,3352,1520, # 416
3687,3981, 196,1034, 775,5035,5036, 929,1816, 249, 439, 38,5037,1063,5038, 794, # 432
3982,1435,2301, 46, 178,3278,2066,5039,2381,5040, 214,1709,4521, 804, 35, 707, # 448
324,3688,1601,2554, 140, 459,4210,5041,5042,1365, 839, 272, 978,2262,2580,3456, # 464
2129,1363,3689,1423, 697, 100,3094, 48, 70,1231, 495,3139,2196,5043,1294,5044, # 480
2080, 462, 586,1042,3279, 853, 256, 988, 185,2382,3457,1698, 434,1084,5045,3458, # 496
314,2625,2788,4522,2335,2336, 569,2285, 637,1817,2525, 757,1162,1879,1616,3459, # 512
287,1577,2116, 768,4523,1671,2868,3566,2526,1321,3816, 909,2418,5046,4211, 933, # 528
3817,4212,2053,2361,1222,4524, 765,2419,1322, 786,4525,5047,1920,1462,1677,2909, # 544
1699,5048,4526,1424,2442,3140,3690,2600,3353,1775,1941,3460,3983,4213, 309,1369, # 560
1130,2825, 364,2234,1653,1299,3984,3567,3985,3986,2656, 525,1085,3041, 902,2001, # 576
1475, 964,4527, 421,1845,1415,1057,2286, 940,1364,3141, 376,4528,4529,1381, 7, # 592
2527, 983,2383, 336,1710,2684,1846, 321,3461, 559,1131,3042,2752,1809,1132,1313, # 608
265,1481,1858,5049, 352,1203,2826,3280, 167,1089, 420,2827, 776, 792,1724,3568, # 624
4214,2443,3281,5050,4215,5051, 446, 229, 333,2753, 901,3818,1200,1557,4530,2657, # 640
1921, 395,2754,2685,3819,4216,1836, 125, 916,3209,2626,4531,5052,5053,3820,5054, # 656
5055,5056,4532,3142,3691,1133,2555,1757,3462,1510,2318,1409,3569,5057,2146, 438, # 672
2601,2910,2384,3354,1068, 958,3043, 461, 311,2869,2686,4217,1916,3210,4218,1979, # 688
383, 750,2755,2627,4219, 274, 539, 385,1278,1442,5058,1154,1965, 384, 561, 210, # 704
98,1295,2556,3570,5059,1711,2420,1482,3463,3987,2911,1257, 129,5060,3821, 642, # 720
523,2789,2790,2658,5061, 141,2235,1333, 68, 176, 441, 876, 907,4220, 603,2602, # 736
710, 171,3464, 404, 549, 18,3143,2398,1410,3692,1666,5062,3571,4533,2912,4534, # 752
5063,2991, 368,5064, 146, 366, 99, 871,3693,1543, 748, 807,1586,1185, 22,2263, # 768
379,3822,3211,5065,3212, 505,1942,2628,1992,1382,2319,5066, 380,2362, 218, 702, # 784
1818,1248,3465,3044,3572,3355,3282,5067,2992,3694, 930,3283,3823,5068, 59,5069, # 800
585, 601,4221, 497,3466,1112,1314,4535,1802,5070,1223,1472,2177,5071, 749,1837, # 816
690,1900,3824,1773,3988,1476, 429,1043,1791,2236,2117, 917,4222, 447,1086,1629, # 832
5072, 556,5073,5074,2021,1654, 844,1090, 105, 550, 966,1758,2828,1008,1783, 686, # 848
1095,5075,2287, 793,1602,5076,3573,2603,4536,4223,2948,2302,4537,3825, 980,2503, # 864
544, 353, 527,4538, 908,2687,2913,5077, 381,2629,1943,1348,5078,1341,1252, 560, # 880
3095,5079,3467,2870,5080,2054, 973, 886,2081, 143,4539,5081,5082, 157,3989, 496, # 896
4224, 57, 840, 540,2039,4540,4541,3468,2118,1445, 970,2264,1748,1966,2082,4225, # 912
3144,1234,1776,3284,2829,3695, 773,1206,2130,1066,2040,1326,3990,1738,1725,4226, # 928
279,3145, 51,1544,2604, 423,1578,2131,2067, 173,4542,1880,5083,5084,1583, 264, # 944
610,3696,4543,2444, 280, 154,5085,5086,5087,1739, 338,1282,3096, 693,2871,1411, # 960
1074,3826,2445,5088,4544,5089,5090,1240, 952,2399,5091,2914,1538,2688, 685,1483, # 976
4227,2475,1436, 953,4228,2055,4545, 671,2400, 79,4229,2446,3285, 608, 567,2689, # 992
3469,4230,4231,1691, 393,1261,1792,2401,5092,4546,5093,5094,5095,5096,1383,1672, # 1008
3827,3213,1464, 522,1119, 661,1150, 216, 675,4547,3991,1432,3574, 609,4548,2690, # 1024
2402,5097,5098,5099,4232,3045, 0,5100,2476, 315, 231,2447, 301,3356,4549,2385, # 1040
5101, 233,4233,3697,1819,4550,4551,5102, 96,1777,1315,2083,5103, 257,5104,1810, # 1056
3698,2718,1139,1820,4234,2022,1124,2164,2791,1778,2659,5105,3097, 363,1655,3214, # 1072
5106,2993,5107,5108,5109,3992,1567,3993, 718, 103,3215, 849,1443, 341,3357,2949, # 1088
1484,5110,1712, 127, 67, 339,4235,2403, 679,1412, 821,5111,5112, 834, 738, 351, # 1104
2994,2147, 846, 235,1497,1881, 418,1993,3828,2719, 186,1100,2148,2756,3575,1545, # 1120
1355,2950,2872,1377, 583,3994,4236,2581,2995,5113,1298,3699,1078,2557,3700,2363, # 1136
78,3829,3830, 267,1289,2100,2002,1594,4237, 348, 369,1274,2197,2178,1838,4552, # 1152
1821,2830,3701,2757,2288,2003,4553,2951,2758, 144,3358, 882,4554,3995,2759,3470, # 1168
4555,2915,5114,4238,1726, 320,5115,3996,3046, 788,2996,5116,2831,1774,1327,2873, # 1184
3997,2832,5117,1306,4556,2004,1700,3831,3576,2364,2660, 787,2023, 506, 824,3702, # 1200
534, 323,4557,1044,3359,2024,1901, 946,3471,5118,1779,1500,1678,5119,1882,4558, # 1216
165, 243,4559,3703,2528, 123, 683,4239, 764,4560, 36,3998,1793, 589,2916, 816, # 1232
626,1667,3047,2237,1639,1555,1622,3832,3999,5120,4000,2874,1370,1228,1933, 891, # 1248
2084,2917, 304,4240,5121, 292,2997,2720,3577, 691,2101,4241,1115,4561, 118, 662, # 1264
5122, 611,1156, 854,2386,1316,2875, 2, 386, 515,2918,5123,5124,3286, 868,2238, # 1280
1486, 855,2661, 785,2216,3048,5125,1040,3216,3578,5126,3146, 448,5127,1525,5128, # 1296
2165,4562,5129,3833,5130,4242,2833,3579,3147, 503, 818,4001,3148,1568, 814, 676, # 1312
1444, 306,1749,5131,3834,1416,1030, 197,1428, 805,2834,1501,4563,5132,5133,5134, # 1328
1994,5135,4564,5136,5137,2198, 13,2792,3704,2998,3149,1229,1917,5138,3835,2132, # 1344
5139,4243,4565,2404,3580,5140,2217,1511,1727,1120,5141,5142, 646,3836,2448, 307, # 1360
5143,5144,1595,3217,5145,5146,5147,3705,1113,1356,4002,1465,2529,2530,5148, 519, # 1376
5149, 128,2133, 92,2289,1980,5150,4003,1512, 342,3150,2199,5151,2793,2218,1981, # 1392
3360,4244, 290,1656,1317, 789, 827,2365,5152,3837,4566, 562, 581,4004,5153, 401, # 1408
4567,2252, 94,4568,5154,1399,2794,5155,1463,2025,4569,3218,1944,5156, 828,1105, # 1424
4245,1262,1394,5157,4246, 605,4570,5158,1784,2876,5159,2835, 819,2102, 578,2200, # 1440
2952,5160,1502, 436,3287,4247,3288,2836,4005,2919,3472,3473,5161,2721,2320,5162, # 1456
5163,2337,2068, 23,4571, 193, 826,3838,2103, 699,1630,4248,3098, 390,1794,1064, # 1472
3581,5164,1579,3099,3100,1400,5165,4249,1839,1640,2877,5166,4572,4573, 137,4250, # 1488
598,3101,1967, 780, 104, 974,2953,5167, 278, 899, 253, 402, 572, 504, 493,1339, # 1504
5168,4006,1275,4574,2582,2558,5169,3706,3049,3102,2253, 565,1334,2722, 863, 41, # 1520
5170,5171,4575,5172,1657,2338, 19, 463,2760,4251, 606,5173,2999,3289,1087,2085, # 1536
1323,2662,3000,5174,1631,1623,1750,4252,2691,5175,2878, 791,2723,2663,2339, 232, # 1552
2421,5176,3001,1498,5177,2664,2630, 755,1366,3707,3290,3151,2026,1609, 119,1918, # 1568
3474, 862,1026,4253,5178,4007,3839,4576,4008,4577,2265,1952,2477,5179,1125, 817, # 1584
4254,4255,4009,1513,1766,2041,1487,4256,3050,3291,2837,3840,3152,5180,5181,1507, # 1600
5182,2692, 733, 40,1632,1106,2879, 345,4257, 841,2531, 230,4578,3002,1847,3292, # 1616
3475,5183,1263, 986,3476,5184, 735, 879, 254,1137, 857, 622,1300,1180,1388,1562, # 1632
4010,4011,2954, 967,2761,2665,1349, 592,2134,1692,3361,3003,1995,4258,1679,4012, # 1648
1902,2188,5185, 739,3708,2724,1296,1290,5186,4259,2201,2202,1922,1563,2605,2559, # 1664
1871,2762,3004,5187, 435,5188, 343,1108, 596, 17,1751,4579,2239,3477,3709,5189, # 1680
4580, 294,3582,2955,1693, 477, 979, 281,2042,3583, 643,2043,3710,2631,2795,2266, # 1696
1031,2340,2135,2303,3584,4581, 367,1249,2560,5190,3585,5191,4582,1283,3362,2005, # 1712
240,1762,3363,4583,4584, 836,1069,3153, 474,5192,2149,2532, 268,3586,5193,3219, # 1728
1521,1284,5194,1658,1546,4260,5195,3587,3588,5196,4261,3364,2693,1685,4262, 961, # 1744
1673,2632, 190,2006,2203,3841,4585,4586,5197, 570,2504,3711,1490,5198,4587,2633, # 1760
3293,1957,4588, 584,1514, 396,1045,1945,5199,4589,1968,2449,5200,5201,4590,4013, # 1776
619,5202,3154,3294, 215,2007,2796,2561,3220,4591,3221,4592, 763,4263,3842,4593, # 1792
5203,5204,1958,1767,2956,3365,3712,1174, 452,1477,4594,3366,3155,5205,2838,1253, # 1808
2387,2189,1091,2290,4264, 492,5206, 638,1169,1825,2136,1752,4014, 648, 926,1021, # 1824
1324,4595, 520,4596, 997, 847,1007, 892,4597,3843,2267,1872,3713,2405,1785,4598, # 1840
1953,2957,3103,3222,1728,4265,2044,3714,4599,2008,1701,3156,1551, 30,2268,4266, # 1856
5207,2027,4600,3589,5208, 501,5209,4267, 594,3478,2166,1822,3590,3479,3591,3223, # 1872
829,2839,4268,5210,1680,3157,1225,4269,5211,3295,4601,4270,3158,2341,5212,4602, # 1888
4271,5213,4015,4016,5214,1848,2388,2606,3367,5215,4603, 374,4017, 652,4272,4273, # 1904
375,1140, 798,5216,5217,5218,2366,4604,2269, 546,1659, 138,3051,2450,4605,5219, # 1920
2254, 612,1849, 910, 796,3844,1740,1371, 825,3845,3846,5220,2920,2562,5221, 692, # 1936
444,3052,2634, 801,4606,4274,5222,1491, 244,1053,3053,4275,4276, 340,5223,4018, # 1952
1041,3005, 293,1168, 87,1357,5224,1539, 959,5225,2240, 721, 694,4277,3847, 219, # 1968
1478, 644,1417,3368,2666,1413,1401,1335,1389,4019,5226,5227,3006,2367,3159,1826, # 1984
730,1515, 184,2840, 66,4607,5228,1660,2958, 246,3369, 378,1457, 226,3480, 975, # 2000
4020,2959,1264,3592, 674, 696,5229, 163,5230,1141,2422,2167, 713,3593,3370,4608, # 2016
4021,5231,5232,1186, 15,5233,1079,1070,5234,1522,3224,3594, 276,1050,2725, 758, # 2032
1126, 653,2960,3296,5235,2342, 889,3595,4022,3104,3007, 903,1250,4609,4023,3481, # 2048
3596,1342,1681,1718, 766,3297, 286, 89,2961,3715,5236,1713,5237,2607,3371,3008, # 2064
5238,2962,2219,3225,2880,5239,4610,2505,2533, 181, 387,1075,4024, 731,2190,3372, # 2080
5240,3298, 310, 313,3482,2304, 770,4278, 54,3054, 189,4611,3105,3848,4025,5241, # 2096
1230,1617,1850, 355,3597,4279,4612,3373, 111,4280,3716,1350,3160,3483,3055,4281, # 2112
2150,3299,3598,5242,2797,4026,4027,3009, 722,2009,5243,1071, 247,1207,2343,2478, # 2128
1378,4613,2010, 864,1437,1214,4614, 373,3849,1142,2220, 667,4615, 442,2763,2563, # 2144
3850,4028,1969,4282,3300,1840, 837, 170,1107, 934,1336,1883,5244,5245,2119,4283, # 2160
2841, 743,1569,5246,4616,4284, 582,2389,1418,3484,5247,1803,5248, 357,1395,1729, # 2176
3717,3301,2423,1564,2241,5249,3106,3851,1633,4617,1114,2086,4285,1532,5250, 482, # 2192
2451,4618,5251,5252,1492, 833,1466,5253,2726,3599,1641,2842,5254,1526,1272,3718, # 2208
4286,1686,1795, 416,2564,1903,1954,1804,5255,3852,2798,3853,1159,2321,5256,2881, # 2224
4619,1610,1584,3056,2424,2764, 443,3302,1163,3161,5257,5258,4029,5259,4287,2506, # 2240
3057,4620,4030,3162,2104,1647,3600,2011,1873,4288,5260,4289, 431,3485,5261, 250, # 2256
97, 81,4290,5262,1648,1851,1558, 160, 848,5263, 866, 740,1694,5264,2204,2843, # 2272
3226,4291,4621,3719,1687, 950,2479, 426, 469,3227,3720,3721,4031,5265,5266,1188, # 2288
424,1996, 861,3601,4292,3854,2205,2694, 168,1235,3602,4293,5267,2087,1674,4622, # 2304
3374,3303, 220,2565,1009,5268,3855, 670,3010, 332,1208, 717,5269,5270,3603,2452, # 2320
4032,3375,5271, 513,5272,1209,2882,3376,3163,4623,1080,5273,5274,5275,5276,2534, # 2336
3722,3604, 815,1587,4033,4034,5277,3605,3486,3856,1254,4624,1328,3058,1390,4035, # 2352
1741,4036,3857,4037,5278, 236,3858,2453,3304,5279,5280,3723,3859,1273,3860,4625, # 2368
5281, 308,5282,4626, 245,4627,1852,2480,1307,2583, 430, 715,2137,2454,5283, 270, # 2384
199,2883,4038,5284,3606,2727,1753, 761,1754, 725,1661,1841,4628,3487,3724,5285, # 2400
5286, 587, 14,3305, 227,2608, 326, 480,2270, 943,2765,3607, 291, 650,1884,5287, # 2416
1702,1226, 102,1547, 62,3488, 904,4629,3489,1164,4294,5288,5289,1224,1548,2766, # 2432
391, 498,1493,5290,1386,1419,5291,2056,1177,4630, 813, 880,1081,2368, 566,1145, # 2448
4631,2291,1001,1035,2566,2609,2242, 394,1286,5292,5293,2069,5294, 86,1494,1730, # 2464
4039, 491,1588, 745, 897,2963, 843,3377,4040,2767,2884,3306,1768, 998,2221,2070, # 2480
397,1827,1195,1970,3725,3011,3378, 284,5295,3861,2507,2138,2120,1904,5296,4041, # 2496
2151,4042,4295,1036,3490,1905, 114,2567,4296, 209,1527,5297,5298,2964,2844,2635, # 2512
2390,2728,3164, 812,2568,5299,3307,5300,1559, 737,1885,3726,1210, 885, 28,2695, # 2528
3608,3862,5301,4297,1004,1780,4632,5302, 346,1982,2222,2696,4633,3863,1742, 797, # 2544
1642,4043,1934,1072,1384,2152, 896,4044,3308,3727,3228,2885,3609,5303,2569,1959, # 2560
4634,2455,1786,5304,5305,5306,4045,4298,1005,1308,3728,4299,2729,4635,4636,1528, # 2576
2610, 161,1178,4300,1983, 987,4637,1101,4301, 631,4046,1157,3229,2425,1343,1241, # 2592
1016,2243,2570, 372, 877,2344,2508,1160, 555,1935, 911,4047,5307, 466,1170, 169, # 2608
1051,2921,2697,3729,2481,3012,1182,2012,2571,1251,2636,5308, 992,2345,3491,1540, # 2624
2730,1201,2071,2406,1997,2482,5309,4638, 528,1923,2191,1503,1874,1570,2369,3379, # 2640
3309,5310, 557,1073,5311,1828,3492,2088,2271,3165,3059,3107, 767,3108,2799,4639, # 2656
1006,4302,4640,2346,1267,2179,3730,3230, 778,4048,3231,2731,1597,2667,5312,4641, # 2672
5313,3493,5314,5315,5316,3310,2698,1433,3311, 131, 95,1504,4049, 723,4303,3166, # 2688
1842,3610,2768,2192,4050,2028,2105,3731,5317,3013,4051,1218,5318,3380,3232,4052, # 2704
4304,2584, 248,1634,3864, 912,5319,2845,3732,3060,3865, 654, 53,5320,3014,5321, # 2720
1688,4642, 777,3494,1032,4053,1425,5322, 191, 820,2121,2846, 971,4643, 931,3233, # 2736
135, 664, 783,3866,1998, 772,2922,1936,4054,3867,4644,2923,3234, 282,2732, 640, # 2752
1372,3495,1127, 922, 325,3381,5323,5324, 711,2045,5325,5326,4055,2223,2800,1937, # 2768
4056,3382,2224,2255,3868,2305,5327,4645,3869,1258,3312,4057,3235,2139,2965,4058, # 2784
4059,5328,2225, 258,3236,4646, 101,1227,5329,3313,1755,5330,1391,3314,5331,2924, # 2800
2057, 893,5332,5333,5334,1402,4305,2347,5335,5336,3237,3611,5337,5338, 878,1325, # 2816
1781,2801,4647, 259,1385,2585, 744,1183,2272,4648,5339,4060,2509,5340, 684,1024, # 2832
4306,5341, 472,3612,3496,1165,3315,4061,4062, 322,2153, 881, 455,1695,1152,1340, # 2848
660, 554,2154,4649,1058,4650,4307, 830,1065,3383,4063,4651,1924,5342,1703,1919, # 2864
5343, 932,2273, 122,5344,4652, 947, 677,5345,3870,2637, 297,1906,1925,2274,4653, # 2880
2322,3316,5346,5347,4308,5348,4309, 84,4310, 112, 989,5349, 547,1059,4064, 701, # 2896
3613,1019,5350,4311,5351,3497, 942, 639, 457,2306,2456, 993,2966, 407, 851, 494, # 2912
4654,3384, 927,5352,1237,5353,2426,3385, 573,4312, 680, 921,2925,1279,1875, 285, # 2928
790,1448,1984, 719,2168,5354,5355,4655,4065,4066,1649,5356,1541, 563,5357,1077, # 2944
5358,3386,3061,3498, 511,3015,4067,4068,3733,4069,1268,2572,3387,3238,4656,4657, # 2960
5359, 535,1048,1276,1189,2926,2029,3167,1438,1373,2847,2967,1134,2013,5360,4313, # 2976
1238,2586,3109,1259,5361, 700,5362,2968,3168,3734,4314,5363,4315,1146,1876,1907, # 2992
4658,2611,4070, 781,2427, 132,1589, 203, 147, 273,2802,2407, 898,1787,2155,4071, # 3008
4072,5364,3871,2803,5365,5366,4659,4660,5367,3239,5368,1635,3872, 965,5369,1805, # 3024
2699,1516,3614,1121,1082,1329,3317,4073,1449,3873, 65,1128,2848,2927,2769,1590, # 3040
3874,5370,5371, 12,2668, 45, 976,2587,3169,4661, 517,2535,1013,1037,3240,5372, # 3056
3875,2849,5373,3876,5374,3499,5375,2612, 614,1999,2323,3877,3110,2733,2638,5376, # 3072
2588,4316, 599,1269,5377,1811,3735,5378,2700,3111, 759,1060, 489,1806,3388,3318, # 3088
1358,5379,5380,2391,1387,1215,2639,2256, 490,5381,5382,4317,1759,2392,2348,5383, # 3104
4662,3878,1908,4074,2640,1807,3241,4663,3500,3319,2770,2349, 874,5384,5385,3501, # 3120
3736,1859, 91,2928,3737,3062,3879,4664,5386,3170,4075,2669,5387,3502,1202,1403, # 3136
3880,2969,2536,1517,2510,4665,3503,2511,5388,4666,5389,2701,1886,1495,1731,4076, # 3152
2370,4667,5390,2030,5391,5392,4077,2702,1216, 237,2589,4318,2324,4078,3881,4668, # 3168
4669,2703,3615,3504, 445,4670,5393,5394,5395,5396,2771, 61,4079,3738,1823,4080, # 3184
5397, 687,2046, 935, 925, 405,2670, 703,1096,1860,2734,4671,4081,1877,1367,2704, # 3200
3389, 918,2106,1782,2483, 334,3320,1611,1093,4672, 564,3171,3505,3739,3390, 945, # 3216
2641,2058,4673,5398,1926, 872,4319,5399,3506,2705,3112, 349,4320,3740,4082,4674, # 3232
3882,4321,3741,2156,4083,4675,4676,4322,4677,2408,2047, 782,4084, 400, 251,4323, # 3248
1624,5400,5401, 277,3742, 299,1265, 476,1191,3883,2122,4324,4325,1109, 205,5402, # 3264
2590,1000,2157,3616,1861,5403,5404,5405,4678,5406,4679,2573, 107,2484,2158,4085, # 3280
3507,3172,5407,1533, 541,1301, 158, 753,4326,2886,3617,5408,1696, 370,1088,4327, # 3296
4680,3618, 579, 327, 440, 162,2244, 269,1938,1374,3508, 968,3063, 56,1396,3113, # 3312
2107,3321,3391,5409,1927,2159,4681,3016,5410,3619,5411,5412,3743,4682,2485,5413, # 3328
2804,5414,1650,4683,5415,2613,5416,5417,4086,2671,3392,1149,3393,4087,3884,4088, # 3344
5418,1076, 49,5419, 951,3242,3322,3323, 450,2850, 920,5420,1812,2805,2371,4328, # 3360
1909,1138,2372,3885,3509,5421,3243,4684,1910,1147,1518,2428,4685,3886,5422,4686, # 3376
2393,2614, 260,1796,3244,5423,5424,3887,3324, 708,5425,3620,1704,5426,3621,1351, # 3392
1618,3394,3017,1887, 944,4329,3395,4330,3064,3396,4331,5427,3744, 422, 413,1714, # 3408
3325, 500,2059,2350,4332,2486,5428,1344,1911, 954,5429,1668,5430,5431,4089,2409, # 3424
4333,3622,3888,4334,5432,2307,1318,2512,3114, 133,3115,2887,4687, 629, 31,2851, # 3440
2706,3889,4688, 850, 949,4689,4090,2970,1732,2089,4335,1496,1853,5433,4091, 620, # 3456
3245, 981,1242,3745,3397,1619,3746,1643,3326,2140,2457,1971,1719,3510,2169,5434, # 3472
3246,5435,5436,3398,1829,5437,1277,4690,1565,2048,5438,1636,3623,3116,5439, 869, # 3488
2852, 655,3890,3891,3117,4092,3018,3892,1310,3624,4691,5440,5441,5442,1733, 558, # 3504
4692,3747, 335,1549,3065,1756,4336,3748,1946,3511,1830,1291,1192, 470,2735,2108, # 3520
2806, 913,1054,4093,5443,1027,5444,3066,4094,4693, 982,2672,3399,3173,3512,3247, # 3536
3248,1947,2807,5445, 571,4694,5446,1831,5447,3625,2591,1523,2429,5448,2090, 984, # 3552
4695,3749,1960,5449,3750, 852, 923,2808,3513,3751, 969,1519, 999,2049,2325,1705, # 3568
5450,3118, 615,1662, 151, 597,4095,2410,2326,1049, 275,4696,3752,4337, 568,3753, # 3584
3626,2487,4338,3754,5451,2430,2275, 409,3249,5452,1566,2888,3514,1002, 769,2853, # 3600
194,2091,3174,3755,2226,3327,4339, 628,1505,5453,5454,1763,2180,3019,4096, 521, # 3616
1161,2592,1788,2206,2411,4697,4097,1625,4340,4341, 412, 42,3119, 464,5455,2642, # 3632
4698,3400,1760,1571,2889,3515,2537,1219,2207,3893,2643,2141,2373,4699,4700,3328, # 3648
1651,3401,3627,5456,5457,3628,2488,3516,5458,3756,5459,5460,2276,2092, 460,5461, # 3664
4701,5462,3020, 962, 588,3629, 289,3250,2644,1116, 52,5463,3067,1797,5464,5465, # 3680
5466,1467,5467,1598,1143,3757,4342,1985,1734,1067,4702,1280,3402, 465,4703,1572, # 3696
510,5468,1928,2245,1813,1644,3630,5469,4704,3758,5470,5471,2673,1573,1534,5472, # 3712
5473, 536,1808,1761,3517,3894,3175,2645,5474,5475,5476,4705,3518,2929,1912,2809, # 3728
5477,3329,1122, 377,3251,5478, 360,5479,5480,4343,1529, 551,5481,2060,3759,1769, # 3744
2431,5482,2930,4344,3330,3120,2327,2109,2031,4706,1404, 136,1468,1479, 672,1171, # 3760
3252,2308, 271,3176,5483,2772,5484,2050, 678,2736, 865,1948,4707,5485,2014,4098, # 3776
2971,5486,2737,2227,1397,3068,3760,4708,4709,1735,2931,3403,3631,5487,3895, 509, # 3792
2854,2458,2890,3896,5488,5489,3177,3178,4710,4345,2538,4711,2309,1166,1010, 552, # 3808
681,1888,5490,5491,2972,2973,4099,1287,1596,1862,3179, 358, 453, 736, 175, 478, # 3824
1117, 905,1167,1097,5492,1854,1530,5493,1706,5494,2181,3519,2292,3761,3520,3632, # 3840
4346,2093,4347,5495,3404,1193,2489,4348,1458,2193,2208,1863,1889,1421,3331,2932, # 3856
3069,2182,3521, 595,2123,5496,4100,5497,5498,4349,1707,2646, 223,3762,1359, 751, # 3872
3121, 183,3522,5499,2810,3021, 419,2374, 633, 704,3897,2394, 241,5500,5501,5502, # 3888
838,3022,3763,2277,2773,2459,3898,1939,2051,4101,1309,3122,2246,1181,5503,1136, # 3904
2209,3899,2375,1446,4350,2310,4712,5504,5505,4351,1055,2615, 484,3764,5506,4102, # 3920
625,4352,2278,3405,1499,4353,4103,5507,4104,4354,3253,2279,2280,3523,5508,5509, # 3936
2774, 808,2616,3765,3406,4105,4355,3123,2539, 526,3407,3900,4356, 955,5510,1620, # 3952
4357,2647,2432,5511,1429,3766,1669,1832, 994, 928,5512,3633,1260,5513,5514,5515, # 3968
1949,2293, 741,2933,1626,4358,2738,2460, 867,1184, 362,3408,1392,5516,5517,4106, # 3984
4359,1770,1736,3254,2934,4713,4714,1929,2707,1459,1158,5518,3070,3409,2891,1292, # 4000
1930,2513,2855,3767,1986,1187,2072,2015,2617,4360,5519,2574,2514,2170,3768,2490, # 4016
3332,5520,3769,4715,5521,5522, 666,1003,3023,1022,3634,4361,5523,4716,1814,2257, # 4032
574,3901,1603, 295,1535, 705,3902,4362, 283, 858, 417,5524,5525,3255,4717,4718, # 4048
3071,1220,1890,1046,2281,2461,4107,1393,1599, 689,2575, 388,4363,5526,2491, 802, # 4064
5527,2811,3903,2061,1405,2258,5528,4719,3904,2110,1052,1345,3256,1585,5529, 809, # 4080
5530,5531,5532, 575,2739,3524, 956,1552,1469,1144,2328,5533,2329,1560,2462,3635, # 4096
3257,4108, 616,2210,4364,3180,2183,2294,5534,1833,5535,3525,4720,5536,1319,3770, # 4112
3771,1211,3636,1023,3258,1293,2812,5537,5538,5539,3905, 607,2311,3906, 762,2892, # 4128
1439,4365,1360,4721,1485,3072,5540,4722,1038,4366,1450,2062,2648,4367,1379,4723, # 4144
2593,5541,5542,4368,1352,1414,2330,2935,1172,5543,5544,3907,3908,4724,1798,1451, # 4160
5545,5546,5547,5548,2936,4109,4110,2492,2351, 411,4111,4112,3637,3333,3124,4725, # 4176
1561,2674,1452,4113,1375,5549,5550, 47,2974, 316,5551,1406,1591,2937,3181,5552, # 4192
1025,2142,3125,3182, 354,2740, 884,2228,4369,2412, 508,3772, 726,3638, 996,2433, # 4208
3639, 729,5553, 392,2194,1453,4114,4726,3773,5554,5555,2463,3640,2618,1675,2813, # 4224
919,2352,2975,2353,1270,4727,4115, 73,5556,5557, 647,5558,3259,2856,2259,1550, # 4240
1346,3024,5559,1332, 883,3526,5560,5561,5562,5563,3334,2775,5564,1212, 831,1347, # 4256
4370,4728,2331,3909,1864,3073, 720,3910,4729,4730,3911,5565,4371,5566,5567,4731, # 4272
5568,5569,1799,4732,3774,2619,4733,3641,1645,2376,4734,5570,2938, 669,2211,2675, # 4288
2434,5571,2893,5572,5573,1028,3260,5574,4372,2413,5575,2260,1353,5576,5577,4735, # 4304
3183, 518,5578,4116,5579,4373,1961,5580,2143,4374,5581,5582,3025,2354,2355,3912, # 4320
516,1834,1454,4117,2708,4375,4736,2229,2620,1972,1129,3642,5583,2776,5584,2976, # 4336
1422, 577,1470,3026,1524,3410,5585,5586, 432,4376,3074,3527,5587,2594,1455,2515, # 4352
2230,1973,1175,5588,1020,2741,4118,3528,4737,5589,2742,5590,1743,1361,3075,3529, # 4368
2649,4119,4377,4738,2295, 895, 924,4378,2171, 331,2247,3076, 166,1627,3077,1098, # 4384
5591,1232,2894,2231,3411,4739, 657, 403,1196,2377, 542,3775,3412,1600,4379,3530, # 4400
5592,4740,2777,3261, 576, 530,1362,4741,4742,2540,2676,3776,4120,5593, 842,3913, # 4416
5594,2814,2032,1014,4121, 213,2709,3413, 665, 621,4380,5595,3777,2939,2435,5596, # 4432
2436,3335,3643,3414,4743,4381,2541,4382,4744,3644,1682,4383,3531,1380,5597, 724, # 4448
2282, 600,1670,5598,1337,1233,4745,3126,2248,5599,1621,4746,5600, 651,4384,5601, # 4464
1612,4385,2621,5602,2857,5603,2743,2312,3078,5604, 716,2464,3079, 174,1255,2710, # 4480
4122,3645, 548,1320,1398, 728,4123,1574,5605,1891,1197,3080,4124,5606,3081,3082, # 4496
3778,3646,3779, 747,5607, 635,4386,4747,5608,5609,5610,4387,5611,5612,4748,5613, # 4512
3415,4749,2437, 451,5614,3780,2542,2073,4388,2744,4389,4125,5615,1764,4750,5616, # 4528
4390, 350,4751,2283,2395,2493,5617,4391,4126,2249,1434,4127, 488,4752, 458,4392, # 4544
4128,3781, 771,1330,2396,3914,2576,3184,2160,2414,1553,2677,3185,4393,5618,2494, # 4560
2895,2622,1720,2711,4394,3416,4753,5619,2543,4395,5620,3262,4396,2778,5621,2016, # 4576
2745,5622,1155,1017,3782,3915,5623,3336,2313, 201,1865,4397,1430,5624,4129,5625, # 4592
5626,5627,5628,5629,4398,1604,5630, 414,1866, 371,2595,4754,4755,3532,2017,3127, # 4608
4756,1708, 960,4399, 887, 389,2172,1536,1663,1721,5631,2232,4130,2356,2940,1580, # 4624
5632,5633,1744,4757,2544,4758,4759,5634,4760,5635,2074,5636,4761,3647,3417,2896, # 4640
4400,5637,4401,2650,3418,2815, 673,2712,2465, 709,3533,4131,3648,4402,5638,1148, # 4656
502, 634,5639,5640,1204,4762,3649,1575,4763,2623,3783,5641,3784,3128, 948,3263, # 4672
121,1745,3916,1110,5642,4403,3083,2516,3027,4132,3785,1151,1771,3917,1488,4133, # 4688
1987,5643,2438,3534,5644,5645,2094,5646,4404,3918,1213,1407,2816, 531,2746,2545, # 4704
3264,1011,1537,4764,2779,4405,3129,1061,5647,3786,3787,1867,2897,5648,2018, 120, # 4720
4406,4407,2063,3650,3265,2314,3919,2678,3419,1955,4765,4134,5649,3535,1047,2713, # 4736
1266,5650,1368,4766,2858, 649,3420,3920,2546,2747,1102,2859,2679,5651,5652,2000, # 4752
5653,1111,3651,2977,5654,2495,3921,3652,2817,1855,3421,3788,5655,5656,3422,2415, # 4768
2898,3337,3266,3653,5657,2577,5658,3654,2818,4135,1460, 856,5659,3655,5660,2899, # 4784
2978,5661,2900,3922,5662,4408, 632,2517, 875,3923,1697,3924,2296,5663,5664,4767, # 4800
3028,1239, 580,4768,4409,5665, 914, 936,2075,1190,4136,1039,2124,5666,5667,5668, # 4816
5669,3423,1473,5670,1354,4410,3925,4769,2173,3084,4137, 915,3338,4411,4412,3339, # 4832
1605,1835,5671,2748, 398,3656,4413,3926,4138, 328,1913,2860,4139,3927,1331,4414, # 4848
3029, 937,4415,5672,3657,4140,4141,3424,2161,4770,3425, 524, 742, 538,3085,1012, # 4864
5673,5674,3928,2466,5675, 658,1103, 225,3929,5676,5677,4771,5678,4772,5679,3267, # 4880
1243,5680,4142, 963,2250,4773,5681,2714,3658,3186,5682,5683,2596,2332,5684,4774, # 4896
5685,5686,5687,3536, 957,3426,2547,2033,1931,2941,2467, 870,2019,3659,1746,2780, # 4912
2781,2439,2468,5688,3930,5689,3789,3130,3790,3537,3427,3791,5690,1179,3086,5691, # 4928
3187,2378,4416,3792,2548,3188,3131,2749,4143,5692,3428,1556,2549,2297, 977,2901, # 4944
2034,4144,1205,3429,5693,1765,3430,3189,2125,1271, 714,1689,4775,3538,5694,2333, # 4960
3931, 533,4417,3660,2184, 617,5695,2469,3340,3539,2315,5696,5697,3190,5698,5699, # 4976
3932,1988, 618, 427,2651,3540,3431,5700,5701,1244,1690,5702,2819,4418,4776,5703, # 4992
3541,4777,5704,2284,1576, 473,3661,4419,3432, 972,5705,3662,5706,3087,5707,5708, # 5008
4778,4779,5709,3793,4145,4146,5710, 153,4780, 356,5711,1892,2902,4420,2144, 408, # 5024
803,2357,5712,3933,5713,4421,1646,2578,2518,4781,4782,3934,5714,3935,4422,5715, # 5040
2416,3433, 752,5716,5717,1962,3341,2979,5718, 746,3030,2470,4783,4423,3794, 698, # 5056
4784,1893,4424,3663,2550,4785,3664,3936,5719,3191,3434,5720,1824,1302,4147,2715, # 5072
3937,1974,4425,5721,4426,3192, 823,1303,1288,1236,2861,3542,4148,3435, 774,3938, # 5088
5722,1581,4786,1304,2862,3939,4787,5723,2440,2162,1083,3268,4427,4149,4428, 344, # 5104
1173, 288,2316, 454,1683,5724,5725,1461,4788,4150,2597,5726,5727,4789, 985, 894, # 5120
5728,3436,3193,5729,1914,2942,3795,1989,5730,2111,1975,5731,4151,5732,2579,1194, # 5136
425,5733,4790,3194,1245,3796,4429,5734,5735,2863,5736, 636,4791,1856,3940, 760, # 5152
1800,5737,4430,2212,1508,4792,4152,1894,1684,2298,5738,5739,4793,4431,4432,2213, # 5168
479,5740,5741, 832,5742,4153,2496,5743,2980,2497,3797, 990,3132, 627,1815,2652, # 5184
4433,1582,4434,2126,2112,3543,4794,5744, 799,4435,3195,5745,4795,2113,1737,3031, # 5200
1018, 543, 754,4436,3342,1676,4796,4797,4154,4798,1489,5746,3544,5747,2624,2903, # 5216
4155,5748,5749,2981,5750,5751,5752,5753,3196,4799,4800,2185,1722,5754,3269,3270, # 5232
1843,3665,1715, 481, 365,1976,1857,5755,5756,1963,2498,4801,5757,2127,3666,3271, # 5248
433,1895,2064,2076,5758, 602,2750,5759,5760,5761,5762,5763,3032,1628,3437,5764, # 5264
3197,4802,4156,2904,4803,2519,5765,2551,2782,5766,5767,5768,3343,4804,2905,5769, # 5280
4805,5770,2864,4806,4807,1221,2982,4157,2520,5771,5772,5773,1868,1990,5774,5775, # 5296
5776,1896,5777,5778,4808,1897,4158, 318,5779,2095,4159,4437,5780,5781, 485,5782, # 5312
938,3941, 553,2680, 116,5783,3942,3667,5784,3545,2681,2783,3438,3344,2820,5785, # 5328
3668,2943,4160,1747,2944,2983,5786,5787, 207,5788,4809,5789,4810,2521,5790,3033, # 5344
890,3669,3943,5791,1878,3798,3439,5792,2186,2358,3440,1652,5793,5794,5795, 941, # 5360
2299, 208,3546,4161,2020, 330,4438,3944,2906,2499,3799,4439,4811,5796,5797,5798, # 5376 #last 512
#Everything below is of no interest for detection purpose
2522,1613,4812,5799,3345,3945,2523,5800,4162,5801,1637,4163,2471,4813,3946,5802, # 5392
2500,3034,3800,5803,5804,2195,4814,5805,2163,5806,5807,5808,5809,5810,5811,5812, # 5408
5813,5814,5815,5816,5817,5818,5819,5820,5821,5822,5823,5824,5825,5826,5827,5828, # 5424
5829,5830,5831,5832,5833,5834,5835,5836,5837,5838,5839,5840,5841,5842,5843,5844, # 5440
5845,5846,5847,5848,5849,5850,5851,5852,5853,5854,5855,5856,5857,5858,5859,5860, # 5456
5861,5862,5863,5864,5865,5866,5867,5868,5869,5870,5871,5872,5873,5874,5875,5876, # 5472
5877,5878,5879,5880,5881,5882,5883,5884,5885,5886,5887,5888,5889,5890,5891,5892, # 5488
5893,5894,5895,5896,5897,5898,5899,5900,5901,5902,5903,5904,5905,5906,5907,5908, # 5504
5909,5910,5911,5912,5913,5914,5915,5916,5917,5918,5919,5920,5921,5922,5923,5924, # 5520
5925,5926,5927,5928,5929,5930,5931,5932,5933,5934,5935,5936,5937,5938,5939,5940, # 5536
5941,5942,5943,5944,5945,5946,5947,5948,5949,5950,5951,5952,5953,5954,5955,5956, # 5552
5957,5958,5959,5960,5961,5962,5963,5964,5965,5966,5967,5968,5969,5970,5971,5972, # 5568
5973,5974,5975,5976,5977,5978,5979,5980,5981,5982,5983,5984,5985,5986,5987,5988, # 5584
5989,5990,5991,5992,5993,5994,5995,5996,5997,5998,5999,6000,6001,6002,6003,6004, # 5600
6005,6006,6007,6008,6009,6010,6011,6012,6013,6014,6015,6016,6017,6018,6019,6020, # 5616
6021,6022,6023,6024,6025,6026,6027,6028,6029,6030,6031,6032,6033,6034,6035,6036, # 5632
6037,6038,6039,6040,6041,6042,6043,6044,6045,6046,6047,6048,6049,6050,6051,6052, # 5648
6053,6054,6055,6056,6057,6058,6059,6060,6061,6062,6063,6064,6065,6066,6067,6068, # 5664
6069,6070,6071,6072,6073,6074,6075,6076,6077,6078,6079,6080,6081,6082,6083,6084, # 5680
6085,6086,6087,6088,6089,6090,6091,6092,6093,6094,6095,6096,6097,6098,6099,6100, # 5696
6101,6102,6103,6104,6105,6106,6107,6108,6109,6110,6111,6112,6113,6114,6115,6116, # 5712
6117,6118,6119,6120,6121,6122,6123,6124,6125,6126,6127,6128,6129,6130,6131,6132, # 5728
6133,6134,6135,6136,6137,6138,6139,6140,6141,6142,6143,6144,6145,6146,6147,6148, # 5744
6149,6150,6151,6152,6153,6154,6155,6156,6157,6158,6159,6160,6161,6162,6163,6164, # 5760
6165,6166,6167,6168,6169,6170,6171,6172,6173,6174,6175,6176,6177,6178,6179,6180, # 5776
6181,6182,6183,6184,6185,6186,6187,6188,6189,6190,6191,6192,6193,6194,6195,6196, # 5792
6197,6198,6199,6200,6201,6202,6203,6204,6205,6206,6207,6208,6209,6210,6211,6212, # 5808
6213,6214,6215,6216,6217,6218,6219,6220,6221,6222,6223,3670,6224,6225,6226,6227, # 5824
6228,6229,6230,6231,6232,6233,6234,6235,6236,6237,6238,6239,6240,6241,6242,6243, # 5840
6244,6245,6246,6247,6248,6249,6250,6251,6252,6253,6254,6255,6256,6257,6258,6259, # 5856
6260,6261,6262,6263,6264,6265,6266,6267,6268,6269,6270,6271,6272,6273,6274,6275, # 5872
6276,6277,6278,6279,6280,6281,6282,6283,6284,6285,4815,6286,6287,6288,6289,6290, # 5888
6291,6292,4816,6293,6294,6295,6296,6297,6298,6299,6300,6301,6302,6303,6304,6305, # 5904
6306,6307,6308,6309,6310,6311,4817,4818,6312,6313,6314,6315,6316,6317,6318,4819, # 5920
6319,6320,6321,6322,6323,6324,6325,6326,6327,6328,6329,6330,6331,6332,6333,6334, # 5936
6335,6336,6337,4820,6338,6339,6340,6341,6342,6343,6344,6345,6346,6347,6348,6349, # 5952
6350,6351,6352,6353,6354,6355,6356,6357,6358,6359,6360,6361,6362,6363,6364,6365, # 5968
6366,6367,6368,6369,6370,6371,6372,6373,6374,6375,6376,6377,6378,6379,6380,6381, # 5984
6382,6383,6384,6385,6386,6387,6388,6389,6390,6391,6392,6393,6394,6395,6396,6397, # 6000
6398,6399,6400,6401,6402,6403,6404,6405,6406,6407,6408,6409,6410,3441,6411,6412, # 6016
6413,6414,6415,6416,6417,6418,6419,6420,6421,6422,6423,6424,6425,4440,6426,6427, # 6032
6428,6429,6430,6431,6432,6433,6434,6435,6436,6437,6438,6439,6440,6441,6442,6443, # 6048
6444,6445,6446,6447,6448,6449,6450,6451,6452,6453,6454,4821,6455,6456,6457,6458, # 6064
6459,6460,6461,6462,6463,6464,6465,6466,6467,6468,6469,6470,6471,6472,6473,6474, # 6080
6475,6476,6477,3947,3948,6478,6479,6480,6481,3272,4441,6482,6483,6484,6485,4442, # 6096
6486,6487,6488,6489,6490,6491,6492,6493,6494,6495,6496,4822,6497,6498,6499,6500, # 6112
6501,6502,6503,6504,6505,6506,6507,6508,6509,6510,6511,6512,6513,6514,6515,6516, # 6128
6517,6518,6519,6520,6521,6522,6523,6524,6525,6526,6527,6528,6529,6530,6531,6532, # 6144
6533,6534,6535,6536,6537,6538,6539,6540,6541,6542,6543,6544,6545,6546,6547,6548, # 6160
6549,6550,6551,6552,6553,6554,6555,6556,2784,6557,4823,6558,6559,6560,6561,6562, # 6176
6563,6564,6565,6566,6567,6568,6569,3949,6570,6571,6572,4824,6573,6574,6575,6576, # 6192
6577,6578,6579,6580,6581,6582,6583,4825,6584,6585,6586,3950,2785,6587,6588,6589, # 6208
6590,6591,6592,6593,6594,6595,6596,6597,6598,6599,6600,6601,6602,6603,6604,6605, # 6224
6606,6607,6608,6609,6610,6611,6612,4826,6613,6614,6615,4827,6616,6617,6618,6619, # 6240
6620,6621,6622,6623,6624,6625,4164,6626,6627,6628,6629,6630,6631,6632,6633,6634, # 6256
3547,6635,4828,6636,6637,6638,6639,6640,6641,6642,3951,2984,6643,6644,6645,6646, # 6272
6647,6648,6649,4165,6650,4829,6651,6652,4830,6653,6654,6655,6656,6657,6658,6659, # 6288
6660,6661,6662,4831,6663,6664,6665,6666,6667,6668,6669,6670,6671,4166,6672,4832, # 6304
3952,6673,6674,6675,6676,4833,6677,6678,6679,4167,6680,6681,6682,3198,6683,6684, # 6320
6685,6686,6687,6688,6689,6690,6691,6692,6693,6694,6695,6696,6697,4834,6698,6699, # 6336
6700,6701,6702,6703,6704,6705,6706,6707,6708,6709,6710,6711,6712,6713,6714,6715, # 6352
6716,6717,6718,6719,6720,6721,6722,6723,6724,6725,6726,6727,6728,6729,6730,6731, # 6368
6732,6733,6734,4443,6735,6736,6737,6738,6739,6740,6741,6742,6743,6744,6745,4444, # 6384
6746,6747,6748,6749,6750,6751,6752,6753,6754,6755,6756,6757,6758,6759,6760,6761, # 6400
6762,6763,6764,6765,6766,6767,6768,6769,6770,6771,6772,6773,6774,6775,6776,6777, # 6416
6778,6779,6780,6781,4168,6782,6783,3442,6784,6785,6786,6787,6788,6789,6790,6791, # 6432
4169,6792,6793,6794,6795,6796,6797,6798,6799,6800,6801,6802,6803,6804,6805,6806, # 6448
6807,6808,6809,6810,6811,4835,6812,6813,6814,4445,6815,6816,4446,6817,6818,6819, # 6464
6820,6821,6822,6823,6824,6825,6826,6827,6828,6829,6830,6831,6832,6833,6834,6835, # 6480
3548,6836,6837,6838,6839,6840,6841,6842,6843,6844,6845,6846,4836,6847,6848,6849, # 6496
6850,6851,6852,6853,6854,3953,6855,6856,6857,6858,6859,6860,6861,6862,6863,6864, # 6512
6865,6866,6867,6868,6869,6870,6871,6872,6873,6874,6875,6876,6877,3199,6878,6879, # 6528
6880,6881,6882,4447,6883,6884,6885,6886,6887,6888,6889,6890,6891,6892,6893,6894, # 6544
6895,6896,6897,6898,6899,6900,6901,6902,6903,6904,4170,6905,6906,6907,6908,6909, # 6560
6910,6911,6912,6913,6914,6915,6916,6917,6918,6919,6920,6921,6922,6923,6924,6925, # 6576
6926,6927,4837,6928,6929,6930,6931,6932,6933,6934,6935,6936,3346,6937,6938,4838, # 6592
6939,6940,6941,4448,6942,6943,6944,6945,6946,4449,6947,6948,6949,6950,6951,6952, # 6608
6953,6954,6955,6956,6957,6958,6959,6960,6961,6962,6963,6964,6965,6966,6967,6968, # 6624
6969,6970,6971,6972,6973,6974,6975,6976,6977,6978,6979,6980,6981,6982,6983,6984, # 6640
6985,6986,6987,6988,6989,6990,6991,6992,6993,6994,3671,6995,6996,6997,6998,4839, # 6656
6999,7000,7001,7002,3549,7003,7004,7005,7006,7007,7008,7009,7010,7011,7012,7013, # 6672
7014,7015,7016,7017,7018,7019,7020,7021,7022,7023,7024,7025,7026,7027,7028,7029, # 6688
7030,4840,7031,7032,7033,7034,7035,7036,7037,7038,4841,7039,7040,7041,7042,7043, # 6704
7044,7045,7046,7047,7048,7049,7050,7051,7052,7053,7054,7055,7056,7057,7058,7059, # 6720
7060,7061,7062,7063,7064,7065,7066,7067,7068,7069,7070,2985,7071,7072,7073,7074, # 6736
7075,7076,7077,7078,7079,7080,4842,7081,7082,7083,7084,7085,7086,7087,7088,7089, # 6752
7090,7091,7092,7093,7094,7095,7096,7097,7098,7099,7100,7101,7102,7103,7104,7105, # 6768
7106,7107,7108,7109,7110,7111,7112,7113,7114,7115,7116,7117,7118,4450,7119,7120, # 6784
7121,7122,7123,7124,7125,7126,7127,7128,7129,7130,7131,7132,7133,7134,7135,7136, # 6800
7137,7138,7139,7140,7141,7142,7143,4843,7144,7145,7146,7147,7148,7149,7150,7151, # 6816
7152,7153,7154,7155,7156,7157,7158,7159,7160,7161,7162,7163,7164,7165,7166,7167, # 6832
7168,7169,7170,7171,7172,7173,7174,7175,7176,7177,7178,7179,7180,7181,7182,7183, # 6848
7184,7185,7186,7187,7188,4171,4172,7189,7190,7191,7192,7193,7194,7195,7196,7197, # 6864
7198,7199,7200,7201,7202,7203,7204,7205,7206,7207,7208,7209,7210,7211,7212,7213, # 6880
7214,7215,7216,7217,7218,7219,7220,7221,7222,7223,7224,7225,7226,7227,7228,7229, # 6896
7230,7231,7232,7233,7234,7235,7236,7237,7238,7239,7240,7241,7242,7243,7244,7245, # 6912
7246,7247,7248,7249,7250,7251,7252,7253,7254,7255,7256,7257,7258,7259,7260,7261, # 6928
7262,7263,7264,7265,7266,7267,7268,7269,7270,7271,7272,7273,7274,7275,7276,7277, # 6944
7278,7279,7280,7281,7282,7283,7284,7285,7286,7287,7288,7289,7290,7291,7292,7293, # 6960
7294,7295,7296,4844,7297,7298,7299,7300,7301,7302,7303,7304,7305,7306,7307,7308, # 6976
7309,7310,7311,7312,7313,7314,7315,7316,4451,7317,7318,7319,7320,7321,7322,7323, # 6992
7324,7325,7326,7327,7328,7329,7330,7331,7332,7333,7334,7335,7336,7337,7338,7339, # 7008
7340,7341,7342,7343,7344,7345,7346,7347,7348,7349,7350,7351,7352,7353,4173,7354, # 7024
7355,4845,7356,7357,7358,7359,7360,7361,7362,7363,7364,7365,7366,7367,7368,7369, # 7040
7370,7371,7372,7373,7374,7375,7376,7377,7378,7379,7380,7381,7382,7383,7384,7385, # 7056
7386,7387,7388,4846,7389,7390,7391,7392,7393,7394,7395,7396,7397,7398,7399,7400, # 7072
7401,7402,7403,7404,7405,3672,7406,7407,7408,7409,7410,7411,7412,7413,7414,7415, # 7088
7416,7417,7418,7419,7420,7421,7422,7423,7424,7425,7426,7427,7428,7429,7430,7431, # 7104
7432,7433,7434,7435,7436,7437,7438,7439,7440,7441,7442,7443,7444,7445,7446,7447, # 7120
7448,7449,7450,7451,7452,7453,4452,7454,3200,7455,7456,7457,7458,7459,7460,7461, # 7136
7462,7463,7464,7465,7466,7467,7468,7469,7470,7471,7472,7473,7474,4847,7475,7476, # 7152
7477,3133,7478,7479,7480,7481,7482,7483,7484,7485,7486,7487,7488,7489,7490,7491, # 7168
7492,7493,7494,7495,7496,7497,7498,7499,7500,7501,7502,3347,7503,7504,7505,7506, # 7184
7507,7508,7509,7510,7511,7512,7513,7514,7515,7516,7517,7518,7519,7520,7521,4848, # 7200
7522,7523,7524,7525,7526,7527,7528,7529,7530,7531,7532,7533,7534,7535,7536,7537, # 7216
7538,7539,7540,7541,7542,7543,7544,7545,7546,7547,7548,7549,3801,4849,7550,7551, # 7232
7552,7553,7554,7555,7556,7557,7558,7559,7560,7561,7562,7563,7564,7565,7566,7567, # 7248
7568,7569,3035,7570,7571,7572,7573,7574,7575,7576,7577,7578,7579,7580,7581,7582, # 7264
7583,7584,7585,7586,7587,7588,7589,7590,7591,7592,7593,7594,7595,7596,7597,7598, # 7280
7599,7600,7601,7602,7603,7604,7605,7606,7607,7608,7609,7610,7611,7612,7613,7614, # 7296
7615,7616,4850,7617,7618,3802,7619,7620,7621,7622,7623,7624,7625,7626,7627,7628, # 7312
7629,7630,7631,7632,4851,7633,7634,7635,7636,7637,7638,7639,7640,7641,7642,7643, # 7328
7644,7645,7646,7647,7648,7649,7650,7651,7652,7653,7654,7655,7656,7657,7658,7659, # 7344
7660,7661,7662,7663,7664,7665,7666,7667,7668,7669,7670,4453,7671,7672,7673,7674, # 7360
7675,7676,7677,7678,7679,7680,7681,7682,7683,7684,7685,7686,7687,7688,7689,7690, # 7376
7691,7692,7693,7694,7695,7696,7697,3443,7698,7699,7700,7701,7702,4454,7703,7704, # 7392
7705,7706,7707,7708,7709,7710,7711,7712,7713,2472,7714,7715,7716,7717,7718,7719, # 7408
7720,7721,7722,7723,7724,7725,7726,7727,7728,7729,7730,7731,3954,7732,7733,7734, # 7424
7735,7736,7737,7738,7739,7740,7741,7742,7743,7744,7745,7746,7747,7748,7749,7750, # 7440
3134,7751,7752,4852,7753,7754,7755,4853,7756,7757,7758,7759,7760,4174,7761,7762, # 7456
7763,7764,7765,7766,7767,7768,7769,7770,7771,7772,7773,7774,7775,7776,7777,7778, # 7472
7779,7780,7781,7782,7783,7784,7785,7786,7787,7788,7789,7790,7791,7792,7793,7794, # 7488
7795,7796,7797,7798,7799,7800,7801,7802,7803,7804,7805,4854,7806,7807,7808,7809, # 7504
7810,7811,7812,7813,7814,7815,7816,7817,7818,7819,7820,7821,7822,7823,7824,7825, # 7520
4855,7826,7827,7828,7829,7830,7831,7832,7833,7834,7835,7836,7837,7838,7839,7840, # 7536
7841,7842,7843,7844,7845,7846,7847,3955,7848,7849,7850,7851,7852,7853,7854,7855, # 7552
7856,7857,7858,7859,7860,3444,7861,7862,7863,7864,7865,7866,7867,7868,7869,7870, # 7568
7871,7872,7873,7874,7875,7876,7877,7878,7879,7880,7881,7882,7883,7884,7885,7886, # 7584
7887,7888,7889,7890,7891,4175,7892,7893,7894,7895,7896,4856,4857,7897,7898,7899, # 7600
7900,2598,7901,7902,7903,7904,7905,7906,7907,7908,4455,7909,7910,7911,7912,7913, # 7616
7914,3201,7915,7916,7917,7918,7919,7920,7921,4858,7922,7923,7924,7925,7926,7927, # 7632
7928,7929,7930,7931,7932,7933,7934,7935,7936,7937,7938,7939,7940,7941,7942,7943, # 7648
7944,7945,7946,7947,7948,7949,7950,7951,7952,7953,7954,7955,7956,7957,7958,7959, # 7664
7960,7961,7962,7963,7964,7965,7966,7967,7968,7969,7970,7971,7972,7973,7974,7975, # 7680
7976,7977,7978,7979,7980,7981,4859,7982,7983,7984,7985,7986,7987,7988,7989,7990, # 7696
7991,7992,7993,7994,7995,7996,4860,7997,7998,7999,8000,8001,8002,8003,8004,8005, # 7712
8006,8007,8008,8009,8010,8011,8012,8013,8014,8015,8016,4176,8017,8018,8019,8020, # 7728
8021,8022,8023,4861,8024,8025,8026,8027,8028,8029,8030,8031,8032,8033,8034,8035, # 7744
8036,4862,4456,8037,8038,8039,8040,4863,8041,8042,8043,8044,8045,8046,8047,8048, # 7760
8049,8050,8051,8052,8053,8054,8055,8056,8057,8058,8059,8060,8061,8062,8063,8064, # 7776
8065,8066,8067,8068,8069,8070,8071,8072,8073,8074,8075,8076,8077,8078,8079,8080, # 7792
8081,8082,8083,8084,8085,8086,8087,8088,8089,8090,8091,8092,8093,8094,8095,8096, # 7808
8097,8098,8099,4864,4177,8100,8101,8102,8103,8104,8105,8106,8107,8108,8109,8110, # 7824
8111,8112,8113,8114,8115,8116,8117,8118,8119,8120,4178,8121,8122,8123,8124,8125, # 7840
8126,8127,8128,8129,8130,8131,8132,8133,8134,8135,8136,8137,8138,8139,8140,8141, # 7856
8142,8143,8144,8145,4865,4866,8146,8147,8148,8149,8150,8151,8152,8153,8154,8155, # 7872
8156,8157,8158,8159,8160,8161,8162,8163,8164,8165,4179,8166,8167,8168,8169,8170, # 7888
8171,8172,8173,8174,8175,8176,8177,8178,8179,8180,8181,4457,8182,8183,8184,8185, # 7904
8186,8187,8188,8189,8190,8191,8192,8193,8194,8195,8196,8197,8198,8199,8200,8201, # 7920
8202,8203,8204,8205,8206,8207,8208,8209,8210,8211,8212,8213,8214,8215,8216,8217, # 7936
8218,8219,8220,8221,8222,8223,8224,8225,8226,8227,8228,8229,8230,8231,8232,8233, # 7952
8234,8235,8236,8237,8238,8239,8240,8241,8242,8243,8244,8245,8246,8247,8248,8249, # 7968
8250,8251,8252,8253,8254,8255,8256,3445,8257,8258,8259,8260,8261,8262,4458,8263, # 7984
8264,8265,8266,8267,8268,8269,8270,8271,8272,4459,8273,8274,8275,8276,3550,8277, # 8000
8278,8279,8280,8281,8282,8283,8284,8285,8286,8287,8288,8289,4460,8290,8291,8292, # 8016
8293,8294,8295,8296,8297,8298,8299,8300,8301,8302,8303,8304,8305,8306,8307,4867, # 8032
8308,8309,8310,8311,8312,3551,8313,8314,8315,8316,8317,8318,8319,8320,8321,8322, # 8048
8323,8324,8325,8326,4868,8327,8328,8329,8330,8331,8332,8333,8334,8335,8336,8337, # 8064
8338,8339,8340,8341,8342,8343,8344,8345,8346,8347,8348,8349,8350,8351,8352,8353, # 8080
8354,8355,8356,8357,8358,8359,8360,8361,8362,8363,4869,4461,8364,8365,8366,8367, # 8096
8368,8369,8370,4870,8371,8372,8373,8374,8375,8376,8377,8378,8379,8380,8381,8382, # 8112
8383,8384,8385,8386,8387,8388,8389,8390,8391,8392,8393,8394,8395,8396,8397,8398, # 8128
8399,8400,8401,8402,8403,8404,8405,8406,8407,8408,8409,8410,4871,8411,8412,8413, # 8144
8414,8415,8416,8417,8418,8419,8420,8421,8422,4462,8423,8424,8425,8426,8427,8428, # 8160
8429,8430,8431,8432,8433,2986,8434,8435,8436,8437,8438,8439,8440,8441,8442,8443, # 8176
8444,8445,8446,8447,8448,8449,8450,8451,8452,8453,8454,8455,8456,8457,8458,8459, # 8192
8460,8461,8462,8463,8464,8465,8466,8467,8468,8469,8470,8471,8472,8473,8474,8475, # 8208
8476,8477,8478,4180,8479,8480,8481,8482,8483,8484,8485,8486,8487,8488,8489,8490, # 8224
8491,8492,8493,8494,8495,8496,8497,8498,8499,8500,8501,8502,8503,8504,8505,8506, # 8240
8507,8508,8509,8510,8511,8512,8513,8514,8515,8516,8517,8518,8519,8520,8521,8522, # 8256
8523,8524,8525,8526,8527,8528,8529,8530,8531,8532,8533,8534,8535,8536,8537,8538, # 8272
8539,8540,8541,8542,8543,8544,8545,8546,8547,8548,8549,8550,8551,8552,8553,8554, # 8288
8555,8556,8557,8558,8559,8560,8561,8562,8563,8564,4872,8565,8566,8567,8568,8569, # 8304
8570,8571,8572,8573,4873,8574,8575,8576,8577,8578,8579,8580,8581,8582,8583,8584, # 8320
8585,8586,8587,8588,8589,8590,8591,8592,8593,8594,8595,8596,8597,8598,8599,8600, # 8336
8601,8602,8603,8604,8605,3803,8606,8607,8608,8609,8610,8611,8612,8613,4874,3804, # 8352
8614,8615,8616,8617,8618,8619,8620,8621,3956,8622,8623,8624,8625,8626,8627,8628, # 8368
8629,8630,8631,8632,8633,8634,8635,8636,8637,8638,2865,8639,8640,8641,8642,8643, # 8384
8644,8645,8646,8647,8648,8649,8650,8651,8652,8653,8654,8655,8656,4463,8657,8658, # 8400
8659,4875,4876,8660,8661,8662,8663,8664,8665,8666,8667,8668,8669,8670,8671,8672, # 8416
8673,8674,8675,8676,8677,8678,8679,8680,8681,4464,8682,8683,8684,8685,8686,8687, # 8432
8688,8689,8690,8691,8692,8693,8694,8695,8696,8697,8698,8699,8700,8701,8702,8703, # 8448
8704,8705,8706,8707,8708,8709,2261,8710,8711,8712,8713,8714,8715,8716,8717,8718, # 8464
8719,8720,8721,8722,8723,8724,8725,8726,8727,8728,8729,8730,8731,8732,8733,4181, # 8480
8734,8735,8736,8737,8738,8739,8740,8741,8742,8743,8744,8745,8746,8747,8748,8749, # 8496
8750,8751,8752,8753,8754,8755,8756,8757,8758,8759,8760,8761,8762,8763,4877,8764, # 8512
8765,8766,8767,8768,8769,8770,8771,8772,8773,8774,8775,8776,8777,8778,8779,8780, # 8528
8781,8782,8783,8784,8785,8786,8787,8788,4878,8789,4879,8790,8791,8792,4880,8793, # 8544
8794,8795,8796,8797,8798,8799,8800,8801,4881,8802,8803,8804,8805,8806,8807,8808, # 8560
8809,8810,8811,8812,8813,8814,8815,3957,8816,8817,8818,8819,8820,8821,8822,8823, # 8576
8824,8825,8826,8827,8828,8829,8830,8831,8832,8833,8834,8835,8836,8837,8838,8839, # 8592
8840,8841,8842,8843,8844,8845,8846,8847,4882,8848,8849,8850,8851,8852,8853,8854, # 8608
8855,8856,8857,8858,8859,8860,8861,8862,8863,8864,8865,8866,8867,8868,8869,8870, # 8624
8871,8872,8873,8874,8875,8876,8877,8878,8879,8880,8881,8882,8883,8884,3202,8885, # 8640
8886,8887,8888,8889,8890,8891,8892,8893,8894,8895,8896,8897,8898,8899,8900,8901, # 8656
8902,8903,8904,8905,8906,8907,8908,8909,8910,8911,8912,8913,8914,8915,8916,8917, # 8672
8918,8919,8920,8921,8922,8923,8924,4465,8925,8926,8927,8928,8929,8930,8931,8932, # 8688
4883,8933,8934,8935,8936,8937,8938,8939,8940,8941,8942,8943,2214,8944,8945,8946, # 8704
8947,8948,8949,8950,8951,8952,8953,8954,8955,8956,8957,8958,8959,8960,8961,8962, # 8720
8963,8964,8965,4884,8966,8967,8968,8969,8970,8971,8972,8973,8974,8975,8976,8977, # 8736
8978,8979,8980,8981,8982,8983,8984,8985,8986,8987,8988,8989,8990,8991,8992,4885, # 8752
8993,8994,8995,8996,8997,8998,8999,9000,9001,9002,9003,9004,9005,9006,9007,9008, # 8768
9009,9010,9011,9012,9013,9014,9015,9016,9017,9018,9019,9020,9021,4182,9022,9023, # 8784
9024,9025,9026,9027,9028,9029,9030,9031,9032,9033,9034,9035,9036,9037,9038,9039, # 8800
9040,9041,9042,9043,9044,9045,9046,9047,9048,9049,9050,9051,9052,9053,9054,9055, # 8816
9056,9057,9058,9059,9060,9061,9062,9063,4886,9064,9065,9066,9067,9068,9069,4887, # 8832
9070,9071,9072,9073,9074,9075,9076,9077,9078,9079,9080,9081,9082,9083,9084,9085, # 8848
9086,9087,9088,9089,9090,9091,9092,9093,9094,9095,9096,9097,9098,9099,9100,9101, # 8864
9102,9103,9104,9105,9106,9107,9108,9109,9110,9111,9112,9113,9114,9115,9116,9117, # 8880
9118,9119,9120,9121,9122,9123,9124,9125,9126,9127,9128,9129,9130,9131,9132,9133, # 8896
9134,9135,9136,9137,9138,9139,9140,9141,3958,9142,9143,9144,9145,9146,9147,9148, # 8912
9149,9150,9151,4888,9152,9153,9154,9155,9156,9157,9158,9159,9160,9161,9162,9163, # 8928
9164,9165,9166,9167,9168,9169,9170,9171,9172,9173,9174,9175,4889,9176,9177,9178, # 8944
9179,9180,9181,9182,9183,9184,9185,9186,9187,9188,9189,9190,9191,9192,9193,9194, # 8960
9195,9196,9197,9198,9199,9200,9201,9202,9203,4890,9204,9205,9206,9207,9208,9209, # 8976
9210,9211,9212,9213,9214,9215,9216,9217,9218,9219,9220,9221,9222,4466,9223,9224, # 8992
9225,9226,9227,9228,9229,9230,9231,9232,9233,9234,9235,9236,9237,9238,9239,9240, # 9008
9241,9242,9243,9244,9245,4891,9246,9247,9248,9249,9250,9251,9252,9253,9254,9255, # 9024
9256,9257,4892,9258,9259,9260,9261,4893,4894,9262,9263,9264,9265,9266,9267,9268, # 9040
9269,9270,9271,9272,9273,4467,9274,9275,9276,9277,9278,9279,9280,9281,9282,9283, # 9056
9284,9285,3673,9286,9287,9288,9289,9290,9291,9292,9293,9294,9295,9296,9297,9298, # 9072
9299,9300,9301,9302,9303,9304,9305,9306,9307,9308,9309,9310,9311,9312,9313,9314, # 9088
9315,9316,9317,9318,9319,9320,9321,9322,4895,9323,9324,9325,9326,9327,9328,9329, # 9104
9330,9331,9332,9333,9334,9335,9336,9337,9338,9339,9340,9341,9342,9343,9344,9345, # 9120
9346,9347,4468,9348,9349,9350,9351,9352,9353,9354,9355,9356,9357,9358,9359,9360, # 9136
9361,9362,9363,9364,9365,9366,9367,9368,9369,9370,9371,9372,9373,4896,9374,4469, # 9152
9375,9376,9377,9378,9379,4897,9380,9381,9382,9383,9384,9385,9386,9387,9388,9389, # 9168
9390,9391,9392,9393,9394,9395,9396,9397,9398,9399,9400,9401,9402,9403,9404,9405, # 9184
9406,4470,9407,2751,9408,9409,3674,3552,9410,9411,9412,9413,9414,9415,9416,9417, # 9200
9418,9419,9420,9421,4898,9422,9423,9424,9425,9426,9427,9428,9429,3959,9430,9431, # 9216
9432,9433,9434,9435,9436,4471,9437,9438,9439,9440,9441,9442,9443,9444,9445,9446, # 9232
9447,9448,9449,9450,3348,9451,9452,9453,9454,9455,9456,9457,9458,9459,9460,9461, # 9248
9462,9463,9464,9465,9466,9467,9468,9469,9470,9471,9472,4899,9473,9474,9475,9476, # 9264
9477,4900,9478,9479,9480,9481,9482,9483,9484,9485,9486,9487,9488,3349,9489,9490, # 9280
9491,9492,9493,9494,9495,9496,9497,9498,9499,9500,9501,9502,9503,9504,9505,9506, # 9296
9507,9508,9509,9510,9511,9512,9513,9514,9515,9516,9517,9518,9519,9520,4901,9521, # 9312
9522,9523,9524,9525,9526,4902,9527,9528,9529,9530,9531,9532,9533,9534,9535,9536, # 9328
9537,9538,9539,9540,9541,9542,9543,9544,9545,9546,9547,9548,9549,9550,9551,9552, # 9344
9553,9554,9555,9556,9557,9558,9559,9560,9561,9562,9563,9564,9565,9566,9567,9568, # 9360
9569,9570,9571,9572,9573,9574,9575,9576,9577,9578,9579,9580,9581,9582,9583,9584, # 9376
3805,9585,9586,9587,9588,9589,9590,9591,9592,9593,9594,9595,9596,9597,9598,9599, # 9392
9600,9601,9602,4903,9603,9604,9605,9606,9607,4904,9608,9609,9610,9611,9612,9613, # 9408
9614,4905,9615,9616,9617,9618,9619,9620,9621,9622,9623,9624,9625,9626,9627,9628, # 9424
9629,9630,9631,9632,4906,9633,9634,9635,9636,9637,9638,9639,9640,9641,9642,9643, # 9440
4907,9644,9645,9646,9647,9648,9649,9650,9651,9652,9653,9654,9655,9656,9657,9658, # 9456
9659,9660,9661,9662,9663,9664,9665,9666,9667,9668,9669,9670,9671,9672,4183,9673, # 9472
9674,9675,9676,9677,4908,9678,9679,9680,9681,4909,9682,9683,9684,9685,9686,9687, # 9488
9688,9689,9690,4910,9691,9692,9693,3675,9694,9695,9696,2945,9697,9698,9699,9700, # 9504
9701,9702,9703,9704,9705,4911,9706,9707,9708,9709,9710,9711,9712,9713,9714,9715, # 9520
9716,9717,9718,9719,9720,9721,9722,9723,9724,9725,9726,9727,9728,9729,9730,9731, # 9536
9732,9733,9734,9735,4912,9736,9737,9738,9739,9740,4913,9741,9742,9743,9744,9745, # 9552
9746,9747,9748,9749,9750,9751,9752,9753,9754,9755,9756,9757,9758,4914,9759,9760, # 9568
9761,9762,9763,9764,9765,9766,9767,9768,9769,9770,9771,9772,9773,9774,9775,9776, # 9584
9777,9778,9779,9780,9781,9782,4915,9783,9784,9785,9786,9787,9788,9789,9790,9791, # 9600
9792,9793,4916,9794,9795,9796,9797,9798,9799,9800,9801,9802,9803,9804,9805,9806, # 9616
9807,9808,9809,9810,9811,9812,9813,9814,9815,9816,9817,9818,9819,9820,9821,9822, # 9632
9823,9824,9825,9826,9827,9828,9829,9830,9831,9832,9833,9834,9835,9836,9837,9838, # 9648
9839,9840,9841,9842,9843,9844,9845,9846,9847,9848,9849,9850,9851,9852,9853,9854, # 9664
9855,9856,9857,9858,9859,9860,9861,9862,9863,9864,9865,9866,9867,9868,4917,9869, # 9680
9870,9871,9872,9873,9874,9875,9876,9877,9878,9879,9880,9881,9882,9883,9884,9885, # 9696
9886,9887,9888,9889,9890,9891,9892,4472,9893,9894,9895,9896,9897,3806,9898,9899, # 9712
9900,9901,9902,9903,9904,9905,9906,9907,9908,9909,9910,9911,9912,9913,9914,4918, # 9728
9915,9916,9917,4919,9918,9919,9920,9921,4184,9922,9923,9924,9925,9926,9927,9928, # 9744
9929,9930,9931,9932,9933,9934,9935,9936,9937,9938,9939,9940,9941,9942,9943,9944, # 9760
9945,9946,4920,9947,9948,9949,9950,9951,9952,9953,9954,9955,4185,9956,9957,9958, # 9776
9959,9960,9961,9962,9963,9964,9965,4921,9966,9967,9968,4473,9969,9970,9971,9972, # 9792
9973,9974,9975,9976,9977,4474,9978,9979,9980,9981,9982,9983,9984,9985,9986,9987, # 9808
9988,9989,9990,9991,9992,9993,9994,9995,9996,9997,9998,9999,10000,10001,10002,10003, # 9824
10004,10005,10006,10007,10008,10009,10010,10011,10012,10013,10014,10015,10016,10017,10018,10019, # 9840
10020,10021,4922,10022,4923,10023,10024,10025,10026,10027,10028,10029,10030,10031,10032,10033, # 9856
10034,10035,10036,10037,10038,10039,10040,10041,10042,10043,10044,10045,10046,10047,10048,4924, # 9872
10049,10050,10051,10052,10053,10054,10055,10056,10057,10058,10059,10060,10061,10062,10063,10064, # 9888
10065,10066,10067,10068,10069,10070,10071,10072,10073,10074,10075,10076,10077,10078,10079,10080, # 9904
10081,10082,10083,10084,10085,10086,10087,4475,10088,10089,10090,10091,10092,10093,10094,10095, # 9920
10096,10097,4476,10098,10099,10100,10101,10102,10103,10104,10105,10106,10107,10108,10109,10110, # 9936
10111,2174,10112,10113,10114,10115,10116,10117,10118,10119,10120,10121,10122,10123,10124,10125, # 9952
10126,10127,10128,10129,10130,10131,10132,10133,10134,10135,10136,10137,10138,10139,10140,3807, # 9968
4186,4925,10141,10142,10143,10144,10145,10146,10147,4477,4187,10148,10149,10150,10151,10152, # 9984
10153,4188,10154,10155,10156,10157,10158,10159,10160,10161,4926,10162,10163,10164,10165,10166, #10000
10167,10168,10169,10170,10171,10172,10173,10174,10175,10176,10177,10178,10179,10180,10181,10182, #10016
10183,10184,10185,10186,10187,10188,10189,10190,10191,10192,3203,10193,10194,10195,10196,10197, #10032
10198,10199,10200,4478,10201,10202,10203,10204,4479,10205,10206,10207,10208,10209,10210,10211, #10048
10212,10213,10214,10215,10216,10217,10218,10219,10220,10221,10222,10223,10224,10225,10226,10227, #10064
10228,10229,10230,10231,10232,10233,10234,4927,10235,10236,10237,10238,10239,10240,10241,10242, #10080
10243,10244,10245,10246,10247,10248,10249,10250,10251,10252,10253,10254,10255,10256,10257,10258, #10096
10259,10260,10261,10262,10263,10264,10265,10266,10267,10268,10269,10270,10271,10272,10273,4480, #10112
4928,4929,10274,10275,10276,10277,10278,10279,10280,10281,10282,10283,10284,10285,10286,10287, #10128
10288,10289,10290,10291,10292,10293,10294,10295,10296,10297,10298,10299,10300,10301,10302,10303, #10144
10304,10305,10306,10307,10308,10309,10310,10311,10312,10313,10314,10315,10316,10317,10318,10319, #10160
10320,10321,10322,10323,10324,10325,10326,10327,10328,10329,10330,10331,10332,10333,10334,4930, #10176
10335,10336,10337,10338,10339,10340,10341,10342,4931,10343,10344,10345,10346,10347,10348,10349, #10192
10350,10351,10352,10353,10354,10355,3088,10356,2786,10357,10358,10359,10360,4189,10361,10362, #10208
10363,10364,10365,10366,10367,10368,10369,10370,10371,10372,10373,10374,10375,4932,10376,10377, #10224
10378,10379,10380,10381,10382,10383,10384,10385,10386,10387,10388,10389,10390,10391,10392,4933, #10240
10393,10394,10395,4934,10396,10397,10398,10399,10400,10401,10402,10403,10404,10405,10406,10407, #10256
10408,10409,10410,10411,10412,3446,10413,10414,10415,10416,10417,10418,10419,10420,10421,10422, #10272
10423,4935,10424,10425,10426,10427,10428,10429,10430,4936,10431,10432,10433,10434,10435,10436, #10288
10437,10438,10439,10440,10441,10442,10443,4937,10444,10445,10446,10447,4481,10448,10449,10450, #10304
10451,10452,10453,10454,10455,10456,10457,10458,10459,10460,10461,10462,10463,10464,10465,10466, #10320
10467,10468,10469,10470,10471,10472,10473,10474,10475,10476,10477,10478,10479,10480,10481,10482, #10336
10483,10484,10485,10486,10487,10488,10489,10490,10491,10492,10493,10494,10495,10496,10497,10498, #10352
10499,10500,10501,10502,10503,10504,10505,4938,10506,10507,10508,10509,10510,2552,10511,10512, #10368
10513,10514,10515,10516,3447,10517,10518,10519,10520,10521,10522,10523,10524,10525,10526,10527, #10384
10528,10529,10530,10531,10532,10533,10534,10535,10536,10537,10538,10539,10540,10541,10542,10543, #10400
4482,10544,4939,10545,10546,10547,10548,10549,10550,10551,10552,10553,10554,10555,10556,10557, #10416
10558,10559,10560,10561,10562,10563,10564,10565,10566,10567,3676,4483,10568,10569,10570,10571, #10432
10572,3448,10573,10574,10575,10576,10577,10578,10579,10580,10581,10582,10583,10584,10585,10586, #10448
10587,10588,10589,10590,10591,10592,10593,10594,10595,10596,10597,10598,10599,10600,10601,10602, #10464
10603,10604,10605,10606,10607,10608,10609,10610,10611,10612,10613,10614,10615,10616,10617,10618, #10480
10619,10620,10621,10622,10623,10624,10625,10626,10627,4484,10628,10629,10630,10631,10632,4940, #10496
10633,10634,10635,10636,10637,10638,10639,10640,10641,10642,10643,10644,10645,10646,10647,10648, #10512
10649,10650,10651,10652,10653,10654,10655,10656,4941,10657,10658,10659,2599,10660,10661,10662, #10528
10663,10664,10665,10666,3089,10667,10668,10669,10670,10671,10672,10673,10674,10675,10676,10677, #10544
10678,10679,10680,4942,10681,10682,10683,10684,10685,10686,10687,10688,10689,10690,10691,10692, #10560
10693,10694,10695,10696,10697,4485,10698,10699,10700,10701,10702,10703,10704,4943,10705,3677, #10576
10706,10707,10708,10709,10710,10711,10712,4944,10713,10714,10715,10716,10717,10718,10719,10720, #10592
10721,10722,10723,10724,10725,10726,10727,10728,4945,10729,10730,10731,10732,10733,10734,10735, #10608
10736,10737,10738,10739,10740,10741,10742,10743,10744,10745,10746,10747,10748,10749,10750,10751, #10624
10752,10753,10754,10755,10756,10757,10758,10759,10760,10761,4946,10762,10763,10764,10765,10766, #10640
10767,4947,4948,10768,10769,10770,10771,10772,10773,10774,10775,10776,10777,10778,10779,10780, #10656
10781,10782,10783,10784,10785,10786,10787,10788,10789,10790,10791,10792,10793,10794,10795,10796, #10672
10797,10798,10799,10800,10801,10802,10803,10804,10805,10806,10807,10808,10809,10810,10811,10812, #10688
10813,10814,10815,10816,10817,10818,10819,10820,10821,10822,10823,10824,10825,10826,10827,10828, #10704
10829,10830,10831,10832,10833,10834,10835,10836,10837,10838,10839,10840,10841,10842,10843,10844, #10720
10845,10846,10847,10848,10849,10850,10851,10852,10853,10854,10855,10856,10857,10858,10859,10860, #10736
10861,10862,10863,10864,10865,10866,10867,10868,10869,10870,10871,10872,10873,10874,10875,10876, #10752
10877,10878,4486,10879,10880,10881,10882,10883,10884,10885,4949,10886,10887,10888,10889,10890, #10768
10891,10892,10893,10894,10895,10896,10897,10898,10899,10900,10901,10902,10903,10904,10905,10906, #10784
10907,10908,10909,10910,10911,10912,10913,10914,10915,10916,10917,10918,10919,4487,10920,10921, #10800
10922,10923,10924,10925,10926,10927,10928,10929,10930,10931,10932,4950,10933,10934,10935,10936, #10816
10937,10938,10939,10940,10941,10942,10943,10944,10945,10946,10947,10948,10949,4488,10950,10951, #10832
10952,10953,10954,10955,10956,10957,10958,10959,4190,10960,10961,10962,10963,10964,10965,10966, #10848
10967,10968,10969,10970,10971,10972,10973,10974,10975,10976,10977,10978,10979,10980,10981,10982, #10864
10983,10984,10985,10986,10987,10988,10989,10990,10991,10992,10993,10994,10995,10996,10997,10998, #10880
10999,11000,11001,11002,11003,11004,11005,11006,3960,11007,11008,11009,11010,11011,11012,11013, #10896
11014,11015,11016,11017,11018,11019,11020,11021,11022,11023,11024,11025,11026,11027,11028,11029, #10912
11030,11031,11032,4951,11033,11034,11035,11036,11037,11038,11039,11040,11041,11042,11043,11044, #10928
11045,11046,11047,4489,11048,11049,11050,11051,4952,11052,11053,11054,11055,11056,11057,11058, #10944
4953,11059,11060,11061,11062,11063,11064,11065,11066,11067,11068,11069,11070,11071,4954,11072, #10960
11073,11074,11075,11076,11077,11078,11079,11080,11081,11082,11083,11084,11085,11086,11087,11088, #10976
11089,11090,11091,11092,11093,11094,11095,11096,11097,11098,11099,11100,11101,11102,11103,11104, #10992
11105,11106,11107,11108,11109,11110,11111,11112,11113,11114,11115,3808,11116,11117,11118,11119, #11008
11120,11121,11122,11123,11124,11125,11126,11127,11128,11129,11130,11131,11132,11133,11134,4955, #11024
11135,11136,11137,11138,11139,11140,11141,11142,11143,11144,11145,11146,11147,11148,11149,11150, #11040
11151,11152,11153,11154,11155,11156,11157,11158,11159,11160,11161,4956,11162,11163,11164,11165, #11056
11166,11167,11168,11169,11170,11171,11172,11173,11174,11175,11176,11177,11178,11179,11180,4957, #11072
11181,11182,11183,11184,11185,11186,4958,11187,11188,11189,11190,11191,11192,11193,11194,11195, #11088
11196,11197,11198,11199,11200,3678,11201,11202,11203,11204,11205,11206,4191,11207,11208,11209, #11104
11210,11211,11212,11213,11214,11215,11216,11217,11218,11219,11220,11221,11222,11223,11224,11225, #11120
11226,11227,11228,11229,11230,11231,11232,11233,11234,11235,11236,11237,11238,11239,11240,11241, #11136
11242,11243,11244,11245,11246,11247,11248,11249,11250,11251,4959,11252,11253,11254,11255,11256, #11152
11257,11258,11259,11260,11261,11262,11263,11264,11265,11266,11267,11268,11269,11270,11271,11272, #11168
11273,11274,11275,11276,11277,11278,11279,11280,11281,11282,11283,11284,11285,11286,11287,11288, #11184
11289,11290,11291,11292,11293,11294,11295,11296,11297,11298,11299,11300,11301,11302,11303,11304, #11200
11305,11306,11307,11308,11309,11310,11311,11312,11313,11314,3679,11315,11316,11317,11318,4490, #11216
11319,11320,11321,11322,11323,11324,11325,11326,11327,11328,11329,11330,11331,11332,11333,11334, #11232
11335,11336,11337,11338,11339,11340,11341,11342,11343,11344,11345,11346,11347,4960,11348,11349, #11248
11350,11351,11352,11353,11354,11355,11356,11357,11358,11359,11360,11361,11362,11363,11364,11365, #11264
11366,11367,11368,11369,11370,11371,11372,11373,11374,11375,11376,11377,3961,4961,11378,11379, #11280
11380,11381,11382,11383,11384,11385,11386,11387,11388,11389,11390,11391,11392,11393,11394,11395, #11296
11396,11397,4192,11398,11399,11400,11401,11402,11403,11404,11405,11406,11407,11408,11409,11410, #11312
11411,4962,11412,11413,11414,11415,11416,11417,11418,11419,11420,11421,11422,11423,11424,11425, #11328
11426,11427,11428,11429,11430,11431,11432,11433,11434,11435,11436,11437,11438,11439,11440,11441, #11344
11442,11443,11444,11445,11446,11447,11448,11449,11450,11451,11452,11453,11454,11455,11456,11457, #11360
11458,11459,11460,11461,11462,11463,11464,11465,11466,11467,11468,11469,4963,11470,11471,4491, #11376
11472,11473,11474,11475,4964,11476,11477,11478,11479,11480,11481,11482,11483,11484,11485,11486, #11392
11487,11488,11489,11490,11491,11492,4965,11493,11494,11495,11496,11497,11498,11499,11500,11501, #11408
11502,11503,11504,11505,11506,11507,11508,11509,11510,11511,11512,11513,11514,11515,11516,11517, #11424
11518,11519,11520,11521,11522,11523,11524,11525,11526,11527,11528,11529,3962,11530,11531,11532, #11440
11533,11534,11535,11536,11537,11538,11539,11540,11541,11542,11543,11544,11545,11546,11547,11548, #11456
11549,11550,11551,11552,11553,11554,11555,11556,11557,11558,11559,11560,11561,11562,11563,11564, #11472
4193,4194,11565,11566,11567,11568,11569,11570,11571,11572,11573,11574,11575,11576,11577,11578, #11488
11579,11580,11581,11582,11583,11584,11585,11586,11587,11588,11589,11590,11591,4966,4195,11592, #11504
11593,11594,11595,11596,11597,11598,11599,11600,11601,11602,11603,11604,3090,11605,11606,11607, #11520
11608,11609,11610,4967,11611,11612,11613,11614,11615,11616,11617,11618,11619,11620,11621,11622, #11536
11623,11624,11625,11626,11627,11628,11629,11630,11631,11632,11633,11634,11635,11636,11637,11638, #11552
11639,11640,11641,11642,11643,11644,11645,11646,11647,11648,11649,11650,11651,11652,11653,11654, #11568
11655,11656,11657,11658,11659,11660,11661,11662,11663,11664,11665,11666,11667,11668,11669,11670, #11584
11671,11672,11673,11674,4968,11675,11676,11677,11678,11679,11680,11681,11682,11683,11684,11685, #11600
11686,11687,11688,11689,11690,11691,11692,11693,3809,11694,11695,11696,11697,11698,11699,11700, #11616
11701,11702,11703,11704,11705,11706,11707,11708,11709,11710,11711,11712,11713,11714,11715,11716, #11632
11717,11718,3553,11719,11720,11721,11722,11723,11724,11725,11726,11727,11728,11729,11730,4969, #11648
11731,11732,11733,11734,11735,11736,11737,11738,11739,11740,4492,11741,11742,11743,11744,11745, #11664
11746,11747,11748,11749,11750,11751,11752,4970,11753,11754,11755,11756,11757,11758,11759,11760, #11680
11761,11762,11763,11764,11765,11766,11767,11768,11769,11770,11771,11772,11773,11774,11775,11776, #11696
11777,11778,11779,11780,11781,11782,11783,11784,11785,11786,11787,11788,11789,11790,4971,11791, #11712
11792,11793,11794,11795,11796,11797,4972,11798,11799,11800,11801,11802,11803,11804,11805,11806, #11728
11807,11808,11809,11810,4973,11811,11812,11813,11814,11815,11816,11817,11818,11819,11820,11821, #11744
11822,11823,11824,11825,11826,11827,11828,11829,11830,11831,11832,11833,11834,3680,3810,11835, #11760
11836,4974,11837,11838,11839,11840,11841,11842,11843,11844,11845,11846,11847,11848,11849,11850, #11776
11851,11852,11853,11854,11855,11856,11857,11858,11859,11860,11861,11862,11863,11864,11865,11866, #11792
11867,11868,11869,11870,11871,11872,11873,11874,11875,11876,11877,11878,11879,11880,11881,11882, #11808
11883,11884,4493,11885,11886,11887,11888,11889,11890,11891,11892,11893,11894,11895,11896,11897, #11824
11898,11899,11900,11901,11902,11903,11904,11905,11906,11907,11908,11909,11910,11911,11912,11913, #11840
11914,11915,4975,11916,11917,11918,11919,11920,11921,11922,11923,11924,11925,11926,11927,11928, #11856
11929,11930,11931,11932,11933,11934,11935,11936,11937,11938,11939,11940,11941,11942,11943,11944, #11872
11945,11946,11947,11948,11949,4976,11950,11951,11952,11953,11954,11955,11956,11957,11958,11959, #11888
11960,11961,11962,11963,11964,11965,11966,11967,11968,11969,11970,11971,11972,11973,11974,11975, #11904
11976,11977,11978,11979,11980,11981,11982,11983,11984,11985,11986,11987,4196,11988,11989,11990, #11920
11991,11992,4977,11993,11994,11995,11996,11997,11998,11999,12000,12001,12002,12003,12004,12005, #11936
12006,12007,12008,12009,12010,12011,12012,12013,12014,12015,12016,12017,12018,12019,12020,12021, #11952
12022,12023,12024,12025,12026,12027,12028,12029,12030,12031,12032,12033,12034,12035,12036,12037, #11968
12038,12039,12040,12041,12042,12043,12044,12045,12046,12047,12048,12049,12050,12051,12052,12053, #11984
12054,12055,12056,12057,12058,12059,12060,12061,4978,12062,12063,12064,12065,12066,12067,12068, #12000
12069,12070,12071,12072,12073,12074,12075,12076,12077,12078,12079,12080,12081,12082,12083,12084, #12016
12085,12086,12087,12088,12089,12090,12091,12092,12093,12094,12095,12096,12097,12098,12099,12100, #12032
12101,12102,12103,12104,12105,12106,12107,12108,12109,12110,12111,12112,12113,12114,12115,12116, #12048
12117,12118,12119,12120,12121,12122,12123,4979,12124,12125,12126,12127,12128,4197,12129,12130, #12064
12131,12132,12133,12134,12135,12136,12137,12138,12139,12140,12141,12142,12143,12144,12145,12146, #12080
12147,12148,12149,12150,12151,12152,12153,12154,4980,12155,12156,12157,12158,12159,12160,4494, #12096
12161,12162,12163,12164,3811,12165,12166,12167,12168,12169,4495,12170,12171,4496,12172,12173, #12112
12174,12175,12176,3812,12177,12178,12179,12180,12181,12182,12183,12184,12185,12186,12187,12188, #12128
12189,12190,12191,12192,12193,12194,12195,12196,12197,12198,12199,12200,12201,12202,12203,12204, #12144
12205,12206,12207,12208,12209,12210,12211,12212,12213,12214,12215,12216,12217,12218,12219,12220, #12160
12221,4981,12222,12223,12224,12225,12226,12227,12228,12229,12230,12231,12232,12233,12234,12235, #12176
4982,12236,12237,12238,12239,12240,12241,12242,12243,12244,12245,4983,12246,12247,12248,12249, #12192
4984,12250,12251,12252,12253,12254,12255,12256,12257,12258,12259,12260,12261,12262,12263,12264, #12208
4985,12265,4497,12266,12267,12268,12269,12270,12271,12272,12273,12274,12275,12276,12277,12278, #12224
12279,12280,12281,12282,12283,12284,12285,12286,12287,4986,12288,12289,12290,12291,12292,12293, #12240
12294,12295,12296,2473,12297,12298,12299,12300,12301,12302,12303,12304,12305,12306,12307,12308, #12256
12309,12310,12311,12312,12313,12314,12315,12316,12317,12318,12319,3963,12320,12321,12322,12323, #12272
12324,12325,12326,12327,12328,12329,12330,12331,12332,4987,12333,12334,12335,12336,12337,12338, #12288
12339,12340,12341,12342,12343,12344,12345,12346,12347,12348,12349,12350,12351,12352,12353,12354, #12304
12355,12356,12357,12358,12359,3964,12360,12361,12362,12363,12364,12365,12366,12367,12368,12369, #12320
12370,3965,12371,12372,12373,12374,12375,12376,12377,12378,12379,12380,12381,12382,12383,12384, #12336
12385,12386,12387,12388,12389,12390,12391,12392,12393,12394,12395,12396,12397,12398,12399,12400, #12352
12401,12402,12403,12404,12405,12406,12407,12408,4988,12409,12410,12411,12412,12413,12414,12415, #12368
12416,12417,12418,12419,12420,12421,12422,12423,12424,12425,12426,12427,12428,12429,12430,12431, #12384
12432,12433,12434,12435,12436,12437,12438,3554,12439,12440,12441,12442,12443,12444,12445,12446, #12400
12447,12448,12449,12450,12451,12452,12453,12454,12455,12456,12457,12458,12459,12460,12461,12462, #12416
12463,12464,4989,12465,12466,12467,12468,12469,12470,12471,12472,12473,12474,12475,12476,12477, #12432
12478,12479,12480,4990,12481,12482,12483,12484,12485,12486,12487,12488,12489,4498,12490,12491, #12448
12492,12493,12494,12495,12496,12497,12498,12499,12500,12501,12502,12503,12504,12505,12506,12507, #12464
12508,12509,12510,12511,12512,12513,12514,12515,12516,12517,12518,12519,12520,12521,12522,12523, #12480
12524,12525,12526,12527,12528,12529,12530,12531,12532,12533,12534,12535,12536,12537,12538,12539, #12496
12540,12541,12542,12543,12544,12545,12546,12547,12548,12549,12550,12551,4991,12552,12553,12554, #12512
12555,12556,12557,12558,12559,12560,12561,12562,12563,12564,12565,12566,12567,12568,12569,12570, #12528
12571,12572,12573,12574,12575,12576,12577,12578,3036,12579,12580,12581,12582,12583,3966,12584, #12544
12585,12586,12587,12588,12589,12590,12591,12592,12593,12594,12595,12596,12597,12598,12599,12600, #12560
12601,12602,12603,12604,12605,12606,12607,12608,12609,12610,12611,12612,12613,12614,12615,12616, #12576
12617,12618,12619,12620,12621,12622,12623,12624,12625,12626,12627,12628,12629,12630,12631,12632, #12592
12633,12634,12635,12636,12637,12638,12639,12640,12641,12642,12643,12644,12645,12646,4499,12647, #12608
12648,12649,12650,12651,12652,12653,12654,12655,12656,12657,12658,12659,12660,12661,12662,12663, #12624
12664,12665,12666,12667,12668,12669,12670,12671,12672,12673,12674,12675,12676,12677,12678,12679, #12640
12680,12681,12682,12683,12684,12685,12686,12687,12688,12689,12690,12691,12692,12693,12694,12695, #12656
12696,12697,12698,4992,12699,12700,12701,12702,12703,12704,12705,12706,12707,12708,12709,12710, #12672
12711,12712,12713,12714,12715,12716,12717,12718,12719,12720,12721,12722,12723,12724,12725,12726, #12688
12727,12728,12729,12730,12731,12732,12733,12734,12735,12736,12737,12738,12739,12740,12741,12742, #12704
12743,12744,12745,12746,12747,12748,12749,12750,12751,12752,12753,12754,12755,12756,12757,12758, #12720
12759,12760,12761,12762,12763,12764,12765,12766,12767,12768,12769,12770,12771,12772,12773,12774, #12736
12775,12776,12777,12778,4993,2175,12779,12780,12781,12782,12783,12784,12785,12786,4500,12787, #12752
12788,12789,12790,12791,12792,12793,12794,12795,12796,12797,12798,12799,12800,12801,12802,12803, #12768
12804,12805,12806,12807,12808,12809,12810,12811,12812,12813,12814,12815,12816,12817,12818,12819, #12784
12820,12821,12822,12823,12824,12825,12826,4198,3967,12827,12828,12829,12830,12831,12832,12833, #12800
12834,12835,12836,12837,12838,12839,12840,12841,12842,12843,12844,12845,12846,12847,12848,12849, #12816
12850,12851,12852,12853,12854,12855,12856,12857,12858,12859,12860,12861,4199,12862,12863,12864, #12832
12865,12866,12867,12868,12869,12870,12871,12872,12873,12874,12875,12876,12877,12878,12879,12880, #12848
12881,12882,12883,12884,12885,12886,12887,4501,12888,12889,12890,12891,12892,12893,12894,12895, #12864
12896,12897,12898,12899,12900,12901,12902,12903,12904,12905,12906,12907,12908,12909,12910,12911, #12880
12912,4994,12913,12914,12915,12916,12917,12918,12919,12920,12921,12922,12923,12924,12925,12926, #12896
12927,12928,12929,12930,12931,12932,12933,12934,12935,12936,12937,12938,12939,12940,12941,12942, #12912
12943,12944,12945,12946,12947,12948,12949,12950,12951,12952,12953,12954,12955,12956,1772,12957, #12928
12958,12959,12960,12961,12962,12963,12964,12965,12966,12967,12968,12969,12970,12971,12972,12973, #12944
12974,12975,12976,12977,12978,12979,12980,12981,12982,12983,12984,12985,12986,12987,12988,12989, #12960
12990,12991,12992,12993,12994,12995,12996,12997,4502,12998,4503,12999,13000,13001,13002,13003, #12976
4504,13004,13005,13006,13007,13008,13009,13010,13011,13012,13013,13014,13015,13016,13017,13018, #12992
13019,13020,13021,13022,13023,13024,13025,13026,13027,13028,13029,3449,13030,13031,13032,13033, #13008
13034,13035,13036,13037,13038,13039,13040,13041,13042,13043,13044,13045,13046,13047,13048,13049, #13024
13050,13051,13052,13053,13054,13055,13056,13057,13058,13059,13060,13061,13062,13063,13064,13065, #13040
13066,13067,13068,13069,13070,13071,13072,13073,13074,13075,13076,13077,13078,13079,13080,13081, #13056
13082,13083,13084,13085,13086,13087,13088,13089,13090,13091,13092,13093,13094,13095,13096,13097, #13072
13098,13099,13100,13101,13102,13103,13104,13105,13106,13107,13108,13109,13110,13111,13112,13113, #13088
13114,13115,13116,13117,13118,3968,13119,4995,13120,13121,13122,13123,13124,13125,13126,13127, #13104
4505,13128,13129,13130,13131,13132,13133,13134,4996,4506,13135,13136,13137,13138,13139,4997, #13120
13140,13141,13142,13143,13144,13145,13146,13147,13148,13149,13150,13151,13152,13153,13154,13155, #13136
13156,13157,13158,13159,4998,13160,13161,13162,13163,13164,13165,13166,13167,13168,13169,13170, #13152
13171,13172,13173,13174,13175,13176,4999,13177,13178,13179,13180,13181,13182,13183,13184,13185, #13168
13186,13187,13188,13189,13190,13191,13192,13193,13194,13195,13196,13197,13198,13199,13200,13201, #13184
13202,13203,13204,13205,13206,5000,13207,13208,13209,13210,13211,13212,13213,13214,13215,13216, #13200
13217,13218,13219,13220,13221,13222,13223,13224,13225,13226,13227,4200,5001,13228,13229,13230, #13216
13231,13232,13233,13234,13235,13236,13237,13238,13239,13240,3969,13241,13242,13243,13244,3970, #13232
13245,13246,13247,13248,13249,13250,13251,13252,13253,13254,13255,13256,13257,13258,13259,13260, #13248
13261,13262,13263,13264,13265,13266,13267,13268,3450,13269,13270,13271,13272,13273,13274,13275, #13264
13276,5002,13277,13278,13279,13280,13281,13282,13283,13284,13285,13286,13287,13288,13289,13290, #13280
13291,13292,13293,13294,13295,13296,13297,13298,13299,13300,13301,13302,3813,13303,13304,13305, #13296
13306,13307,13308,13309,13310,13311,13312,13313,13314,13315,13316,13317,13318,13319,13320,13321, #13312
13322,13323,13324,13325,13326,13327,13328,4507,13329,13330,13331,13332,13333,13334,13335,13336, #13328
13337,13338,13339,13340,13341,5003,13342,13343,13344,13345,13346,13347,13348,13349,13350,13351, #13344
13352,13353,13354,13355,13356,13357,13358,13359,13360,13361,13362,13363,13364,13365,13366,13367, #13360
5004,13368,13369,13370,13371,13372,13373,13374,13375,13376,13377,13378,13379,13380,13381,13382, #13376
13383,13384,13385,13386,13387,13388,13389,13390,13391,13392,13393,13394,13395,13396,13397,13398, #13392
13399,13400,13401,13402,13403,13404,13405,13406,13407,13408,13409,13410,13411,13412,13413,13414, #13408
13415,13416,13417,13418,13419,13420,13421,13422,13423,13424,13425,13426,13427,13428,13429,13430, #13424
13431,13432,4508,13433,13434,13435,4201,13436,13437,13438,13439,13440,13441,13442,13443,13444, #13440
13445,13446,13447,13448,13449,13450,13451,13452,13453,13454,13455,13456,13457,5005,13458,13459, #13456
13460,13461,13462,13463,13464,13465,13466,13467,13468,13469,13470,4509,13471,13472,13473,13474, #13472
13475,13476,13477,13478,13479,13480,13481,13482,13483,13484,13485,13486,13487,13488,13489,13490, #13488
13491,13492,13493,13494,13495,13496,13497,13498,13499,13500,13501,13502,13503,13504,13505,13506, #13504
13507,13508,13509,13510,13511,13512,13513,13514,13515,13516,13517,13518,13519,13520,13521,13522, #13520
13523,13524,13525,13526,13527,13528,13529,13530,13531,13532,13533,13534,13535,13536,13537,13538, #13536
13539,13540,13541,13542,13543,13544,13545,13546,13547,13548,13549,13550,13551,13552,13553,13554, #13552
13555,13556,13557,13558,13559,13560,13561,13562,13563,13564,13565,13566,13567,13568,13569,13570, #13568
13571,13572,13573,13574,13575,13576,13577,13578,13579,13580,13581,13582,13583,13584,13585,13586, #13584
13587,13588,13589,13590,13591,13592,13593,13594,13595,13596,13597,13598,13599,13600,13601,13602, #13600
13603,13604,13605,13606,13607,13608,13609,13610,13611,13612,13613,13614,13615,13616,13617,13618, #13616
13619,13620,13621,13622,13623,13624,13625,13626,13627,13628,13629,13630,13631,13632,13633,13634, #13632
13635,13636,13637,13638,13639,13640,13641,13642,5006,13643,13644,13645,13646,13647,13648,13649, #13648
13650,13651,5007,13652,13653,13654,13655,13656,13657,13658,13659,13660,13661,13662,13663,13664, #13664
13665,13666,13667,13668,13669,13670,13671,13672,13673,13674,13675,13676,13677,13678,13679,13680, #13680
13681,13682,13683,13684,13685,13686,13687,13688,13689,13690,13691,13692,13693,13694,13695,13696, #13696
13697,13698,13699,13700,13701,13702,13703,13704,13705,13706,13707,13708,13709,13710,13711,13712, #13712
13713,13714,13715,13716,13717,13718,13719,13720,13721,13722,13723,13724,13725,13726,13727,13728, #13728
13729,13730,13731,13732,13733,13734,13735,13736,13737,13738,13739,13740,13741,13742,13743,13744, #13744
13745,13746,13747,13748,13749,13750,13751,13752,13753,13754,13755,13756,13757,13758,13759,13760, #13760
13761,13762,13763,13764,13765,13766,13767,13768,13769,13770,13771,13772,13773,13774,3273,13775, #13776
13776,13777,13778,13779,13780,13781,13782,13783,13784,13785,13786,13787,13788,13789,13790,13791, #13792
13792,13793,13794,13795,13796,13797,13798,13799,13800,13801,13802,13803,13804,13805,13806,13807, #13808
13808,13809,13810,13811,13812,13813,13814,13815,13816,13817,13818,13819,13820,13821,13822,13823, #13824
13824,13825,13826,13827,13828,13829,13830,13831,13832,13833,13834,13835,13836,13837,13838,13839, #13840
13840,13841,13842,13843,13844,13845,13846,13847,13848,13849,13850,13851,13852,13853,13854,13855, #13856
13856,13857,13858,13859,13860,13861,13862,13863,13864,13865,13866,13867,13868,13869,13870,13871, #13872
13872,13873,13874,13875,13876,13877,13878,13879,13880,13881,13882,13883,13884,13885,13886,13887, #13888
13888,13889,13890,13891,13892,13893,13894,13895,13896,13897,13898,13899,13900,13901,13902,13903, #13904
13904,13905,13906,13907,13908,13909,13910,13911,13912,13913,13914,13915,13916,13917,13918,13919, #13920
13920,13921,13922,13923,13924,13925,13926,13927,13928,13929,13930,13931,13932,13933,13934,13935, #13936
13936,13937,13938,13939,13940,13941,13942,13943,13944,13945,13946,13947,13948,13949,13950,13951, #13952
13952,13953,13954,13955,13956,13957,13958,13959,13960,13961,13962,13963,13964,13965,13966,13967, #13968
13968,13969,13970,13971,13972) #13973
# flake8: noqa
| mit |
majidaldo/ansible | lib/ansible/utils/module_docs_fragments/rackspace.py | 232 | 4190 | # (c) 2014, Matt Martz <[email protected]>
#
# This file is part of Ansible
#
# Ansible is free software: you can redistribute it and/or modify
# it under the terms of the GNU General Public License as published by
# the Free Software Foundation, either version 3 of the License, or
# (at your option) any later version.
#
# Ansible is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
# GNU General Public License for more details.
#
# You should have received a copy of the GNU General Public License
# along with Ansible. If not, see <http://www.gnu.org/licenses/>.
class ModuleDocFragment(object):
# Standard Rackspace only documentation fragment
DOCUMENTATION = """
options:
api_key:
description:
- Rackspace API key (overrides I(credentials))
aliases:
- password
credentials:
description:
- File to find the Rackspace credentials in (ignored if I(api_key) and
I(username) are provided)
default: null
aliases:
- creds_file
env:
description:
- Environment as configured in ~/.pyrax.cfg,
see U(https://github.com/rackspace/pyrax/blob/master/docs/getting_started.md#pyrax-configuration)
version_added: 1.5
region:
description:
- Region to create an instance in
default: DFW
username:
description:
- Rackspace username (overrides I(credentials))
verify_ssl:
description:
- Whether or not to require SSL validation of API endpoints
version_added: 1.5
requirements:
- "python >= 2.6"
- pyrax
notes:
- The following environment variables can be used, C(RAX_USERNAME),
C(RAX_API_KEY), C(RAX_CREDS_FILE), C(RAX_CREDENTIALS), C(RAX_REGION).
- C(RAX_CREDENTIALS) and C(RAX_CREDS_FILE) points to a credentials file
appropriate for pyrax. See U(https://github.com/rackspace/pyrax/blob/master/docs/getting_started.md#authenticating)
- C(RAX_USERNAME) and C(RAX_API_KEY) obviate the use of a credentials file
- C(RAX_REGION) defines a Rackspace Public Cloud region (DFW, ORD, LON, ...)
"""
# Documentation fragment including attributes to enable communication
# of other OpenStack clouds. Not all rax modules support this.
OPENSTACK = """
options:
api_key:
description:
- Rackspace API key (overrides I(credentials))
aliases:
- password
auth_endpoint:
description:
- The URI of the authentication service
default: https://identity.api.rackspacecloud.com/v2.0/
version_added: 1.5
credentials:
description:
- File to find the Rackspace credentials in (ignored if I(api_key) and
I(username) are provided)
default: null
aliases:
- creds_file
env:
description:
- Environment as configured in ~/.pyrax.cfg,
see U(https://github.com/rackspace/pyrax/blob/master/docs/getting_started.md#pyrax-configuration)
version_added: 1.5
identity_type:
description:
- Authentication machanism to use, such as rackspace or keystone
default: rackspace
version_added: 1.5
region:
description:
- Region to create an instance in
default: DFW
tenant_id:
description:
- The tenant ID used for authentication
version_added: 1.5
tenant_name:
description:
- The tenant name used for authentication
version_added: 1.5
username:
description:
- Rackspace username (overrides I(credentials))
verify_ssl:
description:
- Whether or not to require SSL validation of API endpoints
version_added: 1.5
requirements:
- "python >= 2.6"
- pyrax
notes:
- The following environment variables can be used, C(RAX_USERNAME),
C(RAX_API_KEY), C(RAX_CREDS_FILE), C(RAX_CREDENTIALS), C(RAX_REGION).
- C(RAX_CREDENTIALS) and C(RAX_CREDS_FILE) points to a credentials file
appropriate for pyrax. See U(https://github.com/rackspace/pyrax/blob/master/docs/getting_started.md#authenticating)
- C(RAX_USERNAME) and C(RAX_API_KEY) obviate the use of a credentials file
- C(RAX_REGION) defines a Rackspace Public Cloud region (DFW, ORD, LON, ...)
"""
| gpl-3.0 |
tspus/python-matchingPursuit | src/utils.py | 1 | 5766 | #!/usr/bin/env python
#-*- coding: utf-8 -*-
'''
# This file is part of Matching Pursuit Python program (python-MP).
#
# python-MP is free software: you can redistribute it and/or modify
# it under the terms of the GNU General Public License as published by
# the Free Software Foundation, either version 3 of the License, or
# (at your option) any later version.
#
# python-MP is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
# GNU General Public License for more details.
#
# You should have received a copy of the GNU General Public License
# along with python-MP. If not, see <http://www.gnu.org/licenses/>.
author: Tomasz Spustek
e-mail: [email protected]
University of Warsaw, July 06, 2015
'''
from __future__ import division
import numpy as np
from scipy.io import savemat
from src.processing import calculateMP
def saveBookAsMat(book , data , config , nameOfFile):
# matrix2save = np.zeros([data.shape[0],data.shape[1],config['maxNumberOfIterations']] , dtype='complex') # trials x channels x iterations
results = {}
for indTrial in np.arange(data.shape[0]):
for indChannel in np.arange(data.shape[1]):
partialBook = book[indTrial,indChannel]
nameOfStruct = 'trial_' + str(indTrial) + 'channel_' + str(indChannel)
results[nameOfStruct] = {col_name : partialBook[col_name].values for col_name in partialBook.columns.values}
savemat(nameOfFile , results)
return 'ok'
def generateFinalConfig(dictionaryConfig , dataInfo , algorithmConfig):
flags = {}
flags['useAsymA'] = dictionaryConfig['useAsym']
flags['useRectA'] = dictionaryConfig['useRect']
flags['useGradientOptimization'] = algorithmConfig['useGradient']
flags['displayInfo'] = algorithmConfig['displayInfo']
config = {}
config['flags'] = flags
config['algorithm'] = algorithmConfig['algorithmType']
config['minS'] = dictionaryConfig['minS_samples']
config['maxS'] = dictionaryConfig['maxS_samples']
config['density'] = dictionaryConfig['dictionaryDensity']
config['maxNumberOfIterations'] = algorithmConfig['iterationsLimit']
config['minEnergyExplained'] = algorithmConfig['energyLimit']
config['samplingFrequency'] = dataInfo['samplingFreq']
config['minNFFT'] = algorithmConfig['nfft']
config['channels2calc'] = algorithmConfig['channelsRange']
config['trials2calc'] = algorithmConfig['trialsRange']
return config
def retranslateDictionaryConfig(dictionaryConfig):
config = {}
flags = {}
flags['useAsymA'] = dictionaryConfig['useAsym']
flags['useRectA'] = dictionaryConfig['useRect']
config['flags'] = flags
config['minS'] = dictionaryConfig['minS_samples']
config['maxS'] = dictionaryConfig['maxS_samples']
config['density'] = dictionaryConfig['dictionaryDensity']
return config
def generateRangeFromString(text):
text = text.replace(' ' , '')
text = text.replace(',' , ' ')
text = text.split()
finalRange = []
iterator = 0
for element in text:
f1 = element.find(':')
f2 = element.find('-')
f3 = element.find(';')
if f1 != -1:
start = int(element[0:f1])
end = int(element[f1+1:len(element)])+1
for number in range(start , end):
finalRange.append(number)
elif f2 != -1:
start = int(element[0:f2])
end = int(element[f2+1:len(element)])+1
for number in range(start , end):
finalRange.append(number)
elif f3 != -1:
start = int(element[0:f3])
end = int(element[f3+1:len(element)])+1
for number in range(start , end):
finalRange.append(number)
else:
finalRange.append(int(element))
finalRange = np.array(finalRange)
finalRange.sort()
finalRange = np.unique(finalRange)
return finalRange
def determineAlgorithmConfig(dataInfo):
config = {}
config['algorithmType'] = 'smp'
config['useGradient'] = 1
config['displayInfo'] = 0
config['nfft'] = 1 << (int(dataInfo['samplingFreq'])-1).bit_length()
config['energyLimit'] = 0.99
config['iterationsLimit'] = 20
config['channels2calc'] = '1:' + str(dataInfo['numberOfChannels'])
config['channelsRange'] = generateRangeFromString(config['channels2calc'])
config['trials2calc'] = '1:' + str(dataInfo['numberOfTrials'])
config['trialsRange'] = generateRangeFromString(config['trials2calc'])
return config
def determineDictionaryConfig(dictionaryConfig , energyLimit , dataInfo):
density = 1.0 - energyLimit
if dictionaryConfig == {}:
dictionaryConfig['useAsym'] = 0
dictionaryConfig['useRect'] = 0
dictionaryConfig['minS_samples'] = int((dataInfo['numberOfSeconds']/16)*dataInfo['samplingFreq'])
dictionaryConfig['minS_seconds'] = float(dataInfo['numberOfSeconds']/16)
dictionaryConfig['maxS_samples'] = int(dataInfo['numberOfSamples'])
dictionaryConfig['maxS_seconds'] = float(dataInfo['numberOfSeconds'])
dictionaryConfig['dictionaryDensity'] = density
else:
if dataInfo['numberOfSamples'] > dictionaryConfig['maxS_samples']:
dictionaryConfig['maxS_samples'] = int(dataInfo['numberOfSamples'])
dictionaryConfig['maxS_seconds'] = float(dataInfo['numberOfSamples'] / dataInfo['samplingFreq'])
if (dataInfo['numberOfSeconds']/8)*dataInfo['samplingFreq'] < dictionaryConfig['minS_samples']:
dictionaryConfig['minS_samples'] = int((dataInfo['numberOfSeconds']/16)*dataInfo['samplingFreq'])
dictionaryConfig['minS_seconds'] = float(dataInfo['numberOfSeconds']/16)
if dictionaryConfig['dictionaryDensity'] > density:
dictionaryConfig['dictionaryDensity'] = density
return dictionaryConfig
| gpl-3.0 |
samchrisinger/osf.io | scripts/analytics/tasks.py | 14 | 1913 | import os
import matplotlib
from framework.celery_tasks import app as celery_app
from scripts import utils as script_utils
from scripts.analytics import settings
from scripts.analytics import utils
from website import models
from website import settings as website_settings
from website.app import init_app
from .logger import logger
@celery_app.task(name='scripts.analytics.tasks')
def analytics():
matplotlib.use('Agg')
init_app(routes=False)
script_utils.add_file_logger(logger, __file__)
from scripts.analytics import (
logs, addons, comments, folders, links, watch, email_invites,
permissions, profile, benchmarks
)
modules = (
logs, addons, comments, folders, links, watch, email_invites,
permissions, profile, benchmarks
)
for module in modules:
logger.info('Starting: {}'.format(module.__name__))
module.main()
logger.info('Finished: {}'.format(module.__name__))
upload_analytics()
def upload_analytics(local_path=None, remote_path='/'):
node = models.Node.load(settings.TABULATE_LOGS_NODE_ID)
user = models.User.load(settings.TABULATE_LOGS_USER_ID)
if not local_path:
local_path = website_settings.ANALYTICS_PATH
for name in os.listdir(local_path):
if not os.path.isfile(os.path.join(local_path, name)):
logger.info('create directory: {}'.format(os.path.join(local_path, name)))
metadata = utils.create_object(name, 'folder-update', node, user, kind='folder', path=remote_path)
upload_analytics(os.path.join(local_path, name), metadata['attributes']['path'])
else:
logger.info('update file: {}'.format(os.path.join(local_path, name)))
with open(os.path.join(local_path, name), 'rb') as fp:
utils.create_object(name, 'file-update', node, user, stream=fp, kind='file', path=remote_path)
| apache-2.0 |
gmalmquist/pants | contrib/cpp/src/python/pants/contrib/cpp/register.py | 23 | 1198 | # coding=utf-8
# Copyright 2015 Pants project contributors (see CONTRIBUTORS.md).
# Licensed under the Apache License, Version 2.0 (see LICENSE).
from __future__ import (absolute_import, division, generators, nested_scopes, print_function,
unicode_literals, with_statement)
from pants.build_graph.build_file_aliases import BuildFileAliases
from pants.goal.task_registrar import TaskRegistrar as task
from pants.contrib.cpp.targets.cpp_binary import CppBinary
from pants.contrib.cpp.targets.cpp_library import CppLibrary
from pants.contrib.cpp.tasks.cpp_binary_create import CppBinaryCreate
from pants.contrib.cpp.tasks.cpp_compile import CppCompile
from pants.contrib.cpp.tasks.cpp_library_create import CppLibraryCreate
from pants.contrib.cpp.tasks.cpp_run import CppRun
def build_file_aliases():
return BuildFileAliases(
targets={
'cpp_library': CppLibrary,
'cpp_binary': CppBinary,
}
)
def register_goals():
task(name='cpp', action=CppCompile).install('compile')
task(name='cpplib', action=CppLibraryCreate).install('binary')
task(name='cpp', action=CppBinaryCreate).install('binary')
task(name='cpp', action=CppRun).install('run')
| apache-2.0 |
ClearCorp-dev/server-tools | __unported__/scheduler_error_mailer/__init__.py | 65 | 1129 | # -*- coding: utf-8 -*-
##############################################################################
#
# Scheduler Error Mailer module for OpenERP
# Copyright (C) 2012-2013 Akretion (http://www.akretion.com/)
# @author: Sébastien Beau <[email protected]>
# @author Alexis de Lattre <[email protected]>
#
# This program is free software: you can redistribute it and/or modify
# it under the terms of the GNU Affero General Public License as
# published by the Free Software Foundation, either version 3 of the
# License, or (at your option) any later version.
#
# This program is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
# GNU Affero General Public License for more details.
#
# You should have received a copy of the GNU Affero General Public License
# along with this program. If not, see <http://www.gnu.org/licenses/>.
#
##############################################################################
from . import ir_cron
| agpl-3.0 |
mazaclub/p2pool | p2pool/util/p2protocol.py | 216 | 4144 | '''
Generic message-based protocol used by Bitcoin and P2Pool for P2P communication
'''
import hashlib
import struct
from twisted.internet import protocol
from twisted.python import log
import p2pool
from p2pool.util import datachunker, variable
class TooLong(Exception):
pass
class Protocol(protocol.Protocol):
def __init__(self, message_prefix, max_payload_length, traffic_happened=variable.Event(), ignore_trailing_payload=False):
self._message_prefix = message_prefix
self._max_payload_length = max_payload_length
self.dataReceived2 = datachunker.DataChunker(self.dataReceiver())
self.traffic_happened = traffic_happened
self.ignore_trailing_payload = ignore_trailing_payload
def dataReceived(self, data):
self.traffic_happened.happened('p2p/in', len(data))
self.dataReceived2(data)
def dataReceiver(self):
while True:
start = ''
while start != self._message_prefix:
start = (start + (yield 1))[-len(self._message_prefix):]
command = (yield 12).rstrip('\0')
length, = struct.unpack('<I', (yield 4))
if length > self._max_payload_length:
print 'length too large'
continue
checksum = yield 4
payload = yield length
if hashlib.sha256(hashlib.sha256(payload).digest()).digest()[:4] != checksum:
print 'invalid hash for', self.transport.getPeer().host, repr(command), length, checksum.encode('hex')
if p2pool.DEBUG:
print hashlib.sha256(hashlib.sha256(payload).digest()).digest()[:4].encode('hex'), payload.encode('hex')
self.badPeerHappened()
continue
type_ = getattr(self, 'message_' + command, None)
if type_ is None:
if p2pool.DEBUG:
print 'no type for', repr(command)
continue
try:
self.packetReceived(command, type_.unpack(payload, self.ignore_trailing_payload))
except:
print 'RECV', command, payload[:100].encode('hex') + ('...' if len(payload) > 100 else '')
log.err(None, 'Error handling message: (see RECV line)')
self.disconnect()
def packetReceived(self, command, payload2):
handler = getattr(self, 'handle_' + command, None)
if handler is None:
if p2pool.DEBUG:
print 'no handler for', repr(command)
return
if getattr(self, 'connected', True) and not getattr(self, 'disconnecting', False):
handler(**payload2)
def disconnect(self):
if hasattr(self.transport, 'abortConnection'):
# Available since Twisted 11.1
self.transport.abortConnection()
else:
# This doesn't always close timed out connections! warned about in main
self.transport.loseConnection()
def badPeerHappened(self):
self.disconnect()
def sendPacket(self, command, payload2):
if len(command) >= 12:
raise ValueError('command too long')
type_ = getattr(self, 'message_' + command, None)
if type_ is None:
raise ValueError('invalid command')
#print 'SEND', command, repr(payload2)[:500]
payload = type_.pack(payload2)
if len(payload) > self._max_payload_length:
raise TooLong('payload too long')
data = self._message_prefix + struct.pack('<12sI', command, len(payload)) + hashlib.sha256(hashlib.sha256(payload).digest()).digest()[:4] + payload
self.traffic_happened.happened('p2p/out', len(data))
self.transport.write(data)
def __getattr__(self, attr):
prefix = 'send_'
if attr.startswith(prefix):
command = attr[len(prefix):]
return lambda **payload2: self.sendPacket(command, payload2)
#return protocol.Protocol.__getattr__(self, attr)
raise AttributeError(attr)
| gpl-3.0 |
gnieboer/tensorflow | tensorflow/contrib/tfprof/python/tools/tfprof/model_analyzer_test.py | 8 | 12550 | # Copyright 2016 The TensorFlow Authors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
# ==============================================================================
from __future__ import absolute_import
from __future__ import division
from __future__ import print_function
import os
from tensorflow.core.protobuf import config_pb2
from tensorflow.python.client import session
from tensorflow.python.framework import ops
from tensorflow.python.ops import variables
from tensorflow.python.platform import gfile
from tensorflow.python.platform import test
# XXX: this depends on pywrap_tensorflow and must come later
from tensorflow.contrib.tfprof.python.tools.tfprof import model_analyzer
from tensorflow.contrib.tfprof.python.tools.tfprof import model_analyzer_testlib as lib
class PrintModelAnalysisTest(test.TestCase):
def testDumpToFile(self):
ops.reset_default_graph()
opts = model_analyzer.TRAINABLE_VARS_PARAMS_STAT_OPTIONS
outfile = os.path.join(test.get_temp_dir(), 'dump')
opts['output'] = 'file:outfile=' + outfile
with session.Session() as sess, ops.device('/cpu:0'):
_ = lib.BuildSmallModel()
model_analyzer.print_model_analysis(sess.graph, tfprof_options=opts)
with gfile.Open(outfile, 'r') as f:
self.assertEqual(u'_TFProfRoot (--/451 params)\n'
' DW (3x3x3x6, 162/162 params)\n'
' DW2 (2x2x6x12, 288/288 params)\n'
' ScalarW (1, 1/1 params)\n',
f.read())
def testSelectEverything(self):
ops.reset_default_graph()
opts = model_analyzer.TRAINABLE_VARS_PARAMS_STAT_OPTIONS
outfile = os.path.join(test.get_temp_dir(), 'dump')
opts['output'] = 'file:outfile=' + outfile
opts['account_type_regexes'] = ['.*']
opts['select'] = [
'bytes', 'params', 'float_ops', 'num_hidden_ops', 'device', 'op_types'
]
with session.Session() as sess, ops.device('/cpu:0'):
x = lib.BuildSmallModel()
sess.run(variables.global_variables_initializer())
run_meta = config_pb2.RunMetadata()
_ = sess.run(x,
options=config_pb2.RunOptions(
trace_level=config_pb2.RunOptions.FULL_TRACE),
run_metadata=run_meta)
model_analyzer.print_model_analysis(
sess.graph, run_meta, tfprof_options=opts)
with gfile.Open(outfile, 'r') as f:
# pylint: disable=line-too-long
self.assertEqual(
'_TFProfRoot (0/451 params, 0/10.44k flops, 0B/5.28KB, _kTFScopeParent)\n Conv2D (0/0 params, 5.83k/5.83k flops, 432B/432B, /job:localhost/replica:0/task:0/cpu:0, /job:localhost/replica:0/task:0/cpu:0|Conv2D)\n Conv2D_1 (0/0 params, 4.61k/4.61k flops, 384B/384B, /job:localhost/replica:0/task:0/cpu:0, /job:localhost/replica:0/task:0/cpu:0|Conv2D)\n DW (3x3x3x6, 162/162 params, 0/0 flops, 648B/1.30KB, /job:localhost/replica:0/task:0/cpu:0, /job:localhost/replica:0/task:0/cpu:0|VariableV2|_trainable_variables)\n DW/Assign (0/0 params, 0/0 flops, 0B/0B, Assign)\n DW/Initializer (0/0 params, 0/0 flops, 0B/0B, _kTFScopeParent)\n DW/Initializer/random_normal (0/0 params, 0/0 flops, 0B/0B, Add)\n DW/Initializer/random_normal/RandomStandardNormal (0/0 params, 0/0 flops, 0B/0B, RandomStandardNormal)\n DW/Initializer/random_normal/mean (0/0 params, 0/0 flops, 0B/0B, Const)\n DW/Initializer/random_normal/mul (0/0 params, 0/0 flops, 0B/0B, Mul)\n DW/Initializer/random_normal/shape (0/0 params, 0/0 flops, 0B/0B, Const)\n DW/Initializer/random_normal/stddev (0/0 params, 0/0 flops, 0B/0B, Const)\n DW/read (0/0 params, 0/0 flops, 648B/648B, /job:localhost/replica:0/task:0/cpu:0, /job:localhost/replica:0/task:0/cpu:0|Identity)\n DW2 (2x2x6x12, 288/288 params, 0/0 flops, 1.15KB/2.30KB, /job:localhost/replica:0/task:0/cpu:0, /job:localhost/replica:0/task:0/cpu:0|VariableV2|_trainable_variables)\n DW2/Assign (0/0 params, 0/0 flops, 0B/0B, Assign)\n DW2/Initializer (0/0 params, 0/0 flops, 0B/0B, _kTFScopeParent)\n DW2/Initializer/random_normal (0/0 params, 0/0 flops, 0B/0B, Add)\n DW2/Initializer/random_normal/RandomStandardNormal (0/0 params, 0/0 flops, 0B/0B, RandomStandardNormal)\n DW2/Initializer/random_normal/mean (0/0 params, 0/0 flops, 0B/0B, Const)\n DW2/Initializer/random_normal/mul (0/0 params, 0/0 flops, 0B/0B, Mul)\n DW2/Initializer/random_normal/shape (0/0 params, 0/0 flops, 0B/0B, Const)\n DW2/Initializer/random_normal/stddev (0/0 params, 0/0 flops, 0B/0B, Const)\n DW2/read (0/0 params, 0/0 flops, 1.15KB/1.15KB, /job:localhost/replica:0/task:0/cpu:0, /job:localhost/replica:0/task:0/cpu:0|Identity)\n ScalarW (1, 1/1 params, 0/0 flops, 0B/0B, VariableV2|_trainable_variables)\n ScalarW/Assign (0/0 params, 0/0 flops, 0B/0B, Assign)\n ScalarW/Initializer (0/0 params, 0/0 flops, 0B/0B, _kTFScopeParent)\n ScalarW/Initializer/random_normal (0/0 params, 0/0 flops, 0B/0B, Add)\n ScalarW/Initializer/random_normal/RandomStandardNormal (0/0 params, 0/0 flops, 0B/0B, RandomStandardNormal)\n ScalarW/Initializer/random_normal/mean (0/0 params, 0/0 flops, 0B/0B, Const)\n ScalarW/Initializer/random_normal/mul (0/0 params, 0/0 flops, 0B/0B, Mul)\n ScalarW/Initializer/random_normal/shape (0/0 params, 0/0 flops, 0B/0B, Const)\n ScalarW/Initializer/random_normal/stddev (0/0 params, 0/0 flops, 0B/0B, Const)\n ScalarW/read (0/0 params, 0/0 flops, 0B/0B, Identity)\n init (0/0 params, 0/0 flops, 0B/0B, NoOp)\n zeros (0/0 params, 0/0 flops, 864B/864B, /job:localhost/replica:0/task:0/cpu:0, /job:localhost/replica:0/task:0/cpu:0|Const)\n',
f.read())
# pylint: enable=line-too-long
def testSimpleCodeView(self):
ops.reset_default_graph()
opts = model_analyzer.TRAINABLE_VARS_PARAMS_STAT_OPTIONS.copy()
outfile = os.path.join(test.get_temp_dir(), 'dump')
opts['output'] = 'file:outfile=' + outfile
opts['account_type_regexes'] = ['.*']
opts['show_name_regexes'] = ['.*model_analyzer_testlib.*']
opts['account_displayed_op_only'] = False
# TODO(xpan): Test 'micros'. Since the execution time changes each run,
# it's a bit difficult to test it now.
opts['select'] = [
'bytes', 'params', 'float_ops', 'num_hidden_ops', 'device',
]
with session.Session() as sess, ops.device('/cpu:0'):
x = lib.BuildSmallModel()
sess.run(variables.global_variables_initializer())
run_meta = config_pb2.RunMetadata()
_ = sess.run(x,
options=config_pb2.RunOptions(
trace_level=config_pb2.RunOptions.FULL_TRACE),
run_metadata=run_meta)
model_analyzer.print_model_analysis(
sess.graph, run_meta, tfprof_cmd='code', tfprof_options=opts)
with gfile.Open(outfile, 'r') as f:
# pylint: disable=line-too-long
self.assertEqual(
'_TFProfRoot (0/451 params, 0/10.44k flops, 0B/5.28KB)\n model_analyzer_testlib.py:33:BuildSmallModel:image = array_ops... (0/0 params, 0/0 flops, 0B/864B)\n model_analyzer_testlib.py:37:BuildSmallModel:initializer=init_... (0/1 params, 0/0 flops, 0B/0B)\n model_analyzer_testlib.py:41:BuildSmallModel:initializer=init_... (0/162 params, 0/0 flops, 0B/1.30KB)\n model_analyzer_testlib.py:42:BuildSmallModel:x = nn_ops.conv2d... (0/0 params, 0/5.83k flops, 0B/432B)\n model_analyzer_testlib.py:46:BuildSmallModel:initializer=init_... (0/288 params, 0/0 flops, 0B/2.30KB)\n model_analyzer_testlib.py:47:BuildSmallModel:x = nn_ops.conv2d... (0/0 params, 0/4.61k flops, 0B/384B)\n',
f.read())
# pylint: enable=line-too-long
def testComplexCodeView(self):
ops.reset_default_graph()
opts = model_analyzer.TRAINABLE_VARS_PARAMS_STAT_OPTIONS.copy()
outfile = os.path.join(test.get_temp_dir(), 'dump')
opts['output'] = 'file:outfile=' + outfile
opts['account_type_regexes'] = ['.*']
opts['show_name_regexes'] = ['.*model_analyzer_testlib.py.*']
opts['account_displayed_op_only'] = False
opts['select'] = ['params', 'float_ops']
with session.Session() as sess, ops.device('/cpu:0'):
x = lib.BuildFullModel()
sess.run(variables.global_variables_initializer())
run_meta = config_pb2.RunMetadata()
_ = sess.run(x,
options=config_pb2.RunOptions(
trace_level=config_pb2.RunOptions.FULL_TRACE),
run_metadata=run_meta)
tfprof_node = model_analyzer.print_model_analysis(
sess.graph, run_meta, tfprof_cmd='code', tfprof_options=opts)
# pylint: disable=line-too-long
with gfile.Open(outfile, 'r') as f:
self.assertEqual(
'_TFProfRoot (0/2.84k params, 0/54.08k flops)\n model_analyzer_testlib.py:56:BuildFullModel:seq.append(array_... (0/1.80k params, 0/41.76k flops)\n model_analyzer_testlib.py:33:BuildSmallModel:image = array_ops... (0/0 params, 0/0 flops)\n model_analyzer_testlib.py:37:BuildSmallModel:initializer=init_... (0/4 params, 0/0 flops)\n model_analyzer_testlib.py:41:BuildSmallModel:initializer=init_... (0/648 params, 0/0 flops)\n model_analyzer_testlib.py:42:BuildSmallModel:x = nn_ops.conv2d... (0/0 params, 0/23.33k flops)\n model_analyzer_testlib.py:46:BuildSmallModel:initializer=init_... (0/1.15k params, 0/0 flops)\n model_analyzer_testlib.py:47:BuildSmallModel:x = nn_ops.conv2d... (0/0 params, 0/18.43k flops)\n model_analyzer_testlib.py:60:BuildFullModel:cell, array_ops.c... (0/1.04k params, 0/4.13k flops)\n model_analyzer_testlib.py:62:BuildFullModel:target = array_op... (0/0 params, 0/0 flops)\n model_analyzer_testlib.py:63:BuildFullModel:loss = nn_ops.l2_... (0/0 params, 0/0 flops)\n model_analyzer_testlib.py:65:BuildFullModel:return sgd_op.min... (0/0 params, 0/8.19k flops)\n',
f.read())
self.assertLess(0, tfprof_node.total_exec_micros)
self.assertEqual(2844, tfprof_node.total_parameters)
self.assertEqual(54080, tfprof_node.total_float_ops)
self.assertEqual(5, len(tfprof_node.children))
self.assertEqual('_TFProfRoot', tfprof_node.name)
self.assertEqual('model_analyzer_testlib.py:56:BuildFullModel:seq.append(array_...',
tfprof_node.children[0].name)
self.assertEqual('model_analyzer_testlib.py:60:BuildFullModel:cell, array_ops.c...',
tfprof_node.children[1].name)
self.assertEqual('model_analyzer_testlib.py:62:BuildFullModel:target = array_op...',
tfprof_node.children[2].name)
self.assertEqual('model_analyzer_testlib.py:63:BuildFullModel:loss = nn_ops.l2_...',
tfprof_node.children[3].name)
self.assertEqual('model_analyzer_testlib.py:65:BuildFullModel:return sgd_op.min...',
tfprof_node.children[4].name)
# pylint: enable=line-too-long
def testCodeViewLeafGraphNode(self):
ops.reset_default_graph()
opts = model_analyzer.TRAINABLE_VARS_PARAMS_STAT_OPTIONS.copy()
opts['account_type_regexes'] = ['.*']
opts['account_displayed_op_only'] = False
opts['select'] = [
'bytes', 'params', 'float_ops', 'num_hidden_ops', 'device'
]
with session.Session() as sess, ops.device('/cpu:0'):
x = lib.BuildSmallModel()
sess.run(variables.global_variables_initializer())
run_meta = config_pb2.RunMetadata()
_ = sess.run(x,
options=config_pb2.RunOptions(
trace_level=config_pb2.RunOptions.FULL_TRACE),
run_metadata=run_meta)
tfprof_node = model_analyzer.print_model_analysis(
sess.graph, run_meta, tfprof_cmd='code', tfprof_options=opts)
leaf = tfprof_node
while leaf.children:
self.assertEqual(0, len(leaf.graph_nodes))
leaf = leaf.children[0]
self.assertEqual(1, len(leaf.graph_nodes))
if __name__ == '__main__':
test.main()
| apache-2.0 |
SrNetoChan/Quantum-GIS | python/plugins/processing/tests/SagaAlgorithmsTest.py | 36 | 6002 | # -*- coding: utf-8 -*-
"""
***************************************************************************
SagaAlgorithmsTests.py
---------------------
Date : September 2017
Copyright : (C) 2017 by Alexander Bruy
Email : alexander dot bruy at gmail dot com
***************************************************************************
* *
* This program is free software; you can redistribute it and/or modify *
* it under the terms of the GNU General Public License as published by *
* the Free Software Foundation; either version 2 of the License, or *
* (at your option) any later version. *
* *
***************************************************************************
"""
__author__ = 'Alexander Bruy'
__date__ = 'September 2017'
__copyright__ = '(C) 2017, Alexander Bruy'
import os
import nose2
import shutil
import tempfile
from qgis.core import (QgsProcessingParameterNumber,
QgsProcessingParameterDefinition,
QgsVectorLayer,
QgsApplication,
QgsFeature,
QgsGeometry,
QgsPointXY,
QgsProcessingContext,
QgsProject,
QgsProcessingFeedback,
QgsProcessingFeatureSourceDefinition)
from qgis.testing import start_app, unittest
from processing.algs.saga.SagaParameters import Parameters, SagaImageOutputParam
import AlgorithmsTestBase
class TestSagaAlgorithms(unittest.TestCase, AlgorithmsTestBase.AlgorithmsTest):
@classmethod
def setUpClass(cls):
start_app()
from processing.core.Processing import Processing
Processing.initialize()
cls.cleanup_paths = []
cls.temp_dir = tempfile.mkdtemp()
cls.cleanup_paths.append(cls.temp_dir)
@classmethod
def tearDownClass(cls):
from processing.core.Processing import Processing
Processing.deinitialize()
for path in cls.cleanup_paths:
shutil.rmtree(path)
def test_definition_file(self):
return 'saga_algorithm_tests.yaml'
def test_is_parameter_line(self):
# Test determining whether a line is a parameter line
self.assertFalse(Parameters.is_parameter_line(''))
self.assertFalse(Parameters.is_parameter_line('xxxxxxxxx'))
self.assertTrue(Parameters.is_parameter_line('QgsProcessingParameterNumber|R_PERCTL_MIN|Percentiles Range for RED max|QgsProcessingParameterNumber.Integer|1|False|1|99'))
self.assertTrue(Parameters.is_parameter_line('*QgsProcessingParameterNumber|R_PERCTL_MIN|Percentiles Range for RED max|QgsProcessingParameterNumber.Integer|1|False|1|99'))
self.assertTrue(Parameters.is_parameter_line('SagaImageOutput|RGB|Output RGB'))
def test_param_line(self):
# Test creating a parameter from a description line
param = Parameters.create_parameter_from_line('QgsProcessingParameterNumber|R_PERCTL_MIN|Percentiles Range for RED max|QgsProcessingParameterNumber.Integer|1|False|1|99')
self.assertIsInstance(param, QgsProcessingParameterNumber)
self.assertEqual(param.name(), 'R_PERCTL_MIN')
self.assertEqual(param.description(), 'Percentiles Range for RED max')
self.assertEqual(param.dataType(), QgsProcessingParameterNumber.Integer)
self.assertFalse(param.flags() & QgsProcessingParameterDefinition.FlagOptional)
self.assertEqual(param.minimum(), 1)
self.assertEqual(param.maximum(), 99)
# Test SagaImageOutputParam line
param = Parameters.create_parameter_from_line('SagaImageOutput|RGB|Output RGB')
self.assertIsInstance(param, SagaImageOutputParam)
self.assertEqual(param.name(), 'RGB')
self.assertEqual(param.description(), 'Output RGB')
self.assertEqual(param.defaultFileExtension(), 'tif')
self.assertEqual(param.supportedOutputRasterLayerExtensions(), ['tif'])
def test_non_ascii_output(self):
# create a memory layer and add to project and context
layer = QgsVectorLayer("Point?crs=epsg:3857&field=fldtxt:string&field=fldint:integer",
"testmem", "memory")
self.assertTrue(layer.isValid())
pr = layer.dataProvider()
f = QgsFeature()
f.setAttributes(["test", 123])
f.setGeometry(QgsGeometry.fromPointXY(QgsPointXY(100, 200)))
f2 = QgsFeature()
f2.setAttributes(["test2", 457])
f2.setGeometry(QgsGeometry.fromPointXY(QgsPointXY(110, 200)))
self.assertTrue(pr.addFeatures([f, f2]))
self.assertEqual(layer.featureCount(), 2)
QgsProject.instance().addMapLayer(layer)
context = QgsProcessingContext()
context.setProject(QgsProject.instance())
alg = QgsApplication.processingRegistry().createAlgorithmById('saga:fixeddistancebuffer')
self.assertIsNotNone(alg)
temp_file = os.path.join(self.temp_dir, 'non_ascii_ñññ.shp')
parameters = {'SHAPES': 'testmem',
'DIST_FIELD_DEFAULT': 5,
'NZONES': 1,
'DARC': 5,
'DISSOLVE': False,
'POLY_INNER': False,
'BUFFER': temp_file}
feedback = QgsProcessingFeedback()
results, ok = alg.run(parameters, context, feedback)
self.assertTrue(ok)
self.assertTrue(os.path.exists(temp_file))
# make sure that layer has correct features
res = QgsVectorLayer(temp_file, 'res')
self.assertTrue(res.isValid())
self.assertEqual(res.featureCount(), 2)
QgsProject.instance().removeMapLayer(layer)
if __name__ == '__main__':
nose2.main()
| gpl-2.0 |
ngmiller/mipsy | mipsy/encoder.py | 1 | 8100 | """
mipsy.encoder
Instruction encoder.
See README.md for usage and general information.
"""
# system imports
import bitstring
# application imports
from mipsy.arch import MIPS
from mipsy.util import LabelCache, ParseInfo
class Encoder(object):
"""
Responsible for encoding individual instructions and querying the label cache.
"""
class tokenizer(object):
"""
Defines a 'list' of tokenizing functions used for varying instructions.
Each 'tokenizer' returns a dictionary mapping the specified operands to their tokens
from the instruction data (the portion of the instruction following the operation)
instruction = (operation) (instruction_data) <-- here, we're only concerned with instruction_data
"""
def map_operands(self, to_split, operands):
"""
Helper method.
Maps operands to the preprocessed instruction data string.
"""
operand_values = to_split.split()
if len(operands) != len(operand_values):
raise RuntimeError('instruction contains too many operands')
operand_map = {}
for i in range(len(operands)):
operand_map[operands[i]] = operand_values[i]
return operand_map
def RI_type(self, operands, instruction_data):
"""
The RI_type tokenizer takes instructions with the format:
(operation) [(operand1), (operand2), (operand3)]
"""
to_split = instruction_data.replace(',', ' ')
return self.map_operands(to_split, operands)
def J_type(self, operands, instruction_data):
"""
The J_type tokenizer takes jump (j, jal, jr) instructions
with the format:
(operation) [operand]
"""
return self.map_operands(instruction_data, operands)
def load_store(self, operands, instruction_data):
"""
The load_store tokenizer takes instructions with the format:
(operation) [operand1, (operand2)(operand3)]
"""
# Clear out commas and the parenthesis surrounding the base register
to_split = instruction_data.replace(',', ' ').replace('(', ' ').replace(')', ' ')
return self.map_operands(to_split, operands)
def nop(self, operands, instruction_data):
"""
The nop tokenizer simply maps all the given operands to register $zero.
"""
return {operand: '$zero' for operand in operands}
# The assembler operation table defines the parsing rules
# for a given instruction. The parsing rules are used to
# map tokens in the instruction string to register address
# and immediate value positions. (rs, rt, rd, etc)
t = tokenizer()
operations = {
'nop' : ParseInfo(['rd', 'rs', 'rt'], t.nop),
'add' : ParseInfo(['rd', 'rs', 'rt'], t.RI_type),
'addi' : ParseInfo(['rt', 'rs', 'imm'], t.RI_type),
'and' : ParseInfo(['rd', 'rs', 'rt'], t.RI_type),
'beq' : ParseInfo(['rs', 'rt', 'label'], t.RI_type),
'j' : ParseInfo(['label'], t.J_type),
'jal' : ParseInfo(['label'], t.J_type),
'jr' : ParseInfo(['rs'], t.RI_type),
'lw' : ParseInfo(['rt', 'imm', 'rs'], t.load_store),
'or' : ParseInfo(['rd', 'rs', 'rt'], t.RI_type),
'slt' : ParseInfo(['rd', 'rs', 'rt'], t.RI_type),
'sll' : ParseInfo(['rd', 'rt', 'shamt'], t.RI_type),
'sw' : ParseInfo(['rt', 'imm', 'rs'], t.load_store),
'sub' : ParseInfo(['rd', 'rs', 'rt'], t.RI_type),
# TODO ...
}
def __init__(self):
# ISA definitions
self.mips = MIPS()
# Label resolution cache
self.label_cache = LabelCache()
def encode_instruction(self, pc, instr):
"""
Given an instruction string, generate the encoded bit string.
PC (instruction index is used for branch label resolution)
"""
data = instr.split()
operation = data[0]
try:
mips_op_info = MIPS.operations[operation]
except KeyError, e:
raise RuntimeError('Unknown operation: {}'.format(operation))
# Grab the parsing info from the assembler operations table
# Generate the initial operand map using the specified tokenizer
parse_info = self.operations[operation]
encoding_map = parse_info.tokenizer(parse_info.tokens, ''.join(data[1:]))
# Get the binary equivalents of the operands and MIPS operation information
self.resolve_operands(encoding_map, operation, pc)
# Pull MIPS operation info into encoding map
self.resolve_operation_info(encoding_map, mips_op_info)
instruction = self.mips.generate_instruction(mips_op_info.format)
return instruction.encode(encoding_map)
def resolve_operation_info(self, encoding_map, mips_op_info):
"""
Adds the predefined operation info (opcode, funct) to the current encoding map.
"""
encoding_map['opcode'] = mips_op_info.opcode
encoding_map['funct'] = mips_op_info.funct
def resolve_operands(self, encoding_map, operation, pc):
"""
Converts generic register references (such as $t0, $t1, etc), immediate values, and jump addresses
to their binary equivalents.
"""
convert = Encoder.to_binary
branch_replace = False
jump_replace = False
for operand, value in encoding_map.iteritems():
if (operand == 'rs' or operand == 'rt' or operand == 'rd'):
encoding_map[operand] = MIPS.registers[value]
elif (operand == 'imm'):
encoding_map[operand] = convert(int(value), MIPS.IMMEDIATE_SIZE)
elif (operand == 'addr'):
encoding_map[operand] = convert(int(value), MIPS.ADDRESS_SIZE)
elif (operand == 'shamt'):
encoding_map[operand] = convert(int(value), MIPS.SHAMT_SIZE)
elif (operand == 'label'):
label = encoding_map[operand]
hit, index = self.label_cache.query(label)
if not hit:
raise RuntimeError('No address found for label: {}'.format(label))
if ((operation == 'beq') or (operation == 'bne')):
# Calculate the relative instruction offset. The MIPS ISA uses
# PC + 4 + (branch offset) to resolve branch targets.
if index > pc:
encoding_map[operand] = convert(index - pc - 1, MIPS.IMMEDIATE_SIZE)
elif index < pc:
encoding_map[operand] = convert((pc + 1) - index, MIPS.IMMEDIATE_SIZE)
else:
# Not sure why a branch would resolve to itself, but ok
# (PC + 4) - 4 =
encoding_map[operand] = convert(-1, MIPS.IMMEDIATE_SIZE)
branch_replace = True
elif ((operation == 'j') or (operation == 'jal')):
# Jump addresses are absolute
encoding_map[operand] = convert(index, MIPS.ADDRESS_SIZE)
jump_replace = True
# Need to convert references to 'label' back to references the instruction
# encoding string recognizes, otherwise we end up with the default value (zero)
# This doesn't feel very clean, but working on a fix.
if branch_replace:
encoding_map['imm'] = encoding_map['label']
elif jump_replace:
encoding_map['addr'] = encoding_map['label']
@staticmethod
def to_binary(decimal, length):
"""
Given a decimal, generate the binary equivalent string of
given length.
e.g. binary(2, 5) = 00010
"""
b = bitstring.Bits(int=decimal, length=length)
return b.bin
| mit |
atsolakid/edx-platform | common/djangoapps/dark_lang/tests.py | 80 | 10264 | """
Tests of DarkLangMiddleware
"""
from django.contrib.auth.models import User
from django.http import HttpRequest
import ddt
from django.test import TestCase
from mock import Mock
import unittest
from dark_lang.middleware import DarkLangMiddleware
from dark_lang.models import DarkLangConfig
# TODO PLAT-671 Import from Django 1.8
# from django.utils.translation import LANGUAGE_SESSION_KEY
from django_locale.trans_real import LANGUAGE_SESSION_KEY
from student.tests.factories import UserFactory
UNSET = object()
def set_if_set(dct, key, value):
"""
Sets ``key`` in ``dct`` to ``value``
unless ``value`` is ``UNSET``
"""
if value is not UNSET:
dct[key] = value
@ddt.ddt
class DarkLangMiddlewareTests(TestCase):
"""
Tests of DarkLangMiddleware
"""
def setUp(self):
super(DarkLangMiddlewareTests, self).setUp()
self.user = User()
self.user.save()
DarkLangConfig(
released_languages='rel',
changed_by=self.user,
enabled=True
).save()
def process_request(self, language_session_key=UNSET, accept=UNSET, preview_lang=UNSET, clear_lang=UNSET):
"""
Build a request and then process it using the ``DarkLangMiddleware``.
Args:
language_session_key (str): The language code to set in request.session[LANUGAGE_SESSION_KEY]
accept (str): The accept header to set in request.META['HTTP_ACCEPT_LANGUAGE']
preview_lang (str): The value to set in request.GET['preview_lang']
clear_lang (str): The value to set in request.GET['clear_lang']
"""
session = {}
set_if_set(session, LANGUAGE_SESSION_KEY, language_session_key)
meta = {}
set_if_set(meta, 'HTTP_ACCEPT_LANGUAGE', accept)
get = {}
set_if_set(get, 'preview-lang', preview_lang)
set_if_set(get, 'clear-lang', clear_lang)
request = Mock(
spec=HttpRequest,
session=session,
META=meta,
GET=get,
user=UserFactory()
)
self.assertIsNone(DarkLangMiddleware().process_request(request))
return request
def assertAcceptEquals(self, value, request):
"""
Assert that the HTML_ACCEPT_LANGUAGE header in request
is equal to value
"""
self.assertEquals(
value,
request.META.get('HTTP_ACCEPT_LANGUAGE', UNSET)
)
def test_empty_accept(self):
self.assertAcceptEquals(UNSET, self.process_request())
def test_wildcard_accept(self):
self.assertAcceptEquals('*', self.process_request(accept='*'))
def test_malformed_accept(self):
self.assertAcceptEquals('', self.process_request(accept='xxxxxxxxxxxx'))
self.assertAcceptEquals('', self.process_request(accept='en;q=1.0, es-419:q-0.8'))
def test_released_accept(self):
self.assertAcceptEquals(
'rel;q=1.0',
self.process_request(accept='rel;q=1.0')
)
def test_unreleased_accept(self):
self.assertAcceptEquals(
'rel;q=1.0',
self.process_request(accept='rel;q=1.0, unrel;q=0.5')
)
def test_accept_with_syslang(self):
self.assertAcceptEquals(
'en;q=1.0, rel;q=0.8',
self.process_request(accept='en;q=1.0, rel;q=0.8, unrel;q=0.5')
)
def test_accept_multiple_released_langs(self):
DarkLangConfig(
released_languages=('rel, unrel'),
changed_by=self.user,
enabled=True
).save()
self.assertAcceptEquals(
'rel;q=1.0, unrel;q=0.5',
self.process_request(accept='rel;q=1.0, unrel;q=0.5')
)
self.assertAcceptEquals(
'rel;q=1.0, unrel;q=0.5',
self.process_request(accept='rel;q=1.0, notrel;q=0.3, unrel;q=0.5')
)
self.assertAcceptEquals(
'rel;q=1.0, unrel;q=0.5',
self.process_request(accept='notrel;q=0.3, rel;q=1.0, unrel;q=0.5')
)
def test_accept_released_territory(self):
# We will munge 'rel-ter' to be 'rel', so the 'rel-ter'
# user will actually receive the released language 'rel'
# (Otherwise, the user will actually end up getting the server default)
self.assertAcceptEquals(
'rel;q=1.0, rel;q=0.5',
self.process_request(accept='rel-ter;q=1.0, rel;q=0.5')
)
def test_accept_mixed_case(self):
self.assertAcceptEquals(
'rel;q=1.0, rel;q=0.5',
self.process_request(accept='rel-TER;q=1.0, REL;q=0.5')
)
DarkLangConfig(
released_languages=('REL-TER'),
changed_by=self.user,
enabled=True
).save()
# Since we have only released "rel-ter", the requested code "rel" will
# fuzzy match to "rel-ter", in addition to "rel-ter" exact matching "rel-ter"
self.assertAcceptEquals(
'rel-ter;q=1.0, rel-ter;q=0.5',
self.process_request(accept='rel-ter;q=1.0, rel;q=0.5')
)
@ddt.data(
('es;q=1.0, pt;q=0.5', 'es-419;q=1.0'), # 'es' should get 'es-419', not English
('es-AR;q=1.0, pt;q=0.5', 'es-419;q=1.0'), # 'es-AR' should get 'es-419', not English
)
@ddt.unpack
def test_partial_match_es419(self, accept_header, expected):
# Release es-419
DarkLangConfig(
released_languages=('es-419, en'),
changed_by=self.user,
enabled=True
).save()
self.assertAcceptEquals(
expected,
self.process_request(accept=accept_header)
)
def test_partial_match_esar_es(self):
# If I release 'es', 'es-AR' should get 'es', not English
DarkLangConfig(
released_languages=('es, en'),
changed_by=self.user,
enabled=True
).save()
self.assertAcceptEquals(
'es;q=1.0',
self.process_request(accept='es-AR;q=1.0, pt;q=0.5')
)
@ddt.data(
# Test condition: If I release 'es-419, es, es-es'...
('es;q=1.0, pt;q=0.5', 'es;q=1.0'), # 1. es should get es
('es-419;q=1.0, pt;q=0.5', 'es-419;q=1.0'), # 2. es-419 should get es-419
('es-es;q=1.0, pt;q=0.5', 'es-es;q=1.0'), # 3. es-es should get es-es
)
@ddt.unpack
def test_exact_match_gets_priority(self, accept_header, expected):
# Release 'es-419, es, es-es'
DarkLangConfig(
released_languages=('es-419, es, es-es'),
changed_by=self.user,
enabled=True
).save()
self.assertAcceptEquals(
expected,
self.process_request(accept=accept_header)
)
@unittest.skip("This won't work until fallback is implemented for LA country codes. See LOC-86")
@ddt.data(
'es-AR', # Argentina
'es-PY', # Paraguay
)
def test_partial_match_es_la(self, latin_america_code):
# We need to figure out the best way to implement this. There are a ton of LA country
# codes that ought to fall back to 'es-419' rather than 'es-es'.
# http://unstats.un.org/unsd/methods/m49/m49regin.htm#americas
# If I release 'es, es-419'
# Latin American codes should get es-419
DarkLangConfig(
released_languages=('es, es-419'),
changed_by=self.user,
enabled=True
).save()
self.assertAcceptEquals(
'es-419;q=1.0',
self.process_request(accept='{};q=1.0, pt;q=0.5'.format(latin_america_code))
)
def assertSessionLangEquals(self, value, request):
"""
Assert that the LANGUAGE_SESSION_KEY set in request.session is equal to value
"""
self.assertEquals(
value,
request.session.get(LANGUAGE_SESSION_KEY, UNSET)
)
def test_preview_lang_with_released_language(self):
# Preview lang should always override selection.
self.assertSessionLangEquals(
'rel',
self.process_request(preview_lang='rel')
)
self.assertSessionLangEquals(
'rel',
self.process_request(preview_lang='rel', language_session_key='notrel')
)
def test_preview_lang_with_dark_language(self):
self.assertSessionLangEquals(
'unrel',
self.process_request(preview_lang='unrel')
)
self.assertSessionLangEquals(
'unrel',
self.process_request(preview_lang='unrel', language_session_key='notrel')
)
def test_clear_lang(self):
self.assertSessionLangEquals(
UNSET,
self.process_request(clear_lang=True)
)
self.assertSessionLangEquals(
UNSET,
self.process_request(clear_lang=True, language_session_key='rel')
)
self.assertSessionLangEquals(
UNSET,
self.process_request(clear_lang=True, language_session_key='unrel')
)
def test_disabled(self):
DarkLangConfig(enabled=False, changed_by=self.user).save()
self.assertAcceptEquals(
'notrel;q=0.3, rel;q=1.0, unrel;q=0.5',
self.process_request(accept='notrel;q=0.3, rel;q=1.0, unrel;q=0.5')
)
self.assertSessionLangEquals(
'rel',
self.process_request(clear_lang=True, language_session_key='rel')
)
self.assertSessionLangEquals(
'unrel',
self.process_request(clear_lang=True, language_session_key='unrel')
)
self.assertSessionLangEquals(
'rel',
self.process_request(preview_lang='unrel', language_session_key='rel')
)
def test_accept_chinese_language_codes(self):
DarkLangConfig(
released_languages=('zh-cn, zh-hk, zh-tw'),
changed_by=self.user,
enabled=True
).save()
self.assertAcceptEquals(
'zh-cn;q=1.0, zh-tw;q=0.5, zh-hk;q=0.3',
self.process_request(accept='zh-Hans;q=1.0, zh-Hant-TW;q=0.5, zh-HK;q=0.3')
)
| agpl-3.0 |
sunqb/oa_qian | flask/Lib/site-packages/unidecode/x07e.py | 252 | 4682 | data = (
'Xia ', # 0x00
'Yuan ', # 0x01
'Zong ', # 0x02
'Xu ', # 0x03
'Nawa ', # 0x04
'Odoshi ', # 0x05
'Geng ', # 0x06
'Sen ', # 0x07
'Ying ', # 0x08
'Jin ', # 0x09
'Yi ', # 0x0a
'Zhui ', # 0x0b
'Ni ', # 0x0c
'Bang ', # 0x0d
'Gu ', # 0x0e
'Pan ', # 0x0f
'Zhou ', # 0x10
'Jian ', # 0x11
'Cuo ', # 0x12
'Quan ', # 0x13
'Shuang ', # 0x14
'Yun ', # 0x15
'Xia ', # 0x16
'Shuai ', # 0x17
'Xi ', # 0x18
'Rong ', # 0x19
'Tao ', # 0x1a
'Fu ', # 0x1b
'Yun ', # 0x1c
'Zhen ', # 0x1d
'Gao ', # 0x1e
'Ru ', # 0x1f
'Hu ', # 0x20
'Zai ', # 0x21
'Teng ', # 0x22
'Xian ', # 0x23
'Su ', # 0x24
'Zhen ', # 0x25
'Zong ', # 0x26
'Tao ', # 0x27
'Horo ', # 0x28
'Cai ', # 0x29
'Bi ', # 0x2a
'Feng ', # 0x2b
'Cu ', # 0x2c
'Li ', # 0x2d
'Suo ', # 0x2e
'Yin ', # 0x2f
'Xi ', # 0x30
'Zong ', # 0x31
'Lei ', # 0x32
'Zhuan ', # 0x33
'Qian ', # 0x34
'Man ', # 0x35
'Zhi ', # 0x36
'Lu ', # 0x37
'Mo ', # 0x38
'Piao ', # 0x39
'Lian ', # 0x3a
'Mi ', # 0x3b
'Xuan ', # 0x3c
'Zong ', # 0x3d
'Ji ', # 0x3e
'Shan ', # 0x3f
'Sui ', # 0x40
'Fan ', # 0x41
'Shuai ', # 0x42
'Beng ', # 0x43
'Yi ', # 0x44
'Sao ', # 0x45
'Mou ', # 0x46
'Zhou ', # 0x47
'Qiang ', # 0x48
'Hun ', # 0x49
'Sem ', # 0x4a
'Xi ', # 0x4b
'Jung ', # 0x4c
'Xiu ', # 0x4d
'Ran ', # 0x4e
'Xuan ', # 0x4f
'Hui ', # 0x50
'Qiao ', # 0x51
'Zeng ', # 0x52
'Zuo ', # 0x53
'Zhi ', # 0x54
'Shan ', # 0x55
'San ', # 0x56
'Lin ', # 0x57
'Yu ', # 0x58
'Fan ', # 0x59
'Liao ', # 0x5a
'Chuo ', # 0x5b
'Zun ', # 0x5c
'Jian ', # 0x5d
'Rao ', # 0x5e
'Chan ', # 0x5f
'Rui ', # 0x60
'Xiu ', # 0x61
'Hui ', # 0x62
'Hua ', # 0x63
'Zuan ', # 0x64
'Xi ', # 0x65
'Qiang ', # 0x66
'Un ', # 0x67
'Da ', # 0x68
'Sheng ', # 0x69
'Hui ', # 0x6a
'Xi ', # 0x6b
'Se ', # 0x6c
'Jian ', # 0x6d
'Jiang ', # 0x6e
'Huan ', # 0x6f
'Zao ', # 0x70
'Cong ', # 0x71
'Jie ', # 0x72
'Jiao ', # 0x73
'Bo ', # 0x74
'Chan ', # 0x75
'Yi ', # 0x76
'Nao ', # 0x77
'Sui ', # 0x78
'Yi ', # 0x79
'Shai ', # 0x7a
'Xu ', # 0x7b
'Ji ', # 0x7c
'Bin ', # 0x7d
'Qian ', # 0x7e
'Lan ', # 0x7f
'Pu ', # 0x80
'Xun ', # 0x81
'Zuan ', # 0x82
'Qi ', # 0x83
'Peng ', # 0x84
'Li ', # 0x85
'Mo ', # 0x86
'Lei ', # 0x87
'Xie ', # 0x88
'Zuan ', # 0x89
'Kuang ', # 0x8a
'You ', # 0x8b
'Xu ', # 0x8c
'Lei ', # 0x8d
'Xian ', # 0x8e
'Chan ', # 0x8f
'Kou ', # 0x90
'Lu ', # 0x91
'Chan ', # 0x92
'Ying ', # 0x93
'Cai ', # 0x94
'Xiang ', # 0x95
'Xian ', # 0x96
'Zui ', # 0x97
'Zuan ', # 0x98
'Luo ', # 0x99
'Xi ', # 0x9a
'Dao ', # 0x9b
'Lan ', # 0x9c
'Lei ', # 0x9d
'Lian ', # 0x9e
'Si ', # 0x9f
'Jiu ', # 0xa0
'Yu ', # 0xa1
'Hong ', # 0xa2
'Zhou ', # 0xa3
'Xian ', # 0xa4
'He ', # 0xa5
'Yue ', # 0xa6
'Ji ', # 0xa7
'Wan ', # 0xa8
'Kuang ', # 0xa9
'Ji ', # 0xaa
'Ren ', # 0xab
'Wei ', # 0xac
'Yun ', # 0xad
'Hong ', # 0xae
'Chun ', # 0xaf
'Pi ', # 0xb0
'Sha ', # 0xb1
'Gang ', # 0xb2
'Na ', # 0xb3
'Ren ', # 0xb4
'Zong ', # 0xb5
'Lun ', # 0xb6
'Fen ', # 0xb7
'Zhi ', # 0xb8
'Wen ', # 0xb9
'Fang ', # 0xba
'Zhu ', # 0xbb
'Yin ', # 0xbc
'Niu ', # 0xbd
'Shu ', # 0xbe
'Xian ', # 0xbf
'Gan ', # 0xc0
'Xie ', # 0xc1
'Fu ', # 0xc2
'Lian ', # 0xc3
'Zu ', # 0xc4
'Shen ', # 0xc5
'Xi ', # 0xc6
'Zhi ', # 0xc7
'Zhong ', # 0xc8
'Zhou ', # 0xc9
'Ban ', # 0xca
'Fu ', # 0xcb
'Zhuo ', # 0xcc
'Shao ', # 0xcd
'Yi ', # 0xce
'Jing ', # 0xcf
'Dai ', # 0xd0
'Bang ', # 0xd1
'Rong ', # 0xd2
'Jie ', # 0xd3
'Ku ', # 0xd4
'Rao ', # 0xd5
'Die ', # 0xd6
'Heng ', # 0xd7
'Hui ', # 0xd8
'Gei ', # 0xd9
'Xuan ', # 0xda
'Jiang ', # 0xdb
'Luo ', # 0xdc
'Jue ', # 0xdd
'Jiao ', # 0xde
'Tong ', # 0xdf
'Geng ', # 0xe0
'Xiao ', # 0xe1
'Juan ', # 0xe2
'Xiu ', # 0xe3
'Xi ', # 0xe4
'Sui ', # 0xe5
'Tao ', # 0xe6
'Ji ', # 0xe7
'Ti ', # 0xe8
'Ji ', # 0xe9
'Xu ', # 0xea
'Ling ', # 0xeb
'[?] ', # 0xec
'Xu ', # 0xed
'Qi ', # 0xee
'Fei ', # 0xef
'Chuo ', # 0xf0
'Zhang ', # 0xf1
'Gun ', # 0xf2
'Sheng ', # 0xf3
'Wei ', # 0xf4
'Mian ', # 0xf5
'Shou ', # 0xf6
'Beng ', # 0xf7
'Chou ', # 0xf8
'Tao ', # 0xf9
'Liu ', # 0xfa
'Quan ', # 0xfb
'Zong ', # 0xfc
'Zhan ', # 0xfd
'Wan ', # 0xfe
'Lu ', # 0xff
)
| apache-2.0 |
rohit12/opencog | opencog/python/pln_old/examples/attentionallocation/socrates_attention_agent.py | 26 | 2275 | __author__ = 'sebastian'
from opencog.cogserver import MindAgent
from opencog.atomspace import types
from pln.chainers import Chainer
from pln.rules import *
class SocratesAgent(MindAgent):
def __init__(self):
self.chainer = None
def create_chainer(self, atomspace):
self.chainer = Chainer(atomspace,
agent=self,
stimulateAtoms=True,
preferAttentionalFocus=True,
allow_output_with_variables=True,
delete_temporary_variables=True)
self.chainer.add_rule(
GeneralEvaluationToMemberRule(self.chainer, 0, 2))
self.chainer.add_rule(MemberToInheritanceRule(self.chainer))
self.chainer.add_rule(
DeductionRule(self.chainer, types.InheritanceLink))
self.chainer.add_rule(
InheritanceToMemberRule(self.chainer))
self.chainer.add_rule(
MemberToEvaluationRule(self.chainer))
self.chainer.add_rule(
AbductionRule(self.chainer, types.InheritanceLink))
def run(self, atomspace):
if self.chainer is None:
self.create_chainer(atomspace)
print("PLN Chainer created.")
return
print("PLN continuing.")
# there is no query here, so it doesn't give any stimulus
if not check_result(atomspace):
result = self.chainer.forward_step()
return result
def check_result(atomspace):
"""
Searches for an instance of
EvaluationLink
PredicateNode "breathe"
ListLink
ConceptNode "Socrates"
ConceptNode "air"
"""
result_found = False
eval_links = atomspace.get_atoms_by_type(types.EvaluationLink)
for eval_link in eval_links:
out = atomspace.get_outgoing(eval_link.h)
if out[0].is_a(types.PredicateNode) and "breathe" in out[0].name\
and out[1].is_a(types.ListLink)\
and "Socrates" in out[1].out[0].name\
and "air" in out[1].out[1].name:
result_found = True
break
if result_found:
print("Result found? {0}.".format(result_found))
return result_found
| agpl-3.0 |
ARM-software/lisa | lisa/typeclass.py | 2 | 30480 | # SPDX-License-Identifier: Apache-2.0
#
# Copyright (C) 2020, Arm Limited and contributors.
#
# Licensed under the Apache License, Version 2.0 (the "License"); you may
# not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
#
"""
This module provides a trait system known as typeclasses in Haskell and Scala,
and known as trait in Rust.
The fundamental idea is to decouple the followings:
1. definition of an interface as a set of methods to implement.
2. implementation of the aforementioned methods for a given class.
3. the class definitions themselves.
Decoupling *2.* and *3.* allows providing implementation of the interface on
any type, including foreign types coming from other libraries, or even builtin
types. This is the core benefit from typeclasses as opposed to regular classes
in Object Oriented Programming. They allow extending existing types without
having to modify their inheritance hierarchy.
.. note:: The names of the concepts are drawn from Haskell typeclasses:
* *typeclass*: This is the description of an interface, as a set of mandatory
methods to implement, and optionally helper functions with default
implementations. It's pretty close in concept to abstract base classes.
* *superclass*: The mother typeclass of a given typeclass.
* *instance*: This is the implementation of a given typeclass for a given
(set of) type.
* *values*: Values as opposed to types. Since *instance* is already used to
refer to the implementation of a typeclass, we use the word *value*.
* *type*: That is just a type, also known as *class* in Python.
Here is an example on how to work with typeclasses as provided by this module::
from lisa.typeclass import TypeClass
class FooBar(TypeClass):
"Foobar interface"
# TypeClass.required is an equivalent of abc.abstractmethod: It forces
# implementations of a given set of method
@TypeClass.required
def my_method(self):
pass
# This helper can be used in the implementation of the typeclass, and
# can be overriden by any instance.
def extra_helper(self):
return 42
class ARandomClass:
"Just a random class, it could be anything"
pass
# ``types`` can be either a tuple of types or a single type
class ARandomClassFooBarInstance(FooBar, types=(ARandomClass, int)):
"Implement the FooBar typeclass for both ARandomClass type and int at once."
def my_method(self):
return 'ARandomClass or int value'
value = ARandomClass()
# Both are equivalent
# The @ version is more useful when combining multiple typeclasses on the fly
value_as_foobar = FooBar(value)
value_as_foobar = value @ FooBar
# Inplace variant allows to "cast" the value directly.
# These are all equivalent:
# value @= FooBar
# value = value @ FooBar
# value = FooBar(value)
# The typeclass machinery will dispatch the call to my_method() to the
# right implementation
value_as_foobar.my_method()
# We also implemented FooBar for int type
FooBar(3).my_method()
# Raises a TypeError, since there is no instance for float
FooBar(3.0).my_method()
# Add an instance of FooBar for float type
class FloatFooBarInstance(FooBar, types=float):
def my_method(self):
return 'float'
# Now works once we added the instance
FooBar(3.0).my_method()
Classmethod also work, so typeclasses can be used to define factory interfaces::
from lisa.typeclass import TypeClass
class FromString(TypeClass):
"Build a value by parsing a string"
@TypeClass.required
@classmethod
def from_str(cls, string):
pass
class IntFromStringInstance(FromString, types=int):
@classmethod
def from_str(cls, string):
# Although cls is a value of type TypeProxy, it can be called just
# like a regular class
return cls(string)
# Types can be cast just like values, so we can use the classmethods and
# the staticmethods on them as well
assert 33 == FromString(int).from_str('33')
A more advanced usage can involve a hierarchy of typeclasses that gets combined together::
from lisa.typeclass import TypeClass
class MyTP1(TypeClass):
@TypeClass.required
def meth1(self):
pass
@TypeClass.required
def another_meth(self):
pass
class MyTP2(TypeClass):
@TypeClass.required
def meth2(self):
pass
class IntTP1Instance(MyTP1, types=int):
def meth1(self):
return 'int'
def another_meth(self):
return 42
class IntTP2Instance(MyTP2, types=int):
def meth2(self):
return 'int'
# Reuse an existing function implementation
another_meth = IntTP1Instance.another_meth
# Both are equivalent and allow creating a typeclass that provides
# interfaces of both MyTP1 and MyTP2. If some methods are required by both
# MyTP1 and MyTP2, the conflict is detected and a TypeError is raised:
MyTP1AndMyTP2 = MyTP1 & MyTP2
# This combined typeclass will automatically get the instances from its
# superclasses
class MyTP1AndMyTP2(MyTP1, MyTP2):
pass
# All are equivalent
value = 2 @ (MyTP1 & MyTP2)
value = 2 @ MyTP1AndMyTP2
value = MyTP1AndMyTP2(2)
value = (MyTP1 & MyTP2)(2)
# We can now use the API of both MyTP1 and MyTP2
value.meth1()
value.meth2()
Note that it's possible to implement a typeclass for a type that has no values,
but for which ``isinstance(value, thetype)`` will return true. This can be
achieved using ``__instancecheck__`` or ``__subclasscheck__`` and is used in
particular by the abstract base classes provided by :mod:`collections.abc`.
:class:`lisa.generic.TypedList` is another example. Casting values "registered" as
instances of these types is expensive though, as validity of the cast depends
on the value itself. That means it's not possible to memoize the result of the
cast associated it with the type of the value.
One might wonder what casting a value to a typeclass gives. When possible, a
new value with a synthetic type is returned. That is implemented using a
shallow copy of the value, and then updating its ``__class__`` attribute. This
will provide native attribute lookup speed, and casting will be efficient. If
that is not possible (non-heap types, types using ``__slots__`` etc), an
instance of :class:`lisa.typeclass.ValueProxy` will be returned for values, and
a synthetic type will be created for types.
"""
import ast
import copy
import inspect
import itertools
import contextlib
import textwrap
from collections.abc import Iterable
from devlib.utils.misc import ranges_to_list
from lisa.utils import deduplicate
# TODO: revisit pylint annotation once this is solved:
# https://github.com/PyCQA/pylint/issues/1630
from lisa.generic import TypedList # pylint: disable=unused-import
class TypeClassMeta(type):
"""
Metaclass of all typeclasses.
This implements most of the typeclass magic.
:param name: Name of the typeclass or instance being created.
:type name: str
:param bases: tuple of superclasses of the typeclass being defined.
When an instance is created, bases must have exactly one element, which
is the typeclass being implemented.
:type bases: tuple(type)
:param dct: Dictionary of attributes defined in the body of the ``class``
statement.
:type dct: dict(str, object)
:param types: Type or tuple of types for which the typeclass instance is
provided.
:type types: type or tuple(type) or None
"""
# Python <= 3.5 does cannot cope with custom arguments passed to
# type.__init__(), so filter them out:
# https://stackoverflow.com/questions/27258557/how-to-pass-arguments-to-the-metaclass-from-the-class-definition-in-python-3-x/27259275#27259275
def __init__(cls, name, bases, dct, *args, types=None, **kwargs):
# pylint: disable=unused-argument
super().__init__(name, bases, dct)
def __new__(cls, name, bases, dct, *args, types=None, **kwargs):
try:
typeclass = bases[0]
# That's TypeClass itself
except IndexError:
return super().__new__(cls, name, bases, dct, *args, **kwargs)
# That's a typeclass being defined
if types is None:
dct.update(
INSTANCES={},
DEFAULTS={},
REQUIRED=dict(),
)
superclasses = deduplicate(bases, keep_last=False)
with contextlib.suppress(ValueError):
superclasses.remove(TypeClass)
dct['SUPERCLASSES'] = superclasses
for typeclass in superclasses:
conflicting = {
name
for name in dct['REQUIRED'].keys() & typeclass.REQUIRED.keys()
# If required method was specified in a base typeclass that
# happens to be shared, there is no problem
if dct['REQUIRED'][name] is not typeclass.REQUIRED[name]
}
if conflicting:
def flatten(l):
return list(itertools.chain.from_iterable(l))
# DFS traversal of superclass hierarchy, removing
# intermediate node that are just there to merge parent
# nodes without adding anything else. This avoids having
# intermediate classes created by __and__ for example, for
# better error reporting.
def expand(superclass):
# If that typeclass is an empty shim that just combines other typeclasses
if not (superclass.__dict__.keys() - _EmptyTypeClass.__dict__.keys()):
return flatten(map(expand, superclass.SUPERCLASSES))
else:
return [superclass]
superclasses = flatten(map(expand, superclasses))
superclasses = deduplicate(superclasses, keep_last=False)
def format_method(name):
return '{} (defined in: {} and {})'.format(
name,
dct['REQUIRED'][name].__qualname__,
typeclass.REQUIRED[name].__qualname__,
)
raise TypeError('Cannot merge typeclasses {} since the following methods conflict: {}'.format(
', '.join(sorted(tp.__qualname__ for tp in superclasses)),
', '.join(map(format_method, sorted(conflicting))),
))
else:
dct['DEFAULTS'].update(typeclass.DEFAULTS)
dct['REQUIRED'].update(typeclass.REQUIRED)
typeclass = super().__new__(cls, name, bases, dct, *args, **kwargs)
typeclass.REQUIRED.update({
name: typeclass
for name, attr in dct.items()
if getattr(attr, '__required__', False)
})
not_copied = set(dict(inspect.getmembers(_EmptyTypeClass)).keys())
not_copied |= dct['REQUIRED'].keys() | {'__qualname__', '__name__'}
typeclass.DEFAULTS.update({
attr: val
for attr, val in dct.items()
if attr not in not_copied
})
return typeclass
# Someone tries to inherit from the typeclass to make an instance
else:
if len(bases) != 1:
raise TypeError('A typeclass instance can only implement the methods of one typeclass, but multiple typeclasses were provided: {}'.format(
', '.join(sorted(base.__qualname__ for base in bases))
))
missing = typeclass.REQUIRED.keys() - dct.keys()
if missing:
raise NotImplementedError('Following methods are missing in {} instance and must be defined for instances of the {} typeclass: {}'.format(
name,
typeclass.__name__,
', '.join(sorted(missing)),
))
# Merge-in the typeclass default implementations before using it,
# so each instance contains all the methods of the typeclass
dct = {**typeclass.DEFAULTS, **dct}
types = types if isinstance(types, Iterable) else [types]
for type_ in types:
# Create an instance for each type, with the type as base class.
bases = (type_,)
try:
instance = type(name, bases, dct, *args, **kwargs)
# Some classes like bool cannot be subclassed. Work around by
# listing all their attributes and making a new class that has
# all of them.
except TypeError:
total_dct = {**dict(inspect.getmembers(type_)), **dct}
instance = type(name, tuple(), total_dct, *args, **kwargs)
typeclass.INSTANCES[type_] = (instance, dct)
# Monkey patch the types so that the typeclass methods can be
# called "natively" on them if wanted
get_top_package = lambda mod: mod.split('.')[0]
# Only add the attribute if it does not exist already on the
# target class
def update_attr(attr, val):
# pylint: disable=cell-var-from-loop
if not hasattr(type_, attr):
setattr(type_, attr, val)
# If the instance is declared in the same top-level package,
# update the type itself. This prevents foreign packages from
# monkey patching types but allows instances anywhere in a
# given package
if get_top_package(type_.__module__) == dct['__module__']:
# Then the attributes defined in the instance
for attr, val in dct.items():
update_attr(attr, val)
# We scavanged all what we needed, the class has just been used to
# as a vehicle to create a scope but will not be used directly. It
# will still live a secrete life internally for casting though.
#
# Instead, return a class that is equivalent to the typeclass but
# with the docstring of the instance. This allows Sphinx to pick up
# the instance's docstring.
dct = {**dct, **{'__doc__': dct.get('__doc__')}}
return type(name, (typeclass,), dct)
@staticmethod
def required(f):
"""
Decorator used in a typeclass to flag a method to be required to be
implemented by all instances.
This is very similar to :func:`abc.abstractmethod`.
"""
f.__required__ = True
return f
def __matmul__(cls, obj):
"""
Use the matrix multiplication operator (``@``) as a "cast" operator, to
cast a value or a type to a typeclass.
"""
# pylint: disable=no-value-for-parameter
return cls(obj)
# Also makes it work when operands are swapped.
__rmatmul__ = __matmul__
def __and__(cls, other):
"""
Allow quick combination of multiple typeclasses with bitwise ``&``
operator.
"""
class Combined(cls, other):
pass
return Combined
class TypeClass(metaclass=TypeClassMeta):
"""
Base class to inherit from to define a new typeclass.
"""
def __new__(cls, obj):
safe_to_memoize, instance, dct = cls._find_instance_dct(obj) # pylint: disable=unused-variable
# Shallow copy to allow "casting" to the right type. Using a made-up
# class allows piggy backing on regular attribute lookup, which is much
# faster than any pure-python __getattribute__ implementation
try:
new_obj = obj.__class__.__new__(obj.__class__)
# Objects using __slots__ are not really handled anyway since
# changing __class__ on them can lead to segfault in the
# interpreter
new_obj.__dict__ = copy.copy(obj.__dict__)
new_obj.__class__ = instance
# If obj.__class__ is not a heap type, it's not possible to "cast" the
# value by modifying __class__ parameter (TypeError). Instead, we make
# a proxy object, that has the typeclass attribute lookup implemented
# with __getattribute__
#
# AttributeError can be raised if there is no __dict__ (e.g. if using
# __slots__).
except (TypeError, AttributeError):
# Wrap the object in a proxy value that will implement the
# typeclass-aware attribute lookup
if isinstance(obj, type):
new_obj = cls._make_type_proxy(obj, dct)
else:
new_obj = ValueProxy(obj, dct)
return new_obj
@staticmethod
def _make_type_proxy(obj, dct):
"""
Make a proxy object for given type.
The proxy is itself a type inheriting from the original type, along
with all the methods in ``dct``. ``__call__`` is overrident in the
metaclass to make sure that invoking the type will yield instances of
the original type.
"""
class TypeProxyMeta(type):
def __instancecheck__(cls, x):
return isinstance(x, obj)
def __subclasscheck__(cls, x):
return issubclass(x, obj)
# Allow calling the class as usual, which is necessary to
# use factory classmethod that return new instances
# (alternative constructors).
__call__ = obj.__call__
class TypeProxyBase(metaclass=TypeProxyMeta):
pass
try:
class TypeProxy(obj, TypeProxyBase):
pass
# If we cannot inherit from the class (like bool), pick the first base
# class that is suitable. That is a tad ugly but better than nothing
except TypeError:
# Make sure we get all the methods as on the original type we
# wanted to subclass
dct = {**dict(inspect.getmembers(obj)), **dct}
for obj_ in inspect.getmro(obj):
try:
class TypeProxy(obj_, TypeProxyBase):
pass
except TypeError:
continue
else:
break
for attr, val in dct.items():
with contextlib.suppress(TypeError, AttributeError):
setattr(TypeProxy, attr, val)
TypeProxy.__name__ = obj.__name__
TypeProxy.__qualname__ = obj.__qualname__
return TypeProxy
@classmethod
def _find_instance_dct(cls, obj):
"""
Find the relevant instance and attribute dictionary for the given object.
"""
from_type = isinstance(obj, type)
if from_type:
type_ = obj
else:
type_ = obj.__class__
safe_to_memoize = True
leaf_instance = None
# Find the most derived class (according to MRO) with an instance
# implemented for that typeclass
for i, base in enumerate(type_.__mro__):
try:
instance, dct = cls.INSTANCES[base]
except KeyError:
pass
else:
# We got a "perfect" match on the first item of the MRO (a leaf
# in class hierarchy), so we wont need to create any wrapper
# class
if i == 0:
leaf_instance = instance
break
# No instance was registered already
else:
# If we do have superclasses, we find their instance for the type
# at hand and merge their dict
dct = {}
# Traverse the superclasses in reverse order, so that the leftmost
# superclass has priority. This matches usual inheritance
# precedence rule (i.e. MRO computed according to the C3 class
# graph linearization algo).
for typeclass in reversed(cls.SUPERCLASSES):
safe_to_memoize_, instance_, dct_ = typeclass._find_instance_dct(obj) # pylint: disable=unused-variable
dct.update(dct_)
# As soon as part of the methods are not safe to memoize, the
# whole instance becomes unsafe
safe_to_memoize &= safe_to_memoize_
# Attempt with isinstance. It may succeed since some
# classes register themselves as base classes without appearing
# in the MRO of the "subclass". This can happen when
# implementing __subclasscheck__ or __instancecheck__, such as
# in abc.ABCMeta .
instances = {
instance: dct
for cls, (instance, dct) in cls.INSTANCES.items()
if isinstance(obj, cls)
}
if instances:
# Do not register a new instance, since it's value-dependent.
# Therefore, it has to be re-evaluated for every new value
safe_to_memoize = False
# Check that all dct are the same. If not, there is no way of
# choosing one over the others, so we bail out
dct_list = list(instances.values())
if all(dct1 is dct2 for dct1, dct2 in zip(dct_list, dct_list[1:])):
dct.update(dct_list[0])
else:
# TODO: attempt to find the most derived class among
#instances.keys(). If there is no most derived class,
#then raise the exception.
raise TypeError('Ambiguous instance for {} typeclass: {} could all be used'.format(
cls.__name__,
', '.join(sorted(cls.__name__ for cls in instances.keys()))
))
else:
# Check if all the required
# methods are actually implemented. If so, it's enough to proceed.
dct.update({
attr: getattr(type_, attr)
for attr in cls.REQUIRED.keys()
if hasattr(type_, attr)
})
# If there are some missing methods, then we cannot infer any
# instance
if cls.REQUIRED.keys() > dct.keys():
raise NotImplementedError(f'No instance of {cls.__name__} typeclass for {type_.__name__} type')
# If all required methods are there, carry on with that
else:
dct = {**cls.DEFAULTS, **dct}
if leaf_instance:
instance = leaf_instance
else:
# Since no existing instance was registered for the specific class
# of the object, we create a synthetic one for it, so attribute
# resolution works as expected
instance_name = f'{cls.__qualname__}InstanceOf{obj.__class__.__name__}'
instance = type(instance_name, (obj.__class__,), dct)
# Register that instance for faster future lookup
if safe_to_memoize:
cls.INSTANCES[type_] = (instance, dct)
return (safe_to_memoize, instance, dct)
class ValueProxy:
"""
Values of this class are returned when casting a value to a typeclass, if
the value does not support shallow copy or ``__class__`` attribute
assignment.
It implements the modified attribute lookup, so we can use the typeclass
methods. All other attribute lookups will go through untouched, except
magic methods lookup (also known as dunder names).
"""
def __init__(self, obj, dct):
self._obj = obj
self._instance_dct = dct
def __getattribute__(self, attr):
get = super().__getattribute__
dct = get('_instance_dct')
obj = get('_obj')
try:
val = dct[attr]
# If that is not an method of the typeclass instance, fallback to
# regular attribute lookup
except KeyError:
return obj.__class__.__getattribute__(obj, attr)
# Otherwise, give priority to instance definition over inheritance
else:
# Bind descriptors
if hasattr(val, '__get__'):
if isinstance(obj, type):
# Bind to "self", so the method can use any other method of
# the typeclass
owner = self
value = None
else:
owner = obj.__class__
# Bind to "self", so the method can use any other method of
# the typeclass
value = self
return val.__get__(value, owner)
else:
return val
# Just to have something available to define the final _EmptyTypeClass
class _EmptyTypeClass:
pass
# Serves to know the base set of attributes to not copy over when instantiating
# the typeclass
class _EmptyTypeClass(TypeClass):
pass
class FromString(TypeClass):
"""
Build values by parsing a string.
"""
@TypeClass.required
@classmethod
def from_str(cls, string):
"""
Parse the given string into a value of ``cls``.
"""
pass
@TypeClass.required
@classmethod
def get_format_description(cls, short):
"""
Returns the description of the format parsed by :meth:`from_str`.
:param short: If ``True``, a short description should be returned.
Otherwise a more more lengthy description is acceptable
:type short: bool
"""
pass
class BuiltinFromStringInstance(FromString, types=(int, float, TypedList[float])):
"""
Parse the following types from a string:
* ``int``
* ``float``
* ``str``
Plus all the :class:`lisa.generic.TypedList` subtypes of the above types.
"""
@classmethod
def from_str(cls, string):
val = ast.literal_eval(string)
if not isinstance(val, cls):
raise ValueError(f'Value "{val}" is of type {type(val).__qualname__} but should be of type {cls.__qualname__}')
return val
@classmethod
def get_format_description(cls, short):
return cls.__name__
class BoolFromStringInstance(FromString, types=bool):
"""
Parse boolean from a string.
"""
@classmethod
def from_str(cls, string):
"""
Accepted formats (case insensitive):
* ``0``, ``n``, ``false``
* ``1``, ``y``, ``true``
"""
string = string.casefold().strip()
if string in ('0', 'n', 'false'):
return False
elif string in ('1', 'y', 'true'):
return True
else:
raise ValueError(f'Cannot parse string as a boolean: {string}')
@classmethod
def get_format_description(cls, short):
return 'bool'
class IntListFromStringInstance(FromString, types=TypedList[int]):
"""
Instance of :class:`lisa.typeclass.FromString` for :class:`int` type.
"""
@classmethod
def from_str(cls, string):
"""
Accepts following inputs:
* ``0``: a single integer
* ``4-0``: and inclusive range of integers
* ``1,2,10,55-99``: a comma separated list of the previous formats
"""
return ranges_to_list(string)
@classmethod
def get_format_description(cls, short):
if short:
return 'comma-separated integers'
else:
return textwrap.dedent("""
Can be any of:
* ``0``: a single integer
* ``4-0``: and inclusive range of integers
* ``1,2,10,55-99``: a comma separated list of the previous formats
""").strip()
class StrFromStringInstance(FromString, types=str):
"""
Instance of :class:`lisa.typeclass.FromString` for :class:`str` type.
"""
@classmethod
def from_str(cls, string):
return string
@classmethod
def get_format_description(cls, short):
return 'str'
class StrListFromStringInstance(FromString, types=TypedList[str]):
"""
Instance of :class:`lisa.typeclass.FromString` for :class:`str` type.
"""
@classmethod
def from_str(cls, string):
"""
The accepted format is a comma-separated list of string.
If commas are needed inside the string, you can use quoted string list
instead. Note that in this case, *all* items need to be quoted, like
``"foo,bar", "baz"``. Both single quotes and double quotes are accepted.
"""
# If quotes are found, parse it as a Python string literal after adding
# brackets around
if '"' in string or "'" in string:
string = '[' + string + ']'
l = ast.literal_eval(string)
return [str(x) for x in l]
# Otherwise, just split on commas
else:
return string.split(',')
@classmethod
def get_format_description(cls, short):
if short:
return 'comma-separated string'
else:
return textwrap.dedent("""
Can be either a comma separated string, or a comma-separated quoted
string if commas are needed inside elements.
""").strip()
# vim :set tabstop=4 shiftwidth=4 textwidth=80 expandtab
| apache-2.0 |
malayaleecoder/servo | tests/wpt/web-platform-tests/tools/pytest/testing/python/integration.py | 171 | 11677 | import pytest
from _pytest import python
from _pytest import runner
class TestOEJSKITSpecials:
def test_funcarg_non_pycollectobj(self, testdir): # rough jstests usage
testdir.makeconftest("""
import pytest
def pytest_pycollect_makeitem(collector, name, obj):
if name == "MyClass":
return MyCollector(name, parent=collector)
class MyCollector(pytest.Collector):
def reportinfo(self):
return self.fspath, 3, "xyz"
""")
modcol = testdir.getmodulecol("""
def pytest_funcarg__arg1(request):
return 42
class MyClass:
pass
""")
# this hook finds funcarg factories
rep = runner.collect_one_node(collector=modcol)
clscol = rep.result[0]
clscol.obj = lambda arg1: None
clscol.funcargs = {}
pytest._fillfuncargs(clscol)
assert clscol.funcargs['arg1'] == 42
def test_autouse_fixture(self, testdir): # rough jstests usage
testdir.makeconftest("""
import pytest
def pytest_pycollect_makeitem(collector, name, obj):
if name == "MyClass":
return MyCollector(name, parent=collector)
class MyCollector(pytest.Collector):
def reportinfo(self):
return self.fspath, 3, "xyz"
""")
modcol = testdir.getmodulecol("""
import pytest
@pytest.fixture(autouse=True)
def hello():
pass
def pytest_funcarg__arg1(request):
return 42
class MyClass:
pass
""")
# this hook finds funcarg factories
rep = runner.collect_one_node(modcol)
clscol = rep.result[0]
clscol.obj = lambda: None
clscol.funcargs = {}
pytest._fillfuncargs(clscol)
assert not clscol.funcargs
def test_wrapped_getfslineno():
def func():
pass
def wrap(f):
func.__wrapped__ = f
func.patchings = ["qwe"]
return func
@wrap
def wrapped_func(x, y, z):
pass
fs, lineno = python.getfslineno(wrapped_func)
fs2, lineno2 = python.getfslineno(wrap)
assert lineno > lineno2, "getfslineno does not unwrap correctly"
class TestMockDecoration:
def test_wrapped_getfuncargnames(self):
from _pytest.python import getfuncargnames
def wrap(f):
def func():
pass
func.__wrapped__ = f
return func
@wrap
def f(x):
pass
l = getfuncargnames(f)
assert l == ("x",)
def test_wrapped_getfuncargnames_patching(self):
from _pytest.python import getfuncargnames
def wrap(f):
def func():
pass
func.__wrapped__ = f
func.patchings = ["qwe"]
return func
@wrap
def f(x, y, z):
pass
l = getfuncargnames(f)
assert l == ("y", "z")
def test_unittest_mock(self, testdir):
pytest.importorskip("unittest.mock")
testdir.makepyfile("""
import unittest.mock
class T(unittest.TestCase):
@unittest.mock.patch("os.path.abspath")
def test_hello(self, abspath):
import os
os.path.abspath("hello")
abspath.assert_any_call("hello")
""")
reprec = testdir.inline_run()
reprec.assertoutcome(passed=1)
def test_unittest_mock_and_fixture(self, testdir):
pytest.importorskip("unittest.mock")
testdir.makepyfile("""
import os.path
import unittest.mock
import pytest
@pytest.fixture
def inject_me():
pass
@unittest.mock.patch.object(os.path, "abspath",
new=unittest.mock.MagicMock)
def test_hello(inject_me):
import os
os.path.abspath("hello")
""")
reprec = testdir.inline_run()
reprec.assertoutcome(passed=1)
def test_mock(self, testdir):
pytest.importorskip("mock", "1.0.1")
testdir.makepyfile("""
import os
import unittest
import mock
class T(unittest.TestCase):
@mock.patch("os.path.abspath")
def test_hello(self, abspath):
os.path.abspath("hello")
abspath.assert_any_call("hello")
def mock_basename(path):
return "mock_basename"
@mock.patch("os.path.abspath")
@mock.patch("os.path.normpath")
@mock.patch("os.path.basename", new=mock_basename)
def test_someting(normpath, abspath, tmpdir):
abspath.return_value = "this"
os.path.normpath(os.path.abspath("hello"))
normpath.assert_any_call("this")
assert os.path.basename("123") == "mock_basename"
""")
reprec = testdir.inline_run()
reprec.assertoutcome(passed=2)
calls = reprec.getcalls("pytest_runtest_logreport")
funcnames = [call.report.location[2] for call in calls
if call.report.when == "call"]
assert funcnames == ["T.test_hello", "test_someting"]
def test_mock_sorting(self, testdir):
pytest.importorskip("mock", "1.0.1")
testdir.makepyfile("""
import os
import mock
@mock.patch("os.path.abspath")
def test_one(abspath):
pass
@mock.patch("os.path.abspath")
def test_two(abspath):
pass
@mock.patch("os.path.abspath")
def test_three(abspath):
pass
""")
reprec = testdir.inline_run()
calls = reprec.getreports("pytest_runtest_logreport")
calls = [x for x in calls if x.when == "call"]
names = [x.nodeid.split("::")[-1] for x in calls]
assert names == ["test_one", "test_two", "test_three"]
def test_mock_double_patch_issue473(self, testdir):
pytest.importorskip("mock", "1.0.1")
testdir.makepyfile("""
from mock import patch
from pytest import mark
@patch('os.getcwd')
@patch('os.path')
@mark.slow
class TestSimple:
def test_simple_thing(self, mock_path, mock_getcwd):
pass
""")
reprec = testdir.inline_run()
reprec.assertoutcome(passed=1)
class TestReRunTests:
def test_rerun(self, testdir):
testdir.makeconftest("""
from _pytest.runner import runtestprotocol
def pytest_runtest_protocol(item, nextitem):
runtestprotocol(item, log=False, nextitem=nextitem)
runtestprotocol(item, log=True, nextitem=nextitem)
""")
testdir.makepyfile("""
import pytest
count = 0
req = None
@pytest.fixture
def fix(request):
global count, req
assert request != req
req = request
print ("fix count %s" % count)
count += 1
def test_fix(fix):
pass
""")
result = testdir.runpytest("-s")
result.stdout.fnmatch_lines("""
*fix count 0*
*fix count 1*
""")
result.stdout.fnmatch_lines("""
*2 passed*
""")
def test_pytestconfig_is_session_scoped():
from _pytest.python import pytestconfig
assert pytestconfig._pytestfixturefunction.scope == "session"
class TestNoselikeTestAttribute:
def test_module_with_global_test(self, testdir):
testdir.makepyfile("""
__test__ = False
def test_hello():
pass
""")
reprec = testdir.inline_run()
assert not reprec.getfailedcollections()
calls = reprec.getreports("pytest_runtest_logreport")
assert not calls
def test_class_and_method(self, testdir):
testdir.makepyfile("""
__test__ = True
def test_func():
pass
test_func.__test__ = False
class TestSome:
__test__ = False
def test_method(self):
pass
""")
reprec = testdir.inline_run()
assert not reprec.getfailedcollections()
calls = reprec.getreports("pytest_runtest_logreport")
assert not calls
def test_unittest_class(self, testdir):
testdir.makepyfile("""
import unittest
class TC(unittest.TestCase):
def test_1(self):
pass
class TC2(unittest.TestCase):
__test__ = False
def test_2(self):
pass
""")
reprec = testdir.inline_run()
assert not reprec.getfailedcollections()
call = reprec.getcalls("pytest_collection_modifyitems")[0]
assert len(call.items) == 1
assert call.items[0].cls.__name__ == "TC"
def test_class_with_nasty_getattr(self, testdir):
"""Make sure we handle classes with a custom nasty __getattr__ right.
With a custom __getattr__ which e.g. returns a function (like with a
RPC wrapper), we shouldn't assume this meant "__test__ = True".
"""
# https://github.com/pytest-dev/pytest/issues/1204
testdir.makepyfile("""
class MetaModel(type):
def __getattr__(cls, key):
return lambda: None
BaseModel = MetaModel('Model', (), {})
class Model(BaseModel):
__metaclass__ = MetaModel
def test_blah(self):
pass
""")
reprec = testdir.inline_run()
assert not reprec.getfailedcollections()
call = reprec.getcalls("pytest_collection_modifyitems")[0]
assert not call.items
@pytest.mark.issue351
class TestParameterize:
def test_idfn_marker(self, testdir):
testdir.makepyfile("""
import pytest
def idfn(param):
if param == 0:
return 'spam'
elif param == 1:
return 'ham'
else:
return None
@pytest.mark.parametrize('a,b', [(0, 2), (1, 2)], ids=idfn)
def test_params(a, b):
pass
""")
res = testdir.runpytest('--collect-only')
res.stdout.fnmatch_lines([
"*spam-2*",
"*ham-2*",
])
def test_idfn_fixture(self, testdir):
testdir.makepyfile("""
import pytest
def idfn(param):
if param == 0:
return 'spam'
elif param == 1:
return 'ham'
else:
return None
@pytest.fixture(params=[0, 1], ids=idfn)
def a(request):
return request.param
@pytest.fixture(params=[1, 2], ids=idfn)
def b(request):
return request.param
def test_params(a, b):
pass
""")
res = testdir.runpytest('--collect-only')
res.stdout.fnmatch_lines([
"*spam-2*",
"*ham-2*",
])
| mpl-2.0 |
xpol/gyp | pylib/gyp/mac_tool.py | 8 | 27016 | #!/usr/bin/env python
# Copyright (c) 2012 Google Inc. All rights reserved.
# Use of this source code is governed by a BSD-style license that can be
# found in the LICENSE file.
"""Utility functions to perform Xcode-style build steps.
These functions are executed via gyp-mac-tool when using the Makefile generator.
"""
import fcntl
import fnmatch
import glob
import json
import os
import plistlib
import re
import shutil
import string
import struct
import subprocess
import sys
import tempfile
def main(args):
executor = MacTool()
exit_code = executor.Dispatch(args)
if exit_code is not None:
sys.exit(exit_code)
class MacTool(object):
"""This class performs all the Mac tooling steps. The methods can either be
executed directly, or dispatched from an argument list."""
def Dispatch(self, args):
"""Dispatches a string command to a method."""
if len(args) < 1:
raise Exception("Not enough arguments")
method = "Exec%s" % self._CommandifyName(args[0])
return getattr(self, method)(*args[1:])
def _CommandifyName(self, name_string):
"""Transforms a tool name like copy-info-plist to CopyInfoPlist"""
return name_string.title().replace('-', '')
def ExecCopyBundleResource(self, source, dest, convert_to_binary):
"""Copies a resource file to the bundle/Resources directory, performing any
necessary compilation on each resource."""
convert_to_binary = convert_to_binary == 'True'
extension = os.path.splitext(source)[1].lower()
if os.path.isdir(source):
# Copy tree.
# TODO(thakis): This copies file attributes like mtime, while the
# single-file branch below doesn't. This should probably be changed to
# be consistent with the single-file branch.
if os.path.exists(dest):
shutil.rmtree(dest)
shutil.copytree(source, dest)
elif extension == '.xib':
return self._CopyXIBFile(source, dest)
elif extension == '.storyboard':
return self._CopyXIBFile(source, dest)
elif extension == '.strings' and not convert_to_binary:
self._CopyStringsFile(source, dest)
else:
if os.path.exists(dest):
os.unlink(dest)
shutil.copy(source, dest)
if convert_to_binary and extension in ('.plist', '.strings'):
self._ConvertToBinary(dest)
def _CopyXIBFile(self, source, dest):
"""Compiles a XIB file with ibtool into a binary plist in the bundle."""
# ibtool sometimes crashes with relative paths. See crbug.com/314728.
base = os.path.dirname(os.path.realpath(__file__))
if os.path.relpath(source):
source = os.path.join(base, source)
if os.path.relpath(dest):
dest = os.path.join(base, dest)
args = ['xcrun', 'ibtool', '--errors', '--warnings', '--notices']
if os.environ['XCODE_VERSION_ACTUAL'] > '0700':
args.extend(['--auto-activate-custom-fonts'])
if 'IPHONEOS_DEPLOYMENT_TARGET' in os.environ:
args.extend([
'--target-device', 'iphone', '--target-device', 'ipad',
'--minimum-deployment-target',
os.environ['IPHONEOS_DEPLOYMENT_TARGET'],
])
else:
args.extend([
'--target-device', 'mac',
'--minimum-deployment-target',
os.environ['MACOSX_DEPLOYMENT_TARGET'],
])
args.extend(['--output-format', 'human-readable-text', '--compile', dest,
source])
ibtool_section_re = re.compile(r'/\*.*\*/')
ibtool_re = re.compile(r'.*note:.*is clipping its content')
ibtoolout = subprocess.Popen(args, stdout=subprocess.PIPE)
current_section_header = None
for line in ibtoolout.stdout:
if ibtool_section_re.match(line):
current_section_header = line
elif not ibtool_re.match(line):
if current_section_header:
sys.stdout.write(current_section_header)
current_section_header = None
sys.stdout.write(line)
return ibtoolout.returncode
def _ConvertToBinary(self, dest):
subprocess.check_call([
'xcrun', 'plutil', '-convert', 'binary1', '-o', dest, dest])
def _CopyStringsFile(self, source, dest):
"""Copies a .strings file using iconv to reconvert the input into UTF-16."""
input_code = self._DetectInputEncoding(source) or "UTF-8"
# Xcode's CpyCopyStringsFile / builtin-copyStrings seems to call
# CFPropertyListCreateFromXMLData() behind the scenes; at least it prints
# CFPropertyListCreateFromXMLData(): Old-style plist parser: missing
# semicolon in dictionary.
# on invalid files. Do the same kind of validation.
import CoreFoundation
s = open(source, 'rb').read()
d = CoreFoundation.CFDataCreate(None, s, len(s))
_, error = CoreFoundation.CFPropertyListCreateFromXMLData(None, d, 0, None)
if error:
return
fp = open(dest, 'wb')
fp.write(s.decode(input_code).encode('UTF-16'))
fp.close()
def _DetectInputEncoding(self, file_name):
"""Reads the first few bytes from file_name and tries to guess the text
encoding. Returns None as a guess if it can't detect it."""
fp = open(file_name, 'rb')
try:
header = fp.read(3)
except:
fp.close()
return None
fp.close()
if header.startswith("\xFE\xFF"):
return "UTF-16"
elif header.startswith("\xFF\xFE"):
return "UTF-16"
elif header.startswith("\xEF\xBB\xBF"):
return "UTF-8"
else:
return None
def ExecCopyInfoPlist(self, source, dest, convert_to_binary, *keys):
"""Copies the |source| Info.plist to the destination directory |dest|."""
# Read the source Info.plist into memory.
fd = open(source, 'r')
lines = fd.read()
fd.close()
# Insert synthesized key/value pairs (e.g. BuildMachineOSBuild).
plist = plistlib.readPlistFromString(lines)
if keys:
plist = dict(plist.items() + json.loads(keys[0]).items())
lines = plistlib.writePlistToString(plist)
# Go through all the environment variables and replace them as variables in
# the file.
IDENT_RE = re.compile(r'[_/\s]')
for key in os.environ:
if key.startswith('_'):
continue
evar = '${%s}' % key
evalue = os.environ[key]
lines = string.replace(lines, evar, evalue)
# Xcode supports various suffices on environment variables, which are
# all undocumented. :rfc1034identifier is used in the standard project
# template these days, and :identifier was used earlier. They are used to
# convert non-url characters into things that look like valid urls --
# except that the replacement character for :identifier, '_' isn't valid
# in a URL either -- oops, hence :rfc1034identifier was born.
evar = '${%s:identifier}' % key
evalue = IDENT_RE.sub('_', os.environ[key])
lines = string.replace(lines, evar, evalue)
evar = '${%s:rfc1034identifier}' % key
evalue = IDENT_RE.sub('-', os.environ[key])
lines = string.replace(lines, evar, evalue)
# Remove any keys with values that haven't been replaced.
lines = lines.split('\n')
for i in range(len(lines)):
if lines[i].strip().startswith("<string>${"):
lines[i] = None
lines[i - 1] = None
lines = '\n'.join(filter(lambda x: x is not None, lines))
# Write out the file with variables replaced.
fd = open(dest, 'w')
fd.write(lines)
fd.close()
# Now write out PkgInfo file now that the Info.plist file has been
# "compiled".
self._WritePkgInfo(dest)
if convert_to_binary == 'True':
self._ConvertToBinary(dest)
def _WritePkgInfo(self, info_plist):
"""This writes the PkgInfo file from the data stored in Info.plist."""
plist = plistlib.readPlist(info_plist)
if not plist:
return
# Only create PkgInfo for executable types.
package_type = plist['CFBundlePackageType']
if package_type != 'APPL':
return
# The format of PkgInfo is eight characters, representing the bundle type
# and bundle signature, each four characters. If that is missing, four
# '?' characters are used instead.
signature_code = plist.get('CFBundleSignature', '????')
if len(signature_code) != 4: # Wrong length resets everything, too.
signature_code = '?' * 4
dest = os.path.join(os.path.dirname(info_plist), 'PkgInfo')
fp = open(dest, 'w')
fp.write('%s%s' % (package_type, signature_code))
fp.close()
def ExecFlock(self, lockfile, *cmd_list):
"""Emulates the most basic behavior of Linux's flock(1)."""
# Rely on exception handling to report errors.
fd = os.open(lockfile, os.O_RDONLY|os.O_NOCTTY|os.O_CREAT, 0o666)
fcntl.flock(fd, fcntl.LOCK_EX)
return subprocess.call(cmd_list)
def ExecFilterLibtool(self, *cmd_list):
"""Calls libtool and filters out '/path/to/libtool: file: foo.o has no
symbols'."""
libtool_re = re.compile(r'^.*libtool: (?:for architecture: \S* )?'
r'file: .* has no symbols$')
libtool_re5 = re.compile(
r'^.*libtool: warning for library: ' +
r'.* the table of contents is empty ' +
r'\(no object file members in the library define global symbols\)$')
env = os.environ.copy()
# Ref:
# http://www.opensource.apple.com/source/cctools/cctools-809/misc/libtool.c
# The problem with this flag is that it resets the file mtime on the file to
# epoch=0, e.g. 1970-1-1 or 1969-12-31 depending on timezone.
env['ZERO_AR_DATE'] = '1'
libtoolout = subprocess.Popen(cmd_list, stderr=subprocess.PIPE, env=env)
_, err = libtoolout.communicate()
for line in err.splitlines():
if not libtool_re.match(line) and not libtool_re5.match(line):
print >>sys.stderr, line
# Unconditionally touch the output .a file on the command line if present
# and the command succeeded. A bit hacky.
if not libtoolout.returncode:
for i in range(len(cmd_list) - 1):
if cmd_list[i] == "-o" and cmd_list[i+1].endswith('.a'):
os.utime(cmd_list[i+1], None)
break
return libtoolout.returncode
def ExecPackageIosFramework(self, framework):
# Find the name of the binary based on the part before the ".framework".
binary = os.path.basename(framework).split('.')[0]
module_path = os.path.join(framework, 'Modules');
if not os.path.exists(module_path):
os.mkdir(module_path)
module_template = 'framework module %s {\n' \
' umbrella header "%s.h"\n' \
'\n' \
' export *\n' \
' module * { export * }\n' \
'}\n' % (binary, binary)
module_file = open(os.path.join(module_path, 'module.modulemap'), "w")
module_file.write(module_template)
module_file.close()
def ExecPackageFramework(self, framework, version):
"""Takes a path to Something.framework and the Current version of that and
sets up all the symlinks."""
# Find the name of the binary based on the part before the ".framework".
binary = os.path.basename(framework).split('.')[0]
CURRENT = 'Current'
RESOURCES = 'Resources'
VERSIONS = 'Versions'
if not os.path.exists(os.path.join(framework, VERSIONS, version, binary)):
# Binary-less frameworks don't seem to contain symlinks (see e.g.
# chromium's out/Debug/org.chromium.Chromium.manifest/ bundle).
return
# Move into the framework directory to set the symlinks correctly.
pwd = os.getcwd()
os.chdir(framework)
# Set up the Current version.
self._Relink(version, os.path.join(VERSIONS, CURRENT))
# Set up the root symlinks.
self._Relink(os.path.join(VERSIONS, CURRENT, binary), binary)
self._Relink(os.path.join(VERSIONS, CURRENT, RESOURCES), RESOURCES)
# Back to where we were before!
os.chdir(pwd)
def _Relink(self, dest, link):
"""Creates a symlink to |dest| named |link|. If |link| already exists,
it is overwritten."""
if os.path.lexists(link):
os.remove(link)
os.symlink(dest, link)
def ExecCompileIosFrameworkHeaderMap(self, out, framework, *all_headers):
framework_name = os.path.basename(framework).split('.')[0]
all_headers = map(os.path.abspath, all_headers)
filelist = {}
for header in all_headers:
filename = os.path.basename(header)
filelist[filename] = header
filelist[os.path.join(framework_name, filename)] = header
WriteHmap(out, filelist)
def ExecCopyIosFrameworkHeaders(self, framework, *copy_headers):
header_path = os.path.join(framework, 'Headers');
if not os.path.exists(header_path):
os.makedirs(header_path)
for header in copy_headers:
shutil.copy(header, os.path.join(header_path, os.path.basename(header)))
def ExecCompileXcassets(self, keys, *inputs):
"""Compiles multiple .xcassets files into a single .car file.
This invokes 'actool' to compile all the inputs .xcassets files. The
|keys| arguments is a json-encoded dictionary of extra arguments to
pass to 'actool' when the asset catalogs contains an application icon
or a launch image.
Note that 'actool' does not create the Assets.car file if the asset
catalogs does not contains imageset.
"""
command_line = [
'xcrun', 'actool', '--output-format', 'human-readable-text',
'--compress-pngs', '--notices', '--warnings', '--errors',
]
is_iphone_target = 'IPHONEOS_DEPLOYMENT_TARGET' in os.environ
if is_iphone_target:
platform = os.environ['CONFIGURATION'].split('-')[-1]
if platform not in ('iphoneos', 'iphonesimulator'):
platform = 'iphonesimulator'
command_line.extend([
'--platform', platform, '--target-device', 'iphone',
'--target-device', 'ipad', '--minimum-deployment-target',
os.environ['IPHONEOS_DEPLOYMENT_TARGET'], '--compile',
os.path.abspath(os.environ['CONTENTS_FOLDER_PATH']),
])
else:
command_line.extend([
'--platform', 'macosx', '--target-device', 'mac',
'--minimum-deployment-target', os.environ['MACOSX_DEPLOYMENT_TARGET'],
'--compile',
os.path.abspath(os.environ['UNLOCALIZED_RESOURCES_FOLDER_PATH']),
])
if keys:
keys = json.loads(keys)
for key, value in keys.iteritems():
arg_name = '--' + key
if isinstance(value, bool):
if value:
command_line.append(arg_name)
elif isinstance(value, list):
for v in value:
command_line.append(arg_name)
command_line.append(str(v))
else:
command_line.append(arg_name)
command_line.append(str(value))
# Note: actool crashes if inputs path are relative, so use os.path.abspath
# to get absolute path name for inputs.
command_line.extend(map(os.path.abspath, inputs))
subprocess.check_call(command_line)
def ExecMergeInfoPlist(self, output, *inputs):
"""Merge multiple .plist files into a single .plist file."""
merged_plist = {}
for path in inputs:
plist = self._LoadPlistMaybeBinary(path)
self._MergePlist(merged_plist, plist)
plistlib.writePlist(merged_plist, output)
def ExecCodeSignBundle(self, key, entitlements, provisioning, path, preserve):
"""Code sign a bundle.
This function tries to code sign an iOS bundle, following the same
algorithm as Xcode:
1. pick the provisioning profile that best match the bundle identifier,
and copy it into the bundle as embedded.mobileprovision,
2. copy Entitlements.plist from user or SDK next to the bundle,
3. code sign the bundle.
"""
substitutions, overrides = self._InstallProvisioningProfile(
provisioning, self._GetCFBundleIdentifier())
entitlements_path = self._InstallEntitlements(
entitlements, substitutions, overrides)
args = ['codesign', '--force', '--sign', key]
if preserve == 'True':
args.extend(['--deep', '--preserve-metadata=identifier,entitlements'])
else:
args.extend(['--entitlements', entitlements_path])
args.extend(['--timestamp=none', path])
subprocess.check_call(args)
def _InstallProvisioningProfile(self, profile, bundle_identifier):
"""Installs embedded.mobileprovision into the bundle.
Args:
profile: string, optional, short name of the .mobileprovision file
to use, if empty or the file is missing, the best file installed
will be used
bundle_identifier: string, value of CFBundleIdentifier from Info.plist
Returns:
A tuple containing two dictionary: variables substitutions and values
to overrides when generating the entitlements file.
"""
source_path, provisioning_data, team_id = self._FindProvisioningProfile(
profile, bundle_identifier)
target_path = os.path.join(
os.environ['BUILT_PRODUCTS_DIR'],
os.environ['CONTENTS_FOLDER_PATH'],
'embedded.mobileprovision')
shutil.copy2(source_path, target_path)
substitutions = self._GetSubstitutions(bundle_identifier, team_id + '.')
return substitutions, provisioning_data['Entitlements']
def _FindProvisioningProfile(self, profile, bundle_identifier):
"""Finds the .mobileprovision file to use for signing the bundle.
Checks all the installed provisioning profiles (or if the user specified
the PROVISIONING_PROFILE variable, only consult it) and select the most
specific that correspond to the bundle identifier.
Args:
profile: string, optional, short name of the .mobileprovision file
to use, if empty or the file is missing, the best file installed
will be used
bundle_identifier: string, value of CFBundleIdentifier from Info.plist
Returns:
A tuple of the path to the selected provisioning profile, the data of
the embedded plist in the provisioning profile and the team identifier
to use for code signing.
Raises:
SystemExit: if no .mobileprovision can be used to sign the bundle.
"""
profiles_dir = os.path.join(
os.environ['HOME'], 'Library', 'MobileDevice', 'Provisioning Profiles')
if not os.path.isdir(profiles_dir):
print >>sys.stderr, (
'cannot find mobile provisioning for %s' % bundle_identifier)
sys.exit(1)
provisioning_profiles = None
if profile:
profile_path = os.path.join(profiles_dir, profile + '.mobileprovision')
if os.path.exists(profile_path):
provisioning_profiles = [profile_path]
if not provisioning_profiles:
provisioning_profiles = glob.glob(
os.path.join(profiles_dir, '*.mobileprovision'))
valid_provisioning_profiles = {}
for profile_path in provisioning_profiles:
profile_data = self._LoadProvisioningProfile(profile_path)
app_id_pattern = profile_data.get(
'Entitlements', {}).get('application-identifier', '')
for team_identifier in profile_data.get('TeamIdentifier', []):
app_id = '%s.%s' % (team_identifier, bundle_identifier)
if fnmatch.fnmatch(app_id, app_id_pattern):
valid_provisioning_profiles[app_id_pattern] = (
profile_path, profile_data, team_identifier)
if not valid_provisioning_profiles:
print >>sys.stderr, (
'cannot find mobile provisioning for %s' % bundle_identifier)
sys.exit(1)
# If the user has multiple provisioning profiles installed that can be
# used for ${bundle_identifier}, pick the most specific one (ie. the
# provisioning profile whose pattern is the longest).
selected_key = max(valid_provisioning_profiles, key=lambda v: len(v))
return valid_provisioning_profiles[selected_key]
def _LoadProvisioningProfile(self, profile_path):
"""Extracts the plist embedded in a provisioning profile.
Args:
profile_path: string, path to the .mobileprovision file
Returns:
Content of the plist embedded in the provisioning profile as a dictionary.
"""
with tempfile.NamedTemporaryFile() as temp:
subprocess.check_call([
'security', 'cms', '-D', '-i', profile_path, '-o', temp.name])
return self._LoadPlistMaybeBinary(temp.name)
def _MergePlist(self, merged_plist, plist):
"""Merge |plist| into |merged_plist|."""
for key, value in plist.iteritems():
if isinstance(value, dict):
merged_value = merged_plist.get(key, {})
if isinstance(merged_value, dict):
self._MergePlist(merged_value, value)
merged_plist[key] = merged_value
else:
merged_plist[key] = value
else:
merged_plist[key] = value
def _LoadPlistMaybeBinary(self, plist_path):
"""Loads into a memory a plist possibly encoded in binary format.
This is a wrapper around plistlib.readPlist that tries to convert the
plist to the XML format if it can't be parsed (assuming that it is in
the binary format).
Args:
plist_path: string, path to a plist file, in XML or binary format
Returns:
Content of the plist as a dictionary.
"""
try:
# First, try to read the file using plistlib that only supports XML,
# and if an exception is raised, convert a temporary copy to XML and
# load that copy.
return plistlib.readPlist(plist_path)
except:
pass
with tempfile.NamedTemporaryFile() as temp:
shutil.copy2(plist_path, temp.name)
subprocess.check_call(['plutil', '-convert', 'xml1', temp.name])
return plistlib.readPlist(temp.name)
def _GetSubstitutions(self, bundle_identifier, app_identifier_prefix):
"""Constructs a dictionary of variable substitutions for Entitlements.plist.
Args:
bundle_identifier: string, value of CFBundleIdentifier from Info.plist
app_identifier_prefix: string, value for AppIdentifierPrefix
Returns:
Dictionary of substitutions to apply when generating Entitlements.plist.
"""
return {
'CFBundleIdentifier': bundle_identifier,
'AppIdentifierPrefix': app_identifier_prefix,
}
def _GetCFBundleIdentifier(self):
"""Extracts CFBundleIdentifier value from Info.plist in the bundle.
Returns:
Value of CFBundleIdentifier in the Info.plist located in the bundle.
"""
info_plist_path = os.path.join(
os.environ['TARGET_BUILD_DIR'],
os.environ['INFOPLIST_PATH'])
info_plist_data = self._LoadPlistMaybeBinary(info_plist_path)
return info_plist_data['CFBundleIdentifier']
def _InstallEntitlements(self, entitlements, substitutions, overrides):
"""Generates and install the ${BundleName}.xcent entitlements file.
Expands variables "$(variable)" pattern in the source entitlements file,
add extra entitlements defined in the .mobileprovision file and the copy
the generated plist to "${BundlePath}.xcent".
Args:
entitlements: string, optional, path to the Entitlements.plist template
to use, defaults to "${SDKROOT}/Entitlements.plist"
substitutions: dictionary, variable substitutions
overrides: dictionary, values to add to the entitlements
Returns:
Path to the generated entitlements file.
"""
source_path = entitlements
target_path = os.path.join(
os.environ['BUILT_PRODUCTS_DIR'],
os.environ['PRODUCT_NAME'] + '.xcent')
if not source_path:
source_path = os.path.join(
os.environ['SDKROOT'],
'Entitlements.plist')
shutil.copy2(source_path, target_path)
data = self._LoadPlistMaybeBinary(target_path)
data = self._ExpandVariables(data, substitutions)
if overrides:
for key in overrides:
if key not in data:
data[key] = overrides[key]
plistlib.writePlist(data, target_path)
return target_path
def _ExpandVariables(self, data, substitutions):
"""Expands variables "$(variable)" in data.
Args:
data: object, can be either string, list or dictionary
substitutions: dictionary, variable substitutions to perform
Returns:
Copy of data where each references to "$(variable)" has been replaced
by the corresponding value found in substitutions, or left intact if
the key was not found.
"""
if isinstance(data, str):
for key, value in substitutions.iteritems():
data = data.replace('$(%s)' % key, value)
return data
if isinstance(data, list):
return [self._ExpandVariables(v, substitutions) for v in data]
if isinstance(data, dict):
return {k: self._ExpandVariables(data[k], substitutions) for k in data}
return data
def NextGreaterPowerOf2(x):
return 2**(x).bit_length()
def WriteHmap(output_name, filelist):
"""Generates a header map based on |filelist|.
Per Mark Mentovai:
A header map is structured essentially as a hash table, keyed by names used
in #includes, and providing pathnames to the actual files.
The implementation below and the comment above comes from inspecting:
http://www.opensource.apple.com/source/distcc/distcc-2503/distcc_dist/include_server/headermap.py?txt
while also looking at the implementation in clang in:
https://llvm.org/svn/llvm-project/cfe/trunk/lib/Lex/HeaderMap.cpp
"""
magic = 1751998832
version = 1
_reserved = 0
count = len(filelist)
capacity = NextGreaterPowerOf2(count)
strings_offset = 24 + (12 * capacity)
max_value_length = len(max(filelist.items(), key=lambda (k,v):len(v))[1])
out = open(output_name, "wb")
out.write(struct.pack('<LHHLLLL', magic, version, _reserved, strings_offset,
count, capacity, max_value_length))
# Create empty hashmap buckets.
buckets = [None] * capacity
for file, path in filelist.items():
key = 0
for c in file:
key += ord(c.lower()) * 13
# Fill next empty bucket.
while buckets[key & capacity - 1] is not None:
key = key + 1
buckets[key & capacity - 1] = (file, path)
next_offset = 1
for bucket in buckets:
if bucket is None:
out.write(struct.pack('<LLL', 0, 0, 0))
else:
(file, path) = bucket
key_offset = next_offset
prefix_offset = key_offset + len(file) + 1
suffix_offset = prefix_offset + len(os.path.dirname(path) + os.sep) + 1
next_offset = suffix_offset + len(os.path.basename(path)) + 1
out.write(struct.pack('<LLL', key_offset, prefix_offset, suffix_offset))
# Pad byte since next offset starts at 1.
out.write(struct.pack('<x'))
for bucket in buckets:
if bucket is not None:
(file, path) = bucket
out.write(struct.pack('<%ds' % len(file), file))
out.write(struct.pack('<s', '\0'))
base = os.path.dirname(path) + os.sep
out.write(struct.pack('<%ds' % len(base), base))
out.write(struct.pack('<s', '\0'))
path = os.path.basename(path)
out.write(struct.pack('<%ds' % len(path), path))
out.write(struct.pack('<s', '\0'))
if __name__ == '__main__':
sys.exit(main(sys.argv[1:]))
| bsd-3-clause |
mancoast/CPythonPyc_test | cpython/279_test_contextlib.py | 125 | 9103 | """Unit tests for contextlib.py, and other context managers."""
import sys
import tempfile
import unittest
from contextlib import * # Tests __all__
from test import test_support
try:
import threading
except ImportError:
threading = None
class ContextManagerTestCase(unittest.TestCase):
def test_contextmanager_plain(self):
state = []
@contextmanager
def woohoo():
state.append(1)
yield 42
state.append(999)
with woohoo() as x:
self.assertEqual(state, [1])
self.assertEqual(x, 42)
state.append(x)
self.assertEqual(state, [1, 42, 999])
def test_contextmanager_finally(self):
state = []
@contextmanager
def woohoo():
state.append(1)
try:
yield 42
finally:
state.append(999)
with self.assertRaises(ZeroDivisionError):
with woohoo() as x:
self.assertEqual(state, [1])
self.assertEqual(x, 42)
state.append(x)
raise ZeroDivisionError()
self.assertEqual(state, [1, 42, 999])
def test_contextmanager_no_reraise(self):
@contextmanager
def whee():
yield
ctx = whee()
ctx.__enter__()
# Calling __exit__ should not result in an exception
self.assertFalse(ctx.__exit__(TypeError, TypeError("foo"), None))
def test_contextmanager_trap_yield_after_throw(self):
@contextmanager
def whoo():
try:
yield
except:
yield
ctx = whoo()
ctx.__enter__()
self.assertRaises(
RuntimeError, ctx.__exit__, TypeError, TypeError("foo"), None
)
def test_contextmanager_except(self):
state = []
@contextmanager
def woohoo():
state.append(1)
try:
yield 42
except ZeroDivisionError, e:
state.append(e.args[0])
self.assertEqual(state, [1, 42, 999])
with woohoo() as x:
self.assertEqual(state, [1])
self.assertEqual(x, 42)
state.append(x)
raise ZeroDivisionError(999)
self.assertEqual(state, [1, 42, 999])
def _create_contextmanager_attribs(self):
def attribs(**kw):
def decorate(func):
for k,v in kw.items():
setattr(func,k,v)
return func
return decorate
@contextmanager
@attribs(foo='bar')
def baz(spam):
"""Whee!"""
return baz
def test_contextmanager_attribs(self):
baz = self._create_contextmanager_attribs()
self.assertEqual(baz.__name__,'baz')
self.assertEqual(baz.foo, 'bar')
@unittest.skipIf(sys.flags.optimize >= 2,
"Docstrings are omitted with -O2 and above")
def test_contextmanager_doc_attrib(self):
baz = self._create_contextmanager_attribs()
self.assertEqual(baz.__doc__, "Whee!")
class NestedTestCase(unittest.TestCase):
# XXX This needs more work
def test_nested(self):
@contextmanager
def a():
yield 1
@contextmanager
def b():
yield 2
@contextmanager
def c():
yield 3
with nested(a(), b(), c()) as (x, y, z):
self.assertEqual(x, 1)
self.assertEqual(y, 2)
self.assertEqual(z, 3)
def test_nested_cleanup(self):
state = []
@contextmanager
def a():
state.append(1)
try:
yield 2
finally:
state.append(3)
@contextmanager
def b():
state.append(4)
try:
yield 5
finally:
state.append(6)
with self.assertRaises(ZeroDivisionError):
with nested(a(), b()) as (x, y):
state.append(x)
state.append(y)
1 // 0
self.assertEqual(state, [1, 4, 2, 5, 6, 3])
def test_nested_right_exception(self):
@contextmanager
def a():
yield 1
class b(object):
def __enter__(self):
return 2
def __exit__(self, *exc_info):
try:
raise Exception()
except:
pass
with self.assertRaises(ZeroDivisionError):
with nested(a(), b()) as (x, y):
1 // 0
self.assertEqual((x, y), (1, 2))
def test_nested_b_swallows(self):
@contextmanager
def a():
yield
@contextmanager
def b():
try:
yield
except:
# Swallow the exception
pass
try:
with nested(a(), b()):
1 // 0
except ZeroDivisionError:
self.fail("Didn't swallow ZeroDivisionError")
def test_nested_break(self):
@contextmanager
def a():
yield
state = 0
while True:
state += 1
with nested(a(), a()):
break
state += 10
self.assertEqual(state, 1)
def test_nested_continue(self):
@contextmanager
def a():
yield
state = 0
while state < 3:
state += 1
with nested(a(), a()):
continue
state += 10
self.assertEqual(state, 3)
def test_nested_return(self):
@contextmanager
def a():
try:
yield
except:
pass
def foo():
with nested(a(), a()):
return 1
return 10
self.assertEqual(foo(), 1)
class ClosingTestCase(unittest.TestCase):
# XXX This needs more work
def test_closing(self):
state = []
class C:
def close(self):
state.append(1)
x = C()
self.assertEqual(state, [])
with closing(x) as y:
self.assertEqual(x, y)
self.assertEqual(state, [1])
def test_closing_error(self):
state = []
class C:
def close(self):
state.append(1)
x = C()
self.assertEqual(state, [])
with self.assertRaises(ZeroDivisionError):
with closing(x) as y:
self.assertEqual(x, y)
1 // 0
self.assertEqual(state, [1])
class FileContextTestCase(unittest.TestCase):
def testWithOpen(self):
tfn = tempfile.mktemp()
try:
f = None
with open(tfn, "w") as f:
self.assertFalse(f.closed)
f.write("Booh\n")
self.assertTrue(f.closed)
f = None
with self.assertRaises(ZeroDivisionError):
with open(tfn, "r") as f:
self.assertFalse(f.closed)
self.assertEqual(f.read(), "Booh\n")
1 // 0
self.assertTrue(f.closed)
finally:
test_support.unlink(tfn)
@unittest.skipUnless(threading, 'Threading required for this test.')
class LockContextTestCase(unittest.TestCase):
def boilerPlate(self, lock, locked):
self.assertFalse(locked())
with lock:
self.assertTrue(locked())
self.assertFalse(locked())
with self.assertRaises(ZeroDivisionError):
with lock:
self.assertTrue(locked())
1 // 0
self.assertFalse(locked())
def testWithLock(self):
lock = threading.Lock()
self.boilerPlate(lock, lock.locked)
def testWithRLock(self):
lock = threading.RLock()
self.boilerPlate(lock, lock._is_owned)
def testWithCondition(self):
lock = threading.Condition()
def locked():
return lock._is_owned()
self.boilerPlate(lock, locked)
def testWithSemaphore(self):
lock = threading.Semaphore()
def locked():
if lock.acquire(False):
lock.release()
return False
else:
return True
self.boilerPlate(lock, locked)
def testWithBoundedSemaphore(self):
lock = threading.BoundedSemaphore()
def locked():
if lock.acquire(False):
lock.release()
return False
else:
return True
self.boilerPlate(lock, locked)
# This is needed to make the test actually run under regrtest.py!
def test_main():
with test_support.check_warnings(("With-statements now directly support "
"multiple context managers",
DeprecationWarning)):
test_support.run_unittest(__name__)
if __name__ == "__main__":
test_main()
| gpl-3.0 |
Akson/RemoteConsolePlus3 | RemoteConsolePlus3/RCP3/Backends/Processors/Graphs/Plot1D.py | 1 | 2341 | #Created by Dmytro Konobrytskyi, 2014 (github.com/Akson)
import numpy as np
import matplotlib
import matplotlib.pyplot
from RCP3.Infrastructure import TmpFilesStorage
class Backend(object):
def __init__(self, parentNode):
self._parentNode = parentNode
def Delete(self):
"""
This method is called when a parent node is deleted.
"""
pass
def GetParameters(self):
"""
Returns a dictionary with object parameters, their values,
limits and ways to change them.
"""
return {}
def SetParameters(self, parameters):
"""
Gets a dictionary with parameter values and
update object parameters accordingly
"""
pass
def ProcessMessage(self, message):
"""
This message is called when a new message comes.
If an incoming message should be processed by following nodes, the
'self._parentNode.SendMessage(message)'
should be called with an appropriate message.
"""
dataArray = np.asarray(message["Data"])
fig = matplotlib.pyplot.figure(figsize=(6, 4), dpi=float(96))
ax=fig.add_subplot(111)
#n, bins, patches = ax.hist(dataArray, bins=50)
ax.plot(range(len(dataArray)), dataArray)
processedMessage = {"Stream":message["Stream"], "Info":message["Info"]}
filePath, link = TmpFilesStorage.NewTemporaryFile("png")
fig.savefig(filePath,format='png')
matplotlib.pyplot.close(fig)
html = '<img src="http://{}" alt="Image should come here">'.format(link)
processedMessage["Data"] = html
self._parentNode.SendMessage(processedMessage)
"""
print len(message["Data"])
import numpy as np
import matplotlib.pyplot as plt
x = np.array(message["Data"])
num_bins = 50
# the histogram of the data
n, bins, patches = plt.hist(x, num_bins, normed=1, facecolor='green', alpha=0.5)
plt.subplots_adjust(left=0.15)
plt.show()
"""
def AppendContextMenuItems(self, menu):
"""
Append backend specific menu items to a context menu that user will see
when he clicks on a node.
"""
pass | lgpl-3.0 |
MagicAttacker/APM602 | Tools/LogAnalyzer/tests/TestParams.py | 261 | 3119 | from LogAnalyzer import Test,TestResult
import DataflashLog
import math # for isnan()
class TestParams(Test):
'''test for any obviously bad parameters in the config'''
def __init__(self):
Test.__init__(self)
self.name = "Parameters"
# helper functions
def __checkParamIsEqual(self, paramName, expectedValue, logdata):
value = logdata.parameters[paramName]
if value != expectedValue:
self.result.status = TestResult.StatusType.FAIL
self.result.statusMessage = self.result.statusMessage + "%s set to %s, expecting %s\n" % (paramName, `value`, `expectedValue`)
def __checkParamIsLessThan(self, paramName, maxValue, logdata):
value = logdata.parameters[paramName]
if value >= maxValue:
self.result.status = TestResult.StatusType.FAIL
self.result.statusMessage = self.result.statusMessage + "%s set to %s, expecting less than %s\n" % (paramName, `value`, `maxValue`)
def __checkParamIsMoreThan(self, paramName, minValue, logdata):
value = logdata.parameters[paramName]
if value <= minValue:
self.result.status = TestResult.StatusType.FAIL
self.result.statusMessage = self.result.statusMessage + "%s set to %s, expecting less than %s\n" % (paramName, `value`, `minValue`)
def run(self, logdata, verbose):
self.result = TestResult()
self.result.status = TestResult.StatusType.GOOD # GOOD by default, tests below will override it if they fail
# check all params for NaN
for name,value in logdata.parameters.iteritems():
if math.isnan(value):
self.result.status = TestResult.StatusType.FAIL
self.result.statusMessage = self.result.statusMessage + name + " is NaN\n"
try:
# add parameter checks below using the helper functions, any failures will trigger a FAIL status and accumulate info in statusMessage
# if more complex checking or correlations are required you can access parameter values directly using the logdata.parameters[paramName] dict
if logdata.vehicleType == "ArduCopter":
self.__checkParamIsEqual ("MAG_ENABLE", 1, logdata)
self.__checkParamIsLessThan("THR_MIN", 200, logdata)
self.__checkParamIsLessThan("THR_MID", 701, logdata)
self.__checkParamIsMoreThan("THR_MID", 299, logdata)
# TODO: add more parameter tests, these are just an example...
elif logdata.vehicleType == "ArduPlane":
# TODO: add parameter checks for plane...
pass
elif logdata.vehicleType == "ArduRover":
# TODO: add parameter checks for rover...
pass
if self.result.status == TestResult.StatusType.FAIL:
self.result.statusMessage = "Bad parameters found:\n" + self.result.statusMessage
except KeyError as e:
self.result.status = TestResult.StatusType.FAIL
self.result.statusMessage = str(e) + ' not found' | gpl-3.0 |
BarusXXX/K-Tree | TreeLogic.py | 1 | 3884 | import os
from copy import deepcopy
class RecursiveTree:
def __init__(self, dir_name):
self.dir_name = dir_name
self.files = []
self.folders = [] #Tuple Absolute address, branch, level
self.branches = []
self.children_n = []
self.currentlevel = 0
self.level=[] #len(self.branches)
self.level.append(0)
self.folder_n = len(self.folders)
self.parentIndex = []
self.parentbranch = []
self.iterator = 0
self.reversead = 0
self.parentIndex.append(None)
self.branches.append([0])
self.folders.append((dir_name, "{0}", 0))
RecursiveTree.get_immediate_subdirectories(self, self.dir_name, 0)
self.level_max = max(self.level)
def Branch(self):
pass
def PrintTree(self):
print("#Folders#")
for x in self.folders:
print(x)
print("#Branches#")
for x in self.branches:
print(x)
print("#Parent Branches#")
for x in self.parentbranch:
print(x)
print("#Files#")
for x in self.files:
print(x)
def subdir(self):
return self.folders
def filedir(self):
return self.files
def sortedbranches(self):
STree = []
CountX = 0
for x in self.branches:
STree.append([])
for y in x:
STree[CountX].append(int(y))
CountX += 1
SSum = []
CountX = 0
TTree = deepcopy(STree)
for x in TTree:
CountY = 0
for y in x:
TTree[CountX][CountY] = y + 1
CountY += 1
CountX += 1
SSum.append(sum(x))
SortedTree = [x for y, x in sorted(list(zip(SSum, STree)))]
def get_immediate_subdirectories(self, a_dir, curadd):
nextadd = 0
relocator = 0
cancleNo = self.reversead
for name in os.listdir(a_dir):
if os.path.isdir(os.path.join(a_dir, name)):
curaddstr = str(curadd) + ";" + str(nextadd)
relocator += 1
self.iterator += 1
self.currentlevel += 1
ContainsSub = False
ContainsNo = 0
for x in os.listdir(a_dir + "/" + name):
if os.path.isdir(a_dir + "/" + name + "/" + x):
ContainsSub = True
ContainsNo += 1
self.children_n.append(ContainsNo)
PathConstructor = "{" + str(curadd) + ";" + str(nextadd) + "}" + ":" + os.path.join(a_dir, name)
AbsAddressConstructor = (PathConstructor.split(":")[1]), (PathConstructor.split(":")[2])
self.folders.append((":".join(AbsAddressConstructor), PathConstructor.split(":")[0], self.currentlevel))
self.branches.append((((((PathConstructor.split(":")[0]).split("{")[1])).split("}")[0]).split(";")))
self.parentbranch.append(str(curadd).split(";"))
self.level.append(self.currentlevel)
self.parentIndex.append(self.iterator - relocator - self.reversead + cancleNo) #Cannot negate 1
RecursiveTree.get_immediate_subdirectories(self, (a_dir + "/" + name), curaddstr)
self.currentlevel -= 1
if ContainsSub == True:
self.reversead += ContainsNo
nextadd += 1
else:
self.files.append((self.iterator - relocator - self.reversead + cancleNo, os.path.join(a_dir, name))) #index of parent, direct links to file
#print("file found:", self.iterator - relocator - self.reversead + cancleNo, name)
#print("{"+str(curadd) + ";" + str(nextadd) + "}" + ":" + os.path.join(a_dir, name))
| mit |
Ecotrust/F2S-MOI | moi/indicators/migrations/0009_auto_20160506_1658.py | 1 | 4006 | # -*- coding: utf-8 -*-
# Generated by Django 1.9.4 on 2016-05-06 16:58
from __future__ import unicode_literals
from django.db import migrations
import wagtail.wagtailcore.blocks
import wagtail.wagtailcore.fields
import wagtail.wagtailimages.blocks
class Migration(migrations.Migration):
dependencies = [
('indicators', '0008_auto_20160504_2309'),
]
operations = [
migrations.AlterField(
model_name='indicator',
name='body_content',
field=wagtail.wagtailcore.fields.StreamField([(b'number_count_up', wagtail.wagtailcore.blocks.StructBlock([(b'content', wagtail.wagtailcore.blocks.RichTextBlock(help_text=b'Enter your main content above. Do not use commas for larger numbers.', label=b'Text')), (b'numbers', wagtail.wagtailcore.blocks.CharBlock(help_text=b"Enter the numbers you'd like to count up - seperated by a semicolon. Do not use commas for larger numbers. Ex: 4; 51000; 15", label=b'Numbers to count', required=False)), (b'colored_text', wagtail.wagtailcore.blocks.CharBlock(help_text=b"Enter the content you'd like to be a different color - each set of content is seperated by a semicolon", required=False)), (b'source', wagtail.wagtailcore.blocks.CharBlock(help_text=b'Enter a source for the associated information.', required=False))], icon=b'order', label=b'Content and Number Counter Block')), (b'basic_content', wagtail.wagtailcore.blocks.StructBlock([(b'content', wagtail.wagtailcore.blocks.RichTextBlock(help_text=b'Add your text and/or image content above', label=b'Content Area'))], icon=b'pilcrow', label=b'Basic Content Block')), (b'two_column', wagtail.wagtailcore.blocks.StructBlock([(b'left_column', wagtail.wagtailcore.blocks.StreamBlock([(b'heading', wagtail.wagtailcore.blocks.CharBlock(classname=b'full title', icon=b'title')), (b'paragraph', wagtail.wagtailcore.blocks.RichTextBlock(icon=b'pilcrow')), (b'number_count_up', wagtail.wagtailcore.blocks.StructBlock([(b'content', wagtail.wagtailcore.blocks.RichTextBlock(help_text=b'Enter your main content above. Do not use commas for larger numbers.', label=b'Text')), (b'numbers', wagtail.wagtailcore.blocks.CharBlock(help_text=b"Enter the numbers you'd like to count up - seperated by a semicolon. Do not use commas for larger numbers. Ex: 4; 51000; 15", label=b'Numbers to count', required=False)), (b'colored_text', wagtail.wagtailcore.blocks.CharBlock(help_text=b"Enter the content you'd like to be a different color - each set of content is seperated by a semicolon", required=False)), (b'source', wagtail.wagtailcore.blocks.CharBlock(help_text=b'Enter a source for the associated information.', required=False))], icon=b'collapse-up')), (b'image', wagtail.wagtailimages.blocks.ImageChooserBlock(icon=b'image'))], icon=b'arrow-left', label=b'Left content')), (b'right_column', wagtail.wagtailcore.blocks.StreamBlock([(b'heading', wagtail.wagtailcore.blocks.CharBlock(classname=b'full title', icon=b'title')), (b'paragraph', wagtail.wagtailcore.blocks.RichTextBlock(icon=b'pilcrow')), (b'number_count_up', wagtail.wagtailcore.blocks.StructBlock([(b'content', wagtail.wagtailcore.blocks.RichTextBlock(help_text=b'Enter your main content above. Do not use commas for larger numbers.', label=b'Text')), (b'numbers', wagtail.wagtailcore.blocks.CharBlock(help_text=b"Enter the numbers you'd like to count up - seperated by a semicolon. Do not use commas for larger numbers. Ex: 4; 51000; 15", label=b'Numbers to count', required=False)), (b'colored_text', wagtail.wagtailcore.blocks.CharBlock(help_text=b"Enter the content you'd like to be a different color - each set of content is seperated by a semicolon", required=False)), (b'source', wagtail.wagtailcore.blocks.CharBlock(help_text=b'Enter a source for the associated information.', required=False))], icon=b'collapse-up')), (b'image', wagtail.wagtailimages.blocks.ImageChooserBlock(icon=b'image'))], icon=b'arrow-right', label=b'Right content'))]))], blank=True, default=None, null=True),
),
]
| apache-2.0 |
thurt/arangodb | 3rdParty/V8-4.3.61/third_party/python_26/Lib/site-packages/win32/Demos/service/pipeTestServiceClient.py | 17 | 4173 | # A Test Program for pipeTestService.py
#
# Install and start the Pipe Test service, then run this test
# either from the same machine, or from another using the "-s" param.
#
# Eg: pipeTestServiceClient.py -s server_name Hi There
# Should work.
from win32pipe import *
from win32file import *
from win32event import *
import pywintypes
import win32api
import winerror
import sys, os, traceback
verbose = 0
#def ReadFromPipe(pipeName):
# Could (Should?) use CallNamedPipe, but this technique allows variable size
# messages (whereas you must supply a buffer size for CallNamedPipe!
# hPipe = CreateFile(pipeName, GENERIC_WRITE, 0, None, OPEN_EXISTING, FILE_ATTRIBUTE_NORMAL, 0)
# more = 1
# while more:
# hr = ReadFile(hPipe, 256)
# if hr==0:
# more = 0
# except win32api.error (hr, fn, desc):
# if hr==winerror.ERROR_MORE_DATA:
# data = dat
#
def CallPipe(fn, args):
ret = None
retryCount = 0
while retryCount < 8: # Keep looping until user cancels.
retryCount = retryCount + 1
try:
return apply(fn, args)
except win32api.error, (rc, fnerr, msg):
if rc==winerror.ERROR_PIPE_BUSY:
win32api.Sleep(5000)
continue
else:
raise win32api.error, (rc, fnerr, msg)
raise RuntimeError, "Could not make a connection to the server"
def testClient(server,msg):
if verbose:
print "Sending", msg
data = CallPipe(CallNamedPipe, ("\\\\%s\\pipe\\PyPipeTest" % server, msg, 256, NMPWAIT_WAIT_FOREVER))
if verbose:
print "Server sent back '%s'" % data
print "Sent and received a message!"
def testLargeMessage(server, size = 4096):
if verbose:
print "Sending message of size %d" % (size)
msg = "*" * size
data = CallPipe(CallNamedPipe, ("\\\\%s\\pipe\\PyPipeTest" % server, msg, 512, NMPWAIT_WAIT_FOREVER))
if len(data)-size:
print "Sizes are all wrong - send %d, got back %d" % (size, len(data))
def stressThread(server, numMessages, wait):
try:
try:
for i in xrange(numMessages):
r = CallPipe(CallNamedPipe, ("\\\\%s\\pipe\\PyPipeTest" % server, "#" * 512, 1024, NMPWAIT_WAIT_FOREVER))
except:
traceback.print_exc()
print "Failed after %d messages" % i
finally:
SetEvent(wait)
def stressTestClient(server, numThreads, numMessages):
import thread
thread_waits = []
for t_num in xrange(numThreads):
# Note I could just wait on thread handles (after calling DuplicateHandle)
# See the service itself for an example of waiting for the clients...
wait = CreateEvent(None, 0, 0, None)
thread_waits.append(wait)
thread.start_new_thread(stressThread, (server,numMessages, wait))
# Wait for all threads to finish.
WaitForMultipleObjects(thread_waits, 1, INFINITE)
def main():
import sys, getopt, string
server = "."
thread_count = 0
msg_count = 500
try:
opts, args = getopt.getopt(sys.argv[1:], 's:t:m:vl')
for o,a in opts:
if o=='-s':
server = a
if o=='-m':
msg_count = string.atoi(a)
if o=='-t':
thread_count = string.atoi(a)
if o=='-v':
global verbose
verbose = 1
if o=='-l':
testLargeMessage(server)
msg = string.join(args)
except getopt.error, msg:
print msg
my_name = os.path.split(sys.argv[0])[1]
print "Usage: %s [-v] [-s server] [-t thread_count=0] [-m msg_count=500] msg ..." % my_name
print " -v = verbose"
print " Specifying a value for -t will stress test using that many threads."
return
testClient(server, msg)
if thread_count > 0:
print "Spawning %d threads each sending %d messages..." % (thread_count, msg_count)
stressTestClient(server, thread_count, msg_count)
if __name__=='__main__':
main()
| apache-2.0 |
ndparker/wolfe | wolfe/scheduler/_job_queue.py | 1 | 4458 | # -*- coding: ascii -*-
r"""
:Copyright:
Copyright 2014 - 2016
Andr\xe9 Malo or his licensors, as applicable
:License:
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.
===========
Job Queue
===========
Job Queue. The queue is implemented as priority queue using a heap.
"""
if __doc__: # pragma: no cover
# pylint: disable = redefined-builtin
__doc__ = __doc__.encode('ascii').decode('unicode_escape')
__author__ = r"Andr\xe9 Malo".encode('ascii').decode('unicode_escape')
__docformat__ = "restructuredtext en"
import heapq as _heapq
class JobQueue(object):
"""
Job queue
This container utilizes a heap structure to implement a more or less
generic priority queue (see below). The sorting order of the items is
defined by a wrapper class passed to the constructor.
The queue is made for jobs. That's why wrapper classes have to provide a
job attribute for unwrapping and items passed into the queue are expected
to provide a valid ``id`` attribute.
Additionally the queue implements boolean operations (it's false if it's
empty) and a __contains__ operation based on job IDs.
>>> class Wrapper(object):
... def __init__(self, job):
... self.job = job
... def __lt__(self, other):
... return self.job.id > other.job.id
>>> class Job(object):
... def __init__(self, job_id):
... self.id = job_id
>>> queue = JobQueue(Wrapper)
>>> queue.put(Job(2))
>>> bool(queue)
True
>>> 1 in queue
False
>>> 2 in queue
True
>>> len(queue)
1
:IVariables:
`_queue` : ``list``
actual heap containing wrapped jobs
`_wrapper` : callable
Wrapper class factory
`_ids` : ``set``
Set of job IDs currently queued
"""
def __init__(self, wrapper_class):
"""
Initialization
:Parameters:
`wrapper_class` : any
class factory expected to take a job and represent it inside the
queue. The object should be comparable with other instances
(``__lt__`` is the proper method) and should provide a ``job``
attribute pointing to the original object.
"""
self._queue = []
self._wrapper = wrapper_class
self._ids = set()
def __nonzero__(self):
"""
Return false if the queue is empty, true otherwise
:Return: Is there something in the queue?
:Rtype: ``bool``
"""
return bool(self._queue)
def __contains__(self, job_id):
"""
Check if the passed job_id is currently enqueued
:Return: Is it?
:Rtype: ``bool``
"""
return job_id in self._ids
def __len__(self):
""" Find queue length """
return len(self._queue)
def __iter__(self):
""" Iterate over the queue until it's exhausted """
try:
while True:
yield self.get()
except IndexError:
pass
def put(self, job):
"""
Put a job into the queue
:Parameters:
`job` : any
The job to put in. The object must have an ``id`` attribute,
which must be hashable.
"""
self._ids.add(job.id)
_heapq.heappush(self._queue, self._wrapper(job))
def get(self):
"""
Get the next job from the queue
:Return: A job
:Rtype: any
:Exceptions:
- `IndexError` : Queue was empty
"""
job = _heapq.heappop(self._queue).job
self._ids.remove(job.id)
return job
def peek(self):
"""
Return the next job without removing it from the queue
The job will still be wrapped in the wrapper_class container
:Return: wrapped job
:Rtype: any
:Exceptions:
- `IndexError` : Queue was empty
"""
return self._queue[0]
| apache-2.0 |
ar7z1/ansible | lib/ansible/modules/windows/win_eventlog.py | 28 | 4997 | #!/usr/bin/python
# -*- coding: utf-8 -*-
# Copyright: (c) 2017, Andrew Saraceni <[email protected]>
# GNU General Public License v3.0+ (see COPYING or https://www.gnu.org/licenses/gpl-3.0.txt)
# this is a windows documentation stub. actual code lives in the .ps1
# file of the same name
ANSIBLE_METADATA = {'metadata_version': '1.1',
'status': ['preview'],
'supported_by': 'community'}
DOCUMENTATION = r'''
---
module: win_eventlog
version_added: "2.4"
short_description: Manage Windows event logs
description:
- Allows the addition, clearing and removal of local Windows event logs,
and the creation and removal of sources from a given event log. Also
allows the specification of settings per log and source.
options:
name:
description:
- Name of the event log to manage.
required: yes
state:
description:
- Desired state of the log and/or sources.
- When C(sources) is populated, state is checked for sources.
- When C(sources) is not populated, state is checked for the specified log itself.
- If C(state) is C(clear), event log entries are cleared for the target log.
choices: [ absent, clear, present ]
default: present
sources:
description:
- A list of one or more sources to ensure are present/absent in the log.
- When C(category_file), C(message_file) and/or C(parameter_file) are specified,
these values are applied across all sources.
type: list
category_file:
description:
- For one or more sources specified, the path to a custom category resource file.
type: path
message_file:
description:
- For one or more sources specified, the path to a custom event message resource file.
type: path
parameter_file:
description:
- For one or more sources specified, the path to a custom parameter resource file.
type: path
maximum_size:
description:
- The maximum size of the event log.
- Value must be between 64KB and 4GB, and divisible by 64KB.
- Size can be specified in KB, MB or GB (e.g. 128KB, 16MB, 2.5GB).
overflow_action:
description:
- The action for the log to take once it reaches its maximum size.
- For C(OverwriteOlder), new log entries overwrite those older than the C(retention_days) value.
- For C(OverwriteAsNeeded), each new entry overwrites the oldest entry.
- For C(DoNotOverwrite), all existing entries are kept and new entries are not retained.
choices:
- OverwriteOlder
- OverwriteAsNeeded
- DoNotOverwrite
retention_days:
description:
- The minimum number of days event entries must remain in the log.
- This option is only used when C(overflow_action) is C(OverwriteOlder).
type: int
author:
- Andrew Saraceni (@andrewsaraceni)
'''
EXAMPLES = r'''
- name: Add a new event log with two custom sources
win_eventlog:
name: MyNewLog
sources:
- NewLogSource1
- NewLogSource2
state: present
- name: Change the category and message resource files used for NewLogSource1
win_eventlog:
name: MyNewLog
sources:
- NewLogSource1
category_file: C:\NewApp\CustomCategories.dll
message_file: C:\NewApp\CustomMessages.dll
state: present
- name: Change the maximum size and overflow action for MyNewLog
win_eventlog:
name: MyNewLog
maximum_size: 16MB
overflow_action: DoNotOverwrite
state: present
- name: Clear event entries for MyNewLog
win_eventlog:
name: MyNewLog
state: clear
- name: Remove NewLogSource2 from MyNewLog
win_eventlog:
name: MyNewLog
sources:
- NewLogSource2
state: absent
- name: Remove MyNewLog and all remaining sources
win_eventlog:
name: MyNewLog
state: absent
'''
RETURN = r'''
name:
description: The name of the event log.
returned: always
type: string
sample: MyNewLog
exists:
description: Whether the event log exists or not.
returned: success
type: boolean
sample: true
entries:
description: The count of entries present in the event log.
returned: success
type: int
sample: 50
maximum_size_kb:
description: Maximum size of the log in KB.
returned: success
type: int
sample: 512
overflow_action:
description: The action the log takes once it reaches its maximum size.
returned: success
type: string
sample: OverwriteOlder
retention_days:
description: The minimum number of days entries are retained in the log.
returned: success
type: int
sample: 7
sources:
description: A list of the current sources for the log.
returned: success
type: list
sample: ["MyNewLog", "NewLogSource1", "NewLogSource2"]
sources_changed:
description: A list of sources changed (e.g. re/created, removed) for the log;
this is empty if no sources are changed.
returned: always
type: list
sample: ["NewLogSource2"]
'''
| gpl-3.0 |
bvanrijn/debianpaste-clients | old-paste.py | 1 | 7602 | #!/usr/bin/python
# Filename: paste
# Purpose: XmlRpc interface client to paste.debian.net
# Author: Copyright (C) 2007-2011 Michael Gebetsroither <[email protected]>
# License: This file is licensed under the GPL v2+. Full license text in LICENSE
# Modified original: No modifications have been made
#
# This program is free software; you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation; either version 2 of the License, or (at your option) any later version.
# This program is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details.
# You should have received a copy of the GNU General Public License along with this program; if not, write to the Free Software Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
################################################################################
import sys
import xmlrpclib
import optparse
import inspect
import getpass
# program defaults
DEFAULT_SERVER='http://paste.debian.net/server.pl'
class ActionFailedException(Exception):
'''Thrown if server returned an error'''
def __init__(self, errormsg, ret):
Exception.__init__(self, errormsg, ret)
def what(self):
'''Get errormessage'''
return self.args[0]
def dwhat(self):
'''Get more verbose errormessage'''
return self.args[1]
class Action(object):
def __init__(self, args, opts):
self.args_ = args
self.opts_ = opts
def _createProxy(self):
return xmlrpclib.ServerProxy(self.opts_.server, verbose=False)
def _callProxy(self, functor, server=None):
'''Wrapper for xml-rpc calls to server which throws an
ActionFailedException on error'''
if server is None:
server = self._createProxy()
ret = functor(server)
if ret['rc'] != 0:
raise ActionFailedException(ret['statusmessage'], ret)
return ret
def call(self, method_name):
'''External Interface to call the appropriate action'''
return self.__getattribute__(method_name)()
def actionAddPaste(self):
'''Add paste to the server: <1.line> <2.line> ...
default Read paste from stdin.
[text] Every argument on the commandline will be interpreted as
a seperate line of paste.
'''
server = self._createProxy()
o = self.opts_
code = self.args_
if len(self.args_) == 0:
code = [ i.rstrip() for i in sys.stdin.readlines() ]
code = '\n'.join(code)
result = self._callProxy(lambda s: s.paste.addPaste(code, o.name, o.expire * 3600, o.lang, o.private),
server)
return (result['statusmessage'], result)
def actionDelPaste(self):
'''Delete paste from server: <digest>
<digest> Digest of paste you want to remove.
'''
digest = self.args_.pop(0)
result = self._callProxy(lambda s: s.paste.deletePaste(digest))
return (result['statusmessage'], result)
def actionGetPaste(self):
'''Get paste from server: <id>
<id> Id of paste you want to receive.
'''
id = self.args_.pop(0)
result = self._callProxy(lambda s: s.paste.getPaste(id))
return (result['code'], result)
def actionGetLangs(self):
'''Get supported language highlighting types from server'''
result = self._callProxy(lambda s: s.paste.getLanguages())
return ('\n'.join(result['langs']), result)
def actionAddShortUrl(self):
'''Add short-URL: <url>
<url> Short-URL to add
'''
url = self.args_.pop(0)
result = self._callProxy(lambda s: s.paste.addShortURL(url))
return (result['url'], result)
def actionGetShortUrl(self):
'''Resolve short-URL: <url>
<url> Short-URL to get clicks of
'''
url = self.args_.pop(0)
result = self._callProxy(lambda s: s.paste.resolveShortURL(url))
return (result['url'], result)
def actionGetShortUrlClicks(self):
'''Get clicks of short-URL: <url>
<url> Short-URL to get clicks of
'''
url = self.args_.pop(0)
result = self._callProxy(lambda s: s.paste.ShortURLClicks(url))
return (result['count'], result)
def actionHelp(self):
'''Print more verbose help about specific action: <action>
<action> Topic on which you need more verbose help.
'''
if len(self.args_) < 1:
alias = "help"
else:
alias = self.args_.pop(0)
if alias in actions:
fun = actions[alias]
print inspect.getdoc(self.__getattribute__(fun))
print "\naliase: " + " ".join([i for i in actions_r[fun] if i != alias])
else:
print "Error: No such command - %s" % (alias)
OPT_PARSER.print_usage()
sys.exit(0)
# actionAddPaste -> [add, a]
actions_r = {}
# add -> actionAddPaste
# a -> actionAddPaste
actions = {}
# option parser
OPT_PARSER = None
##
# MAIN
##
if __name__ == "__main__":
action_spec = ['actionAddPaste add a',
'actionDelPaste del d rm',
'actionGetPaste get g',
'actionGetLangs getlangs gl langs l',
'actionAddShortUrl addurl',
'actionGetShortUrl geturl',
'actionGetShortUrlClicks getclicks',
'actionHelp help']
for i in action_spec:
aliases = i.split()
cmd = aliases.pop(0)
actions_r[cmd] = aliases
for (k,v) in actions_r.items():
for i in v:
actions[i] = k
usage = "usage: %prog [options] ACTION <args>\n\n" +\
"actions:\n" +\
"\n".join(["%12s\t%s" % (v[0], inspect.getdoc(getattr(Action, k)).split('\n')[0]) \
for (k,v) in actions_r.items()])
running_user = getpass.getuser()
parser = optparse.OptionParser(usage=usage)
parser.add_option('-n', '--name', default=running_user, help="Name of poster")
parser.add_option('-e', '--expire', type=int, default=72, metavar='HOURS',
help='Time at wich paste should expire')
parser.add_option('-l', '--lang', default='Plain', help='Type of language to highlight')
parser.add_option("-p", "--private", action="count", dest="private", default=0,
help='Create hidden paste'),
parser.add_option('-s', '--server', default=DEFAULT_SERVER,
help='Paste server')
parser.add_option('-v', '--verbose', action='count', default=0, help='More output')
(opts, args) = parser.parse_args()
OPT_PARSER = parser
if len(args) == 0:
parser.error('Please provide me with an action')
elif args[0] in actions:
cmd = args.pop(0)
action = Action(args, opts)
try:
(msg, ret) = action.call(actions[cmd])
if opts.verbose == 0:
print msg
else:
print ret
except ActionFailedException, e:
sys.stderr.write('Server Error: %s\n' % e.what())
if opts.verbose >0:
print e.dwhat()
sys.exit(1)
else:
parser.error('Unknown action: %s' % args[0])
| gpl-2.0 |
wjakob/layerlab | recipes/coated-gold-with-scatmedium.py | 1 | 2082 | # Creates a rough gold layer with a rough dielectric coating containing an
# anisotropic scattering medium
import sys
sys.path.append('.')
from utils.materials import gold
from utils.cie import get_rgb
import layerlab as ll
eta_top = 1.5
# This step integrates the spectral IOR against the CIE XYZ curves to obtain
# equivalent sRGB values. This may seem fairly approximate but turns out to
# yield excellent agreement with spectral reference renders
print('Computing gold IOR parameters')
eta_bot = get_rgb(gold)
alpha_top = 0.1 # Beckmann roughness of top layer (coating)
alpha_bot = 0.1 # Beckmann roughness of bottom layer (gold)
# Medium parameters
g = 0.5 # Scattering anisotropy
albedo = [0.25, 0.0, 0.95] # Single scattering albedo
tau = 0.5 # Optical depth
# Construct quadrature scheme suitable for the material
n_top, m_top = ll.parameterHeuristicMicrofacet(eta=eta_top, alpha=alpha_top)
n_bot, m_bot = ll.parameterHeuristicMicrofacet(eta=eta_bot[0], alpha=alpha_bot)
n_med, m_med = ll.parameterHeuristicHG(g=g)
n = max(n_top, n_bot) # Max of zenith angle discretization
m = m_top # Number of Fourier orders determined by top layer
mu, w = ll.quad.gaussLobatto(n)
print("# of nodes = %i, fourier orders = %i" % (n, m))
# Construct coating layer
print("Creating coating layer")
coating = ll.Layer(mu, w, m)
coating.setMicrofacet(eta=eta_top, alpha=alpha_top)
output = []
for channel in range(3):
# Construct diffuse bottom layer for each channel
print("Creating metal layer")
l = ll.Layer(mu, w, m)
l.setMicrofacet(eta=eta_bot[channel], alpha=alpha_bot)
# Construct medium layer
print("Creating medium layer")
l2 = ll.Layer(mu, w, m)
l2.setHenyeyGreenstein(g=g, albedo=albedo[channel])
l2.expand(tau)
# Apply medium layer
print("Applying medium ..")
l.addToTop(l2)
# Apply coating
print("Applying coating..")
l.addToTop(coating)
output.append(l)
# .. and write to disk
print("Writing to disk..")
storage = ll.BSDFStorage.fromLayerRGB("output.bsdf", *output)
storage.close()
| bsd-2-clause |
plumer/codana | projectdata.py | 1 | 5358 | class VersionDataManager:
"""Manager of all the information of files and packages in a specific version
Attributes:
packages (list of str): List of packages name
files (list of str): List of all the files in the project
packagedict (dict): Map of packages(key) and filenames(value)
filebugnum (dict): Map of filename(key) and bug numbers(value)
fileattr (dict): Map of filename(key) and the attributes of the file(value)
packageattr (dict): Map of package(key) and the attributes of the package(value)
filedepends (list of tuple): List of all the edges in the dependence graph of all files
packagedepends (list of tuple) : List of all the edges in the dependence graph of all packages
"""
def __init__(self, version='6.0.0'):
self.packagedict = {}
self.fileattr = {}
self.files = []
self.filebugnum = {}
self.packageattr = {}
self.versionArray = []
datafile = open(r'tomcat_history/tomcat' + version + r'/tomcat_pack.txt', 'r')
for packs in datafile:
packslice = packs.strip(' \t\n').split('\t')
self.packagedict[packslice[0]] = []
self.packageattr[packslice[0]] = self.packPackageAttr(packslice[1:])
filenum = 0
if int(packslice[1]) == 0:
continue
for files in datafile:
fileattr = files.strip(' \t\n').split('\t')
if not fileattr[0] in self.packagedict[packslice[0]]:
self.files.append(fileattr[0])
self.packagedict[packslice[0]].append(fileattr[0])
self.fileattr[fileattr[0]] = self.packFileAttr(fileattr[1:])
filenum = filenum + 1
if filenum >= int(packslice[1]):
break
datafile.close()
datafile = open(r'tomcat_history/tomcat' + version + r'/log.txt', 'r')
for record in datafile:
recordslice = record.strip(' \t\n').split('\t')
self.filebugnum[recordslice[0]] = int(recordslice[1])
datafile.close()
self.packages = self.packagedict.keys()
self.packagedepends = []
packdependfile = open(r'tomcat_history/tomcat' + version + r'/tomcat_pack_depends.txt', 'r')
for e in packdependfile:
vertices = e.strip(' \t\n').split(' ')
self.packagedepends.append( (vertices[0], vertices[-1]) )
packdependfile.close()
self.filedepends = []
filedependfile = open(r'tomcat_history/tomcat' + version + r'/tomcat_depends.txt', 'r')
for e in filedependfile:
vertices = e.strip(' \t\n').split('\t')
self.filedepends.append( (vertices[0], vertices[-1]) )
filedependfile.close()
def packPackageAttr(self, attrs):
return {'filenum' : attrs[0],
'codelines' : attrs[1],
'cyclomatic' : attrs[2]}
def packFileAttr(self, attrs):
return {'codelines' : attrs[0],
'cyclomatic' : attrs[1]}
def listFileAttr(self):
return ('codelines', 'cyclomatic')
def listPackageAttr(self):
return ('filenum', 'codelines' , 'cyclomatic')
def getPackages(self):
return self.packages
def getFilenames(self):
return self.files
def getFilesOfPackage(self, package):
return self.packagedict[package]
def getPackageOfFile(self, filename):
return self.filedict[filename]
def getFileAttr(self, filename):
return self.fileattr[filename]
def getPackageAttr(self, package):
return self.packageattr[package]
def getFileDependence(self):
return self.filedepends
def getPackageDependence(self):
return self.packagedepends
def getFileDependenceOfPackage(self, package):
deplist = []
filelist = self.getFilesOfPackage(package)
for dep in self.filedepends:
if dep[0] in filelist and dep[1] in filelist:
deplist.append(dep)
return deplist
def getBugNumberOfFile(self, filename):
if filename in self.filebugnum:
return self.filebugnum[filename]
return 0
def getBugNumberOfPackage(self, package):
bugnum = 0
for filename in self.packagedict[package]:
if filename in self.filebugnum:
bugnum = bugnum + self.filebugnum[filename]
return bugnum
class DataManager:
'''Manage all the data in all versions
Attributes:
versionArray (list): List of all the versions
dataManages (dict): Map of the version(key) and the specified data manager(value)
'''
def __init__(self):
self.versionArray = []
datafile = open(r'tomcat_history/tomcat_list.txt', 'r')
for line in datafile:
self.versionArray.append(line.strip(' \n').strip('tomcat'))
datafile.close()
self.dataManages = {}
for version in self.versionArray:
self.dataManages[version] = VersionDataManager(version)
def getManager(self, version):
return self.dataManages[version]
def getVersionArray(self):
return self.versionArray
if __name__ == '__main__':
dm = DataManager()
dm.getFileDependenceOfPackage('apache.catalina')
| mit |
apache8080/NVIDIABot | old_robot_code/driverStation.py | 2 | 3817 | '''
Copyright (c) 2014, Rishi Desai
All rights reserved.
Redistribution and use in source and binary forms, with or without
modification, are permitted provided that the following conditions are met:
* Redistributions of source code must retain the above copyright notice, this
list of conditions and the following disclaimer.
* Redistributions in binary form must reproduce the above copyright notice,
this list of conditions and the following disclaimer in the documentation
and/or other materials provided with the distribution.
THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE
FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
'''
import Tkinter
import tkMessageBox
import socket
import pickle
import pygame
top = Tkinter.Tk()
joyFrame = Tkinter.Frame(top)
noJoyFrame = Tkinter.Frame(top)
port = 8081
host = "10.99.99.2"
#host = "192.168.1.83"
pygame.init()
s = socket.socket(socket.AF_INET, socket.SOCK_DGRAM)
#j =0;
s.bind(("", 0))
started = False
def startSession():
global started
started= True
s.sendto(pickle.dumps(started), (host, port))
# change wait to 2 after done testing
top.after(200, sendJoystickVal)
def endSession():
global started
started= False
#s.bind(("", 0))
s.sendto(pickle.dumps(started), (host, port))
#top.destroy()
def closeProgram():
s.close()
top.destroy()
sessionStart = Tkinter.Button(top, text ="Start Session", command = startSession)
sessionEnd = Tkinter.Button(top, text="End Session", command=endSession)
programClose= Tkinter.Button(top, text="Close Program", command=closeProgram)
def isJoystick():
return pygame.joystick.get_count()>0
def whileJoyCon():
if(isJoystick()):
sessionStart.config(state="normal")
sessionStart.pack()
sessionEnd.config(state="normal")
sessionEnd.pack()
programClose.config(state="normal")
programClose.pack()
howTo = Tkinter.Text(top)
howTo.insert(Tkinter.INSERT, "Press Start on the Joystick or end session to stop the program")
howTo.pack()
else:
print isJoystick()
sessionStart.config(state="disable")
sessionStart.pack()
sessionEnd.config(state="disable")
sessionEnd.pack()
programClose.config(state="normal")
programClose.pack()
noJoy = Tkinter.Text(top)
noJoy.insert(Tkinter.INSERT, "No Joystick Connected. Please connect a Joystick and Restart the program")
noJoy.pack()
def sendJoystickVal():
#print isJoy
#if(isJoystick):
pygame.event.pump()
j = pygame.joystick.Joystick(0)
j.init()
xAxis = j.get_axis(1)
yAxis=j.get_axis(3)
i=1
button =-1;
for i in range(j.get_numbuttons()):
if(j.get_button(i)==True):
button = i
break
data = [started, xAxis, -yAxis, button]
s.sendto(pickle.dumps(data), (host, port))
print data
#change wait to 2 after done testing
top.after(200, sendJoystickVal)
whileJoyCon()
#rint started
#f(started):
#top.after(2000, sendJoystickVal)
top.mainloop()
| bsd-2-clause |
ondra-novak/chromium.src | build/mac/change_mach_o_flags.py | 232 | 10318 | #!/usr/bin/env python
# Copyright (c) 2011 The Chromium Authors. All rights reserved.
# Use of this source code is governed by a BSD-style license that can be
# found in the LICENSE file.
"""Usage: change_mach_o_flags.py [--executable-heap] [--no-pie] <executablepath>
Arranges for the executable at |executable_path| to have its data (heap)
pages protected to prevent execution on Mac OS X 10.7 ("Lion"), and to have
the PIE (position independent executable) bit set to enable ASLR (address
space layout randomization). With --executable-heap or --no-pie, the
respective bits are cleared instead of set, making the heap executable or
disabling PIE/ASLR.
This script is able to operate on thin (single-architecture) Mach-O files
and fat (universal, multi-architecture) files. When operating on fat files,
it will set or clear the bits for each architecture contained therein.
NON-EXECUTABLE HEAP
Traditionally in Mac OS X, 32-bit processes did not have data pages set to
prohibit execution. Although user programs could call mprotect and
mach_vm_protect to deny execution of code in data pages, the kernel would
silently ignore such requests without updating the page tables, and the
hardware would happily execute code on such pages. 64-bit processes were
always given proper hardware protection of data pages. This behavior was
controllable on a system-wide level via the vm.allow_data_exec sysctl, which
is set by default to 1. The bit with value 1 (set by default) allows code
execution on data pages for 32-bit processes, and the bit with value 2
(clear by default) does the same for 64-bit processes.
In Mac OS X 10.7, executables can "opt in" to having hardware protection
against code execution on data pages applied. This is done by setting a new
bit in the |flags| field of an executable's |mach_header|. When
MH_NO_HEAP_EXECUTION is set, proper protections will be applied, regardless
of the setting of vm.allow_data_exec. See xnu-1699.22.73/osfmk/vm/vm_map.c
override_nx and xnu-1699.22.73/bsd/kern/mach_loader.c load_machfile.
The Apple toolchain has been revised to set the MH_NO_HEAP_EXECUTION when
producing executables, provided that -allow_heap_execute is not specified
at link time. Only linkers shipping with Xcode 4.0 and later (ld64-123.2 and
later) have this ability. See ld64-123.2.1/src/ld/Options.cpp
Options::reconfigureDefaults() and
ld64-123.2.1/src/ld/HeaderAndLoadCommands.hpp
HeaderAndLoadCommandsAtom<A>::flags().
This script sets the MH_NO_HEAP_EXECUTION bit on Mach-O executables. It is
intended for use with executables produced by a linker that predates Apple's
modifications to set this bit itself. It is also useful for setting this bit
for non-i386 executables, including x86_64 executables. Apple's linker only
sets it for 32-bit i386 executables, presumably under the assumption that
the value of vm.allow_data_exec is set in stone. However, if someone were to
change vm.allow_data_exec to 2 or 3, 64-bit x86_64 executables would run
without hardware protection against code execution on data pages. This
script can set the bit for x86_64 executables, guaranteeing that they run
with appropriate protection even when vm.allow_data_exec has been tampered
with.
POSITION-INDEPENDENT EXECUTABLES/ADDRESS SPACE LAYOUT RANDOMIZATION
This script sets or clears the MH_PIE bit in an executable's Mach-O header,
enabling or disabling position independence on Mac OS X 10.5 and later.
Processes running position-independent executables have varying levels of
ASLR protection depending on the OS release. The main executable's load
address, shared library load addresess, and the heap and stack base
addresses may be randomized. Position-independent executables are produced
by supplying the -pie flag to the linker (or defeated by supplying -no_pie).
Executables linked with a deployment target of 10.7 or higher have PIE on
by default.
This script is never strictly needed during the build to enable PIE, as all
linkers used are recent enough to support -pie. However, it's used to
disable the PIE bit as needed on already-linked executables.
"""
import optparse
import os
import struct
import sys
# <mach-o/fat.h>
FAT_MAGIC = 0xcafebabe
FAT_CIGAM = 0xbebafeca
# <mach-o/loader.h>
MH_MAGIC = 0xfeedface
MH_CIGAM = 0xcefaedfe
MH_MAGIC_64 = 0xfeedfacf
MH_CIGAM_64 = 0xcffaedfe
MH_EXECUTE = 0x2
MH_PIE = 0x00200000
MH_NO_HEAP_EXECUTION = 0x01000000
class MachOError(Exception):
"""A class for exceptions thrown by this module."""
pass
def CheckedSeek(file, offset):
"""Seeks the file-like object at |file| to offset |offset| and raises a
MachOError if anything funny happens."""
file.seek(offset, os.SEEK_SET)
new_offset = file.tell()
if new_offset != offset:
raise MachOError, \
'seek: expected offset %d, observed %d' % (offset, new_offset)
def CheckedRead(file, count):
"""Reads |count| bytes from the file-like |file| object, raising a
MachOError if any other number of bytes is read."""
bytes = file.read(count)
if len(bytes) != count:
raise MachOError, \
'read: expected length %d, observed %d' % (count, len(bytes))
return bytes
def ReadUInt32(file, endian):
"""Reads an unsinged 32-bit integer from the file-like |file| object,
treating it as having endianness specified by |endian| (per the |struct|
module), and returns it as a number. Raises a MachOError if the proper
length of data can't be read from |file|."""
bytes = CheckedRead(file, 4)
(uint32,) = struct.unpack(endian + 'I', bytes)
return uint32
def ReadMachHeader(file, endian):
"""Reads an entire |mach_header| structure (<mach-o/loader.h>) from the
file-like |file| object, treating it as having endianness specified by
|endian| (per the |struct| module), and returns a 7-tuple of its members
as numbers. Raises a MachOError if the proper length of data can't be read
from |file|."""
bytes = CheckedRead(file, 28)
magic, cputype, cpusubtype, filetype, ncmds, sizeofcmds, flags = \
struct.unpack(endian + '7I', bytes)
return magic, cputype, cpusubtype, filetype, ncmds, sizeofcmds, flags
def ReadFatArch(file):
"""Reads an entire |fat_arch| structure (<mach-o/fat.h>) from the file-like
|file| object, treating it as having endianness specified by |endian|
(per the |struct| module), and returns a 5-tuple of its members as numbers.
Raises a MachOError if the proper length of data can't be read from
|file|."""
bytes = CheckedRead(file, 20)
cputype, cpusubtype, offset, size, align = struct.unpack('>5I', bytes)
return cputype, cpusubtype, offset, size, align
def WriteUInt32(file, uint32, endian):
"""Writes |uint32| as an unsinged 32-bit integer to the file-like |file|
object, treating it as having endianness specified by |endian| (per the
|struct| module)."""
bytes = struct.pack(endian + 'I', uint32)
assert len(bytes) == 4
file.write(bytes)
def HandleMachOFile(file, options, offset=0):
"""Seeks the file-like |file| object to |offset|, reads its |mach_header|,
and rewrites the header's |flags| field if appropriate. The header's
endianness is detected. Both 32-bit and 64-bit Mach-O headers are supported
(mach_header and mach_header_64). Raises MachOError if used on a header that
does not have a known magic number or is not of type MH_EXECUTE. The
MH_PIE and MH_NO_HEAP_EXECUTION bits are set or cleared in the |flags| field
according to |options| and written to |file| if any changes need to be made.
If already set or clear as specified by |options|, nothing is written."""
CheckedSeek(file, offset)
magic = ReadUInt32(file, '<')
if magic == MH_MAGIC or magic == MH_MAGIC_64:
endian = '<'
elif magic == MH_CIGAM or magic == MH_CIGAM_64:
endian = '>'
else:
raise MachOError, \
'Mach-O file at offset %d has illusion of magic' % offset
CheckedSeek(file, offset)
magic, cputype, cpusubtype, filetype, ncmds, sizeofcmds, flags = \
ReadMachHeader(file, endian)
assert magic == MH_MAGIC or magic == MH_MAGIC_64
if filetype != MH_EXECUTE:
raise MachOError, \
'Mach-O file at offset %d is type 0x%x, expected MH_EXECUTE' % \
(offset, filetype)
original_flags = flags
if options.no_heap_execution:
flags |= MH_NO_HEAP_EXECUTION
else:
flags &= ~MH_NO_HEAP_EXECUTION
if options.pie:
flags |= MH_PIE
else:
flags &= ~MH_PIE
if flags != original_flags:
CheckedSeek(file, offset + 24)
WriteUInt32(file, flags, endian)
def HandleFatFile(file, options, fat_offset=0):
"""Seeks the file-like |file| object to |offset| and loops over its
|fat_header| entries, calling HandleMachOFile for each."""
CheckedSeek(file, fat_offset)
magic = ReadUInt32(file, '>')
assert magic == FAT_MAGIC
nfat_arch = ReadUInt32(file, '>')
for index in xrange(0, nfat_arch):
cputype, cpusubtype, offset, size, align = ReadFatArch(file)
assert size >= 28
# HandleMachOFile will seek around. Come back here after calling it, in
# case it sought.
fat_arch_offset = file.tell()
HandleMachOFile(file, options, offset)
CheckedSeek(file, fat_arch_offset)
def main(me, args):
parser = optparse.OptionParser('%prog [options] <executable_path>')
parser.add_option('--executable-heap', action='store_false',
dest='no_heap_execution', default=True,
help='Clear the MH_NO_HEAP_EXECUTION bit')
parser.add_option('--no-pie', action='store_false',
dest='pie', default=True,
help='Clear the MH_PIE bit')
(options, loose_args) = parser.parse_args(args)
if len(loose_args) != 1:
parser.print_usage()
return 1
executable_path = loose_args[0]
executable_file = open(executable_path, 'rb+')
magic = ReadUInt32(executable_file, '<')
if magic == FAT_CIGAM:
# Check FAT_CIGAM and not FAT_MAGIC because the read was little-endian.
HandleFatFile(executable_file, options)
elif magic == MH_MAGIC or magic == MH_CIGAM or \
magic == MH_MAGIC_64 or magic == MH_CIGAM_64:
HandleMachOFile(executable_file, options)
else:
raise MachOError, '%s is not a Mach-O or fat file' % executable_file
executable_file.close()
return 0
if __name__ == '__main__':
sys.exit(main(sys.argv[0], sys.argv[1:]))
| bsd-3-clause |
3dfxmadscientist/odoo_vi | addons/account_voucher/account_voucher.py | 16 | 86218 | # -*- coding: utf-8 -*-
##############################################################################
#
# OpenERP, Open Source Management Solution
# Copyright (C) 2004-2010 Tiny SPRL (<http://tiny.be>).
#
# This program is free software: you can redistribute it and/or modify
# it under the terms of the GNU Affero General Public License as
# published by the Free Software Foundation, either version 3 of the
# License, or (at your option) any later version.
#
# This program is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
# GNU Affero General Public License for more details.
#
# You should have received a copy of the GNU Affero General Public License
# along with this program. If not, see <http://www.gnu.org/licenses/>.
#
##############################################################################
import time
from lxml import etree
from openerp.osv import fields, osv
import openerp.addons.decimal_precision as dp
from openerp.tools.translate import _
from openerp.tools import float_compare
from openerp.report import report_sxw
class res_currency(osv.osv):
_inherit = "res.currency"
def _get_current_rate(self, cr, uid, ids, raise_on_no_rate=True, context=None):
if context is None:
context = {}
res = super(res_currency, self)._get_current_rate(cr, uid, ids, raise_on_no_rate, context=context)
if context.get('voucher_special_currency') in ids and context.get('voucher_special_currency_rate'):
res[context.get('voucher_special_currency')] = context.get('voucher_special_currency_rate')
return res
class res_company(osv.osv):
_inherit = "res.company"
_columns = {
'income_currency_exchange_account_id': fields.many2one(
'account.account',
string="Gain Exchange Rate Account",
domain="[('type', '=', 'other')]",),
'expense_currency_exchange_account_id': fields.many2one(
'account.account',
string="Loss Exchange Rate Account",
domain="[('type', '=', 'other')]",),
}
class account_config_settings(osv.osv_memory):
_inherit = 'account.config.settings'
_columns = {
'income_currency_exchange_account_id': fields.related(
'company_id', 'income_currency_exchange_account_id',
type='many2one',
relation='account.account',
string="Gain Exchange Rate Account",
domain="[('type', '=', 'other')]"),
'expense_currency_exchange_account_id': fields.related(
'company_id', 'expense_currency_exchange_account_id',
type="many2one",
relation='account.account',
string="Loss Exchange Rate Account",
domain="[('type', '=', 'other')]"),
}
def onchange_company_id(self, cr, uid, ids, company_id, context=None):
res = super(account_config_settings, self).onchange_company_id(cr, uid, ids, company_id, context=context)
if company_id:
company = self.pool.get('res.company').browse(cr, uid, company_id, context=context)
res['value'].update({'income_currency_exchange_account_id': company.income_currency_exchange_account_id and company.income_currency_exchange_account_id.id or False,
'expense_currency_exchange_account_id': company.expense_currency_exchange_account_id and company.expense_currency_exchange_account_id.id or False})
else:
res['value'].update({'income_currency_exchange_account_id': False,
'expense_currency_exchange_account_id': False})
return res
class account_voucher(osv.osv):
def _check_paid(self, cr, uid, ids, name, args, context=None):
res = {}
for voucher in self.browse(cr, uid, ids, context=context):
res[voucher.id] = any([((line.account_id.type, 'in', ('receivable', 'payable')) and line.reconcile_id) for line in voucher.move_ids])
return res
def _get_type(self, cr, uid, context=None):
if context is None:
context = {}
return context.get('type', False)
def _get_period(self, cr, uid, context=None):
if context is None: context = {}
if context.get('period_id', False):
return context.get('period_id')
periods = self.pool.get('account.period').find(cr, uid, context=context)
return periods and periods[0] or False
def _make_journal_search(self, cr, uid, ttype, context=None):
journal_pool = self.pool.get('account.journal')
return journal_pool.search(cr, uid, [('type', '=', ttype)], limit=1)
def _get_journal(self, cr, uid, context=None):
if context is None: context = {}
invoice_pool = self.pool.get('account.invoice')
journal_pool = self.pool.get('account.journal')
if context.get('invoice_id', False):
currency_id = invoice_pool.browse(cr, uid, context['invoice_id'], context=context).currency_id.id
journal_id = journal_pool.search(cr, uid, [('currency', '=', currency_id)], limit=1)
return journal_id and journal_id[0] or False
if context.get('journal_id', False):
return context.get('journal_id')
if not context.get('journal_id', False) and context.get('search_default_journal_id', False):
return context.get('search_default_journal_id')
ttype = context.get('type', 'bank')
if ttype in ('payment', 'receipt'):
ttype = 'bank'
res = self._make_journal_search(cr, uid, ttype, context=context)
return res and res[0] or False
def _get_tax(self, cr, uid, context=None):
if context is None: context = {}
journal_pool = self.pool.get('account.journal')
journal_id = context.get('journal_id', False)
if not journal_id:
ttype = context.get('type', 'bank')
res = journal_pool.search(cr, uid, [('type', '=', ttype)], limit=1)
if not res:
return False
journal_id = res[0]
if not journal_id:
return False
journal = journal_pool.browse(cr, uid, journal_id, context=context)
account_id = journal.default_credit_account_id or journal.default_debit_account_id
if account_id and account_id.tax_ids:
tax_id = account_id.tax_ids[0].id
return tax_id
return False
def _get_payment_rate_currency(self, cr, uid, context=None):
"""
Return the default value for field payment_rate_currency_id: the currency of the journal
if there is one, otherwise the currency of the user's company
"""
if context is None: context = {}
journal_pool = self.pool.get('account.journal')
journal_id = context.get('journal_id', False)
if journal_id:
journal = journal_pool.browse(cr, uid, journal_id, context=context)
if journal.currency:
return journal.currency.id
#no journal given in the context, use company currency as default
return self.pool.get('res.users').browse(cr, uid, uid, context=context).company_id.currency_id.id
def _get_currency(self, cr, uid, context=None):
if context is None: context = {}
journal_pool = self.pool.get('account.journal')
journal_id = context.get('journal_id', False)
if journal_id:
journal = journal_pool.browse(cr, uid, journal_id, context=context)
if journal.currency:
return journal.currency.id
return self.pool.get('res.users').browse(cr, uid, uid, context=context).company_id.currency_id.id
def _get_partner(self, cr, uid, context=None):
if context is None: context = {}
return context.get('partner_id', False)
def _get_reference(self, cr, uid, context=None):
if context is None: context = {}
return context.get('reference', False)
def _get_narration(self, cr, uid, context=None):
if context is None: context = {}
return context.get('narration', False)
def _get_amount(self, cr, uid, context=None):
if context is None:
context= {}
return context.get('amount', 0.0)
def name_get(self, cr, uid, ids, context=None):
if not ids:
return []
if context is None: context = {}
return [(r['id'], (r['number'] or _('Voucher'))) for r in self.read(cr, uid, ids, ['number'], context, load='_classic_write')]
def fields_view_get(self, cr, uid, view_id=None, view_type=False, context=None, toolbar=False, submenu=False):
mod_obj = self.pool.get('ir.model.data')
if context is None: context = {}
if view_type == 'form':
if not view_id and context.get('invoice_type'):
if context.get('invoice_type') in ('out_invoice', 'out_refund'):
result = mod_obj.get_object_reference(cr, uid, 'account_voucher', 'view_vendor_receipt_form')
else:
result = mod_obj.get_object_reference(cr, uid, 'account_voucher', 'view_vendor_payment_form')
result = result and result[1] or False
view_id = result
if not view_id and context.get('line_type'):
if context.get('line_type') == 'customer':
result = mod_obj.get_object_reference(cr, uid, 'account_voucher', 'view_vendor_receipt_form')
else:
result = mod_obj.get_object_reference(cr, uid, 'account_voucher', 'view_vendor_payment_form')
result = result and result[1] or False
view_id = result
res = super(account_voucher, self).fields_view_get(cr, uid, view_id=view_id, view_type=view_type, context=context, toolbar=toolbar, submenu=submenu)
doc = etree.XML(res['arch'])
if context.get('type', 'sale') in ('purchase', 'payment'):
nodes = doc.xpath("//field[@name='partner_id']")
for node in nodes:
node.set('context', "{'default_customer': 0, 'search_default_supplier': 1, 'default_supplier': 1}")
if context.get('invoice_type','') in ('in_invoice', 'in_refund'):
node.set('string', _("Supplier"))
res['arch'] = etree.tostring(doc)
return res
def _compute_writeoff_amount(self, cr, uid, line_dr_ids, line_cr_ids, amount, type):
debit = credit = 0.0
sign = type == 'payment' and -1 or 1
for l in line_dr_ids:
debit += l['amount']
for l in line_cr_ids:
credit += l['amount']
return amount - sign * (credit - debit)
def onchange_line_ids(self, cr, uid, ids, line_dr_ids, line_cr_ids, amount, voucher_currency, type, context=None):
context = context or {}
if not line_dr_ids and not line_cr_ids:
return {'value':{'writeoff_amount': 0.0}}
line_osv = self.pool.get("account.voucher.line")
line_dr_ids = resolve_o2m_operations(cr, uid, line_osv, line_dr_ids, ['amount'], context)
line_cr_ids = resolve_o2m_operations(cr, uid, line_osv, line_cr_ids, ['amount'], context)
#compute the field is_multi_currency that is used to hide/display options linked to secondary currency on the voucher
is_multi_currency = False
#loop on the voucher lines to see if one of these has a secondary currency. If yes, we need to see the options
for voucher_line in line_dr_ids+line_cr_ids:
line_id = voucher_line.get('id') and self.pool.get('account.voucher.line').browse(cr, uid, voucher_line['id'], context=context).move_line_id.id or voucher_line.get('move_line_id')
if line_id and self.pool.get('account.move.line').browse(cr, uid, line_id, context=context).currency_id:
is_multi_currency = True
break
return {'value': {'writeoff_amount': self._compute_writeoff_amount(cr, uid, line_dr_ids, line_cr_ids, amount, type), 'is_multi_currency': is_multi_currency}}
def _get_journal_currency(self, cr, uid, ids, name, args, context=None):
res = {}
for voucher in self.browse(cr, uid, ids, context=context):
res[voucher.id] = voucher.journal_id.currency and voucher.journal_id.currency.id or voucher.company_id.currency_id.id
return res
def _get_writeoff_amount(self, cr, uid, ids, name, args, context=None):
if not ids: return {}
currency_obj = self.pool.get('res.currency')
res = {}
debit = credit = 0.0
for voucher in self.browse(cr, uid, ids, context=context):
sign = voucher.type == 'payment' and -1 or 1
for l in voucher.line_dr_ids:
debit += l.amount
for l in voucher.line_cr_ids:
credit += l.amount
currency = voucher.currency_id or voucher.company_id.currency_id
res[voucher.id] = currency_obj.round(cr, uid, currency, voucher.amount - sign * (credit - debit))
return res
def _paid_amount_in_company_currency(self, cr, uid, ids, name, args, context=None):
if context is None:
context = {}
res = {}
ctx = context.copy()
for v in self.browse(cr, uid, ids, context=context):
ctx.update({'date': v.date})
#make a new call to browse in order to have the right date in the context, to get the right currency rate
voucher = self.browse(cr, uid, v.id, context=ctx)
ctx.update({
'voucher_special_currency': voucher.payment_rate_currency_id and voucher.payment_rate_currency_id.id or False,
'voucher_special_currency_rate': voucher.currency_id.rate * voucher.payment_rate,})
res[voucher.id] = self.pool.get('res.currency').compute(cr, uid, voucher.currency_id.id, voucher.company_id.currency_id.id, voucher.amount, context=ctx)
return res
def _get_currency_help_label(self, cr, uid, currency_id, payment_rate, payment_rate_currency_id, context=None):
"""
This function builds a string to help the users to understand the behavior of the payment rate fields they can specify on the voucher.
This string is only used to improve the usability in the voucher form view and has no other effect.
:param currency_id: the voucher currency
:type currency_id: integer
:param payment_rate: the value of the payment_rate field of the voucher
:type payment_rate: float
:param payment_rate_currency_id: the value of the payment_rate_currency_id field of the voucher
:type payment_rate_currency_id: integer
:return: translated string giving a tip on what's the effect of the current payment rate specified
:rtype: str
"""
rml_parser = report_sxw.rml_parse(cr, uid, 'currency_help_label', context=context)
currency_pool = self.pool.get('res.currency')
currency_str = payment_rate_str = ''
if currency_id:
currency_str = rml_parser.formatLang(1, currency_obj=currency_pool.browse(cr, uid, currency_id, context=context))
if payment_rate_currency_id:
payment_rate_str = rml_parser.formatLang(payment_rate, currency_obj=currency_pool.browse(cr, uid, payment_rate_currency_id, context=context))
currency_help_label = _('At the operation date, the exchange rate was\n%s = %s') % (currency_str, payment_rate_str)
return currency_help_label
def _fnct_currency_help_label(self, cr, uid, ids, name, args, context=None):
res = {}
for voucher in self.browse(cr, uid, ids, context=context):
res[voucher.id] = self._get_currency_help_label(cr, uid, voucher.currency_id.id, voucher.payment_rate, voucher.payment_rate_currency_id.id, context=context)
return res
_name = 'account.voucher'
_description = 'Accounting Voucher'
_inherit = ['mail.thread']
_order = "date desc, id desc"
# _rec_name = 'number'
_track = {
'state': {
'account_voucher.mt_voucher_state_change': lambda self, cr, uid, obj, ctx=None: True,
},
}
_columns = {
'type':fields.selection([
('sale','Sale'),
('purchase','Purchase'),
('payment','Payment'),
('receipt','Receipt'),
],'Default Type', readonly=True, states={'draft':[('readonly',False)]}),
'name':fields.char('Memo', size=256, readonly=True, states={'draft':[('readonly',False)]}),
'date':fields.date('Date', readonly=True, select=True, states={'draft':[('readonly',False)]}, help="Effective date for accounting entries"),
'journal_id':fields.many2one('account.journal', 'Journal', required=True, readonly=True, states={'draft':[('readonly',False)]}),
'account_id':fields.many2one('account.account', 'Account', required=True, readonly=True, states={'draft':[('readonly',False)]}),
'line_ids':fields.one2many('account.voucher.line','voucher_id','Voucher Lines', readonly=True, states={'draft':[('readonly',False)]}),
'line_cr_ids':fields.one2many('account.voucher.line','voucher_id','Credits',
domain=[('type','=','cr')], context={'default_type':'cr'}, readonly=True, states={'draft':[('readonly',False)]}),
'line_dr_ids':fields.one2many('account.voucher.line','voucher_id','Debits',
domain=[('type','=','dr')], context={'default_type':'dr'}, readonly=True, states={'draft':[('readonly',False)]}),
'period_id': fields.many2one('account.period', 'Period', required=True, readonly=True, states={'draft':[('readonly',False)]}),
'narration':fields.text('Notes', readonly=True, states={'draft':[('readonly',False)]}),
'currency_id': fields.function(_get_journal_currency, type='many2one', relation='res.currency', string='Currency', readonly=True, required=True),
'company_id': fields.many2one('res.company', 'Company', required=True, readonly=True, states={'draft':[('readonly',False)]}),
'state':fields.selection(
[('draft','Draft'),
('cancel','Cancelled'),
('proforma','Pro-forma'),
('posted','Posted')
], 'Status', readonly=True, size=32, track_visibility='onchange',
help=' * The \'Draft\' status is used when a user is encoding a new and unconfirmed Voucher. \
\n* The \'Pro-forma\' when voucher is in Pro-forma status,voucher does not have an voucher number. \
\n* The \'Posted\' status is used when user create voucher,a voucher number is generated and voucher entries are created in account \
\n* The \'Cancelled\' status is used when user cancel voucher.'),
'amount': fields.float('Total', digits_compute=dp.get_precision('Account'), required=True, readonly=True, states={'draft':[('readonly',False)]}),
'tax_amount':fields.float('Tax Amount', digits_compute=dp.get_precision('Account'), readonly=True, states={'draft':[('readonly',False)]}),
'reference': fields.char('Ref #', size=64, readonly=True, states={'draft':[('readonly',False)]}, help="Transaction reference number."),
'number': fields.char('Number', size=32, readonly=True,),
'move_id':fields.many2one('account.move', 'Account Entry'),
'move_ids': fields.related('move_id','line_id', type='one2many', relation='account.move.line', string='Journal Items', readonly=True),
'partner_id':fields.many2one('res.partner', 'Partner', change_default=1, readonly=True, states={'draft':[('readonly',False)]}),
'audit': fields.related('move_id','to_check', type='boolean', help='Check this box if you are unsure of that journal entry and if you want to note it as \'to be reviewed\' by an accounting expert.', relation='account.move', string='To Review'),
'paid': fields.function(_check_paid, string='Paid', type='boolean', help="The Voucher has been totally paid."),
'pay_now':fields.selection([
('pay_now','Pay Directly'),
('pay_later','Pay Later or Group Funds'),
],'Payment', select=True, readonly=True, states={'draft':[('readonly',False)]}),
'tax_id': fields.many2one('account.tax', 'Tax', readonly=True, states={'draft':[('readonly',False)]}, domain=[('price_include','=', False)], help="Only for tax excluded from price"),
'pre_line':fields.boolean('Previous Payments ?', required=False),
'date_due': fields.date('Due Date', readonly=True, select=True, states={'draft':[('readonly',False)]}),
'payment_option':fields.selection([
('without_writeoff', 'Keep Open'),
('with_writeoff', 'Reconcile Payment Balance'),
], 'Payment Difference', required=True, readonly=True, states={'draft': [('readonly', False)]}, help="This field helps you to choose what you want to do with the eventual difference between the paid amount and the sum of allocated amounts. You can either choose to keep open this difference on the partner's account, or reconcile it with the payment(s)"),
'writeoff_acc_id': fields.many2one('account.account', 'Counterpart Account', readonly=True, states={'draft': [('readonly', False)]}),
'comment': fields.char('Counterpart Comment', size=64, required=True, readonly=True, states={'draft': [('readonly', False)]}),
'analytic_id': fields.many2one('account.analytic.account','Write-Off Analytic Account', readonly=True, states={'draft': [('readonly', False)]}),
'writeoff_amount': fields.function(_get_writeoff_amount, string='Difference Amount', type='float', readonly=True, help="Computed as the difference between the amount stated in the voucher and the sum of allocation on the voucher lines."),
'payment_rate_currency_id': fields.many2one('res.currency', 'Payment Rate Currency', required=True, readonly=True, states={'draft':[('readonly',False)]}),
'payment_rate': fields.float('Exchange Rate', digits=(12,6), required=True, readonly=True, states={'draft': [('readonly', False)]},
help='The specific rate that will be used, in this voucher, between the selected currency (in \'Payment Rate Currency\' field) and the voucher currency.'),
'paid_amount_in_company_currency': fields.function(_paid_amount_in_company_currency, string='Paid Amount in Company Currency', type='float', readonly=True),
'is_multi_currency': fields.boolean('Multi Currency Voucher', help='Fields with internal purpose only that depicts if the voucher is a multi currency one or not'),
'currency_help_label': fields.function(_fnct_currency_help_label, type='text', string="Helping Sentence", help="This sentence helps you to know how to specify the payment rate by giving you the direct effect it has"),
}
_defaults = {
'period_id': _get_period,
'partner_id': _get_partner,
'journal_id':_get_journal,
'currency_id': _get_currency,
'reference': _get_reference,
'narration':_get_narration,
'amount': _get_amount,
'type':_get_type,
'state': 'draft',
'pay_now': 'pay_now',
'name': '',
'date': lambda *a: time.strftime('%Y-%m-%d'),
'company_id': lambda self,cr,uid,c: self.pool.get('res.company')._company_default_get(cr, uid, 'account.voucher',context=c),
'tax_id': _get_tax,
'payment_option': 'without_writeoff',
'comment': _('Write-Off'),
'payment_rate': 1.0,
'payment_rate_currency_id': _get_payment_rate_currency,
}
def compute_tax(self, cr, uid, ids, context=None):
tax_pool = self.pool.get('account.tax')
partner_pool = self.pool.get('res.partner')
position_pool = self.pool.get('account.fiscal.position')
voucher_line_pool = self.pool.get('account.voucher.line')
voucher_pool = self.pool.get('account.voucher')
if context is None: context = {}
for voucher in voucher_pool.browse(cr, uid, ids, context=context):
voucher_amount = 0.0
for line in voucher.line_ids:
voucher_amount += line.untax_amount or line.amount
line.amount = line.untax_amount or line.amount
voucher_line_pool.write(cr, uid, [line.id], {'amount':line.amount, 'untax_amount':line.untax_amount})
if not voucher.tax_id:
self.write(cr, uid, [voucher.id], {'amount':voucher_amount, 'tax_amount':0.0})
continue
tax = [tax_pool.browse(cr, uid, voucher.tax_id.id, context=context)]
partner = partner_pool.browse(cr, uid, voucher.partner_id.id, context=context) or False
taxes = position_pool.map_tax(cr, uid, partner and partner.property_account_position or False, tax)
tax = tax_pool.browse(cr, uid, taxes, context=context)
total = voucher_amount
total_tax = 0.0
if not tax[0].price_include:
for line in voucher.line_ids:
for tax_line in tax_pool.compute_all(cr, uid, tax, line.amount, 1).get('taxes', []):
total_tax += tax_line.get('amount', 0.0)
total += total_tax
else:
for line in voucher.line_ids:
line_total = 0.0
line_tax = 0.0
for tax_line in tax_pool.compute_all(cr, uid, tax, line.untax_amount or line.amount, 1).get('taxes', []):
line_tax += tax_line.get('amount', 0.0)
line_total += tax_line.get('price_unit')
total_tax += line_tax
untax_amount = line.untax_amount or line.amount
voucher_line_pool.write(cr, uid, [line.id], {'amount':line_total, 'untax_amount':untax_amount})
self.write(cr, uid, [voucher.id], {'amount':total, 'tax_amount':total_tax})
return True
def onchange_price(self, cr, uid, ids, line_ids, tax_id, partner_id=False, context=None):
context = context or {}
tax_pool = self.pool.get('account.tax')
partner_pool = self.pool.get('res.partner')
position_pool = self.pool.get('account.fiscal.position')
line_pool = self.pool.get('account.voucher.line')
if not line_ids:
line_ids = []
res = {
'tax_amount': False,
'amount': False,
}
voucher_total = 0.0
line_ids = resolve_o2m_operations(cr, uid, line_pool, line_ids, ["amount"], context)
total_tax = 0.0
for line in line_ids:
line_amount = 0.0
line_amount = line.get('amount',0.0)
if tax_id:
tax = [tax_pool.browse(cr, uid, tax_id, context=context)]
if partner_id:
partner = partner_pool.browse(cr, uid, partner_id, context=context) or False
taxes = position_pool.map_tax(cr, uid, partner and partner.property_account_position or False, tax)
tax = tax_pool.browse(cr, uid, taxes, context=context)
if not tax[0].price_include:
for tax_line in tax_pool.compute_all(cr, uid, tax, line_amount, 1).get('taxes', []):
total_tax += tax_line.get('amount')
voucher_total += line_amount
total = voucher_total + total_tax
res.update({
'amount': total or voucher_total,
'tax_amount': total_tax
})
return {
'value': res
}
def onchange_term_id(self, cr, uid, ids, term_id, amount):
term_pool = self.pool.get('account.payment.term')
terms = False
due_date = False
default = {'date_due':False}
if term_id and amount:
terms = term_pool.compute(cr, uid, term_id, amount)
if terms:
due_date = terms[-1][0]
default.update({
'date_due':due_date
})
return {'value':default}
def onchange_journal_voucher(self, cr, uid, ids, line_ids=False, tax_id=False, price=0.0, partner_id=False, journal_id=False, ttype=False, company_id=False, context=None):
"""price
Returns a dict that contains new values and context
@param partner_id: latest value from user input for field partner_id
@param args: other arguments
@param context: context arguments, like lang, time zone
@return: Returns a dict which contains new values, and context
"""
default = {
'value':{},
}
if not partner_id or not journal_id:
return default
partner_pool = self.pool.get('res.partner')
journal_pool = self.pool.get('account.journal')
journal = journal_pool.browse(cr, uid, journal_id, context=context)
partner = partner_pool.browse(cr, uid, partner_id, context=context)
account_id = False
tr_type = False
if journal.type in ('sale','sale_refund'):
account_id = partner.property_account_receivable.id
tr_type = 'sale'
elif journal.type in ('purchase', 'purchase_refund','expense'):
account_id = partner.property_account_payable.id
tr_type = 'purchase'
else:
if not journal.default_credit_account_id or not journal.default_debit_account_id:
raise osv.except_osv(_('Error!'), _('Please define default credit/debit accounts on the journal "%s".') % (journal.name))
account_id = journal.default_credit_account_id.id or journal.default_debit_account_id.id
tr_type = 'receipt'
default['value']['account_id'] = account_id
default['value']['type'] = ttype or tr_type
vals = self.onchange_journal(cr, uid, ids, journal_id, line_ids, tax_id, partner_id, time.strftime('%Y-%m-%d'), price, ttype, company_id, context)
default['value'].update(vals.get('value'))
return default
def onchange_rate(self, cr, uid, ids, rate, amount, currency_id, payment_rate_currency_id, company_id, context=None):
res = {'value': {'paid_amount_in_company_currency': amount, 'currency_help_label': self._get_currency_help_label(cr, uid, currency_id, rate, payment_rate_currency_id, context=context)}}
if rate and amount and currency_id:
company_currency = self.pool.get('res.company').browse(cr, uid, company_id, context=context).currency_id
#context should contain the date, the payment currency and the payment rate specified on the voucher
amount_in_company_currency = self.pool.get('res.currency').compute(cr, uid, currency_id, company_currency.id, amount, context=context)
res['value']['paid_amount_in_company_currency'] = amount_in_company_currency
return res
def onchange_amount(self, cr, uid, ids, amount, rate, partner_id, journal_id, currency_id, ttype, date, payment_rate_currency_id, company_id, context=None):
if context is None:
context = {}
ctx = context.copy()
ctx.update({'date': date})
#read the voucher rate with the right date in the context
currency_id = currency_id or self.pool.get('res.company').browse(cr, uid, company_id, context=ctx).currency_id.id
voucher_rate = self.pool.get('res.currency').read(cr, uid, currency_id, ['rate'], context=ctx)['rate']
ctx.update({
'voucher_special_currency': payment_rate_currency_id,
'voucher_special_currency_rate': rate * voucher_rate})
res = self.recompute_voucher_lines(cr, uid, ids, partner_id, journal_id, amount, currency_id, ttype, date, context=ctx)
vals = self.onchange_rate(cr, uid, ids, rate, amount, currency_id, payment_rate_currency_id, company_id, context=ctx)
for key in vals.keys():
res[key].update(vals[key])
return res
def recompute_payment_rate(self, cr, uid, ids, vals, currency_id, date, ttype, journal_id, amount, context=None):
if context is None:
context = {}
#on change of the journal, we need to set also the default value for payment_rate and payment_rate_currency_id
currency_obj = self.pool.get('res.currency')
journal = self.pool.get('account.journal').browse(cr, uid, journal_id, context=context)
company_id = journal.company_id.id
payment_rate = 1.0
currency_id = currency_id or journal.company_id.currency_id.id
payment_rate_currency_id = currency_id
ctx = context.copy()
ctx.update({'date': date})
o2m_to_loop = False
if ttype == 'receipt':
o2m_to_loop = 'line_cr_ids'
elif ttype == 'payment':
o2m_to_loop = 'line_dr_ids'
if o2m_to_loop and 'value' in vals and o2m_to_loop in vals['value']:
for voucher_line in vals['value'][o2m_to_loop]:
if voucher_line['currency_id'] != currency_id:
# we take as default value for the payment_rate_currency_id, the currency of the first invoice that
# is not in the voucher currency
payment_rate_currency_id = voucher_line['currency_id']
tmp = currency_obj.browse(cr, uid, payment_rate_currency_id, context=ctx).rate
payment_rate = tmp / currency_obj.browse(cr, uid, currency_id, context=ctx).rate
break
vals['value'].update({
'payment_rate': payment_rate,
'currency_id': currency_id,
'payment_rate_currency_id': payment_rate_currency_id
})
#read the voucher rate with the right date in the context
voucher_rate = self.pool.get('res.currency').read(cr, uid, currency_id, ['rate'], context=ctx)['rate']
ctx.update({
'voucher_special_currency_rate': payment_rate * voucher_rate,
'voucher_special_currency': payment_rate_currency_id})
res = self.onchange_rate(cr, uid, ids, payment_rate, amount, currency_id, payment_rate_currency_id, company_id, context=ctx)
for key in res.keys():
vals[key].update(res[key])
return vals
def basic_onchange_partner(self, cr, uid, ids, partner_id, journal_id, ttype, context=None):
partner_pool = self.pool.get('res.partner')
journal_pool = self.pool.get('account.journal')
res = {'value': {'account_id': False}}
if not partner_id or not journal_id:
return res
journal = journal_pool.browse(cr, uid, journal_id, context=context)
partner = partner_pool.browse(cr, uid, partner_id, context=context)
account_id = False
if journal.type in ('sale','sale_refund'):
account_id = partner.property_account_receivable.id
elif journal.type in ('purchase', 'purchase_refund','expense'):
account_id = partner.property_account_payable.id
else:
account_id = journal.default_credit_account_id.id or journal.default_debit_account_id.id
res['value']['account_id'] = account_id
return res
def onchange_partner_id(self, cr, uid, ids, partner_id, journal_id, amount, currency_id, ttype, date, context=None):
if not journal_id:
return {}
if context is None:
context = {}
#TODO: comment me and use me directly in the sales/purchases views
res = self.basic_onchange_partner(cr, uid, ids, partner_id, journal_id, ttype, context=context)
if ttype in ['sale', 'purchase']:
return res
ctx = context.copy()
# not passing the payment_rate currency and the payment_rate in the context but it's ok because they are reset in recompute_payment_rate
ctx.update({'date': date})
vals = self.recompute_voucher_lines(cr, uid, ids, partner_id, journal_id, amount, currency_id, ttype, date, context=ctx)
vals2 = self.recompute_payment_rate(cr, uid, ids, vals, currency_id, date, ttype, journal_id, amount, context=context)
for key in vals.keys():
res[key].update(vals[key])
for key in vals2.keys():
res[key].update(vals2[key])
#TODO: can probably be removed now
#TODO: onchange_partner_id() should not returns [pre_line, line_dr_ids, payment_rate...] for type sale, and not
# [pre_line, line_cr_ids, payment_rate...] for type purchase.
# We should definitively split account.voucher object in two and make distinct on_change functions. In the
# meanwhile, bellow lines must be there because the fields aren't present in the view, what crashes if the
# onchange returns a value for them
if ttype == 'sale':
del(res['value']['line_dr_ids'])
del(res['value']['pre_line'])
del(res['value']['payment_rate'])
elif ttype == 'purchase':
del(res['value']['line_cr_ids'])
del(res['value']['pre_line'])
del(res['value']['payment_rate'])
return res
def recompute_voucher_lines(self, cr, uid, ids, partner_id, journal_id, price, currency_id, ttype, date, context=None):
"""
Returns a dict that contains new values and context
@param partner_id: latest value from user input for field partner_id
@param args: other arguments
@param context: context arguments, like lang, time zone
@return: Returns a dict which contains new values, and context
"""
def _remove_noise_in_o2m():
"""if the line is partially reconciled, then we must pay attention to display it only once and
in the good o2m.
This function returns True if the line is considered as noise and should not be displayed
"""
if line.reconcile_partial_id:
if currency_id == line.currency_id.id:
if line.amount_residual_currency <= 0:
return True
else:
if line.amount_residual <= 0:
return True
return False
if context is None:
context = {}
context_multi_currency = context.copy()
currency_pool = self.pool.get('res.currency')
move_line_pool = self.pool.get('account.move.line')
partner_pool = self.pool.get('res.partner')
journal_pool = self.pool.get('account.journal')
line_pool = self.pool.get('account.voucher.line')
#set default values
default = {
'value': {'line_dr_ids': [] ,'line_cr_ids': [] ,'pre_line': False,},
}
#drop existing lines
line_ids = ids and line_pool.search(cr, uid, [('voucher_id', '=', ids[0])]) or False
if line_ids:
line_pool.unlink(cr, uid, line_ids)
if not partner_id or not journal_id:
return default
journal = journal_pool.browse(cr, uid, journal_id, context=context)
partner = partner_pool.browse(cr, uid, partner_id, context=context)
currency_id = currency_id or journal.company_id.currency_id.id
total_credit = 0.0
total_debit = 0.0
account_type = None
if context.get('account_id'):
account_type = self.pool['account.account'].browse(cr, uid, context['account_id'], context=context).type
if ttype == 'payment':
if not account_type:
account_type = 'payable'
total_debit = price or 0.0
else:
total_credit = price or 0.0
if not account_type:
account_type = 'receivable'
if not context.get('move_line_ids', False):
ids = move_line_pool.search(cr, uid, [('state','=','valid'), ('account_id.type', '=', account_type), ('reconcile_id', '=', False), ('partner_id', '=', partner_id)], context=context)
else:
ids = context['move_line_ids']
invoice_id = context.get('invoice_id', False)
company_currency = journal.company_id.currency_id.id
move_lines_found = []
#order the lines by most old first
ids.reverse()
account_move_lines = move_line_pool.browse(cr, uid, ids, context=context)
#compute the total debit/credit and look for a matching open amount or invoice
for line in account_move_lines:
if _remove_noise_in_o2m():
continue
if invoice_id:
if line.invoice.id == invoice_id:
#if the invoice linked to the voucher line is equal to the invoice_id in context
#then we assign the amount on that line, whatever the other voucher lines
move_lines_found.append(line.id)
elif currency_id == company_currency:
#otherwise treatments is the same but with other field names
if line.amount_residual == price:
#if the amount residual is equal the amount voucher, we assign it to that voucher
#line, whatever the other voucher lines
move_lines_found.append(line.id)
break
#otherwise we will split the voucher amount on each line (by most old first)
total_credit += line.credit or 0.0
total_debit += line.debit or 0.0
elif currency_id == line.currency_id.id:
if line.amount_residual_currency == price:
move_lines_found.append(line.id)
break
total_credit += line.credit and line.amount_currency or 0.0
total_debit += line.debit and line.amount_currency or 0.0
remaining_amount = price
#voucher line creation
for line in account_move_lines:
if _remove_noise_in_o2m():
continue
if line.currency_id and currency_id == line.currency_id.id:
amount_original = abs(line.amount_currency)
amount_unreconciled = abs(line.amount_residual_currency)
else:
#always use the amount booked in the company currency as the basis of the conversion into the voucher currency
amount_original = currency_pool.compute(cr, uid, company_currency, currency_id, line.credit or line.debit or 0.0, context=context_multi_currency)
amount_unreconciled = currency_pool.compute(cr, uid, company_currency, currency_id, abs(line.amount_residual), context=context_multi_currency)
line_currency_id = line.currency_id and line.currency_id.id or company_currency
rs = {
'name':line.move_id.name,
'type': line.credit and 'dr' or 'cr',
'move_line_id':line.id,
'account_id':line.account_id.id,
'amount_original': amount_original,
'amount': (line.id in move_lines_found) and min(abs(remaining_amount), amount_unreconciled) or 0.0,
'date_original':line.date,
'date_due':line.date_maturity,
'amount_unreconciled': amount_unreconciled,
'currency_id': line_currency_id,
}
remaining_amount -= rs['amount']
#in case a corresponding move_line hasn't been found, we now try to assign the voucher amount
#on existing invoices: we split voucher amount by most old first, but only for lines in the same currency
if not move_lines_found:
if currency_id == line_currency_id:
if line.credit:
amount = min(amount_unreconciled, abs(total_debit))
rs['amount'] = amount
total_debit -= amount
else:
amount = min(amount_unreconciled, abs(total_credit))
rs['amount'] = amount
total_credit -= amount
if rs['amount_unreconciled'] == rs['amount']:
rs['reconcile'] = True
if rs['type'] == 'cr':
default['value']['line_cr_ids'].append(rs)
else:
default['value']['line_dr_ids'].append(rs)
if len(default['value']['line_cr_ids']) > 0:
default['value']['pre_line'] = 1
elif len(default['value']['line_dr_ids']) > 0:
default['value']['pre_line'] = 1
default['value']['writeoff_amount'] = self._compute_writeoff_amount(cr, uid, default['value']['line_dr_ids'], default['value']['line_cr_ids'], price, ttype)
return default
def onchange_payment_rate_currency(self, cr, uid, ids, currency_id, payment_rate, payment_rate_currency_id, date, amount, company_id, context=None):
if context is None:
context = {}
res = {'value': {}}
if currency_id:
#set the default payment rate of the voucher and compute the paid amount in company currency
ctx = context.copy()
ctx.update({'date': date})
#read the voucher rate with the right date in the context
voucher_rate = self.pool.get('res.currency').read(cr, uid, currency_id, ['rate'], context=ctx)['rate']
ctx.update({
'voucher_special_currency_rate': payment_rate * voucher_rate,
'voucher_special_currency': payment_rate_currency_id})
vals = self.onchange_rate(cr, uid, ids, payment_rate, amount, currency_id, payment_rate_currency_id, company_id, context=ctx)
for key in vals.keys():
res[key].update(vals[key])
return res
def onchange_date(self, cr, uid, ids, date, currency_id, payment_rate_currency_id, amount, company_id, context=None):
"""
@param date: latest value from user input for field date
@param args: other arguments
@param context: context arguments, like lang, time zone
@return: Returns a dict which contains new values, and context
"""
if context is None:
context ={}
res = {'value': {}}
#set the period of the voucher
period_pool = self.pool.get('account.period')
currency_obj = self.pool.get('res.currency')
ctx = context.copy()
ctx.update({'company_id': company_id, 'account_period_prefer_normal': True})
voucher_currency_id = currency_id or self.pool.get('res.company').browse(cr, uid, company_id, context=ctx).currency_id.id
pids = period_pool.find(cr, uid, date, context=ctx)
if pids:
res['value'].update({'period_id':pids[0]})
if payment_rate_currency_id:
ctx.update({'date': date})
payment_rate = 1.0
if payment_rate_currency_id != currency_id:
tmp = currency_obj.browse(cr, uid, payment_rate_currency_id, context=ctx).rate
payment_rate = tmp / currency_obj.browse(cr, uid, voucher_currency_id, context=ctx).rate
vals = self.onchange_payment_rate_currency(cr, uid, ids, voucher_currency_id, payment_rate, payment_rate_currency_id, date, amount, company_id, context=context)
vals['value'].update({'payment_rate': payment_rate})
for key in vals.keys():
res[key].update(vals[key])
return res
def onchange_journal(self, cr, uid, ids, journal_id, line_ids, tax_id, partner_id, date, amount, ttype, company_id, context=None):
if context is None:
context = {}
if not journal_id:
return False
journal_pool = self.pool.get('account.journal')
journal = journal_pool.browse(cr, uid, journal_id, context=context)
account_id = journal.default_credit_account_id or journal.default_debit_account_id
tax_id = False
if account_id and account_id.tax_ids:
tax_id = account_id.tax_ids[0].id
vals = {'value':{} }
if ttype in ('sale', 'purchase'):
vals = self.onchange_price(cr, uid, ids, line_ids, tax_id, partner_id, context)
vals['value'].update({'tax_id':tax_id,'amount': amount})
currency_id = False
if journal.currency:
currency_id = journal.currency.id
else:
currency_id = journal.company_id.currency_id.id
vals['value'].update({'currency_id': currency_id})
#in case we want to register the payment directly from an invoice, it's confusing to allow to switch the journal
#without seeing that the amount is expressed in the journal currency, and not in the invoice currency. So to avoid
#this common mistake, we simply reset the amount to 0 if the currency is not the invoice currency.
if context.get('payment_expected_currency') and currency_id != context.get('payment_expected_currency'):
vals['value']['amount'] = 0
amount = 0
if partner_id:
res = self.onchange_partner_id(cr, uid, ids, partner_id, journal_id, amount, currency_id, ttype, date, context)
for key in res.keys():
vals[key].update(res[key])
return vals
def button_proforma_voucher(self, cr, uid, ids, context=None):
self.signal_proforma_voucher(cr, uid, ids)
return {'type': 'ir.actions.act_window_close'}
def proforma_voucher(self, cr, uid, ids, context=None):
self.action_move_line_create(cr, uid, ids, context=context)
return True
def action_cancel_draft(self, cr, uid, ids, context=None):
self.create_workflow(cr, uid, ids)
self.write(cr, uid, ids, {'state':'draft'})
return True
def cancel_voucher(self, cr, uid, ids, context=None):
reconcile_pool = self.pool.get('account.move.reconcile')
move_pool = self.pool.get('account.move')
move_line_pool = self.pool.get('account.move.line')
for voucher in self.browse(cr, uid, ids, context=context):
# refresh to make sure you don't unlink an already removed move
voucher.refresh()
for line in voucher.move_ids:
if line.reconcile_id:
move_lines = [move_line.id for move_line in line.reconcile_id.line_id]
move_lines.remove(line.id)
reconcile_pool.unlink(cr, uid, [line.reconcile_id.id])
if len(move_lines) >= 2:
move_line_pool.reconcile_partial(cr, uid, move_lines, 'auto',context=context)
if voucher.move_id:
move_pool.button_cancel(cr, uid, [voucher.move_id.id])
move_pool.unlink(cr, uid, [voucher.move_id.id])
res = {
'state':'cancel',
'move_id':False,
}
self.write(cr, uid, ids, res)
return True
def unlink(self, cr, uid, ids, context=None):
for t in self.read(cr, uid, ids, ['state'], context=context):
if t['state'] not in ('draft', 'cancel'):
raise osv.except_osv(_('Invalid Action!'), _('Cannot delete voucher(s) which are already opened or paid.'))
return super(account_voucher, self).unlink(cr, uid, ids, context=context)
def onchange_payment(self, cr, uid, ids, pay_now, journal_id, partner_id, ttype='sale'):
res = {}
if not partner_id:
return res
res = {}
partner_pool = self.pool.get('res.partner')
journal_pool = self.pool.get('account.journal')
if pay_now == 'pay_later':
partner = partner_pool.browse(cr, uid, partner_id)
journal = journal_pool.browse(cr, uid, journal_id)
if journal.type in ('sale','sale_refund'):
account_id = partner.property_account_receivable.id
elif journal.type in ('purchase', 'purchase_refund','expense'):
account_id = partner.property_account_payable.id
else:
account_id = journal.default_credit_account_id.id or journal.default_debit_account_id.id
if account_id:
res['account_id'] = account_id
return {'value':res}
def _sel_context(self, cr, uid, voucher_id, context=None):
"""
Select the context to use accordingly if it needs to be multicurrency or not.
:param voucher_id: Id of the actual voucher
:return: The returned context will be the same as given in parameter if the voucher currency is the same
than the company currency, otherwise it's a copy of the parameter with an extra key 'date' containing
the date of the voucher.
:rtype: dict
"""
company_currency = self._get_company_currency(cr, uid, voucher_id, context)
current_currency = self._get_current_currency(cr, uid, voucher_id, context)
if current_currency <> company_currency:
context_multi_currency = context.copy()
voucher = self.pool.get('account.voucher').browse(cr, uid, voucher_id, context)
context_multi_currency.update({'date': voucher.date})
return context_multi_currency
return context
def first_move_line_get(self, cr, uid, voucher_id, move_id, company_currency, current_currency, context=None):
'''
Return a dict to be use to create the first account move line of given voucher.
:param voucher_id: Id of voucher what we are creating account_move.
:param move_id: Id of account move where this line will be added.
:param company_currency: id of currency of the company to which the voucher belong
:param current_currency: id of currency of the voucher
:return: mapping between fieldname and value of account move line to create
:rtype: dict
'''
voucher = self.pool.get('account.voucher').browse(cr,uid,voucher_id,context)
debit = credit = 0.0
# TODO: is there any other alternative then the voucher type ??
# ANSWER: We can have payment and receipt "In Advance".
# TODO: Make this logic available.
# -for sale, purchase we have but for the payment and receipt we do not have as based on the bank/cash journal we can not know its payment or receipt
if voucher.type in ('purchase', 'payment'):
credit = voucher.paid_amount_in_company_currency
elif voucher.type in ('sale', 'receipt'):
debit = voucher.paid_amount_in_company_currency
if debit < 0: credit = -debit; debit = 0.0
if credit < 0: debit = -credit; credit = 0.0
sign = debit - credit < 0 and -1 or 1
#set the first line of the voucher
move_line = {
'name': voucher.name or '/',
'debit': debit,
'credit': credit,
'account_id': voucher.account_id.id,
'move_id': move_id,
'journal_id': voucher.journal_id.id,
'period_id': voucher.period_id.id,
'partner_id': voucher.partner_id.id,
'currency_id': company_currency <> current_currency and current_currency or False,
'amount_currency': company_currency <> current_currency and sign * voucher.amount or 0.0,
'date': voucher.date,
'date_maturity': voucher.date_due
}
return move_line
def account_move_get(self, cr, uid, voucher_id, context=None):
'''
This method prepare the creation of the account move related to the given voucher.
:param voucher_id: Id of voucher for which we are creating account_move.
:return: mapping between fieldname and value of account move to create
:rtype: dict
'''
seq_obj = self.pool.get('ir.sequence')
voucher = self.pool.get('account.voucher').browse(cr,uid,voucher_id,context)
if voucher.number:
name = voucher.number
elif voucher.journal_id.sequence_id:
if not voucher.journal_id.sequence_id.active:
raise osv.except_osv(_('Configuration Error !'),
_('Please activate the sequence of selected journal !'))
c = dict(context)
c.update({'fiscalyear_id': voucher.period_id.fiscalyear_id.id})
name = seq_obj.next_by_id(cr, uid, voucher.journal_id.sequence_id.id, context=c)
else:
raise osv.except_osv(_('Error!'),
_('Please define a sequence on the journal.'))
if not voucher.reference:
ref = name.replace('/','')
else:
ref = voucher.reference
move = {
'name': name,
'journal_id': voucher.journal_id.id,
'narration': voucher.narration,
'date': voucher.date,
'ref': ref,
'period_id': voucher.period_id.id,
}
return move
def _get_exchange_lines(self, cr, uid, line, move_id, amount_residual, company_currency, current_currency, context=None):
'''
Prepare the two lines in company currency due to currency rate difference.
:param line: browse record of the voucher.line for which we want to create currency rate difference accounting
entries
:param move_id: Account move wher the move lines will be.
:param amount_residual: Amount to be posted.
:param company_currency: id of currency of the company to which the voucher belong
:param current_currency: id of currency of the voucher
:return: the account move line and its counterpart to create, depicted as mapping between fieldname and value
:rtype: tuple of dict
'''
if amount_residual > 0:
account_id = line.voucher_id.company_id.expense_currency_exchange_account_id
if not account_id:
raise osv.except_osv(_('Insufficient Configuration!'),_("You should configure the 'Loss Exchange Rate Account' in the accounting settings, to manage automatically the booking of accounting entries related to differences between exchange rates."))
else:
account_id = line.voucher_id.company_id.income_currency_exchange_account_id
if not account_id:
raise osv.except_osv(_('Insufficient Configuration!'),_("You should configure the 'Gain Exchange Rate Account' in the accounting settings, to manage automatically the booking of accounting entries related to differences between exchange rates."))
# Even if the amount_currency is never filled, we need to pass the foreign currency because otherwise
# the receivable/payable account may have a secondary currency, which render this field mandatory
if line.account_id.currency_id:
account_currency_id = line.account_id.currency_id.id
else:
account_currency_id = company_currency <> current_currency and current_currency or False
move_line = {
'journal_id': line.voucher_id.journal_id.id,
'period_id': line.voucher_id.period_id.id,
'name': _('change')+': '+(line.name or '/'),
'account_id': line.account_id.id,
'move_id': move_id,
'partner_id': line.voucher_id.partner_id.id,
'currency_id': account_currency_id,
'amount_currency': 0.0,
'quantity': 1,
'credit': amount_residual > 0 and amount_residual or 0.0,
'debit': amount_residual < 0 and -amount_residual or 0.0,
'date': line.voucher_id.date,
}
move_line_counterpart = {
'journal_id': line.voucher_id.journal_id.id,
'period_id': line.voucher_id.period_id.id,
'name': _('change')+': '+(line.name or '/'),
'account_id': account_id.id,
'move_id': move_id,
'amount_currency': 0.0,
'partner_id': line.voucher_id.partner_id.id,
'currency_id': account_currency_id,
'quantity': 1,
'debit': amount_residual > 0 and amount_residual or 0.0,
'credit': amount_residual < 0 and -amount_residual or 0.0,
'date': line.voucher_id.date,
}
return (move_line, move_line_counterpart)
def _convert_amount(self, cr, uid, amount, voucher_id, context=None):
'''
This function convert the amount given in company currency. It takes either the rate in the voucher (if the
payment_rate_currency_id is relevant) either the rate encoded in the system.
:param amount: float. The amount to convert
:param voucher: id of the voucher on which we want the conversion
:param context: to context to use for the conversion. It may contain the key 'date' set to the voucher date
field in order to select the good rate to use.
:return: the amount in the currency of the voucher's company
:rtype: float
'''
if context is None:
context = {}
currency_obj = self.pool.get('res.currency')
voucher = self.browse(cr, uid, voucher_id, context=context)
return currency_obj.compute(cr, uid, voucher.currency_id.id, voucher.company_id.currency_id.id, amount, context=context)
def voucher_move_line_create(self, cr, uid, voucher_id, line_total, move_id, company_currency, current_currency, context=None):
'''
Create one account move line, on the given account move, per voucher line where amount is not 0.0.
It returns Tuple with tot_line what is total of difference between debit and credit and
a list of lists with ids to be reconciled with this format (total_deb_cred,list_of_lists).
:param voucher_id: Voucher id what we are working with
:param line_total: Amount of the first line, which correspond to the amount we should totally split among all voucher lines.
:param move_id: Account move wher those lines will be joined.
:param company_currency: id of currency of the company to which the voucher belong
:param current_currency: id of currency of the voucher
:return: Tuple build as (remaining amount not allocated on voucher lines, list of account_move_line created in this method)
:rtype: tuple(float, list of int)
'''
if context is None:
context = {}
move_line_obj = self.pool.get('account.move.line')
currency_obj = self.pool.get('res.currency')
tax_obj = self.pool.get('account.tax')
tot_line = line_total
rec_lst_ids = []
date = self.read(cr, uid, voucher_id, ['date'], context=context)['date']
ctx = context.copy()
ctx.update({'date': date})
voucher = self.pool.get('account.voucher').browse(cr, uid, voucher_id, context=ctx)
voucher_currency = voucher.journal_id.currency or voucher.company_id.currency_id
ctx.update({
'voucher_special_currency_rate': voucher_currency.rate * voucher.payment_rate ,
'voucher_special_currency': voucher.payment_rate_currency_id and voucher.payment_rate_currency_id.id or False,})
prec = self.pool.get('decimal.precision').precision_get(cr, uid, 'Account')
for line in voucher.line_ids:
#create one move line per voucher line where amount is not 0.0
# AND (second part of the clause) only if the original move line was not having debit = credit = 0 (which is a legal value)
if not line.amount and not (line.move_line_id and not float_compare(line.move_line_id.debit, line.move_line_id.credit, precision_digits=prec) and not float_compare(line.move_line_id.debit, 0.0, precision_digits=prec)):
continue
# convert the amount set on the voucher line into the currency of the voucher's company
# this calls res_curreny.compute() with the right context, so that it will take either the rate on the voucher if it is relevant or will use the default behaviour
amount = self._convert_amount(cr, uid, line.untax_amount or line.amount, voucher.id, context=ctx)
# if the amount encoded in voucher is equal to the amount unreconciled, we need to compute the
# currency rate difference
if line.amount == line.amount_unreconciled:
if not line.move_line_id:
raise osv.except_osv(_('Wrong voucher line'),_("The invoice you are willing to pay is not valid anymore."))
sign = voucher.type in ('payment', 'purchase') and -1 or 1
currency_rate_difference = sign * (line.move_line_id.amount_residual - amount)
else:
currency_rate_difference = 0.0
move_line = {
'journal_id': voucher.journal_id.id,
'period_id': voucher.period_id.id,
'name': line.name or '/',
'account_id': line.account_id.id,
'move_id': move_id,
'partner_id': voucher.partner_id.id,
'currency_id': line.move_line_id and (company_currency <> line.move_line_id.currency_id.id and line.move_line_id.currency_id.id) or False,
'analytic_account_id': line.account_analytic_id and line.account_analytic_id.id or False,
'quantity': 1,
'credit': 0.0,
'debit': 0.0,
'date': voucher.date
}
if amount < 0:
amount = -amount
if line.type == 'dr':
line.type = 'cr'
else:
line.type = 'dr'
if (line.type=='dr'):
tot_line += amount
move_line['debit'] = amount
else:
tot_line -= amount
move_line['credit'] = amount
if voucher.tax_id and voucher.type in ('sale', 'purchase'):
move_line.update({
'account_tax_id': voucher.tax_id.id,
})
if move_line.get('account_tax_id', False):
tax_data = tax_obj.browse(cr, uid, [move_line['account_tax_id']], context=context)[0]
if not (tax_data.base_code_id and tax_data.tax_code_id):
raise osv.except_osv(_('No Account Base Code and Account Tax Code!'),_("You have to configure account base code and account tax code on the '%s' tax!") % (tax_data.name))
# compute the amount in foreign currency
foreign_currency_diff = 0.0
amount_currency = False
if line.move_line_id:
# We want to set it on the account move line as soon as the original line had a foreign currency
if line.move_line_id.currency_id and line.move_line_id.currency_id.id != company_currency:
# we compute the amount in that foreign currency.
if line.move_line_id.currency_id.id == current_currency:
# if the voucher and the voucher line share the same currency, there is no computation to do
sign = (move_line['debit'] - move_line['credit']) < 0 and -1 or 1
amount_currency = sign * (line.amount)
else:
# if the rate is specified on the voucher, it will be used thanks to the special keys in the context
# otherwise we use the rates of the system
amount_currency = currency_obj.compute(cr, uid, company_currency, line.move_line_id.currency_id.id, move_line['debit']-move_line['credit'], context=ctx)
if line.amount == line.amount_unreconciled:
sign = voucher.type in ('payment', 'purchase') and -1 or 1
foreign_currency_diff = sign * line.move_line_id.amount_residual_currency + amount_currency
move_line['amount_currency'] = amount_currency
voucher_line = move_line_obj.create(cr, uid, move_line)
rec_ids = [voucher_line, line.move_line_id.id]
if not currency_obj.is_zero(cr, uid, voucher.company_id.currency_id, currency_rate_difference):
# Change difference entry in company currency
exch_lines = self._get_exchange_lines(cr, uid, line, move_id, currency_rate_difference, company_currency, current_currency, context=context)
new_id = move_line_obj.create(cr, uid, exch_lines[0],context)
move_line_obj.create(cr, uid, exch_lines[1], context)
rec_ids.append(new_id)
if line.move_line_id and line.move_line_id.currency_id and not currency_obj.is_zero(cr, uid, line.move_line_id.currency_id, foreign_currency_diff):
# Change difference entry in voucher currency
move_line_foreign_currency = {
'journal_id': line.voucher_id.journal_id.id,
'period_id': line.voucher_id.period_id.id,
'name': _('change')+': '+(line.name or '/'),
'account_id': line.account_id.id,
'move_id': move_id,
'partner_id': line.voucher_id.partner_id.id,
'currency_id': line.move_line_id.currency_id.id,
'amount_currency': -1 * foreign_currency_diff,
'quantity': 1,
'credit': 0.0,
'debit': 0.0,
'date': line.voucher_id.date,
}
new_id = move_line_obj.create(cr, uid, move_line_foreign_currency, context=context)
rec_ids.append(new_id)
if line.move_line_id.id:
rec_lst_ids.append(rec_ids)
return (tot_line, rec_lst_ids)
def writeoff_move_line_get(self, cr, uid, voucher_id, line_total, move_id, name, company_currency, current_currency, context=None):
'''
Set a dict to be use to create the writeoff move line.
:param voucher_id: Id of voucher what we are creating account_move.
:param line_total: Amount remaining to be allocated on lines.
:param move_id: Id of account move where this line will be added.
:param name: Description of account move line.
:param company_currency: id of currency of the company to which the voucher belong
:param current_currency: id of currency of the voucher
:return: mapping between fieldname and value of account move line to create
:rtype: dict
'''
currency_obj = self.pool.get('res.currency')
move_line = {}
voucher = self.pool.get('account.voucher').browse(cr,uid,voucher_id,context)
current_currency_obj = voucher.currency_id or voucher.journal_id.company_id.currency_id
if not currency_obj.is_zero(cr, uid, current_currency_obj, line_total):
diff = line_total
account_id = False
write_off_name = ''
if voucher.payment_option == 'with_writeoff':
account_id = voucher.writeoff_acc_id.id
write_off_name = voucher.comment
elif voucher.type in ('sale', 'receipt'):
account_id = voucher.partner_id.property_account_receivable.id
else:
account_id = voucher.partner_id.property_account_payable.id
sign = voucher.type == 'payment' and -1 or 1
move_line = {
'name': write_off_name or name,
'account_id': account_id,
'move_id': move_id,
'partner_id': voucher.partner_id.id,
'date': voucher.date,
'credit': diff > 0 and diff or 0.0,
'debit': diff < 0 and -diff or 0.0,
'amount_currency': company_currency <> current_currency and (sign * -1 * voucher.writeoff_amount) or 0.0,
'currency_id': company_currency <> current_currency and current_currency or False,
'analytic_account_id': voucher.analytic_id and voucher.analytic_id.id or False,
}
return move_line
def _get_company_currency(self, cr, uid, voucher_id, context=None):
'''
Get the currency of the actual company.
:param voucher_id: Id of the voucher what i want to obtain company currency.
:return: currency id of the company of the voucher
:rtype: int
'''
return self.pool.get('account.voucher').browse(cr,uid,voucher_id,context).journal_id.company_id.currency_id.id
def _get_current_currency(self, cr, uid, voucher_id, context=None):
'''
Get the currency of the voucher.
:param voucher_id: Id of the voucher what i want to obtain current currency.
:return: currency id of the voucher
:rtype: int
'''
voucher = self.pool.get('account.voucher').browse(cr,uid,voucher_id,context)
return voucher.currency_id.id or self._get_company_currency(cr,uid,voucher.id,context)
def action_move_line_create(self, cr, uid, ids, context=None):
'''
Confirm the vouchers given in ids and create the journal entries for each of them
'''
if context is None:
context = {}
move_pool = self.pool.get('account.move')
move_line_pool = self.pool.get('account.move.line')
for voucher in self.browse(cr, uid, ids, context=context):
local_context = dict(context, force_company=voucher.journal_id.company_id.id)
if voucher.move_id:
continue
company_currency = self._get_company_currency(cr, uid, voucher.id, context)
current_currency = self._get_current_currency(cr, uid, voucher.id, context)
# we select the context to use accordingly if it's a multicurrency case or not
context = self._sel_context(cr, uid, voucher.id, context)
# But for the operations made by _convert_amount, we always need to give the date in the context
ctx = context.copy()
ctx.update({'date': voucher.date})
# Create the account move record.
move_id = move_pool.create(cr, uid, self.account_move_get(cr, uid, voucher.id, context=context), context=context)
# Get the name of the account_move just created
name = move_pool.browse(cr, uid, move_id, context=context).name
# Create the first line of the voucher
move_line_id = move_line_pool.create(cr, uid, self.first_move_line_get(cr,uid,voucher.id, move_id, company_currency, current_currency, local_context), local_context)
move_line_brw = move_line_pool.browse(cr, uid, move_line_id, context=context)
line_total = move_line_brw.debit - move_line_brw.credit
rec_list_ids = []
if voucher.type == 'sale':
line_total = line_total - self._convert_amount(cr, uid, voucher.tax_amount, voucher.id, context=ctx)
elif voucher.type == 'purchase':
line_total = line_total + self._convert_amount(cr, uid, voucher.tax_amount, voucher.id, context=ctx)
# Create one move line per voucher line where amount is not 0.0
line_total, rec_list_ids = self.voucher_move_line_create(cr, uid, voucher.id, line_total, move_id, company_currency, current_currency, context)
# Create the writeoff line if needed
ml_writeoff = self.writeoff_move_line_get(cr, uid, voucher.id, line_total, move_id, name, company_currency, current_currency, local_context)
if ml_writeoff:
move_line_pool.create(cr, uid, ml_writeoff, local_context)
# We post the voucher.
self.write(cr, uid, [voucher.id], {
'move_id': move_id,
'state': 'posted',
'number': name,
})
if voucher.journal_id.entry_posted:
move_pool.post(cr, uid, [move_id], context={})
# We automatically reconcile the account move lines.
reconcile = False
for rec_ids in rec_list_ids:
if len(rec_ids) >= 2:
reconcile = move_line_pool.reconcile_partial(cr, uid, rec_ids, writeoff_acc_id=voucher.writeoff_acc_id.id, writeoff_period_id=voucher.period_id.id, writeoff_journal_id=voucher.journal_id.id)
return True
def copy(self, cr, uid, id, default=None, context=None):
if default is None:
default = {}
default.update({
'state': 'draft',
'number': False,
'move_id': False,
'line_cr_ids': False,
'line_dr_ids': False,
'reference': False
})
if 'date' not in default:
default['date'] = time.strftime('%Y-%m-%d')
return super(account_voucher, self).copy(cr, uid, id, default, context)
class account_voucher_line(osv.osv):
_name = 'account.voucher.line'
_description = 'Voucher Lines'
_order = "move_line_id"
# If the payment is in the same currency than the invoice, we keep the same amount
# Otherwise, we compute from invoice currency to payment currency
def _compute_balance(self, cr, uid, ids, name, args, context=None):
currency_pool = self.pool.get('res.currency')
rs_data = {}
for line in self.browse(cr, uid, ids, context=context):
ctx = context.copy()
ctx.update({'date': line.voucher_id.date})
voucher_rate = self.pool.get('res.currency').read(cr, uid, line.voucher_id.currency_id.id, ['rate'], context=ctx)['rate']
ctx.update({
'voucher_special_currency': line.voucher_id.payment_rate_currency_id and line.voucher_id.payment_rate_currency_id.id or False,
'voucher_special_currency_rate': line.voucher_id.payment_rate * voucher_rate})
res = {}
company_currency = line.voucher_id.journal_id.company_id.currency_id.id
voucher_currency = line.voucher_id.currency_id and line.voucher_id.currency_id.id or company_currency
move_line = line.move_line_id or False
if not move_line:
res['amount_original'] = 0.0
res['amount_unreconciled'] = 0.0
elif move_line.currency_id and voucher_currency==move_line.currency_id.id:
res['amount_original'] = abs(move_line.amount_currency)
res['amount_unreconciled'] = abs(move_line.amount_residual_currency)
else:
#always use the amount booked in the company currency as the basis of the conversion into the voucher currency
res['amount_original'] = currency_pool.compute(cr, uid, company_currency, voucher_currency, move_line.credit or move_line.debit or 0.0, context=ctx)
res['amount_unreconciled'] = currency_pool.compute(cr, uid, company_currency, voucher_currency, abs(move_line.amount_residual), context=ctx)
rs_data[line.id] = res
return rs_data
def _currency_id(self, cr, uid, ids, name, args, context=None):
'''
This function returns the currency id of a voucher line. It's either the currency of the
associated move line (if any) or the currency of the voucher or the company currency.
'''
res = {}
for line in self.browse(cr, uid, ids, context=context):
move_line = line.move_line_id
if move_line:
res[line.id] = move_line.currency_id and move_line.currency_id.id or move_line.company_id.currency_id.id
else:
res[line.id] = line.voucher_id.currency_id and line.voucher_id.currency_id.id or line.voucher_id.company_id.currency_id.id
return res
_columns = {
'voucher_id':fields.many2one('account.voucher', 'Voucher', required=1, ondelete='cascade'),
'name':fields.char('Description', size=256),
'account_id':fields.many2one('account.account','Account', required=True),
'partner_id':fields.related('voucher_id', 'partner_id', type='many2one', relation='res.partner', string='Partner'),
'untax_amount':fields.float('Untax Amount'),
'amount':fields.float('Amount', digits_compute=dp.get_precision('Account')),
'reconcile': fields.boolean('Full Reconcile'),
'type':fields.selection([('dr','Debit'),('cr','Credit')], 'Dr/Cr'),
'account_analytic_id': fields.many2one('account.analytic.account', 'Analytic Account'),
'move_line_id': fields.many2one('account.move.line', 'Journal Item'),
'date_original': fields.related('move_line_id','date', type='date', relation='account.move.line', string='Date', readonly=1),
'date_due': fields.related('move_line_id','date_maturity', type='date', relation='account.move.line', string='Due Date', readonly=1),
'amount_original': fields.function(_compute_balance, multi='dc', type='float', string='Original Amount', store=True, digits_compute=dp.get_precision('Account')),
'amount_unreconciled': fields.function(_compute_balance, multi='dc', type='float', string='Open Balance', store=True, digits_compute=dp.get_precision('Account')),
'company_id': fields.related('voucher_id','company_id', relation='res.company', type='many2one', string='Company', store=True, readonly=True),
'currency_id': fields.function(_currency_id, string='Currency', type='many2one', relation='res.currency', readonly=True),
}
_defaults = {
'name': '',
}
def onchange_reconcile(self, cr, uid, ids, reconcile, amount, amount_unreconciled, context=None):
vals = {'amount': 0.0}
if reconcile:
vals = { 'amount': amount_unreconciled}
return {'value': vals}
def onchange_amount(self, cr, uid, ids, amount, amount_unreconciled, context=None):
vals = {}
if amount:
vals['reconcile'] = (amount == amount_unreconciled)
return {'value': vals}
def onchange_move_line_id(self, cr, user, ids, move_line_id, context=None):
"""
Returns a dict that contains new values and context
@param move_line_id: latest value from user input for field move_line_id
@param args: other arguments
@param context: context arguments, like lang, time zone
@return: Returns a dict which contains new values, and context
"""
res = {}
move_line_pool = self.pool.get('account.move.line')
if move_line_id:
move_line = move_line_pool.browse(cr, user, move_line_id, context=context)
if move_line.credit:
ttype = 'dr'
else:
ttype = 'cr'
res.update({
'account_id': move_line.account_id.id,
'type': ttype,
'currency_id': move_line.currency_id and move_line.currency_id.id or move_line.company_id.currency_id.id,
})
return {
'value':res,
}
def default_get(self, cr, user, fields_list, context=None):
"""
Returns default values for fields
@param fields_list: list of fields, for which default values are required to be read
@param context: context arguments, like lang, time zone
@return: Returns a dict that contains default values for fields
"""
if context is None:
context = {}
journal_id = context.get('journal_id', False)
partner_id = context.get('partner_id', False)
journal_pool = self.pool.get('account.journal')
partner_pool = self.pool.get('res.partner')
values = super(account_voucher_line, self).default_get(cr, user, fields_list, context=context)
if (not journal_id) or ('account_id' not in fields_list):
return values
journal = journal_pool.browse(cr, user, journal_id, context=context)
account_id = False
ttype = 'cr'
if journal.type in ('sale', 'sale_refund'):
account_id = journal.default_credit_account_id and journal.default_credit_account_id.id or False
ttype = 'cr'
elif journal.type in ('purchase', 'expense', 'purchase_refund'):
account_id = journal.default_debit_account_id and journal.default_debit_account_id.id or False
ttype = 'dr'
elif partner_id:
partner = partner_pool.browse(cr, user, partner_id, context=context)
if context.get('type') == 'payment':
ttype = 'dr'
account_id = partner.property_account_payable.id
elif context.get('type') == 'receipt':
account_id = partner.property_account_receivable.id
values.update({
'account_id':account_id,
'type':ttype
})
return values
def resolve_o2m_operations(cr, uid, target_osv, operations, fields, context):
results = []
for operation in operations:
result = None
if not isinstance(operation, (list, tuple)):
result = target_osv.read(cr, uid, operation, fields, context=context)
elif operation[0] == 0:
# may be necessary to check if all the fields are here and get the default values?
result = operation[2]
elif operation[0] == 1:
result = target_osv.read(cr, uid, operation[1], fields, context=context)
if not result: result = {}
result.update(operation[2])
elif operation[0] == 4:
result = target_osv.read(cr, uid, operation[1], fields, context=context)
if result != None:
results.append(result)
return results
# vim:expandtab:smartindent:tabstop=4:softtabstop=4:shiftwidth=4:
| agpl-3.0 |
rockyzhang/zhangyanhit-python-for-android-mips | python-modules/twisted/twisted/protocols/basic.py | 49 | 28640 | # -*- test-case-name: twisted.test.test_protocols -*-
# Copyright (c) 2001-2010 Twisted Matrix Laboratories.
# See LICENSE for details.
"""
Basic protocols, such as line-oriented, netstring, and int prefixed strings.
Maintainer: Itamar Shtull-Trauring
"""
# System imports
import re
import struct
import warnings
import cStringIO
import math
from zope.interface import implements
# Twisted imports
from twisted.internet import protocol, defer, interfaces, error
from twisted.python import log, deprecate, versions
LENGTH, DATA, COMMA = range(3)
NUMBER = re.compile('(\d*)(:?)')
deprecatedSince = versions.Version("Twisted", 10, 2, 0)
message = "NetstringReceiver parser state is private."
for attr in ["LENGTH", "DATA", "COMMA", "NUMBER"]:
deprecate.deprecatedModuleAttribute(
deprecatedSince, message, __name__, attr)
del deprecatedSince, message, attr
DEBUG = 0
class NetstringParseError(ValueError):
"""
The incoming data is not in valid Netstring format.
"""
class IncompleteNetstring(Exception):
"""
Not enough data to complete a netstring.
"""
class NetstringReceiver(protocol.Protocol):
"""
A protocol that sends and receives netstrings.
See U{http://cr.yp.to/proto/netstrings.txt} for the specification of
netstrings. Every netstring starts with digits that specify the length
of the data. This length specification is separated from the data by
a colon. The data is terminated with a comma.
Override L{stringReceived} to handle received netstrings. This
method is called with the netstring payload as a single argument
whenever a complete netstring is received.
Security features:
1. Messages are limited in size, useful if you don't want
someone sending you a 500MB netstring (change C{self.MAX_LENGTH}
to the maximum length you wish to accept).
2. The connection is lost if an illegal message is received.
@ivar MAX_LENGTH: Defines the maximum length of netstrings that can be
received.
@type MAX_LENGTH: C{int}
@ivar _LENGTH: A pattern describing all strings that contain a netstring
length specification. Examples for length specifications are '0:',
'12:', and '179:'. '007:' is no valid length specification, since
leading zeros are not allowed.
@type _LENGTH: C{re.Match}
@ivar _LENGTH_PREFIX: A pattern describing all strings that contain
the first part of a netstring length specification (without the
trailing comma). Examples are '0', '12', and '179'. '007' does not
start a netstring length specification, since leading zeros are
not allowed.
@type _LENGTH_PREFIX: C{re.Match}
@ivar _PARSING_LENGTH: Indicates that the C{NetstringReceiver} is in
the state of parsing the length portion of a netstring.
@type _PARSING_LENGTH: C{int}
@ivar _PARSING_PAYLOAD: Indicates that the C{NetstringReceiver} is in
the state of parsing the payload portion (data and trailing comma)
of a netstring.
@type _PARSING_PAYLOAD: C{int}
@ivar brokenPeer: Indicates if the connection is still functional
@type brokenPeer: C{int}
@ivar _state: Indicates if the protocol is consuming the length portion
(C{PARSING_LENGTH}) or the payload (C{PARSING_PAYLOAD}) of a netstring
@type _state: C{int}
@ivar _remainingData: Holds the chunk of data that has not yet been consumed
@type _remainingData: C{string}
@ivar _payload: Holds the payload portion of a netstring including the
trailing comma
@type _payload: C{cStringIO.StringIO}
@ivar _expectedPayloadSize: Holds the payload size plus one for the trailing
comma.
@type _expectedPayloadSize: C{int}
"""
MAX_LENGTH = 99999
_LENGTH = re.compile('(0|[1-9]\d*)(:)')
_LENGTH_PREFIX = re.compile('(0|[1-9]\d*)$')
# Some error information for NetstringParseError instances.
_MISSING_LENGTH = ("The received netstring does not start with a "
"length specification.")
_OVERFLOW = ("The length specification of the received netstring "
"cannot be represented in Python - it causes an "
"OverflowError!")
_TOO_LONG = ("The received netstring is longer than the maximum %s "
"specified by self.MAX_LENGTH")
_MISSING_COMMA = "The received netstring is not terminated by a comma."
_DATA_SUPPORT_DEPRECATED = ("Data passed to sendString() must be a string. "
"Non-string support is deprecated since "
"Twisted 10.0")
# The following constants are used for determining if the NetstringReceiver
# is parsing the length portion of a netstring, or the payload.
_PARSING_LENGTH, _PARSING_PAYLOAD = range(2)
def makeConnection(self, transport):
"""
Initializes the protocol.
"""
protocol.Protocol.makeConnection(self, transport)
self._remainingData = ""
self._currentPayloadSize = 0
self._payload = cStringIO.StringIO()
self._state = self._PARSING_LENGTH
self._expectedPayloadSize = 0
self.brokenPeer = 0
def sendString(self, string):
"""
Sends a netstring.
Wraps up C{string} by adding length information and a
trailing comma; writes the result to the transport.
@param string: The string to send. The necessary framing (length
prefix, etc) will be added.
@type string: C{str}
"""
if not isinstance(string, str):
warnings.warn(self._DATA_SUPPORT_DEPRECATED, DeprecationWarning, 2)
string = str(string)
self.transport.write('%d:%s,' % (len(string), string))
def dataReceived(self, data):
"""
Receives some characters of a netstring.
Whenever a complete netstring is received, this method extracts
its payload and calls L{stringReceived} to process it.
@param data: A chunk of data representing a (possibly partial)
netstring
@type data: C{str}
"""
self._remainingData += data
while self._remainingData:
try:
self._consumeData()
except IncompleteNetstring:
break
except NetstringParseError:
self._handleParseError()
break
def stringReceived(self, string):
"""
Override this for notification when each complete string is received.
@param string: The complete string which was received with all
framing (length prefix, etc) removed.
@type string: C{str}
@raise NotImplementedError: because the method has to be implemented
by the child class.
"""
raise NotImplementedError()
def _maxLengthSize(self):
"""
Calculate and return the string size of C{self.MAX_LENGTH}.
@return: The size of the string representation for C{self.MAX_LENGTH}
@rtype: C{float}
"""
return math.ceil(math.log10(self.MAX_LENGTH)) + 1
def _consumeData(self):
"""
Consumes the content of C{self._remainingData}.
@raise IncompleteNetstring: if C{self._remainingData} does not
contain enough data to complete the current netstring.
@raise NetstringParseError: if the received data do not
form a valid netstring.
"""
if self._state == self._PARSING_LENGTH:
self._consumeLength()
self._prepareForPayloadConsumption()
if self._state == self._PARSING_PAYLOAD:
self._consumePayload()
def _consumeLength(self):
"""
Consumes the length portion of C{self._remainingData}.
@raise IncompleteNetstring: if C{self._remainingData} contains
a partial length specification (digits without trailing
comma).
@raise NetstringParseError: if the received data do not form a valid
netstring.
"""
lengthMatch = self._LENGTH.match(self._remainingData)
if not lengthMatch:
self._checkPartialLengthSpecification()
raise IncompleteNetstring()
self._processLength(lengthMatch)
def _checkPartialLengthSpecification(self):
"""
Makes sure that the received data represents a valid number.
Checks if C{self._remainingData} represents a number smaller or
equal to C{self.MAX_LENGTH}.
@raise NetstringParseError: if C{self._remainingData} is no
number or is too big (checked by L{extractLength}).
"""
partialLengthMatch = self._LENGTH_PREFIX.match(self._remainingData)
if not partialLengthMatch:
raise NetstringParseError(self._MISSING_LENGTH)
lengthSpecification = (partialLengthMatch.group(1))
self._extractLength(lengthSpecification)
def _processLength(self, lengthMatch):
"""
Processes the length definition of a netstring.
Extracts and stores in C{self._expectedPayloadSize} the number
representing the netstring size. Removes the prefix
representing the length specification from
C{self._remainingData}.
@raise NetstringParseError: if the received netstring does not
start with a number or the number is bigger than
C{self.MAX_LENGTH}.
@param lengthMatch: A regular expression match object matching
a netstring length specification
@type lengthMatch: C{re.Match}
"""
endOfNumber = lengthMatch.end(1)
startOfData = lengthMatch.end(2)
lengthString = self._remainingData[:endOfNumber]
# Expect payload plus trailing comma:
self._expectedPayloadSize = self._extractLength(lengthString) + 1
self._remainingData = self._remainingData[startOfData:]
def _extractLength(self, lengthAsString):
"""
Attempts to extract the length information of a netstring.
@raise NetstringParseError: if the number is bigger than
C{self.MAX_LENGTH}.
@param lengthAsString: A chunk of data starting with a length
specification
@type lengthAsString: C{str}
@return: The length of the netstring
@rtype: C{int}
"""
self._checkStringSize(lengthAsString)
length = int(lengthAsString)
if length > self.MAX_LENGTH:
raise NetstringParseError(self._TOO_LONG % (self.MAX_LENGTH,))
return length
def _checkStringSize(self, lengthAsString):
"""
Checks the sanity of lengthAsString.
Checks if the size of the length specification exceeds the
size of the string representing self.MAX_LENGTH. If this is
not the case, the number represented by lengthAsString is
certainly bigger than self.MAX_LENGTH, and a
NetstringParseError can be raised.
This method should make sure that netstrings with extremely
long length specifications are refused before even attempting
to convert them to an integer (which might trigger a
MemoryError).
"""
if len(lengthAsString) > self._maxLengthSize():
raise NetstringParseError(self._TOO_LONG % (self.MAX_LENGTH,))
def _prepareForPayloadConsumption(self):
"""
Sets up variables necessary for consuming the payload of a netstring.
"""
self._state = self._PARSING_PAYLOAD
self._currentPayloadSize = 0
self._payload.seek(0)
self._payload.truncate()
def _consumePayload(self):
"""
Consumes the payload portion of C{self._remainingData}.
If the payload is complete, checks for the trailing comma and
processes the payload. If not, raises an L{IncompleteNetstring}
exception.
@raise IncompleteNetstring: if the payload received so far
contains fewer characters than expected.
@raise NetstringParseError: if the payload does not end with a
comma.
"""
self._extractPayload()
if self._currentPayloadSize < self._expectedPayloadSize:
raise IncompleteNetstring()
self._checkForTrailingComma()
self._state = self._PARSING_LENGTH
self._processPayload()
def _extractPayload(self):
"""
Extracts payload information from C{self._remainingData}.
Splits C{self._remainingData} at the end of the netstring. The
first part becomes C{self._payload}, the second part is stored
in C{self._remainingData}.
If the netstring is not yet complete, the whole content of
C{self._remainingData} is moved to C{self._payload}.
"""
if self._payloadComplete():
remainingPayloadSize = (self._expectedPayloadSize -
self._currentPayloadSize)
self._payload.write(self._remainingData[:remainingPayloadSize])
self._remainingData = self._remainingData[remainingPayloadSize:]
self._currentPayloadSize = self._expectedPayloadSize
else:
self._payload.write(self._remainingData)
self._currentPayloadSize += len(self._remainingData)
self._remainingData = ""
def _payloadComplete(self):
"""
Checks if enough data have been received to complete the netstring.
@return: C{True} iff the received data contain at least as many
characters as specified in the length section of the
netstring
@rtype: C{bool}
"""
return (len(self._remainingData) + self._currentPayloadSize >=
self._expectedPayloadSize)
def _processPayload(self):
"""
Processes the actual payload with L{stringReceived}.
Strips C{self._payload} of the trailing comma and calls
L{stringReceived} with the result.
"""
self.stringReceived(self._payload.getvalue()[:-1])
def _checkForTrailingComma(self):
"""
Checks if the netstring has a trailing comma at the expected position.
@raise NetstringParseError: if the last payload character is
anything but a comma.
"""
if self._payload.getvalue()[-1] != ",":
raise NetstringParseError(self._MISSING_COMMA)
def _handleParseError(self):
"""
Terminates the connection and sets the flag C{self.brokenPeer}.
"""
self.transport.loseConnection()
self.brokenPeer = 1
class LineOnlyReceiver(protocol.Protocol):
"""
A protocol that receives only lines.
This is purely a speed optimisation over LineReceiver, for the
cases that raw mode is known to be unnecessary.
@cvar delimiter: The line-ending delimiter to use. By default this is
'\\r\\n'.
@cvar MAX_LENGTH: The maximum length of a line to allow (If a
sent line is longer than this, the connection is dropped).
Default is 16384.
"""
_buffer = ''
delimiter = '\r\n'
MAX_LENGTH = 16384
def dataReceived(self, data):
"""
Translates bytes into lines, and calls lineReceived.
"""
lines = (self._buffer+data).split(self.delimiter)
self._buffer = lines.pop(-1)
for line in lines:
if self.transport.disconnecting:
# this is necessary because the transport may be told to lose
# the connection by a line within a larger packet, and it is
# important to disregard all the lines in that packet following
# the one that told it to close.
return
if len(line) > self.MAX_LENGTH:
return self.lineLengthExceeded(line)
else:
self.lineReceived(line)
if len(self._buffer) > self.MAX_LENGTH:
return self.lineLengthExceeded(self._buffer)
def lineReceived(self, line):
"""
Override this for when each line is received.
@param line: The line which was received with the delimiter removed.
@type line: C{str}
"""
raise NotImplementedError
def sendLine(self, line):
"""
Sends a line to the other end of the connection.
@param line: The line to send, not including the delimiter.
@type line: C{str}
"""
return self.transport.writeSequence((line, self.delimiter))
def lineLengthExceeded(self, line):
"""
Called when the maximum line length has been reached.
Override if it needs to be dealt with in some special way.
"""
return error.ConnectionLost('Line length exceeded')
class _PauseableMixin:
paused = False
def pauseProducing(self):
self.paused = True
self.transport.pauseProducing()
def resumeProducing(self):
self.paused = False
self.transport.resumeProducing()
self.dataReceived('')
def stopProducing(self):
self.paused = True
self.transport.stopProducing()
class LineReceiver(protocol.Protocol, _PauseableMixin):
"""
A protocol that receives lines and/or raw data, depending on mode.
In line mode, each line that's received becomes a callback to
L{lineReceived}. In raw data mode, each chunk of raw data becomes a
callback to L{rawDataReceived}. The L{setLineMode} and L{setRawMode}
methods switch between the two modes.
This is useful for line-oriented protocols such as IRC, HTTP, POP, etc.
@cvar delimiter: The line-ending delimiter to use. By default this is
'\\r\\n'.
@cvar MAX_LENGTH: The maximum length of a line to allow (If a
sent line is longer than this, the connection is dropped).
Default is 16384.
"""
line_mode = 1
__buffer = ''
delimiter = '\r\n'
MAX_LENGTH = 16384
def clearLineBuffer(self):
"""
Clear buffered data.
@return: All of the cleared buffered data.
@rtype: C{str}
"""
b = self.__buffer
self.__buffer = ""
return b
def dataReceived(self, data):
"""
Protocol.dataReceived.
Translates bytes into lines, and calls lineReceived (or
rawDataReceived, depending on mode.)
"""
self.__buffer = self.__buffer+data
while self.line_mode and not self.paused:
try:
line, self.__buffer = self.__buffer.split(self.delimiter, 1)
except ValueError:
if len(self.__buffer) > self.MAX_LENGTH:
line, self.__buffer = self.__buffer, ''
return self.lineLengthExceeded(line)
break
else:
linelength = len(line)
if linelength > self.MAX_LENGTH:
exceeded = line + self.__buffer
self.__buffer = ''
return self.lineLengthExceeded(exceeded)
why = self.lineReceived(line)
if why or self.transport and self.transport.disconnecting:
return why
else:
if not self.paused:
data=self.__buffer
self.__buffer=''
if data:
return self.rawDataReceived(data)
def setLineMode(self, extra=''):
"""
Sets the line-mode of this receiver.
If you are calling this from a rawDataReceived callback,
you can pass in extra unhandled data, and that data will
be parsed for lines. Further data received will be sent
to lineReceived rather than rawDataReceived.
Do not pass extra data if calling this function from
within a lineReceived callback.
"""
self.line_mode = 1
if extra:
return self.dataReceived(extra)
def setRawMode(self):
"""
Sets the raw mode of this receiver.
Further data received will be sent to rawDataReceived rather
than lineReceived.
"""
self.line_mode = 0
def rawDataReceived(self, data):
"""
Override this for when raw data is received.
"""
raise NotImplementedError
def lineReceived(self, line):
"""
Override this for when each line is received.
@param line: The line which was received with the delimiter removed.
@type line: C{str}
"""
raise NotImplementedError
def sendLine(self, line):
"""
Sends a line to the other end of the connection.
@param line: The line to send, not including the delimiter.
@type line: C{str}
"""
return self.transport.write(line + self.delimiter)
def lineLengthExceeded(self, line):
"""
Called when the maximum line length has been reached.
Override if it needs to be dealt with in some special way.
The argument 'line' contains the remainder of the buffer, starting
with (at least some part) of the line which is too long. This may
be more than one line, or may be only the initial portion of the
line.
"""
return self.transport.loseConnection()
class StringTooLongError(AssertionError):
"""
Raised when trying to send a string too long for a length prefixed
protocol.
"""
class IntNStringReceiver(protocol.Protocol, _PauseableMixin):
"""
Generic class for length prefixed protocols.
@ivar recvd: buffer holding received data when splitted.
@type recvd: C{str}
@ivar structFormat: format used for struct packing/unpacking. Define it in
subclass.
@type structFormat: C{str}
@ivar prefixLength: length of the prefix, in bytes. Define it in subclass,
using C{struct.calcsize(structFormat)}
@type prefixLength: C{int}
"""
MAX_LENGTH = 99999
recvd = ""
def stringReceived(self, string):
"""
Override this for notification when each complete string is received.
@param string: The complete string which was received with all
framing (length prefix, etc) removed.
@type string: C{str}
"""
raise NotImplementedError
def lengthLimitExceeded(self, length):
"""
Callback invoked when a length prefix greater than C{MAX_LENGTH} is
received. The default implementation disconnects the transport.
Override this.
@param length: The length prefix which was received.
@type length: C{int}
"""
self.transport.loseConnection()
def dataReceived(self, recd):
"""
Convert int prefixed strings into calls to stringReceived.
"""
self.recvd = self.recvd + recd
while len(self.recvd) >= self.prefixLength and not self.paused:
length ,= struct.unpack(
self.structFormat, self.recvd[:self.prefixLength])
if length > self.MAX_LENGTH:
self.lengthLimitExceeded(length)
return
if len(self.recvd) < length + self.prefixLength:
break
packet = self.recvd[self.prefixLength:length + self.prefixLength]
self.recvd = self.recvd[length + self.prefixLength:]
self.stringReceived(packet)
def sendString(self, string):
"""
Send a prefixed string to the other end of the connection.
@param string: The string to send. The necessary framing (length
prefix, etc) will be added.
@type string: C{str}
"""
if len(string) >= 2 ** (8 * self.prefixLength):
raise StringTooLongError(
"Try to send %s bytes whereas maximum is %s" % (
len(string), 2 ** (8 * self.prefixLength)))
self.transport.write(
struct.pack(self.structFormat, len(string)) + string)
class Int32StringReceiver(IntNStringReceiver):
"""
A receiver for int32-prefixed strings.
An int32 string is a string prefixed by 4 bytes, the 32-bit length of
the string encoded in network byte order.
This class publishes the same interface as NetstringReceiver.
"""
structFormat = "!I"
prefixLength = struct.calcsize(structFormat)
class Int16StringReceiver(IntNStringReceiver):
"""
A receiver for int16-prefixed strings.
An int16 string is a string prefixed by 2 bytes, the 16-bit length of
the string encoded in network byte order.
This class publishes the same interface as NetstringReceiver.
"""
structFormat = "!H"
prefixLength = struct.calcsize(structFormat)
class Int8StringReceiver(IntNStringReceiver):
"""
A receiver for int8-prefixed strings.
An int8 string is a string prefixed by 1 byte, the 8-bit length of
the string.
This class publishes the same interface as NetstringReceiver.
"""
structFormat = "!B"
prefixLength = struct.calcsize(structFormat)
class StatefulStringProtocol:
"""
A stateful string protocol.
This is a mixin for string protocols (Int32StringReceiver,
NetstringReceiver) which translates stringReceived into a callback
(prefixed with 'proto_') depending on state.
The state 'done' is special; if a proto_* method returns it, the
connection will be closed immediately.
"""
state = 'init'
def stringReceived(self, string):
"""
Choose a protocol phase function and call it.
Call back to the appropriate protocol phase; this begins with
the function proto_init and moves on to proto_* depending on
what each proto_* function returns. (For example, if
self.proto_init returns 'foo', then self.proto_foo will be the
next function called when a protocol message is received.
"""
try:
pto = 'proto_'+self.state
statehandler = getattr(self,pto)
except AttributeError:
log.msg('callback',self.state,'not found')
else:
self.state = statehandler(string)
if self.state == 'done':
self.transport.loseConnection()
class FileSender:
"""
A producer that sends the contents of a file to a consumer.
This is a helper for protocols that, at some point, will take a
file-like object, read its contents, and write them out to the network,
optionally performing some transformation on the bytes in between.
"""
implements(interfaces.IProducer)
CHUNK_SIZE = 2 ** 14
lastSent = ''
deferred = None
def beginFileTransfer(self, file, consumer, transform = None):
"""
Begin transferring a file
@type file: Any file-like object
@param file: The file object to read data from
@type consumer: Any implementor of IConsumer
@param consumer: The object to write data to
@param transform: A callable taking one string argument and returning
the same. All bytes read from the file are passed through this before
being written to the consumer.
@rtype: C{Deferred}
@return: A deferred whose callback will be invoked when the file has
been completely written to the consumer. The last byte written to the
consumer is passed to the callback.
"""
self.file = file
self.consumer = consumer
self.transform = transform
self.deferred = deferred = defer.Deferred()
self.consumer.registerProducer(self, False)
return deferred
def resumeProducing(self):
chunk = ''
if self.file:
chunk = self.file.read(self.CHUNK_SIZE)
if not chunk:
self.file = None
self.consumer.unregisterProducer()
if self.deferred:
self.deferred.callback(self.lastSent)
self.deferred = None
return
if self.transform:
chunk = self.transform(chunk)
self.consumer.write(chunk)
self.lastSent = chunk[-1]
def pauseProducing(self):
pass
def stopProducing(self):
if self.deferred:
self.deferred.errback(
Exception("Consumer asked us to stop producing"))
self.deferred = None
| apache-2.0 |
miyakz1192/neutron | neutron/db/migration/migrate_to_ml2.py | 10 | 20722 | # Copyright (c) 2014 Red Hat, Inc.
# All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License"); you may
# not use this file except in compliance with the License. You may obtain
# a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
# License for the specific language governing permissions and limitations
# under the License.
"""
This script will migrate the database of an openvswitch, linuxbridge or
Hyper-V plugin so that it can be used with the ml2 plugin.
Known Limitations:
- THIS SCRIPT IS DESTRUCTIVE! Make sure to backup your
Neutron database before running this script, in case anything goes
wrong.
- It will be necessary to upgrade the database to the target release
via neutron-db-manage before attempting to migrate to ml2.
Initially, only the icehouse release is supported.
- This script does not automate configuration migration.
Example usage:
python -m neutron.db.migration.migrate_to_ml2 openvswitch \
mysql://login:[email protected]/neutron
Note that migration of tunneling state will only be attempted if the
--tunnel-type parameter is provided.
To manually test migration from ovs to ml2 with devstack:
- stack with Q_PLUGIN=openvswitch
- boot an instance and validate connectivity
- stop the neutron service and all agents
- run the neutron-migrate-to-ml2 script
- update /etc/neutron/neutron.conf as follows:
core_plugin = neutron.plugins.ml2.plugin.Ml2Plugin
- Create /etc/neutron/plugins/ml2/ml2_conf.ini and ensure that:
- ml2.mechanism_drivers includes 'openvswitch'
- ovs.local_ip is set correctly
- database.connection is set correctly
- Start the neutron service with the ml2 config file created in
the previous step in place of the openvswitch config file
- Start all the agents
- verify that the booted instance still has connectivity
- boot a second instance and validate connectivity
"""
import argparse
from oslo_db.sqlalchemy import session
import sqlalchemy as sa
from neutron.extensions import portbindings
from neutron.openstack.common import uuidutils
from neutron.plugins.common import constants as p_const
# Migration targets
LINUXBRIDGE = 'linuxbridge'
OPENVSWITCH = 'openvswitch'
HYPERV = 'hyperv'
# Releases
ICEHOUSE = 'icehouse'
JUNO = 'juno'
SUPPORTED_SCHEMA_VERSIONS = [ICEHOUSE, JUNO]
def check_db_schema_version(engine, metadata):
"""Check that current version of the db schema is supported."""
version_table = sa.Table(
'alembic_version', metadata, autoload=True, autoload_with=engine)
versions = [v[0] for v in engine.execute(version_table.select())]
if not versions:
raise ValueError(_("Missing version in alembic_versions table"))
elif len(versions) > 1:
raise ValueError(_("Multiple versions in alembic_versions table: %s")
% versions)
current_version = versions[0]
if current_version not in SUPPORTED_SCHEMA_VERSIONS:
raise SystemError(_("Unsupported database schema %(current)s. "
"Please migrate your database to one of following "
"versions: %(supported)s")
% {'current': current_version,
'supported': ', '.join(SUPPORTED_SCHEMA_VERSIONS)}
)
# Duplicated from neutron.plugins.linuxbridge.common.constants to
# avoid having any dependency on the linuxbridge plugin being
# installed.
def interpret_vlan_id(vlan_id):
"""Return (network_type, segmentation_id) tuple for encoded vlan_id."""
FLAT_VLAN_ID = -1
LOCAL_VLAN_ID = -2
if vlan_id == LOCAL_VLAN_ID:
return (p_const.TYPE_LOCAL, None)
elif vlan_id == FLAT_VLAN_ID:
return (p_const.TYPE_FLAT, None)
else:
return (p_const.TYPE_VLAN, vlan_id)
class BaseMigrateToMl2(object):
def __init__(self, vif_type, driver_type, segment_table_name,
vlan_allocation_table_name, old_tables):
self.vif_type = vif_type
self.driver_type = driver_type
self.segment_table_name = segment_table_name
self.vlan_allocation_table_name = vlan_allocation_table_name
self.old_tables = old_tables
def __call__(self, connection_url, save_tables=False, tunnel_type=None,
vxlan_udp_port=None):
engine = session.create_engine(connection_url)
metadata = sa.MetaData()
check_db_schema_version(engine, metadata)
if hasattr(self, 'define_ml2_tables'):
self.define_ml2_tables(metadata)
# Autoload the ports table to ensure that foreign keys to it and
# the network table can be created for the new tables.
sa.Table('ports', metadata, autoload=True, autoload_with=engine)
metadata.create_all(engine)
self.migrate_network_segments(engine, metadata)
if tunnel_type:
self.migrate_tunnels(engine, tunnel_type, vxlan_udp_port)
self.migrate_vlan_allocations(engine)
self.migrate_port_bindings(engine, metadata)
if hasattr(self, 'drop_old_tables'):
self.drop_old_tables(engine, save_tables)
def migrate_segment_dict(self, binding):
binding['id'] = uuidutils.generate_uuid()
def migrate_network_segments(self, engine, metadata):
# Migrating network segments requires loading the data to python
# so that a uuid can be generated for each segment.
source_table = sa.Table(self.segment_table_name, metadata,
autoload=True, autoload_with=engine)
source_segments = engine.execute(source_table.select())
ml2_segments = [dict(x) for x in source_segments]
for segment in ml2_segments:
self.migrate_segment_dict(segment)
if ml2_segments:
ml2_network_segments = metadata.tables['ml2_network_segments']
engine.execute(ml2_network_segments.insert(), ml2_segments)
def migrate_tunnels(self, engine, tunnel_type, vxlan_udp_port=None):
"""Override this method to perform plugin-specific tunnel migration."""
pass
def migrate_vlan_allocations(self, engine):
engine.execute(("""
INSERT INTO ml2_vlan_allocations
SELECT physical_network, vlan_id, allocated
FROM %(source_table)s
WHERE allocated = TRUE
""") % {'source_table': self.vlan_allocation_table_name})
def get_port_segment_map(self, engine):
"""Retrieve a mapping of port id to segment id.
The monolithic plugins only support a single segment per
network, so the segment id can be uniquely identified by
the network associated with a given port.
"""
port_segments = engine.execute("""
SELECT ports_network.port_id, ml2_network_segments.id AS segment_id
FROM ml2_network_segments, (
SELECT portbindingports.port_id, ports.network_id
FROM portbindingports, ports
WHERE portbindingports.port_id = ports.id
) AS ports_network
WHERE ml2_network_segments.network_id = ports_network.network_id
""")
return dict(x for x in port_segments)
def migrate_port_bindings(self, engine, metadata):
port_segment_map = self.get_port_segment_map(engine)
port_binding_ports = sa.Table('portbindingports', metadata,
autoload=True, autoload_with=engine)
source_bindings = engine.execute(port_binding_ports.select())
ml2_bindings = [dict(x) for x in source_bindings]
for binding in ml2_bindings:
binding['vif_type'] = self.vif_type
binding['driver'] = self.driver_type
segment = port_segment_map.get(binding['port_id'])
if segment:
binding['segment'] = segment
if ml2_bindings:
ml2_port_bindings = metadata.tables['ml2_port_bindings']
engine.execute(ml2_port_bindings.insert(), ml2_bindings)
class BaseMigrateToMl2_IcehouseMixin(object):
"""A mixin to ensure ml2 database schema state for Icehouse.
This classes the missing tables for Icehouse schema revisions. In Juno,
the schema state has been healed, so we do not need to run these.
"""
def drop_old_tables(self, engine, save_tables=False):
if save_tables:
return
old_tables = self.old_tables + [self.vlan_allocation_table_name,
self.segment_table_name]
for table_name in old_tables:
engine.execute('DROP TABLE %s' % table_name)
def define_ml2_tables(self, metadata):
sa.Table(
'arista_provisioned_nets', metadata,
sa.Column('tenant_id', sa.String(length=255), nullable=True),
sa.Column('id', sa.String(length=36), nullable=False),
sa.Column('network_id', sa.String(length=36), nullable=True),
sa.Column('segmentation_id', sa.Integer(),
autoincrement=False, nullable=True),
sa.PrimaryKeyConstraint('id'),
)
sa.Table(
'arista_provisioned_vms', metadata,
sa.Column('tenant_id', sa.String(length=255), nullable=True),
sa.Column('id', sa.String(length=36), nullable=False),
sa.Column('vm_id', sa.String(length=255), nullable=True),
sa.Column('host_id', sa.String(length=255), nullable=True),
sa.Column('port_id', sa.String(length=36), nullable=True),
sa.Column('network_id', sa.String(length=36), nullable=True),
sa.PrimaryKeyConstraint('id'),
)
sa.Table(
'arista_provisioned_tenants', metadata,
sa.Column('tenant_id', sa.String(length=255), nullable=True),
sa.Column('id', sa.String(length=36), nullable=False),
sa.PrimaryKeyConstraint('id'),
)
sa.Table(
'cisco_ml2_nexusport_bindings', metadata,
sa.Column('binding_id', sa.Integer(), nullable=False),
sa.Column('port_id', sa.String(length=255), nullable=True),
sa.Column('vlan_id', sa.Integer(), autoincrement=False,
nullable=False),
sa.Column('switch_ip', sa.String(length=255), nullable=True),
sa.Column('instance_id', sa.String(length=255), nullable=True),
sa.PrimaryKeyConstraint('binding_id'),
)
sa.Table(
'cisco_ml2_credentials', metadata,
sa.Column('credential_id', sa.String(length=255), nullable=True),
sa.Column('tenant_id', sa.String(length=255), nullable=False),
sa.Column('credential_name', sa.String(length=255),
nullable=False),
sa.Column('user_name', sa.String(length=255), nullable=True),
sa.Column('password', sa.String(length=255), nullable=True),
sa.PrimaryKeyConstraint('tenant_id', 'credential_name'),
)
sa.Table(
'ml2_flat_allocations', metadata,
sa.Column('physical_network', sa.String(length=64),
nullable=False),
sa.PrimaryKeyConstraint('physical_network'),
)
sa.Table(
'ml2_gre_allocations', metadata,
sa.Column('gre_id', sa.Integer, nullable=False,
autoincrement=False),
sa.Column('allocated', sa.Boolean, nullable=False),
sa.PrimaryKeyConstraint('gre_id'),
)
sa.Table(
'ml2_gre_endpoints', metadata,
sa.Column('ip_address', sa.String(length=64)),
sa.PrimaryKeyConstraint('ip_address'),
)
sa.Table(
'ml2_network_segments', metadata,
sa.Column('id', sa.String(length=36), nullable=False),
sa.Column('network_id', sa.String(length=36), nullable=False),
sa.Column('network_type', sa.String(length=32), nullable=False),
sa.Column('physical_network', sa.String(length=64), nullable=True),
sa.Column('segmentation_id', sa.Integer(), nullable=True),
sa.ForeignKeyConstraint(['network_id'], ['networks.id'],
ondelete='CASCADE'),
sa.PrimaryKeyConstraint('id'),
)
sa.Table(
'ml2_port_bindings', metadata,
sa.Column('port_id', sa.String(length=36), nullable=False),
sa.Column('host', sa.String(length=255), nullable=False),
sa.Column('vif_type', sa.String(length=64), nullable=False),
sa.Column('driver', sa.String(length=64), nullable=True),
sa.Column('segment', sa.String(length=36), nullable=True),
sa.Column('vnic_type', sa.String(length=64), nullable=False,
server_default='normal'),
sa.Column('vif_details', sa.String(4095), nullable=False,
server_default=''),
sa.Column('profile', sa.String(4095), nullable=False,
server_default=''),
sa.ForeignKeyConstraint(['port_id'], ['ports.id'],
ondelete='CASCADE'),
sa.ForeignKeyConstraint(['segment'], ['ml2_network_segments.id'],
ondelete='SET NULL'),
sa.PrimaryKeyConstraint('port_id'),
)
sa.Table(
'ml2_vlan_allocations', metadata,
sa.Column('physical_network', sa.String(length=64),
nullable=False),
sa.Column('vlan_id', sa.Integer(), autoincrement=False,
nullable=False),
sa.Column('allocated', sa.Boolean(), autoincrement=False,
nullable=False),
sa.PrimaryKeyConstraint('physical_network', 'vlan_id'),
)
sa.Table(
'ml2_vxlan_allocations', metadata,
sa.Column('vxlan_vni', sa.Integer, nullable=False,
autoincrement=False),
sa.Column('allocated', sa.Boolean, nullable=False),
sa.PrimaryKeyConstraint('vxlan_vni'),
)
sa.Table(
'ml2_vxlan_endpoints', metadata,
sa.Column('ip_address', sa.String(length=64)),
sa.Column('udp_port', sa.Integer(), nullable=False,
autoincrement=False),
sa.PrimaryKeyConstraint('ip_address', 'udp_port'),
)
class MigrateLinuxBridgeToMl2_Juno(BaseMigrateToMl2):
def __init__(self):
super(MigrateLinuxBridgeToMl2_Juno, self).__init__(
vif_type=portbindings.VIF_TYPE_BRIDGE,
driver_type=LINUXBRIDGE,
segment_table_name='network_bindings',
vlan_allocation_table_name='network_states',
old_tables=['portbindingports'])
def migrate_segment_dict(self, binding):
super(MigrateLinuxBridgeToMl2_Juno, self).migrate_segment_dict(
binding)
vlan_id = binding.pop('vlan_id')
network_type, segmentation_id = interpret_vlan_id(vlan_id)
binding['network_type'] = network_type
binding['segmentation_id'] = segmentation_id
class MigrateHyperVPluginToMl2_Juno(BaseMigrateToMl2):
def __init__(self):
super(MigrateHyperVPluginToMl2_Juno, self).__init__(
vif_type=portbindings.VIF_TYPE_HYPERV,
driver_type=HYPERV,
segment_table_name='hyperv_network_bindings',
vlan_allocation_table_name='hyperv_vlan_allocations',
old_tables=['portbindingports'])
def migrate_segment_dict(self, binding):
super(MigrateHyperVPluginToMl2_Juno, self).migrate_segment_dict(
binding)
# the 'hyperv_network_bindings' table has the column
# 'segmentation_id' instead of 'vlan_id'.
vlan_id = binding.pop('segmentation_id')
network_type, segmentation_id = interpret_vlan_id(vlan_id)
binding['network_type'] = network_type
binding['segmentation_id'] = segmentation_id
class MigrateOpenvswitchToMl2_Juno(BaseMigrateToMl2):
def __init__(self):
super(MigrateOpenvswitchToMl2_Juno, self).__init__(
vif_type=portbindings.VIF_TYPE_OVS,
driver_type=OPENVSWITCH,
segment_table_name='ovs_network_bindings',
vlan_allocation_table_name='ovs_vlan_allocations',
old_tables=[
'ovs_tunnel_allocations',
'ovs_tunnel_endpoints',
'portbindingports',
])
def migrate_tunnels(self, engine, tunnel_type, vxlan_udp_port=None):
if tunnel_type == p_const.TYPE_GRE:
engine.execute("""
INSERT INTO ml2_gre_allocations
SELECT tunnel_id as gre_id, allocated
FROM ovs_tunnel_allocations
WHERE allocated = TRUE
""")
engine.execute("""
INSERT INTO ml2_gre_endpoints
SELECT ip_address
FROM ovs_tunnel_endpoints
""")
elif tunnel_type == p_const.TYPE_VXLAN:
if not vxlan_udp_port:
vxlan_udp_port = p_const.VXLAN_UDP_PORT
engine.execute("""
INSERT INTO ml2_vxlan_allocations
SELECT tunnel_id as vxlan_vni, allocated
FROM ovs_tunnel_allocations
WHERE allocated = TRUE
""")
engine.execute(sa.text("""
INSERT INTO ml2_vxlan_endpoints
SELECT ip_address, :udp_port as udp_port
FROM ovs_tunnel_endpoints
"""), udp_port=vxlan_udp_port)
else:
raise ValueError(_('Unknown tunnel type: %s') % tunnel_type)
class MigrateLinuxBridgeToMl2_Icehouse(MigrateLinuxBridgeToMl2_Juno,
BaseMigrateToMl2_IcehouseMixin):
pass
class MigrateOpenvswitchToMl2_Icehouse(MigrateOpenvswitchToMl2_Juno,
BaseMigrateToMl2_IcehouseMixin):
pass
class MigrateHyperVPluginToMl2_Icehouse(MigrateHyperVPluginToMl2_Juno,
BaseMigrateToMl2_IcehouseMixin):
pass
migrate_map = {
ICEHOUSE: {
OPENVSWITCH: MigrateOpenvswitchToMl2_Icehouse,
LINUXBRIDGE: MigrateLinuxBridgeToMl2_Icehouse,
HYPERV: MigrateHyperVPluginToMl2_Icehouse,
},
JUNO: {
OPENVSWITCH: MigrateOpenvswitchToMl2_Juno,
LINUXBRIDGE: MigrateLinuxBridgeToMl2_Juno,
HYPERV: MigrateHyperVPluginToMl2_Juno,
},
}
def main():
parser = argparse.ArgumentParser()
parser.add_argument('plugin', choices=[OPENVSWITCH, LINUXBRIDGE, HYPERV],
help=_('The plugin type whose database will be '
'migrated'))
parser.add_argument('connection',
help=_('The connection url for the target db'))
parser.add_argument('--tunnel-type', choices=[p_const.TYPE_GRE,
p_const.TYPE_VXLAN],
help=_('The %s tunnel type to migrate from') %
OPENVSWITCH)
parser.add_argument('--vxlan-udp-port', default=None, type=int,
help=_('The UDP port to use for VXLAN tunnels.'))
parser.add_argument('--release', default=JUNO, choices=[ICEHOUSE, JUNO])
parser.add_argument('--save-tables', default=False, action='store_true',
help=_("Retain the old plugin's tables"))
#TODO(marun) Provide a verbose option
args = parser.parse_args()
if args.plugin in [LINUXBRIDGE, HYPERV] and (args.tunnel_type or
args.vxlan_udp_port):
msg = _('Tunnel args (tunnel-type and vxlan-udp-port) are not valid '
'for the %s plugin')
parser.error(msg % args.plugin)
try:
migrate_func = migrate_map[args.release][args.plugin]()
except KeyError:
msg = _('Support for migrating %(plugin)s for release '
'%(release)s is not yet implemented')
parser.error(msg % {'plugin': args.plugin, 'release': args.release})
else:
migrate_func(args.connection, args.save_tables, args.tunnel_type,
args.vxlan_udp_port)
if __name__ == '__main__':
main()
| apache-2.0 |
HybridF5/nova | nova/scheduler/filters/compute_capabilities_filter.py | 10 | 4182 | # Copyright (c) 2011 OpenStack Foundation
# All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License"); you may
# not use this file except in compliance with the License. You may obtain
# a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
# License for the specific language governing permissions and limitations
# under the License.
from oslo_log import log as logging
from oslo_serialization import jsonutils
import six
from nova.scheduler import filters
from nova.scheduler.filters import extra_specs_ops
LOG = logging.getLogger(__name__)
class ComputeCapabilitiesFilter(filters.BaseHostFilter):
"""HostFilter hard-coded to work with InstanceType records."""
# Instance type and host capabilities do not change within a request
run_filter_once_per_request = True
def _get_capabilities(self, host_state, scope):
cap = host_state
for index in range(0, len(scope)):
try:
if isinstance(cap, six.string_types):
try:
cap = jsonutils.loads(cap)
except ValueError as e:
LOG.debug("%(host_state)s fails. The capabilities "
"'%(cap)s' couldn't be loaded from JSON: "
"%(error)s",
{'host_state': host_state, 'cap': cap,
'error': e})
return None
if not isinstance(cap, dict):
if getattr(cap, scope[index], None) is None:
# If can't find, check stats dict
cap = cap.stats.get(scope[index], None)
else:
cap = getattr(cap, scope[index], None)
else:
cap = cap.get(scope[index], None)
except AttributeError as e:
LOG.debug("%(host_state)s fails. The capabilities couldn't "
"be retrieved: %(error)s.",
{'host_state': host_state, 'error': e})
return None
if cap is None:
LOG.debug("%(host_state)s fails. There are no capabilities "
"to retrieve.",
{'host_state': host_state})
return None
return cap
def _satisfies_extra_specs(self, host_state, instance_type):
"""Check that the host_state provided by the compute service
satisfies the extra specs associated with the instance type.
"""
if 'extra_specs' not in instance_type:
return True
for key, req in six.iteritems(instance_type.extra_specs):
# Either not scope format, or in capabilities scope
scope = key.split(':')
if len(scope) > 1:
if scope[0] != "capabilities":
continue
else:
del scope[0]
cap = self._get_capabilities(host_state, scope)
if cap is None:
return False
if not extra_specs_ops.match(str(cap), req):
LOG.debug("%(host_state)s fails extra_spec requirements. "
"'%(req)s' does not match '%(cap)s'",
{'host_state': host_state, 'req': req,
'cap': cap})
return False
return True
def host_passes(self, host_state, spec_obj):
"""Return a list of hosts that can create instance_type."""
instance_type = spec_obj.flavor
if not self._satisfies_extra_specs(host_state,
instance_type):
LOG.debug("%(host_state)s fails instance_type extra_specs "
"requirements", {'host_state': host_state})
return False
return True
| apache-2.0 |
thelazier/p2pool-dash | dev/convert_networks.py | 2 | 1614 | import sys
f = open(sys.argv[1])
while True:
if f.readline().strip() == 'nets = dict(': break
def nesting(l):
res = 0
for c in l:
if c == '(': res += 1
if c == ')': res -= 1
return res
def write_header(f, name):
if sys.argv[3] == 'p2pool':
f2.write('from p2pool.dash import networks\n\n')
if name == 'bitcoin':
f2.write('''# CHAIN_LENGTH = number of shares back client keeps
# REAL_CHAIN_LENGTH = maximum number of shares back client uses to compute payout
# REAL_CHAIN_LENGTH must always be <= CHAIN_LENGTH
# REAL_CHAIN_LENGTH must be changed in sync with all other clients
# changes can be done by changing one, then the other
''')
elif sys.argv[3] == 'dash':
f2.write('''import os
import platform
from twisted.internet import defer
from .. import data, helper
from p2pool.util import pack
''')
else: assert False, 'invalid type argument'
while True:
l = f.readline()
if not l.strip(): continue
if l.strip() == ')': break
name = l.strip().split('=')[0]
lines = []
while True:
l = f.readline()
if not l.strip(): continue
if l.strip() == '),': break
while nesting(l) != 0:
l += f.readline()
lines.append(l.split('=', 1))
with open(sys.argv[2] + name + '.py', 'wb') as f2:
write_header(f2, name)
for a, b in lines:
if ', #' in b: b = b.replace(', #', ' #')
elif b.strip().endswith(','): b = b.strip()[:-1]
else: assert False, b
f2.write('%s = %s\n' % (a.strip(), b.strip()))
| gpl-3.0 |
skarlekar/chehara | websocket/_core.py | 23 | 16397 | """
websocket - WebSocket client library for Python
Copyright (C) 2010 Hiroki Ohtani(liris)
This library is free software; you can redistribute it and/or
modify it under the terms of the GNU Lesser General Public
License as published by the Free Software Foundation; either
version 2.1 of the License, or (at your option) any later version.
This library is distributed in the hope that it will be useful,
but WITHOUT ANY WARRANTY; without even the implied warranty of
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
Lesser General Public License for more details.
You should have received a copy of the GNU Lesser General Public
License along with this library; if not, write to the Free Software
Foundation, Inc., 51 Franklin Street, Fifth Floor,
Boston, MA 02110-1335 USA
"""
from __future__ import print_function
import socket
import struct
import threading
import six
# websocket modules
from ._abnf import *
from ._exceptions import *
from ._handshake import *
from ._http import *
from ._logging import *
from ._socket import *
from ._utils import *
__all__ = ['WebSocket', 'create_connection']
"""
websocket python client.
=========================
This version support only hybi-13.
Please see http://tools.ietf.org/html/rfc6455 for protocol.
"""
class WebSocket(object):
"""
Low level WebSocket interface.
This class is based on
The WebSocket protocol draft-hixie-thewebsocketprotocol-76
http://tools.ietf.org/html/draft-hixie-thewebsocketprotocol-76
We can connect to the websocket server and send/receive data.
The following example is an echo client.
>>> import websocket
>>> ws = websocket.WebSocket()
>>> ws.connect("ws://echo.websocket.org")
>>> ws.send("Hello, Server")
>>> ws.recv()
'Hello, Server'
>>> ws.close()
get_mask_key: a callable to produce new mask keys, see the set_mask_key
function's docstring for more details
sockopt: values for socket.setsockopt.
sockopt must be tuple and each element is argument of sock.setsockopt.
sslopt: dict object for ssl socket option.
fire_cont_frame: fire recv event for each cont frame. default is False
enable_multithread: if set to True, lock send method.
skip_utf8_validation: skip utf8 validation.
"""
def __init__(self, get_mask_key=None, sockopt=None, sslopt=None,
fire_cont_frame=False, enable_multithread=False,
skip_utf8_validation=False, **_):
"""
Initialize WebSocket object.
"""
self.sock_opt = sock_opt(sockopt, sslopt)
self.handshake_response = None
self.sock = None
self.connected = False
self.get_mask_key = get_mask_key
# These buffer over the build-up of a single frame.
self.frame_buffer = frame_buffer(self._recv, skip_utf8_validation)
self.cont_frame = continuous_frame(
fire_cont_frame, skip_utf8_validation)
if enable_multithread:
self.lock = threading.Lock()
else:
self.lock = NoLock()
def __iter__(self):
"""
Allow iteration over websocket, implying sequential `recv` executions.
"""
while True:
yield self.recv()
def __next__(self):
return self.recv()
def next(self):
return self.__next__()
def fileno(self):
return self.sock.fileno()
def set_mask_key(self, func):
"""
set function to create musk key. You can customize mask key generator.
Mainly, this is for testing purpose.
func: callable object. the func takes 1 argument as integer.
The argument means length of mask key.
This func must return string(byte array),
which length is argument specified.
"""
self.get_mask_key = func
def gettimeout(self):
"""
Get the websocket timeout(second).
"""
return self.sock_opt.timeout
def settimeout(self, timeout):
"""
Set the timeout to the websocket.
timeout: timeout time(second).
"""
self.sock_opt.timeout = timeout
if self.sock:
self.sock.settimeout(timeout)
timeout = property(gettimeout, settimeout)
def getsubprotocol(self):
"""
get subprotocol
"""
if self.handshake_response:
return self.handshake_response.subprotocol
else:
return None
subprotocol = property(getsubprotocol)
def getstatus(self):
"""
get handshake status
"""
if self.handshake_response:
return self.handshake_response.status
else:
return None
status = property(getstatus)
def getheaders(self):
"""
get handshake response header
"""
if self.handshake_response:
return self.handshake_response.headers
else:
return None
headers = property(getheaders)
def connect(self, url, **options):
"""
Connect to url. url is websocket url scheme.
ie. ws://host:port/resource
You can customize using 'options'.
If you set "header" list object, you can set your own custom header.
>>> ws = WebSocket()
>>> ws.connect("ws://echo.websocket.org/",
... header=["User-Agent: MyProgram",
... "x-custom: header"])
timeout: socket timeout time. This value is integer.
if you set None for this value,
it means "use default_timeout value"
options: "header" -> custom http header list or dict.
"cookie" -> cookie value.
"origin" -> custom origin url.
"host" -> custom host header string.
"http_proxy_host" - http proxy host name.
"http_proxy_port" - http proxy port. If not set, set to 80.
"http_no_proxy" - host names, which doesn't use proxy.
"http_proxy_auth" - http proxy auth information.
tuple of username and password.
default is None
"subprotocols" - array of available sub protocols.
default is None.
"socket" - pre-initialized stream socket.
"""
self.sock, addrs = connect(url, self.sock_opt, proxy_info(**options),
options.pop('socket', None))
try:
self.handshake_response = handshake(self.sock, *addrs, **options)
self.connected = True
except:
if self.sock:
self.sock.close()
self.sock = None
raise
def send(self, payload, opcode=ABNF.OPCODE_TEXT):
"""
Send the data as string.
payload: Payload must be utf-8 string or unicode,
if the opcode is OPCODE_TEXT.
Otherwise, it must be string(byte array)
opcode: operation code to send. Please see OPCODE_XXX.
"""
frame = ABNF.create_frame(payload, opcode)
return self.send_frame(frame)
def send_frame(self, frame):
"""
Send the data frame.
frame: frame data created by ABNF.create_frame
>>> ws = create_connection("ws://echo.websocket.org/")
>>> frame = ABNF.create_frame("Hello", ABNF.OPCODE_TEXT)
>>> ws.send_frame(frame)
>>> cont_frame = ABNF.create_frame("My name is ", ABNF.OPCODE_CONT, 0)
>>> ws.send_frame(frame)
>>> cont_frame = ABNF.create_frame("Foo Bar", ABNF.OPCODE_CONT, 1)
>>> ws.send_frame(frame)
"""
if self.get_mask_key:
frame.get_mask_key = self.get_mask_key
data = frame.format()
length = len(data)
trace("send: " + repr(data))
with self.lock:
while data:
l = self._send(data)
data = data[l:]
return length
def send_binary(self, payload):
return self.send(payload, ABNF.OPCODE_BINARY)
def ping(self, payload=""):
"""
send ping data.
payload: data payload to send server.
"""
if isinstance(payload, six.text_type):
payload = payload.encode("utf-8")
self.send(payload, ABNF.OPCODE_PING)
def pong(self, payload):
"""
send pong data.
payload: data payload to send server.
"""
if isinstance(payload, six.text_type):
payload = payload.encode("utf-8")
self.send(payload, ABNF.OPCODE_PONG)
def recv(self):
"""
Receive string data(byte array) from the server.
return value: string(byte array) value.
"""
opcode, data = self.recv_data()
if six.PY3 and opcode == ABNF.OPCODE_TEXT:
return data.decode("utf-8")
elif opcode == ABNF.OPCODE_TEXT or opcode == ABNF.OPCODE_BINARY:
return data
else:
return ''
def recv_data(self, control_frame=False):
"""
Receive data with operation code.
control_frame: a boolean flag indicating whether to return control frame
data, defaults to False
return value: tuple of operation code and string(byte array) value.
"""
opcode, frame = self.recv_data_frame(control_frame)
return opcode, frame.data
def recv_data_frame(self, control_frame=False):
"""
Receive data with operation code.
control_frame: a boolean flag indicating whether to return control frame
data, defaults to False
return value: tuple of operation code and string(byte array) value.
"""
while True:
frame = self.recv_frame()
if not frame:
# handle error:
# 'NoneType' object has no attribute 'opcode'
raise WebSocketProtocolException(
"Not a valid frame %s" % frame)
elif frame.opcode in (ABNF.OPCODE_TEXT, ABNF.OPCODE_BINARY, ABNF.OPCODE_CONT):
self.cont_frame.validate(frame)
self.cont_frame.add(frame)
if self.cont_frame.is_fire(frame):
return self.cont_frame.extract(frame)
elif frame.opcode == ABNF.OPCODE_CLOSE:
self.send_close()
return frame.opcode, frame
elif frame.opcode == ABNF.OPCODE_PING:
if len(frame.data) < 126:
self.pong(frame.data)
else:
raise WebSocketProtocolException(
"Ping message is too long")
if control_frame:
return frame.opcode, frame
elif frame.opcode == ABNF.OPCODE_PONG:
if control_frame:
return frame.opcode, frame
def recv_frame(self):
"""
receive data as frame from server.
return value: ABNF frame object.
"""
return self.frame_buffer.recv_frame()
def send_close(self, status=STATUS_NORMAL, reason=six.b("")):
"""
send close data to the server.
status: status code to send. see STATUS_XXX.
reason: the reason to close. This must be string or bytes.
"""
if status < 0 or status >= ABNF.LENGTH_16:
raise ValueError("code is invalid range")
self.connected = False
self.send(struct.pack('!H', status) + reason, ABNF.OPCODE_CLOSE)
def close(self, status=STATUS_NORMAL, reason=six.b(""), timeout=3):
"""
Close Websocket object
status: status code to send. see STATUS_XXX.
reason: the reason to close. This must be string.
timeout: timeout until receive a close frame.
If None, it will wait forever until receive a close frame.
"""
if self.connected:
if status < 0 or status >= ABNF.LENGTH_16:
raise ValueError("code is invalid range")
try:
self.connected = False
self.send(struct.pack('!H', status) +
reason, ABNF.OPCODE_CLOSE)
sock_timeout = self.sock.gettimeout()
self.sock.settimeout(timeout)
try:
frame = self.recv_frame()
if isEnabledForError():
recv_status = struct.unpack("!H", frame.data)[0]
if recv_status != STATUS_NORMAL:
error("close status: " + repr(recv_status))
except:
pass
self.sock.settimeout(sock_timeout)
self.sock.shutdown(socket.SHUT_RDWR)
except:
pass
self.shutdown()
def abort(self):
"""
Low-level asynchronous abort, wakes up other threads that are waiting in recv_*
"""
if self.connected:
self.sock.shutdown(socket.SHUT_RDWR)
def shutdown(self):
"""close socket, immediately."""
if self.sock:
self.sock.close()
self.sock = None
self.connected = False
def _send(self, data):
return send(self.sock, data)
def _recv(self, bufsize):
try:
return recv(self.sock, bufsize)
except WebSocketConnectionClosedException:
if self.sock:
self.sock.close()
self.sock = None
self.connected = False
raise
def create_connection(url, timeout=None, class_=WebSocket, **options):
"""
connect to url and return websocket object.
Connect to url and return the WebSocket object.
Passing optional timeout parameter will set the timeout on the socket.
If no timeout is supplied,
the global default timeout setting returned by getdefauttimeout() is used.
You can customize using 'options'.
If you set "header" list object, you can set your own custom header.
>>> conn = create_connection("ws://echo.websocket.org/",
... header=["User-Agent: MyProgram",
... "x-custom: header"])
timeout: socket timeout time. This value is integer.
if you set None for this value,
it means "use default_timeout value"
class_: class to instantiate when creating the connection. It has to implement
settimeout and connect. It's __init__ should be compatible with
WebSocket.__init__, i.e. accept all of it's kwargs.
options: "header" -> custom http header list or dict.
"cookie" -> cookie value.
"origin" -> custom origin url.
"host" -> custom host header string.
"http_proxy_host" - http proxy host name.
"http_proxy_port" - http proxy port. If not set, set to 80.
"http_no_proxy" - host names, which doesn't use proxy.
"http_proxy_auth" - http proxy auth information.
tuple of username and password.
default is None
"enable_multithread" -> enable lock for multithread.
"sockopt" -> socket options
"sslopt" -> ssl option
"subprotocols" - array of available sub protocols.
default is None.
"skip_utf8_validation" - skip utf8 validation.
"socket" - pre-initialized stream socket.
"""
sockopt = options.pop("sockopt", [])
sslopt = options.pop("sslopt", {})
fire_cont_frame = options.pop("fire_cont_frame", False)
enable_multithread = options.pop("enable_multithread", False)
skip_utf8_validation = options.pop("skip_utf8_validation", False)
websock = class_(sockopt=sockopt, sslopt=sslopt,
fire_cont_frame=fire_cont_frame,
enable_multithread=enable_multithread,
skip_utf8_validation=skip_utf8_validation, **options)
websock.settimeout(timeout if timeout is not None else getdefaulttimeout())
websock.connect(url, **options)
return websock
| mit |
jaw20/Crunchyroll-XML-Decoder | crunchy-xml-decoder/requests/packages/urllib3/filepost.py | 1009 | 2281 | import codecs
from uuid import uuid4
from io import BytesIO
from .packages import six
from .packages.six import b
from .fields import RequestField
writer = codecs.lookup('utf-8')[3]
def choose_boundary():
"""
Our embarassingly-simple replacement for mimetools.choose_boundary.
"""
return uuid4().hex
def iter_field_objects(fields):
"""
Iterate over fields.
Supports list of (k, v) tuples and dicts, and lists of
:class:`~urllib3.fields.RequestField`.
"""
if isinstance(fields, dict):
i = six.iteritems(fields)
else:
i = iter(fields)
for field in i:
if isinstance(field, RequestField):
yield field
else:
yield RequestField.from_tuples(*field)
def iter_fields(fields):
"""
.. deprecated:: 1.6
Iterate over fields.
The addition of :class:`~urllib3.fields.RequestField` makes this function
obsolete. Instead, use :func:`iter_field_objects`, which returns
:class:`~urllib3.fields.RequestField` objects.
Supports list of (k, v) tuples and dicts.
"""
if isinstance(fields, dict):
return ((k, v) for k, v in six.iteritems(fields))
return ((k, v) for k, v in fields)
def encode_multipart_formdata(fields, boundary=None):
"""
Encode a dictionary of ``fields`` using the multipart/form-data MIME format.
:param fields:
Dictionary of fields or list of (key, :class:`~urllib3.fields.RequestField`).
:param boundary:
If not specified, then a random boundary will be generated using
:func:`mimetools.choose_boundary`.
"""
body = BytesIO()
if boundary is None:
boundary = choose_boundary()
for field in iter_field_objects(fields):
body.write(b('--%s\r\n' % (boundary)))
writer(body).write(field.render_headers())
data = field.data
if isinstance(data, int):
data = str(data) # Backwards compatibility
if isinstance(data, six.text_type):
writer(body).write(data)
else:
body.write(data)
body.write(b'\r\n')
body.write(b('--%s--\r\n' % (boundary)))
content_type = str('multipart/form-data; boundary=%s' % boundary)
return body.getvalue(), content_type
| gpl-2.0 |
jdsika/TUM_HOly | openrave/sympy/physics/quantum/grover.py | 6 | 9227 | """Grover's algorithm and helper functions.
Todo:
* W gate construction (or perhaps -W gate based on Mermin's book)
* Generalize the algorithm for an unknown function that returns 1 on
multiple qubit states, not just one.
* Implement _represent_ZGate in OracleGate
"""
from sympy import sqrt, pi, floor
from sympy.physics.quantum.qapply import qapply
from sympy.physics.quantum.qexpr import QuantumError
from sympy.physics.quantum.hilbert import ComplexSpace
from sympy.physics.quantum.operator import UnitaryOperator
from sympy.physics.quantum.gate import Gate, HadamardGate
from sympy.physics.quantum.qubit import IntQubit
from sympy.core.compatibility import callable
__all__ = [
'OracleGate',
'WGate',
'superposition_basis',
'grover_iteration',
'apply_grover'
]
def superposition_basis(nqubits):
"""Creates an equal superposition of the computational basis.
Parameters
==========
nqubits : int
The number of qubits.
Return
======
state : Qubit
An equal superposition of the computational basis with nqubits.
Examples
========
Create an equal superposition of 2 qubits::
>>> from sympy.physics.quantum.grover import superposition_basis
>>> superposition_basis(2)
|0>/2 + |1>/2 + |2>/2 + |3>/2
"""
amp = 1/sqrt(2**nqubits)
return sum([amp*IntQubit(n, nqubits) for n in range(2**nqubits)])
class OracleGate(Gate):
"""A black box gate.
The gate marks the desired qubits of an unknown function by flipping
the sign of the qubits. The unknown function returns true when it
finds its desired qubits and false otherwise.
Parameters
==========
qubits : int
Number of qubits.
oracle : callable
A callable function that returns a boolean on a computational basis.
Examples
========
Apply an Oracle gate that flips the sign of |2> on different qubits::
>>> from sympy.physics.quantum.qubit import IntQubit
>>> from sympy.physics.quantum.qapply import qapply
>>> from sympy.physics.quantum.grover import OracleGate
>>> f = lambda qubits: qubits == IntQubit(2)
>>> v = OracleGate(2, f)
>>> qapply(v*IntQubit(2))
-|2>
>>> qapply(v*IntQubit(3))
|3>
"""
gate_name = u'V'
gate_name_latex = u'V'
#-------------------------------------------------------------------------
# Initialization/creation
#-------------------------------------------------------------------------
@classmethod
def _eval_args(cls, args):
if len(args) != 2:
raise QuantumError(
'Insufficient/excessive arguments to Oracle. Please ' +
'supply the number of qubits and an unknown function.'
)
sub_args = args[0],
sub_args = UnitaryOperator._eval_args(sub_args)
if not sub_args[0].is_Integer:
raise TypeError('Integer expected, got: %r' % sub_args[0])
if not callable(args[1]):
raise TypeError('Callable expected, got: %r' % args[1])
sub_args = UnitaryOperator._eval_args(tuple(range(args[0])))
return (sub_args, args[1])
@classmethod
def _eval_hilbert_space(cls, args):
"""This returns the smallest possible Hilbert space."""
return ComplexSpace(2)**(max(args[0])+1)
#-------------------------------------------------------------------------
# Properties
#-------------------------------------------------------------------------
@property
def search_function(self):
"""The unknown function that helps find the sought after qubits."""
return self.label[1]
@property
def targets(self):
"""A tuple of target qubits."""
return self.label[0]
#-------------------------------------------------------------------------
# Apply
#-------------------------------------------------------------------------
def _apply_operator_Qubit(self, qubits, **options):
"""Apply this operator to a Qubit subclass.
Parameters
==========
qubits : Qubit
The qubit subclass to apply this operator to.
Returns
=======
state : Expr
The resulting quantum state.
"""
if qubits.nqubits != self.nqubits:
raise QuantumError(
'OracleGate operates on %r qubits, got: %r'
(self.nqubits, qubits.nqubits)
)
# If function returns 1 on qubits
# return the negative of the qubits (flip the sign)
if self.search_function(qubits):
return -qubits
else:
return qubits
#-------------------------------------------------------------------------
# Represent
#-------------------------------------------------------------------------
def _represent_ZGate(self, basis, **options):
raise NotImplementedError(
"Represent for the Oracle has not been implemented yet"
)
class WGate(Gate):
"""General n qubit W Gate in Grover's algorithm.
The gate performs the operation 2|phi><phi| - 1 on some qubits.
|phi> = (tensor product of n Hadamards)*(|0> with n qubits)
Parameters
==========
nqubits : int
The number of qubits to operate on
"""
gate_name = u'W'
gate_name_latex = u'W'
@classmethod
def _eval_args(cls, args):
if len(args) != 1:
raise QuantumError(
'Insufficient/excessive arguments to W gate. Please ' +
'supply the number of qubits to operate on.'
)
args = UnitaryOperator._eval_args(args)
if not args[0].is_Integer:
raise TypeError('Integer expected, got: %r' % args[0])
return tuple(reversed(range(args[0])))
#-------------------------------------------------------------------------
# Apply
#-------------------------------------------------------------------------
def _apply_operator_Qubit(self, qubits, **options):
"""
qubits: a set of qubits (Qubit)
Returns: quantum object (quantum expression - QExpr)
"""
if qubits.nqubits != self.nqubits:
raise QuantumError(
'WGate operates on %r qubits, got: %r'
(self.nqubits, qubits.nqubits)
)
# See 'Quantum Computer Science' by David Mermin p.92 -> W|a> result
# Return (2/(sqrt(2^n)))|phi> - |a> where |a> is the current basis
# state and phi is the superposition of basis states (see function
# create_computational_basis above)
basis_states = superposition_basis(self.nqubits)
change_to_basis = (2/sqrt(2**self.nqubits))*basis_states
return change_to_basis - qubits
def grover_iteration(qstate, oracle):
"""Applies one application of the Oracle and W Gate, WV.
Parameters
==========
qstate : Qubit
A superposition of qubits.
oracle : OracleGate
The black box operator that flips the sign of the desired basis qubits.
Returns
=======
Qubit : The qubits after applying the Oracle and W gate.
Examples
========
Perform one iteration of grover's algorithm to see a phase change::
>>> from sympy.physics.quantum.qapply import qapply
>>> from sympy.physics.quantum.qubit import IntQubit
>>> from sympy.physics.quantum.grover import OracleGate
>>> from sympy.physics.quantum.grover import superposition_basis
>>> from sympy.physics.quantum.grover import grover_iteration
>>> numqubits = 2
>>> basis_states = superposition_basis(numqubits)
>>> f = lambda qubits: qubits == IntQubit(2)
>>> v = OracleGate(numqubits, f)
>>> qapply(grover_iteration(basis_states, v))
|2>
"""
wgate = WGate(oracle.nqubits)
return wgate*oracle*qstate
def apply_grover(oracle, nqubits, iterations=None):
"""Applies grover's algorithm.
Parameters
==========
oracle : callable
The unknown callable function that returns true when applied to the
desired qubits and false otherwise.
Returns
=======
state : Expr
The resulting state after Grover's algorithm has been iterated.
Examples
========
Apply grover's algorithm to an even superposition of 2 qubits::
>>> from sympy.physics.quantum.qapply import qapply
>>> from sympy.physics.quantum.qubit import IntQubit
>>> from sympy.physics.quantum.grover import apply_grover
>>> f = lambda qubits: qubits == IntQubit(2)
>>> qapply(apply_grover(f, 2))
|2>
"""
if nqubits <= 0:
raise QuantumError(
'Grover\'s algorithm needs nqubits > 0, received %r qubits'
% nqubits
)
if iterations is None:
iterations = floor(sqrt(2**nqubits)*(pi/4))
v = OracleGate(nqubits, oracle)
iterated = superposition_basis(nqubits)
for iter in range(iterations):
iterated = grover_iteration(iterated, v)
iterated = qapply(iterated)
return iterated
| mit |
chutsu/robotics | prototype/models/two_wheel.py | 1 | 3500 | from math import cos
from math import sin
import numpy as np
import sympy
from sympy import pprint
def two_wheel_2d_model(x, u, dt):
"""Two wheel 2D motion model
Parameters
----------
x : np.array
Two Wheel model state vector (x, y, theta)
u : np.array
Input
dt : float
Time difference
Returns
-------
np.array (x, y, theta)
"""
gdot = np.array([[u[0, 0] * cos(x[2, 0]) * dt],
[u[0, 0] * sin(x[2, 0]) * dt],
[u[1, 0] * dt]])
return x + gdot
def two_wheel_2d_linearized_model(x, u, dt):
"""Two wheel 2D linearized motion model
Parameters
----------
x : np.array
Two Wheel model state vector (x, y, theta)
u : np.array
Input
dt : float
Time difference
Returns
-------
np.array 3x3 matrix of linearized two wheel model
"""
G1 = 1.0
G2 = 0.0
G3 = -u[0, 0] * sin(x[2, 0]) * dt
G4 = 0.0
G5 = 1.0
G6 = u[0, 0] * cos(x[2, 0]) * dt
G7 = 0.0
G8 = 0.0
G9 = 1.0
return np.array([[G1, G2, G3],
[G4, G5, G6],
[G7, G8, G9]])
def two_wheel_3d_model(x, u, dt):
"""Two wheel 3D motion model
Parameters
----------
x : np.array
Two Wheel model state vector (x, y, theta)
u : np.array
Input
dt : float
Time difference
Returns
-------
np.array (x, y, z, theta)
"""
g1 = x[0] + u[0] * cos(x[3]) * dt
g2 = x[1] + u[0] * sin(x[3]) * dt
g3 = x[2] + u[1] * dt
g4 = x[3] + u[2] * dt
return np.array([g1, g2, g3, g4])
def two_wheel_2d_deriv():
""" Symbolic derivation of Jacobian of the 2D two wheel motion model """
x1, x2, x3, x4, x5 = sympy.symbols("x1,x2,x3,x4,x5")
dt = sympy.symbols("dt")
# x, y, theta, v, omega
f1 = x1 + x4 * sympy.cos(x3) * dt
f2 = x2 + x4 * sympy.sin(x3) * dt
f3 = x3 + x5 * dt
f4 = x4
f5 = x5
F = sympy.Matrix([f1, f2, f3, f4, f5])
pprint(F.jacobian([x1, x2, x3, x4, x5]))
def two_wheel_3d_deriv():
""" Symbolic derivation of Jacobian of the 3D two wheel motion model """
x1, x2, x3, x4, x5, x6, x7 = sympy.symbols("x1,x2,x3,x4,x5,x6,x7")
dt = sympy.symbols("dt")
# x1 - x
# x2 - y
# x3 - z
# x4 - theta
# x5 - v
# x6 - omega
# x7 - vz
# x, y, z, theta, v, omega, vz
f1 = x1 + x5 * sympy.cos(x4) * dt
f2 = x2 + x5 * sympy.sin(x4) * dt
f3 = x3 + x7 * dt
f4 = x4 + x6 * dt
f5 = x5
f6 = x6
f7 = x7
F = sympy.Matrix([f1, f2, f3, f4, f5, f6, f7])
pprint(F.jacobian([x1, x2, x3, x4, x5, x6, x7]))
def two_wheel_3d_deriv2():
""" Symbolic derivation of Jacobian of the 3D two wheel motion model """
functions = sympy.symbols("f1,f2,f3,f4,f5,f6,f7,f8,f9")
variables = sympy.symbols("x1,x2,x3,x4,x5,x6,x7,x8,x9")
f1, f2, f3, f4, f5, f6, f7, f8, f9 = functions
x1, x2, x3, x4, x5, x6, x7, x8, x9 = variables
dt = sympy.symbols("dt")
# x1 - x
# x2 - y
# x3 - z
# x4 - theta
# x5 - v
# x6 - vz
# x7 - omega
# x8 - a
# x9 - az
f1 = x1 + x5 * sympy.cos(x4) * dt
f2 = x2 + x5 * sympy.sin(x4) * dt
f3 = x3 + x6 * dt
f4 = x4 + x7 * dt
f5 = x5 + x8 * dt
f6 = x6 + x9 * dt
f7 = x7
f8 = x8
f9 = x9
F = sympy.Matrix([f1, f2, f3, f4, f5, f6, f7, f8, f9])
pprint(F.jacobian([x1, x2, x3, x4, x5, x6, x7, x8, x9]))
| gpl-3.0 |
TheTypoMaster/chromium-crosswalk | third_party/mojo/src/mojo/public/tools/bindings/pylib/mojom/generate/pack.py | 22 | 8235 | # Copyright 2013 The Chromium Authors. All rights reserved.
# Use of this source code is governed by a BSD-style license that can be
# found in the LICENSE file.
import module as mojom
# This module provides a mechanism for determining the packed order and offsets
# of a mojom.Struct.
#
# ps = pack.PackedStruct(struct)
# ps.packed_fields will access a list of PackedField objects, each of which
# will have an offset, a size and a bit (for mojom.BOOLs).
# Size of struct header in bytes: num_bytes [4B] + version [4B].
HEADER_SIZE = 8
class PackedField(object):
kind_to_size = {
mojom.BOOL: 1,
mojom.INT8: 1,
mojom.UINT8: 1,
mojom.INT16: 2,
mojom.UINT16: 2,
mojom.INT32: 4,
mojom.UINT32: 4,
mojom.FLOAT: 4,
mojom.HANDLE: 4,
mojom.MSGPIPE: 4,
mojom.SHAREDBUFFER: 4,
mojom.DCPIPE: 4,
mojom.DPPIPE: 4,
mojom.NULLABLE_HANDLE: 4,
mojom.NULLABLE_MSGPIPE: 4,
mojom.NULLABLE_SHAREDBUFFER: 4,
mojom.NULLABLE_DCPIPE: 4,
mojom.NULLABLE_DPPIPE: 4,
mojom.INT64: 8,
mojom.UINT64: 8,
mojom.DOUBLE: 8,
mojom.STRING: 8,
mojom.NULLABLE_STRING: 8
}
@classmethod
def GetSizeForKind(cls, kind):
if isinstance(kind, (mojom.Array, mojom.Map, mojom.Struct,
mojom.Interface)):
return 8
if isinstance(kind, mojom.Union):
return 16
if isinstance(kind, mojom.InterfaceRequest):
kind = mojom.MSGPIPE
if isinstance(kind, mojom.Enum):
# TODO(mpcomplete): what about big enums?
return cls.kind_to_size[mojom.INT32]
if not kind in cls.kind_to_size:
raise Exception("Invalid kind: %s" % kind.spec)
return cls.kind_to_size[kind]
@classmethod
def GetAlignmentForKind(cls, kind):
if isinstance(kind, mojom.Interface):
return 4
if isinstance(kind, mojom.Union):
return 8
return cls.GetSizeForKind(kind)
def __init__(self, field, index, ordinal):
"""
Args:
field: the original field.
index: the position of the original field in the struct.
ordinal: the ordinal of the field for serialization.
"""
self.field = field
self.index = index
self.ordinal = ordinal
self.size = self.GetSizeForKind(field.kind)
self.alignment = self.GetAlignmentForKind(field.kind)
self.offset = None
self.bit = None
self.min_version = None
def GetPad(offset, alignment):
"""Returns the pad necessary to reserve space so that |offset + pad| equals to
some multiple of |alignment|."""
return (alignment - (offset % alignment)) % alignment
def GetFieldOffset(field, last_field):
"""Returns a 2-tuple of the field offset and bit (for BOOLs)."""
if (field.field.kind == mojom.BOOL and
last_field.field.kind == mojom.BOOL and
last_field.bit < 7):
return (last_field.offset, last_field.bit + 1)
offset = last_field.offset + last_field.size
pad = GetPad(offset, field.alignment)
return (offset + pad, 0)
def GetPayloadSizeUpToField(field):
"""Returns the payload size (not including struct header) if |field| is the
last field.
"""
if not field:
return 0
offset = field.offset + field.size
pad = GetPad(offset, 8)
return offset + pad
class PackedStruct(object):
def __init__(self, struct):
self.struct = struct
# |packed_fields| contains all the fields, in increasing offset order.
self.packed_fields = []
# |packed_fields_in_ordinal_order| refers to the same fields as
# |packed_fields|, but in ordinal order.
self.packed_fields_in_ordinal_order = []
# No fields.
if (len(struct.fields) == 0):
return
# Start by sorting by ordinal.
src_fields = self.packed_fields_in_ordinal_order
ordinal = 0
for index, field in enumerate(struct.fields):
if field.ordinal is not None:
ordinal = field.ordinal
src_fields.append(PackedField(field, index, ordinal))
ordinal += 1
src_fields.sort(key=lambda field: field.ordinal)
# Set |min_version| for each field.
next_min_version = 0
for packed_field in src_fields:
if packed_field.field.min_version is None:
assert next_min_version == 0
else:
assert packed_field.field.min_version >= next_min_version
next_min_version = packed_field.field.min_version
packed_field.min_version = next_min_version
if (packed_field.min_version != 0 and
mojom.IsReferenceKind(packed_field.field.kind) and
not packed_field.field.kind.is_nullable):
raise Exception("Non-nullable fields are only allowed in version 0 of "
"a struct. %s.%s is defined with [MinVersion=%d]."
% (self.struct.name, packed_field.field.name,
packed_field.min_version))
src_field = src_fields[0]
src_field.offset = 0
src_field.bit = 0
dst_fields = self.packed_fields
dst_fields.append(src_field)
# Then find first slot that each field will fit.
for src_field in src_fields[1:]:
last_field = dst_fields[0]
for i in xrange(1, len(dst_fields)):
next_field = dst_fields[i]
offset, bit = GetFieldOffset(src_field, last_field)
if offset + src_field.size <= next_field.offset:
# Found hole.
src_field.offset = offset
src_field.bit = bit
dst_fields.insert(i, src_field)
break
last_field = next_field
if src_field.offset is None:
# Add to end
src_field.offset, src_field.bit = GetFieldOffset(src_field, last_field)
dst_fields.append(src_field)
class ByteInfo(object):
def __init__(self):
self.is_padding = False
self.packed_fields = []
def GetByteLayout(packed_struct):
total_payload_size = GetPayloadSizeUpToField(
packed_struct.packed_fields[-1] if packed_struct.packed_fields else None)
bytes = [ByteInfo() for i in xrange(total_payload_size)]
limit_of_previous_field = 0
for packed_field in packed_struct.packed_fields:
for i in xrange(limit_of_previous_field, packed_field.offset):
bytes[i].is_padding = True
bytes[packed_field.offset].packed_fields.append(packed_field)
limit_of_previous_field = packed_field.offset + packed_field.size
for i in xrange(limit_of_previous_field, len(bytes)):
bytes[i].is_padding = True
for byte in bytes:
# A given byte cannot both be padding and have a fields packed into it.
assert not (byte.is_padding and byte.packed_fields)
return bytes
class VersionInfo(object):
def __init__(self, version, num_fields, num_bytes):
self.version = version
self.num_fields = num_fields
self.num_bytes = num_bytes
def GetVersionInfo(packed_struct):
"""Get version information for a struct.
Args:
packed_struct: A PackedStruct instance.
Returns:
A non-empty list of VersionInfo instances, sorted by version in increasing
order.
Note: The version numbers may not be consecutive.
"""
versions = []
last_version = 0
last_num_fields = 0
last_payload_size = 0
for packed_field in packed_struct.packed_fields_in_ordinal_order:
if packed_field.min_version != last_version:
versions.append(
VersionInfo(last_version, last_num_fields,
last_payload_size + HEADER_SIZE))
last_version = packed_field.min_version
last_num_fields += 1
# The fields are iterated in ordinal order here. However, the size of a
# version is determined by the last field of that version in pack order,
# instead of ordinal order. Therefore, we need to calculate the max value.
last_payload_size = max(GetPayloadSizeUpToField(packed_field),
last_payload_size)
assert len(versions) == 0 or last_num_fields != versions[-1].num_fields
versions.append(VersionInfo(last_version, last_num_fields,
last_payload_size + HEADER_SIZE))
return versions
| bsd-3-clause |
citrix-openstack-build/nova | nova/openstack/common/timeutils.py | 24 | 5623 | # vim: tabstop=4 shiftwidth=4 softtabstop=4
# Copyright 2011 OpenStack Foundation.
# All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License"); you may
# not use this file except in compliance with the License. You may obtain
# a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
# License for the specific language governing permissions and limitations
# under the License.
"""
Time related utilities and helper functions.
"""
import calendar
import datetime
import iso8601
import six
# ISO 8601 extended time format with microseconds
_ISO8601_TIME_FORMAT_SUBSECOND = '%Y-%m-%dT%H:%M:%S.%f'
_ISO8601_TIME_FORMAT = '%Y-%m-%dT%H:%M:%S'
PERFECT_TIME_FORMAT = _ISO8601_TIME_FORMAT_SUBSECOND
def isotime(at=None, subsecond=False):
"""Stringify time in ISO 8601 format."""
if not at:
at = utcnow()
st = at.strftime(_ISO8601_TIME_FORMAT
if not subsecond
else _ISO8601_TIME_FORMAT_SUBSECOND)
tz = at.tzinfo.tzname(None) if at.tzinfo else 'UTC'
st += ('Z' if tz == 'UTC' else tz)
return st
def parse_isotime(timestr):
"""Parse time from ISO 8601 format."""
try:
return iso8601.parse_date(timestr)
except iso8601.ParseError as e:
raise ValueError(e.message)
except TypeError as e:
raise ValueError(e.message)
def strtime(at=None, fmt=PERFECT_TIME_FORMAT):
"""Returns formatted utcnow."""
if not at:
at = utcnow()
return at.strftime(fmt)
def parse_strtime(timestr, fmt=PERFECT_TIME_FORMAT):
"""Turn a formatted time back into a datetime."""
return datetime.datetime.strptime(timestr, fmt)
def normalize_time(timestamp):
"""Normalize time in arbitrary timezone to UTC naive object."""
offset = timestamp.utcoffset()
if offset is None:
return timestamp
return timestamp.replace(tzinfo=None) - offset
def is_older_than(before, seconds):
"""Return True if before is older than seconds."""
if isinstance(before, six.string_types):
before = parse_strtime(before).replace(tzinfo=None)
return utcnow() - before > datetime.timedelta(seconds=seconds)
def is_newer_than(after, seconds):
"""Return True if after is newer than seconds."""
if isinstance(after, six.string_types):
after = parse_strtime(after).replace(tzinfo=None)
return after - utcnow() > datetime.timedelta(seconds=seconds)
def utcnow_ts():
"""Timestamp version of our utcnow function."""
return calendar.timegm(utcnow().timetuple())
def utcnow():
"""Overridable version of utils.utcnow."""
if utcnow.override_time:
try:
return utcnow.override_time.pop(0)
except AttributeError:
return utcnow.override_time
return datetime.datetime.utcnow()
def iso8601_from_timestamp(timestamp):
"""Returns a iso8601 formated date from timestamp."""
return isotime(datetime.datetime.utcfromtimestamp(timestamp))
utcnow.override_time = None
def set_time_override(override_time=datetime.datetime.utcnow()):
"""Overrides utils.utcnow.
Make it return a constant time or a list thereof, one at a time.
"""
utcnow.override_time = override_time
def advance_time_delta(timedelta):
"""Advance overridden time using a datetime.timedelta."""
assert(not utcnow.override_time is None)
try:
for dt in utcnow.override_time:
dt += timedelta
except TypeError:
utcnow.override_time += timedelta
def advance_time_seconds(seconds):
"""Advance overridden time by seconds."""
advance_time_delta(datetime.timedelta(0, seconds))
def clear_time_override():
"""Remove the overridden time."""
utcnow.override_time = None
def marshall_now(now=None):
"""Make an rpc-safe datetime with microseconds.
Note: tzinfo is stripped, but not required for relative times.
"""
if not now:
now = utcnow()
return dict(day=now.day, month=now.month, year=now.year, hour=now.hour,
minute=now.minute, second=now.second,
microsecond=now.microsecond)
def unmarshall_time(tyme):
"""Unmarshall a datetime dict."""
return datetime.datetime(day=tyme['day'],
month=tyme['month'],
year=tyme['year'],
hour=tyme['hour'],
minute=tyme['minute'],
second=tyme['second'],
microsecond=tyme['microsecond'])
def delta_seconds(before, after):
"""Return the difference between two timing objects.
Compute the difference in seconds between two date, time, or
datetime objects (as a float, to microsecond resolution).
"""
delta = after - before
try:
return delta.total_seconds()
except AttributeError:
return ((delta.days * 24 * 3600) + delta.seconds +
float(delta.microseconds) / (10 ** 6))
def is_soon(dt, window):
"""Determines if time is going to happen in the next window seconds.
:params dt: the time
:params window: minimum seconds to remain to consider the time not soon
:return: True if expiration is within the given duration
"""
soon = (utcnow() + datetime.timedelta(seconds=window))
return normalize_time(dt) <= soon
| apache-2.0 |
sysbot/CouchPotatoServer | couchpotato/core/notifications/plex/main.py | 86 | 2356 | from couchpotato.core.event import addEvent, fireEvent
from couchpotato.core.logger import CPLog
from couchpotato.core.notifications.base import Notification
from .client import PlexClientHTTP, PlexClientJSON
from .server import PlexServer
log = CPLog(__name__)
class Plex(Notification):
http_time_between_calls = 0
def __init__(self):
super(Plex, self).__init__()
self.server = PlexServer(self)
self.client_protocols = {
'http': PlexClientHTTP(self),
'json': PlexClientJSON(self)
}
addEvent('renamer.after', self.addToLibrary)
def addToLibrary(self, message = None, group = None):
if self.isDisabled(): return
if not group: group = {}
return self.server.refresh()
def getClientNames(self):
return [
x.strip().lower()
for x in self.conf('clients').split(',')
]
def notifyClients(self, message, client_names):
success = True
for client_name in client_names:
client_success = False
client = self.server.clients.get(client_name)
if client and client['found']:
client_success = fireEvent('notify.plex.notifyClient', client, message, single = True)
if not client_success:
if self.server.staleClients() or not client:
log.info('Failed to send notification to client "%s". '
'Client list is stale, updating the client list and retrying.', client_name)
self.server.updateClients(self.getClientNames())
else:
log.warning('Failed to send notification to client %s, skipping this time', client_name)
success = False
return success
def notify(self, message = '', data = None, listener = None):
if not data: data = {}
return self.notifyClients(message, self.getClientNames())
def test(self, **kwargs):
test_type = self.testNotifyName()
log.info('Sending test to %s', test_type)
notify_success = self.notify(
message = self.test_message,
data = {},
listener = 'test'
)
refresh_success = self.addToLibrary()
return {'success': notify_success or refresh_success}
| gpl-3.0 |
aromanovich/kozmic-ci | kozmic/accounts/views.py | 3 | 1103 | from flask import current_app, request, render_template, redirect, url_for, flash
from flask.ext.login import current_user
from kozmic import db
from . import bp
from .forms import SettingsForm
@bp.route('/settings/', methods=('GET', 'POST'))
def settings():
form = SettingsForm(request.form, obj=current_user)
if form.validate_on_submit():
form.populate_obj(current_user)
db.session.add(current_user)
db.session.commit()
flash('Your settings have been saved.', category='success')
return redirect(url_for('.settings'))
return render_template('accounts/settings.html', form=form)
@bp.route('/memberships/sync/', methods=('POST',))
def sync_memberships():
ok_to_commit = current_user.sync_memberships_with_github()
if ok_to_commit:
db.session.commit()
else:
db.session.rollback()
flash('Something went wrong (probably there was a problem '
'communicating with the GitHub API). Please try again later.',
'warning')
return redirect(request.referrer or url_for('projects.index'))
| bsd-3-clause |
redhatrises/freeipa | ipalib/constants.py | 2 | 12530 | # Authors:
# Martin Nagy <[email protected]>
# Jason Gerard DeRose <[email protected]>
#
# Copyright (C) 2008 Red Hat
# see file 'COPYING' for use and warranty information
#
# This program is free software; you can redistribute it and/or modify
# it under the terms of the GNU General Public License as published by
# the Free Software Foundation, either version 3 of the License, or
# (at your option) any later version.
#
# This program is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
# GNU General Public License for more details.
#
# You should have received a copy of the GNU General Public License
# along with this program. If not, see <http://www.gnu.org/licenses/>.
"""
All constants centralised in one file.
"""
import os
import socket
from ipapython.dn import DN
from ipapython.version import VERSION, API_VERSION
try:
FQDN = socket.getfqdn()
except Exception:
try:
FQDN = socket.gethostname()
except Exception:
FQDN = None
# regular expression NameSpace member names must match:
NAME_REGEX = r'^[a-z][_a-z0-9]*[a-z0-9]$|^[a-z]$'
# Format for ValueError raised when name does not match above regex:
NAME_ERROR = "name must match '%s'; got '%s'"
# Standard format for TypeError message:
TYPE_ERROR = '%s: need a %r; got %r (a %r)'
# Stardard format for TypeError message when a callable is expected:
CALLABLE_ERROR = '%s: need a callable; got %r (which is a %r)'
# Standard format for Exception message when overriding an attribute:
OVERRIDE_ERROR = 'cannot override %s.%s value %r with %r'
# Standard format for AttributeError message when a read-only attribute is
# already locked:
SET_ERROR = 'locked: cannot set %s.%s to %r'
DEL_ERROR = 'locked: cannot delete %s.%s'
# Used for a tab (or indentation level) when formatting for CLI:
CLI_TAB = ' ' # Two spaces
# The section to read in the config files, i.e. [global]
CONFIG_SECTION = 'global'
# The default configuration for api.env
# This is a tuple instead of a dict so that it is immutable.
# To create a dict with this config, just "d = dict(DEFAULT_CONFIG)".
DEFAULT_CONFIG = (
('api_version', API_VERSION),
('version', VERSION),
# Domain, realm, basedn:
('domain', 'example.com'),
('realm', 'EXAMPLE.COM'),
('basedn', DN(('dc', 'example'), ('dc', 'com'))),
# LDAP containers:
('container_accounts', DN(('cn', 'accounts'))),
('container_user', DN(('cn', 'users'), ('cn', 'accounts'))),
('container_deleteuser', DN(('cn', 'deleted users'), ('cn', 'accounts'), ('cn', 'provisioning'))),
('container_stageuser', DN(('cn', 'staged users'), ('cn', 'accounts'), ('cn', 'provisioning'))),
('container_group', DN(('cn', 'groups'), ('cn', 'accounts'))),
('container_service', DN(('cn', 'services'), ('cn', 'accounts'))),
('container_host', DN(('cn', 'computers'), ('cn', 'accounts'))),
('container_hostgroup', DN(('cn', 'hostgroups'), ('cn', 'accounts'))),
('container_rolegroup', DN(('cn', 'roles'), ('cn', 'accounts'))),
('container_permission', DN(('cn', 'permissions'), ('cn', 'pbac'))),
('container_privilege', DN(('cn', 'privileges'), ('cn', 'pbac'))),
('container_automount', DN(('cn', 'automount'))),
('container_policies', DN(('cn', 'policies'))),
('container_configs', DN(('cn', 'configs'), ('cn', 'policies'))),
('container_roles', DN(('cn', 'roles'), ('cn', 'policies'))),
('container_applications', DN(('cn', 'applications'), ('cn', 'configs'), ('cn', 'policies'))),
('container_policygroups', DN(('cn', 'policygroups'), ('cn', 'configs'), ('cn', 'policies'))),
('container_policylinks', DN(('cn', 'policylinks'), ('cn', 'configs'), ('cn', 'policies'))),
('container_netgroup', DN(('cn', 'ng'), ('cn', 'alt'))),
('container_hbac', DN(('cn', 'hbac'))),
('container_hbacservice', DN(('cn', 'hbacservices'), ('cn', 'hbac'))),
('container_hbacservicegroup', DN(('cn', 'hbacservicegroups'), ('cn', 'hbac'))),
('container_dns', DN(('cn', 'dns'))),
('container_vault', DN(('cn', 'vaults'), ('cn', 'kra'))),
('container_virtual', DN(('cn', 'virtual operations'), ('cn', 'etc'))),
('container_sudorule', DN(('cn', 'sudorules'), ('cn', 'sudo'))),
('container_sudocmd', DN(('cn', 'sudocmds'), ('cn', 'sudo'))),
('container_sudocmdgroup', DN(('cn', 'sudocmdgroups'), ('cn', 'sudo'))),
('container_automember', DN(('cn', 'automember'), ('cn', 'etc'))),
('container_selinux', DN(('cn', 'usermap'), ('cn', 'selinux'))),
('container_s4u2proxy', DN(('cn', 's4u2proxy'), ('cn', 'etc'))),
('container_cifsdomains', DN(('cn', 'ad'), ('cn', 'etc'))),
('container_trusts', DN(('cn', 'trusts'))),
('container_adtrusts', DN(('cn', 'ad'), ('cn', 'trusts'))),
('container_ranges', DN(('cn', 'ranges'), ('cn', 'etc'))),
('container_dna', DN(('cn', 'dna'), ('cn', 'ipa'), ('cn', 'etc'))),
('container_dna_posix_ids', DN(('cn', 'posix-ids'), ('cn', 'dna'), ('cn', 'ipa'), ('cn', 'etc'))),
('container_realm_domains', DN(('cn', 'Realm Domains'), ('cn', 'ipa'), ('cn', 'etc'))),
('container_otp', DN(('cn', 'otp'))),
('container_radiusproxy', DN(('cn', 'radiusproxy'))),
('container_views', DN(('cn', 'views'), ('cn', 'accounts'))),
('container_masters', DN(('cn', 'masters'), ('cn', 'ipa'), ('cn', 'etc'))),
('container_certprofile', DN(('cn', 'certprofiles'), ('cn', 'ca'))),
('container_topology', DN(('cn', 'topology'), ('cn', 'ipa'), ('cn', 'etc'))),
('container_caacl', DN(('cn', 'caacls'), ('cn', 'ca'))),
('container_locations', DN(('cn', 'locations'), ('cn', 'etc'))),
('container_ca', DN(('cn', 'cas'), ('cn', 'ca'))),
('container_dnsservers', DN(('cn', 'servers'), ('cn', 'dns'))),
('container_custodia', DN(('cn', 'custodia'), ('cn', 'ipa'), ('cn', 'etc'))),
('container_sysaccounts', DN(('cn', 'sysaccounts'), ('cn', 'etc'))),
('container_certmap', DN(('cn', 'certmap'))),
('container_certmaprules', DN(('cn', 'certmaprules'), ('cn', 'certmap'))),
# Ports, hosts, and URIs:
('xmlrpc_uri', 'http://localhost:8888/ipa/xml'),
# jsonrpc_uri is set in Env._finalize_core()
('ldap_uri', 'ldap://localhost:389'),
('rpc_protocol', 'jsonrpc'),
# Define an inclusive range of SSL/TLS version support
('tls_version_min', 'tls1.0'),
('tls_version_max', 'tls1.2'),
# Time to wait for a service to start, in seconds
('startup_timeout', 300),
# Web Application mount points
('mount_ipa', '/ipa/'),
# WebUI stuff:
('webui_prod', True),
# Session stuff:
# Maximum time before a session expires forcing credentials to be reacquired.
('session_auth_duration', '20 minutes'),
# How a session expiration is computed, see SessionManager.set_session_expiration_time()
('session_duration_type', 'inactivity_timeout'),
# Debugging:
('verbose', 0),
('debug', False),
('startup_traceback', False),
('mode', 'production'),
('wait_for_dns', 0),
# CA plugin:
('ca_host', FQDN), # Set in Env._finalize_core()
('ca_port', 80),
('ca_agent_port', 443),
('ca_ee_port', 443),
# For the following ports, None means a default specific to the installed
# Dogtag version.
('ca_install_port', None),
('ca_agent_install_port', None),
('ca_ee_install_port', None),
# Topology plugin
('recommended_max_agmts', 4), # Recommended maximum number of replication
# agreements
# Special CLI:
('prompt_all', False),
('interactive', True),
('fallback', True),
('delegate', False),
# Enable certain optional plugins:
('enable_ra', False),
('ra_plugin', 'selfsign'),
('dogtag_version', 9),
# Used when verifying that the API hasn't changed. Not for production.
('validate_api', False),
# Skip client vs. server API version checking. Can lead to errors/strange
# behavior when newer clients talk to older servers. Use with caution.
('skip_version_check', False),
# Ignore TTL. Perform schema call and download schema if not in cache.
('force_schema_check', False),
# ********************************************************
# The remaining keys are never set from the values here!
# ********************************************************
#
# Env._bootstrap() or Env._finalize_core() will have filled in all the keys
# below by the time DEFAULT_CONFIG is merged in, so the values below are
# never actually used. They are listed both to provide a big picture and
# also so DEFAULT_CONFIG contains at least all the keys that should be
# present after Env._finalize_core() is called.
#
# Each environment variable below is sent to ``object``, which just happens
# to be an invalid value for an environment variable, so if for some reason
# any of these keys were set from the values here, an exception will be
# raised.
# Non-overridable vars set in Env._bootstrap():
('host', FQDN),
('ipalib', object), # The directory containing ipalib/__init__.py
('site_packages', object), # The directory contaning ipalib
('script', object), # sys.argv[0]
('bin', object), # The directory containing the script
('home', object), # $HOME
# Vars set in Env._bootstrap():
('in_tree', object), # Whether or not running in-tree (bool)
('dot_ipa', object), # ~/.ipa directory
('context', object), # Name of context, default is 'default'
('confdir', object), # Directory containing config files
('env_confdir', None), # conf dir specified by IPA_CONFDIR env variable
('conf', object), # File containing context specific config
('conf_default', object), # File containing context independent config
('plugins_on_demand', object), # Whether to finalize plugins on-demand (bool)
('nss_dir', object), # Path to nssdb, default {confdir}/nssdb
('tls_ca_cert', object), # Path to CA cert file
# Set in Env._finalize_core():
('in_server', object), # Whether or not running in-server (bool)
('logdir', object), # Directory containing log files
('log', object), # Path to context specific log file
('jsonrpc_uri', object), # derived from xmlrpc_uri in Env._finalize_core()
('server', object), # derived from jsonrpc_uri in Env._finalize_core()
)
LDAP_GENERALIZED_TIME_FORMAT = "%Y%m%d%H%M%SZ"
IPA_ANCHOR_PREFIX = ':IPA:'
SID_ANCHOR_PREFIX = ':SID:'
# domains levels
DOMAIN_LEVEL_0 = 0 # compat
DOMAIN_LEVEL_1 = 1 # replica promotion, topology plugin
MIN_DOMAIN_LEVEL = DOMAIN_LEVEL_0
MAX_DOMAIN_LEVEL = DOMAIN_LEVEL_1
# Constants used in generation of replication agreements and as topology
# defaults
# List of attributes that need to be excluded from replication initialization.
REPL_AGMT_TOTAL_EXCLUDES = ('entryusn',
'krblastsuccessfulauth',
'krblastfailedauth',
'krbloginfailedcount')
# List of attributes that need to be excluded from normal replication.
REPL_AGMT_EXCLUDES = ('memberof', 'idnssoaserial') + REPL_AGMT_TOTAL_EXCLUDES
# List of attributes that are not updated on empty replication
REPL_AGMT_STRIP_ATTRS = ('modifiersName',
'modifyTimestamp',
'internalModifiersName',
'internalModifyTimestamp')
DOMAIN_SUFFIX_NAME = 'domain'
CA_SUFFIX_NAME = 'ca'
PKI_GSSAPI_SERVICE_NAME = 'dogtag'
IPA_CA_CN = u'ipa'
IPA_CA_RECORD = "ipa-ca"
IPA_CA_NICKNAME = 'caSigningCert cert-pki-ca'
RENEWAL_CA_NAME = 'dogtag-ipa-ca-renew-agent'
# regexp definitions
PATTERN_GROUPUSER_NAME = '^[a-zA-Z0-9_.][a-zA-Z0-9_.-]*[a-zA-Z0-9_.$-]?$'
# Kerberos Anonymous principal name
ANON_USER = 'WELLKNOWN/ANONYMOUS'
# IPA API Framework user
IPAAPI_USER = 'ipaapi'
IPAAPI_GROUP = 'ipaapi'
# TLS related constants
TLS_VERSIONS = [
"ssl2",
"ssl3",
"tls1.0",
"tls1.1",
"tls1.2"
]
TLS_VERSION_MINIMAL = "tls1.0"
# high ciphers without RC4, MD5, TripleDES, pre-shared key
# and secure remote password
TLS_HIGH_CIPHERS = "HIGH:!aNULL:!eNULL:!MD5:!RC4:!3DES:!PSK:!SRP"
# Use cache path
USER_CACHE_PATH = (
os.environ.get('XDG_CACHE_HOME') or
os.path.join(
os.environ.get(
'HOME',
os.path.expanduser('~')
),
'.cache'
)
)
SOFTHSM_DNSSEC_TOKEN_LABEL = u'ipaDNSSEC'
| gpl-3.0 |
XiangyiKong/flask-snippets | appstructure/zc.buildout/__init__.py | 2 | 1215 | # -*- coding: utf-8 -*-
"""
appstructure.zc.buildout
~~~~~~~~~~~~~~~~~~~~~~~~
Deploy using zc.buildout and PythonPaste
http://flask.pocoo.org/snippets/27/
"""
"""
Deploy the application
First, you could save the buildout directory using your favorite DVCS, or create a tarball for future deployments.
Then bootstrap the buildout:
~/buildout_env $ python bootstrap.py --distribute
Adjust your settings in buildout.cfg, and build the application:
~/buildout_env $ bin/buildout
Run the tests:
~/buildout_env $ bin/test
Test rendered page. ... ok
------------------------------------------------------------
Ran 1 test in 0.055s
OK
~/buildout_env $
Now launch the server:
~/buildout_env $ bin/flask-ctl debug fg
bin/paster serve parts/etc/debug.ini --reload
Starting subprocess with file monitor
Starting server in PID 24862.
serving on http://127.0.0.1:5000
Visit http://127.0.0.1:5000 with your browser.
Visit http://127.0.0.1:5000/?broken to bring the Werkzeug Debugger. Quit the application with Ctrl+C.
Note: when you change the configuration in buildout.cfg, you need to rebuild the application using bin/buildout.
Further reading:
http://www.buildout.org
http://pythonpaste.org
"""
| bsd-3-clause |
gurneyalex/stock-logistics-workflow | product_serial/__openerp__.py | 17 | 2709 | # -*- encoding: utf-8 -*-
##############################################################################
#
# Copyright (C) 2008 Raphaël Valyi
# Copyright (C) 2013 Akretion (http://www.akretion.com/)
#
# This program is free software: you can redistribute it and/or modify
# it under the terms of the GNU Affero General Public License as
# published by the Free Software Foundation, either version 3 of the
# License, or (at your option) any later version.
#
# This program is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
# GNU Affero General Public License for more details.
#
# You should have received a copy of the GNU Affero General Public License
# along with this program. If not, see <http://www.gnu.org/licenses/>.
#
##############################################################################
{
"name": "Product Serial",
"summary": "Enhance Serial Number management",
"version": "1.0",
"author": "Akretion, NaN·tic,Odoo Community Association (OCA)",
"website": "http://www.akretion.com",
"depends": ["stock"],
"category": "Generic Modules/Inventory Control",
"license": "AGPL-3",
"description": """Enhance the management of Production Lots (Serial Numbers) in OpenERP.
Here are the additional features proposed by this module:
1. Add a new selection field 'Lot split type' on the product form
under the 'Inventory' tab to specify how the Production Lots should be
split on the Pickings (you should also enable 'Track Incoming/Outgoing
Lots', and the new 'Track internal lots' field).
2. If the option 'Active auto split' is active for the Company,
OpenERP will automagically split up picking list movements into one
movement per product instance or logistical unit packing quantity (in
that case, only the first logistical unit is taken into account at the
present time. Improvement to take them all to be done!).
3. Turn Incoming Pickings into an editable grid where you can
directly type the codes of a new production lot and/or tracking number
to create and associate to the move (it also checks it doesn't exist
yet).
4. If the option 'Group invoice lines' is active for the Company,
OpenERP will group the invoice lines to make it look like the
Sale/Purchase Order when generating an Invoice from a Picking.
""",
"demo": ["product_demo.xml"],
"data": [
"product_view.xml",
"company_view.xml",
"stock_view.xml",
"wizard/prodlot_wizard_view.xml",
],
"active": False,
'installable': False
}
| agpl-3.0 |
charbeljc/account-financial-tools | __unported__/account_cancel_invoice_check_payment_order/account_invoice.py | 44 | 2589 | # -*- coding: utf-8 -*-
##############################################################################
#
# Author Vincent Renaville. Copyright 2012 Camptocamp SA
#
# This program is free software: you can redistribute it and/or modify
# it under the terms of the GNU Affero General Public License as
# published by the Free Software Foundation, either version 3 of the
# License, or (at your option) any later version.
#
# This program is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
# GNU Affero General Public License for more details.
#
# You should have received a copy of the GNU Affero General Public License
# along with this program. If not, see <http://www.gnu.org/licenses/>.
#
##############################################################################
from openerp.tools.translate import _
from openerp.osv import osv, orm
class account_invoice(orm.Model):
_inherit = "account.invoice"
def action_cancel(self, cr, uid, ids, *args):
invoices = self.read(cr, uid, ids, ['move_id', 'payment_ids'])
for invoice in invoices:
if invoice['move_id']:
# This invoice have a move line, we search move_line
# concerned by this move
cr.execute("""SELECT po.reference as payment_name,
po.date_done as payment_date,
pl.name
FROM payment_line as pl
INNER JOIN payment_order AS po
ON pl.id = order_id
WHERE move_line_id IN (SELECT id
FROM account_move_line
WHERE move_id = %s)
LIMIT 1""",
(invoice['move_id'][0],))
payment_orders = cr.dictfetchone()
if payment_orders:
raise osv.except_osv(
_('Error !'),
_("Invoice already imported in the payment "
"order (%s) at %s on line %s" %
(payment_orders['payment_name'],
payment_orders['payment_date'],
payment_orders['name']))
)
return super(account_invoice, self).action_cancel(cr, uid, ids, *args)
| agpl-3.0 |
lingthio/Flask-User | flask_user/user_mixin.py | 1 | 4450 | """This module implements the UserMixin class for Flask-User.
This Mixin adds required methods to User data-model.
"""
from flask import current_app
from flask_login import UserMixin as FlaskLoginUserMixin
class UserMixin(FlaskLoginUserMixin):
""" This class adds required methods to the User data-model.
Example:
class User(db.Model, UserMixin):
...
"""
def get_id(self):
"""Converts a User ID and parts of a User password hash to a token."""
# This function is used by Flask-Login to store a User ID securely as a browser cookie.
# The last part of the password is included to invalidate tokens when password change.
# user_id and password_ends_with are encrypted, timestamped and signed.
# This function works in tandem with UserMixin.get_user_by_token()
user_manager = current_app.user_manager
user_id = self.id
password_ends_with = '' if user_manager.USER_ENABLE_AUTH0 else self.password[-8:]
user_token = user_manager.generate_token(
user_id, # User ID
password_ends_with, # Last 8 characters of user password
)
# print("UserMixin.get_id: ID:", self.id, "token:", user_token)
return user_token
@classmethod
def get_user_by_token(cls, token, expiration_in_seconds=None):
# This function works in tandem with UserMixin.get_id()
# Token signatures and timestamps are verified.
# user_id and password_ends_with are decrypted.
# Verifies a token and decrypts a User ID and parts of a User password hash
user_manager = current_app.user_manager
data_items = user_manager.verify_token(token, expiration_in_seconds)
# Verify password_ends_with
token_is_valid = False
if data_items:
# Load user by User ID
user_id = data_items[0]
password_ends_with = data_items[1]
user = user_manager.db_manager.get_user_by_id(user_id)
user_password = '' if user_manager.USER_ENABLE_AUTH0 else user.password[-8:]
# Make sure that last 8 characters of user password matches
token_is_valid = user and user_password==password_ends_with
return user if token_is_valid else None
def has_roles(self, *requirements):
""" Return True if the user has all of the specified roles. Return False otherwise.
has_roles() accepts a list of requirements:
has_role(requirement1, requirement2, requirement3).
Each requirement is either a role_name, or a tuple_of_role_names.
role_name example: 'manager'
tuple_of_role_names: ('funny', 'witty', 'hilarious')
A role_name-requirement is accepted when the user has this role.
A tuple_of_role_names-requirement is accepted when the user has ONE of these roles.
has_roles() returns true if ALL of the requirements have been accepted.
For example:
has_roles('a', ('b', 'c'), d)
Translates to:
User has role 'a' AND (role 'b' OR role 'c') AND role 'd'"""
# Translates a list of role objects to a list of role_names
user_manager = current_app.user_manager
role_names = user_manager.db_manager.get_user_roles(self)
# has_role() accepts a list of requirements
for requirement in requirements:
if isinstance(requirement, (list, tuple)):
# this is a tuple_of_role_names requirement
tuple_of_role_names = requirement
authorized = False
for role_name in tuple_of_role_names:
if role_name in role_names:
# tuple_of_role_names requirement was met: break out of loop
authorized = True
break
if not authorized:
return False # tuple_of_role_names requirement failed: return False
else:
# this is a role_name requirement
role_name = requirement
# the user must have this role
if not role_name in role_names:
return False # role_name requirement failed: return False
# All requirements have been met: return True
return True
| mit |
mathcamp/steward_web | steward_web/__init__.py | 1 | 1965 | """ Steward extension providing framework for web interface """
import re
import pyramid.renderers
from pyramid.request import Request
from pyramid.settings import asbool
def to_json(value):
""" A json filter for jinja2 """
return pyramid.renderers.render('json', value)
def do_index(request):
""" Render the index page """
return {}
def _add_steward_web_app(config, title, name):
""" Add a route to the list of steward web apps """
config.registry.steward_web_apps.append((title, name))
def _web_apps(request):
""" Get the list of steward web apps """
return tuple(request.registry.steward_web_apps)
def _route_names(request, pattern=r'.*'):
""" Get a list of route names that match the pattern """
pattern = re.compile('^' + pattern + '$')
introspector = request.registry.introspector
routes = introspector.get_category('routes')
names = []
for route in routes:
name = route['introspectable']['name']
if pattern.match(name):
names.append(name)
return names
def _route_map(request, pattern=r'.*'):
""" Get a dict of route names to route urls """
return {name: request.route_url(name) for name in
request.route_names(pattern)}
def includeme(config):
""" Configure the app """
settings = config.get_settings()
config.add_route('root', '/')
config.add_view('steward_web.do_index', route_name='root',
renderer='index.jinja2')
config.add_route('login', '/login')
config.add_route('logout', '/logout')
config.registry.steward_web_apps = []
config.add_directive('add_steward_web_app', _add_steward_web_app)
config.add_request_method(_web_apps, name='steward_web_apps', reify=True)
config.add_request_method(_route_names, name='route_names')
config.add_request_method(_route_map, name='route_map')
if asbool(settings.get('steward.web.basic_login', True)):
config.scan()
| mit |
eayunstack/fuel-web | nailgun/nailgun/extensions/cluster_upgrade/upgrade.py | 3 | 7844 | # -*- coding: utf-8 -*-
# Copyright 2015 Mirantis, Inc.
#
# Licensed under the Apache License, Version 2.0 (the "License"); you may
# not use this file except in compliance with the License. You may obtain
# a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
# License for the specific language governing permissions and limitations
# under the License.
import collections
import copy
from distutils import version
import six
from nailgun import consts
from nailgun.objects.serializers import network_configuration
from nailgun import utils
from .objects import adapters
def merge_attributes(a, b):
"""Merge values of editable attributes.
The values of the b attributes have precedence over the values
of the a attributes.
"""
attrs = copy.deepcopy(b)
for section, pairs in six.iteritems(attrs):
if section == "repo_setup" or section not in a:
continue
a_values = a[section]
for key, values in six.iteritems(pairs):
if key != "metadata" and key in a_values:
values["value"] = a_values[key]["value"]
return attrs
def merge_nets(a, b):
new_settings = copy.deepcopy(b)
source_networks = dict((n["name"], n) for n in a["networks"])
for net in new_settings["networks"]:
if net["name"] not in source_networks:
continue
source_net = source_networks[net["name"]]
for key, value in six.iteritems(net):
if (key not in ("cluster_id", "id", "meta", "group_id") and
key in source_net):
net[key] = source_net[key]
networking_params = new_settings["networking_parameters"]
source_params = a["networking_parameters"]
for key, value in six.iteritems(networking_params):
if key not in source_params:
continue
networking_params[key] = source_params[key]
return new_settings
class UpgradeHelper(object):
network_serializers = {
consts.CLUSTER_NET_PROVIDERS.neutron:
network_configuration.NeutronNetworkConfigurationSerializer,
consts.CLUSTER_NET_PROVIDERS.nova_network:
network_configuration.NovaNetworkConfigurationSerializer,
}
@classmethod
def clone_cluster(cls, orig_cluster, data):
from .objects import relations
new_cluster = cls.create_cluster_clone(orig_cluster, data)
cls.copy_attributes(orig_cluster, new_cluster)
cls.copy_network_config(orig_cluster, new_cluster)
relations.UpgradeRelationObject.create_relation(orig_cluster.id,
new_cluster.id)
return new_cluster
@classmethod
def create_cluster_clone(cls, orig_cluster, data):
create_data = orig_cluster.get_create_data()
create_data["name"] = data["name"]
create_data["release_id"] = data["release_id"]
new_cluster = adapters.NailgunClusterAdapter.create(create_data)
return new_cluster
@classmethod
def copy_attributes(cls, orig_cluster, new_cluster):
# TODO(akscram): Attributes should be copied including
# borderline cases when some parameters are
# renamed or moved into plugins. Also, we should
# to keep special steps in copying of parameters
# that know how to translate parameters from one
# version to another. A set of this kind of steps
# should define an upgrade path of a particular
# cluster.
new_cluster.generated_attrs = utils.dict_merge(
new_cluster.generated_attrs,
orig_cluster.generated_attrs)
new_cluster.editable_attrs = merge_attributes(
orig_cluster.editable_attrs,
new_cluster.editable_attrs)
@classmethod
def transform_vips_for_net_groups_70(cls, vips):
"""Rename or remove types of VIPs for 7.0 network groups.
This method renames types of VIPs from older releases (<7.0) to
be compatible with network groups of the 7.0 release according
to the rules:
management: haproxy -> management
public: haproxy -> public
public: vrouter -> vrouter_pub
Note, that in the result VIPs are present only those IPs that
correspond to the given rules.
"""
rename_vip_rules = {
"management": {
"haproxy": "management",
"vrouter": "vrouter",
},
"public": {
"haproxy": "public",
"vrouter": "vrouter_pub",
},
}
renamed_vips = collections.defaultdict(dict)
for ng_name, vips in six.iteritems(vips):
ng_vip_rules = rename_vip_rules[ng_name]
for vip_type, vip_addr in six.iteritems(vips):
if vip_type not in ng_vip_rules:
continue
new_vip_type = ng_vip_rules[vip_type]
renamed_vips[ng_name][new_vip_type] = vip_addr
return renamed_vips
@classmethod
def copy_network_config(cls, orig_cluster, new_cluster):
nets_serializer = cls.network_serializers[orig_cluster.net_provider]
nets = merge_nets(
nets_serializer.serialize_for_cluster(orig_cluster.cluster),
nets_serializer.serialize_for_cluster(new_cluster.cluster))
orig_net_manager = orig_cluster.get_network_manager()
new_net_manager = new_cluster.get_network_manager()
new_net_manager.update(nets)
vips = orig_net_manager.get_assigned_vips()
for ng_name in vips:
if ng_name not in (consts.NETWORKS.public,
consts.NETWORKS.management):
vips.pop(ng_name)
# NOTE(akscram): In the 7.0 release was introduced networking
# templates that use the vip_type column as
# unique names of VIPs.
if version.LooseVersion(orig_cluster.release.environment_version) < \
version.LooseVersion("7.0"):
vips = cls.transform_vips_for_net_groups_70(vips)
new_net_manager.assign_given_vips_for_net_groups(vips)
new_net_manager.assign_vips_for_net_groups()
@classmethod
def assign_node_to_cluster(cls, node, seed_cluster):
orig_cluster = adapters.NailgunClusterAdapter.get_by_uid(
node.cluster_id)
orig_manager = orig_cluster.get_network_manager()
seed_manager = seed_cluster.get_network_manager()
netgroups_id_mapping = cls.get_netgroups_id_mapping(
orig_cluster, seed_cluster)
node.update_cluster_assignment(seed_cluster)
seed_manager.set_node_netgroups_ids(node, netgroups_id_mapping)
orig_manager.set_nic_assignment_netgroups_ids(
node, netgroups_id_mapping)
orig_manager.set_bond_assignment_netgroups_ids(
node, netgroups_id_mapping)
node.add_pending_change(consts.CLUSTER_CHANGES.interfaces)
@classmethod
def get_netgroups_id_mapping(self, orig_cluster, seed_cluster):
orig_ng = orig_cluster.get_network_groups()
seed_ng = seed_cluster.get_network_groups()
seed_ng_dict = dict((ng.name, ng.id) for ng in seed_ng)
mapping = dict((ng.id, seed_ng_dict[ng.name]) for ng in orig_ng)
mapping[orig_cluster.get_admin_network_group().id] = \
seed_cluster.get_admin_network_group().id
return mapping
| apache-2.0 |
zace-yuan/viewfinder | backend/db/async_aws_sts.py | 13 | 4387 | #!/bin/env python
#
# Copyright 2012 bit.ly
#
# Licensed under the Apache License, Version 2.0 (the "License"); you may
# not use this file except in compliance with the License. You may obtain
# a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
# License for the specific language governing permissions and limitations
# under the License.
"""
Created by Dan Frank on 2012-01-25.
Copyright (c) 2012 bit.ly. All rights reserved.
"""
import functools
from tornado.httpclient import HTTPRequest
from tornado.httpclient import AsyncHTTPClient
import xml.sax
import boto
from boto.sts.connection import STSConnection
from boto.sts.credentials import Credentials
from boto.exception import BotoServerError
class InvalidClientTokenIdError(BotoServerError):
"""Error subclass to indicate that the client's token(s) is/are invalid.
"""
pass
class AsyncAwsSts(STSConnection):
"""Class that manages session tokens. Users of AsyncDynamoDB should not
need to worry about what goes on here.
Usage: Keep an instance of this class (though it should be cheap to
re instantiate) and periodically call get_session_token to get a new
Credentials object when, say, your session token expires.
"""
def __init__(self, aws_access_key_id=None, aws_secret_access_key=None,
is_secure=True, port=None, proxy=None, proxy_port=None,
proxy_user=None, proxy_pass=None, debug=0,
https_connection_factory=None, region=None, path='/',
converter=None):
STSConnection.__init__(self, aws_access_key_id,
aws_secret_access_key,
is_secure, port, proxy, proxy_port,
proxy_user, proxy_pass, debug,
https_connection_factory, region, path, converter)
def get_session_token(self, callback):
"""Gets a new Credentials object with a session token, using this
instance's aws keys. Callback should operate on the new Credentials obj,
or else a boto.exception.BotoServerError.
"""
return self.get_object('GetSessionToken', {}, Credentials, verb='POST', callback=callback)
def get_object(self, action, params, cls, path="/", parent=None, verb="GET", callback=None):
"""Get an instance of `cls` using `action`."""
if not parent:
parent = self
self.make_request(action, params, path, verb,
functools.partial(self._finish_get_object, callback=callback, parent=parent, cls=cls))
def _finish_get_object(self, response_body, callback, cls=None, parent=None, error=None):
"""Process the body returned by STS. If an error is present,
convert from a tornado error to a boto error.
"""
if error:
if error.code == 403:
error_class = InvalidClientTokenIdError
else:
error_class = BotoServerError
return callback(None, error=error_class(error.code, error.message, response_body))
obj = cls(parent)
h = boto.handler.XmlHandler(obj, parent)
xml.sax.parseString(response_body, h)
return callback(obj)
def make_request(self, action, params={}, path='/', verb='GET', callback=None):
"""Make an async request. This handles the logic of translating
from boto params to a tornado request obj, issuing the request,
and passing back the body.
The callback should operate on the body of the response, and take
an optional error argument that will be a tornado error.
"""
request = HTTPRequest('https://%s' % self.host, method=verb)
request.params = params
request.auth_path = '/' # need this for auth
request.host = self.host # need this for auth
if action:
request.params['Action'] = action
if self.APIVersion:
request.params['Version'] = self.APIVersion
self._auth_handler.add_auth(request) # add signature
http_client = AsyncHTTPClient()
http_client.fetch(request, functools.partial(self._finish_make_request, callback=callback))
def _finish_make_request(self, response, callback):
if response.error:
return callback(response.body, error=response.error)
return callback(response.body)
| apache-2.0 |
DmitryADP/diff_qc750 | external/webkit/Tools/CygwinDownloader/cygwin-downloader.py | 20 | 5471 | #!/usr/bin/env python
import os, random, sys, time, urllib
#
# Options
#
dry_run = len(sys.argv) > 1 and "--dry-run" in set(sys.argv[1:])
quiet = len(sys.argv) > 1 and "--quiet" in set(sys.argv[1:])
#
# Functions and constants
#
def download_progress_hook(block_count, block_size, total_blocks):
if quiet or random.random() > 0.5:
return
sys.stdout.write(".")
sys.stdout.flush()
def download_url_to_file(url, file, message):
if not quiet:
print message + " ",
if not dry_run:
dir = os.path.dirname(file)
if len(dir) and not os.path.exists(dir):
os.makedirs(dir)
urllib.urlretrieve(url, file, download_progress_hook)
if not quiet:
print
# This is mostly just the list of North America http mirrors from http://cygwin.com/mirrors.html,
# but a few have been removed that seemed unresponsive from Cupertino.
mirror_servers = ["http://cygwin.elite-systems.org/",
"http://mirror.mcs.anl.gov/cygwin/",
"http://cygwin.osuosl.org/",
"http://mirrors.kernel.org/sourceware/cygwin/",
"http://mirrors.xmission.com/cygwin/",
"http://sourceware.mirrors.tds.net/pub/sourceware.org/cygwin/"]
package_mirror_url = mirror_servers[random.choice(range(len(mirror_servers)))]
def download_package(package, message):
download_url_to_file(package_mirror_url + package["path"], package["path"], message)
required_packages = frozenset(["apache",
"bc",
"bison",
"curl",
"diffutils",
"e2fsprogs",
"emacs",
"flex",
"gcc",
"gperf",
"keychain",
"make",
"nano",
"openssh",
"patch",
"perl",
"perl-libwin32",
"python",
"rebase",
"rsync",
"ruby",
"subversion",
"unzip",
"vim",
"zip"])
#
# Main
#
print "Using Cygwin mirror server " + package_mirror_url + " to download setup.ini..."
urllib.urlretrieve(package_mirror_url + "setup.ini", "setup.ini.orig")
downloaded_packages_file_path = "setup.ini.orig"
downloaded_packages_file = file(downloaded_packages_file_path, "r")
if not dry_run:
modified_packages_file = file("setup.ini", "w")
packages = {}
current_package = ''
for line in downloaded_packages_file.readlines():
if line[0] == "@":
current_package = line[2:-1]
packages[current_package] = {"name": current_package, "needs_download": False, "requires": [], "path": ""}
elif line[:10] == "category: ":
if current_package in required_packages:
line = "category: Base\n"
if "Base" in set(line[10:-1].split()):
packages[current_package]["needs_download"] = True
elif line[:10] == "requires: ":
packages[current_package]["requires"] = line[10:].split()
packages[current_package]["requires"].sort()
elif line[:9] == "install: " and not len(packages[current_package]["path"]):
end_of_path = line.find(" ", 9)
if end_of_path != -1:
packages[current_package]["path"] = line[9:end_of_path]
if not dry_run:
modified_packages_file.write(line)
downloaded_packages_file.close()
os.remove(downloaded_packages_file_path)
if not dry_run:
modified_packages_file.close()
names_to_download = set()
package_names = packages.keys()
package_names.sort()
def add_package_and_dependencies(name):
if name in names_to_download:
return
if not name in packages:
return
packages[name]["needs_download"] = True
names_to_download.add(name)
for dep in packages[name]["requires"]:
add_package_and_dependencies(dep)
for name in package_names:
if packages[name]["needs_download"]:
add_package_and_dependencies(name)
downloaded_so_far = 0
for name in package_names:
if packages[name]["needs_download"]:
downloaded_so_far += 1
download_package(packages[name], "Downloading package %3d of %3d (%s)" % (downloaded_so_far, len(names_to_download), name))
download_url_to_file("http://cygwin.com/setup.exe", "setup.exe", "Downloading setup.exe")
seconds_to_sleep = 10
print """
Finished downloading Cygwin. In %d seconds,
I will run setup.exe. Select the "Install
from Local Directory" option and browse to
"%s"
when asked for the "Local Package Directory".
""" % (seconds_to_sleep, os.getcwd())
while seconds_to_sleep > 0:
print "%d..." % seconds_to_sleep,
sys.stdout.flush()
time.sleep(1)
seconds_to_sleep -= 1
print
if not dry_run:
os.execl("setup.exe")
| gpl-2.0 |
gavinelliott/patsi | node_modules/node-sass/node_modules/node-gyp/gyp/pylib/gyp/easy_xml.py | 1558 | 4945 | # Copyright (c) 2011 Google Inc. All rights reserved.
# Use of this source code is governed by a BSD-style license that can be
# found in the LICENSE file.
import re
import os
def XmlToString(content, encoding='utf-8', pretty=False):
""" Writes the XML content to disk, touching the file only if it has changed.
Visual Studio files have a lot of pre-defined structures. This function makes
it easy to represent these structures as Python data structures, instead of
having to create a lot of function calls.
Each XML element of the content is represented as a list composed of:
1. The name of the element, a string,
2. The attributes of the element, a dictionary (optional), and
3+. The content of the element, if any. Strings are simple text nodes and
lists are child elements.
Example 1:
<test/>
becomes
['test']
Example 2:
<myelement a='value1' b='value2'>
<childtype>This is</childtype>
<childtype>it!</childtype>
</myelement>
becomes
['myelement', {'a':'value1', 'b':'value2'},
['childtype', 'This is'],
['childtype', 'it!'],
]
Args:
content: The structured content to be converted.
encoding: The encoding to report on the first XML line.
pretty: True if we want pretty printing with indents and new lines.
Returns:
The XML content as a string.
"""
# We create a huge list of all the elements of the file.
xml_parts = ['<?xml version="1.0" encoding="%s"?>' % encoding]
if pretty:
xml_parts.append('\n')
_ConstructContentList(xml_parts, content, pretty)
# Convert it to a string
return ''.join(xml_parts)
def _ConstructContentList(xml_parts, specification, pretty, level=0):
""" Appends the XML parts corresponding to the specification.
Args:
xml_parts: A list of XML parts to be appended to.
specification: The specification of the element. See EasyXml docs.
pretty: True if we want pretty printing with indents and new lines.
level: Indentation level.
"""
# The first item in a specification is the name of the element.
if pretty:
indentation = ' ' * level
new_line = '\n'
else:
indentation = ''
new_line = ''
name = specification[0]
if not isinstance(name, str):
raise Exception('The first item of an EasyXml specification should be '
'a string. Specification was ' + str(specification))
xml_parts.append(indentation + '<' + name)
# Optionally in second position is a dictionary of the attributes.
rest = specification[1:]
if rest and isinstance(rest[0], dict):
for at, val in sorted(rest[0].iteritems()):
xml_parts.append(' %s="%s"' % (at, _XmlEscape(val, attr=True)))
rest = rest[1:]
if rest:
xml_parts.append('>')
all_strings = reduce(lambda x, y: x and isinstance(y, str), rest, True)
multi_line = not all_strings
if multi_line and new_line:
xml_parts.append(new_line)
for child_spec in rest:
# If it's a string, append a text node.
# Otherwise recurse over that child definition
if isinstance(child_spec, str):
xml_parts.append(_XmlEscape(child_spec))
else:
_ConstructContentList(xml_parts, child_spec, pretty, level + 1)
if multi_line and indentation:
xml_parts.append(indentation)
xml_parts.append('</%s>%s' % (name, new_line))
else:
xml_parts.append('/>%s' % new_line)
def WriteXmlIfChanged(content, path, encoding='utf-8', pretty=False,
win32=False):
""" Writes the XML content to disk, touching the file only if it has changed.
Args:
content: The structured content to be written.
path: Location of the file.
encoding: The encoding to report on the first line of the XML file.
pretty: True if we want pretty printing with indents and new lines.
"""
xml_string = XmlToString(content, encoding, pretty)
if win32 and os.linesep != '\r\n':
xml_string = xml_string.replace('\n', '\r\n')
try:
xml_string = xml_string.encode(encoding)
except Exception:
xml_string = unicode(xml_string, 'latin-1').encode(encoding)
# Get the old content
try:
f = open(path, 'r')
existing = f.read()
f.close()
except:
existing = None
# It has changed, write it
if existing != xml_string:
f = open(path, 'w')
f.write(xml_string)
f.close()
_xml_escape_map = {
'"': '"',
"'": ''',
'<': '<',
'>': '>',
'&': '&',
'\n': '
',
'\r': '
',
}
_xml_escape_re = re.compile(
"(%s)" % "|".join(map(re.escape, _xml_escape_map.keys())))
def _XmlEscape(value, attr=False):
""" Escape a string for inclusion in XML."""
def replace(match):
m = match.string[match.start() : match.end()]
# don't replace single quotes in attrs
if attr and m == "'":
return m
return _xml_escape_map[m]
return _xml_escape_re.sub(replace, value)
| mit |
PolicyStat/django | tests/get_or_create/tests.py | 19 | 13380 | from __future__ import unicode_literals
from datetime import date
import traceback
import warnings
from django.db import IntegrityError, DatabaseError
from django.utils.encoding import DjangoUnicodeDecodeError
from django.test import TestCase, TransactionTestCase
from .models import (DefaultPerson, Person, ManualPrimaryKeyTest, Profile,
Tag, Thing, Publisher, Author, Book)
class GetOrCreateTests(TestCase):
def setUp(self):
self.lennon = Person.objects.create(
first_name='John', last_name='Lennon', birthday=date(1940, 10, 9)
)
def test_get_or_create_method_with_get(self):
created = Person.objects.get_or_create(
first_name="John", last_name="Lennon", defaults={
"birthday": date(1940, 10, 9)
}
)[1]
self.assertFalse(created)
self.assertEqual(Person.objects.count(), 1)
def test_get_or_create_method_with_create(self):
created = Person.objects.get_or_create(
first_name='George', last_name='Harrison', defaults={
'birthday': date(1943, 2, 25)
}
)[1]
self.assertTrue(created)
self.assertEqual(Person.objects.count(), 2)
def test_get_or_create_redundant_instance(self):
"""
If we execute the exact same statement twice, the second time,
it won't create a Person.
"""
Person.objects.get_or_create(
first_name='George', last_name='Harrison', defaults={
'birthday': date(1943, 2, 25)
}
)
created = Person.objects.get_or_create(
first_name='George', last_name='Harrison', defaults={
'birthday': date(1943, 2, 25)
}
)[1]
self.assertFalse(created)
self.assertEqual(Person.objects.count(), 2)
def test_get_or_create_invalid_params(self):
"""
If you don't specify a value or default value for all required
fields, you will get an error.
"""
self.assertRaises(
IntegrityError,
Person.objects.get_or_create, first_name="Tom", last_name="Smith"
)
def test_get_or_create_on_related_manager(self):
p = Publisher.objects.create(name="Acme Publishing")
# Create a book through the publisher.
book, created = p.books.get_or_create(name="The Book of Ed & Fred")
self.assertTrue(created)
# The publisher should have one book.
self.assertEqual(p.books.count(), 1)
# Try get_or_create again, this time nothing should be created.
book, created = p.books.get_or_create(name="The Book of Ed & Fred")
self.assertFalse(created)
# And the publisher should still have one book.
self.assertEqual(p.books.count(), 1)
# Add an author to the book.
ed, created = book.authors.get_or_create(name="Ed")
self.assertTrue(created)
# The book should have one author.
self.assertEqual(book.authors.count(), 1)
# Try get_or_create again, this time nothing should be created.
ed, created = book.authors.get_or_create(name="Ed")
self.assertFalse(created)
# And the book should still have one author.
self.assertEqual(book.authors.count(), 1)
# Add a second author to the book.
fred, created = book.authors.get_or_create(name="Fred")
self.assertTrue(created)
# The book should have two authors now.
self.assertEqual(book.authors.count(), 2)
# Create an Author not tied to any books.
Author.objects.create(name="Ted")
# There should be three Authors in total. The book object should have two.
self.assertEqual(Author.objects.count(), 3)
self.assertEqual(book.authors.count(), 2)
# Try creating a book through an author.
_, created = ed.books.get_or_create(name="Ed's Recipes", publisher=p)
self.assertTrue(created)
# Now Ed has two Books, Fred just one.
self.assertEqual(ed.books.count(), 2)
self.assertEqual(fred.books.count(), 1)
# Use the publisher's primary key value instead of a model instance.
_, created = ed.books.get_or_create(name='The Great Book of Ed', publisher_id=p.id)
self.assertTrue(created)
# Try get_or_create again, this time nothing should be created.
_, created = ed.books.get_or_create(name='The Great Book of Ed', publisher_id=p.id)
self.assertFalse(created)
# The publisher should have three books.
self.assertEqual(p.books.count(), 3)
class GetOrCreateTestsWithManualPKs(TestCase):
def setUp(self):
self.first_pk = ManualPrimaryKeyTest.objects.create(id=1, data="Original")
def test_create_with_duplicate_primary_key(self):
"""
If you specify an existing primary key, but different other fields,
then you will get an error and data will not be updated.
"""
self.assertRaises(
IntegrityError,
ManualPrimaryKeyTest.objects.get_or_create, id=1, data="Different"
)
self.assertEqual(ManualPrimaryKeyTest.objects.get(id=1).data, "Original")
def test_get_or_create_raises_IntegrityError_plus_traceback(self):
"""
get_or_create should raise IntegrityErrors with the full traceback.
This is tested by checking that a known method call is in the traceback.
We cannot use assertRaises here because we need to inspect
the actual traceback. Refs #16340.
"""
try:
ManualPrimaryKeyTest.objects.get_or_create(id=1, data="Different")
except IntegrityError:
formatted_traceback = traceback.format_exc()
self.assertIn(str('obj.save'), formatted_traceback)
def test_savepoint_rollback(self):
"""
Regression test for #20463: the database connection should still be
usable after a DataError or ProgrammingError in .get_or_create().
"""
try:
# Hide warnings when broken data is saved with a warning (MySQL).
with warnings.catch_warnings():
warnings.simplefilter('ignore')
Person.objects.get_or_create(
birthday=date(1970, 1, 1),
defaults={'first_name': b"\xff", 'last_name': b"\xff"})
except (DatabaseError, DjangoUnicodeDecodeError):
Person.objects.create(
first_name="Bob", last_name="Ross", birthday=date(1950, 1, 1))
else:
self.skipTest("This backend accepts broken utf-8.")
def test_get_or_create_empty(self):
"""
Regression test for #16137: get_or_create does not require kwargs.
"""
try:
DefaultPerson.objects.get_or_create()
except AssertionError:
self.fail("If all the attributes on a model have defaults, we "
"shouldn't need to pass any arguments.")
class GetOrCreateTransactionTests(TransactionTestCase):
available_apps = ['get_or_create']
def test_get_or_create_integrityerror(self):
"""
Regression test for #15117. Requires a TransactionTestCase on
databases that delay integrity checks until the end of transactions,
otherwise the exception is never raised.
"""
try:
Profile.objects.get_or_create(person=Person(id=1))
except IntegrityError:
pass
else:
self.skipTest("This backend does not support integrity checks.")
class GetOrCreateThroughManyToMany(TestCase):
def test_get_get_or_create(self):
tag = Tag.objects.create(text='foo')
a_thing = Thing.objects.create(name='a')
a_thing.tags.add(tag)
obj, created = a_thing.tags.get_or_create(text='foo')
self.assertFalse(created)
self.assertEqual(obj.pk, tag.pk)
def test_create_get_or_create(self):
a_thing = Thing.objects.create(name='a')
obj, created = a_thing.tags.get_or_create(text='foo')
self.assertTrue(created)
self.assertEqual(obj.text, 'foo')
self.assertIn(obj, a_thing.tags.all())
def test_something(self):
Tag.objects.create(text='foo')
a_thing = Thing.objects.create(name='a')
self.assertRaises(IntegrityError, a_thing.tags.get_or_create, text='foo')
class UpdateOrCreateTests(TestCase):
def test_update(self):
Person.objects.create(
first_name='John', last_name='Lennon', birthday=date(1940, 10, 9)
)
p, created = Person.objects.update_or_create(
first_name='John', last_name='Lennon', defaults={
'birthday': date(1940, 10, 10)
}
)
self.assertFalse(created)
self.assertEqual(p.first_name, 'John')
self.assertEqual(p.last_name, 'Lennon')
self.assertEqual(p.birthday, date(1940, 10, 10))
def test_create(self):
p, created = Person.objects.update_or_create(
first_name='John', last_name='Lennon', defaults={
'birthday': date(1940, 10, 10)
}
)
self.assertTrue(created)
self.assertEqual(p.first_name, 'John')
self.assertEqual(p.last_name, 'Lennon')
self.assertEqual(p.birthday, date(1940, 10, 10))
def test_create_twice(self):
params = {
'first_name': 'John',
'last_name': 'Lennon',
'birthday': date(1940, 10, 10),
}
Person.objects.update_or_create(**params)
# If we execute the exact same statement, it won't create a Person.
p, created = Person.objects.update_or_create(**params)
self.assertFalse(created)
def test_integrity(self):
"""
If you don't specify a value or default value for all required
fields, you will get an error.
"""
self.assertRaises(IntegrityError,
Person.objects.update_or_create, first_name="Tom", last_name="Smith")
def test_manual_primary_key_test(self):
"""
If you specify an existing primary key, but different other fields,
then you will get an error and data will not be updated.
"""
ManualPrimaryKeyTest.objects.create(id=1, data="Original")
self.assertRaises(
IntegrityError,
ManualPrimaryKeyTest.objects.update_or_create, id=1, data="Different"
)
self.assertEqual(ManualPrimaryKeyTest.objects.get(id=1).data, "Original")
def test_error_contains_full_traceback(self):
"""
update_or_create should raise IntegrityErrors with the full traceback.
This is tested by checking that a known method call is in the traceback.
We cannot use assertRaises/assertRaises here because we need to inspect
the actual traceback. Refs #16340.
"""
try:
ManualPrimaryKeyTest.objects.update_or_create(id=1, data="Different")
except IntegrityError:
formatted_traceback = traceback.format_exc()
self.assertIn('obj.save', formatted_traceback)
def test_create_with_related_manager(self):
"""
Should be able to use update_or_create from the related manager to
create a book. Refs #23611.
"""
p = Publisher.objects.create(name="Acme Publishing")
book, created = p.books.update_or_create(name="The Book of Ed & Fred")
self.assertTrue(created)
self.assertEqual(p.books.count(), 1)
def test_update_with_related_manager(self):
"""
Should be able to use update_or_create from the related manager to
update a book. Refs #23611.
"""
p = Publisher.objects.create(name="Acme Publishing")
book = Book.objects.create(name="The Book of Ed & Fred", publisher=p)
self.assertEqual(p.books.count(), 1)
name = "The Book of Django"
book, created = p.books.update_or_create(defaults={'name': name}, id=book.id)
self.assertFalse(created)
self.assertEqual(book.name, name)
self.assertEqual(p.books.count(), 1)
def test_create_with_many(self):
"""
Should be able to use update_or_create from the m2m related manager to
create a book. Refs #23611.
"""
p = Publisher.objects.create(name="Acme Publishing")
author = Author.objects.create(name="Ted")
book, created = author.books.update_or_create(name="The Book of Ed & Fred", publisher=p)
self.assertTrue(created)
self.assertEqual(author.books.count(), 1)
def test_update_with_many(self):
"""
Should be able to use update_or_create from the m2m related manager to
update a book. Refs #23611.
"""
p = Publisher.objects.create(name="Acme Publishing")
author = Author.objects.create(name="Ted")
book = Book.objects.create(name="The Book of Ed & Fred", publisher=p)
book.authors.add(author)
self.assertEqual(author.books.count(), 1)
name = "The Book of Django"
book, created = author.books.update_or_create(defaults={'name': name}, id=book.id)
self.assertFalse(created)
self.assertEqual(book.name, name)
self.assertEqual(author.books.count(), 1)
| bsd-3-clause |
abrt/faf | src/pyfaf/storage/migrations/versions/168c63b81f85_report_history_default_value.py | 1 | 1945 | # Copyright (C) 2014 ABRT Team
# Copyright (C) 2014 Red Hat, Inc.
#
# This file is part of faf.
#
# faf is free software: you can redistribute it and/or modify
# it under the terms of the GNU General Public License as published by
# the Free Software Foundation, either version 3 of the License, or
# (at your option) any later version.
#
# faf is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
# GNU General Public License for more details.
#
# You should have received a copy of the GNU General Public License
# along with faf. If not, see <http://www.gnu.org/licenses/>.
"""
Report history default value
Revision ID: 168c63b81f85
Revises: 183a15e52a4f
Create Date: 2016-12-13 15:49:32.883743
"""
from alembic.op import alter_column, execute
# revision identifiers, used by Alembic.
revision = '168c63b81f85'
down_revision = '1c4d6317721a'
def upgrade() -> None:
alter_column('reporthistorydaily', 'unique', server_default="0")
alter_column('reporthistoryweekly', 'unique', server_default="0")
alter_column('reporthistorymonthly', 'unique', server_default="0")
execute('UPDATE reporthistorydaily SET "unique" = 0 WHERE "unique" IS NULL')
execute('UPDATE reporthistoryweekly SET "unique" = 0 WHERE "unique" IS NULL')
execute('UPDATE reporthistorymonthly SET "unique" = 0 WHERE "unique" IS NULL')
def downgrade() -> None:
alter_column('reporthistorydaily', 'unique', server_default=None)
alter_column('reporthistoryweekly', 'unique', server_default=None)
alter_column('reporthistorymonthly', 'unique', server_default=None)
execute('UPDATE reporthistorydaily SET "unique" = NULL WHERE "unique" = 0')
execute('UPDATE reporthistoryweekly SET "unique" = NULL WHERE "unique" = 0')
execute('UPDATE reporthistorymonthly SET "unique" = NULL WHERE "unique" = 0')
| gpl-3.0 |
lancezlin/ml_template_py | lib/python2.7/site-packages/pandas/tests/frame/test_missing.py | 7 | 24048 | # -*- coding: utf-8 -*-
from __future__ import print_function
from distutils.version import LooseVersion
from numpy import nan, random
import numpy as np
from pandas.compat import lrange
from pandas import (DataFrame, Series, Timestamp,
date_range)
import pandas as pd
from pandas.util.testing import (assert_series_equal,
assert_frame_equal,
assertRaisesRegexp)
import pandas.util.testing as tm
from pandas.tests.frame.common import TestData, _check_mixed_float
def _skip_if_no_pchip():
try:
from scipy.interpolate import pchip_interpolate # noqa
except ImportError:
import nose
raise nose.SkipTest('scipy.interpolate.pchip missing')
class TestDataFrameMissingData(tm.TestCase, TestData):
_multiprocess_can_split_ = True
def test_dropEmptyRows(self):
N = len(self.frame.index)
mat = random.randn(N)
mat[:5] = nan
frame = DataFrame({'foo': mat}, index=self.frame.index)
original = Series(mat, index=self.frame.index, name='foo')
expected = original.dropna()
inplace_frame1, inplace_frame2 = frame.copy(), frame.copy()
smaller_frame = frame.dropna(how='all')
# check that original was preserved
assert_series_equal(frame['foo'], original)
inplace_frame1.dropna(how='all', inplace=True)
assert_series_equal(smaller_frame['foo'], expected)
assert_series_equal(inplace_frame1['foo'], expected)
smaller_frame = frame.dropna(how='all', subset=['foo'])
inplace_frame2.dropna(how='all', subset=['foo'], inplace=True)
assert_series_equal(smaller_frame['foo'], expected)
assert_series_equal(inplace_frame2['foo'], expected)
def test_dropIncompleteRows(self):
N = len(self.frame.index)
mat = random.randn(N)
mat[:5] = nan
frame = DataFrame({'foo': mat}, index=self.frame.index)
frame['bar'] = 5
original = Series(mat, index=self.frame.index, name='foo')
inp_frame1, inp_frame2 = frame.copy(), frame.copy()
smaller_frame = frame.dropna()
assert_series_equal(frame['foo'], original)
inp_frame1.dropna(inplace=True)
exp = Series(mat[5:], index=self.frame.index[5:], name='foo')
tm.assert_series_equal(smaller_frame['foo'], exp)
tm.assert_series_equal(inp_frame1['foo'], exp)
samesize_frame = frame.dropna(subset=['bar'])
assert_series_equal(frame['foo'], original)
self.assertTrue((frame['bar'] == 5).all())
inp_frame2.dropna(subset=['bar'], inplace=True)
self.assert_index_equal(samesize_frame.index, self.frame.index)
self.assert_index_equal(inp_frame2.index, self.frame.index)
def test_dropna(self):
df = DataFrame(np.random.randn(6, 4))
df[2][:2] = nan
dropped = df.dropna(axis=1)
expected = df.ix[:, [0, 1, 3]]
inp = df.copy()
inp.dropna(axis=1, inplace=True)
assert_frame_equal(dropped, expected)
assert_frame_equal(inp, expected)
dropped = df.dropna(axis=0)
expected = df.ix[lrange(2, 6)]
inp = df.copy()
inp.dropna(axis=0, inplace=True)
assert_frame_equal(dropped, expected)
assert_frame_equal(inp, expected)
# threshold
dropped = df.dropna(axis=1, thresh=5)
expected = df.ix[:, [0, 1, 3]]
inp = df.copy()
inp.dropna(axis=1, thresh=5, inplace=True)
assert_frame_equal(dropped, expected)
assert_frame_equal(inp, expected)
dropped = df.dropna(axis=0, thresh=4)
expected = df.ix[lrange(2, 6)]
inp = df.copy()
inp.dropna(axis=0, thresh=4, inplace=True)
assert_frame_equal(dropped, expected)
assert_frame_equal(inp, expected)
dropped = df.dropna(axis=1, thresh=4)
assert_frame_equal(dropped, df)
dropped = df.dropna(axis=1, thresh=3)
assert_frame_equal(dropped, df)
# subset
dropped = df.dropna(axis=0, subset=[0, 1, 3])
inp = df.copy()
inp.dropna(axis=0, subset=[0, 1, 3], inplace=True)
assert_frame_equal(dropped, df)
assert_frame_equal(inp, df)
# all
dropped = df.dropna(axis=1, how='all')
assert_frame_equal(dropped, df)
df[2] = nan
dropped = df.dropna(axis=1, how='all')
expected = df.ix[:, [0, 1, 3]]
assert_frame_equal(dropped, expected)
# bad input
self.assertRaises(ValueError, df.dropna, axis=3)
def test_drop_and_dropna_caching(self):
# tst that cacher updates
original = Series([1, 2, np.nan], name='A')
expected = Series([1, 2], dtype=original.dtype, name='A')
df = pd.DataFrame({'A': original.values.copy()})
df2 = df.copy()
df['A'].dropna()
assert_series_equal(df['A'], original)
df['A'].dropna(inplace=True)
assert_series_equal(df['A'], expected)
df2['A'].drop([1])
assert_series_equal(df2['A'], original)
df2['A'].drop([1], inplace=True)
assert_series_equal(df2['A'], original.drop([1]))
def test_dropna_corner(self):
# bad input
self.assertRaises(ValueError, self.frame.dropna, how='foo')
self.assertRaises(TypeError, self.frame.dropna, how=None)
# non-existent column - 8303
self.assertRaises(KeyError, self.frame.dropna, subset=['A', 'X'])
def test_dropna_multiple_axes(self):
df = DataFrame([[1, np.nan, 2, 3],
[4, np.nan, 5, 6],
[np.nan, np.nan, np.nan, np.nan],
[7, np.nan, 8, 9]])
cp = df.copy()
result = df.dropna(how='all', axis=[0, 1])
result2 = df.dropna(how='all', axis=(0, 1))
expected = df.dropna(how='all').dropna(how='all', axis=1)
assert_frame_equal(result, expected)
assert_frame_equal(result2, expected)
assert_frame_equal(df, cp)
inp = df.copy()
inp.dropna(how='all', axis=(0, 1), inplace=True)
assert_frame_equal(inp, expected)
def test_fillna(self):
self.tsframe.ix[:5, 'A'] = nan
self.tsframe.ix[-5:, 'A'] = nan
zero_filled = self.tsframe.fillna(0)
self.assertTrue((zero_filled.ix[:5, 'A'] == 0).all())
padded = self.tsframe.fillna(method='pad')
self.assertTrue(np.isnan(padded.ix[:5, 'A']).all())
self.assertTrue((padded.ix[-5:, 'A'] == padded.ix[-5, 'A']).all())
# mixed type
self.mixed_frame.ix[5:20, 'foo'] = nan
self.mixed_frame.ix[-10:, 'A'] = nan
result = self.mixed_frame.fillna(value=0)
result = self.mixed_frame.fillna(method='pad')
self.assertRaises(ValueError, self.tsframe.fillna)
self.assertRaises(ValueError, self.tsframe.fillna, 5, method='ffill')
# mixed numeric (but no float16)
mf = self.mixed_float.reindex(columns=['A', 'B', 'D'])
mf.ix[-10:, 'A'] = nan
result = mf.fillna(value=0)
_check_mixed_float(result, dtype=dict(C=None))
result = mf.fillna(method='pad')
_check_mixed_float(result, dtype=dict(C=None))
# empty frame (GH #2778)
df = DataFrame(columns=['x'])
for m in ['pad', 'backfill']:
df.x.fillna(method=m, inplace=1)
df.x.fillna(method=m)
# with different dtype (GH3386)
df = DataFrame([['a', 'a', np.nan, 'a'], [
'b', 'b', np.nan, 'b'], ['c', 'c', np.nan, 'c']])
result = df.fillna({2: 'foo'})
expected = DataFrame([['a', 'a', 'foo', 'a'],
['b', 'b', 'foo', 'b'],
['c', 'c', 'foo', 'c']])
assert_frame_equal(result, expected)
df.fillna({2: 'foo'}, inplace=True)
assert_frame_equal(df, expected)
# limit and value
df = DataFrame(np.random.randn(10, 3))
df.iloc[2:7, 0] = np.nan
df.iloc[3:5, 2] = np.nan
expected = df.copy()
expected.iloc[2, 0] = 999
expected.iloc[3, 2] = 999
result = df.fillna(999, limit=1)
assert_frame_equal(result, expected)
# with datelike
# GH 6344
df = DataFrame({
'Date': [pd.NaT, Timestamp("2014-1-1")],
'Date2': [Timestamp("2013-1-1"), pd.NaT]
})
expected = df.copy()
expected['Date'] = expected['Date'].fillna(df.ix[0, 'Date2'])
result = df.fillna(value={'Date': df['Date2']})
assert_frame_equal(result, expected)
def test_fillna_dtype_conversion(self):
# make sure that fillna on an empty frame works
df = DataFrame(index=["A", "B", "C"], columns=[1, 2, 3, 4, 5])
result = df.get_dtype_counts().sort_values()
expected = Series({'object': 5})
assert_series_equal(result, expected)
result = df.fillna(1)
expected = DataFrame(1, index=["A", "B", "C"], columns=[1, 2, 3, 4, 5])
result = result.get_dtype_counts().sort_values()
expected = Series({'int64': 5})
assert_series_equal(result, expected)
# empty block
df = DataFrame(index=lrange(3), columns=['A', 'B'], dtype='float64')
result = df.fillna('nan')
expected = DataFrame('nan', index=lrange(3), columns=['A', 'B'])
assert_frame_equal(result, expected)
# equiv of replace
df = DataFrame(dict(A=[1, np.nan], B=[1., 2.]))
for v in ['', 1, np.nan, 1.0]:
expected = df.replace(np.nan, v)
result = df.fillna(v)
assert_frame_equal(result, expected)
def test_fillna_datetime_columns(self):
# GH 7095
df = pd.DataFrame({'A': [-1, -2, np.nan],
'B': date_range('20130101', periods=3),
'C': ['foo', 'bar', None],
'D': ['foo2', 'bar2', None]},
index=date_range('20130110', periods=3))
result = df.fillna('?')
expected = pd.DataFrame({'A': [-1, -2, '?'],
'B': date_range('20130101', periods=3),
'C': ['foo', 'bar', '?'],
'D': ['foo2', 'bar2', '?']},
index=date_range('20130110', periods=3))
self.assert_frame_equal(result, expected)
df = pd.DataFrame({'A': [-1, -2, np.nan],
'B': [pd.Timestamp('2013-01-01'),
pd.Timestamp('2013-01-02'), pd.NaT],
'C': ['foo', 'bar', None],
'D': ['foo2', 'bar2', None]},
index=date_range('20130110', periods=3))
result = df.fillna('?')
expected = pd.DataFrame({'A': [-1, -2, '?'],
'B': [pd.Timestamp('2013-01-01'),
pd.Timestamp('2013-01-02'), '?'],
'C': ['foo', 'bar', '?'],
'D': ['foo2', 'bar2', '?']},
index=pd.date_range('20130110', periods=3))
self.assert_frame_equal(result, expected)
def test_ffill(self):
self.tsframe['A'][:5] = nan
self.tsframe['A'][-5:] = nan
assert_frame_equal(self.tsframe.ffill(),
self.tsframe.fillna(method='ffill'))
def test_bfill(self):
self.tsframe['A'][:5] = nan
self.tsframe['A'][-5:] = nan
assert_frame_equal(self.tsframe.bfill(),
self.tsframe.fillna(method='bfill'))
def test_fillna_skip_certain_blocks(self):
# don't try to fill boolean, int blocks
df = DataFrame(np.random.randn(10, 4).astype(int))
# it works!
df.fillna(np.nan)
def test_fillna_inplace(self):
df = DataFrame(np.random.randn(10, 4))
df[1][:4] = np.nan
df[3][-4:] = np.nan
expected = df.fillna(value=0)
self.assertIsNot(expected, df)
df.fillna(value=0, inplace=True)
assert_frame_equal(df, expected)
df[1][:4] = np.nan
df[3][-4:] = np.nan
expected = df.fillna(method='ffill')
self.assertIsNot(expected, df)
df.fillna(method='ffill', inplace=True)
assert_frame_equal(df, expected)
def test_fillna_dict_series(self):
df = DataFrame({'a': [nan, 1, 2, nan, nan],
'b': [1, 2, 3, nan, nan],
'c': [nan, 1, 2, 3, 4]})
result = df.fillna({'a': 0, 'b': 5})
expected = df.copy()
expected['a'] = expected['a'].fillna(0)
expected['b'] = expected['b'].fillna(5)
assert_frame_equal(result, expected)
# it works
result = df.fillna({'a': 0, 'b': 5, 'd': 7})
# Series treated same as dict
result = df.fillna(df.max())
expected = df.fillna(df.max().to_dict())
assert_frame_equal(result, expected)
# disable this for now
with assertRaisesRegexp(NotImplementedError, 'column by column'):
df.fillna(df.max(1), axis=1)
def test_fillna_dataframe(self):
# GH 8377
df = DataFrame({'a': [nan, 1, 2, nan, nan],
'b': [1, 2, 3, nan, nan],
'c': [nan, 1, 2, 3, 4]},
index=list('VWXYZ'))
# df2 may have different index and columns
df2 = DataFrame({'a': [nan, 10, 20, 30, 40],
'b': [50, 60, 70, 80, 90],
'foo': ['bar'] * 5},
index=list('VWXuZ'))
result = df.fillna(df2)
# only those columns and indices which are shared get filled
expected = DataFrame({'a': [nan, 1, 2, nan, 40],
'b': [1, 2, 3, nan, 90],
'c': [nan, 1, 2, 3, 4]},
index=list('VWXYZ'))
assert_frame_equal(result, expected)
def test_fillna_columns(self):
df = DataFrame(np.random.randn(10, 10))
df.values[:, ::2] = np.nan
result = df.fillna(method='ffill', axis=1)
expected = df.T.fillna(method='pad').T
assert_frame_equal(result, expected)
df.insert(6, 'foo', 5)
result = df.fillna(method='ffill', axis=1)
expected = df.astype(float).fillna(method='ffill', axis=1)
assert_frame_equal(result, expected)
def test_fillna_invalid_method(self):
with assertRaisesRegexp(ValueError, 'ffil'):
self.frame.fillna(method='ffil')
def test_fillna_invalid_value(self):
# list
self.assertRaises(TypeError, self.frame.fillna, [1, 2])
# tuple
self.assertRaises(TypeError, self.frame.fillna, (1, 2))
# frame with series
self.assertRaises(ValueError, self.frame.iloc[:, 0].fillna,
self.frame)
def test_fillna_col_reordering(self):
cols = ["COL." + str(i) for i in range(5, 0, -1)]
data = np.random.rand(20, 5)
df = DataFrame(index=lrange(20), columns=cols, data=data)
filled = df.fillna(method='ffill')
self.assertEqual(df.columns.tolist(), filled.columns.tolist())
def test_fill_corner(self):
self.mixed_frame.ix[5:20, 'foo'] = nan
self.mixed_frame.ix[-10:, 'A'] = nan
filled = self.mixed_frame.fillna(value=0)
self.assertTrue((filled.ix[5:20, 'foo'] == 0).all())
del self.mixed_frame['foo']
empty_float = self.frame.reindex(columns=[])
# TODO(wesm): unused?
result = empty_float.fillna(value=0) # noqa
def test_fill_value_when_combine_const(self):
# GH12723
dat = np.array([0, 1, np.nan, 3, 4, 5], dtype='float')
df = DataFrame({'foo': dat}, index=range(6))
exp = df.fillna(0).add(2)
res = df.add(2, fill_value=0)
assert_frame_equal(res, exp)
class TestDataFrameInterpolate(tm.TestCase, TestData):
def test_interp_basic(self):
df = DataFrame({'A': [1, 2, np.nan, 4],
'B': [1, 4, 9, np.nan],
'C': [1, 2, 3, 5],
'D': list('abcd')})
expected = DataFrame({'A': [1., 2., 3., 4.],
'B': [1., 4., 9., 9.],
'C': [1, 2, 3, 5],
'D': list('abcd')})
result = df.interpolate()
assert_frame_equal(result, expected)
result = df.set_index('C').interpolate()
expected = df.set_index('C')
expected.loc[3, 'A'] = 3
expected.loc[5, 'B'] = 9
assert_frame_equal(result, expected)
def test_interp_bad_method(self):
df = DataFrame({'A': [1, 2, np.nan, 4],
'B': [1, 4, 9, np.nan],
'C': [1, 2, 3, 5],
'D': list('abcd')})
with tm.assertRaises(ValueError):
df.interpolate(method='not_a_method')
def test_interp_combo(self):
df = DataFrame({'A': [1., 2., np.nan, 4.],
'B': [1, 4, 9, np.nan],
'C': [1, 2, 3, 5],
'D': list('abcd')})
result = df['A'].interpolate()
expected = Series([1., 2., 3., 4.], name='A')
assert_series_equal(result, expected)
result = df['A'].interpolate(downcast='infer')
expected = Series([1, 2, 3, 4], name='A')
assert_series_equal(result, expected)
def test_interp_nan_idx(self):
df = DataFrame({'A': [1, 2, np.nan, 4], 'B': [np.nan, 2, 3, 4]})
df = df.set_index('A')
with tm.assertRaises(NotImplementedError):
df.interpolate(method='values')
def test_interp_various(self):
tm._skip_if_no_scipy()
df = DataFrame({'A': [1, 2, np.nan, 4, 5, np.nan, 7],
'C': [1, 2, 3, 5, 8, 13, 21]})
df = df.set_index('C')
expected = df.copy()
result = df.interpolate(method='polynomial', order=1)
expected.A.loc[3] = 2.66666667
expected.A.loc[13] = 5.76923076
assert_frame_equal(result, expected)
result = df.interpolate(method='cubic')
expected.A.loc[3] = 2.81621174
expected.A.loc[13] = 5.64146581
assert_frame_equal(result, expected)
result = df.interpolate(method='nearest')
expected.A.loc[3] = 2
expected.A.loc[13] = 5
assert_frame_equal(result, expected, check_dtype=False)
result = df.interpolate(method='quadratic')
expected.A.loc[3] = 2.82533638
expected.A.loc[13] = 6.02817974
assert_frame_equal(result, expected)
result = df.interpolate(method='slinear')
expected.A.loc[3] = 2.66666667
expected.A.loc[13] = 5.76923077
assert_frame_equal(result, expected)
result = df.interpolate(method='zero')
expected.A.loc[3] = 2.
expected.A.loc[13] = 5
assert_frame_equal(result, expected, check_dtype=False)
result = df.interpolate(method='quadratic')
expected.A.loc[3] = 2.82533638
expected.A.loc[13] = 6.02817974
assert_frame_equal(result, expected)
def test_interp_alt_scipy(self):
tm._skip_if_no_scipy()
df = DataFrame({'A': [1, 2, np.nan, 4, 5, np.nan, 7],
'C': [1, 2, 3, 5, 8, 13, 21]})
result = df.interpolate(method='barycentric')
expected = df.copy()
expected.ix[2, 'A'] = 3
expected.ix[5, 'A'] = 6
assert_frame_equal(result, expected)
result = df.interpolate(method='barycentric', downcast='infer')
assert_frame_equal(result, expected.astype(np.int64))
result = df.interpolate(method='krogh')
expectedk = df.copy()
expectedk['A'] = expected['A']
assert_frame_equal(result, expectedk)
_skip_if_no_pchip()
import scipy
result = df.interpolate(method='pchip')
expected.ix[2, 'A'] = 3
if LooseVersion(scipy.__version__) >= '0.17.0':
expected.ix[5, 'A'] = 6.0
else:
expected.ix[5, 'A'] = 6.125
assert_frame_equal(result, expected)
def test_interp_rowwise(self):
df = DataFrame({0: [1, 2, np.nan, 4],
1: [2, 3, 4, np.nan],
2: [np.nan, 4, 5, 6],
3: [4, np.nan, 6, 7],
4: [1, 2, 3, 4]})
result = df.interpolate(axis=1)
expected = df.copy()
expected.loc[3, 1] = 5
expected.loc[0, 2] = 3
expected.loc[1, 3] = 3
expected[4] = expected[4].astype(np.float64)
assert_frame_equal(result, expected)
# scipy route
tm._skip_if_no_scipy()
result = df.interpolate(axis=1, method='values')
assert_frame_equal(result, expected)
result = df.interpolate(axis=0)
expected = df.interpolate()
assert_frame_equal(result, expected)
def test_rowwise_alt(self):
df = DataFrame({0: [0, .5, 1., np.nan, 4, 8, np.nan, np.nan, 64],
1: [1, 2, 3, 4, 3, 2, 1, 0, -1]})
df.interpolate(axis=0)
def test_interp_leading_nans(self):
df = DataFrame({"A": [np.nan, np.nan, .5, .25, 0],
"B": [np.nan, -3, -3.5, np.nan, -4]})
result = df.interpolate()
expected = df.copy()
expected['B'].loc[3] = -3.75
assert_frame_equal(result, expected)
tm._skip_if_no_scipy()
result = df.interpolate(method='polynomial', order=1)
assert_frame_equal(result, expected)
def test_interp_raise_on_only_mixed(self):
df = DataFrame({'A': [1, 2, np.nan, 4],
'B': ['a', 'b', 'c', 'd'],
'C': [np.nan, 2, 5, 7],
'D': [np.nan, np.nan, 9, 9],
'E': [1, 2, 3, 4]})
with tm.assertRaises(TypeError):
df.interpolate(axis=1)
def test_interp_inplace(self):
df = DataFrame({'a': [1., 2., np.nan, 4.]})
expected = DataFrame({'a': [1., 2., 3., 4.]})
result = df.copy()
result['a'].interpolate(inplace=True)
assert_frame_equal(result, expected)
result = df.copy()
result['a'].interpolate(inplace=True, downcast='infer')
assert_frame_equal(result, expected.astype('int64'))
def test_interp_inplace_row(self):
# GH 10395
result = DataFrame({'a': [1., 2., 3., 4.],
'b': [np.nan, 2., 3., 4.],
'c': [3, 2, 2, 2]})
expected = result.interpolate(method='linear', axis=1, inplace=False)
result.interpolate(method='linear', axis=1, inplace=True)
assert_frame_equal(result, expected)
def test_interp_ignore_all_good(self):
# GH
df = DataFrame({'A': [1, 2, np.nan, 4],
'B': [1, 2, 3, 4],
'C': [1., 2., np.nan, 4.],
'D': [1., 2., 3., 4.]})
expected = DataFrame({'A': np.array(
[1, 2, 3, 4], dtype='float64'),
'B': np.array(
[1, 2, 3, 4], dtype='int64'),
'C': np.array(
[1., 2., 3, 4.], dtype='float64'),
'D': np.array(
[1., 2., 3., 4.], dtype='float64')})
result = df.interpolate(downcast=None)
assert_frame_equal(result, expected)
# all good
result = df[['B', 'D']].interpolate(downcast=None)
assert_frame_equal(result, df[['B', 'D']])
if __name__ == '__main__':
import nose
nose.runmodule(argv=[__file__, '-vvs', '-x', '--pdb', '--pdb-failure'],
# '--with-coverage', '--cover-package=pandas.core']
exit=False)
| mit |
NAMD/justicecloud | justice/external/wtforms/ext/sqlalchemy/orm.py | 50 | 10766 | """
Tools for generating forms based on SQLAlchemy models.
"""
from __future__ import unicode_literals
import inspect
from wtforms import fields as f
from wtforms import validators
from wtforms.form import Form
from wtforms.ext.sqlalchemy.fields import QuerySelectField
from wtforms.ext.sqlalchemy.fields import QuerySelectMultipleField
from wtforms.ext.sqlalchemy.validators import Unique
__all__ = (
'model_fields', 'model_form',
)
def converts(*args):
def _inner(func):
func._converter_for = frozenset(args)
return func
return _inner
class ModelConverterBase(object):
def __init__(self, converters, use_mro=True):
self.use_mro = use_mro
if not converters:
converters = {}
for name in dir(self):
obj = getattr(self, name)
if hasattr(obj, '_converter_for'):
for classname in obj._converter_for:
converters[classname] = obj
self.converters = converters
class ModelConverterBase(object):
def __init__(self, converters, use_mro=True):
self.use_mro = use_mro
if not converters:
converters = {}
for name in dir(self):
obj = getattr(self, name)
if hasattr(obj, '_converter_for'):
for classname in obj._converter_for:
converters[classname] = obj
self.converters = converters
def convert(self, model, mapper, prop, field_args, db_session=None):
if not hasattr(prop, 'columns') and not hasattr(prop, 'direction'):
return
elif not hasattr(prop, 'direction') and len(prop.columns) != 1:
raise TypeError('Do not know how to convert multiple-column '
+ 'properties currently')
kwargs = {
'validators': [],
'filters': [],
'default': None,
}
converter = None
column = None
if not hasattr(prop, 'direction'):
column = prop.columns[0]
# Support sqlalchemy.schema.ColumnDefault, so users can benefit
# from setting defaults for fields, e.g.:
# field = Column(DateTimeField, default=datetime.utcnow)
default = getattr(column, 'default', None)
if default is not None:
# Only actually change default if it has an attribute named
# 'arg' that's callable.
callable_default = getattr(default, 'arg', None)
if callable_default and callable(callable_default):
default = callable_default(None)
kwargs['default'] = default
if column.nullable:
kwargs['validators'].append(validators.Optional())
else:
kwargs['validators'].append(validators.Required())
if db_session and column.unique:
kwargs['validators'].append(Unique(lambda: db_session, model,
column))
if self.use_mro:
types = inspect.getmro(type(column.type))
else:
types = [type(column.type)]
for col_type in types:
type_string = '%s.%s' % (col_type.__module__,
col_type.__name__)
if type_string.startswith('sqlalchemy'):
type_string = type_string[11:]
if type_string in self.converters:
converter = self.converters[type_string]
break
else:
for col_type in types:
if col_type.__name__ in self.converters:
converter = self.converters[col_type.__name__]
break
else:
return
if db_session and hasattr(prop, 'direction'):
foreign_model = prop.mapper.class_
nullable = True
for pair in prop.local_remote_pairs:
if not pair[0].nullable:
nullable = False
kwargs.update({
'allow_blank': nullable,
'query_factory': lambda: db_session.query(foreign_model).all()
})
converter = self.converters[prop.direction.name]
if field_args:
kwargs.update(field_args)
return converter(model=model, mapper=mapper, prop=prop, column=column,
field_args=kwargs)
class ModelConverter(ModelConverterBase):
def __init__(self, extra_converters=None):
super(ModelConverter, self).__init__(extra_converters)
@classmethod
def _string_common(cls, column, field_args, **extra):
if column.type.length:
field_args['validators'].append(validators.Length(max=column.type.length))
@converts('String', 'Unicode')
def conv_String(self, field_args, **extra):
self._string_common(field_args=field_args, **extra)
return f.TextField(**field_args)
@converts('Text', 'UnicodeText', 'types.LargeBinary', 'types.Binary')
def conv_Text(self, field_args, **extra):
self._string_common(field_args=field_args, **extra)
return f.TextAreaField(**field_args)
@converts('Boolean')
def conv_Boolean(self, field_args, **extra):
return f.BooleanField(**field_args)
@converts('Date')
def conv_Date(self, field_args, **extra):
return f.DateField(**field_args)
@converts('DateTime')
def conv_DateTime(self, field_args, **extra):
return f.DateTimeField(**field_args)
@converts('Integer', 'SmallInteger')
def handle_integer_types(self, column, field_args, **extra):
unsigned = getattr(column.type, 'unsigned', False)
if unsigned:
field_args['validators'].append(validators.NumberRange(min=0))
return f.IntegerField(**field_args)
@converts('Numeric', 'Float')
def handle_decimal_types(self, column, field_args, **extra):
places = getattr(column.type, 'scale', 2)
if places is not None:
field_args['places'] = places
return f.DecimalField(**field_args)
@converts('databases.mysql.MSYear')
def conv_MSYear(self, field_args, **extra):
field_args['validators'].append(validators.NumberRange(min=1901, max=2155))
return f.TextField(**field_args)
@converts('databases.postgres.PGInet', 'dialects.postgresql.base.INET')
def conv_PGInet(self, field_args, **extra):
field_args.setdefault('label', 'IP Address')
field_args['validators'].append(validators.IPAddress())
return f.TextField(**field_args)
@converts('dialects.postgresql.base.MACADDR')
def conv_PGMacaddr(self, field_args, **extra):
field_args.setdefault('label', 'MAC Address')
field_args['validators'].append(validators.MacAddress())
return f.TextField(**field_args)
@converts('dialects.postgresql.base.UUID')
def conv_PGUuid(self, field_args, **extra):
field_args.setdefault('label', 'UUID')
field_args['validators'].append(validators.UUID())
return f.TextField(**field_args)
@converts('MANYTOONE')
def conv_ManyToOne(self, field_args, **extra):
return QuerySelectField(**field_args)
@converts('MANYTOMANY', 'ONETOMANY')
def conv_ManyToMany(self, field_args, **extra):
return QuerySelectMultipleField(**field_args)
def model_fields(model, db_session=None, only=None, exclude=None,
field_args=None, converter=None):
"""
Generate a dictionary of fields for a given SQLAlchemy model.
See `model_form` docstring for description of parameters.
"""
if not hasattr(model, '_sa_class_manager'):
raise TypeError('model must be a sqlalchemy mapped model')
mapper = model._sa_class_manager.mapper
converter = converter or ModelConverter()
field_args = field_args or {}
properties = ((p.key, p) for p in mapper.iterate_properties)
if only:
properties = (x for x in properties if x[0] in only)
elif exclude:
properties = (x for x in properties if x[0] not in exclude)
field_dict = {}
for name, prop in properties:
field = converter.convert(model, mapper, prop,
field_args.get(name), db_session)
if field is not None:
field_dict[name] = field
return field_dict
def model_form(model, db_session=None, base_class=Form, only=None,
exclude=None, field_args=None, converter=None, exclude_pk=True,
exclude_fk=True, type_name=None):
"""
Create a wtforms Form for a given SQLAlchemy model class::
from wtalchemy.orm import model_form
from myapp.models import User
UserForm = model_form(User)
:param model:
A SQLAlchemy mapped model class.
:param db_session:
An optional SQLAlchemy Session.
:param base_class:
Base form class to extend from. Must be a ``wtforms.Form`` subclass.
:param only:
An optional iterable with the property names that should be included in
the form. Only these properties will have fields.
:param exclude:
An optional iterable with the property names that should be excluded
from the form. All other properties will have fields.
:param field_args:
An optional dictionary of field names mapping to keyword arguments used
to construct each field object.
:param converter:
A converter to generate the fields based on the model properties. If
not set, ``ModelConverter`` is used.
:param exclude_pk:
An optional boolean to force primary key exclusion.
:param exclude_fk:
An optional boolean to force foreign keys exclusion.
:param type_name:
An optional string to set returned type name.
"""
class ModelForm(base_class):
"""Sets object as form attribute."""
def __init__(self, *args, **kwargs):
if 'obj' in kwargs:
self._obj = kwargs['obj']
super(ModelForm, self).__init__(*args, **kwargs)
if not exclude:
exclude = []
model_mapper = model.__mapper__
for prop in model_mapper.iterate_properties:
if not hasattr(prop, 'direction') and prop.columns[0].primary_key:
if exclude_pk:
exclude.append(prop.key)
if hasattr(prop, 'direction') and exclude_fk and \
prop.direction.name != 'MANYTOMANY':
for pair in prop.local_remote_pairs:
exclude.append(pair[0].key)
type_name = type_name or str(model.__name__ + 'Form')
field_dict = model_fields(model, db_session, only, exclude, field_args,
converter)
return type(type_name, (ModelForm, ), field_dict)
| lgpl-3.0 |
HalcyonChimera/osf.io | addons/gitlab/tests/test_serializer.py | 15 | 1607 | # -*- coding: utf-8 -*-
"""Serializer tests for the GitLab addon."""
import mock
import pytest
from tests.base import OsfTestCase
from addons.base.tests.serializers import StorageAddonSerializerTestSuiteMixin
from addons.gitlab.api import GitLabClient
from addons.gitlab.tests.factories import GitLabAccountFactory
from addons.gitlab.serializer import GitLabSerializer
pytestmark = pytest.mark.django_db
class TestGitLabSerializer(StorageAddonSerializerTestSuiteMixin, OsfTestCase):
addon_short_name = 'gitlab'
Serializer = GitLabSerializer
ExternalAccountFactory = GitLabAccountFactory
client = GitLabClient()
def set_provider_id(self, pid):
self.node_settings.repo = pid
## Overrides ##
def setUp(self):
super(TestGitLabSerializer, self).setUp()
self.mock_api_user = mock.patch('addons.gitlab.api.GitLabClient.user')
self.mock_api_user.return_value = mock.Mock()
self.mock_api_user.start()
def tearDown(self):
self.mock_api_user.stop()
super(TestGitLabSerializer, self).tearDown()
def test_serialize_acccount(self):
ea = self.ExternalAccountFactory()
expected = {
'id': ea._id,
'provider_id': ea.provider_id,
'provider_name': ea.provider_name,
'provider_short_name': ea.provider,
'display_name': ea.display_name,
'profile_url': ea.profile_url,
'nodes': [],
'host': ea.oauth_secret,
'host_url': ea.oauth_secret,
}
assert self.ser.serialize_account(ea) == expected
| apache-2.0 |
vmanoria/bluemix-hue-filebrowser | hue-3.8.1-bluemix/desktop/core/ext-py/pycrypto-2.6.1/lib/Crypto/SelfTest/Random/__init__.py | 105 | 1973 | # -*- coding: utf-8 -*-
#
# SelfTest/Random/__init__.py: Self-test for random number generation modules
#
# Written in 2008 by Dwayne C. Litzenberger <[email protected]>
#
# ===================================================================
# The contents of this file are dedicated to the public domain. To
# the extent that dedication to the public domain is not available,
# everyone is granted a worldwide, perpetual, royalty-free,
# non-exclusive license to exercise all rights associated with the
# contents of this file for any purpose whatsoever.
# No rights are reserved.
#
# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
# EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
# MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
# NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS
# BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN
# ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
# CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
# SOFTWARE.
# ===================================================================
"""Self-test for random number generators"""
__revision__ = "$Id$"
def get_tests(config={}):
tests = []
from Crypto.SelfTest.Random import Fortuna; tests += Fortuna.get_tests(config=config)
from Crypto.SelfTest.Random import OSRNG; tests += OSRNG.get_tests(config=config)
from Crypto.SelfTest.Random import test_random; tests += test_random.get_tests(config=config)
from Crypto.SelfTest.Random import test_rpoolcompat; tests += test_rpoolcompat.get_tests(config=config)
from Crypto.SelfTest.Random import test__UserFriendlyRNG; tests += test__UserFriendlyRNG.get_tests(config=config)
return tests
if __name__ == '__main__':
import unittest
suite = lambda: unittest.TestSuite(get_tests())
unittest.main(defaultTest='suite')
# vim:set ts=4 sw=4 sts=4 expandtab:
| gpl-2.0 |
mauriceling/dose | examples/14_revive_simulation_13_fitness_loss.py | 2 | 4596 | '''
Example 14: Continuation of examining the effects of natural selection on a
population's genetic pool by implementing a fitness scheme that counts
a specific sequence within the chromosome along with a goal to be reached
from an evenly deployed population. In this simulation, loss of fitness is
observed by implementing a random selection scheme to the population.
In this simulation,
- revival of 1 population of 100 organisms
- unchanged simulation parameters
- 5000 generations to be simulated
- random organism killing in pospopulation_control
'''
# needed to run this example without prior
# installation of DOSE into Python site-packages
try:
import run_examples_without_installation
except ImportError: pass
# Example codes starts from here
import dose, random
from collections import Counter
from copy import deepcopy
parameters = {"database_source" : "T1_11x0.db",
"simulation_time": "default",
"rev_start" : [200],
"extend_gen" : 5000,
"simulation_name": "T1_11x0_revival",
"database_file": "T1_11x0_revival.db",
"database_logging_frequency": 1,
}
class simulation_functions(dose.dose_functions):
def organism_movement(self, Populations, pop_name, World): pass
def organism_location(self, Populations, pop_name, World): pass
def ecoregulate(self, World): pass
def update_ecology(self, World, x, y, z): pass
def update_local(self, World, x, y, z): pass
def report(self, World): pass
def fitness(self, Populations, pop_name):
for organism in Populations[pop_name].agents:
final_fitness = []
chromosome = organism.genome[0].sequence
zero_count = []
for base_index in range(parameters["chromosome_size"] - 1):
if int(chromosome[base_index]) == 0 and int(chromosome[base_index - 1]) != 0:
next_index = 1
while int(chromosome[next_index + base_index]) == 0:
next_index += 1
if (next_index + base_index) == parameters["chromosome_size"]: break
zero_count.append(next_index)
for sequence in range(len(zero_count)):
if len(final_fitness) == 10: break
seq_score = sorted(zero_count, reverse = True)[sequence]
if seq_score > int(parameters["goal"]/10): seq_score = int(parameters["goal"]/10)
final_fitness.append(seq_score)
organism.status['fitness'] = sum(final_fitness)
def mutation_scheme(self, organism):
organism.genome[0].rmutate(parameters["mutation_type"],
parameters["additional_mutation"])
def prepopulation_control(self, Populations, pop_name): pass
def mating(self, Populations, pop_name):
group = deepcopy(Populations[pop_name].agents)
for organism in group:
organism.generate_name()
Populations[pop_name].agents.append(organism)
def postpopulation_control(self, Populations, pop_name):
group = deepcopy(Populations[pop_name].agents)
for i in range(len(group)//2):
Populations[pop_name].agents.remove(random.choice(Populations[pop_name].agents))
def generation_events(self, Populations, pop_name): pass
def population_report(self, Populations, pop_name):
report_list = []
for organism in Populations[pop_name].agents:
chromosome = organism.status['identity']
fitness = str(organism.status['fitness'])
report_list.append(chromosome + ' ' + fitness)
return '\n'.join(report_list)
def database_report(self, con, cur, start_time,
Populations, World, generation_count):
try:
dose.database_report_populations(con, cur, start_time,
Populations, generation_count)
except: pass
try:
dose.database_report_world(con, cur, start_time,
World, generation_count)
except: pass
def deployment_scheme(self, Populations, pop_name, World): pass
for trial in range(13, 26):
parameters["simulation_name"] = "T" + str(trial) + "_ts_7x0_loss1"
parameters["database_source"] = "T" + str(trial) + "_ts_7x0_gain1.db"
parameters["database_file"] = "T" + str(trial) + "_ts_7x0_loss1.db"
dose.revive_simulation(parameters, simulation_functions)
parameters["simulation_time"] = "default" | gpl-3.0 |
sradevski/homeAutomate | scripts/laptop_on_network.py | 1 | 1994 | #!/usr/bin/python
import remote_core as core
import os
import sys
import nmap
import datetime
import time
import re
import go_to_sleep
try:
nm = nmap.PortScanner() # instance of nmap.PortScanner
except nmap.PortScannerError:
print('Nmap not found', sys.exc_info()[0])
sys.exit(0)
except:
print("Unexpected error:", sys.exc_info()[0])
sys.exit(0)
macAddressToSearch = '64:76:BA:A3:43:B0'
laptopHasBeenTurnedOn = False
disconnectedCounter = 0
def checkIfLaptopOn():
global macAddressToSearch, laptopHasBeenTurnedOn, disconnectedCounter
curHosts = []
# nm.scan(hosts = '192.168.11.1-8', arguments = '-n -sP -PS 7,22,88,443,80,660,2195 -PA 80,22,443 -PU -T3')
nm.scan(hosts = '192.168.11.1-8', arguments = '-n -sn -PR')
for host in nm.all_hosts():
try:
mac = nm[host]['addresses']['mac']
vendor = nm[host]['vendor'][mac]
except:
vendor = mac = 'unknown'
curHosts.append(mac)
localtime = time.asctime(time.localtime(time.time()))
print('============ {0} ============'.format(localtime))
for host in curHosts:
print(host)
config = core.load_config();
if config['location']['am_home']:
if macAddressToSearch not in curHosts:
if laptopHasBeenTurnedOn:
if disconnectedCounter > 3:
wentToSleepScript()
laptopHasBeenTurnedOn = False
disconnectedCounter += 1
else:
laptopHasBeenTurnedOn = True
def wentToSleepScript():
time.sleep(10)
go_to_sleep.go_to_sleep()
# print("SLEEPING")
if __name__ == '__main__':
start_at_hour = 22
stop_at_hour = 2
sleep_seconds = 60 * 60 * (start_at_hour - stop_at_hour) - 20
while True:
localtime = time.localtime(time.time())
if localtime.tm_hour > stop_at_hour and localtime.tm_hour < start_at_hour:
time.sleep(sleep_seconds - (60 * 60 * (start_at_hour - localtime.tm_hour)))
time.sleep(10)
checkIfLaptopOn()
| mit |
Orav/kbengine | kbe/src/lib/python/Lib/tkinter/font.py | 2 | 6845 | # Tkinter font wrapper
#
# written by Fredrik Lundh, February 1998
#
__version__ = "0.9"
import itertools
import tkinter
# weight/slant
NORMAL = "normal"
ROMAN = "roman"
BOLD = "bold"
ITALIC = "italic"
def nametofont(name):
"""Given the name of a tk named font, returns a Font representation.
"""
return Font(name=name, exists=True)
class Font:
"""Represents a named font.
Constructor options are:
font -- font specifier (name, system font, or (family, size, style)-tuple)
name -- name to use for this font configuration (defaults to a unique name)
exists -- does a named font by this name already exist?
Creates a new named font if False, points to the existing font if True.
Raises _tkinter.TclError if the assertion is false.
the following are ignored if font is specified:
family -- font 'family', e.g. Courier, Times, Helvetica
size -- font size in points
weight -- font thickness: NORMAL, BOLD
slant -- font slant: ROMAN, ITALIC
underline -- font underlining: false (0), true (1)
overstrike -- font strikeout: false (0), true (1)
"""
counter = itertools.count(1)
def _set(self, kw):
options = []
for k, v in kw.items():
options.append("-"+k)
options.append(str(v))
return tuple(options)
def _get(self, args):
options = []
for k in args:
options.append("-"+k)
return tuple(options)
def _mkdict(self, args):
options = {}
for i in range(0, len(args), 2):
options[args[i][1:]] = args[i+1]
return options
def __init__(self, root=None, font=None, name=None, exists=False,
**options):
if not root:
root = tkinter._default_root
tk = getattr(root, 'tk', root)
if font:
# get actual settings corresponding to the given font
font = tk.splitlist(tk.call("font", "actual", font))
else:
font = self._set(options)
if not name:
name = "font" + str(next(self.counter))
self.name = name
if exists:
self.delete_font = False
# confirm font exists
if self.name not in tk.splitlist(tk.call("font", "names")):
raise tkinter._tkinter.TclError(
"named font %s does not already exist" % (self.name,))
# if font config info supplied, apply it
if font:
tk.call("font", "configure", self.name, *font)
else:
# create new font (raises TclError if the font exists)
tk.call("font", "create", self.name, *font)
self.delete_font = True
self._tk = tk
self._split = tk.splitlist
self._call = tk.call
def __str__(self):
return self.name
def __eq__(self, other):
return isinstance(other, Font) and self.name == other.name
def __getitem__(self, key):
return self.cget(key)
def __setitem__(self, key, value):
self.configure(**{key: value})
def __del__(self):
try:
if self.delete_font:
self._call("font", "delete", self.name)
except (KeyboardInterrupt, SystemExit):
raise
except Exception:
pass
def copy(self):
"Return a distinct copy of the current font"
return Font(self._tk, **self.actual())
def actual(self, option=None, displayof=None):
"Return actual font attributes"
args = ()
if displayof:
args = ('-displayof', displayof)
if option:
args = args + ('-' + option, )
return self._call("font", "actual", self.name, *args)
else:
return self._mkdict(
self._split(self._call("font", "actual", self.name, *args)))
def cget(self, option):
"Get font attribute"
return self._call("font", "config", self.name, "-"+option)
def config(self, **options):
"Modify font attributes"
if options:
self._call("font", "config", self.name,
*self._set(options))
else:
return self._mkdict(
self._split(self._call("font", "config", self.name)))
configure = config
def measure(self, text, displayof=None):
"Return text width"
args = (text,)
if displayof:
args = ('-displayof', displayof, text)
return int(self._call("font", "measure", self.name, *args))
def metrics(self, *options, **kw):
"""Return font metrics.
For best performance, create a dummy widget
using this font before calling this method."""
args = ()
displayof = kw.pop('displayof', None)
if displayof:
args = ('-displayof', displayof)
if options:
args = args + self._get(options)
return int(
self._call("font", "metrics", self.name, *args))
else:
res = self._split(self._call("font", "metrics", self.name, *args))
options = {}
for i in range(0, len(res), 2):
options[res[i][1:]] = int(res[i+1])
return options
def families(root=None, displayof=None):
"Get font families (as a tuple)"
if not root:
root = tkinter._default_root
args = ()
if displayof:
args = ('-displayof', displayof)
return root.tk.splitlist(root.tk.call("font", "families", *args))
def names(root=None):
"Get names of defined fonts (as a tuple)"
if not root:
root = tkinter._default_root
return root.tk.splitlist(root.tk.call("font", "names"))
# --------------------------------------------------------------------
# test stuff
if __name__ == "__main__":
root = tkinter.Tk()
# create a font
f = Font(family="times", size=30, weight=NORMAL)
print(f.actual())
print(f.actual("family"))
print(f.actual("weight"))
print(f.config())
print(f.cget("family"))
print(f.cget("weight"))
print(names())
print(f.measure("hello"), f.metrics("linespace"))
print(f.metrics(displayof=root))
f = Font(font=("Courier", 20, "bold"))
print(f.measure("hello"), f.metrics("linespace", displayof=root))
w = tkinter.Label(root, text="Hello, world", font=f)
w.pack()
w = tkinter.Button(root, text="Quit!", command=root.destroy)
w.pack()
fb = Font(font=w["font"]).copy()
fb.config(weight=BOLD)
w.config(font=fb)
tkinter.mainloop()
| lgpl-3.0 |
ixc/django-fluent-contents | fluent_contents/plugins/code/migrations/0001_initial.py | 2 | 1042 | # -*- coding: utf-8 -*-
from __future__ import unicode_literals
from django.db import models, migrations
class Migration(migrations.Migration):
dependencies = [
('fluent_contents', '0001_initial'),
]
operations = [
migrations.CreateModel(
name='CodeItem',
fields=[
('contentitem_ptr', models.OneToOneField(parent_link=True, auto_created=True, primary_key=True, serialize=False, to='fluent_contents.ContentItem')),
('language', models.CharField(default=b'html', max_length=50, verbose_name='Language')),
('code', models.TextField(verbose_name='Code')),
('linenumbers', models.BooleanField(default=False, verbose_name='Show line numbers')),
],
options={
'db_table': 'contentitem_code_codeitem',
'verbose_name': 'Code snippet',
'verbose_name_plural': 'Code snippets',
},
bases=('fluent_contents.contentitem',),
),
]
| apache-2.0 |
RobertoMalatesta/shedskin | tests/155.py | 6 | 6975 |
# (c) Peter Cock
# --- http://www2.warwick.ac.uk/fac/sci/moac/currentstudents/peter_cock/python/sudoku/
TRIPLETS = [[0,1,2],[3,4,5],[6,7,8]]
ROW_ITER = [[(row,col) for col in range(0,9)] for row in range(0,9)]
COL_ITER = [[(row,col) for row in range(0,9)] for col in range(0,9)]
TxT_ITER = [[(row,col) for row in rows for col in cols] for rows in TRIPLETS for cols in TRIPLETS]
class soduko:
def __init__(self, start_grid=None) :
self.squares =[ [range(1,10) for col in range(0,9)] for row in range(0,9)]
if start_grid is not None:
assert len(start_grid)==9, "Bad input!"
for row in range(0,9) :
self.set_row(row, start_grid[row])
self._changed=False
def copy(self) :
soduko_copy = soduko(None)
for row in range(0,9) :
for col in range(0,9) :
soduko_copy.squares[row][col] = self.squares[row][col][:]
soduko_copy._changed=False
return soduko_copy
def set_row(self,row, x_list) :
assert len(x_list)==9, 'not 9'
for col in range(0,9) :
try :
x = int(x_list[col])
except :
x = 0
self.set_cell(row,col,x)
def set_cell(self,row,col,x):
if self.squares[row][col] == [x] :
pass
elif x not in range(1,9+1) :
pass
else:
assert x in self.squares[row][col], "bugger2"
self.squares[row][col] = [x]
self.update_neighbours(row,col,x)
self._changed=True
def cell_exclude(self, row,col,x) :
assert x in range(1,9+1), 'inra'
if x in self.squares[row][col] :
self.squares[row][col].remove(x)
assert len(self.squares[row][col]) > 0, "bugger"
if len(self.squares[row][col]) == 1 :
self._changed=True
self.update_neighbours(row,col,self.squares[row][col][0])
else :
pass
return
def update_neighbours(self,set_row,set_col,x) :
for row in range(0,9) :
if row <> set_row :
self.cell_exclude(row,set_col,x)
for col in range(0,9) :
if col <> set_col :
self.cell_exclude(set_row,col,x)
for triplet in TRIPLETS :
if set_row in triplet : rows = triplet[:]
if set_col in triplet : cols = triplet[:]
rows.remove(set_row)
cols.remove(set_col)
for row in rows :
for col in cols :
assert row <> set_row or col <> set_col , 'meuh'
self.cell_exclude(row,col,x)
def get_cell_digit_str(self,row,col) :
if len(self.squares[row][col])==1 :
return str(self.squares[row][col][0])
else :
return "0"
def __str__(self):
answer = " 123 456 789\n"
for row in range(0,9) :
answer = answer + str(row+1) + " [" + "".join([self.get_cell_digit_str(row,col).replace("0","?") for col in range(0,3)]) + "] [" + "".join([self.get_cell_digit_str(row,col).replace("0","?") for col in range(3,6)]) + "] [" + "".join([self.get_cell_digit_str(row,col).replace("0","?") for col in range(6,9)]) + "]\n"
if row+1 in [3,6] :
answer = answer + " --- --- ---\n"
return answer
def check(self) :
self._changed=True
while self._changed:
self._changed=False
self.check_for_single_occurances()
self.check_for_last_in_row_col_3x3()
return
def check_for_single_occurances(self):
for check_type in [ROW_ITER, COL_ITER, TxT_ITER]:
for check_list in check_type :
for x in range(1,9+1) : #1 to 9 inclusive
x_in_list = []
for (row,col) in check_list :
if x in self.squares[row][col] :
x_in_list.append((row,col))
if len(x_in_list)==1 :
(row,col) = x_in_list[0]
if len(self.squares[row][col]) > 1 :
self.set_cell(row,col,x)
def check_for_last_in_row_col_3x3(self):
for (type_name, check_type) in [("Row",ROW_ITER),("Col",COL_ITER),("3x3",TxT_ITER)]:
for check_list in check_type :
unknown_entries = []
unassigned_values = range(1,9+1) #1-9 inclusive
known_values = []
for (row,col) in check_list :
if len(self.squares[row][col]) == 1 :
assert self.squares[row][col][0] not in known_values, "bugger3"
known_values.append(self.squares[row][col][0])
assert self.squares[row][col][0] in unassigned_values, "bugger4"
unassigned_values.remove(self.squares[row][col][0])
else :
unknown_entries.append((row,col))
assert len(unknown_entries) + len(known_values) == 9, 'bugger5'
assert len(unknown_entries) == len(unassigned_values), 'bugger6'
if len(unknown_entries) == 1 :
x = unassigned_values[0]
(row,col) = unknown_entries[0]
self.set_cell(row,col,x)
return
def one_level_supposition(self):
progress=True
while progress :
progress=False
for row in range(0,9) :
for col in range(0,9):
if len(self.squares[row][col]) > 1 :
bad_x = []
for x in self.squares[row][col] :
soduko_copy = self.copy()
try:
soduko_copy.set_cell(row,col,x)
soduko_copy.check()
except AssertionError, e :
bad_x.append(x)
del soduko_copy
if len(bad_x) == 0 :
pass
elif len(bad_x) < len(self.squares[row][col]) :
for x in bad_x :
self.cell_exclude(row,col,x)
self.check()
progress=True
else :
assert False, "bugger7"
for x in range(50):
t = soduko(["800000600",
"040500100",
"070090000",
"030020007",
"600008004",
"500000090",
"000030020",
"001006050",
"004000003"])
t.check()
t.one_level_supposition()
t.check()
print t
| gpl-3.0 |
JordanReiter/django-notification | notification/views.py | 1 | 6596 | from django.core.urlresolvers import reverse
from django.shortcuts import render_to_response, get_object_or_404
from django.http import HttpResponseRedirect, Http404
from django.template import RequestContext
from django.contrib.auth.decorators import login_required
try:
from django.contrib.syndication.views import Feed
except ImportError:
from django.contrib.syndication.views import feed as Feed
from notification.models import *
from notification.decorators import basic_auth_required, simple_basic_auth_callback
from notification.feeds import NoticeUserFeed
@basic_auth_required(realm="Notices Feed", callback_func=simple_basic_auth_callback)
def feed_for_user(request):
"""
An atom feed for all unarchived :model:`notification.Notice`s for a user.
"""
url = "feed/%s" % request.user.username
return Feed(request, url, {
"feed": NoticeUserFeed,
})
@login_required
def notices(request):
"""
The main notices index view.
Template: :template:`notification/notices.html`
Context:
notices
A list of :model:`notification.Notice` objects that are not archived
and to be displayed on the site.
"""
notices = Notice.objects.notices_for(request.user, on_site=True)
return render_to_response("notification/notices.html", {
"notices": notices,
}, context_instance=RequestContext(request))
@login_required
def notice_settings(request):
"""
The notice settings view.
Template: :template:`notification/notice_settings.html`
Context:
notice_types
A list of all :model:`notification.NoticeType` objects.
notice_settings
A dictionary containing ``column_headers`` for each ``NOTICE_MEDIA``
and ``rows`` containing a list of dictionaries: ``notice_type``, a
:model:`notification.NoticeType` object and ``cells``, a list of
tuples whose first value is suitable for use in forms and the second
value is ``True`` or ``False`` depending on a ``request.POST``
variable called ``form_label``, whose valid value is ``on``.
"""
notice_types = NoticeType.objects.all()
settings_table = []
for notice_type in notice_types:
settings_row = []
for medium_id, medium_display in NOTICE_MEDIA:
form_label = "%s_%s" % (notice_type.label, medium_id)
setting = get_notification_setting(request.user, notice_type, medium_id)
if request.method == "POST":
if request.POST.get(form_label) == "on":
if not setting.send:
setting.send = True
setting.save()
else:
if setting.send:
setting.send = False
setting.save()
settings_row.append((form_label, setting.send))
settings_table.append({"notice_type": notice_type, "cells": settings_row})
if request.method == "POST":
next_page = request.POST.get("next_page", ".")
return HttpResponseRedirect(next_page)
notice_settings = {
"column_headers": [medium_display for medium_id, medium_display in NOTICE_MEDIA],
"rows": settings_table,
}
return render_to_response("notification/notice_settings.html", {
"notice_types": notice_types,
"notice_settings": notice_settings,
}, context_instance=RequestContext(request))
@login_required
def single(request, id, mark_seen=True):
"""
Detail view for a single :model:`notification.Notice`.
Template: :template:`notification/single.html`
Context:
notice
The :model:`notification.Notice` being viewed
Optional arguments:
mark_seen
If ``True``, mark the notice as seen if it isn't
already. Do nothing if ``False``. Default: ``True``.
"""
notice = get_object_or_404(Notice, id=id)
if request.user == notice.recipient:
if mark_seen and notice.unseen:
notice.unseen = False
notice.save()
return render_to_response("notification/single.html", {
"notice": notice,
}, context_instance=RequestContext(request))
raise Http404
@login_required
def archive(request, noticeid=None, next_page=None):
"""
Archive a :model:`notices.Notice` if the requesting user is the
recipient or if the user is a superuser. Returns a
``HttpResponseRedirect`` when complete.
Optional arguments:
noticeid
The ID of the :model:`notices.Notice` to be archived.
next_page
The page to redirect to when done.
"""
if noticeid:
try:
notice = Notice.objects.get(id=noticeid)
if request.user == notice.recipient or request.user.is_superuser:
notice.archive()
else: # you can archive other users' notices
# only if you are superuser.
return HttpResponseRedirect(next_page)
except Notice.DoesNotExist:
return HttpResponseRedirect(next_page)
return HttpResponseRedirect(next_page)
@login_required
def delete(request, noticeid=None, next_page=None):
"""
Delete a :model:`notices.Notice` if the requesting user is the recipient
or if the user is a superuser. Returns a ``HttpResponseRedirect`` when
complete.
Optional arguments:
noticeid
The ID of the :model:`notices.Notice` to be archived.
next_page
The page to redirect to when done.
"""
if noticeid:
try:
notice = Notice.objects.get(id=noticeid)
if request.user == notice.recipient or request.user.is_superuser:
notice.delete()
else: # you can delete other users' notices
# only if you are superuser.
return HttpResponseRedirect(next_page)
except Notice.DoesNotExist:
return HttpResponseRedirect(next_page)
return HttpResponseRedirect(next_page)
@login_required
def mark_all_seen(request):
"""
Mark all unseen notices for the requesting user as seen. Returns a
``HttpResponseRedirect`` when complete.
"""
for notice in Notice.objects.notices_for(request.user, unseen=True):
notice.unseen = False
notice.save()
return HttpResponseRedirect(reverse("notification_notices"))
| mit |
matthiasdiener/spack | var/spack/repos/builtin/packages/r-tseries/package.py | 5 | 1765 | ##############################################################################
# Copyright (c) 2013-2018, Lawrence Livermore National Security, LLC.
# Produced at the Lawrence Livermore National Laboratory.
#
# This file is part of Spack.
# Created by Todd Gamblin, [email protected], All rights reserved.
# LLNL-CODE-647188
#
# For details, see https://github.com/spack/spack
# Please also see the NOTICE and LICENSE files for our notice and the LGPL.
#
# This program is free software; you can redistribute it and/or modify
# it under the terms of the GNU Lesser General Public License (as
# published by the Free Software Foundation) version 2.1, February 1999.
#
# This program is distributed in the hope that it will be useful, but
# WITHOUT ANY WARRANTY; without even the IMPLIED WARRANTY OF
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the terms and
# conditions of the GNU Lesser General Public License for more details.
#
# You should have received a copy of the GNU Lesser General Public
# License along with this program; if not, write to the Free Software
# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
##############################################################################
from spack import *
class RTseries(RPackage):
"""Time series analysis and computational finance."""
homepage = "https://cran.r-project.org/package=tseries"
url = "https://cran.r-project.org/src/contrib/tseries_0.10-42.tar.gz"
list_url = "https://cran.r-project.org/src/contrib/Archive/tseries"
version('0.10-42', '3feaa5c463bc967d749323163d9bc836')
depends_on('r-quadprog', type=('build', 'run'))
depends_on('r-zoo', type=('build', 'run'))
depends_on('r-quantmod', type=('build', 'run'))
| lgpl-2.1 |
ErickMurillo/ciat_plataforma | ficha_granos_basicos/migrations/0006_auto__del_datosparcela__del_field_monitoreo_fecha_monitoreo__add_field.py | 3 | 36192 | # -*- coding: utf-8 -*-
from south.utils import datetime_utils as datetime
from south.db import db
from south.v2 import SchemaMigration
from django.db import models
class Migration(SchemaMigration):
def forwards(self, orm):
# Deleting model 'DatosParcela'
db.delete_table(u'ficha_granos_basicos_datosparcela')
# Deleting field 'Monitoreo.fecha_monitoreo'
db.delete_column(u'ficha_granos_basicos_monitoreo', 'fecha_monitoreo')
# Adding field 'Monitoreo.cultivo'
db.add_column(u'ficha_granos_basicos_monitoreo', 'cultivo',
self.gf('django.db.models.fields.IntegerField')(null=True, blank=True),
keep_default=False)
def backwards(self, orm):
# Adding model 'DatosParcela'
db.create_table(u'ficha_granos_basicos_datosparcela', (
('latitud', self.gf('django.db.models.fields.FloatField')(null=True, blank=True)),
('percepcion_fertilidad', self.gf('django.db.models.fields.IntegerField')()),
('distancia', self.gf('django.db.models.fields.FloatField')(null=True, blank=True)),
('edad_parcela', self.gf('django.db.models.fields.FloatField')()),
('profundidad_capa', self.gf('django.db.models.fields.FloatField')()),
(u'id', self.gf('django.db.models.fields.AutoField')(primary_key=True)),
('fuente_agua', self.gf('multiselectfield.db.fields.MultiSelectField')(max_length=7, null=True, blank=True)),
('longitud', self.gf('django.db.models.fields.FloatField')(null=True, blank=True)),
('acceso_agua', self.gf('django.db.models.fields.IntegerField')()),
('monitoreo', self.gf('django.db.models.fields.related.ForeignKey')(to=orm['ficha_granos_basicos.Monitoreo'])),
('direccion_viento', self.gf('django.db.models.fields.IntegerField')()),
('nombre', self.gf('django.db.models.fields.CharField')(max_length=100)),
('tamano_parcela', self.gf('django.db.models.fields.FloatField')()),
))
db.send_create_signal(u'ficha_granos_basicos', ['DatosParcela'])
# Adding field 'Monitoreo.fecha_monitoreo'
db.add_column(u'ficha_granos_basicos_monitoreo', 'fecha_monitoreo',
self.gf('django.db.models.fields.DateField')(null=True, blank=True),
keep_default=False)
# Deleting field 'Monitoreo.cultivo'
db.delete_column(u'ficha_granos_basicos_monitoreo', 'cultivo')
models = {
u'ficha_granos_basicos.curadosemilla': {
'Meta': {'object_name': 'CuradoSemilla'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'tratamiento': ('django.db.models.fields.related.ManyToManyField', [], {'to': u"orm['ficha_granos_basicos.TratamientoSemilla']", 'symmetrical': 'False'}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.datosmonitoreo': {
'Meta': {'object_name': 'DatosMonitoreo'},
'area_siembra': ('django.db.models.fields.FloatField', [], {}),
'cultivo': ('django.db.models.fields.IntegerField', [], {}),
'fecha_cosecha': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}),
'fecha_siembra': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'monitoreo': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Monitoreo']"})
},
u'ficha_granos_basicos.distribucionpendiente': {
'Meta': {'object_name': 'DistribucionPendiente'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'inclinado': ('django.db.models.fields.FloatField', [], {}),
'monitoreo': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Monitoreo']"}),
'plano': ('django.db.models.fields.FloatField', [], {}),
'seleccion': ('django.db.models.fields.IntegerField', [], {})
},
u'ficha_granos_basicos.enfermedadesfrijol': {
'Meta': {'object_name': 'EnfermedadesFrijol'},
'enfermedad': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Especies']"}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'planta_1': ('django.db.models.fields.IntegerField', [], {}),
'planta_2': ('django.db.models.fields.IntegerField', [], {}),
'planta_3': ('django.db.models.fields.IntegerField', [], {}),
'planta_4': ('django.db.models.fields.IntegerField', [], {}),
'planta_5': ('django.db.models.fields.IntegerField', [], {}),
'promedio': ('django.db.models.fields.FloatField', [], {}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.enfermedadesmaiz': {
'Meta': {'object_name': 'EnfermedadesMaiz'},
'enfermedad': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Especies']"}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'planta_1': ('django.db.models.fields.IntegerField', [], {}),
'planta_2': ('django.db.models.fields.IntegerField', [], {}),
'planta_3': ('django.db.models.fields.IntegerField', [], {}),
'planta_4': ('django.db.models.fields.IntegerField', [], {}),
'planta_5': ('django.db.models.fields.IntegerField', [], {}),
'promedio': ('django.db.models.fields.FloatField', [], {}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.especies': {
'Meta': {'object_name': 'Especies'},
'control_biologico': ('ckeditor.fields.RichTextField', [], {'null': 'True', 'blank': 'True'}),
'control_cultural': ('ckeditor.fields.RichTextField', [], {'null': 'True', 'blank': 'True'}),
'control_quimico': ('ckeditor.fields.RichTextField', [], {'null': 'True', 'blank': 'True'}),
'dano1': ('ckeditor.fields.RichTextField', [], {'null': 'True', 'blank': 'True'}),
'descripcion': ('django.db.models.fields.CharField', [], {'max_length': '150', 'null': 'True', 'blank': 'True'}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'nombre_cientifico': ('django.db.models.fields.CharField', [], {'max_length': '100', 'null': 'True', 'blank': 'True'}),
'nombre_popular': ('django.db.models.fields.CharField', [], {'max_length': '100'}),
'rango_max': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'}),
'rango_min': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'}),
'reconocimiento': ('ckeditor.fields.RichTextField', [], {'null': 'True', 'blank': 'True'}),
'rubro': ('django.db.models.fields.IntegerField', [], {}),
'tipo': ('django.db.models.fields.IntegerField', [], {}),
'umbral': ('django.db.models.fields.IntegerField', [], {})
},
u'ficha_granos_basicos.estimadocosechafrijol': {
'Meta': {'object_name': 'EstimadoCosechaFrijol'},
'estacion': ('django.db.models.fields.IntegerField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'planta_1': ('django.db.models.fields.IntegerField', [], {}),
'planta_2': ('django.db.models.fields.IntegerField', [], {}),
'planta_3': ('django.db.models.fields.IntegerField', [], {}),
'planta_4': ('django.db.models.fields.IntegerField', [], {}),
'planta_5': ('django.db.models.fields.IntegerField', [], {}),
'promedio': ('django.db.models.fields.FloatField', [], {}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.estimadocosechamaiz': {
'Meta': {'object_name': 'EstimadoCosechaMaiz'},
'estacion_1': ('django.db.models.fields.IntegerField', [], {}),
'estacion_2': ('django.db.models.fields.IntegerField', [], {}),
'estacion_3': ('django.db.models.fields.IntegerField', [], {}),
'estacion_4': ('django.db.models.fields.IntegerField', [], {}),
'estacion_5': ('django.db.models.fields.IntegerField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'mazorca': ('django.db.models.fields.IntegerField', [], {}),
'promedio': ('django.db.models.fields.FloatField', [], {}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.estimadocosechamaiz2': {
'Meta': {'object_name': 'EstimadoCosechaMaiz2'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'mazorca': ('django.db.models.fields.IntegerField', [], {}),
'peso': ('django.db.models.fields.FloatField', [], {}),
'peso_promedio': ('django.db.models.fields.IntegerField', [], {}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.fotosespecies': {
'Meta': {'object_name': 'FotosEspecies'},
'especie': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Especies']"}),
'foto': (u'sorl.thumbnail.fields.ImageField', [], {'max_length': '100'}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'})
},
u'ficha_granos_basicos.gastos': {
'Meta': {'object_name': 'Gastos'},
'fecha_siembra': ('django.db.models.fields.DateField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'productor': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Monitoreo']"}),
'rubro': ('django.db.models.fields.IntegerField', [], {})
},
u'ficha_granos_basicos.granosplanta': {
'Meta': {'object_name': 'GranosPlanta'},
'cantidad': ('django.db.models.fields.FloatField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.historialrendimiento': {
'Meta': {'object_name': 'HistorialRendimiento'},
'anio': ('django.db.models.fields.IntegerField', [], {}),
'ciclo_productivo': ('django.db.models.fields.IntegerField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'monitoreo': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Monitoreo']"}),
'rendimiento': ('django.db.models.fields.FloatField', [], {}),
'rubro': ('django.db.models.fields.IntegerField', [], {})
},
u'ficha_granos_basicos.insumos': {
'Meta': {'object_name': 'Insumos'},
'fecha_siembra': ('django.db.models.fields.DateField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'productor': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Monitoreo']"}),
'rubro': ('django.db.models.fields.IntegerField', [], {})
},
u'ficha_granos_basicos.liga_nested': {
'Meta': {'object_name': 'Liga_Nested'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'producto': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Productos']"}),
'tabla_insumos': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.TablaInsumos']"}),
'unidades': ('django.db.models.fields.FloatField', [], {})
},
u'ficha_granos_basicos.macrofauna': {
'Meta': {'object_name': 'Macrofauna'},
'especie': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Especies']"}),
'est1': ('django.db.models.fields.IntegerField', [], {}),
'est2': ('django.db.models.fields.IntegerField', [], {}),
'est3': ('django.db.models.fields.IntegerField', [], {}),
'est4': ('django.db.models.fields.IntegerField', [], {}),
'est5': ('django.db.models.fields.IntegerField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'promedio': ('django.db.models.fields.FloatField', [], {}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.monitoreo': {
'Meta': {'object_name': 'Monitoreo'},
'acceso_agua': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}),
'anio': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}),
'ciclo_productivo': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}),
'cultivo': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}),
'direccion_viento': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}),
'distancia': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'}),
'edad_parcela': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'}),
'fuente_agua': ('multiselectfield.db.fields.MultiSelectField', [], {'max_length': '7', 'null': 'True', 'blank': 'True'}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'latitud': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'}),
'longitud': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'}),
'nombre_parcela': ('django.db.models.fields.CharField', [], {'max_length': '100', 'null': 'True', 'blank': 'True'}),
'percepcion_fertilidad': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}),
'productor': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['mapeo.Persona']"}),
'profundidad_capa': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'}),
'tamano_parcela': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'})
},
u'ficha_granos_basicos.monitoreomalezas': {
'Meta': {'object_name': 'MonitoreoMalezas'},
'ciperaceas': ('django.db.models.fields.FloatField', [], {}),
'cobertura': ('django.db.models.fields.IntegerField', [], {}),
'cobertura_total': ('django.db.models.fields.FloatField', [], {}),
'gramineas': ('django.db.models.fields.FloatField', [], {}),
'hoja_ancha': ('django.db.models.fields.FloatField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.parametrossuelo': {
'Meta': {'object_name': 'ParametrosSuelo'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'nivel_critico': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'}),
'nivel_suficiencia': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'}),
'parametro': ('django.db.models.fields.CharField', [], {'max_length': '100'}),
'unidad': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'})
},
u'ficha_granos_basicos.plagasfrijol': {
'Meta': {'object_name': 'PlagasFrijol'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'plaga': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Especies']"}),
'porcentaje_dano_1': ('django.db.models.fields.FloatField', [], {}),
'porcentaje_dano_2': ('django.db.models.fields.FloatField', [], {}),
'porcentaje_dano_3': ('django.db.models.fields.FloatField', [], {}),
'porcentaje_dano_4': ('django.db.models.fields.FloatField', [], {}),
'porcentaje_dano_5': ('django.db.models.fields.FloatField', [], {}),
'presencia_1': ('django.db.models.fields.FloatField', [], {}),
'presencia_2': ('django.db.models.fields.FloatField', [], {}),
'presencia_3': ('django.db.models.fields.FloatField', [], {}),
'presencia_4': ('django.db.models.fields.FloatField', [], {}),
'presencia_5': ('django.db.models.fields.FloatField', [], {}),
'promedio_dano': ('django.db.models.fields.FloatField', [], {}),
'promedio_presencia': ('django.db.models.fields.FloatField', [], {}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.plagasmaiz': {
'Meta': {'object_name': 'PlagasMaiz'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'plaga': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Especies']"}),
'porcentaje_dano_1': ('django.db.models.fields.FloatField', [], {}),
'porcentaje_dano_2': ('django.db.models.fields.FloatField', [], {}),
'porcentaje_dano_3': ('django.db.models.fields.FloatField', [], {}),
'porcentaje_dano_4': ('django.db.models.fields.FloatField', [], {}),
'porcentaje_dano_5': ('django.db.models.fields.FloatField', [], {}),
'presencia_1': ('django.db.models.fields.FloatField', [], {}),
'presencia_2': ('django.db.models.fields.FloatField', [], {}),
'presencia_3': ('django.db.models.fields.FloatField', [], {}),
'presencia_4': ('django.db.models.fields.FloatField', [], {}),
'presencia_5': ('django.db.models.fields.FloatField', [], {}),
'promedio_dano': ('django.db.models.fields.FloatField', [], {}),
'promedio_presencia': ('django.db.models.fields.FloatField', [], {}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.poblacionfrijol': {
'Meta': {'object_name': 'PoblacionFrijol'},
'distancia_frijol': ('django.db.models.fields.FloatField', [], {}),
'est1': ('django.db.models.fields.IntegerField', [], {}),
'est2': ('django.db.models.fields.IntegerField', [], {}),
'est3': ('django.db.models.fields.IntegerField', [], {}),
'est4': ('django.db.models.fields.IntegerField', [], {}),
'est5': ('django.db.models.fields.IntegerField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'metros_lineales': ('django.db.models.fields.FloatField', [], {}),
'numero_surcos': ('django.db.models.fields.FloatField', [], {}),
'poblacion': ('django.db.models.fields.FloatField', [], {}),
'promedio': ('django.db.models.fields.FloatField', [], {}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.poblacionmaiz': {
'Meta': {'object_name': 'PoblacionMaiz'},
'distancia_maiz': ('django.db.models.fields.FloatField', [], {}),
'est1': ('django.db.models.fields.IntegerField', [], {}),
'est2': ('django.db.models.fields.IntegerField', [], {}),
'est3': ('django.db.models.fields.IntegerField', [], {}),
'est4': ('django.db.models.fields.IntegerField', [], {}),
'est5': ('django.db.models.fields.IntegerField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'metros_lineales': ('django.db.models.fields.FloatField', [], {}),
'numero_surcos': ('django.db.models.fields.FloatField', [], {}),
'poblacion': ('django.db.models.fields.FloatField', [], {}),
'promedio': ('django.db.models.fields.FloatField', [], {}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.procedenciasemilla': {
'Meta': {'object_name': 'ProcedenciaSemilla'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'procedencia': ('django.db.models.fields.IntegerField', [], {}),
'rubro': ('django.db.models.fields.IntegerField', [], {}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.productos': {
'Meta': {'object_name': 'Productos'},
'categoria': ('django.db.models.fields.IntegerField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'nombre_comercial': ('django.db.models.fields.CharField', [], {'max_length': '100'}),
'presentacion': ('django.db.models.fields.IntegerField', [], {}),
'principio_activo': ('django.db.models.fields.CharField', [], {'max_length': '100'})
},
u'ficha_granos_basicos.pruebagerminacion': {
'Meta': {'object_name': 'PruebaGerminacion'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'porcentaje': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'}),
'respuesta': ('django.db.models.fields.IntegerField', [], {}),
'rubro': ('django.db.models.fields.IntegerField', [], {}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.recursossiembra': {
'Meta': {'object_name': 'RecursosSiembra'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'monitoreo': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Monitoreo']"}),
'respuesta': ('django.db.models.fields.IntegerField', [], {}),
'rubro': ('django.db.models.fields.IntegerField', [], {})
},
u'ficha_granos_basicos.semillas': {
'Meta': {'object_name': 'Semillas'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'nombre_semilla': ('django.db.models.fields.CharField', [], {'max_length': '100'}),
'rubro': ('django.db.models.fields.IntegerField', [], {}),
'tipo_semilla': ('django.db.models.fields.IntegerField', [], {}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.sobrecosecha': {
'Meta': {'object_name': 'SobreCosecha'},
'almacenamiento': ('django.db.models.fields.FloatField', [], {}),
'cosecha': ('django.db.models.fields.FloatField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'precio_mercado': ('django.db.models.fields.FloatField', [], {}),
'rubro': ('django.db.models.fields.IntegerField', [], {}),
'venta': ('django.db.models.fields.FloatField', [], {}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.suelo': {
'Meta': {'object_name': 'Suelo'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'parametro': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.ParametrosSuelo']"}),
'resultado': ('django.db.models.fields.FloatField', [], {}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.tabladecisiones': {
'Meta': {'object_name': 'TablaDecisiones'},
'area': ('django.db.models.fields.IntegerField', [], {}),
'decision': ('django.db.models.fields.TextField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'porque': ('django.db.models.fields.TextField', [], {}),
'seleccion': ('django.db.models.fields.IntegerField', [], {}),
'toma_deciciones': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.TomaDecisiones']"}),
'visita': ('django.db.models.fields.IntegerField', [], {})
},
u'ficha_granos_basicos.tablagastos': {
'Meta': {'object_name': 'TablaGastos'},
'actividad': ('django.db.models.fields.IntegerField', [], {}),
'descripcion': ('django.db.models.fields.TextField', [], {}),
'dias_persona': ('django.db.models.fields.IntegerField', [], {}),
'fecha': ('django.db.models.fields.DateField', [], {}),
'gastos': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Gastos']"}),
'hombres': ('django.db.models.fields.IntegerField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'mujeres': ('django.db.models.fields.IntegerField', [], {}),
'valor': ('django.db.models.fields.IntegerField', [], {})
},
u'ficha_granos_basicos.tablainsumos': {
'Meta': {'object_name': 'TablaInsumos'},
'bombas': ('django.db.models.fields.FloatField', [], {}),
'fecha': ('django.db.models.fields.DateField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'insumos': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Insumos']"}),
'producto': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Productos']"}),
'unidades': ('django.db.models.fields.FloatField', [], {})
},
u'ficha_granos_basicos.tablamalezas': {
'Meta': {'object_name': 'TablaMalezas'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'maleza': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.TiposMalezas']"}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.tiposmalezas': {
'Meta': {'object_name': 'TiposMalezas'},
'categoria': ('django.db.models.fields.IntegerField', [], {}),
'ciclo': ('django.db.models.fields.IntegerField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'nombre_cientifico': ('django.db.models.fields.CharField', [], {'max_length': '100', 'null': 'True', 'blank': 'True'}),
'nombre_popular': ('django.db.models.fields.CharField', [], {'max_length': '100'})
},
u'ficha_granos_basicos.tomadecisiones': {
'Meta': {'object_name': 'TomaDecisiones'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'productor': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Monitoreo']"})
},
u'ficha_granos_basicos.tratamientosemilla': {
'Meta': {'object_name': 'TratamientoSemilla'},
'dosis': ('django.db.models.fields.CharField', [], {'max_length': '150'}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'nombre': ('django.db.models.fields.CharField', [], {'max_length': '100'}),
'preparacion': ('django.db.models.fields.TextField', [], {'blank': 'True'})
},
u'ficha_granos_basicos.vigorfrijol': {
'Meta': {'object_name': 'VigorFrijol'},
'est1': ('django.db.models.fields.IntegerField', [], {}),
'est2': ('django.db.models.fields.IntegerField', [], {}),
'est3': ('django.db.models.fields.IntegerField', [], {}),
'est4': ('django.db.models.fields.IntegerField', [], {}),
'est5': ('django.db.models.fields.IntegerField', [], {}),
'estimado_plantas': ('django.db.models.fields.FloatField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'plantas': ('django.db.models.fields.IntegerField', [], {}),
'porcentaje': ('django.db.models.fields.FloatField', [], {}),
'promedio': ('django.db.models.fields.FloatField', [], {}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.vigormaiz': {
'Meta': {'object_name': 'VigorMaiz'},
'est1': ('django.db.models.fields.IntegerField', [], {}),
'est2': ('django.db.models.fields.IntegerField', [], {}),
'est3': ('django.db.models.fields.IntegerField', [], {}),
'est4': ('django.db.models.fields.IntegerField', [], {}),
'est5': ('django.db.models.fields.IntegerField', [], {}),
'estimado_plantas': ('django.db.models.fields.FloatField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'plantas': ('django.db.models.fields.IntegerField', [], {}),
'porcentaje': ('django.db.models.fields.FloatField', [], {}),
'promedio': ('django.db.models.fields.FloatField', [], {}),
'visita': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Visitas']"})
},
u'ficha_granos_basicos.visitas': {
'Meta': {'object_name': 'Visitas'},
'anio': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}),
'areas': ('multiselectfield.db.fields.MultiSelectField', [], {'max_length': '17'}),
'fecha': ('django.db.models.fields.DateField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'productor': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['ficha_granos_basicos.Monitoreo']"}),
'visita': ('django.db.models.fields.IntegerField', [], {})
},
u'lugar.comunidad': {
'Meta': {'ordering': "['nombre']", 'object_name': 'Comunidad'},
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'latitud': ('django.db.models.fields.DecimalField', [], {'null': 'True', 'max_digits': '8', 'decimal_places': '5', 'blank': 'True'}),
'longitud': ('django.db.models.fields.DecimalField', [], {'null': 'True', 'max_digits': '8', 'decimal_places': '5', 'blank': 'True'}),
'municipio': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['lugar.Municipio']"}),
'nombre': ('django.db.models.fields.CharField', [], {'max_length': '40'})
},
u'lugar.departamento': {
'Meta': {'ordering': "['nombre']", 'object_name': 'Departamento'},
'extension': ('django.db.models.fields.DecimalField', [], {'null': 'True', 'max_digits': '10', 'decimal_places': '2', 'blank': 'True'}),
'id': ('django.db.models.fields.IntegerField', [], {'primary_key': 'True'}),
'latitud': ('django.db.models.fields.DecimalField', [], {'null': 'True', 'max_digits': '8', 'decimal_places': '5', 'blank': 'True'}),
'longitud': ('django.db.models.fields.DecimalField', [], {'null': 'True', 'max_digits': '8', 'decimal_places': '5', 'blank': 'True'}),
'nombre': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '30'}),
'pais': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['lugar.Pais']"}),
'slug': ('django.db.models.fields.SlugField', [], {'max_length': '50', 'unique': 'True', 'null': 'True'})
},
u'lugar.municipio': {
'Meta': {'ordering': "['departamento__nombre', 'nombre']", 'object_name': 'Municipio'},
'departamento': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['lugar.Departamento']"}),
'extension': ('django.db.models.fields.DecimalField', [], {'null': 'True', 'max_digits': '10', 'decimal_places': '2', 'blank': 'True'}),
'id': ('django.db.models.fields.IntegerField', [], {'primary_key': 'True'}),
'latitud': ('django.db.models.fields.DecimalField', [], {'null': 'True', 'max_digits': '8', 'decimal_places': '5', 'blank': 'True'}),
'longitud': ('django.db.models.fields.DecimalField', [], {'null': 'True', 'max_digits': '8', 'decimal_places': '5', 'blank': 'True'}),
'nombre': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '30'}),
'slug': ('django.db.models.fields.SlugField', [], {'max_length': '50', 'unique': 'True', 'null': 'True'})
},
u'lugar.pais': {
'Meta': {'object_name': 'Pais'},
'codigo': ('django.db.models.fields.CharField', [], {'max_length': '2'}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'nombre': ('django.db.models.fields.CharField', [], {'max_length': '200'})
},
u'mapeo.persona': {
'Meta': {'object_name': 'Persona'},
'cedula': ('django.db.models.fields.CharField', [], {'max_length': '200', 'null': 'True', 'blank': 'True'}),
'comunidad': ('smart_selects.db_fields.ChainedForeignKey', [], {'to': u"orm['lugar.Comunidad']"}),
'departamento': ('smart_selects.db_fields.ChainedForeignKey', [], {'to': u"orm['lugar.Departamento']"}),
'edad': ('django.db.models.fields.IntegerField', [], {}),
u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'municipio': ('smart_selects.db_fields.ChainedForeignKey', [], {'to': u"orm['lugar.Municipio']"}),
'nombre': ('django.db.models.fields.CharField', [], {'max_length': '200'}),
'pais': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['lugar.Pais']"}),
'sexo': ('django.db.models.fields.IntegerField', [], {}),
'tipo_persona': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'})
}
}
complete_apps = ['ficha_granos_basicos'] | mit |
yjydmlh/zerorpc-python | zerorpc/socket.py | 134 | 1737 | # -*- coding: utf-8 -*-
# Open Source Initiative OSI - The MIT License (MIT):Licensing
#
# The MIT License (MIT)
# Copyright (c) 2012 DotCloud Inc ([email protected])
#
# Permission is hereby granted, free of charge, to any person obtaining a copy of
# this software and associated documentation files (the "Software"), to deal in
# the Software without restriction, including without limitation the rights to
# use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
# of the Software, and to permit persons to whom the Software is furnished to do
# so, subject to the following conditions:
#
# The above copyright notice and this permission notice shall be included in all
# copies or substantial portions of the Software.
#
# THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
# IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
# FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
# AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
# LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
# OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
# SOFTWARE.
from .context import Context
from .events import Events
class SocketBase(object):
def __init__(self, zmq_socket_type, context=None):
self._context = context or Context.get_instance()
self._events = Events(zmq_socket_type, context)
def close(self):
self._events.close()
def connect(self, endpoint, resolve=True):
return self._events.connect(endpoint, resolve)
def bind(self, endpoint, resolve=True):
return self._events.bind(endpoint, resolve)
| mit |
alexwaters/python-readability-api | readability/models.py | 1 | 5472 | # -*- coding: utf-8 -*-
"""
readability.models
~~~~~~~~~~~~~~~~~~
This module provides the core Readability API models.
"""
from .helpers import to_python, to_api
class BaseResource(object):
"""A Base BaseResource object."""
def __init__(self):
super(BaseResource, self).__init__()
self._rdd = None
def __dir__(self):
d = self.__dict__.copy()
try:
del d['_rdd']
except KeyError:
pass
return d.keys()
class Bookmark(BaseResource):
"""Bookmark API Model."""
def __init__(self):
self.id = None
self.user_id = None
self.read_percent = None
self.date_updated = None
self.favorite = None
self.archive = None
self.date_archived = None
self.date_opened = None
self.date_added = None
self.article = None
def __repr__(self):
return '<bookmark id="%s" favorite="%s" archive="%s" read_percent="%s">' % (self.id, self.favorite, self.archive, self.read_percent)
@staticmethod
def new_from_dict(d, rdd=None):
b = to_python(
obj=Bookmark(), in_dict=d,
string_keys = (
'id', 'user_id', 'read_percent', 'favorite', 'archive',
'author',
),
date_keys = ('date_updated', 'date_archived', 'date_opened', 'date_added'),
object_map = {'article': Article},
_rdd = rdd
)
return b
def delete(self):
"""Deletes Bookmark."""
return self._rdd._delete_resource(('bookmarks', self.id))
def update(self):
"""Updates Bookmark."""
args = to_api(
dict(
favorite=self.favorite,
archive=self.archive,
read_percent=self.read_percent,
),
int_keys=('favorite', 'archive')
)
r = self._rdd._post_resource(('bookmarks', self.id), **args)
return r
class Article(BaseResource):
def __init__(self):
self.id = None
self.domain = None
self.title = None
self.url = None
self.short_url = None
self.author = None
self.word_count = None
self.content = None
self.excerpt = None
self.date_published = None
self.next_page_href = None
self.processed = None
self.content_size = None
def __repr__(self):
return '<article id="%s">' % (self.id,)
@staticmethod
def new_from_dict(d, rdd=None):
return to_python(
obj=Article(), in_dict=d,
string_keys = (
'id', 'domain', 'title', 'url', 'short_url', 'author',
'word_count', 'content', 'excerpt', 'next_page_href',
'processed', 'content_size',
),
date_keys = ('date_published',),
_rdd = rdd
)
class Domain(BaseResource):
def __init__(self):
super(Domain, self).__init__()
self.fqdn = None
self.articles_ref = None
def __repr__(self):
return '<domain fqdn="%s">' % (self.fqdn,)
@staticmethod
def new_from_dict(d, rdd=None):
return to_python(
obj=Domain(), in_dict=d,
string_keys = ('fqdn', 'articles_ref'),
_rdd = rdd
)
def articles(self, **filters):
"""Returns Article list, filtered by Domain."""
return self._rdd.get_articles(domain=self.fqdn, **filters)
def contributions(self, **filters):
"""Returns Article list, filtered by Domain."""
return self._rdd.get_contributions(domain=self.fqdn, **filters)
class Contribution(BaseResource):
def __init__(self):
super(Contribution, self).__init__()
self.date = None
self.contribution = None
self.user = None
self.domain = None
self.num_bookmarks = None
def __repr__(self):
return '<contribution domain="%s">' % (self.domain,)
@staticmethod
def new_from_dict(d, rdd=None):
return to_python(
obj=Contribution(), in_dict=d,
string_keys = ('contribution', 'user', 'domain', 'num_bookmarks'),
date_keys = ('date'),
_rdd = rdd
)
class User(BaseResource):
"""User API Model."""
def __init__(self):
self.username = None
self.first_name = None
self.last_name = None
self.date_joined = None
def __repr__(self):
return '<user name="%s">' % (self.username,)
@staticmethod
def new_from_dict(d, rdd=None):
return to_python(
obj=User(), in_dict=d,
string_keys = ('username', 'first_name'),
date_keys = ('date_joined',),
_rdd=rdd
)
def bookmarks(self, **filters):
"""Returns Bookmark list, filtered by User."""
if self.username == self._rdd.username:
return self._rdd.get_bookmarks(user=self.username, **filters)
else:
return self._rdd.get_bookmarks_by_user(self.username, **filters)
def contributions(self, **filters):
"""Returns Contributions list, filtered by User."""
if self.username == self._rdd.username:
return self._rdd.get_contributions(user=self.username, **filters)
else:
return self._rdd.get_contributions_by_user(self.username, **filters)
| mit |
charlesccychen/incubator-beam | sdks/python/apache_beam/examples/complete/autocomplete_test.py | 5 | 2520 | #
# Licensed to the Apache Software Foundation (ASF) under one or more
# contributor license agreements. See the NOTICE file distributed with
# this work for additional information regarding copyright ownership.
# The ASF licenses this file to You under the Apache License, Version 2.0
# (the "License"); you may not use this file except in compliance with
# the License. You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
#
"""Test for the autocomplete example."""
from __future__ import absolute_import
import unittest
from nose.plugins.attrib import attr
import apache_beam as beam
from apache_beam.examples.complete import autocomplete
from apache_beam.testing.test_pipeline import TestPipeline
from apache_beam.testing.util import assert_that
from apache_beam.testing.util import equal_to
class AutocompleteTest(unittest.TestCase):
WORDS = ['this', 'this', 'that', 'to', 'to', 'to']
KINGLEAR_HASH_SUM = 3104188901048578415956
KINGLEAR_INPUT = 'gs://dataflow-samples/shakespeare/kinglear.txt'
def test_top_prefixes(self):
with TestPipeline() as p:
words = p | beam.Create(self.WORDS)
result = words | autocomplete.TopPerPrefix(5)
# values must be hashable for now
result = result | beam.Map(lambda k_vs: (k_vs[0], tuple(k_vs[1])))
assert_that(result, equal_to(
[
('t', ((3, 'to'), (2, 'this'), (1, 'that'))),
('to', ((3, 'to'), )),
('th', ((2, 'this'), (1, 'that'))),
('thi', ((2, 'this'), )),
('this', ((2, 'this'), )),
('tha', ((1, 'that'), )),
('that', ((1, 'that'), )),
]))
@attr('IT')
def test_autocomplete_it(self):
with TestPipeline(is_integration_test=True) as p:
words = p | beam.io.ReadFromText(self.KINGLEAR_INPUT)
result = words | autocomplete.TopPerPrefix(10)
# values must be hashable for now
result = result | beam.Map(lambda k_vs: (k_vs[0], tuple(k_vs[1])))
checksum = result | beam.Map(hash) | beam.CombineGlobally(sum)
assert_that(checksum, equal_to([self.KINGLEAR_HASH_SUM]))
if __name__ == '__main__':
unittest.main()
| apache-2.0 |
Wikidata/StrepHit | tests/test_classification.py | 1 | 4013 | # -*- encoding: utf-8 -*-
import unittest
from treetaggerwrapper import Tag
from strephit.classification import feature_extractors
class TestFactExtractorFeatureExtractor(unittest.TestCase):
def setUp(self):
self.gazetteer = {
'sentence': ['feature1', 'feature2']
}
self.sentences_data = [
{
'sentence': u'This is the first sentence',
'fes': {
'Subject': u'this',
'Missing': u'this is not',
'Object': u'first sentence',
},
},
{
'sentence': u'This is the second sentence',
'fes': {},
}
]
def test_sorted_set(self):
s = feature_extractors.SortedSet()
for i in xrange(5):
index = s.put(i)
self.assertEqual(index, i)
for i in xrange(5):
index = s.index(i)
self.assertEqual(index, i)
def test_sentence_to_tokens(self):
extractor = feature_extractors.FactExtractorFeatureExtractor('en')
tokens = extractor.sentence_to_tokens(**self.sentences_data[0])
self.assertEqual(tokens, [[u'this', u'DT', u'this', u'Subject'],
Tag(word=u'is', pos=u'VBZ', lemma=u'be'),
Tag(word=u'the', pos=u'DT', lemma=u'the'),
[u'first sentence', 'ENT', u'first sentence', u'Object']])
def test_feature_for(self):
extractor = feature_extractors.FactExtractorFeatureExtractor('en')
self.assertEqual(extractor.feature_for('word1', 'pos', 3, True), 1)
self.assertEqual(extractor.feature_for('word2', 'lemma', -2, True), 2)
self.assertEqual(extractor.feature_for('WoRd1', 'POs', 3, True), 1)
def test_extract_features_no_window(self):
extractor = feature_extractors.FactExtractorFeatureExtractor('en', 0)
_, f1 = extractor.extract_features(add_unknown=True, gazetteer=self.gazetteer,
**self.sentences_data[0])
_, f2 = extractor.extract_features(add_unknown=True, gazetteer=self.gazetteer,
**self.sentences_data[1])
self.assertEqual(f1[0][0], f2[0][0])
self.assertEqual(f1[1][0], f2[1][0])
self.assertEqual(f1[2][0], f2[2][0])
def test_extract_features_window(self):
window = 2
extractor = feature_extractors.FactExtractorFeatureExtractor('en', window)
_, feat = extractor.extract_features(add_unknown=True, gazetteer=self.gazetteer,
**self.sentences_data[1])
self.assertEqual(len(feat[2][0]), 3 * (2 * window + 1) + 2)
def test_feature_labels(self):
extractor = feature_extractors.FactExtractorFeatureExtractor('en')
_, tokens = extractor.extract_features(add_unknown=True, gazetteer=self.gazetteer,
**self.sentences_data[0])
self.assertEqual(tokens[0][1], 0)
self.assertEqual(tokens[1][1], 1)
self.assertEqual(tokens[2][1], 1)
self.assertEqual(tokens[3][1], 2)
def test_get_training_set(self):
extractor = feature_extractors.FactExtractorFeatureExtractor('en')
extractor.process_sentence(add_unknown=True, gazetteer=self.gazetteer,
**self.sentences_data[0])
extractor.process_sentence(add_unknown=True, gazetteer=self.gazetteer,
**self.sentences_data[1])
x, y = extractor.get_features()
self.assertEqual(x.shape, (9, 70))
self.assertEqual(list(y), [0, 1, 1, 2, 1, 1, 1, 1, 1])
def test_unknown_token(self):
extractor = feature_extractors.FactExtractorFeatureExtractor('en')
self.assertEqual(extractor.feature_for('a', 'b', 12, add_unknown=False),
extractor.unk_index)
| gpl-3.0 |
IPVL/swift-kilo | test/unit/common/middleware/test_bulk.py | 14 | 37987 | # Copyright (c) 2012 OpenStack Foundation
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
# implied.
# See the License for the specific language governing permissions and
# limitations under the License.
import numbers
import unittest
import os
import tarfile
import urllib
import zlib
import mock
from shutil import rmtree
from tempfile import mkdtemp
from StringIO import StringIO
from eventlet import sleep
from mock import patch, call
from swift.common import utils, constraints
from swift.common.middleware import bulk
from swift.common.swob import Request, Response, HTTPException
from swift.common.http import HTTP_NOT_FOUND, HTTP_UNAUTHORIZED
class FakeApp(object):
def __init__(self):
self.calls = 0
self.delete_paths = []
self.max_pathlen = 100
self.del_cont_total_calls = 2
self.del_cont_cur_call = 0
def __call__(self, env, start_response):
self.calls += 1
if env['PATH_INFO'].startswith('/unauth/'):
if env['PATH_INFO'].endswith('/c/f_ok'):
return Response(status='204 No Content')(env, start_response)
return Response(status=401)(env, start_response)
if env['PATH_INFO'].startswith('/create_cont/'):
if env['REQUEST_METHOD'] == 'HEAD':
return Response(status='404 Not Found')(env, start_response)
return Response(status='201 Created')(env, start_response)
if env['PATH_INFO'].startswith('/create_cont_fail/'):
if env['REQUEST_METHOD'] == 'HEAD':
return Response(status='403 Forbidden')(env, start_response)
return Response(status='404 Not Found')(env, start_response)
if env['PATH_INFO'].startswith('/create_obj_unauth/'):
if env['PATH_INFO'].endswith('/cont'):
return Response(status='201 Created')(env, start_response)
return Response(status=401)(env, start_response)
if env['PATH_INFO'].startswith('/tar_works/'):
if len(env['PATH_INFO']) > self.max_pathlen:
return Response(status='400 Bad Request')(env, start_response)
return Response(status='201 Created')(env, start_response)
if env['PATH_INFO'].startswith('/tar_works_cont_head_fail/'):
if env['REQUEST_METHOD'] == 'HEAD':
return Response(status='404 Not Found')(env, start_response)
if len(env['PATH_INFO']) > 100:
return Response(status='400 Bad Request')(env, start_response)
return Response(status='201 Created')(env, start_response)
if (env['PATH_INFO'].startswith('/delete_works/')
and env['REQUEST_METHOD'] == 'DELETE'):
self.delete_paths.append(env['PATH_INFO'])
if len(env['PATH_INFO']) > self.max_pathlen:
return Response(status='400 Bad Request')(env, start_response)
if env['PATH_INFO'].endswith('404'):
return Response(status='404 Not Found')(env, start_response)
if env['PATH_INFO'].endswith('badutf8'):
return Response(
status='412 Precondition Failed')(env, start_response)
return Response(status='204 No Content')(env, start_response)
if env['PATH_INFO'].startswith('/delete_cont_fail/'):
return Response(status='409 Conflict')(env, start_response)
if env['PATH_INFO'].startswith('/broke/'):
return Response(status='500 Internal Error')(env, start_response)
if env['PATH_INFO'].startswith('/delete_cont_success_after_attempts/'):
if self.del_cont_cur_call < self.del_cont_total_calls:
self.del_cont_cur_call += 1
return Response(status='409 Conflict')(env, start_response)
else:
return Response(status='204 No Content')(env, start_response)
def build_dir_tree(start_path, tree_obj):
if isinstance(tree_obj, list):
for obj in tree_obj:
build_dir_tree(start_path, obj)
if isinstance(tree_obj, dict):
for dir_name, obj in tree_obj.iteritems():
dir_path = os.path.join(start_path, dir_name)
os.mkdir(dir_path)
build_dir_tree(dir_path, obj)
if isinstance(tree_obj, unicode):
tree_obj = tree_obj.encode('utf8')
if isinstance(tree_obj, str):
obj_path = os.path.join(start_path, tree_obj)
with open(obj_path, 'w+') as tree_file:
tree_file.write('testing')
def build_tar_tree(tar, start_path, tree_obj, base_path=''):
if isinstance(tree_obj, list):
for obj in tree_obj:
build_tar_tree(tar, start_path, obj, base_path=base_path)
if isinstance(tree_obj, dict):
for dir_name, obj in tree_obj.iteritems():
dir_path = os.path.join(start_path, dir_name)
tar_info = tarfile.TarInfo(dir_path[len(base_path):])
tar_info.type = tarfile.DIRTYPE
tar.addfile(tar_info)
build_tar_tree(tar, dir_path, obj, base_path=base_path)
if isinstance(tree_obj, unicode):
tree_obj = tree_obj.encode('utf8')
if isinstance(tree_obj, str):
obj_path = os.path.join(start_path, tree_obj)
tar_info = tarfile.TarInfo('./' + obj_path[len(base_path):])
tar.addfile(tar_info)
class TestUntar(unittest.TestCase):
def setUp(self):
self.app = FakeApp()
self.bulk = bulk.filter_factory({})(self.app)
self.testdir = mkdtemp(suffix='tmp_test_bulk')
def tearDown(self):
self.app.calls = 0
rmtree(self.testdir, ignore_errors=1)
def handle_extract_and_iter(self, req, compress_format,
out_content_type='application/json'):
resp_body = ''.join(
self.bulk.handle_extract_iter(req, compress_format,
out_content_type=out_content_type))
return resp_body
def test_create_container_for_path(self):
req = Request.blank('/')
self.assertEquals(
self.bulk.create_container(req, '/create_cont/acc/cont'),
True)
self.assertEquals(self.app.calls, 2)
self.assertRaises(
bulk.CreateContainerError,
self.bulk.create_container,
req, '/create_cont_fail/acc/cont')
self.assertEquals(self.app.calls, 3)
def test_extract_tar_works(self):
# On systems where $TMPDIR is long (like OS X), we need to do this
# or else every upload will fail due to the path being too long.
self.app.max_pathlen += len(self.testdir)
for compress_format in ['', 'gz', 'bz2']:
base_name = 'base_works_%s' % compress_format
dir_tree = [
{base_name: [{'sub_dir1': ['sub1_file1', 'sub1_file2']},
{'sub_dir2': ['sub2_file1', u'test obj \u2661']},
'sub_file1',
{'sub_dir3': [{'sub4_dir1': '../sub4 file1'}]},
{'sub_dir4': None},
]}]
build_dir_tree(self.testdir, dir_tree)
mode = 'w'
extension = ''
if compress_format:
mode += ':' + compress_format
extension += '.' + compress_format
tar = tarfile.open(name=os.path.join(self.testdir,
'tar_works.tar' + extension),
mode=mode)
tar.add(os.path.join(self.testdir, base_name))
tar.close()
req = Request.blank('/tar_works/acc/cont/')
req.environ['wsgi.input'] = open(
os.path.join(self.testdir, 'tar_works.tar' + extension))
req.headers['transfer-encoding'] = 'chunked'
resp_body = self.handle_extract_and_iter(req, compress_format)
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Number Files Created'], 6)
# test out xml
req = Request.blank('/tar_works/acc/cont/')
req.environ['wsgi.input'] = open(
os.path.join(self.testdir, 'tar_works.tar' + extension))
req.headers['transfer-encoding'] = 'chunked'
resp_body = self.handle_extract_and_iter(
req, compress_format, 'application/xml')
self.assert_('<response_status>201 Created</response_status>' in
resp_body)
self.assert_('<number_files_created>6</number_files_created>' in
resp_body)
# test out nonexistent format
req = Request.blank('/tar_works/acc/cont/?extract-archive=tar',
headers={'Accept': 'good_xml'})
req.environ['REQUEST_METHOD'] = 'PUT'
req.environ['wsgi.input'] = open(
os.path.join(self.testdir, 'tar_works.tar' + extension))
req.headers['transfer-encoding'] = 'chunked'
def fake_start_response(*args, **kwargs):
pass
app_iter = self.bulk(req.environ, fake_start_response)
resp_body = ''.join([i for i in app_iter])
self.assert_('Response Status: 406' in resp_body)
def test_extract_call(self):
base_name = 'base_works_gz'
dir_tree = [
{base_name: [{'sub_dir1': ['sub1_file1', 'sub1_file2']},
{'sub_dir2': ['sub2_file1', 'sub2_file2']},
'sub_file1',
{'sub_dir3': [{'sub4_dir1': 'sub4_file1'}]}]}]
build_dir_tree(self.testdir, dir_tree)
tar = tarfile.open(name=os.path.join(self.testdir,
'tar_works.tar.gz'),
mode='w:gz')
tar.add(os.path.join(self.testdir, base_name))
tar.close()
def fake_start_response(*args, **kwargs):
pass
req = Request.blank('/tar_works/acc/cont/?extract-archive=tar.gz')
req.environ['wsgi.input'] = open(
os.path.join(self.testdir, 'tar_works.tar.gz'))
self.bulk(req.environ, fake_start_response)
self.assertEquals(self.app.calls, 1)
self.app.calls = 0
req.environ['wsgi.input'] = open(
os.path.join(self.testdir, 'tar_works.tar.gz'))
req.headers['transfer-encoding'] = 'Chunked'
req.method = 'PUT'
app_iter = self.bulk(req.environ, fake_start_response)
list(app_iter) # iter over resp
self.assertEquals(self.app.calls, 7)
self.app.calls = 0
req = Request.blank('/tar_works/acc/cont/?extract-archive=bad')
req.method = 'PUT'
req.headers['transfer-encoding'] = 'Chunked'
req.environ['wsgi.input'] = open(
os.path.join(self.testdir, 'tar_works.tar.gz'))
t = self.bulk(req.environ, fake_start_response)
self.assertEquals(t[0], "Unsupported archive format")
tar = tarfile.open(name=os.path.join(self.testdir,
'tar_works.tar'),
mode='w')
tar.add(os.path.join(self.testdir, base_name))
tar.close()
self.app.calls = 0
req = Request.blank('/tar_works/acc/cont/?extract-archive=tar')
req.method = 'PUT'
req.headers['transfer-encoding'] = 'Chunked'
req.environ['wsgi.input'] = open(
os.path.join(self.testdir, 'tar_works.tar'))
app_iter = self.bulk(req.environ, fake_start_response)
list(app_iter) # iter over resp
self.assertEquals(self.app.calls, 7)
def test_bad_container(self):
req = Request.blank('/invalid/', body='')
resp_body = self.handle_extract_and_iter(req, '')
self.assertTrue('404 Not Found' in resp_body)
def test_content_length_required(self):
req = Request.blank('/create_cont_fail/acc/cont')
resp_body = self.handle_extract_and_iter(req, '')
self.assertTrue('411 Length Required' in resp_body)
def test_bad_tar(self):
req = Request.blank('/create_cont_fail/acc/cont', body='')
def bad_open(*args, **kwargs):
raise zlib.error('bad tar')
with patch.object(tarfile, 'open', bad_open):
resp_body = self.handle_extract_and_iter(req, '')
self.assertTrue('400 Bad Request' in resp_body)
def build_tar(self, dir_tree=None):
if not dir_tree:
dir_tree = [
{'base_fails1': [{'sub_dir1': ['sub1_file1']},
{'sub_dir2': ['sub2_file1', 'sub2_file2']},
'f' * 101,
{'sub_dir3': [{'sub4_dir1': 'sub4_file1'}]}]}]
tar = tarfile.open(name=os.path.join(self.testdir, 'tar_fails.tar'),
mode='w')
build_tar_tree(tar, self.testdir, dir_tree,
base_path=self.testdir + '/')
tar.close()
return tar
def test_extract_tar_with_basefile(self):
dir_tree = [
'base_lvl_file', 'another_base_file',
{'base_fails1': [{'sub_dir1': ['sub1_file1']},
{'sub_dir2': ['sub2_file1', 'sub2_file2']},
{'sub_dir3': [{'sub4_dir1': 'sub4_file1'}]}]}]
self.build_tar(dir_tree)
req = Request.blank('/tar_works/acc/')
req.environ['wsgi.input'] = open(os.path.join(self.testdir,
'tar_fails.tar'))
req.headers['transfer-encoding'] = 'chunked'
resp_body = self.handle_extract_and_iter(req, '')
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Number Files Created'], 4)
def test_extract_tar_fail_cont_401(self):
self.build_tar()
req = Request.blank('/unauth/acc/',
headers={'Accept': 'application/json'})
req.environ['wsgi.input'] = open(os.path.join(self.testdir,
'tar_fails.tar'))
req.headers['transfer-encoding'] = 'chunked'
resp_body = self.handle_extract_and_iter(req, '')
self.assertEquals(self.app.calls, 1)
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Response Status'], '401 Unauthorized')
self.assertEquals(resp_data['Errors'], [])
def test_extract_tar_fail_obj_401(self):
self.build_tar()
req = Request.blank('/create_obj_unauth/acc/cont/',
headers={'Accept': 'application/json'})
req.environ['wsgi.input'] = open(os.path.join(self.testdir,
'tar_fails.tar'))
req.headers['transfer-encoding'] = 'chunked'
resp_body = self.handle_extract_and_iter(req, '')
self.assertEquals(self.app.calls, 2)
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Response Status'], '401 Unauthorized')
self.assertEquals(
resp_data['Errors'],
[['cont/base_fails1/sub_dir1/sub1_file1', '401 Unauthorized']])
def test_extract_tar_fail_obj_name_len(self):
self.build_tar()
req = Request.blank('/tar_works/acc/cont/',
headers={'Accept': 'application/json'})
req.environ['wsgi.input'] = open(os.path.join(self.testdir,
'tar_fails.tar'))
req.headers['transfer-encoding'] = 'chunked'
resp_body = self.handle_extract_and_iter(req, '')
self.assertEquals(self.app.calls, 6)
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Number Files Created'], 4)
self.assertEquals(
resp_data['Errors'],
[['cont/base_fails1/' + ('f' * 101), '400 Bad Request']])
def test_extract_tar_fail_compress_type(self):
self.build_tar()
req = Request.blank('/tar_works/acc/cont/',
headers={'Accept': 'application/json'})
req.environ['wsgi.input'] = open(os.path.join(self.testdir,
'tar_fails.tar'))
req.headers['transfer-encoding'] = 'chunked'
resp_body = self.handle_extract_and_iter(req, 'gz')
self.assertEquals(self.app.calls, 0)
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Response Status'], '400 Bad Request')
self.assertEquals(
resp_data['Response Body'].lower(),
'invalid tar file: not a gzip file')
def test_extract_tar_fail_max_failed_extractions(self):
self.build_tar()
with patch.object(self.bulk, 'max_failed_extractions', 1):
self.app.calls = 0
req = Request.blank('/tar_works/acc/cont/',
headers={'Accept': 'application/json'})
req.environ['wsgi.input'] = open(os.path.join(self.testdir,
'tar_fails.tar'))
req.headers['transfer-encoding'] = 'chunked'
resp_body = self.handle_extract_and_iter(req, '')
self.assertEquals(self.app.calls, 5)
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Number Files Created'], 3)
self.assertEquals(
resp_data['Errors'],
[['cont/base_fails1/' + ('f' * 101), '400 Bad Request']])
@patch.object(constraints, 'MAX_FILE_SIZE', 4)
def test_extract_tar_fail_max_file_size(self):
tar = self.build_tar()
dir_tree = [{'test': [{'sub_dir1': ['sub1_file1']}]}]
build_dir_tree(self.testdir, dir_tree)
tar = tarfile.open(name=os.path.join(self.testdir,
'tar_works.tar'),
mode='w')
tar.add(os.path.join(self.testdir, 'test'))
tar.close()
self.app.calls = 0
req = Request.blank('/tar_works/acc/cont/',
headers={'Accept': 'application/json'})
req.environ['wsgi.input'] = open(
os.path.join(self.testdir, 'tar_works.tar'))
req.headers['transfer-encoding'] = 'chunked'
resp_body = self.handle_extract_and_iter(req, '')
resp_data = utils.json.loads(resp_body)
self.assertEquals(
resp_data['Errors'],
[['cont' + self.testdir + '/test/sub_dir1/sub1_file1',
'413 Request Entity Too Large']])
def test_extract_tar_fail_max_cont(self):
dir_tree = [{'sub_dir1': ['sub1_file1']},
{'sub_dir2': ['sub2_file1', 'sub2_file2']},
'f' * 101,
{'sub_dir3': [{'sub4_dir1': 'sub4_file1'}]}]
self.build_tar(dir_tree)
with patch.object(self.bulk, 'max_containers', 1):
self.app.calls = 0
body = open(os.path.join(self.testdir, 'tar_fails.tar')).read()
req = Request.blank('/tar_works_cont_head_fail/acc/', body=body,
headers={'Accept': 'application/json'})
req.headers['transfer-encoding'] = 'chunked'
resp_body = self.handle_extract_and_iter(req, '')
self.assertEquals(self.app.calls, 5)
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Response Status'], '400 Bad Request')
self.assertEquals(
resp_data['Response Body'],
'More than 1 containers to create from tar.')
def test_extract_tar_fail_create_cont(self):
dir_tree = [{'base_fails1': [
{'sub_dir1': ['sub1_file1']},
{'sub_dir2': ['sub2_file1', 'sub2_file2']},
{'./sub_dir3': [{'sub4_dir1': 'sub4_file1'}]}]}]
self.build_tar(dir_tree)
req = Request.blank('/create_cont_fail/acc/cont/',
headers={'Accept': 'application/json'})
req.environ['wsgi.input'] = open(os.path.join(self.testdir,
'tar_fails.tar'))
req.headers['transfer-encoding'] = 'chunked'
resp_body = self.handle_extract_and_iter(req, '')
resp_data = utils.json.loads(resp_body)
self.assertEquals(self.app.calls, 5)
self.assertEquals(len(resp_data['Errors']), 5)
def test_extract_tar_fail_create_cont_value_err(self):
self.build_tar()
req = Request.blank('/create_cont_fail/acc/cont/',
headers={'Accept': 'application/json'})
req.environ['wsgi.input'] = open(os.path.join(self.testdir,
'tar_fails.tar'))
req.headers['transfer-encoding'] = 'chunked'
def bad_create(req, path):
raise ValueError('Test')
with patch.object(self.bulk, 'create_container', bad_create):
resp_body = self.handle_extract_and_iter(req, '')
resp_data = utils.json.loads(resp_body)
self.assertEquals(self.app.calls, 0)
self.assertEquals(len(resp_data['Errors']), 5)
self.assertEquals(
resp_data['Errors'][0],
['cont/base_fails1/sub_dir1/sub1_file1', '400 Bad Request'])
def test_extract_tar_fail_unicode(self):
dir_tree = [{'sub_dir1': ['sub1_file1']},
{'sub_dir2': ['sub2\xdefile1', 'sub2_file2']},
{'sub_\xdedir3': [{'sub4_dir1': 'sub4_file1'}]}]
self.build_tar(dir_tree)
req = Request.blank('/tar_works/acc/',
headers={'Accept': 'application/json'})
req.environ['wsgi.input'] = open(os.path.join(self.testdir,
'tar_fails.tar'))
req.headers['transfer-encoding'] = 'chunked'
resp_body = self.handle_extract_and_iter(req, '')
resp_data = utils.json.loads(resp_body)
self.assertEquals(self.app.calls, 4)
self.assertEquals(resp_data['Number Files Created'], 2)
self.assertEquals(resp_data['Response Status'], '400 Bad Request')
self.assertEquals(
resp_data['Errors'],
[['sub_dir2/sub2%DEfile1', '412 Precondition Failed'],
['sub_%DEdir3/sub4_dir1/sub4_file1', '412 Precondition Failed']])
def test_get_response_body(self):
txt_body = bulk.get_response_body(
'bad_formay', {'hey': 'there'}, [['json > xml', '202 Accepted']])
self.assert_('hey: there' in txt_body)
xml_body = bulk.get_response_body(
'text/xml', {'hey': 'there'}, [['json > xml', '202 Accepted']])
self.assert_('>' in xml_body)
class TestDelete(unittest.TestCase):
def setUp(self):
self.app = FakeApp()
self.bulk = bulk.filter_factory({})(self.app)
def tearDown(self):
self.app.calls = 0
self.app.delete_paths = []
def handle_delete_and_iter(self, req, out_content_type='application/json'):
resp_body = ''.join(self.bulk.handle_delete_iter(
req, out_content_type=out_content_type))
return resp_body
def test_bulk_delete_uses_predefined_object_errors(self):
req = Request.blank('/delete_works/AUTH_Acc')
objs_to_delete = [
{'name': '/c/file_a'},
{'name': '/c/file_b', 'error': {'code': HTTP_NOT_FOUND,
'message': 'not found'}},
{'name': '/c/file_c', 'error': {'code': HTTP_UNAUTHORIZED,
'message': 'unauthorized'}},
{'name': '/c/file_d'}]
resp_body = ''.join(self.bulk.handle_delete_iter(
req, objs_to_delete=objs_to_delete,
out_content_type='application/json'))
self.assertEquals(
self.app.delete_paths, ['/delete_works/AUTH_Acc/c/file_a',
'/delete_works/AUTH_Acc/c/file_d'])
self.assertEquals(self.app.calls, 2)
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Response Status'], '400 Bad Request')
self.assertEquals(resp_data['Number Deleted'], 2)
self.assertEquals(resp_data['Number Not Found'], 1)
self.assertEquals(resp_data['Errors'],
[['/c/file_c', 'unauthorized']])
def test_bulk_delete_works_with_POST_verb(self):
req = Request.blank('/delete_works/AUTH_Acc', body='/c/f\n/c/f404',
headers={'Accept': 'application/json'})
req.method = 'POST'
resp_body = self.handle_delete_and_iter(req)
self.assertEquals(
self.app.delete_paths,
['/delete_works/AUTH_Acc/c/f', '/delete_works/AUTH_Acc/c/f404'])
self.assertEquals(self.app.calls, 2)
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Number Deleted'], 1)
self.assertEquals(resp_data['Number Not Found'], 1)
def test_bulk_delete_works_with_DELETE_verb(self):
req = Request.blank('/delete_works/AUTH_Acc', body='/c/f\n/c/f404',
headers={'Accept': 'application/json'})
req.method = 'DELETE'
resp_body = self.handle_delete_and_iter(req)
self.assertEquals(
self.app.delete_paths,
['/delete_works/AUTH_Acc/c/f', '/delete_works/AUTH_Acc/c/f404'])
self.assertEquals(self.app.calls, 2)
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Number Deleted'], 1)
self.assertEquals(resp_data['Number Not Found'], 1)
def test_bulk_delete_bad_content_type(self):
req = Request.blank('/delete_works/AUTH_Acc',
headers={'Accept': 'badformat'})
req = Request.blank('/delete_works/AUTH_Acc',
headers={'Accept': 'application/json',
'Content-Type': 'text/xml'})
req.method = 'POST'
req.environ['wsgi.input'] = StringIO('/c/f\n/c/f404')
resp_body = self.handle_delete_and_iter(req)
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Response Status'], '406 Not Acceptable')
def test_bulk_delete_call_and_content_type(self):
def fake_start_response(*args, **kwargs):
self.assertEquals(args[1][0], ('Content-Type', 'application/json'))
req = Request.blank('/delete_works/AUTH_Acc?bulk-delete')
req.method = 'POST'
req.headers['Transfer-Encoding'] = 'chunked'
req.headers['Accept'] = 'application/json'
req.environ['wsgi.input'] = StringIO('/c/f%20')
list(self.bulk(req.environ, fake_start_response)) # iterate over resp
self.assertEquals(
self.app.delete_paths, ['/delete_works/AUTH_Acc/c/f '])
self.assertEquals(self.app.calls, 1)
def test_bulk_delete_get_objs(self):
req = Request.blank('/delete_works/AUTH_Acc', body='1%20\r\n2\r\n')
req.method = 'POST'
with patch.object(self.bulk, 'max_deletes_per_request', 2):
results = self.bulk.get_objs_to_delete(req)
self.assertEquals(results, [{'name': '1 '}, {'name': '2'}])
with patch.object(self.bulk, 'max_path_length', 2):
results = []
req.environ['wsgi.input'] = StringIO('1\n2\n3')
results = self.bulk.get_objs_to_delete(req)
self.assertEquals(results,
[{'name': '1'}, {'name': '2'}, {'name': '3'}])
with patch.object(self.bulk, 'max_deletes_per_request', 9):
with patch.object(self.bulk, 'max_path_length', 1):
req_body = '\n'.join([str(i) for i in xrange(10)])
req = Request.blank('/delete_works/AUTH_Acc', body=req_body)
self.assertRaises(
HTTPException, self.bulk.get_objs_to_delete, req)
def test_bulk_delete_works_extra_newlines_extra_quoting(self):
req = Request.blank('/delete_works/AUTH_Acc',
body='/c/f\n\n\n/c/f404\n\n\n/c/%2525',
headers={'Accept': 'application/json'})
req.method = 'POST'
resp_body = self.handle_delete_and_iter(req)
self.assertEquals(
self.app.delete_paths,
['/delete_works/AUTH_Acc/c/f',
'/delete_works/AUTH_Acc/c/f404',
'/delete_works/AUTH_Acc/c/%25'])
self.assertEquals(self.app.calls, 3)
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Number Deleted'], 2)
self.assertEquals(resp_data['Number Not Found'], 1)
def test_bulk_delete_too_many_newlines(self):
req = Request.blank('/delete_works/AUTH_Acc')
req.method = 'POST'
data = '\n\n' * self.bulk.max_deletes_per_request
req.environ['wsgi.input'] = StringIO(data)
req.content_length = len(data)
resp_body = self.handle_delete_and_iter(req)
self.assertTrue('413 Request Entity Too Large' in resp_body)
def test_bulk_delete_works_unicode(self):
body = (u'/c/ obj \u2661\r\n'.encode('utf8') +
'c/ objbadutf8\r\n' +
'/c/f\xdebadutf8\n')
req = Request.blank('/delete_works/AUTH_Acc', body=body,
headers={'Accept': 'application/json'})
req.method = 'POST'
resp_body = self.handle_delete_and_iter(req)
self.assertEquals(
self.app.delete_paths,
['/delete_works/AUTH_Acc/c/ obj \xe2\x99\xa1',
'/delete_works/AUTH_Acc/c/ objbadutf8'])
self.assertEquals(self.app.calls, 2)
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Number Deleted'], 1)
self.assertEquals(len(resp_data['Errors']), 2)
self.assertEquals(
resp_data['Errors'],
[[urllib.quote('c/ objbadutf8'), '412 Precondition Failed'],
[urllib.quote('/c/f\xdebadutf8'), '412 Precondition Failed']])
def test_bulk_delete_no_body(self):
req = Request.blank('/unauth/AUTH_acc/')
resp_body = self.handle_delete_and_iter(req)
self.assertTrue('411 Length Required' in resp_body)
def test_bulk_delete_no_files_in_body(self):
req = Request.blank('/unauth/AUTH_acc/', body=' ')
resp_body = self.handle_delete_and_iter(req)
self.assertTrue('400 Bad Request' in resp_body)
def test_bulk_delete_unauth(self):
req = Request.blank('/unauth/AUTH_acc/', body='/c/f\n/c/f_ok\n',
headers={'Accept': 'application/json'})
req.method = 'POST'
resp_body = self.handle_delete_and_iter(req)
self.assertEquals(self.app.calls, 2)
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Errors'], [['/c/f', '401 Unauthorized']])
self.assertEquals(resp_data['Response Status'], '400 Bad Request')
self.assertEquals(resp_data['Number Deleted'], 1)
def test_bulk_delete_500_resp(self):
req = Request.blank('/broke/AUTH_acc/', body='/c/f\nc/f2\n',
headers={'Accept': 'application/json'})
req.method = 'POST'
resp_body = self.handle_delete_and_iter(req)
resp_data = utils.json.loads(resp_body)
self.assertEquals(
resp_data['Errors'],
[['/c/f', '500 Internal Error'], ['c/f2', '500 Internal Error']])
self.assertEquals(resp_data['Response Status'], '502 Bad Gateway')
def test_bulk_delete_bad_path(self):
req = Request.blank('/delete_cont_fail/')
resp_body = self.handle_delete_and_iter(req)
self.assertTrue('404 Not Found' in resp_body)
def test_bulk_delete_container_delete(self):
req = Request.blank('/delete_cont_fail/AUTH_Acc', body='c\n',
headers={'Accept': 'application/json'})
req.method = 'POST'
with patch('swift.common.middleware.bulk.sleep',
new=mock.MagicMock(wraps=sleep,
return_value=None)) as mock_sleep:
resp_body = self.handle_delete_and_iter(req)
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Number Deleted'], 0)
self.assertEquals(resp_data['Errors'], [['c', '409 Conflict']])
self.assertEquals(resp_data['Response Status'], '400 Bad Request')
self.assertEquals([], mock_sleep.call_args_list)
def test_bulk_delete_container_delete_retry_and_fails(self):
self.bulk.retry_count = 3
req = Request.blank('/delete_cont_fail/AUTH_Acc', body='c\n',
headers={'Accept': 'application/json'})
req.method = 'POST'
with patch('swift.common.middleware.bulk.sleep',
new=mock.MagicMock(wraps=sleep,
return_value=None)) as mock_sleep:
resp_body = self.handle_delete_and_iter(req)
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Number Deleted'], 0)
self.assertEquals(resp_data['Errors'], [['c', '409 Conflict']])
self.assertEquals(resp_data['Response Status'], '400 Bad Request')
self.assertEquals([call(self.bulk.retry_interval),
call(self.bulk.retry_interval ** 2),
call(self.bulk.retry_interval ** 3)],
mock_sleep.call_args_list)
def test_bulk_delete_container_delete_retry_and_success(self):
self.bulk.retry_count = 3
self.app.del_container_total = 2
req = Request.blank('/delete_cont_success_after_attempts/AUTH_Acc',
body='c\n', headers={'Accept': 'application/json'})
req.method = 'DELETE'
with patch('swift.common.middleware.bulk.sleep',
new=mock.MagicMock(wraps=sleep,
return_value=None)) as mock_sleep:
resp_body = self.handle_delete_and_iter(req)
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Number Deleted'], 1)
self.assertEquals(resp_data['Errors'], [])
self.assertEquals(resp_data['Response Status'], '200 OK')
self.assertEquals([call(self.bulk.retry_interval),
call(self.bulk.retry_interval ** 2)],
mock_sleep.call_args_list)
def test_bulk_delete_bad_file_too_long(self):
req = Request.blank('/delete_works/AUTH_Acc',
headers={'Accept': 'application/json'})
req.method = 'POST'
bad_file = 'c/' + ('1' * self.bulk.max_path_length)
data = '/c/f\n' + bad_file + '\n/c/f'
req.environ['wsgi.input'] = StringIO(data)
req.headers['Transfer-Encoding'] = 'chunked'
resp_body = self.handle_delete_and_iter(req)
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Number Deleted'], 2)
self.assertEquals(resp_data['Errors'], [[bad_file, '400 Bad Request']])
self.assertEquals(resp_data['Response Status'], '400 Bad Request')
def test_bulk_delete_bad_file_over_twice_max_length(self):
body = '/c/f\nc/' + ('123456' * self.bulk.max_path_length) + '\n'
req = Request.blank('/delete_works/AUTH_Acc', body=body)
req.method = 'POST'
resp_body = self.handle_delete_and_iter(req)
self.assertTrue('400 Bad Request' in resp_body)
def test_bulk_delete_max_failures(self):
req = Request.blank('/unauth/AUTH_Acc', body='/c/f1\n/c/f2\n/c/f3',
headers={'Accept': 'application/json'})
req.method = 'POST'
with patch.object(self.bulk, 'max_failed_deletes', 2):
resp_body = self.handle_delete_and_iter(req)
self.assertEquals(self.app.calls, 2)
resp_data = utils.json.loads(resp_body)
self.assertEquals(resp_data['Response Status'], '400 Bad Request')
self.assertEquals(resp_data['Response Body'],
'Max delete failures exceeded')
self.assertEquals(resp_data['Errors'],
[['/c/f1', '401 Unauthorized'],
['/c/f2', '401 Unauthorized']])
class TestSwiftInfo(unittest.TestCase):
def setUp(self):
utils._swift_info = {}
utils._swift_admin_info = {}
def test_registered_defaults(self):
bulk.filter_factory({})
swift_info = utils.get_swift_info()
self.assertTrue('bulk_upload' in swift_info)
self.assertTrue(isinstance(
swift_info['bulk_upload'].get('max_containers_per_extraction'),
numbers.Integral))
self.assertTrue(isinstance(
swift_info['bulk_upload'].get('max_failed_extractions'),
numbers.Integral))
self.assertTrue('bulk_delete' in swift_info)
self.assertTrue(isinstance(
swift_info['bulk_delete'].get('max_deletes_per_request'),
numbers.Integral))
self.assertTrue(isinstance(
swift_info['bulk_delete'].get('max_failed_deletes'),
numbers.Integral))
if __name__ == '__main__':
unittest.main()
| apache-2.0 |